diff options
156 files changed, 34650 insertions, 4060 deletions
diff --git a/.gitmodules b/.gitmodules deleted file mode 100644 index f93599e..0000000 --- a/.gitmodules +++ /dev/null @@ -1,6 +0,0 @@ -[submodule "libpicofe"] - path = frontend/libpicofe - url = git://notaz.gp2x.de/~notaz/libpicofe.git -[submodule "warm"] - path = frontend/warm - url = git://notaz.gp2x.de/~notaz/warm.git diff --git a/.travis.yml b/.travis.yml index 7c4eafb..e2b0927 100644 --- a/.travis.yml +++ b/.travis.yml @@ -5,4 +5,4 @@ compiler: before_install: - sudo apt-get update -qq - sudo apt-get install -y libsdl1.2-dev libasound2-dev libpng-dev libz-dev -script: ./configure && make +script: ./configure --platform=libretro && make @@ -2,10 +2,16 @@ # default stuff goes here, so that config can override TARGET ?= pcsx -CFLAGS += -Wall -ggdb -Iinclude -ffast-math -ifndef DEBUG +CFLAGS += -Wall -Iinclude -ffast-math +ifeq ($(DEBUG), 1) +CFLAGS += -O0 -ggdb +else +ifeq ($(platform), vita) +CFLAGS += -O3 -DNDEBUG +else CFLAGS += -O2 -DNDEBUG endif +endif CXXFLAGS += $(CFLAGS) #DRC_DBG = 1 #PCNT = 1 @@ -46,6 +52,22 @@ OBJS += libpcsxcore/cdriso.o libpcsxcore/cdrom.o libpcsxcore/cheat.o libpcsxcore libpcsxcore/psxhw.o libpcsxcore/psxinterpreter.o libpcsxcore/psxmem.o libpcsxcore/r3000a.o \ libpcsxcore/sio.o libpcsxcore/socket.o libpcsxcore/spu.o OBJS += libpcsxcore/gte.o libpcsxcore/gte_nf.o libpcsxcore/gte_divider.o +ifeq ($(WANT_ZLIB),1) +OBJS += deps/zlib/adler32.o \ + deps/zlib/compress.o \ + deps/zlib/crc32.o \ + deps/zlib/deflate.o \ + deps/zlib/gzclose.o \ + deps/zlib/gzlib.o \ + deps/zlib/gzread.o \ + deps/zlib/gzwrite.o \ + deps/zlib/inffast.o \ + deps/zlib/inflate.o \ + deps/zlib/inftrees.o \ + deps/zlib/trees.o \ + deps/zlib/uncompr.o \ + deps/zlib/zutil.o +endif ifeq "$(ARCH)" "arm" OBJS += libpcsxcore/gte_arm.o endif @@ -56,21 +78,23 @@ libpcsxcore/psxbios.o: CFLAGS += -Wno-nonnull # dynarec ifeq "$(USE_DYNAREC)" "1" -OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/linkage_arm.o -OBJS += libpcsxcore/new_dynarec/pcsxmem.o +OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/arm/linkage_arm.o +OBJS += libpcsxcore/new_dynarec/backends/psx/pcsxmem.o else -libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -DDRC_DISABLE +libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -DDRC_DISABLE frontend/libretro.o: CFLAGS += -DDRC_DISABLE endif -OBJS += libpcsxcore/new_dynarec/emu_if.o -libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/assem_arm.c \ - libpcsxcore/new_dynarec/pcsxmem_inline.c +OBJS += libpcsxcore/new_dynarec/backends/psx/emu_if.o +libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/arm/assem_arm.c \ + libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c ifdef DRC_DBG -libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64 +libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64 CFLAGS += -DDRC_DBG endif ifeq "$(DRC_CACHE_BASE)" "1" libpcsxcore/new_dynarec/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 +libpcsxcore/new_dynarec/backends/psx/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 +libpcsxcore/new_dynarec/arm/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 endif # spu @@ -194,6 +218,7 @@ endif ifeq "$(PLATFORM)" "libretro" OBJS += frontend/libretro.o CFLAGS += -DFRONTEND_SUPPORTS_RGB565 +CFLAGS += -DHAVE_LIBRETRO ifeq ($(MMAP_WIN32),1) OBJS += libpcsxcore/memmap_win32.o @@ -246,11 +271,22 @@ frontend/revision.h: FORCE %.o: %.S $(CC_AS) $(CFLAGS) -c $^ -o $@ +%.o: %.cpp + $(CXX) $(CXXFLAGS) -c -o $@ $< + +%.o: %.c + $(CC) $(CFLAGS) -c -o $@ $< target_: $(TARGET) $(TARGET): $(OBJS) + @echo "** BUILDING $(TARGET) FOR PLATFORM $(PLATFORM) **" +ifeq ($(STATIC_LINKING), 1) + $(AR) rcs $@ $(OBJS) +else $(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS) +endif + @echo "** BUILD SUCCESSFUL! GG NO RE **" clean: $(PLAT_CLEAN) clean_plugins $(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h diff --git a/Makefile.libretro b/Makefile.libretro index 223ba9f..a8c8c4a 100644 --- a/Makefile.libretro +++ b/Makefile.libretro @@ -1,5 +1,8 @@ # Makefile for PCSX ReARMed (libretro) +DEBUG=0 +WANT_ZLIB=1 + ifeq ($(platform),) platform = unix ifeq ($(shell uname -a),) @@ -20,35 +23,67 @@ CC_AS ?= $(CC) CFLAGS ?= TARGET_NAME := pcsx_rearmed - +GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)" +ifneq ($(GIT_VERSION)," unknown") + CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\" +endif +ifneq ($(WANT_ZLIB),1) +LIBZ := -lz +endif +LIBPTHREAD := -lpthread +ifneq ($(findstring Haiku,$(shell uname -s)),) +LIBDL := -lroot -lnetwork +else +LIBDL := -ldl +endif MMAP_WIN32=0 +EXTRA_LDFLAGS = # Unix ifeq ($(platform), unix) TARGET := $(TARGET_NAME)_libretro.so fpic := -fPIC - SHARED := -shared -Wl,--version-script=libretro/link.T +ifneq ($(findstring SunOS,$(shell uname -s)),) + CC = gcc +endif + +else ifeq ($(platform), linux-portable) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC -nostdlib + EXTRA_LDFLAGS += -fPIC -nostdlib + LIBZ := + LIBPTHREAD := + LIBDL := + NO_UNDEF_CHECK = 1 # OS X else ifeq ($(platform), osx) TARGET := $(TARGET_NAME)_libretro.dylib fpic := -fPIC - SHARED := -dynamiclib - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - fpic += -mmacosx-version-min=10.5 - endif + fpic += -mmacosx-version-min=10.1 # iOS -else ifeq ($(platform), ios) +else ifeq ($(platform),$(filter $(platform),ios-arm64)) + ARCH := arm64 + USE_DYNAREC = 0 + HAVE_NEON = 0 + BUILTIN_GPU = peops + TARGET := $(TARGET_NAME)_libretro_ios.dylib + +else ifneq (,$(findstring ios,$(platform))) ARCH := arm + USE_DYNAREC ?= 1 + HAVE_NEON = 1 + BUILTIN_GPU = neon TARGET := $(TARGET_NAME)_libretro_ios.dylib +ifeq ($(USE_DYNAREC),1) + # Override + TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib +endif fpic := -fPIC - SHARED := -dynamiclib ifeq ($(IOSSDK),) - IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path) + IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path) endif CC = clang -arch armv7 -isysroot $(IOSSDK) @@ -56,18 +91,18 @@ else ifeq ($(platform), ios) CC_AS = perl ./tools/gas-preprocessor.pl $(CC) CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon - HAVE_NEON = 1 - BUILTIN_GPU = neon - USE_DYNAREC = 1 CFLAGS += -DIOS - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - CC += -miphoneos-version-min=5.0 - CXX += -miphoneos-version-min=5.0 - CC_AS += -miphoneos-version-min=5.0 - CFLAGS += -miphoneos-version-min=5.0 - endif +ifeq ($(platform),ios9) + CC += -miphoneos-version-min=8.0 + CXX += -miphoneos-version-min=8.0 + CC_AS += -miphoneos-version-min=8.0 + CFLAGS += -miphoneos-version-min=8.0 +else + CC += -miphoneos-version-min=5.0 + CXX += -miphoneos-version-min=5.0 + CC_AS += -miphoneos-version-min=5.0 + CFLAGS += -miphoneos-version-min=5.0 +endif # PS3 else ifeq ($(platform), ps3) @@ -97,6 +132,52 @@ else ifeq ($(platform), psp1) AR = psp-ar$(EXE_EXT) CFLAGS += -DPSP -G0 +# Vita +else ifeq ($(platform), vita) + TARGET := $(TARGET_NAME)_libretro_vita.a + CC = arm-vita-eabi-gcc$(EXE_EXT) + AR = arm-vita-eabi-ar$(EXE_EXT) + CFLAGS += -DVITA + CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm + CFLAGS += -fsingle-precision-constant -mword-relocations -fno-unwind-tables + CFLAGS += -fno-asynchronous-unwind-tables -ftree-vectorize -funroll-loops + CFLAGS += -fno-optimize-sibling-calls + CFLAGS += -I$(VITASDK)/include -Ifrontend/vita + CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB + ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon + +# CFLAGS += -U__ARM_NEON__ + HAVE_NEON = 1 + BUILTIN_GPU = neon + + USE_DYNAREC = 1 + DRC_CACHE_BASE = 0 + + ARCH = arm + STATIC_LINKING = 1 + +# CTR(3DS) +else ifeq ($(platform), ctr) + TARGET := $(TARGET_NAME)_libretro_ctr.a + CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT) + CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT) + AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT) + CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET + CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft + CFLAGS += -Wall -mword-relocations + CFLAGS += -fomit-frame-pointer -ffast-math + CFLAGS += -Ifrontend/3ds + CFLAGS += -Werror=implicit-function-declaration + +# CFLAGS += -DPCSX + BUILTIN_GPU = unai + USE_DYNAREC = 1 + DRC_CACHE_BASE = 0 + ARCH = arm + HAVE_NEON = 0 + + STATIC_LINKING = 1 + # Xbox 360 else ifeq ($(platform), xenon) TARGET := $(TARGET_NAME)_libretro_xenon360.a @@ -121,6 +202,7 @@ else ifeq ($(platform), wii) # QNX else ifeq ($(platform), qnx) TARGET := $(TARGET_NAME)_libretro_qnx.so + fpic := -fPIC CC = qcc -Vgcc_ntoarmv7le CC_AS = $(CC) HAVE_NEON = 1 @@ -130,15 +212,79 @@ else ifeq ($(platform), qnx) ARCH = arm CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp + MAIN_LDLIBS += -lsocket + LIBPTHREAD := + LIBDL := + +#Raspberry Pi 2 +else ifeq ($(platform), rpi2) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 + +#Raspberry Pi 3 +else ifeq ($(platform), rpi3) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 + +# Classic Platforms #################### +# Platform affix = classic_<ISA>_<µARCH> +# Help at https://modmyclassic.com/comp + +# (armv7 a7, hard point, neon based) ### +# NESC, SNESC, C64 mini +else ifeq ($(platform), classic_armv7_a7) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -Ofast \ + -flto=4 -fwhole-program -fuse-linker-plugin \ + -fdata-sections -ffunction-sections -Wl,--gc-sections \ + -fno-stack-protector -fno-ident -fomit-frame-pointer \ + -falign-functions=1 -falign-jumps=1 -falign-loops=1 \ + -fno-unwind-tables -fno-asynchronous-unwind-tables -fno-unroll-loops \ + -fmerge-all-constants -fno-math-errno \ + -marm -mtune=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + CXXFLAGS += $(CFLAGS) + CPPFLAGS += $(CFLAGS) + ASFLAGS += $(CFLAGS) + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 + ifeq ($(shell echo `$(CC) -dumpversion` "< 4.9" | bc -l), 1) + CFLAGS += -march=armv7-a + else + CFLAGS += -march=armv7ve + # If gcc is 5.0 or later + ifeq ($(shell echo `$(CC) -dumpversion` ">= 5" | bc -l), 1) + LDFLAGS += -static-libgcc -static-libstdc++ + endif + endif +####################################### # ARM else ifneq (,$(findstring armv,$(platform))) TARGET := $(TARGET_NAME)_libretro.so - SHARED := -shared -Wl,--no-undefined + fpic := -fPIC DRC_CACHE_BASE = 0 ifneq (,$(findstring cortexa8,$(platform))) CFLAGS += -marm -mcpu=cortex-a8 ASFLAGS += -mcpu=cortex-a8 + else ifneq (,$(findstring cortexa7,$(platform))) + CFLAGS += -marm -mcpu=cortex-a7 + ASFLAGS += -mcpu=cortex-a7 + LIBZ := else ifneq (,$(findstring cortexa9,$(platform))) CFLAGS += -marm -mcpu=cortex-a9 ASFLAGS += -mcpu=cortex-a9 @@ -163,24 +309,30 @@ else ifneq (,$(findstring armv,$(platform))) # Windows else TARGET := $(TARGET_NAME)_libretro.dll - CC = gcc - fpic := -fPIC - LD_FLAGS := -fPIC - SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T - CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__ + BUILTIN_GPU = peops + PLATFORM = libretro + MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s + CFLAGS += -D__WIN32__ -DNO_DYLIB MMAP_WIN32=1 -endif - -CFLAGS += -fPIC -ifeq ($(platform),win) MAIN_LDLIBS += -lws2_32 -else ifneq ($(platform),qnx) - LDLIBS += -lpthread - MAIN_LDLIBS += -ldl + LIBPTHREAD := + LIBDL := endif + +CFLAGS += $(fpic) MAIN_LDFLAGS += -shared -MAIN_LDLIBS += -lm -lz -EXTRA_LDFLAGS = +MAIN_LDLIBS += $(LIBPTHREAD) $(LIBDL) $(LIBZ) + +# try to autodetect stuff for the lazy +ifndef ARCH +ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}') +endif +ifndef HAVE_NEON +HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0) +endif +ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU) +MAIN_LDFLAGS += -Wl,--no-undefined +endif # try to autodetect stuff for the lazy ifndef ARCH @@ -200,6 +352,14 @@ SOUND_DRIVERS = libretro PLUGINS = NO_CONFIG_MAK = yes +libretro_all: all +ifeq ($(platform),ios) +ifeq ($(USE_DYNAREC),1) + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) +endif +endif + include Makefile # no special AS needed for gpu_neon @@ -1,7 +1,7 @@ PCSX-ReARMed - yet another PCSX fork ==================================== -[](https://travis-ci.org/notaz/pcsx_rearmed) +[](https://travis-ci.org/libretro/pcsx_rearmed) *see [readme.txt](readme.txt) for more complete documentation* diff --git a/blackberry_qnx/.cproject b/blackberry_qnx/.cproject deleted file mode 100644 index 565f4a9..0000000 --- a/blackberry_qnx/.cproject +++ /dev/null @@ -1,142 +0,0 @@ -<?xml version="1.0" encoding="UTF-8" standalone="no"?> -<?fileVersion 4.0.0?> - -<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage"> - <storageModule moduleId="org.eclipse.cdt.core.settings"> - <cconfiguration id="com.qnx.qcc.toolChain.1762498539"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1815033502"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1271074456"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/> - <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/> - </storageModule> - <storageModule moduleId="scannerConfiguration"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - </storageModule> - <storageModule moduleId="refreshScope" versionNumber="1"> - <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/> - </storageModule> -</cproject> diff --git a/blackberry_qnx/.project b/blackberry_qnx/.project deleted file mode 100644 index c8e1e20..0000000 --- a/blackberry_qnx/.project +++ /dev/null @@ -1,84 +0,0 @@ -<?xml version="1.0" encoding="UTF-8"?> -<projectDescription> - <name>pcsx_rearmed</name> - <comment></comment> - <projects> - </projects> - <buildSpec> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name> - <triggers>clean,full,incremental,</triggers> - <arguments> - <dictionary> - <key>?name?</key> - <value></value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.append_environment</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.autoBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildArguments</key> - <value>-C .. -f Makefile.libretro platform=qnx</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildCommand</key> - <value>make</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.cleanBuildTarget</key> - <value>clean</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.contents</key> - <value>org.eclipse.cdt.make.core.activeConfigSettings</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableAutoBuild</key> - <value>false</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableCleanBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableFullBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.fullBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.stopOnError</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key> - <value>false</value> - </dictionary> - </arguments> - </buildCommand> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name> - <triggers>full,incremental,</triggers> - <arguments> - </arguments> - </buildCommand> - <buildCommand> - <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name> - <arguments> - </arguments> - </buildCommand> - </buildSpec> - <natures> - <nature>org.eclipse.cdt.core.cnature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature> - <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature> - </natures> -</projectDescription> diff --git a/debian_maemo/buildpkg b/debian_maemo/buildpkg deleted file mode 100644 index 4c34f94..0000000 --- a/debian_maemo/buildpkg +++ /dev/null @@ -1,13 +0,0 @@ -#!/bin/bash -e - -NAME=`head debian/changelog -n1 | sed -n 's/^\(.*\) (\(.*\)) .*/\1-\2/p'` -[[ -z $NAME ]] && { echo "Could not extract package name and version from debian/changelog" 2>&1; exit 1; } - -rm -rf ../$NAME -cp -r ../`basename $PWD` ../$NAME -cd ../$NAME -rm -rf .git* -find . -depth -name .svn -type d -exec rm -r {} \; -find . -name '*~' -exec rm {} \; - -LD_LIBRARY_PATH=/usr/lib dpkg-buildpackage -rfakeroot $* diff --git a/debian_maemo/changelog b/debian_maemo/changelog deleted file mode 100644 index e3395de..0000000 --- a/debian_maemo/changelog +++ /dev/null @@ -1,112 +0,0 @@ -pcsxrearmed (0.4.0.14.13) unstable; urgency=low - - * Updated source to notaz git version - - -- sakya <sakya_tg@yahoo.it> Fri, 15 Feb 2013 12:50:28 +0200 - -pcsxrearmed (0.4.0.14.12) unstable; urgency=low - - * Fixed a problem with controller and vibration (Gran Turismo 2, Wipeout 3) - * Added dependency to libts - - -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 17:09:33 +0200 - -pcsxrearmed (0.4.0.14.11) unstable; urgency=low - - * Added option -guncon and -gunnotrigger to activate guncon controller type - - -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 09:37:12 +0200 - -pcsxrearmed (0.4.0.14.10) unstable; urgency=low - - * Added option -corners to set action to execute when clicking on display corners - * Fixed problem with notification using gles plugin - * Fixed controller problem with game "Heart Of Darkness" (maybe others?) - - -- sakya <sakya_tg@yahoo.it> Fri, 11 May 2012 16:38:29 +0200 - -pcsxrearmed (0.4.0.14.9) unstable; urgency=low - - * Added support to .mdf extension - * Added option -vibration to activate vibration - - -- sakya <sakya_tg@yahoo.it> Tue, 1 May 2012 12:19:49 +0200 - -pcsxrearmed (0.4.0.14.8) unstable; urgency=low - - * Added option -disc to set the initial disc in multi discs images (used when loading a savestate with -load) - * Added option -autosave - * Fixed disc change for multi discs images (PBP) - * Merged commits from Notaz git - * drc: inv: fix ram ofset and mirror handling - * support emulated RAM mapped at offset - - -- sakya <sakya_tg@yahoo.it> Fri, 20 Apr 2012 20:27:19 +0200 - -pcsxrearmed (0.4.0.14.7) unstable; urgency=low - - * Fixed -displayon - - -- sakya <sakya_tg@yahoo.it> Sun, 15 Apr 2012 17:22:08 +0200 - -pcsxrearmed (0.4.0.14.6) unstable; urgency=low - - * Added option -keys to set the keys config file - * Fixed L1/L2/R1/R2 - * Added autopause on incoming call - - -- sakya <sakya_tg@yahoo.it> Wed, 13 Apr 2012 12:51:35 +0200 - -pcsxrearmed (0.4.0.14.5) unstable; urgency=low - - * Fixed accelerometer using gles - * Added -analog option to use the accelerometer as the analog pad - * Added options to set accelerometer sens, max value, y_def - * Added -displayon option to keep the display on (useful when playing using the accelerometer) - - -- sakya <sakya_tg@yahoo.it> Tue, 10 Apr 2012 15:34:11 +0200 - -pcsxrearmed (0.4.0.14.4) unstable; urgency=low - - * Fixed -load option - * Added disc change (configured a new key) - - -- sakya <sakya_tg@yahoo.it> Fri, 06 Apr 2012 13:54:56 +0200 - -pcsxrearmed (0.4.0.14.3) unstable; urgency=low - - * Added options to set various gles settings - * Fixed save state slot selection - * Added notification on save state slot change - - -- sakya <sakya_tg@yahoo.it> Wed, 04 Apr 2012 10:20:18 +0200 - -pcsxrearmed (0.4.0.14.2) unstable; urgency=low - - * Fixed fullscreen using gpu-gles - * Fixed crash when saving savestate using gpu-gles - * Added options to set spu reverb and interpolation (disabled by default) - - -- sakya <sakya_tg@yahoo.it> Sun, 01 Apr 2012 11:42:20 +0200 - -pcsxrearmed (0.4.0.14.1) unstable; urgency=low - - * Added option to set psx region (NTSC/PAL/Auto) - * Use PulseAudio (better audio) - - -- sakya <sakya_tg@yahoo.it> Wed, 30 Mar 2012 09:44:51 +0200 - -pcsxrearmed (0.4.0.14) unstable; urgency=low - - * Updated to r14 - * Added --help - * PCSX4All - - -- sakya <sakya_tg@yahoo.it> Sun, 27 Dec 2011 00:02:27 +0200 - -pcsxrearmed (0.4.0.12.2) unstable; urgency=low - - * gpu-gles - - - -- Bonapart <bonapart@programist.ru> Sun, 27 Dec 2011 00:02:27 +0200 diff --git a/debian_maemo/compat b/debian_maemo/compat deleted file mode 100644 index 7ed6ff8..0000000 --- a/debian_maemo/compat +++ /dev/null @@ -1 +0,0 @@ -5 diff --git a/debian_maemo/control b/debian_maemo/control deleted file mode 100644 index 4469ed8..0000000 --- a/debian_maemo/control +++ /dev/null @@ -1,115 +0,0 @@ -Source: pcsxrearmed -Section: user/games -Priority: extra -Maintainer: Bonapart <bonapart@programist.ru> -Build-Depends: debhelper (>= 5), zlib1g-dev, libhildon1-dev, libpulse-dev, libasound2-dev, libbz2-dev, libgles1-sgx-img-dev, opengles-sgx-img-common-dev, libosso-dev, libdbus-1-dev, libhildonfm2-dev, libts-dev -Standards-Version: 3.7.3 - -Package: pcsxrearmed -Architecture: armel -Depends: ${shlibs:Depends}, libts-0.0-0 -Description: Sony PlayStation emulator -XSBC-Homepage: http://notaz.gp2x.de/pcsx_rearmed.php -XSBC-Bugtracker: http://notaz.gp2x.de/pcsx_rearmed.php -XB-Maemo-Display-Name: PCSX-ReArmed -XB-Maemo-Icon-26: - iVBORw0KGgoAAAANSUhEUgAAADAAAAAwCAYAAABXAvmHAAAAAXNSR0IArs4c - 6QAAEStJREFUaN7Fmn+wXVV1xz9r733uufe+e9+DJIRESEICEQghAUQBI8Uo - ik7jrxm1o+3ooB2RkWrtONqZlhn7Y8bRUVudqVZsoTjFH2CrSKsVEFIQIr8C - JARC0CDkBwkkIcl7L7n3nLP36h97n3Pvo07/7c2cOfeenB9rr/Vd3/Vd6zxh - 7DM52b9isj+5YcGC+a9bunTpOVNTU91WK5Msy1ECIgYRMGKxzmGtQQBrHSZ9 - R8C5DOcc1hiMtTjrsM4hAtZYWq1W/H9nyZzDZVk6x9LKWmSteH2rlZNlLhw/ - fnzXszt3fmHjxo13bH74oReBwbbtO6r0ODht5UpnfXXdytOXX+mswVcl1hqc - swjgQ0BV8T7gfSCEQFBQFFQJqqhquptpHCJiMGIQKxhjsdZircMai8kczibj - XUaWZdi0d1lGlrVwmdN2nsvypUtZvmwpw7LY8dSTT37yX264/sGgOrNl67ZS - AFavPudTF5y76u9fOniQZ3/7PLPHjuG9Z8wSJO7QeAABVIW0DFAFBEVANF0j - AGh9XBWV9L3eRFAx6dr6XFDiMWMNy049VS9Yu4o/et+7xBj78u5duz78lS9/ - 8U6UoZx59lnZ2StXbMP7lT+7cyNFUWCsbQwmyLhTo1EiydvpSFogIpiIMQST - zhOMMSAmnmcMIhYxgogFYxBjEYnnYOIWn2OjA4IiRjhj+TL98uc/K5X3W7Zs - 2fKBf/72Pz5tZmdmz5jodJZtfeppyqqK+LQx3EYtpm0wRChYazBWMCYaasRg - TFwAUu/TsgyIiecytkAxBjG1sTZuzfe4GIwDk4GxqMmQLAdx7PjNs/KNG75H - 3srWLFmy5E3P79rj7Omnr7is08o+8Otnn6MYFtGIErQCyZXsqxW6B3S3gQqw - /I6PNgEZwSPmQAMVYxERVCSSQTI8et4iYtF6MckhcXECJuWSGPbvf1EvumCN - nDA1taIoypuNr6pFg6JgMEjGe2Ch0vpmSXdnQeuqQPeeivZtBbI6oIWiKJqS - WLU2vM6POh2SIZjEXpIMtglGdSTib9IxEsSoFy9mBFtjmTleyJ33bMIYOevQ - oUMnuLIs5w+LkuCr+HAP+dcqWu8PFD8SZAEwA9kGxawuOXZeBjMGXJ0BNMk4 - gpIZYbr2ZvJ6hJBrftcLEGPTfVJ+EBcfUo6pgohQhMCBgwdB4fDhw5MG6JdV - RQgKQZAO2IuVMIDB+xzhcWF4lWP4FUPYZJATf1dCp0ROxps69LXR1mGsTZtD - TNrbWE/i9/jbmFEiRx6oCSCRRHJZURTMzMx0nUK7LD2KIgZ0CPoM2KWQf8tj - TlPkZGX4GRdNdiTvzzW+Nrg2voaIqb1uHUYsYm2KRNxURnBSTfdB4k5r6q0x - qogIIShFWVKWZWa8962y8g0eRGH4GYd/Usg/GsjerHQ2VnRuK7GvC6iXhjpH - xo+MyPOcdruNsTZyughiXFxI42mHuAyswzgLNrGRNWANYg1gUCOoMQ2DYUZ5 - JgKqahxI5n0Y4cJBeMxw7LwM+6ZA62880o454C4rmb1U4AkLrXHjY6UNqpx6 - ymKm+n2qEBgUFUemZzk8PYsPinMxIsa6xDAR71rXjFj/CJo8WdNDXeQTY4iA - tZHVnKo61VBfCW3FXqzoUCl/bnB/ECj+0uGurGj/bcBdESifcBGLKQIN5oFu - p8OCBfPpdDp0u13yvI1X5fnd+9jx210cOjJDnmUY4yLOE9xACEmamHoRQZtF - aar0oBgxOJfFBYgxTjXxeGVgnqdzd4nuh9mLshizFkieHDKcyzam5nNjICjt - djS81+sxMTHB5OQkvV6P89euoZXn3Pfgo9y16RGKMiDWRu8bQVTQEEAiPQsh - KoAwqjApDBgjZM5F54mIa5IwA31OKL5kMYthYkeJe2ege39Bfm3Ab4fqJy7i - PVjEW/AGCel3sHTb0fh+v8/k5CQ+KEemZ+h0u8yfN48PvvddXPvpq5ma6qMK - 1goGk2qdIKYmZlMrLiBE+ISAAkaELMswxohx1mZSaxgBnFD8hePYBx3V92PW - hEeFwecyjr+lA7stsgDMUkWWhLidGpBXBWRxQPvKZH+yWcA9v9rMN2+8mWd2 - Pk+/36fX6/G615zHtZ++GucsqpIkR6obgJFXVPfa+QliYgwuy7DW4sQYGdFg - UsMC1fct1Q8c+ZdKqq9lhBds1D3WYt8zwP3JMNFc/RTBiPLcXdtZ9/LFdHtd - +v0+/ck+Yi0vHXyZXq9Ht9ul3W5z2bqLeNsb13HrHffQytvUVdSIRPyPVfna - +HpJxiSpL4LTEDAxHFFC12IssUz51y2oBNOSVPqF8MMu1X90QWykR7EY46iq - ite89VImzp6Ixvf7tLIW1rbodDtMTEzQ6XTI85w8z7nowvP54U/vJs9Hyanq - myKpKKIpAppEsWqCXhRlTlUxSbvXJTtSlYyS1tTcnKrt0CKFbSqqcZHnfeVY - 0DupMb7X65HlOVhD3mo33s/znCzLWLl8Ka08IxBtUA1NUBVFJeoukdg0ee+Z - mZllMBwgCM45cSGEEPHX0OzcRqaWv4y+R/GVqmqSCJJ6iM5Ep2GeXq9H1soR - sWSt1hzjsyxj3oknMJG3KGqmqTsmiaCvo1BWnmJYUJRDKu9HjZIqzhijseSb - RlXW+zoqkSJMoyZreWDHKms8Bt1urzG+1+vhsgwjllaWkef5qB+2lsoHfEj8 - PoZ3QQjeU5QFRVFSlRUh+Oa8qIK1gVAwxozEWLpN3Tr6oIhRjIJY0yhHsbEB - qQWaMRapPN1uh36/z8TEBN1ul8xliAHrsjnGG2PY88I+Zo4dZ6I3EVnHB4qy - ZDgYUpYVGkJqbUO0SAEJqAYq72MEAG+SFtc6DwREU6+bIhCA4AMWgzhpEnek - c2KE6iJWV+I4jbA4Z2vubqK96aHHokQuo5eHRYEGT0hDBG0wLU0VltRi+qqK - CxARX+uKV+J/1HhHcRXVo+C9EvB4FWwAYwLz5p+IwZC1crrdLp1Oh3a7jRhD - 5QODwSAZBoPhkLvv/RXfuP4mPIbS+5iA49t4m9QcjwUt+EBRFrV0I4y8ImOV - Q5qOKiZzrUINKlBVnrzlWLFsCWefdQbr113CLx94BCNCp9Oh0+nQarWoqujZ - m370U3bs3MWik+Zx5OhRfnHPJnrdLsOyZPr4MarKY63BGtMYKnXhIsKmXogP - nqIogajuGwjVTKQyd+yROnQCUJYVJ05NsWb1Kt74hks4c+XpnPKqxfT7fZ58 - 5lmyVqsxPsuilsqtsPrMM7jktWs5/bRl9HtdrvnYh7HWMhgMefHAQR7c/Dg/ - u3Mjj27djnEWI6aJQNJ0zcd7T1EMI4RUtaqTamxWMoJOUoo+KKcsWsglF13I - 773hEk6av4B+vzcnYV8+fKQpUs45nHMcPTrNT757Heede04zwfhfcAXeuv5S - Pvepj3PHXffw2c9/kWd378Vg0DAXRqrgK89gMCSEMJbEafxBrVoZNS55nnP5 - G9dx+frLmgJVU+TR6Vnu+O/7+Pdb/4vHt2zjfe/ZEKdsaTRTVSWLTl6Ic5ay - qjg2e4ytTz3NDf96C4889jjHBkP+/E+v5sMfeC/tPOcdb38LU/0+7//jT3J0 - enpsXDDKCx88xTAtQKFsIKRjA6t6WqZw9qvP4PL1lzE5OcnExATtdocHHn6M - +x/azP0PPkorb7P23HO4MG8nre6oqdmK4cCBg+zavYc77v4lP7/rHrZse4oz - Vqxg7bnn8o4r1vPmy9Y1zATw4oGDBO/RkPJRx1pKjRAaDCMpOIGqSWIZTdqU - URIfPjpNnrdHnncZe/e/xAknnMDVH/0Q6y+9hFVnvZp/+s73CaqM15V+v8s1 - n72W5/fsY3Z2lt9/y3o+9fErOX/NOSxfthTnRoOmF/bt58bv3sz1N93CzOzs - qJGRxEAoSCB4z3A4yoFiVAdovB6naQYV4bnd+/jCV7/BuzdcwaVvuJjTly/i - z675GO12m06n00gDl2WNWhyfXBw9Ms2nr7qSd2+4gkUnL6Tdzkd5oPCrBx/m - m9d/h433PcjR6RmGRTXWTupcFKnifcWwzgERKWMEatYZCdjxAe2uF/bxtW/d - yNe/fSNrV69i1dmvZvHCRbSyDLGW/fv38/O77uX1//CVOcl5+MhRbv/xTSw6 - eWGjX7z3TE9P88Nbf8oNN93MY1ufjHoqiUljYncW6sSlrgFRRnhfMSzqHFAt - jJFGsMXRRuR+bSZjMULORSmxdfuveXzbMzFlxiYS5XDI3n37eenAQebPOzFC - CeLMCXjpwEGe3P4Mt/zoNv7z9l/w/J59KYKt6NwxxlFlrIAx+h0ghEAxLOIC - gmpRj/5C7XV5xfiiRkRiVWcdtOq5T2z9xBjaeYu/+uLf8YN/u5ULzlvNhisu - ZzAcsOnBh9m9dy+3/+JeNm95giNHZ8haGZNT/cjxGtvGKB9CQkpACQRCwkBI - 8jouoCxLvPfqNIRBnQOicY6TXBvlrMaGew60dCT8JIUcBWMNBw4d5t5ND3Pf - A4/wvVt+wuzsMbZt/zXT09MMyxJjLZ1Op1GUUmuexsPjsoH4m7lsFEKgrLXQ - KInndIdzJs9xRhPHHLFKayrtBiQZks4REWxm0QAHXz4MCoNiCBiyzKVnNJiI - 9wmRYXTMeG2eERKca4qJLBRqNaqqRZ7nWOua1q2REPWKAs1UTALxfVkawMYb - +9F8RxQNZvz9B6iMTbLjTUMIc7yu9Z4wFoUR89T72ODXL0oEZ4yUcQFWVcbZ - TZtmRhtRFXm4rtIRXqnZVghGRzYzPmtPhKraDK8aVtG52J/LOjp6hUVI3lVE - RK2NswsHlK34llCa7BeNuKd2uU0tTkA1hiJG1qNqmh6C1F01EJyzklFyJspJ - JBNSDigStDlWGz96AZGco4qNr31qOS1F1spod9ujKXP9Uq5OgWa0B0ZHN2s8 - Qz3XTBBibpvYxLSBgI4aljpx0Yb3m1eHiaHGtZ8I5O0cUMqy9KaqyuPe+4OL - Fy4kc07rmzH2kDjqCOnBPr4F0YCGufuAJwSPBo+G6hVbOlc9IV2j9bWEdN8k - F9SPYEZgjH5oOdHFCxcwHBb7q6oqzNGj00cOHjz05No1q1lw4qSoD801UlfC - Bn5a3yfOMTUWn7gF8CkR/4+NEFknfq/vXz9z9LwRtBI0gxK8Z+H8E2XtmtXs - 3bv38enp6VlzbHb25W3bnnhANQzeseFtKBWVL0bYk9jU61jySTP1Do2XGsrT - MOa5sU1HXZXq+LFRtyK11yXMmciB4qsCoeRd73w7RVEc37x586YjR44ctsba - 7NChQ3m73T7ltRe+Zumac1ax9Yltenx6RsSmF26M6aRxlkpo1zQASEgevQTU - MRgSKTJomHMMJb7pb/7RRDbWBk91/DiTUxN6zVUfkWVLlnDvvffed//99/8Y - +I0VkWCtMc/s2DHw3i9at+71C996+Xrp9Sd01/O7ZHD8GASP+gpClfbxt097 - rY/7ilAlvPt4bHwLVUmo4n1COten65rzqmL0PXgmum3eueEK/ciH/lBOmJrU - 2267bevtt9/+XeBRYJ8Att3OT6oqf6b3/pJ58+a96ROf+MRFZ5115sTk5JTp - 93vSzttYF//OwaU/2siyLPatiSqNiXI8TjhoeoIRe0gjr4MGqjI6oKoqyqKk - KAqGxRBf+TQIGFKWJbMzszozOxt27tw5e9111z1w4MCBO4H7gKeBlwWg3c5b - 3of5VVWtUNVzgfMvvvji80477bQFS5Ys6VprTd301IaNG2iMaWBR9wKNwa/Y - 69j8sqoqQhpeeR8Nr+V22sKePXuO7969+6WHHnroseT1x4GdwCGgbFzU7XSy - wXDYDyGcDKwAlgOLgUmgzf/PZwgcAV4Ank2G7wemgRLgfwDIFWZCNtkwCgAA - AABJRU5ErkJggg== diff --git a/debian_maemo/copyright b/debian_maemo/copyright deleted file mode 100644 index 75a6b06..0000000 --- a/debian_maemo/copyright +++ /dev/null @@ -1,2 +0,0 @@ -this package was maemonized by Roman Deninberg <bonapart@programist.ru> -Mon, 10 Jan 2011 02:00:13 +0100 diff --git a/debian_maemo/dirs b/debian_maemo/dirs deleted file mode 100644 index 33359b8..0000000 --- a/debian_maemo/dirs +++ /dev/null @@ -1 +0,0 @@ -usr/games diff --git a/debian_maemo/docs b/debian_maemo/docs deleted file mode 100644 index e845566..0000000 --- a/debian_maemo/docs +++ /dev/null @@ -1 +0,0 @@ -README diff --git a/debian_maemo/files b/debian_maemo/files deleted file mode 100644 index 0cc57dd..0000000 --- a/debian_maemo/files +++ /dev/null @@ -1 +0,0 @@ -pcsxrearmed_0.4.0.14.13_armel.deb user/games extra diff --git a/debian_maemo/install b/debian_maemo/install deleted file mode 100644 index a260186..0000000 --- a/debian_maemo/install +++ /dev/null @@ -1,6 +0,0 @@ -pcsx opt/maemo/usr/games/ -plugins/spunull/spunull.so opt/maemo/usr/games/plugins -plugins/gpu_unai/gpu_unai.so opt/maemo/usr/games/plugins -#plugins/gpu_unai/gpuPCSX4ALL.so opt/maemo/usr/games/plugins -plugins/dfxvideo/gpu_peops.so opt/maemo/usr/games/plugins -plugins/gpu-gles/gpu_gles.so opt/maemo/usr/games/plugins diff --git a/debian_maemo/rules b/debian_maemo/rules deleted file mode 100644 index 5230bf7..0000000 --- a/debian_maemo/rules +++ /dev/null @@ -1,68 +0,0 @@ -#!/usr/bin/make -f -# -*- makefile -*- - -#export DH_VERBOSE=1 - -DEB_HOST_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_HOST_GNU_TYPE) -DEB_BUILD_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_BUILD_GNU_TYPE) -DEB_HOST_ARCH ?= $(shell dpkg-architecture -qDEB_HOST_ARCH) - -#GAME_VERSION := $(shell head debian/changelog -n1 | sed -n 's/.* (\(.*\)) .*/\1/p') -CFLAGS = -Wall -g - -ifneq (,$(findstring noopt,$(DEB_BUILD_OPTIONS))) - CFLAGS += -O0 -else - CFLAGS += -O2 -endif - -build: build-stamp - -build-stamp: - dh_testdir - ./configure --platform=maemo --gpu=neon --sound-drivers=pulseaudio --enable-neon - $(MAKE) - strip pcsx - strip plugins/gpu_unai/gpu_unai.so - strip plugins/gpu-gles/gpu_gles.so - strip plugins/spunull/spunull.so - touch build-stamp - -clean: - dh_testdir - dh_testroot - rm -f build-stamp - dh_clean - $(MAKE) clean clean_plugins - -install: build - dh_testdir - dh_testroot - dh_installdirs - mkdir -p "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - chmod 777 "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - chown user "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - dh_install - -binary-indep: build install - -binary-arch: build install - dh_testdir - dh_testroot - dh_installchangelogs - dh_installdocs - #dh_installmenu - dh_link - dh_strip - dh_compress - dh_fixperms - dh_installdeb - dh_makeshlibs - dh_shlibdeps - dh_gencontrol - #maemo-optify - dh_md5sums - dh_builddeb - -binary: binary-indep binary-arch -.PHONY: build clean binary-indep binary-arch binary install diff --git a/deps/adler32.c b/deps/adler32.c new file mode 100644 index 0000000..cccb3a2 --- /dev/null +++ b/deps/adler32.c @@ -0,0 +1,75 @@ +/* adler32.c -- compute the Adler-32 checksum of a data stream + * Copyright (C) 1995-2003 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include <stdint.h> +#include <stddef.h> +#include "zutil.h" + +#define BASE 65521UL /* largest prime smaller than 65536 */ +#define NMAX 5552 +/* NMAX is the largest n such that 255n(n+1)/2 + (n+1)(BASE-1) <= 2^32-1 */ + +#define DO1(buf,i) {s1 += buf[i]; s2 += s1;} +#define DO2(buf,i) DO1(buf,i); DO1(buf,i+1); +#define DO4(buf,i) DO2(buf,i); DO2(buf,i+2); +#define DO8(buf,i) DO4(buf,i); DO4(buf,i+4); +#define DO16(buf) DO8(buf,0); DO8(buf,8); + +#ifdef NO_DIVIDE +# define MOD(a) \ + do { \ + if (a >= (BASE << 16)) a -= (BASE << 16); \ + if (a >= (BASE << 15)) a -= (BASE << 15); \ + if (a >= (BASE << 14)) a -= (BASE << 14); \ + if (a >= (BASE << 13)) a -= (BASE << 13); \ + if (a >= (BASE << 12)) a -= (BASE << 12); \ + if (a >= (BASE << 11)) a -= (BASE << 11); \ + if (a >= (BASE << 10)) a -= (BASE << 10); \ + if (a >= (BASE << 9)) a -= (BASE << 9); \ + if (a >= (BASE << 8)) a -= (BASE << 8); \ + if (a >= (BASE << 7)) a -= (BASE << 7); \ + if (a >= (BASE << 6)) a -= (BASE << 6); \ + if (a >= (BASE << 5)) a -= (BASE << 5); \ + if (a >= (BASE << 4)) a -= (BASE << 4); \ + if (a >= (BASE << 3)) a -= (BASE << 3); \ + if (a >= (BASE << 2)) a -= (BASE << 2); \ + if (a >= (BASE << 1)) a -= (BASE << 1); \ + if (a >= BASE) a -= BASE; \ + } while (0) +#else +# define MOD(a) a %= BASE +#endif + +/* ========================================================================= */ +uLong adler32(uLong adler, const Bytef *buf, uInt len) +{ + uint32_t s1 = adler & 0xffff; + uint32_t s2 = (adler >> 16) & 0xffff; + int k; + + if (buf == NULL) + return 1L; + + while (len > 0) { + k = len < NMAX ? (int)len : NMAX; + len -= k; + while (k >= 16) { + DO16(buf); + buf += 16; + k -= 16; + } + if (k != 0) do { + s1 += *buf++; + s2 += s1; + } while (--k); + MOD(s1); + MOD(s2); + } + return (s2 << 16) | s1; +} + diff --git a/deps/compress.c b/deps/compress.c new file mode 100644 index 0000000..48465bd --- /dev/null +++ b/deps/compress.c @@ -0,0 +1,70 @@ +/* compress.c -- compress a memory buffer + * Copyright (C) 1995-2005 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include "zlib.h" + +/* =========================================================================== + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least 0.1% larger than sourceLen plus + 12 bytes. Upon exit, destLen is the actual size of the compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. + */ +int ZEXPORT compress2 (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen, int level) +{ + z_stream stream; + int err; + + stream.next_in = (Bytef *)source; + stream.avail_in = (uInt)sourceLen; +#ifdef MAXSEG_64K + /* Check for source > 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; +#endif + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = Z_NULL; + stream.zfree = Z_NULL; + stream.opaque = (voidpf)0; + + err = deflateInit(&stream, level); + if (err != Z_OK) return err; + + err = deflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + deflateEnd(&stream); + return err == Z_OK ? Z_BUF_ERROR : err; + } + *destLen = stream.total_out; + + err = deflateEnd(&stream); + return err; +} + +/* =========================================================================== +*/ +int ZEXPORT compress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen) +{ + return compress2(dest, destLen, source, sourceLen, Z_DEFAULT_COMPRESSION); +} + +/* =========================================================================== + If the default memLevel or windowBits for deflateInit() is changed, then + this function needs to be updated. + */ +uLong ZEXPORT compressBound (uLong sourceLen) +{ + return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) + + (sourceLen >> 25) + 13; +} diff --git a/deps/crc32.c b/deps/crc32.c new file mode 100644 index 0000000..73369a2 --- /dev/null +++ b/deps/crc32.c @@ -0,0 +1,88 @@ +#ifndef _S_CRC32_H +#define _S_CRC32_H + +#ifdef __cplusplus +extern "C" { +#endif + + static const unsigned long crc_table[256] = { + 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L, + 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L, + 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L, + 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL, + 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L, + 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L, + 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L, + 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL, + 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L, + 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL, + 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L, + 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L, + 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L, + 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL, + 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL, + 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L, + 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL, + 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L, + 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L, + 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L, + 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL, + 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L, + 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L, + 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL, + 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L, + 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L, + 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L, + 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L, + 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L, + 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL, + 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL, + 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L, + 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L, + 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL, + 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL, + 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L, + 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL, + 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L, + 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL, + 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L, + 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL, + 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L, + 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L, + 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL, + 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L, + 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L, + 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L, + 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L, + 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L, + 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L, + 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL, + 0x2d02ef8dL + }; + +#define DO1_CRC32(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8); +#define DO2_CRC32(buf) DO1_CRC32(buf); DO1_CRC32(buf); +#define DO4_CRC32(buf) DO2_CRC32(buf); DO2_CRC32(buf); +#define DO8_CRC32(buf) DO4_CRC32(buf); DO4_CRC32(buf); + + unsigned long crc32(unsigned long crc, const unsigned char *buf, unsigned int len) + { + if (buf == 0) return 0L; + crc = crc ^ 0xffffffffL; + while (len >= 8) + { + DO8_CRC32(buf); + len -= 8; + } + if (len) do { + DO1_CRC32(buf); + } while (--len); + return crc ^ 0xffffffffL; + } + +#ifdef __cplusplus +} +#endif + +#endif + diff --git a/deps/deflate.c b/deps/deflate.c new file mode 100644 index 0000000..f8fbc48 --- /dev/null +++ b/deps/deflate.c @@ -0,0 +1,1913 @@ +/* deflate.c -- compress data using the deflation algorithm + * Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process depends on being able to identify portions + * of the input text which are identical to earlier input (within a + * sliding window trailing behind the input currently being processed). + * + * The most straightforward technique turns out to be the fastest for + * most input files: try all possible matches and select the longest. + * The key feature of this algorithm is that insertions into the string + * dictionary are very simple and thus fast, and deletions are avoided + * completely. Insertions are performed at each input character, whereas + * string matches are performed only when the previous match ends. So it + * is preferable to spend more time in matches to allow very fast string + * insertions and avoid deletions. The matching algorithm for small + * strings is inspired from that of Rabin & Karp. A brute force approach + * is used to find longer strings when a small match has been found. + * A similar algorithm is used in comic (by Jan-Mark Wams) and freeze + * (by Leonid Broukhis). + * A previous version of this file used a more sophisticated algorithm + * (by Fiala and Greene) which is guaranteed to run in linear amortized + * time, but has a larger average cost, uses more memory and is patented. + * However the F&G algorithm may be faster for some highly redundant + * files if the parameter max_chain_length (described below) is too large. + * + * ACKNOWLEDGEMENTS + * + * The idea of lazy evaluation of matches is due to Jan-Mark Wams, and + * I found it in 'freeze' written by Leonid Broukhis. + * Thanks to many people for bug reports and testing. + * + * REFERENCES + * + * Deutsch, L.P.,"DEFLATE Compressed Data Format Specification". + * Available in http://tools.ietf.org/html/rfc1951 + * + * A description of the Rabin and Karp algorithm is given in the book + * "Algorithms" by R. Sedgewick, Addison-Wesley, p252. + * + * Fiala,E.R., and Greene,D.H. + * Data Compression with Finite Windows, Comm.ACM, 32,4 (1989) 490-595 + * + */ + +/* @(#) $Id$ */ + +#include "deflate.h" + +const char deflate_copyright[] = +" deflate 1.2.8 Copyright 1995-2013 Jean-loup Gailly and Mark Adler "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ + +/* =========================================================================== + * Function prototypes. + */ +typedef enum { + need_more, /* block not completed, need more input or more output */ + block_done, /* block flush performed */ + finish_started, /* finish started, need only more output at next deflate */ + finish_done /* finish done, accept no more input or output */ +} block_state; + +typedef block_state (*compress_func) OF((deflate_state *s, int flush)); +/* Compression function. Returns the block state after the call. */ + +local void fill_window OF((deflate_state *s)); +local block_state deflate_stored OF((deflate_state *s, int flush)); +local block_state deflate_fast OF((deflate_state *s, int flush)); +#ifndef FASTEST +local block_state deflate_slow OF((deflate_state *s, int flush)); +#endif +local block_state deflate_rle OF((deflate_state *s, int flush)); +local block_state deflate_huff OF((deflate_state *s, int flush)); +local void lm_init OF((deflate_state *s)); +local void putShortMSB OF((deflate_state *s, uInt b)); +local void flush_pending OF((z_streamp strm)); +local int read_buf OF((z_streamp strm, Bytef *buf, unsigned size)); +#ifdef ASMV +void match_init OF((void)); /* asm code initialization */ +uInt longest_match OF((deflate_state *s, IPos cur_match)); +#else +local uInt longest_match OF((deflate_state *s, IPos cur_match)); +#endif + +#ifdef DEBUG +local void check_match OF((deflate_state *s, IPos start, IPos match, + int length)); +#endif + +/* =========================================================================== + * Local data + */ + +#define NIL 0 +/* Tail of hash chains */ + +#ifndef TOO_FAR +# define TOO_FAR 4096 +#endif +/* Matches of length 3 are discarded if their distance exceeds TOO_FAR */ + +/* Values for max_lazy_match, good_match and max_chain_length, depending on + * the desired pack level (0..9). The values given below have been tuned to + * exclude worst case performance for pathological files. Better values may be + * found for specific files. + */ +typedef struct config_s { + ush good_length; /* reduce lazy search above this match length */ + ush max_lazy; /* do not perform lazy search above this match length */ + ush nice_length; /* quit search above this match length */ + ush max_chain; + compress_func func; +} config; + +#ifdef FASTEST +local const config configuration_table[2] = { + /* good lazy nice chain */ + /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */ + /* 1 */ {4, 4, 8, 4, deflate_fast}}; /* max speed, no lazy matches */ +#else +local const config configuration_table[10] = { + /* good lazy nice chain */ + /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */ + /* 1 */ {4, 4, 8, 4, deflate_fast}, /* max speed, no lazy matches */ + /* 2 */ {4, 5, 16, 8, deflate_fast}, + /* 3 */ {4, 6, 32, 32, deflate_fast}, + + /* 4 */ {4, 4, 16, 16, deflate_slow}, /* lazy matches */ + /* 5 */ {8, 16, 32, 32, deflate_slow}, + /* 6 */ {8, 16, 128, 128, deflate_slow}, + /* 7 */ {8, 32, 128, 256, deflate_slow}, + /* 8 */ {32, 128, 258, 1024, deflate_slow}, + /* 9 */ {32, 258, 258, 4096, deflate_slow}}; /* max compression */ +#endif + +/* Note: the deflate() code requires max_lazy >= MIN_MATCH and max_chain >= 4 + * For deflate_fast() (levels <= 3) good is ignored and lazy has a different + * meaning. + */ + +#define EQUAL 0 +/* result of memcmp for equal strings */ + +/* rank Z_BLOCK between Z_NO_FLUSH and Z_PARTIAL_FLUSH */ +#define RANK(f) (((f) << 1) - ((f) > 4 ? 9 : 0)) + +/* =========================================================================== + * Update a hash value with the given input byte + * IN assertion: all calls to to UPDATE_HASH are made with consecutive + * input characters, so that a running hash key can be computed from the + * previous key instead of complete recalculation each time. + */ +#define UPDATE_HASH(s,h,c) (h = (((h)<<s->hash_shift) ^ (c)) & s->hash_mask) + + +/* =========================================================================== + * Insert string str in the dictionary and set match_head to the previous head + * of the hash chain (the most recent string with same hash key). Return + * the previous length of the hash chain. + * If this file is compiled with -DFASTEST, the compression level is forced + * to 1, and no hash chains are maintained. + * IN assertion: all calls to to INSERT_STRING are made with consecutive + * input characters and the first MIN_MATCH bytes of str are valid + * (except for the last MIN_MATCH-1 bytes of the input file). + */ +#ifdef FASTEST +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + match_head = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#else +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + match_head = s->prev[(str) & s->w_mask] = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#endif + +/* =========================================================================== + * Initialize the hash table (avoiding 64K overflow for 16 bit systems). + * prev[] will be initialized on the fly. + */ +#define CLEAR_HASH(s) \ + s->head[s->hash_size-1] = NIL; \ +zmemzero((Bytef *)s->head, (unsigned)(s->hash_size-1)*sizeof(*s->head)); + +int ZEXPORT deflateResetKeep (z_streamp strm); + +int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits); + +/* ========================================================================= */ +int ZEXPORT deflateInit_(z_streamp strm, int level, const char *version, int stream_size) +{ + return deflateInit2_(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL, + Z_DEFAULT_STRATEGY, version, stream_size); + /* To do: ignore strm->next_in if we use it as window */ +} + +/* ========================================================================= */ +int ZEXPORT deflateInit2_(z_streamp strm, int level, int method, int windowBits, int memLevel, int strategy, + const char *version, int stream_size) +{ + deflate_state *s; + int wrap = 1; + static const char my_version[] = ZLIB_VERSION; + + ushf *overlay; + /* We overlay pending_buf and d_buf+l_buf. This works since the average + * output size for (length,distance) codes is <= 24 bits. + */ + + if (version == Z_NULL || version[0] != my_version[0] || + stream_size != sizeof(z_stream)) { + return Z_VERSION_ERROR; + } + if (strm == Z_NULL) return Z_STREAM_ERROR; + + strm->msg = Z_NULL; + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + +#ifdef FASTEST + if (level != 0) level = 1; +#else + if (level == Z_DEFAULT_COMPRESSION) level = 6; +#endif + + if (windowBits < 0) { /* suppress zlib wrapper */ + wrap = 0; + windowBits = -windowBits; + } +#ifdef GZIP + else if (windowBits > 15) { + wrap = 2; /* write gzip wrapper instead */ + windowBits -= 16; + } +#endif + if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method != Z_DEFLATED || + windowBits < 8 || windowBits > 15 || level < 0 || level > 9 || + strategy < 0 || strategy > Z_FIXED) { + return Z_STREAM_ERROR; + } + if (windowBits == 8) windowBits = 9; /* until 256-byte window bug fixed */ + s = (deflate_state *) ZALLOC(strm, 1, sizeof(deflate_state)); + if (s == Z_NULL) return Z_MEM_ERROR; + strm->state = (struct internal_state*)s; + s->strm = strm; + + s->wrap = wrap; + s->gzhead = Z_NULL; + s->w_bits = windowBits; + s->w_size = 1 << s->w_bits; + s->w_mask = s->w_size - 1; + + s->hash_bits = memLevel + 7; + s->hash_size = 1 << s->hash_bits; + s->hash_mask = s->hash_size - 1; + s->hash_shift = ((s->hash_bits+MIN_MATCH-1)/MIN_MATCH); + + s->window = (Bytef *) ZALLOC(strm, s->w_size, 2*sizeof(Byte)); + s->prev = (Posf *) ZALLOC(strm, s->w_size, sizeof(Pos)); + s->head = (Posf *) ZALLOC(strm, s->hash_size, sizeof(Pos)); + + s->high_water = 0; /* nothing written to s->window yet */ + + s->lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */ + + overlay = (ushf *) ZALLOC(strm, s->lit_bufsize, sizeof(ush)+2); + s->pending_buf = (uchf *) overlay; + s->pending_buf_size = (ulg)s->lit_bufsize * (sizeof(ush)+2L); + + if (s->window == Z_NULL || s->prev == Z_NULL || s->head == Z_NULL || + s->pending_buf == Z_NULL) { + s->status = FINISH_STATE; + strm->msg = ERR_MSG(Z_MEM_ERROR); + deflateEnd (strm); + return Z_MEM_ERROR; + } + s->d_buf = overlay + s->lit_bufsize/sizeof(ush); + s->l_buf = s->pending_buf + (1+sizeof(ush))*s->lit_bufsize; + + s->level = level; + s->strategy = strategy; + s->method = (Byte)method; + + return deflateReset(strm); +} + +/* ========================================================================= */ +int ZEXPORT deflateSetDictionary (z_streamp strm, const Bytef *dictionary, uInt dictLength) +{ + deflate_state *s; + uInt str, n; + int wrap; + unsigned avail; + unsigned char *next; + + if (strm == Z_NULL || strm->state == Z_NULL || dictionary == Z_NULL) + return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + wrap = s->wrap; + if (wrap == 2 || (wrap == 1 && s->status != INIT_STATE) || s->lookahead) + return Z_STREAM_ERROR; + + /* when using zlib wrappers, compute Adler-32 for provided dictionary */ + if (wrap == 1) + strm->adler = adler32(strm->adler, dictionary, dictLength); + s->wrap = 0; /* avoid computing Adler-32 in read_buf */ + + /* if dictionary would fill window, just replace the history */ + if (dictLength >= s->w_size) { + if (wrap == 0) { /* already empty otherwise */ + CLEAR_HASH(s); + s->strstart = 0; + s->block_start = 0L; + s->insert = 0; + } + dictionary += dictLength - s->w_size; /* use the tail */ + dictLength = s->w_size; + } + + /* insert dictionary into window and hash */ + avail = strm->avail_in; + next = strm->next_in; + strm->avail_in = dictLength; + strm->next_in = (Bytef *)dictionary; + fill_window(s); + while (s->lookahead >= MIN_MATCH) { + str = s->strstart; + n = s->lookahead - (MIN_MATCH-1); + do { + UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]); +#ifndef FASTEST + s->prev[str & s->w_mask] = s->head[s->ins_h]; +#endif + s->head[s->ins_h] = (Pos)str; + str++; + } while (--n); + s->strstart = str; + s->lookahead = MIN_MATCH-1; + fill_window(s); + } + s->strstart += s->lookahead; + s->block_start = (long)s->strstart; + s->insert = s->lookahead; + s->lookahead = 0; + s->match_length = s->prev_length = MIN_MATCH-1; + s->match_available = 0; + strm->next_in = next; + strm->avail_in = avail; + s->wrap = wrap; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateResetKeep (z_streamp strm) +{ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + strm->zalloc == Z_NULL || strm->zfree == Z_NULL) { + return Z_STREAM_ERROR; + } + + strm->total_in = strm->total_out = 0; + strm->msg = Z_NULL; /* use zfree if we ever allocate msg dynamically */ + strm->data_type = Z_UNKNOWN; + + s = (deflate_state *)strm->state; + s->pending = 0; + s->pending_out = s->pending_buf; + + if (s->wrap < 0) { + s->wrap = -s->wrap; /* was made negative by deflate(..., Z_FINISH); */ + } + s->status = s->wrap ? INIT_STATE : BUSY_STATE; + strm->adler = +#ifdef GZIP + s->wrap == 2 ? crc32(0L, Z_NULL, 0) : +#endif + adler32(0L, Z_NULL, 0); + s->last_flush = Z_NO_FLUSH; + + _tr_init(s); + + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateReset (z_streamp strm) +{ + int ret; + + ret = deflateResetKeep(strm); + if (ret == Z_OK) + lm_init((deflate_state*)strm->state); + return ret; +} + +/* ========================================================================= */ +int ZEXPORT deflateSetHeader (z_streamp strm, gz_headerp head) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + if (state->wrap != 2) + return Z_STREAM_ERROR; + state->gzhead = head; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + if (pending != Z_NULL) + *pending = state->pending; + if (bits != Z_NULL) + *bits = state->bi_valid; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflatePrime (z_streamp strm, int bits, int value) +{ + deflate_state *s; + int put; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + if ((Bytef *)(s->d_buf) < s->pending_out + ((Buf_size + 7) >> 3)) + return Z_BUF_ERROR; + do { + put = Buf_size - s->bi_valid; + if (put > bits) + put = bits; + s->bi_buf |= (ush)((value & ((1 << put) - 1)) << s->bi_valid); + s->bi_valid += put; + _tr_flush_bits(s); + value >>= put; + bits -= put; + } while (bits); + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateParams(z_streamp strm, int level, int strategy) +{ + deflate_state *s; + compress_func func; + int err = Z_OK; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + +#ifdef FASTEST + if (level != 0) level = 1; +#else + if (level == Z_DEFAULT_COMPRESSION) level = 6; +#endif + if (level < 0 || level > 9 || strategy < 0 || strategy > Z_FIXED) { + return Z_STREAM_ERROR; + } + func = configuration_table[s->level].func; + + if ((strategy != s->strategy || func != configuration_table[level].func) && + strm->total_in != 0) { + /* Flush the last buffer: */ + err = deflate(strm, Z_BLOCK); + if (err == Z_BUF_ERROR && s->pending == 0) + err = Z_OK; + } + if (s->level != level) { + s->level = level; + s->max_lazy_match = configuration_table[level].max_lazy; + s->good_match = configuration_table[level].good_length; + s->nice_match = configuration_table[level].nice_length; + s->max_chain_length = configuration_table[level].max_chain; + } + s->strategy = strategy; + return err; +} + +/* ========================================================================= */ +int ZEXPORT deflateTune(z_streamp strm, int good_length, int max_lazy, int nice_length, int max_chain) +{ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + s->good_match = good_length; + s->max_lazy_match = max_lazy; + s->nice_match = nice_length; + s->max_chain_length = max_chain; + return Z_OK; +} + +/* ========================================================================= + * For the default windowBits of 15 and memLevel of 8, this function returns + * a close to exact, as well as small, upper bound on the compressed size. + * They are coded as constants here for a reason--if the #define's are + * changed, then this function needs to be changed as well. The return + * value for 15 and 8 only works for those exact settings. + * + * For any setting other than those defaults for windowBits and memLevel, + * the value returned is a conservative worst case for the maximum expansion + * resulting from using fixed blocks instead of stored blocks, which deflate + * can emit on compressed data for some combinations of the parameters. + * + * This function could be more sophisticated to provide closer upper bounds for + * every combination of windowBits and memLevel. But even the conservative + * upper bound of about 14% expansion does not seem onerous for output buffer + * allocation. + */ +uLong ZEXPORT deflateBound(z_streamp strm, uLong sourceLen) +{ + deflate_state *s; + uLong complen, wraplen; + Bytef *str; + + /* conservative upper bound for compressed data */ + complen = sourceLen + + ((sourceLen + 7) >> 3) + ((sourceLen + 63) >> 6) + 5; + + /* if can't get parameters, return conservative bound plus zlib wrapper */ + if (strm == Z_NULL || strm->state == Z_NULL) + return complen + 6; + + /* compute wrapper length */ + s = (deflate_state*)strm->state; + switch (s->wrap) { + case 0: /* raw deflate */ + wraplen = 0; + break; + case 1: /* zlib wrapper */ + wraplen = 6 + (s->strstart ? 4 : 0); + break; + case 2: /* gzip wrapper */ + wraplen = 18; + if (s->gzhead != Z_NULL) { /* user-supplied gzip header */ + if (s->gzhead->extra != Z_NULL) + wraplen += 2 + s->gzhead->extra_len; + str = s->gzhead->name; + if (str != Z_NULL) + do { + wraplen++; + } while (*str++); + str = s->gzhead->comment; + if (str != Z_NULL) + do { + wraplen++; + } while (*str++); + if (s->gzhead->hcrc) + wraplen += 2; + } + break; + default: /* for compiler happiness */ + wraplen = 6; + } + + /* if not default parameters, return conservative bound */ + if (s->w_bits != 15 || s->hash_bits != 8 + 7) + return complen + wraplen; + + /* default settings: return tight bound for that case */ + return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) + + (sourceLen >> 25) + 13 - 6 + wraplen; +} + +/* ========================================================================= + * Put a short in the pending buffer. The 16-bit value is put in MSB order. + * IN assertion: the stream state is correct and there is enough room in + * pending_buf. + */ +local void putShortMSB (deflate_state *s, uInt b) +{ + put_byte(s, (Byte)(b >> 8)); + put_byte(s, (Byte)(b & 0xff)); +} + +/* ========================================================================= + * Flush as much pending output as possible. All deflate() output goes + * through this function so some applications may wish to modify it + * to avoid allocating a large strm->next_out buffer and copying into it. + * (See also read_buf()). + */ +local void flush_pending(z_streamp strm) +{ + unsigned len; + deflate_state *s = (deflate_state*)strm->state; + + _tr_flush_bits(s); + len = s->pending; + if (len > strm->avail_out) len = strm->avail_out; + if (len == 0) return; + + zmemcpy(strm->next_out, s->pending_out, len); + strm->next_out += len; + s->pending_out += len; + strm->total_out += len; + strm->avail_out -= len; + s->pending -= len; + if (s->pending == 0) { + s->pending_out = s->pending_buf; + } +} + +/* ========================================================================= */ +int ZEXPORT deflate (z_streamp strm, int flush) +{ + int old_flush; /* value of flush param for previous deflate call */ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + flush > Z_BLOCK || flush < 0) { + return Z_STREAM_ERROR; + } + s = (deflate_state*)strm->state; + + if (strm->next_out == Z_NULL || + (strm->next_in == Z_NULL && strm->avail_in != 0) || + (s->status == FINISH_STATE && flush != Z_FINISH)) { + ERR_RETURN(strm, Z_STREAM_ERROR); + } + if (strm->avail_out == 0) ERR_RETURN(strm, Z_BUF_ERROR); + + s->strm = strm; /* just in case */ + old_flush = s->last_flush; + s->last_flush = flush; + + /* Write the header */ + if (s->status == INIT_STATE) { +#ifdef GZIP + if (s->wrap == 2) { + strm->adler = crc32(0L, Z_NULL, 0); + put_byte(s, 31); + put_byte(s, 139); + put_byte(s, 8); + if (s->gzhead == Z_NULL) { + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, s->level == 9 ? 2 : + (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ? + 4 : 0)); + put_byte(s, OS_CODE); + s->status = BUSY_STATE; + } + else { + put_byte(s, (s->gzhead->text ? 1 : 0) + + (s->gzhead->hcrc ? 2 : 0) + + (s->gzhead->extra == Z_NULL ? 0 : 4) + + (s->gzhead->name == Z_NULL ? 0 : 8) + + (s->gzhead->comment == Z_NULL ? 0 : 16) + ); + put_byte(s, (Byte)(s->gzhead->time & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 8) & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 16) & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 24) & 0xff)); + put_byte(s, s->level == 9 ? 2 : + (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ? + 4 : 0)); + put_byte(s, s->gzhead->os & 0xff); + if (s->gzhead->extra != Z_NULL) { + put_byte(s, s->gzhead->extra_len & 0xff); + put_byte(s, (s->gzhead->extra_len >> 8) & 0xff); + } + if (s->gzhead->hcrc) + strm->adler = crc32(strm->adler, s->pending_buf, + s->pending); + s->gzindex = 0; + s->status = EXTRA_STATE; + } + } + else +#endif + { + uInt header = (Z_DEFLATED + ((s->w_bits-8)<<4)) << 8; + uInt level_flags; + + if (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2) + level_flags = 0; + else if (s->level < 6) + level_flags = 1; + else if (s->level == 6) + level_flags = 2; + else + level_flags = 3; + header |= (level_flags << 6); + if (s->strstart != 0) header |= PRESET_DICT; + header += 31 - (header % 31); + + s->status = BUSY_STATE; + putShortMSB(s, header); + + /* Save the adler32 of the preset dictionary: */ + if (s->strstart != 0) { + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + } + strm->adler = adler32(0L, Z_NULL, 0); + } + } +#ifdef GZIP + if (s->status == EXTRA_STATE) { + if (s->gzhead->extra != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + + while (s->gzindex < (s->gzhead->extra_len & 0xffff)) { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) + break; + } + put_byte(s, s->gzhead->extra[s->gzindex]); + s->gzindex++; + } + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (s->gzindex == s->gzhead->extra_len) { + s->gzindex = 0; + s->status = NAME_STATE; + } + } + else + s->status = NAME_STATE; + } + if (s->status == NAME_STATE) { + if (s->gzhead->name != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + int val; + + do { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) { + val = 1; + break; + } + } + val = s->gzhead->name[s->gzindex++]; + put_byte(s, val); + } while (val != 0); + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (val == 0) { + s->gzindex = 0; + s->status = COMMENT_STATE; + } + } + else + s->status = COMMENT_STATE; + } + if (s->status == COMMENT_STATE) { + if (s->gzhead->comment != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + int val; + + do { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) { + val = 1; + break; + } + } + val = s->gzhead->comment[s->gzindex++]; + put_byte(s, val); + } while (val != 0); + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (val == 0) + s->status = HCRC_STATE; + } + else + s->status = HCRC_STATE; + } + if (s->status == HCRC_STATE) { + if (s->gzhead->hcrc) { + if (s->pending + 2 > s->pending_buf_size) + flush_pending(strm); + if (s->pending + 2 <= s->pending_buf_size) { + put_byte(s, (Byte)(strm->adler & 0xff)); + put_byte(s, (Byte)((strm->adler >> 8) & 0xff)); + strm->adler = crc32(0L, Z_NULL, 0); + s->status = BUSY_STATE; + } + } + else + s->status = BUSY_STATE; + } +#endif + + /* Flush as much pending output as possible */ + if (s->pending != 0) { + flush_pending(strm); + if (strm->avail_out == 0) { + /* Since avail_out is 0, deflate will be called again with + * more output space, but possibly with both pending and + * avail_in equal to zero. There won't be anything to do, + * but this is not an error situation so make sure we + * return OK instead of BUF_ERROR at next call of deflate: + */ + s->last_flush = -1; + return Z_OK; + } + + /* Make sure there is something to do and avoid duplicate consecutive + * flushes. For repeated and useless calls with Z_FINISH, we keep + * returning Z_STREAM_END instead of Z_BUF_ERROR. + */ + } else if (strm->avail_in == 0 && RANK(flush) <= RANK(old_flush) && + flush != Z_FINISH) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* User must not provide more input after the first FINISH: */ + if (s->status == FINISH_STATE && strm->avail_in != 0) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* Start a new block or continue the current one. + */ + if (strm->avail_in != 0 || s->lookahead != 0 || + (flush != Z_NO_FLUSH && s->status != FINISH_STATE)) { + block_state bstate; + + bstate = s->strategy == Z_HUFFMAN_ONLY ? deflate_huff(s, flush) : + (s->strategy == Z_RLE ? deflate_rle(s, flush) : + (*(configuration_table[s->level].func))(s, flush)); + + if (bstate == finish_started || bstate == finish_done) { + s->status = FINISH_STATE; + } + if (bstate == need_more || bstate == finish_started) { + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR next call, see above */ + } + return Z_OK; + /* If flush != Z_NO_FLUSH && avail_out == 0, the next call + * of deflate should use the same flush parameter to make sure + * that the flush is complete. So we don't have to output an + * empty block here, this will be done at next call. This also + * ensures that for a very small output buffer, we emit at most + * one empty block. + */ + } + if (bstate == block_done) { + if (flush == Z_PARTIAL_FLUSH) { + _tr_align(s); + } else if (flush != Z_BLOCK) { /* FULL_FLUSH or SYNC_FLUSH */ + _tr_stored_block(s, (char*)0, 0L, 0); + /* For a full flush, this empty block will be recognized + * as a special marker by inflate_sync(). + */ + if (flush == Z_FULL_FLUSH) { + CLEAR_HASH(s); /* forget history */ + if (s->lookahead == 0) { + s->strstart = 0; + s->block_start = 0L; + s->insert = 0; + } + } + } + flush_pending(strm); + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR at next call, see above */ + return Z_OK; + } + } + } + Assert(strm->avail_out > 0, "bug2"); + + if (flush != Z_FINISH) return Z_OK; + if (s->wrap <= 0) return Z_STREAM_END; + + /* Write the trailer */ +#ifdef GZIP + if (s->wrap == 2) { + put_byte(s, (Byte)(strm->adler & 0xff)); + put_byte(s, (Byte)((strm->adler >> 8) & 0xff)); + put_byte(s, (Byte)((strm->adler >> 16) & 0xff)); + put_byte(s, (Byte)((strm->adler >> 24) & 0xff)); + put_byte(s, (Byte)(strm->total_in & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 8) & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 16) & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 24) & 0xff)); + } + else +#endif + { + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + } + flush_pending(strm); + /* If avail_out is zero, the application will call deflate again + * to flush the rest. + */ + if (s->wrap > 0) s->wrap = -s->wrap; /* write the trailer only once! */ + return s->pending != 0 ? Z_OK : Z_STREAM_END; +} + +/* ========================================================================= */ +int ZEXPORT deflateEnd (z_streamp strm) +{ + struct internal_state_deflate *state; + int status; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct internal_state_deflate*)strm->state; + + status = state->status; + if (status != INIT_STATE && + status != EXTRA_STATE && + status != NAME_STATE && + status != COMMENT_STATE && + status != HCRC_STATE && + status != BUSY_STATE && + status != FINISH_STATE) { + return Z_STREAM_ERROR; + } + + /* Deallocate in reverse order of allocations: */ + TRY_FREE(strm, state->pending_buf); + TRY_FREE(strm, state->head); + TRY_FREE(strm, state->prev); + TRY_FREE(strm, state->window); + + ZFREE(strm, state); + state = Z_NULL; + + return status == BUSY_STATE ? Z_DATA_ERROR : Z_OK; +} + +/* ========================================================================= + * Copy the source state to the destination state. + * To simplify the source, this is not supported for 16-bit MSDOS (which + * doesn't have enough memory anyway to duplicate compression states). + */ +int ZEXPORT deflateCopy (z_streamp dest, z_streamp source) +{ +#ifdef MAXSEG_64K + return Z_STREAM_ERROR; +#else + deflate_state *ds; + deflate_state *ss; + ushf *overlay; + + + if (source == Z_NULL || dest == Z_NULL || source->state == Z_NULL) { + return Z_STREAM_ERROR; + } + + ss = (deflate_state*)source->state; + + zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream)); + + ds = (deflate_state *) ZALLOC(dest, 1, sizeof(deflate_state)); + if (ds == Z_NULL) return Z_MEM_ERROR; + dest->state = (struct internal_state FAR *) ds; + zmemcpy((voidpf)ds, (voidpf)ss, sizeof(deflate_state)); + ds->strm = dest; + + ds->window = (Bytef *) ZALLOC(dest, ds->w_size, 2*sizeof(Byte)); + ds->prev = (Posf *) ZALLOC(dest, ds->w_size, sizeof(Pos)); + ds->head = (Posf *) ZALLOC(dest, ds->hash_size, sizeof(Pos)); + overlay = (ushf *) ZALLOC(dest, ds->lit_bufsize, sizeof(ush)+2); + ds->pending_buf = (uchf *) overlay; + + if (ds->window == Z_NULL || ds->prev == Z_NULL || ds->head == Z_NULL || + ds->pending_buf == Z_NULL) { + deflateEnd (dest); + return Z_MEM_ERROR; + } + /* following zmemcpy do not work for 16-bit MSDOS */ + zmemcpy(ds->window, ss->window, ds->w_size * 2 * sizeof(Byte)); + zmemcpy((voidpf)ds->prev, (voidpf)ss->prev, ds->w_size * sizeof(Pos)); + zmemcpy((voidpf)ds->head, (voidpf)ss->head, ds->hash_size * sizeof(Pos)); + zmemcpy(ds->pending_buf, ss->pending_buf, (uInt)ds->pending_buf_size); + + ds->pending_out = ds->pending_buf + (ss->pending_out - ss->pending_buf); + ds->d_buf = overlay + ds->lit_bufsize/sizeof(ush); + ds->l_buf = ds->pending_buf + (1+sizeof(ush))*ds->lit_bufsize; + + ds->l_desc.dyn_tree = ds->dyn_ltree; + ds->d_desc.dyn_tree = ds->dyn_dtree; + ds->bl_desc.dyn_tree = ds->bl_tree; + + return Z_OK; +#endif /* MAXSEG_64K */ +} + +/* =========================================================================== + * Read a new buffer from the current input stream, update the adler32 + * and total number of bytes read. All deflate() input goes through + * this function so some applications may wish to modify it to avoid + * allocating a large strm->next_in buffer and copying from it. + * (See also flush_pending()). + */ +local int read_buf(z_streamp strm, Bytef *buf, unsigned size) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + unsigned len = strm->avail_in; + + if (len > size) len = size; + if (len == 0) return 0; + + strm->avail_in -= len; + + zmemcpy(buf, strm->next_in, len); + if (state->wrap == 1) { + strm->adler = adler32(strm->adler, buf, len); + } +#ifdef GZIP + else if (state->wrap == 2) { + strm->adler = crc32(strm->adler, buf, len); + } +#endif + strm->next_in += len; + strm->total_in += len; + + return (int)len; +} + +/* =========================================================================== + * Initialize the "longest match" routines for a new zlib stream + */ +local void lm_init (deflate_state *s) +{ + s->window_size = (ulg)2L*s->w_size; + + CLEAR_HASH(s); + + /* Set the default configuration parameters: + */ + s->max_lazy_match = configuration_table[s->level].max_lazy; + s->good_match = configuration_table[s->level].good_length; + s->nice_match = configuration_table[s->level].nice_length; + s->max_chain_length = configuration_table[s->level].max_chain; + + s->strstart = 0; + s->block_start = 0L; + s->lookahead = 0; + s->insert = 0; + s->match_length = s->prev_length = MIN_MATCH-1; + s->match_available = 0; + s->ins_h = 0; +#ifndef FASTEST +#ifdef ASMV + match_init(); /* initialize the asm code */ +#endif +#endif +} + +#ifndef FASTEST +/* =========================================================================== + * Set match_start to the longest match starting at the given string and + * return its length. Matches shorter or equal to prev_length are discarded, + * in which case the result is equal to prev_length and match_start is + * garbage. + * IN assertions: cur_match is the head of the hash chain for the current + * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1 + * OUT assertion: the match length is not greater than s->lookahead. + */ +#ifndef ASMV +/* For 80x86 and 680x0, an optimized version will be provided in match.asm or + * match.S. The code will be functionally equivalent. + */ +local uInt longest_match(deflate_state *s, IPos cur_match) +{ + unsigned chain_length = s->max_chain_length;/* max hash chain length */ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + int best_len = s->prev_length; /* best match length so far */ + int nice_match = s->nice_match; /* stop if match long enough */ + IPos limit = s->strstart > (IPos)MAX_DIST(s) ? + s->strstart - (IPos)MAX_DIST(s) : NIL; + /* Stop when cur_match becomes <= limit. To simplify the code, + * we prevent matches with the string of window index 0. + */ + Posf *prev = s->prev; + uInt wmask = s->w_mask; + +#ifdef UNALIGNED_OK + /* Compare two bytes at a time. Note: this is not always beneficial. + * Try with and without -DUNALIGNED_OK to check. + */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1; + register ush scan_start = *(ushf*)scan; + register ush scan_end = *(ushf*)(scan+best_len-1); +#else + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + register Byte scan_end1 = scan[best_len-1]; + register Byte scan_end = scan[best_len]; +#endif + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + /* Do not waste too much time if we already have a good match: */ + if (s->prev_length >= s->good_match) { + chain_length >>= 2; + } + /* Do not look for matches beyond the end of the input. This is necessary + * to make deflate deterministic. + */ + if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + do { + Assert(cur_match < s->strstart, "no future"); + match = s->window + cur_match; + + /* Skip to next match if the match length cannot increase + * or if the match length is less than 2. Note that the checks below + * for insufficient lookahead only occur occasionally for performance + * reasons. Therefore uninitialized memory will be accessed, and + * conditional jumps will be made that depend on those values. + * However the length of the match is limited to the lookahead, so + * the output of deflate is not affected by the uninitialized values. + */ +#if (defined(UNALIGNED_OK) && MAX_MATCH == 258) + /* This code assumes sizeof(unsigned short) == 2. Do not use + * UNALIGNED_OK if your compiler uses a different size. + */ + if (*(ushf*)(match+best_len-1) != scan_end || + *(ushf*)match != scan_start) continue; + + /* It is not necessary to compare scan[2] and match[2] since they are + * always equal when the other bytes match, given that the hash keys + * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at + * strstart+3, +5, ... up to strstart+257. We check for insufficient + * lookahead only every 4th comparison; the 128th check will be made + * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is + * necessary to put more guard bytes at the end of the window, or + * to check more often for insufficient lookahead. + */ + Assert(scan[2] == match[2], "scan[2]?"); + scan++, match++; + do { + } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + scan < strend); + /* The funny "do {}" generates better code on most compilers */ + + /* Here, scan <= window+strstart+257 */ + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + if (*scan == *match) scan++; + + len = (MAX_MATCH - 1) - (int)(strend-scan); + scan = strend - (MAX_MATCH-1); + +#else /* UNALIGNED_OK */ + + if (match[best_len] != scan_end || + match[best_len-1] != scan_end1 || + *match != *scan || + *++match != scan[1]) continue; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match++; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + scan = strend - MAX_MATCH; + +#endif /* UNALIGNED_OK */ + + if (len > best_len) { + s->match_start = cur_match; + best_len = len; + if (len >= nice_match) break; +#ifdef UNALIGNED_OK + scan_end = *(ushf*)(scan+best_len-1); +#else + scan_end1 = scan[best_len-1]; + scan_end = scan[best_len]; +#endif + } + } while ((cur_match = prev[cur_match & wmask]) > limit + && --chain_length != 0); + + if ((uInt)best_len <= s->lookahead) return (uInt)best_len; + return s->lookahead; +} +#endif /* ASMV */ + +#else /* FASTEST */ + +/* --------------------------------------------------------------------------- + * Optimized version for FASTEST only + */ +local uInt longest_match(s, cur_match) + deflate_state *s; + IPos cur_match; /* current match */ +{ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + Assert(cur_match < s->strstart, "no future"); + + match = s->window + cur_match; + + /* Return failure if the match length is less than 2: + */ + if (match[0] != scan[0] || match[1] != scan[1]) return MIN_MATCH-1; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match += 2; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + + if (len < MIN_MATCH) return MIN_MATCH - 1; + + s->match_start = cur_match; + return (uInt)len <= s->lookahead ? (uInt)len : s->lookahead; +} + +#endif /* FASTEST */ + +#ifdef DEBUG +/* =========================================================================== + * Check that the match at match_start is indeed a match. + */ +local void check_match(s, start, match, length) + deflate_state *s; + IPos start, match; + int length; +{ + /* check that the match is indeed a match */ + if (zmemcmp(s->window + match, + s->window + start, length) != EQUAL) { + fprintf(stderr, " start %u, match %u, length %d\n", + start, match, length); + do { + fprintf(stderr, "%c%c", s->window[match++], s->window[start++]); + } while (--length != 0); + z_error("invalid match"); + } + if (z_verbose > 1) { + fprintf(stderr,"\\[%d,%d]", start-match, length); + do { putc(s->window[start++], stderr); } while (--length != 0); + } +} +#else +# define check_match(s, start, match, length) +#endif /* DEBUG */ + +/* =========================================================================== + * Fill the window when the lookahead becomes insufficient. + * Updates strstart and lookahead. + * + * IN assertion: lookahead < MIN_LOOKAHEAD + * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD + * At least one byte has been read, or avail_in == 0; reads are + * performed for at least two bytes (required for the zip translate_eol + * option -- not supported here). + */ +local void fill_window(deflate_state *s) +{ + register unsigned n, m; + register Posf *p; + unsigned more; /* Amount of free space at the end of the window. */ + uInt wsize = s->w_size; + + Assert(s->lookahead < MIN_LOOKAHEAD, "already enough lookahead"); + + do { + more = (unsigned)(s->window_size -(ulg)s->lookahead -(ulg)s->strstart); + + /* Deal with !@#$% 64K limit: */ + if (sizeof(int) <= 2) { + if (more == 0 && s->strstart == 0 && s->lookahead == 0) { + more = wsize; + + } else if (more == (unsigned)(-1)) { + /* Very unlikely, but possible on 16 bit machine if + * strstart == 0 && lookahead == 1 (input done a byte at time) + */ + more--; + } + } + + /* If the window is almost full and there is insufficient lookahead, + * move the upper half to the lower one to make room in the upper half. + */ + if (s->strstart >= wsize+MAX_DIST(s)) { + + zmemcpy(s->window, s->window+wsize, (unsigned)wsize); + s->match_start -= wsize; + s->strstart -= wsize; /* we now have strstart >= MAX_DIST */ + s->block_start -= (long) wsize; + + /* Slide the hash table (could be avoided with 32 bit values + at the expense of memory usage). We slide even when level == 0 + to keep the hash table consistent if we switch back to level > 0 + later. (Using level 0 permanently is not an optimal usage of + zlib, so we don't care about this pathological case.) + */ + n = s->hash_size; + p = &s->head[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + } while (--n); + + n = wsize; +#ifndef FASTEST + p = &s->prev[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + /* If n is not on any hash chain, prev[n] is garbage but + * its value will never be used. + */ + } while (--n); +#endif + more += wsize; + } + if (s->strm->avail_in == 0) break; + + /* If there was no sliding: + * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 && + * more == window_size - lookahead - strstart + * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1) + * => more >= window_size - 2*WSIZE + 2 + * In the BIG_MEM or MMAP case (not yet supported), + * window_size == input_size + MIN_LOOKAHEAD && + * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD. + * Otherwise, window_size == 2*WSIZE so more >= 2. + * If there was sliding, more >= WSIZE. So in all cases, more >= 2. + */ + Assert(more >= 2, "more < 2"); + + n = read_buf(s->strm, s->window + s->strstart + s->lookahead, more); + s->lookahead += n; + + /* Initialize the hash value now that we have some input: */ + if (s->lookahead + s->insert >= MIN_MATCH) { + uInt str = s->strstart - s->insert; + s->ins_h = s->window[str]; + UPDATE_HASH(s, s->ins_h, s->window[str + 1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + while (s->insert) { + UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]); +#ifndef FASTEST + s->prev[str & s->w_mask] = s->head[s->ins_h]; +#endif + s->head[s->ins_h] = (Pos)str; + str++; + s->insert--; + if (s->lookahead + s->insert < MIN_MATCH) + break; + } + } + /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage, + * but this is not important since only literal bytes will be emitted. + */ + + } while (s->lookahead < MIN_LOOKAHEAD && s->strm->avail_in != 0); + + /* If the WIN_INIT bytes after the end of the current data have never been + * written, then zero those bytes in order to avoid memory check reports of + * the use of uninitialized (or uninitialised as Julian writes) bytes by + * the longest match routines. Update the high water mark for the next + * time through here. WIN_INIT is set to MAX_MATCH since the longest match + * routines allow scanning to strstart + MAX_MATCH, ignoring lookahead. + */ + if (s->high_water < s->window_size) { + ulg curr = s->strstart + (ulg)(s->lookahead); + ulg init; + + if (s->high_water < curr) { + /* Previous high water mark below current data -- zero WIN_INIT + * bytes or up to end of window, whichever is less. + */ + init = s->window_size - curr; + if (init > WIN_INIT) + init = WIN_INIT; + zmemzero(s->window + curr, (unsigned)init); + s->high_water = curr + init; + } + else if (s->high_water < (ulg)curr + WIN_INIT) { + /* High water mark at or above current data, but below current data + * plus WIN_INIT -- zero out to current data plus WIN_INIT, or up + * to end of window, whichever is less. + */ + init = (ulg)curr + WIN_INIT - s->high_water; + if (init > s->window_size - s->high_water) + init = s->window_size - s->high_water; + zmemzero(s->window + s->high_water, (unsigned)init); + s->high_water += init; + } + } + + Assert((ulg)s->strstart <= s->window_size - MIN_LOOKAHEAD, + "not enough room for search"); +} + +/* =========================================================================== + * Flush the current block, with given end-of-file flag. + * IN assertion: strstart is set to the end of the current match. + */ +#define FLUSH_BLOCK_ONLY(s, last) { \ + _tr_flush_block(s, (s->block_start >= 0L ? \ + (charf *)&s->window[(unsigned)s->block_start] : \ + (charf *)Z_NULL), \ + (ulg)((long)s->strstart - s->block_start), \ + (last)); \ + s->block_start = s->strstart; \ + flush_pending(s->strm); \ + Tracev((stderr,"[FLUSH]")); \ +} + +/* Same but force premature exit if necessary. */ +#define FLUSH_BLOCK(s, last) { \ + FLUSH_BLOCK_ONLY(s, last); \ + if (s->strm->avail_out == 0) return (last) ? finish_started : need_more; \ +} + +/* =========================================================================== + * Copy without compression as much as possible from the input stream, return + * the current block state. + * This function does not insert new strings in the dictionary since + * uncompressible data is probably not useful. This function is used + * only for the level=0 compression option. + * NOTE: this function should be optimized to avoid extra copying from + * window to pending_buf. + */ +local block_state deflate_stored(deflate_state *s, int flush) +{ + /* Stored blocks are limited to 0xffff bytes, pending_buf is limited + * to pending_buf_size, and each stored block has a 5 byte header: + */ + ulg max_block_size = 0xffff; + ulg max_start; + + if (max_block_size > s->pending_buf_size - 5) { + max_block_size = s->pending_buf_size - 5; + } + + /* Copy as much as possible from input to output: */ + for (;;) { + /* Fill the window as much as possible: */ + if (s->lookahead <= 1) { + + Assert(s->strstart < s->w_size+MAX_DIST(s) || + s->block_start >= (long)s->w_size, "slide too late"); + + fill_window(s); + if (s->lookahead == 0 && flush == Z_NO_FLUSH) return need_more; + + if (s->lookahead == 0) break; /* flush the current block */ + } + Assert(s->block_start >= 0L, "block gone"); + + s->strstart += s->lookahead; + s->lookahead = 0; + + /* Emit a stored block if pending_buf will be full: */ + max_start = s->block_start + max_block_size; + if (s->strstart == 0 || (ulg)s->strstart >= max_start) { + /* strstart == 0 is possible when wraparound on 16-bit machine */ + s->lookahead = (uInt)(s->strstart - max_start); + s->strstart = (uInt)max_start; + FLUSH_BLOCK(s, 0); + } + /* Flush if we may have to slide, otherwise block_start may become + * negative and the data will be gone: + */ + if (s->strstart - (uInt)s->block_start >= MAX_DIST(s)) { + FLUSH_BLOCK(s, 0); + } + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if ((long)s->strstart > s->block_start) + FLUSH_BLOCK(s, 0); + return block_done; +} + +/* =========================================================================== + * Compress as much as possible from the input stream, return the current + * block state. + * This function does not perform lazy evaluation of matches and inserts + * new strings in the dictionary only for unmatched strings or for short + * matches. It is used only for the fast compression options. + */ +local block_state deflate_fast(deflate_state *s, int flush) +{ + IPos hash_head; /* head of the hash chain */ + int bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = NIL; + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + * At this point we have always match_length < MIN_MATCH + */ + if (hash_head != NIL && s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s->match_length = longest_match (s, hash_head); + /* longest_match() sets match_start */ + } + if (s->match_length >= MIN_MATCH) { + check_match(s, s->strstart, s->match_start, s->match_length); + + _tr_tally_dist(s, s->strstart - s->match_start, + s->match_length - MIN_MATCH, bflush); + + s->lookahead -= s->match_length; + + /* Insert new strings in the hash table only if the match length + * is not too large. This saves time but degrades compression. + */ +#ifndef FASTEST + if (s->match_length <= s->max_insert_length && + s->lookahead >= MIN_MATCH) { + s->match_length--; /* string at strstart already in table */ + do { + s->strstart++; + INSERT_STRING(s, s->strstart, hash_head); + /* strstart never exceeds WSIZE-MAX_MATCH, so there are + * always MIN_MATCH bytes ahead. + */ + } while (--s->match_length != 0); + s->strstart++; + } else +#endif + { + s->strstart += s->match_length; + s->match_length = 0; + s->ins_h = s->window[s->strstart]; + UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not + * matter since it will be recomputed at next deflate call. + */ + } + } else { + /* No match, output a literal byte */ + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + } + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} + +#ifndef FASTEST +/* =========================================================================== + * Same as above, but achieves better compression. We use a lazy + * evaluation for matches: a match is finally adopted only if there is + * no better match at the next window position. + */ +local block_state deflate_slow(deflate_state *s, int flush) +{ + IPos hash_head; /* head of hash chain */ + int bflush; /* set if current block must be flushed */ + + /* Process the input block. */ + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = NIL; + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + */ + s->prev_length = s->match_length, s->prev_match = s->match_start; + s->match_length = MIN_MATCH-1; + + if (hash_head != NIL && s->prev_length < s->max_lazy_match && + s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s->match_length = longest_match (s, hash_head); + /* longest_match() sets match_start */ + + if (s->match_length <= 5 && (s->strategy == Z_FILTERED +#if TOO_FAR <= 32767 + || (s->match_length == MIN_MATCH && + s->strstart - s->match_start > TOO_FAR) +#endif + )) { + + /* If prev_match is also MIN_MATCH, match_start is garbage + * but we will ignore the current match anyway. + */ + s->match_length = MIN_MATCH-1; + } + } + /* If there was a match at the previous step and the current + * match is not better, output the previous match: + */ + if (s->prev_length >= MIN_MATCH && s->match_length <= s->prev_length) { + uInt max_insert = s->strstart + s->lookahead - MIN_MATCH; + /* Do not insert strings in hash table beyond this. */ + + check_match(s, s->strstart-1, s->prev_match, s->prev_length); + + _tr_tally_dist(s, s->strstart -1 - s->prev_match, + s->prev_length - MIN_MATCH, bflush); + + /* Insert in hash table all strings up to the end of the match. + * strstart-1 and strstart are already inserted. If there is not + * enough lookahead, the last two strings are not inserted in + * the hash table. + */ + s->lookahead -= s->prev_length-1; + s->prev_length -= 2; + do { + if (++s->strstart <= max_insert) { + INSERT_STRING(s, s->strstart, hash_head); + } + } while (--s->prev_length != 0); + s->match_available = 0; + s->match_length = MIN_MATCH-1; + s->strstart++; + + if (bflush) FLUSH_BLOCK(s, 0); + + } else if (s->match_available) { + /* If there was no match at the previous position, output a + * single literal. If there was a match but the current match + * is longer, truncate the previous match to a single literal. + */ + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + if (bflush) { + FLUSH_BLOCK_ONLY(s, 0); + } + s->strstart++; + s->lookahead--; + if (s->strm->avail_out == 0) return need_more; + } else { + /* There is no previous match to compare with, wait for + * the next step to decide. + */ + s->match_available = 1; + s->strstart++; + s->lookahead--; + } + } + Assert (flush != Z_NO_FLUSH, "no flush?"); + if (s->match_available) { + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + s->match_available = 0; + } + s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} +#endif /* FASTEST */ + +/* =========================================================================== + * For Z_RLE, simply look for runs of bytes, generate matches only of distance + * one. Do not maintain a hash table. (It will be regenerated if this run of + * deflate switches away from Z_RLE.) + */ +local block_state deflate_rle(deflate_state *s, int flush) +{ + int bflush; /* set if current block must be flushed */ + uInt prev; /* byte at distance one to match */ + Bytef *scan, *strend; /* scan goes up to strend for length of run */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the longest run, plus one for the unrolled loop. + */ + if (s->lookahead <= MAX_MATCH) { + fill_window(s); + if (s->lookahead <= MAX_MATCH && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* See how many times the previous byte repeats */ + s->match_length = 0; + if (s->lookahead >= MIN_MATCH && s->strstart > 0) { + scan = s->window + s->strstart - 1; + prev = *scan; + if (prev == *++scan && prev == *++scan && prev == *++scan) { + strend = s->window + s->strstart + MAX_MATCH; + do { + } while (prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + scan < strend); + s->match_length = MAX_MATCH - (int)(strend - scan); + if (s->match_length > s->lookahead) + s->match_length = s->lookahead; + } + Assert(scan <= s->window+(uInt)(s->window_size-1), "wild scan"); + } + + /* Emit match if have run of MIN_MATCH or longer, else emit literal */ + if (s->match_length >= MIN_MATCH) { + check_match(s, s->strstart, s->strstart - 1, s->match_length); + + _tr_tally_dist(s, 1, s->match_length - MIN_MATCH, bflush); + + s->lookahead -= s->match_length; + s->strstart += s->match_length; + s->match_length = 0; + } else { + /* No match, output a literal byte */ + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + } + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} + +/* =========================================================================== + * For Z_HUFFMAN_ONLY, do not look for matches. Do not maintain a hash table. + * (It will be regenerated if this run of deflate switches away from Huffman.) + */ +local block_state deflate_huff(deflate_state *s, int flush) +{ + int bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we have a literal to write. */ + if (s->lookahead == 0) { + fill_window(s); + if (s->lookahead == 0) { + if (flush == Z_NO_FLUSH) + return need_more; + break; /* flush the current block */ + } + } + + /* Output a literal byte */ + s->match_length = 0; + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} diff --git a/deps/deflate.h b/deps/deflate.h new file mode 100644 index 0000000..82fe93e --- /dev/null +++ b/deps/deflate.h @@ -0,0 +1,346 @@ +/* deflate.h -- internal compression state + * Copyright (C) 1995-2012 Jean-loup Gailly + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef DEFLATE_H +#define DEFLATE_H + +#include "zutil.h" + +/* define NO_GZIP when compiling if you want to disable gzip header and + trailer creation by deflate(). NO_GZIP would be used to avoid linking in + the crc code when it is not needed. For shared libraries, gzip encoding + should be left enabled. */ +#ifndef NO_GZIP +# define GZIP +#endif + +/* =========================================================================== + * Internal compression state. + */ + +#define LENGTH_CODES 29 +/* number of length codes, not counting the special END_BLOCK code */ + +#define LITERALS 256 +/* number of literal bytes 0..255 */ + +#define L_CODES (LITERALS+1+LENGTH_CODES) +/* number of Literal or Length codes, including the END_BLOCK code */ + +#define D_CODES 30 +/* number of distance codes */ + +#define BL_CODES 19 +/* number of codes used to transfer the bit lengths */ + +#define HEAP_SIZE (2*L_CODES+1) +/* maximum heap size */ + +#define MAX_BITS 15 +/* All codes must not exceed MAX_BITS bits */ + +#define Buf_size 16 +/* size of bit buffer in bi_buf */ + +#define INIT_STATE 42 +#define EXTRA_STATE 69 +#define NAME_STATE 73 +#define COMMENT_STATE 91 +#define HCRC_STATE 103 +#define BUSY_STATE 113 +#define FINISH_STATE 666 +/* Stream status */ + + +/* Data structure describing a single value and its code string. */ +typedef struct ct_data_s { + union { + ush freq; /* frequency count */ + ush code; /* bit string */ + } fc; + union { + ush dad; /* father node in Huffman tree */ + ush len; /* length of bit string */ + } dl; +} FAR ct_data; + +#define Freq fc.freq +#define Code fc.code +#define Dad dl.dad +#define Len dl.len + +typedef struct static_tree_desc_s static_tree_desc; + +typedef struct tree_desc_s { + ct_data *dyn_tree; /* the dynamic tree */ + int max_code; /* largest code with non zero frequency */ + static_tree_desc *stat_desc; /* the corresponding static tree */ +} FAR tree_desc; + +typedef ush Pos; +typedef Pos FAR Posf; +typedef unsigned IPos; + +/* A Pos is an index in the character window. We use short instead of int to + * save space in the various tables. IPos is used only for parameter passing. + */ + +typedef struct internal_state_deflate { + z_streamp strm; /* pointer back to this zlib stream */ + int status; /* as the name implies */ + Bytef *pending_buf; /* output still pending */ + ulg pending_buf_size; /* size of pending_buf */ + Bytef *pending_out; /* next pending byte to output to the stream */ + uInt pending; /* nb of bytes in the pending buffer */ + int wrap; /* bit 0 true for zlib, bit 1 true for gzip */ + gz_headerp gzhead; /* gzip header information to write */ + uInt gzindex; /* where in extra, name, or comment */ + Byte method; /* can only be DEFLATED */ + int last_flush; /* value of flush param for previous deflate call */ + + /* used by deflate.c: */ + + uInt w_size; /* LZ77 window size (32K by default) */ + uInt w_bits; /* log2(w_size) (8..16) */ + uInt w_mask; /* w_size - 1 */ + + Bytef *window; + /* Sliding window. Input bytes are read into the second half of the window, + * and move to the first half later to keep a dictionary of at least wSize + * bytes. With this organization, matches are limited to a distance of + * wSize-MAX_MATCH bytes, but this ensures that IO is always + * performed with a length multiple of the block size. Also, it limits + * the window size to 64K, which is quite useful on MSDOS. + * To do: use the user input buffer as sliding window. + */ + + ulg window_size; + /* Actual size of window: 2*wSize, except when the user input buffer + * is directly used as sliding window. + */ + + Posf *prev; + /* Link to older string with same hash index. To limit the size of this + * array to 64K, this link is maintained only for the last 32K strings. + * An index in this array is thus a window index modulo 32K. + */ + + Posf *head; /* Heads of the hash chains or NIL. */ + + uInt ins_h; /* hash index of string to be inserted */ + uInt hash_size; /* number of elements in hash table */ + uInt hash_bits; /* log2(hash_size) */ + uInt hash_mask; /* hash_size-1 */ + + uInt hash_shift; + /* Number of bits by which ins_h must be shifted at each input + * step. It must be such that after MIN_MATCH steps, the oldest + * byte no longer takes part in the hash key, that is: + * hash_shift * MIN_MATCH >= hash_bits + */ + + long block_start; + /* Window position at the beginning of the current output block. Gets + * negative when the window is moved backwards. + */ + + uInt match_length; /* length of best match */ + IPos prev_match; /* previous match */ + int match_available; /* set if previous match exists */ + uInt strstart; /* start of string to insert */ + uInt match_start; /* start of matching string */ + uInt lookahead; /* number of valid bytes ahead in window */ + + uInt prev_length; + /* Length of the best match at previous step. Matches not greater than this + * are discarded. This is used in the lazy match evaluation. + */ + + uInt max_chain_length; + /* To speed up deflation, hash chains are never searched beyond this + * length. A higher limit improves compression ratio but degrades the + * speed. + */ + + uInt max_lazy_match; + /* Attempt to find a better match only when the current match is strictly + * smaller than this value. This mechanism is used only for compression + * levels >= 4. + */ +# define max_insert_length max_lazy_match + /* Insert new strings in the hash table only if the match length is not + * greater than this length. This saves time but degrades compression. + * max_insert_length is used only for compression levels <= 3. + */ + + int level; /* compression level (1..9) */ + int strategy; /* favor or force Huffman coding*/ + + uInt good_match; + /* Use a faster search when the previous match is longer than this */ + + int nice_match; /* Stop searching when current match exceeds this */ + + /* used by trees.c: */ + /* Didn't use ct_data typedef below to suppress compiler warning */ + struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */ + struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */ + struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */ + + struct tree_desc_s l_desc; /* desc. for literal tree */ + struct tree_desc_s d_desc; /* desc. for distance tree */ + struct tree_desc_s bl_desc; /* desc. for bit length tree */ + + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */ + int heap_len; /* number of elements in the heap */ + int heap_max; /* element of largest frequency */ + /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used. + * The same heap array is used to build all trees. + */ + + uch depth[2*L_CODES+1]; + /* Depth of each subtree used as tie breaker for trees of equal frequency + */ + + uchf *l_buf; /* buffer for literals or lengths */ + + uInt lit_bufsize; + /* Size of match buffer for literals/lengths. There are 4 reasons for + * limiting lit_bufsize to 64K: + * - frequencies can be kept in 16 bit counters + * - if compression is not successful for the first block, all input + * data is still in the window so we can still emit a stored block even + * when input comes from standard input. (This can also be done for + * all blocks if lit_bufsize is not greater than 32K.) + * - if compression is not successful for a file smaller than 64K, we can + * even emit a stored file instead of a stored block (saving 5 bytes). + * This is applicable only for zip (not gzip or zlib). + * - creating new Huffman trees less frequently may not provide fast + * adaptation to changes in the input data statistics. (Take for + * example a binary file with poorly compressible code followed by + * a highly compressible string table.) Smaller buffer sizes give + * fast adaptation but have of course the overhead of transmitting + * trees more frequently. + * - I can't count above 4 + */ + + uInt last_lit; /* running index in l_buf */ + + ushf *d_buf; + /* Buffer for distances. To simplify the code, d_buf and l_buf have + * the same number of elements. To use different lengths, an extra flag + * array would be necessary. + */ + + ulg opt_len; /* bit length of current block with optimal trees */ + ulg static_len; /* bit length of current block with static trees */ + uInt matches; /* number of string matches in current block */ + uInt insert; /* bytes at end of window left to insert */ + +#ifdef DEBUG + ulg compressed_len; /* total bit length of compressed file mod 2^32 */ + ulg bits_sent; /* bit length of compressed data sent mod 2^32 */ +#endif + + ush bi_buf; + /* Output buffer. bits are inserted starting at the bottom (least + * significant bits). + */ + int bi_valid; + /* Number of valid bits in bi_buf. All bits above the last valid bit + * are always zero. + */ + + ulg high_water; + /* High water mark offset in window for initialized bytes -- bytes above + * this are set to zero in order to avoid memory check warnings when + * longest match routines access bytes past the input. This is then + * updated to the new high water mark. + */ + +} deflate_state; + +/* Output a byte on the stream. + * IN assertion: there is enough room in pending_buf. + */ +#define put_byte(s, c) {s->pending_buf[s->pending++] = (c);} + + +#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1) +/* Minimum amount of lookahead, except at the end of the input file. + * See deflate.c for comments about the MIN_MATCH+1. + */ + +#define MAX_DIST(s) ((s)->w_size-MIN_LOOKAHEAD) +/* In order to simplify the code, particularly on 16 bit machines, match + * distances are limited to MAX_DIST instead of WSIZE. + */ + +#define WIN_INIT MAX_MATCH +/* Number of bytes after end of data in window to initialize in order to avoid + memory checker errors from longest match routines */ + + /* in trees.c */ +void ZLIB_INTERNAL _tr_init OF((deflate_state *s)); +int ZLIB_INTERNAL _tr_tally OF((deflate_state *s, unsigned dist, unsigned lc)); +void ZLIB_INTERNAL _tr_flush_block OF((deflate_state *s, charf *buf, + ulg stored_len, int last)); +void ZLIB_INTERNAL _tr_flush_bits OF((deflate_state *s)); +void ZLIB_INTERNAL _tr_align OF((deflate_state *s)); +void ZLIB_INTERNAL _tr_stored_block OF((deflate_state *s, charf *buf, + ulg stored_len, int last)); + +#define d_code(dist) \ + ((dist) < 256 ? _dist_code[dist] : _dist_code[256+((dist)>>7)]) +/* Mapping from a distance to a distance code. dist is the distance - 1 and + * must not have side effects. _dist_code[256] and _dist_code[257] are never + * used. + */ + +#ifndef DEBUG +/* Inline versions of _tr_tally for speed: */ + +#if defined(GEN_TREES_H) || !defined(STDC) + extern uch ZLIB_INTERNAL _length_code[]; + extern uch ZLIB_INTERNAL _dist_code[]; +#else + extern const uch ZLIB_INTERNAL _length_code[]; + extern const uch ZLIB_INTERNAL _dist_code[]; +#endif + +# define _tr_tally_lit(s, c, flush) \ + { uch cc = (c); \ + s->d_buf[s->last_lit] = 0; \ + s->l_buf[s->last_lit++] = cc; \ + s->dyn_ltree[cc].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +# define _tr_tally_dist(s, distance, length, flush) \ + { uch len = (length); \ + ush dist = (distance); \ + s->d_buf[s->last_lit] = dist; \ + s->l_buf[s->last_lit++] = len; \ + dist--; \ + s->dyn_ltree[_length_code[len]+LITERALS+1].Freq++; \ + s->dyn_dtree[d_code(dist)].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +#else +# define _tr_tally_lit(s, c, flush) flush = _tr_tally(s, 0, c) +# define _tr_tally_dist(s, distance, length, flush) \ + flush = _tr_tally(s, distance, length) +#endif + +#endif /* DEFLATE_H */ diff --git a/deps/gzclose.c b/deps/gzclose.c new file mode 100644 index 0000000..edeee03 --- /dev/null +++ b/deps/gzclose.c @@ -0,0 +1,27 @@ +/* gzclose.c -- zlib gzclose() function + * Copyright (C) 2004, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +extern int gzclose_w(gzFile file); +extern int gzclose_r(gzFile file); + +/* gzclose() is in a separate file so that it is linked in only if it is used. + That way the other gzclose functions can be used instead to avoid linking in + unneeded compression or decompression routines. */ +int gzclose(gzFile file) +{ +#ifndef NO_GZCOMPRESS + gz_statep state; + + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + return state->mode == GZ_READ ? gzclose_r(file) : gzclose_w(file); +#else + return gzclose_r(file); +#endif +} diff --git a/deps/gzfile.h b/deps/gzfile.h new file mode 100644 index 0000000..2df4842 --- /dev/null +++ b/deps/gzfile.h @@ -0,0 +1,12 @@ + +#ifndef _GZFILE_H +#define _GZFILE_H + +struct gzFile_s +{ + unsigned have; + unsigned char *next; + z_off64_t pos; +}; + +#endif diff --git a/deps/gzguts.h b/deps/gzguts.h new file mode 100644 index 0000000..6068d41 --- /dev/null +++ b/deps/gzguts.h @@ -0,0 +1,222 @@ +/* gzguts.h -- zlib internal header definitions for gz* operations + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#ifndef _GZGUTS_H +#define _GZGUTS_H + +#ifdef _LARGEFILE64_SOURCE +# ifndef _LARGEFILE_SOURCE +# define _LARGEFILE_SOURCE 1 +# endif +# ifdef _FILE_OFFSET_BITS +# undef _FILE_OFFSET_BITS +# endif +#endif + +#ifdef HAVE_HIDDEN +# define ZLIB_INTERNAL __attribute__((visibility ("hidden"))) +#else +# define ZLIB_INTERNAL +#endif + +#include <stdio.h> +#include "zlib.h" +#ifdef STDC +# include <string.h> +# include <stdlib.h> +# include <limits.h> +#endif +#include <fcntl.h> + +#ifdef _WIN32 +# include <stddef.h> +#else +# include <unistd.h> +#endif + +#if defined(__TURBOC__) || defined(_MSC_VER) || defined(_WIN32) +# include <io.h> +#endif + +#ifdef WINAPI_FAMILY +# define open _open +# define read _read +# define write _write +# define close _close +#endif + +#ifdef NO_DEFLATE /* for compatibility with old definition */ +# define NO_GZCOMPRESS +#endif + +#if defined(STDC99) || (defined(__TURBOC__) && __TURBOC__ >= 0x550) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#if defined(__CYGWIN__) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#if defined(MSDOS) && defined(__BORLANDC__) && (BORLANDC > 0x410) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#ifndef HAVE_VSNPRINTF +# ifdef MSDOS +/* vsnprintf may exist on some MS-DOS compilers (DJGPP?), + but for now we just assume it doesn't. */ +# define NO_vsnprintf +# endif +# ifdef __TURBOC__ +# define NO_vsnprintf +# endif +# ifdef WIN32 +/* In Win32, vsnprintf is available as the "non-ANSI" _vsnprintf. */ +# if !defined(vsnprintf) && !defined(NO_vsnprintf) +# if !defined(_MSC_VER) || ( defined(_MSC_VER) && _MSC_VER < 1500 ) +# define vsnprintf _vsnprintf +# endif +# endif +# endif +# ifdef __SASC +# define NO_vsnprintf +# endif +# ifdef VMS +# define NO_vsnprintf +# endif +# ifdef __OS400__ +# define NO_vsnprintf +# endif +# ifdef __MVS__ +# define NO_vsnprintf +# endif +#endif + +/* unlike snprintf (which is required in C99, yet still not supported by + Microsoft more than a decade later!), _snprintf does not guarantee null + termination of the result -- however this is only used in gzlib.c where + the result is assured to fit in the space provided */ +#ifdef _MSC_VER +# define snprintf _snprintf +#endif + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +/* gz* functions always use library allocation functions */ +#ifndef STDC + extern voidp malloc OF((uInt size)); + extern void free OF((voidpf ptr)); +#endif + +/* get errno and strerror definition */ +#if defined UNDER_CE +# include <windows.h> +# define zstrerror() gz_strwinerror((DWORD)GetLastError()) +#else +# ifndef NO_STRERROR +# include <errno.h> +# define zstrerror() strerror(errno) +# else +# define zstrerror() "stdio error (consult errno)" +# endif +#endif + +/* provide prototypes for these when building zlib without LFS */ +#if !defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0 +#ifndef z_off64_t +#define z_off64_t z_off_t +#endif + + gzFile gzopen64 OF((const char *, const char *)); + z_off64_t gzseek64 OF((gzFile, z_off64_t, int)); + z_off64_t gztell64 OF((gzFile)); + z_off64_t gzoffset64 OF((gzFile)); +#endif + +/* default memLevel */ +#if MAX_MEM_LEVEL >= 8 +# define DEF_MEM_LEVEL 8 +#else +# define DEF_MEM_LEVEL MAX_MEM_LEVEL +#endif + +/* default i/o buffer size -- double this for output when reading (this and + twice this must be able to fit in an unsigned type) */ +#define GZBUFSIZE 8192 + +/* gzip modes, also provide a little integrity check on the passed structure */ +#define GZ_NONE 0 +#define GZ_READ 7247 +#define GZ_WRITE 31153 +#define GZ_APPEND 1 /* mode set to GZ_WRITE after the file is opened */ + +/* values for gz_state how */ +#define LOOK 0 /* look for a gzip header */ +#define MODE_COPY 1 /* copy input directly */ +#define MODE_GZIP 2 /* decompress a gzip stream */ + +#include "gzfile.h" + +/* internal gzip file state data structure */ +typedef struct { + /* exposed contents for gzgetc() macro */ + struct gzFile_s x; /* "x" for exposed */ + /* x.have: number of bytes available at x.next */ + /* x.next: next output data to deliver or write */ + /* x.pos: current position in uncompressed data */ + /* used for both reading and writing */ + int mode; /* see gzip modes above */ + int fd; /* file descriptor */ + char *path; /* path or fd for error messages */ + unsigned size; /* buffer size, zero if not allocated yet */ + unsigned want; /* requested buffer size, default is GZBUFSIZE */ + unsigned char *in; /* input buffer */ + unsigned char *out; /* output buffer (double-sized when reading) */ + int direct; /* 0 if processing gzip, 1 if transparent */ + /* just for reading */ + int how; /* 0: get header, 1: copy, 2: decompress */ + z_off64_t start; /* where the gzip data started, for rewinding */ + int eof; /* true if end of input file reached */ + int past; /* true if read requested past end */ + /* just for writing */ + int level; /* compression level */ + int strategy; /* compression strategy */ + /* seek request */ + z_off64_t skip; /* amount to skip (already rewound if backwards) */ + int seek; /* true if seek request pending */ + /* error information */ + int err; /* error code */ + char *msg; /* error message */ + /* zlib inflate or deflate stream */ + z_stream strm; /* stream structure in-place (not a pointer) */ +} gz_state; +typedef gz_state FAR *gz_statep; + +/* shared functions */ +void ZLIB_INTERNAL gz_error OF((gz_statep, int, const char *)); +#if defined UNDER_CE +char ZLIB_INTERNAL *gz_strwinerror OF((DWORD error)); +#endif + +/* GT_OFF(x), where x is an unsigned value, is true if x > maximum z_off64_t + value -- needed when comparing unsigned to z_off64_t, which is signed + (possible z_off64_t types off_t, off64_t, and long are all signed) */ +#ifdef INT_MAX +# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > INT_MAX) +#else +unsigned ZLIB_INTERNAL gz_intmax OF((void)); +# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > gz_intmax()) +#endif + +#endif diff --git a/deps/gzlib.c b/deps/gzlib.c new file mode 100644 index 0000000..7443a75 --- /dev/null +++ b/deps/gzlib.c @@ -0,0 +1,604 @@ +/* gzlib.c -- zlib functions common to reading and writing gzip files + * Copyright (C) 2004, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +#if defined(_WIN32) && !defined(__BORLANDC__) +# define LSEEK _lseeki64 +#else +#if defined(_LARGEFILE64_SOURCE) && _LFS64_LARGEFILE-0 +# define LSEEK lseek64 +#else +# define LSEEK lseek +#endif +#endif + +/* Forward declarations */ +z_off_t ZEXPORT gzoffset(gzFile file); +int ZEXPORT gzbuffer(gzFile file, unsigned size); + +/* Local functions */ +local void gz_reset OF((gz_statep)); +local gzFile gz_open OF((const void *, int, const char *)); + +#if defined UNDER_CE + +/* Map the Windows error number in ERROR to a locale-dependent error message + string and return a pointer to it. Typically, the values for ERROR come + from GetLastError. + + The string pointed to shall not be modified by the application, but may be + overwritten by a subsequent call to gz_strwinerror + + The gz_strwinerror function does not change the current setting of + GetLastError. */ +char ZLIB_INTERNAL *gz_strwinerror (error) + DWORD error; +{ + static char buf[1024]; + + wchar_t *msgbuf; + DWORD lasterr = GetLastError(); + DWORD chars = FormatMessage(FORMAT_MESSAGE_FROM_SYSTEM + | FORMAT_MESSAGE_ALLOCATE_BUFFER, + NULL, + error, + 0, /* Default language */ + (LPVOID)&msgbuf, + 0, + NULL); + if (chars != 0) { + /* If there is an \r\n appended, zap it. */ + if (chars >= 2 + && msgbuf[chars - 2] == '\r' && msgbuf[chars - 1] == '\n') { + chars -= 2; + msgbuf[chars] = 0; + } + + if (chars > sizeof (buf) - 1) { + chars = sizeof (buf) - 1; + msgbuf[chars] = 0; + } + + wcstombs(buf, msgbuf, chars + 1); + LocalFree(msgbuf); + } + else { + sprintf(buf, "unknown win32 error (%ld)", error); + } + + SetLastError(lasterr); + return buf; +} + +#endif /* UNDER_CE */ + +/* Reset gzip file state */ +local void gz_reset(gz_statep state) +{ + state->x.have = 0; /* no output data available */ + if (state->mode == GZ_READ) { /* for reading ... */ + state->eof = 0; /* not at end of file */ + state->past = 0; /* have not read past end yet */ + state->how = LOOK; /* look for gzip header */ + } + state->seek = 0; /* no seek request pending */ + gz_error(state, Z_OK, NULL); /* clear error */ + state->x.pos = 0; /* no uncompressed data yet */ + state->strm.avail_in = 0; /* no input data yet */ +} + +/* Open a gzip file either by name or file descriptor. */ +local gzFile gz_open(const void *path, int fd, const char *mode) +{ + gz_statep state; + size_t len; + int oflag; +#ifdef O_CLOEXEC + int cloexec = 0; +#endif +#ifdef O_EXCL + int exclusive = 0; +#endif + + /* check input */ + if (path == NULL) + return NULL; + + /* allocate gzFile structure to return */ + state = (gz_statep)malloc(sizeof(gz_state)); + if (state == NULL) + return NULL; + state->size = 0; /* no buffers allocated yet */ + state->want = GZBUFSIZE; /* requested buffer size */ + state->msg = NULL; /* no error message yet */ + + /* interpret mode */ + state->mode = GZ_NONE; + state->level = Z_DEFAULT_COMPRESSION; + state->strategy = Z_DEFAULT_STRATEGY; + state->direct = 0; + while (*mode) { + if (*mode >= '0' && *mode <= '9') + state->level = *mode - '0'; + else + switch (*mode) { + case 'r': + state->mode = GZ_READ; + break; +#ifndef NO_GZCOMPRESS + case 'w': + state->mode = GZ_WRITE; + break; + case 'a': + state->mode = GZ_APPEND; + break; +#endif + case '+': /* can't read and write at the same time */ + free(state); + return NULL; + case 'b': /* ignore -- will request binary anyway */ + break; +#ifdef O_CLOEXEC + case 'e': + cloexec = 1; + break; +#endif +#ifdef O_EXCL + case 'x': + exclusive = 1; + break; +#endif + case 'f': + state->strategy = Z_FILTERED; + break; + case 'h': + state->strategy = Z_HUFFMAN_ONLY; + break; + case 'R': + state->strategy = Z_RLE; + break; + case 'F': + state->strategy = Z_FIXED; + break; + case 'T': + state->direct = 1; + break; + default: /* could consider as an error, but just ignore */ + ; + } + mode++; + } + + /* must provide an "r", "w", or "a" */ + if (state->mode == GZ_NONE) { + free(state); + return NULL; + } + + /* can't force transparent read */ + if (state->mode == GZ_READ) { + if (state->direct) { + free(state); + return NULL; + } + state->direct = 1; /* for empty file */ + } + + /* save the path name for error messages */ +#ifdef _WIN32 + if (fd == -2) { + len = wcstombs(NULL, (const wchar_t*)path, 0); + if (len == (size_t)-1) + len = 0; + } + else +#endif + len = strlen((const char *)path); + state->path = (char *)malloc(len + 1); + if (state->path == NULL) { + free(state); + return NULL; + } +#ifdef _WIN32 + if (fd == -2) + if (len) + wcstombs(state->path, (const wchar_t*)path, len + 1); + else + *(state->path) = 0; + else +#endif +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(state->path, len + 1, "%s", (const char *)path); +#else + strlcpy(state->path, path, sizeof(state->path)); +#endif + + /* compute the flags for open() */ + oflag = +#ifdef O_LARGEFILE + O_LARGEFILE | +#endif +#ifdef O_BINARY + O_BINARY | +#endif +#ifdef O_CLOEXEC + (cloexec ? O_CLOEXEC : 0) | +#endif + (state->mode == GZ_READ ? + O_RDONLY : + (O_WRONLY | O_CREAT | +#ifdef O_EXCL + (exclusive ? O_EXCL : 0) | +#endif + (state->mode == GZ_WRITE ? + O_TRUNC : + O_APPEND))); + + /* open the file with the appropriate flags (or just use fd) */ + state->fd = fd > -1 ? fd : ( +#ifdef _WIN32 + fd == -2 ? _wopen((const wchar_t*)path, oflag, 0666) : +#endif + open((const char *)path, oflag, 0666)); + if (state->fd == -1) { + free(state->path); + free(state); + return NULL; + } + if (state->mode == GZ_APPEND) + state->mode = GZ_WRITE; /* simplify later checks */ + + /* save the current position for rewinding (only if reading) */ + if (state->mode == GZ_READ) { + state->start = LSEEK(state->fd, 0, SEEK_CUR); + if (state->start == -1) state->start = 0; + } + + /* initialize stream */ + gz_reset(state); + + /* return stream */ + return (gzFile)state; +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzopen(const char *path, const char *mode) +{ + return gz_open(path, -1, mode); +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzopen64(const char *path, const char *mode) +{ + return gz_open(path, -1, mode); +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzdopen(int fd, const char *mode) +{ + char *path; /* identifier for error messages */ + gzFile gz; + + if (fd == -1 || (path = (char *)malloc(7 + 3 * sizeof(int))) == NULL) + return NULL; +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(path, 7 + 3 * sizeof(int), "<fd:%d>", fd); /* for debugging */ +#else + sprintf(path, "<fd:%d>", fd); /* for debugging */ +#endif + gz = gz_open(path, fd, mode); + free(path); + return gz; +} + +/* -- see zlib.h -- */ +#ifdef _WIN32 +gzFile ZEXPORT gzopen_w(const wchar_t *path, const char *mode) +{ + return gz_open(path, -2, mode); +} +#endif + +/* -- see zlib.h -- */ +int ZEXPORT gzbuffer(gzFile file, unsigned size) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* make sure we haven't already allocated memory */ + if (state->size != 0) + return -1; + + /* check and set requested size */ + if (size < 2) + size = 2; /* need two bytes to check magic header */ + state->want = size; + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzrewind(gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* back up and start over */ + if (LSEEK(state->fd, state->start, SEEK_SET) == -1) + return -1; + gz_reset(state); + return 0; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gzseek64(gzFile file, z_off64_t offset, int whence) +{ + unsigned n; + z_off64_t ret; + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* check that there's no error */ + if (state->err != Z_OK && state->err != Z_BUF_ERROR) + return -1; + + /* can only seek from start or relative to current position */ + if (whence != SEEK_SET && whence != SEEK_CUR) + return -1; + + /* normalize offset to a SEEK_CUR specification */ + if (whence == SEEK_SET) + offset -= state->x.pos; + else if (state->seek) + offset += state->skip; + state->seek = 0; + + /* if within raw area while reading, just go there */ + if (state->mode == GZ_READ && state->how == MODE_COPY && + state->x.pos + offset >= 0) { + ret = LSEEK(state->fd, offset - state->x.have, SEEK_CUR); + if (ret == -1) + return -1; + state->x.have = 0; + state->eof = 0; + state->past = 0; + state->seek = 0; + gz_error(state, Z_OK, NULL); + state->strm.avail_in = 0; + state->x.pos += offset; + return state->x.pos; + } + + /* calculate skip amount, rewinding if needed for back seek when reading */ + if (offset < 0) { + if (state->mode != GZ_READ) /* writing -- can't go backwards */ + return -1; + offset += state->x.pos; + if (offset < 0) /* before start of file! */ + return -1; + if (gzrewind(file) == -1) /* rewind, then skip to offset */ + return -1; + } + + /* if reading, skip what's in output buffer (one less gzgetc() check) */ + if (state->mode == GZ_READ) { + n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > offset ? + (unsigned)offset : state->x.have; + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + offset -= n; + } + + /* request skip (if not zero) */ + if (offset) { + state->seek = 1; + state->skip = offset; + } + return state->x.pos + offset; +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gzseek(gzFile file, z_off_t offset, int whence) +{ + z_off64_t ret; + + ret = gzseek64(file, (z_off64_t)offset, whence); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gztell64(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* return position */ + return state->x.pos + (state->seek ? state->skip : 0); +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gztell(gzFile file) +{ + z_off64_t ret; + + ret = gztell64(file); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gzoffset64(gzFile file) +{ + z_off64_t offset; + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* compute and return effective offset in file */ + offset = LSEEK(state->fd, 0, SEEK_CUR); + if (offset == -1) + return -1; + if (state->mode == GZ_READ) /* reading */ + offset -= state->strm.avail_in; /* don't count buffered input */ + return offset; +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gzoffset(gzFile file) +{ + z_off64_t ret = gzoffset64(file); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzeof(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return 0; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return 0; + + /* return end-of-file state */ + return state->mode == GZ_READ ? state->past : 0; +} + +/* -- see zlib.h -- */ +const char * ZEXPORT gzerror(gzFile file, int *errnum) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return NULL; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return NULL; + + /* return error information */ + if (errnum != NULL) + *errnum = state->err; + return state->err == Z_MEM_ERROR ? "out of memory" : + (state->msg == NULL ? "" : state->msg); +} + +/* -- see zlib.h -- */ +void ZEXPORT gzclearerr(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return; + + /* clear error and end-of-file */ + if (state->mode == GZ_READ) { + state->eof = 0; + state->past = 0; + } + gz_error(state, Z_OK, NULL); +} + +/* Create an error message in allocated memory and set state->err and + state->msg accordingly. Free any previous error message already there. Do + not try to free or allocate space if the error is Z_MEM_ERROR (out of + memory). Simply save the error message as a static string. If there is an + allocation failure constructing the error message, then convert the error to + out of memory. */ +void ZLIB_INTERNAL gz_error(gz_statep state, int err, const char *msg) +{ + /* free previously allocated message and clear */ + if (state->msg != NULL) { + if (state->err != Z_MEM_ERROR) + free(state->msg); + state->msg = NULL; + } + + /* if fatal, set state->x.have to 0 so that the gzgetc() macro fails */ + if (err != Z_OK && err != Z_BUF_ERROR) + state->x.have = 0; + + /* set error code, and if no message, then done */ + state->err = err; + if (msg == NULL) + return; + + /* for an out of memory error, return literal string when requested */ + if (err == Z_MEM_ERROR) + return; + + /* construct error message with path */ + if ((state->msg = (char *)malloc(strlen(state->path) + strlen(msg) + 3)) == + NULL) { + state->err = Z_MEM_ERROR; + return; + } +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(state->msg, strlen(state->path) + strlen(msg) + 3, + "%s%s%s", state->path, ": ", msg); +#else + strlcpy(state->msg, state->path, sizeof(state->msg)); + strlcat(state->msg, ": ", sizeof(state->msg)); + strlcat(state->msg, msg, sizeof(state->msg)); +#endif + return; +} + +#ifndef INT_MAX +/* portably return maximum value for an int (when limits.h presumed not + available) -- we need to do this to cover cases where 2's complement not + used, since C standard permits 1's complement and sign-bit representations, + otherwise we could just use ((unsigned)-1) >> 1 */ +unsigned ZLIB_INTERNAL gz_intmax() +{ + unsigned p, q; + + p = 1; + do { + q = p; + p <<= 1; + p++; + } while (p > q); + return q >> 1; +} +#endif diff --git a/deps/gzread.c b/deps/gzread.c new file mode 100644 index 0000000..7f6ec7e --- /dev/null +++ b/deps/gzread.c @@ -0,0 +1,575 @@ +/* gzread.c -- zlib functions for reading gzip files + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +/* Local functions */ +local int gz_load OF((gz_statep, unsigned char *, unsigned, unsigned *)); +local int gz_avail OF((gz_statep)); +local int gz_look OF((gz_statep)); +local int gz_decomp OF((gz_statep)); +local int gz_fetch OF((gz_statep)); +local int gz_skip OF((gz_statep, z_off64_t)); + +int ZEXPORT gzgetc_(gzFile file); + +/* Use read() to load a buffer -- return -1 on error, otherwise 0. Read from + state->fd, and update state->eof, state->err, and state->msg as appropriate. + This function needs to loop on read(), since read() is not guaranteed to + read the number of bytes requested, depending on the type of descriptor. */ +local int gz_load(gz_statep state, unsigned char *buf, unsigned len, unsigned *have) +{ + int ret; + + *have = 0; + do { + ret = read(state->fd, buf + *have, len - *have); + if (ret <= 0) + break; + *have += ret; + } while (*have < len); + if (ret < 0) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + if (ret == 0) + state->eof = 1; + return 0; +} + +/* Load up input buffer and set eof flag if last data loaded -- return -1 on + error, 0 otherwise. Note that the eof flag is set when the end of the input + file is reached, even though there may be unused data in the buffer. Once + that data has been used, no more attempts will be made to read the file. + If strm->avail_in != 0, then the current data is moved to the beginning of + the input buffer, and then the remainder of the buffer is loaded with the + available data from the input file. */ +local int gz_avail(gz_statep state) +{ + unsigned got; + z_streamp strm = &(state->strm); + + if (state->err != Z_OK && state->err != Z_BUF_ERROR) + return -1; + if (state->eof == 0) { + if (strm->avail_in) { /* copy what's there to the start */ + unsigned char *p = state->in; + unsigned const char *q = strm->next_in; + unsigned n = strm->avail_in; + do { + *p++ = *q++; + } while (--n); + } + if (gz_load(state, state->in + strm->avail_in, + state->size - strm->avail_in, &got) == -1) + return -1; + strm->avail_in += got; + strm->next_in = state->in; + } + return 0; +} + +/* Look for gzip header, set up for inflate or copy. state->x.have must be 0. + If this is the first time in, allocate required memory. state->how will be + left unchanged if there is no more input data available, will be set to COPY + if there is no gzip header and direct copying will be performed, or it will + be set to GZIP for decompression. If direct copying, then leftover input + data from the input buffer will be copied to the output buffer. In that + case, all further file reads will be directly to either the output buffer or + a user buffer. If decompressing, the inflate state will be initialized. + gz_look() will return 0 on success or -1 on failure. */ +local int gz_look(gz_statep state) +{ + z_streamp strm = &(state->strm); + + /* allocate read buffers and inflate memory */ + if (state->size == 0) { + /* allocate buffers */ + state->in = (unsigned char *)malloc(state->want); + state->out = (unsigned char *)malloc(state->want << 1); + if (state->in == NULL || state->out == NULL) { + if (state->out != NULL) + free(state->out); + if (state->in != NULL) + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + state->size = state->want; + + /* allocate inflate memory */ + state->strm.zalloc = Z_NULL; + state->strm.zfree = Z_NULL; + state->strm.opaque = Z_NULL; + state->strm.avail_in = 0; + state->strm.next_in = Z_NULL; + if (inflateInit2(&(state->strm), 15 + 16) != Z_OK) { /* gunzip */ + free(state->out); + free(state->in); + state->size = 0; + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + } + + /* get at least the magic bytes in the input buffer */ + if (strm->avail_in < 2) { + if (gz_avail(state) == -1) + return -1; + if (strm->avail_in == 0) + return 0; + } + + /* look for gzip magic bytes -- if there, do gzip decoding (note: there is + a logical dilemma here when considering the case of a partially written + gzip file, to wit, if a single 31 byte is written, then we cannot tell + whether this is a single-byte file, or just a partially written gzip + file -- for here we assume that if a gzip file is being written, then + the header will be written in a single operation, so that reading a + single byte is sufficient indication that it is not a gzip file) */ + if (strm->avail_in > 1 && + strm->next_in[0] == 31 && strm->next_in[1] == 139) { + inflateReset(strm); + state->how = MODE_GZIP; + state->direct = 0; + return 0; + } + + /* no gzip header -- if we were decoding gzip before, then this is trailing + garbage. Ignore the trailing garbage and finish. */ + if (state->direct == 0) { + strm->avail_in = 0; + state->eof = 1; + state->x.have = 0; + return 0; + } + + /* doing raw i/o, copy any leftover input to output -- this assumes that + the output buffer is larger than the input buffer, which also assures + space for gzungetc() */ + state->x.next = state->out; + if (strm->avail_in) { + memcpy(state->x.next, strm->next_in, strm->avail_in); + state->x.have = strm->avail_in; + strm->avail_in = 0; + } + state->how = MODE_COPY; + state->direct = 1; + return 0; +} + +/* Decompress from input to the provided next_out and avail_out in the state. + On return, state->x.have and state->x.next point to the just decompressed + data. If the gzip stream completes, state->how is reset to LOOK to look for + the next gzip stream or raw data, once state->x.have is depleted. Returns 0 + on success, -1 on failure. */ +local int gz_decomp(gz_statep state) +{ + int ret = Z_OK; + unsigned had; + z_streamp strm = &(state->strm); + + /* fill output buffer up to end of deflate stream */ + had = strm->avail_out; + do { + /* get more input for inflate() */ + if (strm->avail_in == 0 && gz_avail(state) == -1) + return -1; + if (strm->avail_in == 0) { + gz_error(state, Z_BUF_ERROR, "unexpected end of file"); + break; + } + + /* decompress and handle errors */ + ret = inflate(strm, Z_NO_FLUSH); + if (ret == Z_STREAM_ERROR || ret == Z_NEED_DICT) { + gz_error(state, Z_STREAM_ERROR, + "internal error: inflate stream corrupt"); + return -1; + } + if (ret == Z_MEM_ERROR) { + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + if (ret == Z_DATA_ERROR) { /* deflate stream invalid */ + gz_error(state, Z_DATA_ERROR, + strm->msg == NULL ? "compressed data error" : strm->msg); + return -1; + } + } while (strm->avail_out && ret != Z_STREAM_END); + + /* update available output */ + state->x.have = had - strm->avail_out; + state->x.next = strm->next_out - state->x.have; + + /* if the gzip stream completed successfully, look for another */ + if (ret == Z_STREAM_END) + state->how = LOOK; + + /* good decompression */ + return 0; +} + +/* Fetch data and put it in the output buffer. Assumes state->x.have is 0. + Data is either copied from the input file or decompressed from the input + file depending on state->how. If state->how is LOOK, then a gzip header is + looked for to determine whether to copy or decompress. Returns -1 on error, + otherwise 0. gz_fetch() will leave state->how as COPY or GZIP unless the + end of the input file has been reached and all data has been processed. */ +local int gz_fetch(gz_statep state) +{ + z_streamp strm = &(state->strm); + + do { + switch(state->how) { + case LOOK: /* -> LOOK, MODE_COPY (only if never GZIP), or MODE_GZIP */ + if (gz_look(state) == -1) + return -1; + if (state->how == LOOK) + return 0; + break; + case MODE_COPY: /* -> MODE_COPY */ + if (gz_load(state, state->out, state->size << 1, &(state->x.have)) + == -1) + return -1; + state->x.next = state->out; + return 0; + case MODE_GZIP: /* -> GZIP or LOOK (if end of gzip stream) */ + strm->avail_out = state->size << 1; + strm->next_out = state->out; + if (gz_decomp(state) == -1) + return -1; + } + } while (state->x.have == 0 && (!state->eof || strm->avail_in)); + return 0; +} + +/* Skip len uncompressed bytes of output. Return -1 on error, 0 on success. */ +local int gz_skip(gz_statep state, z_off64_t len) +{ + unsigned n; + + /* skip over len bytes or reach end-of-file, whichever comes first */ + while (len) + /* skip over whatever is in output buffer */ + if (state->x.have) { + n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > len ? + (unsigned)len : state->x.have; + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + len -= n; + } + + /* output buffer empty -- return if we're at the end of the input */ + else if (state->eof && state->strm.avail_in == 0) + break; + + /* need more data to skip -- load up output buffer */ + else { + /* get more output, looking for header if required */ + if (gz_fetch(state) == -1) + return -1; + } + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzread(gzFile file, voidp buf, unsigned len) +{ + unsigned got, n; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* since an int is returned, make sure len fits in one, otherwise return + with an error (this avoids the flaw in the interface) */ + if ((int)len < 0) { + gz_error(state, Z_DATA_ERROR, "requested length does not fit in int"); + return -1; + } + + /* if len is zero, avoid unnecessary operations */ + if (len == 0) + return 0; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return -1; + } + + /* get len bytes to buf, or less than len if at the end */ + got = 0; + n = 0; + do { + /* first just try copying data from the output buffer */ + if (state->x.have) { + n = state->x.have > len ? len : state->x.have; + memcpy(buf, state->x.next, n); + state->x.next += n; + state->x.have -= n; + } + + /* output buffer empty -- return if we're at the end of the input */ + else if (state->eof && strm->avail_in == 0) { + state->past = 1; /* tried to read past end */ + break; + } + + /* need output data -- for small len or new stream load up our output + buffer */ + else if (state->how == LOOK || len < (state->size << 1)) { + /* get more output, looking for header if required */ + if (gz_fetch(state) == -1) + return -1; + continue; /* no progress yet -- go back to copy above */ + /* the copy above assures that we will leave with space in the + output buffer, allowing at least one gzungetc() to succeed */ + } + + /* large len -- read directly into user buffer */ + else if (state->how == MODE_COPY) { /* read directly */ + if (gz_load(state, (unsigned char *)buf, len, &n) == -1) + return -1; + } + + /* large len -- decompress directly into user buffer */ + else { /* state->how == GZIP */ + strm->avail_out = len; + strm->next_out = (unsigned char *)buf; + if (gz_decomp(state) == -1) + return -1; + n = state->x.have; + state->x.have = 0; + } + + /* update progress */ + len -= n; + buf = (char *)buf + n; + got += n; + state->x.pos += n; + } while (len); + + /* return number of bytes read into user buffer (will fit in int) */ + return (int)got; +} + +/* -- see zlib.h -- */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +#else +# undef gzgetc +#endif +int ZEXPORT gzgetc(gzFile file) +{ + int ret; + unsigned char buf[1]; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* try output buffer (no need to check for skip request) */ + if (state->x.have) { + state->x.have--; + state->x.pos++; + return *(state->x.next)++; + } + + /* nothing there -- try gzread() */ + ret = gzread(file, buf, 1); + return ret < 1 ? -1 : buf[0]; +} + +int ZEXPORT gzgetc_(gzFile file) +{ + return gzgetc(file); +} + +/* -- see zlib.h -- */ +int ZEXPORT gzungetc(int c, gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return -1; + } + + /* can't push EOF */ + if (c < 0) + return -1; + + /* if output buffer empty, put byte at end (allows more pushing) */ + if (state->x.have == 0) { + state->x.have = 1; + state->x.next = state->out + (state->size << 1) - 1; + state->x.next[0] = c; + state->x.pos--; + state->past = 0; + return c; + } + + /* if no room, give up (must have already done a gzungetc()) */ + if (state->x.have == (state->size << 1)) { + gz_error(state, Z_DATA_ERROR, "out of room to push characters"); + return -1; + } + + /* slide output data if needed and insert byte before existing data */ + if (state->x.next == state->out) { + unsigned char *src = state->out + state->x.have; + unsigned char *dest = state->out + (state->size << 1); + while (src > state->out) + *--dest = *--src; + state->x.next = dest; + } + state->x.have++; + state->x.next--; + state->x.next[0] = c; + state->x.pos--; + state->past = 0; + return c; +} + +/* -- see zlib.h -- */ +char * ZEXPORT gzgets(gzFile file, char *buf, int len) +{ + unsigned left, n; + char *str; + unsigned char *eol; + gz_statep state; + + /* check parameters and get internal structure */ + if (file == NULL || buf == NULL || len < 1) + return NULL; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return NULL; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return NULL; + } + + /* copy output bytes up to new line or len - 1, whichever comes first -- + append a terminating zero to the string (we don't check for a zero in + the contents, let the user worry about that) */ + str = buf; + left = (unsigned)len - 1; + if (left) do { + /* assure that something is in the output buffer */ + if (state->x.have == 0 && gz_fetch(state) == -1) + return NULL; /* error */ + if (state->x.have == 0) { /* end of file */ + state->past = 1; /* read past end */ + break; /* return what we have */ + } + + /* look for end-of-line in current output buffer */ + n = state->x.have > left ? left : state->x.have; + eol = (unsigned char *)memchr(state->x.next, '\n', n); + if (eol != NULL) + n = (unsigned)(eol - state->x.next) + 1; + + /* copy through end-of-line, or remainder if not found */ + memcpy(buf, state->x.next, n); + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + left -= n; + buf += n; + } while (left && eol == NULL); + + /* return terminated string, or if nothing, end of file */ + if (buf == str) + return NULL; + buf[0] = 0; + return str; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzdirect(gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return 0; + state = (gz_statep)file; + + /* if the state is not known, but we can find out, then do so (this is + mainly for right after a gzopen() or gzdopen()) */ + if (state->mode == GZ_READ && state->how == LOOK && state->x.have == 0) + (void)gz_look(state); + + /* return 1 if transparent, 0 if processing a gzip stream */ + return state->direct; +} + +/* -- see zlib.h -- */ +int gzclose_r(gzFile file) +{ + int ret, err; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + /* check that we're reading */ + if (state->mode != GZ_READ) + return Z_STREAM_ERROR; + + /* free memory and close file */ + if (state->size) { + inflateEnd(&(state->strm)); + free(state->out); + free(state->in); + } + err = state->err == Z_BUF_ERROR ? Z_BUF_ERROR : Z_OK; + gz_error(state, Z_OK, NULL); + free(state->path); + ret = close(state->fd); + free(state); + return ret ? Z_ERRNO : err; +} diff --git a/deps/gzwrite.c b/deps/gzwrite.c new file mode 100644 index 0000000..61b217e --- /dev/null +++ b/deps/gzwrite.c @@ -0,0 +1,557 @@ +/* gzwrite.c -- zlib functions for writing gzip files + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +/* Local functions */ +local int gz_init OF((gz_statep)); +local int gz_comp OF((gz_statep, int)); +local int gz_zero OF((gz_statep, z_off64_t)); + +int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va); + +/* Initialize state for writing a gzip file. Mark initialization by setting + state->size to non-zero. Return -1 on failure or 0 on success. */ +local int gz_init(gz_statep state) +{ + int ret; + z_streamp strm = &(state->strm); + + /* allocate input buffer */ + state->in = (unsigned char *)malloc(state->want); + if (state->in == NULL) { + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + + /* only need output buffer and deflate state if compressing */ + if (!state->direct) { + /* allocate output buffer */ + state->out = (unsigned char *)malloc(state->want); + if (state->out == NULL) { + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + + /* allocate deflate memory, set up for gzip compression */ + strm->zalloc = Z_NULL; + strm->zfree = Z_NULL; + strm->opaque = Z_NULL; + ret = deflateInit2(strm, state->level, Z_DEFLATED, + MAX_WBITS + 16, DEF_MEM_LEVEL, state->strategy); + if (ret != Z_OK) { + free(state->out); + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + } + + /* mark state as initialized */ + state->size = state->want; + + /* initialize write buffer if compressing */ + if (!state->direct) { + strm->avail_out = state->size; + strm->next_out = state->out; + state->x.next = strm->next_out; + } + return 0; +} + +/* Compress whatever is at avail_in and next_in and write to the output file. + Return -1 if there is an error writing to the output file, otherwise 0. + flush is assumed to be a valid deflate() flush value. If flush is Z_FINISH, + then the deflate() state is reset to start a new gzip stream. If gz->direct + is true, then simply write to the output file without compressing, and + ignore flush. */ +local int gz_comp(gz_statep state, int flush) +{ + int ret, got; + unsigned have; + z_streamp strm = &(state->strm); + + /* allocate memory if this is the first time through */ + if (state->size == 0 && gz_init(state) == -1) + return -1; + + /* write directly if requested */ + if (state->direct) { + got = write(state->fd, strm->next_in, strm->avail_in); + if (got < 0 || (unsigned)got != strm->avail_in) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + strm->avail_in = 0; + return 0; + } + + /* run deflate() on provided input until it produces no more output */ + ret = Z_OK; + do { + /* write out current buffer contents if full, or if flushing, but if + doing Z_FINISH then don't write until we get to Z_STREAM_END */ + if (strm->avail_out == 0 || (flush != Z_NO_FLUSH && + (flush != Z_FINISH || ret == Z_STREAM_END))) { + have = (unsigned)(strm->next_out - state->x.next); + if (have && ((got = write(state->fd, state->x.next, have)) < 0 || + (unsigned)got != have)) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + if (strm->avail_out == 0) { + strm->avail_out = state->size; + strm->next_out = state->out; + } + state->x.next = strm->next_out; + } + + /* compress */ + have = strm->avail_out; + ret = deflate(strm, flush); + if (ret == Z_STREAM_ERROR) { + gz_error(state, Z_STREAM_ERROR, + "internal error: deflate stream corrupt"); + return -1; + } + have -= strm->avail_out; + } while (have); + + /* if that completed a deflate stream, allow another to start */ + if (flush == Z_FINISH) + deflateReset(strm); + + /* all done, no errors */ + return 0; +} + +/* Compress len zeros to output. Return -1 on error, 0 on success. */ +local int gz_zero(gz_statep state, z_off64_t len) +{ + int first; + unsigned n; + z_streamp strm = &(state->strm); + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return -1; + + /* compress len zeros (len guaranteed > 0) */ + first = 1; + while (len) { + n = GT_OFF(state->size) || (z_off64_t)state->size > len ? + (unsigned)len : state->size; + if (first) { + memset(state->in, 0, n); + first = 0; + } + strm->avail_in = n; + strm->next_in = state->in; + state->x.pos += n; + if (gz_comp(state, Z_NO_FLUSH) == -1) + return -1; + len -= n; + } + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzwrite(gzFile file, voidpc buf, unsigned len) +{ + unsigned put = len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return 0; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* since an int is returned, make sure len fits in one, otherwise return + with an error (this avoids the flaw in the interface) */ + if ((int)len < 0) { + gz_error(state, Z_DATA_ERROR, "requested length does not fit in int"); + return 0; + } + + /* if len is zero, avoid unnecessary operations */ + if (len == 0) + return 0; + + /* allocate memory if this is the first time through */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* for small len, copy to input buffer, otherwise compress directly */ + if (len < state->size) { + /* copy to input buffer, compress when full */ + do { + unsigned have, copy; + + if (strm->avail_in == 0) + strm->next_in = state->in; + have = (unsigned)((strm->next_in + strm->avail_in) - state->in); + copy = state->size - have; + if (copy > len) + copy = len; + memcpy(state->in + have, buf, copy); + strm->avail_in += copy; + state->x.pos += copy; + buf = (const char *)buf + copy; + len -= copy; + if (len && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + } while (len); + } + else { + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* directly compress user buffer to file */ + strm->avail_in = len; + strm->next_in = (Bytef *)buf; + state->x.pos += len; + if (gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + } + + /* input was all buffered or compressed (put will fit in int) */ + return (int)put; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzputc(gzFile file, int c) +{ + unsigned have; + unsigned char buf[1]; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return -1; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* try writing to input buffer for speed (state->size == 0 if buffer not + initialized) */ + if (state->size) { + if (strm->avail_in == 0) + strm->next_in = state->in; + have = (unsigned)((strm->next_in + strm->avail_in) - state->in); + if (have < state->size) { + state->in[have] = c; + strm->avail_in++; + state->x.pos++; + return c & 0xff; + } + } + + /* no room in buffer or not initialized, use gz_write() */ + buf[0] = c; + if (gzwrite(file, buf, 1) != 1) + return -1; + return c & 0xff; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzputs(gzFile file, const char *str) +{ + int ret; + unsigned len; + + /* write string */ + len = (unsigned)strlen(str); + ret = gzwrite(file, str, len); + return ret == 0 && len != 0 ? -1 : ret; +} + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +#include <stdarg.h> + +/* -- see zlib.h -- */ +int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va) +{ + int size, len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* make sure we have some buffer space */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* do the printf() into the input buffer, put length in len */ + size = (int)(state->size); + state->in[size - 1] = 0; +#ifdef NO_vsnprintf +# ifdef HAS_vsprintf_void + (void)vsprintf((char *)(state->in), format, va); + for (len = 0; len < size; len++) + if (state->in[len] == 0) break; +# else + len = vsprintf((char *)(state->in), format, va); +# endif +#else +# ifdef HAS_vsnprintf_void + (void)vsnprintf((char *)(state->in), size, format, va); + len = strlen((char *)(state->in)); +# else + len = vsnprintf((char *)(state->in), size, format, va); +# endif +#endif + + /* check that printf() results fit in buffer */ + if (len <= 0 || len >= (int)size || state->in[size - 1] != 0) + return 0; + + /* update buffer and position, defer compression until needed */ + strm->avail_in = (unsigned)len; + strm->next_in = state->in; + state->x.pos += len; + return len; +} + +int ZEXPORTVA gzprintf(gzFile file, const char *format, ...) +{ + va_list va; + int ret; + + va_start(va, format); + ret = gzvprintf(file, format, va); + va_end(va); + return ret; +} + +#else /* !STDC && !Z_HAVE_STDARG_H */ + +/* -- see zlib.h -- */ +int ZEXPORTVA gzprintf (gzFile file, const char *format, int a1, int a2, int a3, int a4, int a5, int a6, int a7, int a8, int a9, int a10, + int a11, int a12, int a13, int a14, int a15, int a16, int a17, int a18, int a19, int a20) +{ + int size, len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that can really pass pointer in ints */ + if (sizeof(int) != sizeof(void *)) + return 0; + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* make sure we have some buffer space */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* do the printf() into the input buffer, put length in len */ + size = (int)(state->size); + state->in[size - 1] = 0; +#ifdef NO_snprintf +# ifdef HAS_sprintf_void + sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); + for (len = 0; len < size; len++) + if (state->in[len] == 0) break; +# else + len = sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); +# endif +#else +# ifdef HAS_snprintf_void + snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); + len = strlen((char *)(state->in)); +# else + len = snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6, + a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, + a19, a20); +# endif +#endif + + /* check that printf() results fit in buffer */ + if (len <= 0 || len >= (int)size || state->in[size - 1] != 0) + return 0; + + /* update buffer and position, defer compression until needed */ + strm->avail_in = (unsigned)len; + strm->next_in = state->in; + state->x.pos += len; + return len; +} + +#endif + +/* -- see zlib.h -- */ +int ZEXPORT gzflush(gzFile file, int flush) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return Z_STREAM_ERROR; + + /* check flush parameter */ + if (flush < 0 || flush > Z_FINISH) + return Z_STREAM_ERROR; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* compress remaining data with requested flush */ + gz_comp(state, flush); + return state->err; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzsetparams(gzFile file, int level, int strategy) +{ + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return Z_STREAM_ERROR; + + /* if no change is requested, then do nothing */ + if (level == state->level && strategy == state->strategy) + return Z_OK; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* change compression parameters for subsequent input */ + if (state->size) { + /* flush previous input with previous parameters before changing */ + if (strm->avail_in && gz_comp(state, Z_PARTIAL_FLUSH) == -1) + return state->err; + deflateParams(strm, level, strategy); + } + state->level = level; + state->strategy = strategy; + return Z_OK; +} + +/* -- see zlib.h -- */ +int gzclose_w(gzFile file) +{ + int ret = Z_OK; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + /* check that we're writing */ + if (state->mode != GZ_WRITE) + return Z_STREAM_ERROR; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + ret = state->err; + } + + /* flush, free memory, and close file */ + if (gz_comp(state, Z_FINISH) == -1) + ret = state->err; + if (state->size) { + if (!state->direct) { + (void)deflateEnd(&(state->strm)); + free(state->out); + } + free(state->in); + } + gz_error(state, Z_OK, NULL); + free(state->path); + if (close(state->fd) == -1) + ret = Z_ERRNO; + free(state); + return ret; +} diff --git a/deps/infback.c b/deps/infback.c new file mode 100644 index 0000000..7206cde --- /dev/null +++ b/deps/infback.c @@ -0,0 +1,628 @@ +/* infback.c -- inflate using a call-back interface + * Copyright (C) 1995-2011 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + This code is largely copied from inflate.c. Normally either infback.o or + inflate.o would be linked into an application--not both. The interface + with inffast.c is retained so that optimized assembler-coded versions of + inflate_fast() can be used with either inflate.c or infback.c. + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +/* function prototypes */ +local void fixedtables OF((struct inflate_state FAR *state)); + +/* + strm provides memory allocation functions in zalloc and zfree, or + Z_NULL to use the library memory allocation functions. + + windowBits is in the range 8..15, and window is a user-supplied + window and output buffer that is 2**windowBits bytes. + */ +int ZEXPORT inflateBackInit_(z_streamp strm, int windowBits, unsigned char FAR *window, const char *version, int stream_size) +{ + struct inflate_state FAR *state; + + if (version == Z_NULL || version[0] != ZLIB_VERSION[0] || + stream_size != (int)(sizeof(z_stream))) + return Z_VERSION_ERROR; + if (strm == Z_NULL || window == Z_NULL || + windowBits < 8 || windowBits > 15) + return Z_STREAM_ERROR; + strm->msg = Z_NULL; /* in case we return an error */ + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == Z_NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + state = (struct inflate_state FAR *)ZALLOC(strm, 1, + sizeof(struct inflate_state)); + if (state == Z_NULL) return Z_MEM_ERROR; + Tracev((stderr, "inflate: allocated\n")); + strm->state = (struct internal_state FAR *)state; + state->dmax = 32768U; + state->wbits = windowBits; + state->wsize = 1U << windowBits; + state->window = window; + state->wnext = 0; + state->whave = 0; + return Z_OK; +} + +/* + Return state with length and distance decoding tables and index sizes set to + fixed code decoding. Normally this returns fixed tables from inffixed.h. + If BUILDFIXED is defined, then instead this routine builds the tables the + first time it's called, and returns those tables the first time and + thereafter. This reduces the size of the code by about 2K bytes, in + exchange for a little execution time. However, BUILDFIXED should not be + used for threaded applications, since the rewriting of the tables and virgin + may not be thread-safe. + */ +local void fixedtables(struct inflate_state FAR *state) +{ +#ifdef BUILDFIXED + static int virgin = 1; + static code *lenfix, *distfix; + static code fixed[544]; + + /* build fixed huffman tables if first call (may not be thread safe) */ + if (virgin) { + unsigned sym, bits; + static code *next; + + /* literal/length table */ + sym = 0; + while (sym < 144) state->lens[sym++] = 8; + while (sym < 256) state->lens[sym++] = 9; + while (sym < 280) state->lens[sym++] = 7; + while (sym < 288) state->lens[sym++] = 8; + next = fixed; + lenfix = next; + bits = 9; + inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work); + + /* distance table */ + sym = 0; + while (sym < 32) state->lens[sym++] = 5; + distfix = next; + bits = 5; + inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work); + + /* do this just once */ + virgin = 0; + } +#else /* !BUILDFIXED */ +# include "inffixed.h" +#endif /* BUILDFIXED */ + state->lencode = lenfix; + state->lenbits = 9; + state->distcode = distfix; + state->distbits = 5; +} + +/* Macros for inflateBack(): */ + +/* Load returned state from inflate_fast() */ +#define LOAD() \ + do { \ + put = strm->next_out; \ + left = strm->avail_out; \ + next = strm->next_in; \ + have = strm->avail_in; \ + hold = state->hold; \ + bits = state->bits; \ + } while (0) + +/* Set state from registers for inflate_fast() */ +#define RESTORE() \ + do { \ + strm->next_out = put; \ + strm->avail_out = left; \ + strm->next_in = next; \ + strm->avail_in = have; \ + state->hold = hold; \ + state->bits = bits; \ + } while (0) + +/* Clear the input bit accumulator */ +#define INITBITS() \ + do { \ + hold = 0; \ + bits = 0; \ + } while (0) + +/* Assure that some input is available. If input is requested, but denied, + then return a Z_BUF_ERROR from inflateBack(). */ +#define PULL() \ + do { \ + if (have == 0) { \ + have = in(in_desc, &next); \ + if (have == 0) { \ + next = Z_NULL; \ + ret = Z_BUF_ERROR; \ + goto inf_leave; \ + } \ + } \ + } while (0) + +/* Get a byte of input into the bit accumulator, or return from inflateBack() + with an error if there is no input available. */ +#define PULLBYTE() \ + do { \ + PULL(); \ + have--; \ + hold += (unsigned long)(*next++) << bits; \ + bits += 8; \ + } while (0) + +/* Assure that there are at least n bits in the bit accumulator. If there is + not enough available input to do that, then return from inflateBack() with + an error. */ +#define NEEDBITS(n) \ + do { \ + while (bits < (unsigned)(n)) \ + PULLBYTE(); \ + } while (0) + +/* Return the low n bits of the bit accumulator (n < 16) */ +#define BITS(n) \ + ((unsigned)hold & ((1U << (n)) - 1)) + +/* Remove n bits from the bit accumulator */ +#define DROPBITS(n) \ + do { \ + hold >>= (n); \ + bits -= (unsigned)(n); \ + } while (0) + +/* Remove zero to seven bits as needed to go to a byte boundary */ +#define BYTEBITS() \ + do { \ + hold >>= bits & 7; \ + bits -= bits & 7; \ + } while (0) + +/* Assure that some output space is available, by writing out the window + if it's full. If the write fails, return from inflateBack() with a + Z_BUF_ERROR. */ +#define ROOM() \ + do { \ + if (left == 0) { \ + put = state->window; \ + left = state->wsize; \ + state->whave = left; \ + if (out(out_desc, put, left)) { \ + ret = Z_BUF_ERROR; \ + goto inf_leave; \ + } \ + } \ + } while (0) + +/* + strm provides the memory allocation functions and window buffer on input, + and provides information on the unused input on return. For Z_DATA_ERROR + returns, strm will also provide an error message. + + in() and out() are the call-back input and output functions. When + inflateBack() needs more input, it calls in(). When inflateBack() has + filled the window with output, or when it completes with data in the + window, it calls out() to write out the data. The application must not + change the provided input until in() is called again or inflateBack() + returns. The application must not change the window/output buffer until + inflateBack() returns. + + in() and out() are called with a descriptor parameter provided in the + inflateBack() call. This parameter can be a structure that provides the + information required to do the read or write, as well as accumulated + information on the input and output such as totals and check values. + + in() should return zero on failure. out() should return non-zero on + failure. If either in() or out() fails, than inflateBack() returns a + Z_BUF_ERROR. strm->next_in can be checked for Z_NULL to see whether it + was in() or out() that caused in the error. Otherwise, inflateBack() + returns Z_STREAM_END on success, Z_DATA_ERROR for an deflate format + error, or Z_MEM_ERROR if it could not allocate memory for the state. + inflateBack() can also return Z_STREAM_ERROR if the input parameters + are not correct, i.e. strm is Z_NULL or the state was not initialized. + */ +int ZEXPORT inflateBack(z_streamp strm, in_func in, void FAR *in_desc, out_func out, void FAR *out_desc) +{ + struct inflate_state FAR *state; + z_const unsigned char FAR *next; /* next input */ + unsigned char FAR *put; /* next output */ + unsigned have, left; /* available input and output */ + unsigned long hold; /* bit buffer */ + unsigned bits; /* bits in bit buffer */ + unsigned copy; /* number of stored or match bytes to copy */ + unsigned char FAR *from; /* where to copy match bytes from */ + code here; /* current decoding table entry */ + code last; /* parent table entry */ + unsigned len; /* length to copy for repeats, bits to drop */ + int ret; /* return code */ + static const unsigned short order[19] = /* permutation of code lengths */ + {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15}; + + /* Check that the strm exists and that the state was initialized */ + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* Reset the state */ + strm->msg = Z_NULL; + state->mode = TYPE; + state->last = 0; + state->whave = 0; + next = strm->next_in; + have = next != Z_NULL ? strm->avail_in : 0; + hold = 0; + bits = 0; + put = state->window; + left = state->wsize; + + /* Inflate until end of block marked as last */ + for (;;) + switch (state->mode) { + case TYPE: + /* determine and dispatch block type */ + if (state->last) { + BYTEBITS(); + state->mode = DONE; + break; + } + NEEDBITS(3); + state->last = BITS(1); + DROPBITS(1); + switch (BITS(2)) { + case 0: /* stored block */ + Tracev((stderr, "inflate: stored block%s\n", + state->last ? " (last)" : "")); + state->mode = STORED; + break; + case 1: /* fixed block */ + fixedtables(state); + Tracev((stderr, "inflate: fixed codes block%s\n", + state->last ? " (last)" : "")); + state->mode = LEN; /* decode codes */ + break; + case 2: /* dynamic block */ + Tracev((stderr, "inflate: dynamic codes block%s\n", + state->last ? " (last)" : "")); + state->mode = TABLE; + break; + case 3: + strm->msg = (char *)"invalid block type"; + state->mode = BAD; + } + DROPBITS(2); + break; + + case STORED: + /* get and verify stored block length */ + BYTEBITS(); /* go to byte boundary */ + NEEDBITS(32); + if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) { + strm->msg = (char *)"invalid stored block lengths"; + state->mode = BAD; + break; + } + state->length = (unsigned)hold & 0xffff; + Tracev((stderr, "inflate: stored length %u\n", + state->length)); + INITBITS(); + + /* copy stored block from input to output */ + while (state->length != 0) { + copy = state->length; + PULL(); + ROOM(); + if (copy > have) copy = have; + if (copy > left) copy = left; + zmemcpy(put, next, copy); + have -= copy; + next += copy; + left -= copy; + put += copy; + state->length -= copy; + } + Tracev((stderr, "inflate: stored end\n")); + state->mode = TYPE; + break; + + case TABLE: + /* get dynamic table entries descriptor */ + NEEDBITS(14); + state->nlen = BITS(5) + 257; + DROPBITS(5); + state->ndist = BITS(5) + 1; + DROPBITS(5); + state->ncode = BITS(4) + 4; + DROPBITS(4); +#ifndef PKZIP_BUG_WORKAROUND + if (state->nlen > 286 || state->ndist > 30) { + strm->msg = (char *)"too many length or distance symbols"; + state->mode = BAD; + break; + } +#endif + Tracev((stderr, "inflate: table sizes ok\n")); + + /* get code length code lengths (not a typo) */ + state->have = 0; + while (state->have < state->ncode) { + NEEDBITS(3); + state->lens[order[state->have++]] = (unsigned short)BITS(3); + DROPBITS(3); + } + while (state->have < 19) + state->lens[order[state->have++]] = 0; + state->next = state->codes; + state->lencode = (code const FAR *)(state->next); + state->lenbits = 7; + ret = inflate_table(CODES, state->lens, 19, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid code lengths set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: code lengths ok\n")); + + /* get length and distance code code lengths */ + state->have = 0; + while (state->have < state->nlen + state->ndist) { + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.val < 16) { + DROPBITS(here.bits); + state->lens[state->have++] = here.val; + } + else { + if (here.val == 16) { + NEEDBITS(here.bits + 2); + DROPBITS(here.bits); + if (state->have == 0) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + len = (unsigned)(state->lens[state->have - 1]); + copy = 3 + BITS(2); + DROPBITS(2); + } + else if (here.val == 17) { + NEEDBITS(here.bits + 3); + DROPBITS(here.bits); + len = 0; + copy = 3 + BITS(3); + DROPBITS(3); + } + else { + NEEDBITS(here.bits + 7); + DROPBITS(here.bits); + len = 0; + copy = 11 + BITS(7); + DROPBITS(7); + } + if (state->have + copy > state->nlen + state->ndist) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + while (copy--) + state->lens[state->have++] = (unsigned short)len; + } + } + + /* handle error breaks in while */ + if (state->mode == BAD) break; + + /* check for end-of-block code (better have one) */ + if (state->lens[256] == 0) { + strm->msg = (char *)"invalid code -- missing end-of-block"; + state->mode = BAD; + break; + } + + /* build code tables -- note: do not change the lenbits or distbits + values here (9 and 6) without reading the comments in inftrees.h + concerning the ENOUGH constants, which depend on those values */ + state->next = state->codes; + state->lencode = (code const FAR *)(state->next); + state->lenbits = 9; + ret = inflate_table(LENS, state->lens, state->nlen, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid literal/lengths set"; + state->mode = BAD; + break; + } + state->distcode = (code const FAR *)(state->next); + state->distbits = 6; + ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist, + &(state->next), &(state->distbits), state->work); + if (ret) { + strm->msg = (char *)"invalid distances set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: codes ok\n")); + state->mode = LEN; + + case LEN: + /* use inflate_fast() if we have enough input and output */ + if (have >= 6 && left >= 258) { + RESTORE(); + if (state->whave < state->wsize) + state->whave = state->wsize - left; + inflate_fast(strm, state->wsize); + LOAD(); + break; + } + + /* get a literal, length, or end-of-block code */ + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.op && (here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->lencode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + } + DROPBITS(here.bits); + state->length = (unsigned)here.val; + + /* process literal */ + if (here.op == 0) { + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + ROOM(); + *put++ = (unsigned char)(state->length); + left--; + state->mode = LEN; + break; + } + + /* process end of block */ + if (here.op & 32) { + Tracevv((stderr, "inflate: end of block\n")); + state->mode = TYPE; + break; + } + + /* invalid code */ + if (here.op & 64) { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + + /* length code -- get extra bits, if any */ + state->extra = (unsigned)(here.op) & 15; + if (state->extra != 0) { + NEEDBITS(state->extra); + state->length += BITS(state->extra); + DROPBITS(state->extra); + } + Tracevv((stderr, "inflate: length %u\n", state->length)); + + /* get distance code */ + for (;;) { + here = state->distcode[BITS(state->distbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if ((here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->distcode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + } + DROPBITS(here.bits); + if (here.op & 64) { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + state->offset = (unsigned)here.val; + + /* get distance extra bits, if any */ + state->extra = (unsigned)(here.op) & 15; + if (state->extra != 0) { + NEEDBITS(state->extra); + state->offset += BITS(state->extra); + DROPBITS(state->extra); + } + if (state->offset > state->wsize - (state->whave < state->wsize ? + left : 0)) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } + Tracevv((stderr, "inflate: distance %u\n", state->offset)); + + /* copy match from window to output */ + do { + ROOM(); + copy = state->wsize - state->offset; + if (copy < left) { + from = put + copy; + copy = left - copy; + } + else { + from = put - state->offset; + copy = left; + } + if (copy > state->length) copy = state->length; + state->length -= copy; + left -= copy; + do { + *put++ = *from++; + } while (--copy); + } while (state->length != 0); + break; + + case DONE: + /* inflate stream terminated properly -- write leftover output */ + ret = Z_STREAM_END; + if (left < state->wsize) { + if (out(out_desc, state->window, state->wsize - left)) + ret = Z_BUF_ERROR; + } + goto inf_leave; + + case BAD: + ret = Z_DATA_ERROR; + goto inf_leave; + + default: /* can't happen, but makes compilers happy */ + ret = Z_STREAM_ERROR; + goto inf_leave; + } + + /* Return unused input */ +inf_leave: + strm->next_in = next; + strm->avail_in = have; + return ret; +} + +int ZEXPORT inflateBackEnd(z_streamp strm) +{ + if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL) + return Z_STREAM_ERROR; + ZFREE(strm, strm->state); + strm->state = Z_NULL; + Tracev((stderr, "inflate: end\n")); + return Z_OK; +} diff --git a/deps/inffast.c b/deps/inffast.c new file mode 100644 index 0000000..a88859f --- /dev/null +++ b/deps/inffast.c @@ -0,0 +1,338 @@ +/* inffast.c -- fast decoding + * Copyright (C) 1995-2008, 2010, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +#ifndef ASMINF + +/* Allow machine dependent optimization for post-increment or pre-increment. + Based on testing to date, + Pre-increment preferred for: + - PowerPC G3 (Adler) + - MIPS R5000 (Randers-Pehrson) + Post-increment preferred for: + - none + No measurable difference: + - Pentium III (Anderson) + - M68060 (Nikl) + */ +#ifdef POSTINC +# define OFF 0 +# define PUP(a) *(a)++ +#else +# define OFF 1 +# define PUP(a) *++(a) +#endif + +/* + Decode literal, length, and distance codes and write out the resulting + literal and match bytes until either not enough input or output is + available, an end-of-block is encountered, or a data error is encountered. + When large enough input and output buffers are supplied to inflate(), for + example, a 16K input buffer and a 64K output buffer, more than 95% of the + inflate execution time is spent in this routine. + + Entry assumptions: + + state->mode == LEN + strm->avail_in >= 6 + strm->avail_out >= 258 + start >= strm->avail_out + state->bits < 8 + + On return, state->mode is one of: + + LEN -- ran out of enough output space or enough available input + TYPE -- reached end of block code, inflate() to interpret next block + BAD -- error in block data + +Notes: + +- The maximum input bits used by a length/distance pair is 15 bits for the +length code, 5 bits for the length extra, 15 bits for the distance code, +and 13 bits for the distance extra. This totals 48 bits, or six bytes. +Therefore if strm->avail_in >= 6, then there is enough input to avoid +checking for available input while decoding. + +- The maximum bytes that a single length/distance pair can output is 258 +bytes, which is the maximum length that can be coded. inflate_fast() +requires strm->avail_out >= 258 for each loop to avoid checking for +output space. +*/ +void ZLIB_INTERNAL inflate_fast(z_streamp strm, unsigned start) +{ + struct inflate_state FAR *state; + unsigned char FAR *in; /* local strm->next_in */ + unsigned char FAR *last; /* have enough input while in < last */ + unsigned char FAR *out; /* local strm->next_out */ + unsigned char FAR *beg; /* inflate()'s initial strm->next_out */ + unsigned char FAR *end; /* while out < end, enough space available */ +#ifdef INFLATE_STRICT + unsigned dmax; /* maximum distance from zlib header */ +#endif + unsigned wsize; /* window size or zero if not using window */ + unsigned whave; /* valid bytes in the window */ + unsigned wnext; /* window write index */ + unsigned char FAR *window; /* allocated sliding window, if wsize != 0 */ + unsigned long hold; /* local strm->hold */ + unsigned bits; /* local strm->bits */ + code const FAR *lcode; /* local strm->lencode */ + code const FAR *dcode; /* local strm->distcode */ + unsigned lmask; /* mask for first level of length codes */ + unsigned dmask; /* mask for first level of distance codes */ + code here; /* retrieved table entry */ + unsigned op; /* code bits, operation, extra bits, or */ + /* window position, window bytes to copy */ + unsigned len; /* match length, unused bytes */ + unsigned dist; /* match distance */ + unsigned char FAR *from; /* where to copy match from */ + + /* copy state to local variables */ + state = (struct inflate_state FAR *)strm->state; + in = strm->next_in - OFF; + last = in + (strm->avail_in - 5); + out = strm->next_out - OFF; + beg = out - (start - strm->avail_out); + end = out + (strm->avail_out - 257); +#ifdef INFLATE_STRICT + dmax = state->dmax; +#endif + wsize = state->wsize; + whave = state->whave; + wnext = state->wnext; + window = state->window; + hold = state->hold; + bits = state->bits; + lcode = state->lencode; + dcode = state->distcode; + lmask = (1U << state->lenbits) - 1; + dmask = (1U << state->distbits) - 1; + + /* decode literals and length/distances until end-of-block or not enough + input data or output space */ + do { + if (bits < 15) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + here = lcode[hold & lmask]; +dolen: + op = (unsigned)(here.bits); + hold >>= op; + bits -= op; + op = (unsigned)(here.op); + if (op == 0) { /* literal */ + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + PUP(out) = (unsigned char)(here.val); + } + else if (op & 16) { /* length base */ + len = (unsigned)(here.val); + op &= 15; /* number of extra bits */ + if (op) { + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + len += (unsigned)hold & ((1U << op) - 1); + hold >>= op; + bits -= op; + } + Tracevv((stderr, "inflate: length %u\n", len)); + if (bits < 15) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + here = dcode[hold & dmask]; +dodist: + op = (unsigned)(here.bits); + hold >>= op; + bits -= op; + op = (unsigned)(here.op); + if (op & 16) { /* distance base */ + dist = (unsigned)(here.val); + op &= 15; /* number of extra bits */ + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + } + dist += (unsigned)hold & ((1U << op) - 1); +#ifdef INFLATE_STRICT + if (dist > dmax) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#endif + hold >>= op; + bits -= op; + Tracevv((stderr, "inflate: distance %u\n", dist)); + op = (unsigned)(out - beg); /* max distance in output */ + if (dist > op) { /* see if copy from window */ + op = dist - op; /* distance back in window */ + if (op > whave) { + if (state->sane) { + strm->msg = + (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + if (len <= op - whave) { + do { + PUP(out) = 0; + } while (--len); + continue; + } + len -= op - whave; + do { + PUP(out) = 0; + } while (--op > whave); + if (op == 0) { + from = out - dist; + do { + PUP(out) = PUP(from); + } while (--len); + continue; + } +#endif + } + from = window - OFF; + if (wnext == 0) { /* very common case */ + from += wsize - op; + if (op < len) { /* some from window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + else if (wnext < op) { /* wrap around window */ + from += wsize + wnext - op; + op -= wnext; + if (op < len) { /* some from end of window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = window - OFF; + if (wnext < len) { /* some from start of window */ + op = wnext; + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + } + else { /* contiguous in window */ + from += wnext - op; + if (op < len) { /* some from window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + while (len > 2) { + PUP(out) = PUP(from); + PUP(out) = PUP(from); + PUP(out) = PUP(from); + len -= 3; + } + if (len) { + PUP(out) = PUP(from); + if (len > 1) + PUP(out) = PUP(from); + } + } + else { + from = out - dist; /* copy direct from output */ + do { /* minimum length is three */ + PUP(out) = PUP(from); + PUP(out) = PUP(from); + PUP(out) = PUP(from); + len -= 3; + } while (len > 2); + if (len) { + PUP(out) = PUP(from); + if (len > 1) + PUP(out) = PUP(from); + } + } + } + else if ((op & 64) == 0) { /* 2nd level distance code */ + here = dcode[here.val + (hold & ((1U << op) - 1))]; + goto dodist; + } + else { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + } + else if ((op & 64) == 0) { /* 2nd level length code */ + here = lcode[here.val + (hold & ((1U << op) - 1))]; + goto dolen; + } + else if (op & 32) { /* end-of-block */ + Tracevv((stderr, "inflate: end of block\n")); + state->mode = TYPE; + break; + } + else { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + } while (in < last && out < end); + + /* return unused bytes (on entry, bits < 8, so in won't go too far back) */ + len = bits >> 3; + in -= len; + bits -= len << 3; + hold &= (1U << bits) - 1; + + /* update state and return */ + strm->next_in = in + OFF; + strm->next_out = out + OFF; + strm->avail_in = (unsigned)(in < last ? 5 + (last - in) : 5 - (in - last)); + strm->avail_out = (unsigned)(out < end ? + 257 + (end - out) : 257 - (out - end)); + state->hold = hold; + state->bits = bits; + return; +} + +/* + inflate_fast() speedups that turned out slower (on a PowerPC G3 750CXe): + - Using bit fields for code structure + - Different op definition to avoid & for extra bits (do & for table bits) + - Three separate decoding do-loops for direct, window, and wnext == 0 + - Special case for distance > 1 copies to do overlapped load and store copy + - Explicit branch predictions (based on measured branch probabilities) + - Deferring match copy and interspersed it with decoding subsequent codes + - Swapping literal/length else + - Swapping window/direct else + - Larger unrolled copy loops (three is about right) + - Moving len -= 3 statement into middle of loop + */ + +#endif /* !ASMINF */ diff --git a/deps/inffast.h b/deps/inffast.h new file mode 100644 index 0000000..169a85a --- /dev/null +++ b/deps/inffast.h @@ -0,0 +1,15 @@ +/* inffast.h -- header to use inffast.c + * Copyright (C) 1995-2003, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ +#ifndef _INFFAST_H +#define _INFFAST_H + +void ZLIB_INTERNAL inflate_fast OF((z_streamp strm, unsigned start)); + +#endif diff --git a/deps/inffixed.h b/deps/inffixed.h new file mode 100644 index 0000000..238a55f --- /dev/null +++ b/deps/inffixed.h @@ -0,0 +1,99 @@ +#ifndef _INFFIXED_H +#define _INFFIXED_H + +/* inffixed.h -- table for decoding fixed codes + * Generated automatically by makefixed(). + */ + + /* WARNING: this file should *not* be used by applications. + It is part of the implementation of this library and is + subject to change. Applications should only use zlib.h. + */ + + static const code lenfix[512] = { + {96,7,0},{0,8,80},{0,8,16},{20,8,115},{18,7,31},{0,8,112},{0,8,48}, + {0,9,192},{16,7,10},{0,8,96},{0,8,32},{0,9,160},{0,8,0},{0,8,128}, + {0,8,64},{0,9,224},{16,7,6},{0,8,88},{0,8,24},{0,9,144},{19,7,59}, + {0,8,120},{0,8,56},{0,9,208},{17,7,17},{0,8,104},{0,8,40},{0,9,176}, + {0,8,8},{0,8,136},{0,8,72},{0,9,240},{16,7,4},{0,8,84},{0,8,20}, + {21,8,227},{19,7,43},{0,8,116},{0,8,52},{0,9,200},{17,7,13},{0,8,100}, + {0,8,36},{0,9,168},{0,8,4},{0,8,132},{0,8,68},{0,9,232},{16,7,8}, + {0,8,92},{0,8,28},{0,9,152},{20,7,83},{0,8,124},{0,8,60},{0,9,216}, + {18,7,23},{0,8,108},{0,8,44},{0,9,184},{0,8,12},{0,8,140},{0,8,76}, + {0,9,248},{16,7,3},{0,8,82},{0,8,18},{21,8,163},{19,7,35},{0,8,114}, + {0,8,50},{0,9,196},{17,7,11},{0,8,98},{0,8,34},{0,9,164},{0,8,2}, + {0,8,130},{0,8,66},{0,9,228},{16,7,7},{0,8,90},{0,8,26},{0,9,148}, + {20,7,67},{0,8,122},{0,8,58},{0,9,212},{18,7,19},{0,8,106},{0,8,42}, + {0,9,180},{0,8,10},{0,8,138},{0,8,74},{0,9,244},{16,7,5},{0,8,86}, + {0,8,22},{64,8,0},{19,7,51},{0,8,118},{0,8,54},{0,9,204},{17,7,15}, + {0,8,102},{0,8,38},{0,9,172},{0,8,6},{0,8,134},{0,8,70},{0,9,236}, + {16,7,9},{0,8,94},{0,8,30},{0,9,156},{20,7,99},{0,8,126},{0,8,62}, + {0,9,220},{18,7,27},{0,8,110},{0,8,46},{0,9,188},{0,8,14},{0,8,142}, + {0,8,78},{0,9,252},{96,7,0},{0,8,81},{0,8,17},{21,8,131},{18,7,31}, + {0,8,113},{0,8,49},{0,9,194},{16,7,10},{0,8,97},{0,8,33},{0,9,162}, + {0,8,1},{0,8,129},{0,8,65},{0,9,226},{16,7,6},{0,8,89},{0,8,25}, + {0,9,146},{19,7,59},{0,8,121},{0,8,57},{0,9,210},{17,7,17},{0,8,105}, + {0,8,41},{0,9,178},{0,8,9},{0,8,137},{0,8,73},{0,9,242},{16,7,4}, + {0,8,85},{0,8,21},{16,8,258},{19,7,43},{0,8,117},{0,8,53},{0,9,202}, + {17,7,13},{0,8,101},{0,8,37},{0,9,170},{0,8,5},{0,8,133},{0,8,69}, + {0,9,234},{16,7,8},{0,8,93},{0,8,29},{0,9,154},{20,7,83},{0,8,125}, + {0,8,61},{0,9,218},{18,7,23},{0,8,109},{0,8,45},{0,9,186},{0,8,13}, + {0,8,141},{0,8,77},{0,9,250},{16,7,3},{0,8,83},{0,8,19},{21,8,195}, + {19,7,35},{0,8,115},{0,8,51},{0,9,198},{17,7,11},{0,8,99},{0,8,35}, + {0,9,166},{0,8,3},{0,8,131},{0,8,67},{0,9,230},{16,7,7},{0,8,91}, + {0,8,27},{0,9,150},{20,7,67},{0,8,123},{0,8,59},{0,9,214},{18,7,19}, + {0,8,107},{0,8,43},{0,9,182},{0,8,11},{0,8,139},{0,8,75},{0,9,246}, + {16,7,5},{0,8,87},{0,8,23},{64,8,0},{19,7,51},{0,8,119},{0,8,55}, + {0,9,206},{17,7,15},{0,8,103},{0,8,39},{0,9,174},{0,8,7},{0,8,135}, + {0,8,71},{0,9,238},{16,7,9},{0,8,95},{0,8,31},{0,9,158},{20,7,99}, + {0,8,127},{0,8,63},{0,9,222},{18,7,27},{0,8,111},{0,8,47},{0,9,190}, + {0,8,15},{0,8,143},{0,8,79},{0,9,254},{96,7,0},{0,8,80},{0,8,16}, + {20,8,115},{18,7,31},{0,8,112},{0,8,48},{0,9,193},{16,7,10},{0,8,96}, + {0,8,32},{0,9,161},{0,8,0},{0,8,128},{0,8,64},{0,9,225},{16,7,6}, + {0,8,88},{0,8,24},{0,9,145},{19,7,59},{0,8,120},{0,8,56},{0,9,209}, + {17,7,17},{0,8,104},{0,8,40},{0,9,177},{0,8,8},{0,8,136},{0,8,72}, + {0,9,241},{16,7,4},{0,8,84},{0,8,20},{21,8,227},{19,7,43},{0,8,116}, + {0,8,52},{0,9,201},{17,7,13},{0,8,100},{0,8,36},{0,9,169},{0,8,4}, + {0,8,132},{0,8,68},{0,9,233},{16,7,8},{0,8,92},{0,8,28},{0,9,153}, + {20,7,83},{0,8,124},{0,8,60},{0,9,217},{18,7,23},{0,8,108},{0,8,44}, + {0,9,185},{0,8,12},{0,8,140},{0,8,76},{0,9,249},{16,7,3},{0,8,82}, + {0,8,18},{21,8,163},{19,7,35},{0,8,114},{0,8,50},{0,9,197},{17,7,11}, + {0,8,98},{0,8,34},{0,9,165},{0,8,2},{0,8,130},{0,8,66},{0,9,229}, + {16,7,7},{0,8,90},{0,8,26},{0,9,149},{20,7,67},{0,8,122},{0,8,58}, + {0,9,213},{18,7,19},{0,8,106},{0,8,42},{0,9,181},{0,8,10},{0,8,138}, + {0,8,74},{0,9,245},{16,7,5},{0,8,86},{0,8,22},{64,8,0},{19,7,51}, + {0,8,118},{0,8,54},{0,9,205},{17,7,15},{0,8,102},{0,8,38},{0,9,173}, + {0,8,6},{0,8,134},{0,8,70},{0,9,237},{16,7,9},{0,8,94},{0,8,30}, + {0,9,157},{20,7,99},{0,8,126},{0,8,62},{0,9,221},{18,7,27},{0,8,110}, + {0,8,46},{0,9,189},{0,8,14},{0,8,142},{0,8,78},{0,9,253},{96,7,0}, + {0,8,81},{0,8,17},{21,8,131},{18,7,31},{0,8,113},{0,8,49},{0,9,195}, + {16,7,10},{0,8,97},{0,8,33},{0,9,163},{0,8,1},{0,8,129},{0,8,65}, + {0,9,227},{16,7,6},{0,8,89},{0,8,25},{0,9,147},{19,7,59},{0,8,121}, + {0,8,57},{0,9,211},{17,7,17},{0,8,105},{0,8,41},{0,9,179},{0,8,9}, + {0,8,137},{0,8,73},{0,9,243},{16,7,4},{0,8,85},{0,8,21},{16,8,258}, + {19,7,43},{0,8,117},{0,8,53},{0,9,203},{17,7,13},{0,8,101},{0,8,37}, + {0,9,171},{0,8,5},{0,8,133},{0,8,69},{0,9,235},{16,7,8},{0,8,93}, + {0,8,29},{0,9,155},{20,7,83},{0,8,125},{0,8,61},{0,9,219},{18,7,23}, + {0,8,109},{0,8,45},{0,9,187},{0,8,13},{0,8,141},{0,8,77},{0,9,251}, + {16,7,3},{0,8,83},{0,8,19},{21,8,195},{19,7,35},{0,8,115},{0,8,51}, + {0,9,199},{17,7,11},{0,8,99},{0,8,35},{0,9,167},{0,8,3},{0,8,131}, + {0,8,67},{0,9,231},{16,7,7},{0,8,91},{0,8,27},{0,9,151},{20,7,67}, + {0,8,123},{0,8,59},{0,9,215},{18,7,19},{0,8,107},{0,8,43},{0,9,183}, + {0,8,11},{0,8,139},{0,8,75},{0,9,247},{16,7,5},{0,8,87},{0,8,23}, + {64,8,0},{19,7,51},{0,8,119},{0,8,55},{0,9,207},{17,7,15},{0,8,103}, + {0,8,39},{0,9,175},{0,8,7},{0,8,135},{0,8,71},{0,9,239},{16,7,9}, + {0,8,95},{0,8,31},{0,9,159},{20,7,99},{0,8,127},{0,8,63},{0,9,223}, + {18,7,27},{0,8,111},{0,8,47},{0,9,191},{0,8,15},{0,8,143},{0,8,79}, + {0,9,255} + }; + + static const code distfix[32] = { + {16,5,1},{23,5,257},{19,5,17},{27,5,4097},{17,5,5},{25,5,1025}, + {21,5,65},{29,5,16385},{16,5,3},{24,5,513},{20,5,33},{28,5,8193}, + {18,5,9},{26,5,2049},{22,5,129},{64,5,0},{16,5,2},{23,5,385}, + {19,5,25},{27,5,6145},{17,5,7},{25,5,1537},{21,5,97},{29,5,24577}, + {16,5,4},{24,5,769},{20,5,49},{28,5,12289},{18,5,13},{26,5,3073}, + {22,5,193},{64,5,0} + }; + +#endif diff --git a/deps/inflate.c b/deps/inflate.c new file mode 100644 index 0000000..0b4f0b7 --- /dev/null +++ b/deps/inflate.c @@ -0,0 +1,1489 @@ +/* inflate.c -- zlib decompression + * Copyright (C) 1995-2012 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * Change history: + * + * 1.2.beta0 24 Nov 2002 + * - First version -- complete rewrite of inflate to simplify code, avoid + * creation of window when not needed, minimize use of window when it is + * needed, make inffast.c even faster, implement gzip decoding, and to + * improve code readability and style over the previous zlib inflate code + * + * 1.2.beta1 25 Nov 2002 + * - Use pointers for available input and output checking in inffast.c + * - Remove input and output counters in inffast.c + * - Change inffast.c entry and loop from avail_in >= 7 to >= 6 + * - Remove unnecessary second byte pull from length extra in inffast.c + * - Unroll direct copy to three copies per loop in inffast.c + * + * 1.2.beta2 4 Dec 2002 + * - Change external routine names to reduce potential conflicts + * - Correct filename to inffixed.h for fixed tables in inflate.c + * - Make hbuf[] unsigned char to match parameter type in inflate.c + * - Change strm->next_out[-state->offset] to *(strm->next_out - state->offset) + * to avoid negation problem on Alphas (64 bit) in inflate.c + * + * 1.2.beta3 22 Dec 2002 + * - Add comments on state->bits assertion in inffast.c + * - Add comments on op field in inftrees.h + * - Fix bug in reuse of allocated window after inflateReset() + * - Remove bit fields--back to byte structure for speed + * - Remove distance extra == 0 check in inflate_fast()--only helps for lengths + * - Change post-increments to pre-increments in inflate_fast(), PPC biased? + * - Add compile time option, POSTINC, to use post-increments instead (Intel?) + * - Make MATCH copy in inflate() much faster for when inflate_fast() not used + * - Use local copies of stream next and avail values, as well as local bit + * buffer and bit count in inflate()--for speed when inflate_fast() not used + * + * 1.2.beta4 1 Jan 2003 + * - Split ptr - 257 statements in inflate_table() to avoid compiler warnings + * - Move a comment on output buffer sizes from inffast.c to inflate.c + * - Add comments in inffast.c to introduce the inflate_fast() routine + * - Rearrange window copies in inflate_fast() for speed and simplification + * - Unroll last copy for window match in inflate_fast() + * - Use local copies of window variables in inflate_fast() for speed + * - Pull out common wnext == 0 case for speed in inflate_fast() + * - Make op and len in inflate_fast() unsigned for consistency + * - Add FAR to lcode and dcode declarations in inflate_fast() + * - Simplified bad distance check in inflate_fast() + * - Added inflateBackInit(), inflateBack(), and inflateBackEnd() in new + * source file infback.c to provide a call-back interface to inflate for + * programs like gzip and unzip -- uses window as output buffer to avoid + * window copying + * + * 1.2.beta5 1 Jan 2003 + * - Improved inflateBack() interface to allow the caller to provide initial + * input in strm. + * - Fixed stored blocks bug in inflateBack() + * + * 1.2.beta6 4 Jan 2003 + * - Added comments in inffast.c on effectiveness of POSTINC + * - Typecasting all around to reduce compiler warnings + * - Changed loops from while (1) or do {} while (1) to for (;;), again to + * make compilers happy + * - Changed type of window in inflateBackInit() to unsigned char * + * + * 1.2.beta7 27 Jan 2003 + * - Changed many types to unsigned or unsigned short to avoid warnings + * - Added inflateCopy() function + * + * 1.2.0 9 Mar 2003 + * - Changed inflateBack() interface to provide separate opaque descriptors + * for the in() and out() functions + * - Changed inflateBack() argument and in_func typedef to swap the length + * and buffer address return values for the input function +* - Check next_in and next_out for Z_NULL on entry to inflate() + * + * The history for versions after 1.2.0 are in ChangeLog in zlib distribution. + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +#ifdef MAKEFIXED +# ifndef BUILDFIXED +# define BUILDFIXED +# endif +#endif + +#ifndef Z_TREES +#define Z_TREES 6 +#endif + + /* function prototypes */ +int ZEXPORT inflateReset2(z_streamp strm, int windowBits); + local void fixedtables OF((struct inflate_state FAR *state)); + local int updatewindow OF((z_streamp strm, const unsigned char FAR *end, + unsigned copy)); +#ifdef BUILDFIXED +void makefixed OF((void)); +#endif +local unsigned syncsearch OF((unsigned FAR *have, const unsigned char FAR *buf, + unsigned len)); + +long ZEXPORT inflateMark(z_streamp strm); + +int ZEXPORT inflateResetKeep(z_streamp strm); + +int ZEXPORT inflateUndermine(z_streamp strm, int subvert); + +int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength); + +int ZEXPORT inflateResetKeep(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + strm->total_in = strm->total_out = state->total = 0; + strm->msg = Z_NULL; + if (state->wrap) /* to support ill-conceived Java test suite */ + strm->adler = state->wrap & 1; + state->mode = HEAD; + state->last = 0; + state->havedict = 0; + state->dmax = 32768U; + state->head = Z_NULL; + state->hold = 0; + state->bits = 0; + state->lencode = state->distcode = state->next = state->codes; + state->sane = 1; + state->back = -1; + Tracev((stderr, "inflate: reset\n")); + return Z_OK; +} + +int ZEXPORT inflateReset(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + state->wsize = 0; + state->whave = 0; + state->wnext = 0; + return inflateResetKeep(strm); +} + +int ZEXPORT inflateReset2(z_streamp strm, int windowBits) +{ + int wrap; + struct inflate_state FAR *state = NULL; + + /* get the state */ + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* extract wrap request from windowBits parameter */ + if (windowBits < 0) { + wrap = 0; + windowBits = -windowBits; + } + else { + wrap = (windowBits >> 4) + 1; +#ifdef GUNZIP + if (windowBits < 48) + windowBits &= 15; +#endif + } + + /* set number of window bits, free window if different */ + if (windowBits && (windowBits < 8 || windowBits > 15)) + return Z_STREAM_ERROR; + if (state->window != Z_NULL && state->wbits != (unsigned)windowBits) { + ZFREE(strm, state->window); + state->window = Z_NULL; + } + + /* update state and reset the rest of it */ + state->wrap = wrap; + state->wbits = (unsigned)windowBits; + return inflateReset(strm); +} + +int ZEXPORT inflateInit2_(z_streamp strm, int windowBits, const char *version, int stream_size) +{ + int ret; + struct inflate_state FAR *state; + + if (version == Z_NULL || version[0] != ZLIB_VERSION[0] || + stream_size != (int)(sizeof(z_stream))) + return Z_VERSION_ERROR; + if (strm == Z_NULL) return Z_STREAM_ERROR; + strm->msg = Z_NULL; /* in case we return an error */ + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == Z_NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + state = (struct inflate_state FAR *) + ZALLOC(strm, 1, sizeof(struct inflate_state)); + if (state == Z_NULL) return Z_MEM_ERROR; + Tracev((stderr, "inflate: allocated\n")); + strm->state = (struct internal_state FAR *)state; + state->window = Z_NULL; + ret = inflateReset2(strm, windowBits); + if (ret != Z_OK) { + ZFREE(strm, state); + strm->state = Z_NULL; + } + return ret; +} + +int ZEXPORT inflateInit_(z_streamp strm, const char *version, int stream_size) +{ + return inflateInit2_(strm, DEF_WBITS, version, stream_size); +} + +int ZEXPORT inflatePrime(z_streamp strm, int bits, int value) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (bits < 0) { + state->hold = 0; + state->bits = 0; + return Z_OK; + } + if (bits > 16 || state->bits + bits > 32) return Z_STREAM_ERROR; + value &= (1L << bits) - 1; + state->hold += value << state->bits; + state->bits += bits; + return Z_OK; +} + +/* + Return state with length and distance decoding tables and index sizes set to + fixed code decoding. Normally this returns fixed tables from inffixed.h. + If BUILDFIXED is defined, then instead this routine builds the tables the + first time it's called, and returns those tables the first time and + thereafter. This reduces the size of the code by about 2K bytes, in + exchange for a little execution time. However, BUILDFIXED should not be + used for threaded applications, since the rewriting of the tables and virgin + may not be thread-safe. + */ +local void fixedtables(struct inflate_state FAR *state) +{ +#ifdef BUILDFIXED + static int virgin = 1; + static code *lenfix, *distfix; + static code fixed[544]; + + /* build fixed huffman tables if first call (may not be thread safe) */ + if (virgin) { + unsigned sym, bits; + static code *next; + + /* literal/length table */ + sym = 0; + while (sym < 144) state->lens[sym++] = 8; + while (sym < 256) state->lens[sym++] = 9; + while (sym < 280) state->lens[sym++] = 7; + while (sym < 288) state->lens[sym++] = 8; + next = fixed; + lenfix = next; + bits = 9; + inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work); + + /* distance table */ + sym = 0; + while (sym < 32) state->lens[sym++] = 5; + distfix = next; + bits = 5; + inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work); + + /* do this just once */ + virgin = 0; + } +#else /* !BUILDFIXED */ +# include "inffixed.h" +#endif /* BUILDFIXED */ + state->lencode = lenfix; + state->lenbits = 9; + state->distcode = distfix; + state->distbits = 5; +} + +#ifdef MAKEFIXED +#include <stdio.h> + +/* + Write out the inffixed.h that is #include'd above. Defining MAKEFIXED also + defines BUILDFIXED, so the tables are built on the fly. makefixed() writes + those tables to stdout, which would be piped to inffixed.h. A small program + can simply call makefixed to do this: + + void makefixed(void); + + int main(void) + { + makefixed(); + return 0; + } + + Then that can be linked with zlib built with MAKEFIXED defined and run: + + a.out > inffixed.h + */ +void makefixed(void) +{ + unsigned low, size; + struct inflate_state state; + + fixedtables(&state); + puts(" /* inffixed.h -- table for decoding fixed codes"); + puts(" * Generated automatically by makefixed()."); + puts(" */"); + puts(""); + puts(" /* WARNING: this file should *not* be used by applications."); + puts(" It is part of the implementation of this library and is"); + puts(" subject to change. Applications should only use zlib.h."); + puts(" */"); + puts(""); + size = 1U << 9; + printf(" static const code lenfix[%u] = {", size); + low = 0; + for (;;) { + if ((low % 7) == 0) printf("\n "); + printf("{%u,%u,%d}", (low & 127) == 99 ? 64 : state.lencode[low].op, + state.lencode[low].bits, state.lencode[low].val); + if (++low == size) break; + putchar(','); + } + puts("\n };"); + size = 1U << 5; + printf("\n static const code distfix[%u] = {", size); + low = 0; + for (;;) { + if ((low % 6) == 0) printf("\n "); + printf("{%u,%u,%d}", state.distcode[low].op, state.distcode[low].bits, + state.distcode[low].val); + if (++low == size) break; + putchar(','); + } + puts("\n };"); +} +#endif /* MAKEFIXED */ + +/* + Update the window with the last wsize (normally 32K) bytes written before + returning. If window does not exist yet, create it. This is only called + when a window is already in use, or when output has been written during this + inflate call, but the end of the deflate stream has not been reached yet. + It is also called to create a window for dictionary data when a dictionary + is loaded. + + Providing output buffers larger than 32K to inflate() should provide a speed + advantage, since only the last 32K of output is copied to the sliding window + upon return from inflate(), and since all distances after the first 32K of + output will fall in the output data, making match copies simpler and faster. + The advantage may be dependent on the size of the processor's data caches. + */ +local int updatewindow(z_streamp strm, const Bytef *end, unsigned copy) +{ + struct inflate_state FAR *state; + unsigned dist; + + state = (struct inflate_state FAR *)strm->state; + + /* if it hasn't been done already, allocate space for the window */ + if (state->window == Z_NULL) { + state->window = (unsigned char FAR *) + ZALLOC(strm, 1U << state->wbits, + sizeof(unsigned char)); + if (state->window == Z_NULL) return 1; + } + + /* if window not in use yet, initialize */ + if (state->wsize == 0) { + state->wsize = 1U << state->wbits; + state->wnext = 0; + state->whave = 0; + } + + /* copy state->wsize or less output bytes into the circular window */ + if (copy >= state->wsize) { + zmemcpy(state->window, end - state->wsize, state->wsize); + state->wnext = 0; + state->whave = state->wsize; + } + else { + dist = state->wsize - state->wnext; + if (dist > copy) dist = copy; + zmemcpy(state->window + state->wnext, end - copy, dist); + copy -= dist; + if (copy) { + zmemcpy(state->window, end - copy, copy); + state->wnext = copy; + state->whave = state->wsize; + } + else { + state->wnext += dist; + if (state->wnext == state->wsize) state->wnext = 0; + if (state->whave < state->wsize) state->whave += dist; + } + } + return 0; +} + +/* Macros for inflate(): */ + +/* check function to use adler32() for zlib or crc32() for gzip */ +#ifdef GUNZIP +# define UPDATE(check, buf, len) \ + (state->flags ? crc32(check, buf, len) : adler32(check, buf, len)) +#else +# define UPDATE(check, buf, len) adler32(check, buf, len) +#endif + +/* check macros for header crc */ +#ifdef GUNZIP +# define CRC2(check, word) \ + do { \ + hbuf[0] = (unsigned char)(word); \ + hbuf[1] = (unsigned char)((word) >> 8); \ + check = crc32(check, hbuf, 2); \ + } while (0) + +# define CRC4(check, word) \ + do { \ + hbuf[0] = (unsigned char)(word); \ + hbuf[1] = (unsigned char)((word) >> 8); \ + hbuf[2] = (unsigned char)((word) >> 16); \ + hbuf[3] = (unsigned char)((word) >> 24); \ + check = crc32(check, hbuf, 4); \ + } while (0) +#endif + +/* Load registers with state in inflate() for speed */ +#define LOAD() \ + do { \ + put = strm->next_out; \ + left = strm->avail_out; \ + next = strm->next_in; \ + have = strm->avail_in; \ + hold = state->hold; \ + bits = state->bits; \ + } while (0) + +/* Restore state from registers in inflate() */ +#define RESTORE() \ + do { \ + strm->next_out = put; \ + strm->avail_out = left; \ + strm->next_in = next; \ + strm->avail_in = have; \ + state->hold = hold; \ + state->bits = bits; \ + } while (0) + +/* Clear the input bit accumulator */ +#define INITBITS() \ + do { \ + hold = 0; \ + bits = 0; \ + } while (0) + +/* Get a byte of input into the bit accumulator, or return from inflate() + if there is no input available. */ +#define PULLBYTE() \ + do { \ + if (have == 0) goto inf_leave; \ + have--; \ + hold += (unsigned long)(*next++) << bits; \ + bits += 8; \ + } while (0) + +/* Assure that there are at least n bits in the bit accumulator. If there is + not enough available input to do that, then return from inflate(). */ +#define NEEDBITS(n) \ + do { \ + while (bits < (unsigned)(n)) \ + PULLBYTE(); \ + } while (0) + +/* Return the low n bits of the bit accumulator (n < 16) */ +#define BITS(n) \ + ((unsigned)hold & ((1U << (n)) - 1)) + +/* Remove n bits from the bit accumulator */ +#define DROPBITS(n) \ + do { \ + hold >>= (n); \ + bits -= (unsigned)(n); \ + } while (0) + +/* Remove zero to seven bits as needed to go to a byte boundary */ +#define BYTEBITS() \ + do { \ + hold >>= bits & 7; \ + bits -= bits & 7; \ + } while (0) + +/* + inflate() uses a state machine to process as much input data and generate as + much output data as possible before returning. The state machine is + structured roughly as follows: + + for (;;) switch (state) { + ... + case STATEn: + if (not enough input data or output space to make progress) + return; + ... make progress ... + state = STATEm; + break; + ... + } + + so when inflate() is called again, the same case is attempted again, and + if the appropriate resources are provided, the machine proceeds to the + next state. The NEEDBITS() macro is usually the way the state evaluates + whether it can proceed or should return. NEEDBITS() does the return if + the requested bits are not available. The typical use of the BITS macros +is: + +NEEDBITS(n); +... do something with BITS(n) ... +DROPBITS(n); + +where NEEDBITS(n) either returns from inflate() if there isn't enough +input left to load n bits into the accumulator, or it continues. BITS(n) +gives the low n bits in the accumulator. When done, DROPBITS(n) drops +the low n bits off the accumulator. INITBITS() clears the accumulator +and sets the number of available bits to zero. BYTEBITS() discards just +enough bits to put the accumulator on a byte boundary. After BYTEBITS() +and a NEEDBITS(8), then BITS(8) would return the next byte in the stream. + +NEEDBITS(n) uses PULLBYTE() to get an available byte of input, or to return +if there is no input available. The decoding of variable length codes uses +PULLBYTE() directly in order to pull just enough bytes to decode the next +code, and no more. + +Some states loop until they get enough input, making sure that enough +state information is maintained to continue the loop where it left off +if NEEDBITS() returns in the loop. For example, want, need, and keep +would all have to actually be part of the saved state in case NEEDBITS() +returns: + +case STATEw: +while (want < need) { +NEEDBITS(n); +keep[want++] = BITS(n); +DROPBITS(n); +} +state = STATEx; +case STATEx: + +As shown above, if the next state is also the next case, then the break +is omitted. + +A state may also return if there is not enough output space available to +complete that state. Those states are copying stored data, writing a +literal byte, and copying a matching string. + +When returning, a "goto inf_leave" is used to update the total counters, +update the check value, and determine whether any progress has been made +during that inflate() call in order to return the proper return code. +Progress is defined as a change in either strm->avail_in or strm->avail_out. +When there is a window, goto inf_leave will update the window with the last +output written. If a goto inf_leave occurs in the middle of decompression +and there is no window currently, goto inf_leave will create one and copy +output to the window for the next call of inflate(). + +In this implementation, the flush parameter of inflate() only affects the +return code (per zlib.h). inflate() always writes as much as possible to +strm->next_out, given the space available and the provided input--the effect +documented in zlib.h of Z_SYNC_FLUSH. Furthermore, inflate() always defers +the allocation of and copying into a sliding window until necessary, which +provides the effect documented in zlib.h for Z_FINISH when the entire input +stream available. So the only thing the flush parameter actually does is: +when flush is set to Z_FINISH, inflate() cannot return Z_OK. Instead it +will return Z_BUF_ERROR if it has not reached the end of the stream. +*/ + +int ZEXPORT inflate(z_streamp strm, int flush) +{ + struct inflate_state FAR *state; + unsigned char FAR *next; /* next input */ + unsigned char FAR *put; /* next output */ + unsigned have, left; /* available input and output */ + unsigned long hold; /* bit buffer */ + unsigned bits; /* bits in bit buffer */ + unsigned in, out; /* save starting available input and output */ + unsigned copy; /* number of stored or match bytes to copy */ + unsigned char FAR *from; /* where to copy match bytes from */ + code here; /* current decoding table entry */ + code last; /* parent table entry */ + unsigned len; /* length to copy for repeats, bits to drop */ + int ret; /* return code */ +#ifdef GUNZIP + unsigned char hbuf[4]; /* buffer for gzip header crc calculation */ +#endif + static const unsigned short order[19] = /* permutation of code lengths */ + {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15}; + + if (strm == Z_NULL || strm->state == Z_NULL || strm->next_out == Z_NULL || + (strm->next_in == Z_NULL && strm->avail_in != 0)) + return Z_STREAM_ERROR; + + state = (struct inflate_state FAR *)strm->state; + if (state->mode == TYPE) state->mode = TYPEDO; /* skip check */ + LOAD(); + in = have; + out = left; + ret = Z_OK; + for (;;) + switch (state->mode) { + case HEAD: + if (state->wrap == 0) { + state->mode = TYPEDO; + break; + } + NEEDBITS(16); +#ifdef GUNZIP + if ((state->wrap & 2) && hold == 0x8b1f) { /* gzip header */ + state->check = crc32(0L, Z_NULL, 0); + CRC2(state->check, hold); + INITBITS(); + state->mode = FLAGS; + break; + } + state->flags = 0; /* expect zlib header */ + if (state->head != Z_NULL) + state->head->done = -1; + if (!(state->wrap & 1) || /* check if zlib header allowed */ +#else + if ( +#endif + ((BITS(8) << 8) + (hold >> 8)) % 31) { + strm->msg = (char *)"incorrect header check"; + state->mode = BAD; + break; + } + if (BITS(4) != Z_DEFLATED) { + strm->msg = (char *)"unknown compression method"; + state->mode = BAD; + break; + } + DROPBITS(4); + len = BITS(4) + 8; + if (state->wbits == 0) + state->wbits = len; + else if (len > state->wbits) { + strm->msg = (char *)"invalid window size"; + state->mode = BAD; + break; + } + state->dmax = 1U << len; + Tracev((stderr, "inflate: zlib header ok\n")); + strm->adler = state->check = adler32(0L, Z_NULL, 0); + state->mode = hold & 0x200 ? DICTID : TYPE; + INITBITS(); + break; +#ifdef GUNZIP + case FLAGS: + NEEDBITS(16); + state->flags = (int)(hold); + if ((state->flags & 0xff) != Z_DEFLATED) { + strm->msg = (char *)"unknown compression method"; + state->mode = BAD; + break; + } + if (state->flags & 0xe000) { + strm->msg = (char *)"unknown header flags set"; + state->mode = BAD; + break; + } + if (state->head != Z_NULL) + state->head->text = (int)((hold >> 8) & 1); + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + state->mode = TIME; + case TIME: + NEEDBITS(32); + if (state->head != Z_NULL) + state->head->time = hold; + if (state->flags & 0x0200) CRC4(state->check, hold); + INITBITS(); + state->mode = OS; + case OS: + NEEDBITS(16); + if (state->head != Z_NULL) { + state->head->xflags = (int)(hold & 0xff); + state->head->os = (int)(hold >> 8); + } + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + state->mode = EXLEN; + case EXLEN: + if (state->flags & 0x0400) { + NEEDBITS(16); + state->length = (unsigned)(hold); + if (state->head != Z_NULL) + state->head->extra_len = (unsigned)hold; + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + } + else if (state->head != Z_NULL) + state->head->extra = Z_NULL; + state->mode = EXTRA; + case EXTRA: + if (state->flags & 0x0400) { + copy = state->length; + if (copy > have) copy = have; + if (copy) { + if (state->head != Z_NULL && + state->head->extra != Z_NULL) { + len = state->head->extra_len - state->length; + zmemcpy(state->head->extra + len, next, + len + copy > state->head->extra_max ? + state->head->extra_max - len : copy); + } + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + state->length -= copy; + } + if (state->length) goto inf_leave; + } + state->length = 0; + state->mode = NAME; + case NAME: + if (state->flags & 0x0800) { + if (have == 0) goto inf_leave; + copy = 0; + do { + len = (unsigned)(next[copy++]); + if (state->head != Z_NULL && + state->head->name != Z_NULL && + state->length < state->head->name_max) + state->head->name[state->length++] = len; + } while (len && copy < have); + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + if (len) goto inf_leave; + } + else if (state->head != Z_NULL) + state->head->name = Z_NULL; + state->length = 0; + state->mode = COMMENT; + case COMMENT: + if (state->flags & 0x1000) { + if (have == 0) goto inf_leave; + copy = 0; + do { + len = (unsigned)(next[copy++]); + if (state->head != Z_NULL && + state->head->comment != Z_NULL && + state->length < state->head->comm_max) + state->head->comment[state->length++] = len; + } while (len && copy < have); + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + if (len) goto inf_leave; + } + else if (state->head != Z_NULL) + state->head->comment = Z_NULL; + state->mode = HCRC; + case HCRC: + if (state->flags & 0x0200) { + NEEDBITS(16); + if (hold != (state->check & 0xffff)) { + strm->msg = (char *)"header crc mismatch"; + state->mode = BAD; + break; + } + INITBITS(); + } + if (state->head != Z_NULL) { + state->head->hcrc = (int)((state->flags >> 9) & 1); + state->head->done = 1; + } + strm->adler = state->check = crc32(0L, Z_NULL, 0); + state->mode = TYPE; + break; +#endif + case DICTID: + NEEDBITS(32); + strm->adler = state->check = ZSWAP32(hold); + INITBITS(); + state->mode = DICT; + case DICT: + if (state->havedict == 0) { + RESTORE(); + return Z_NEED_DICT; + } + strm->adler = state->check = adler32(0L, Z_NULL, 0); + state->mode = TYPE; + case TYPE: + if (flush == Z_BLOCK || flush == Z_TREES) goto inf_leave; + case TYPEDO: + if (state->last) { + BYTEBITS(); + state->mode = CHECK; + break; + } + NEEDBITS(3); + state->last = BITS(1); + DROPBITS(1); + switch (BITS(2)) { + case 0: /* stored block */ + Tracev((stderr, "inflate: stored block%s\n", + state->last ? " (last)" : "")); + state->mode = STORED; + break; + case 1: /* fixed block */ + fixedtables(state); + Tracev((stderr, "inflate: fixed codes block%s\n", + state->last ? " (last)" : "")); + state->mode = LEN_; /* decode codes */ + if (flush == Z_TREES) { + DROPBITS(2); + goto inf_leave; + } + break; + case 2: /* dynamic block */ + Tracev((stderr, "inflate: dynamic codes block%s\n", + state->last ? " (last)" : "")); + state->mode = TABLE; + break; + case 3: + strm->msg = (char *)"invalid block type"; + state->mode = BAD; + } + DROPBITS(2); + break; + case STORED: + BYTEBITS(); /* go to byte boundary */ + NEEDBITS(32); + if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) { + strm->msg = (char *)"invalid stored block lengths"; + state->mode = BAD; + break; + } + state->length = (unsigned)hold & 0xffff; + Tracev((stderr, "inflate: stored length %u\n", + state->length)); + INITBITS(); + state->mode = COPY_; + if (flush == Z_TREES) goto inf_leave; + case COPY_: + state->mode = COPY; + case COPY: + copy = state->length; + if (copy) { + if (copy > have) copy = have; + if (copy > left) copy = left; + if (copy == 0) goto inf_leave; + zmemcpy(put, next, copy); + have -= copy; + next += copy; + left -= copy; + put += copy; + state->length -= copy; + break; + } + Tracev((stderr, "inflate: stored end\n")); + state->mode = TYPE; + break; + case TABLE: + NEEDBITS(14); + state->nlen = BITS(5) + 257; + DROPBITS(5); + state->ndist = BITS(5) + 1; + DROPBITS(5); + state->ncode = BITS(4) + 4; + DROPBITS(4); +#ifndef PKZIP_BUG_WORKAROUND + if (state->nlen > 286 || state->ndist > 30) { + strm->msg = (char *)"too many length or distance symbols"; + state->mode = BAD; + break; + } +#endif + Tracev((stderr, "inflate: table sizes ok\n")); + state->have = 0; + state->mode = LENLENS; + case LENLENS: + while (state->have < state->ncode) { + NEEDBITS(3); + state->lens[order[state->have++]] = (unsigned short)BITS(3); + DROPBITS(3); + } + while (state->have < 19) + state->lens[order[state->have++]] = 0; + state->next = state->codes; + state->lencode = (const code FAR *)(state->next); + state->lenbits = 7; + ret = inflate_table(CODES, state->lens, 19, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid code lengths set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: code lengths ok\n")); + state->have = 0; + state->mode = CODELENS; + case CODELENS: + while (state->have < state->nlen + state->ndist) { + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.val < 16) { + DROPBITS(here.bits); + state->lens[state->have++] = here.val; + } + else { + if (here.val == 16) { + NEEDBITS(here.bits + 2); + DROPBITS(here.bits); + if (state->have == 0) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + len = state->lens[state->have - 1]; + copy = 3 + BITS(2); + DROPBITS(2); + } + else if (here.val == 17) { + NEEDBITS(here.bits + 3); + DROPBITS(here.bits); + len = 0; + copy = 3 + BITS(3); + DROPBITS(3); + } + else { + NEEDBITS(here.bits + 7); + DROPBITS(here.bits); + len = 0; + copy = 11 + BITS(7); + DROPBITS(7); + } + if (state->have + copy > state->nlen + state->ndist) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + while (copy--) + state->lens[state->have++] = (unsigned short)len; + } + } + + /* handle error breaks in while */ + if (state->mode == BAD) break; + + /* check for end-of-block code (better have one) */ + if (state->lens[256] == 0) { + strm->msg = (char *)"invalid code -- missing end-of-block"; + state->mode = BAD; + break; + } + + /* build code tables -- note: do not change the lenbits or distbits + values here (9 and 6) without reading the comments in inftrees.h + concerning the ENOUGH constants, which depend on those values */ + state->next = state->codes; + state->lencode = (const code FAR *)(state->next); + state->lenbits = 9; + ret = inflate_table(LENS, state->lens, state->nlen, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid literal/lengths set"; + state->mode = BAD; + break; + } + state->distcode = (const code FAR *)(state->next); + state->distbits = 6; + ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist, + &(state->next), &(state->distbits), state->work); + if (ret) { + strm->msg = (char *)"invalid distances set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: codes ok\n")); + state->mode = LEN_; + if (flush == Z_TREES) goto inf_leave; + case LEN_: + state->mode = LEN; + case LEN: + if (have >= 6 && left >= 258) { + RESTORE(); + inflate_fast(strm, out); + LOAD(); + if (state->mode == TYPE) + state->back = -1; + break; + } + state->back = 0; + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.op && (here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->lencode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + state->back += last.bits; + } + DROPBITS(here.bits); + state->back += here.bits; + state->length = (unsigned)here.val; + if ((int)(here.op) == 0) { + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + state->mode = LIT; + break; + } + if (here.op & 32) { + Tracevv((stderr, "inflate: end of block\n")); + state->back = -1; + state->mode = TYPE; + break; + } + if (here.op & 64) { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + state->extra = (unsigned)(here.op) & 15; + state->mode = LENEXT; + case LENEXT: + if (state->extra) { + NEEDBITS(state->extra); + state->length += BITS(state->extra); + DROPBITS(state->extra); + state->back += state->extra; + } + Tracevv((stderr, "inflate: length %u\n", state->length)); + state->was = state->length; + state->mode = DIST; + case DIST: + for (;;) { + here = state->distcode[BITS(state->distbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if ((here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->distcode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + state->back += last.bits; + } + DROPBITS(here.bits); + state->back += here.bits; + if (here.op & 64) { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + state->offset = (unsigned)here.val; + state->extra = (unsigned)(here.op) & 15; + state->mode = DISTEXT; + case DISTEXT: + if (state->extra) { + NEEDBITS(state->extra); + state->offset += BITS(state->extra); + DROPBITS(state->extra); + state->back += state->extra; + } +#ifdef INFLATE_STRICT + if (state->offset > state->dmax) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#endif + Tracevv((stderr, "inflate: distance %u\n", state->offset)); + state->mode = MATCH; + case MATCH: + if (left == 0) goto inf_leave; + copy = out - left; + if (state->offset > copy) { /* copy from window */ + copy = state->offset - copy; + if (copy > state->whave) { + if (state->sane) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + Trace((stderr, "inflate.c too far\n")); + copy -= state->whave; + if (copy > state->length) copy = state->length; + if (copy > left) copy = left; + left -= copy; + state->length -= copy; + do { + *put++ = 0; + } while (--copy); + if (state->length == 0) state->mode = LEN; + break; +#endif + } + if (copy > state->wnext) { + copy -= state->wnext; + from = state->window + (state->wsize - copy); + } + else + from = state->window + (state->wnext - copy); + if (copy > state->length) copy = state->length; + } + else { /* copy from output */ + from = put - state->offset; + copy = state->length; + } + if (copy > left) copy = left; + left -= copy; + state->length -= copy; + do { + *put++ = *from++; + } while (--copy); + if (state->length == 0) state->mode = LEN; + break; + case LIT: + if (left == 0) goto inf_leave; + *put++ = (unsigned char)(state->length); + left--; + state->mode = LEN; + break; + case CHECK: + if (state->wrap) { + NEEDBITS(32); + out -= left; + strm->total_out += out; + state->total += out; + if (out) + strm->adler = state->check = + UPDATE(state->check, put - out, out); + out = left; + if (( +#ifdef GUNZIP + state->flags ? hold : +#endif + ZSWAP32(hold)) != state->check) { + strm->msg = (char *)"incorrect data check"; + state->mode = BAD; + break; + } + INITBITS(); + Tracev((stderr, "inflate: check matches trailer\n")); + } +#ifdef GUNZIP + state->mode = LENGTH; + case LENGTH: + if (state->wrap && state->flags) { + NEEDBITS(32); + if (hold != (state->total & 0xffffffffUL)) { + strm->msg = (char *)"incorrect length check"; + state->mode = BAD; + break; + } + INITBITS(); + Tracev((stderr, "inflate: length matches trailer\n")); + } +#endif + state->mode = DONE; + case DONE: + ret = Z_STREAM_END; + goto inf_leave; + case BAD: + ret = Z_DATA_ERROR; + goto inf_leave; + case MEM: + return Z_MEM_ERROR; + case SYNC: + default: + return Z_STREAM_ERROR; + } + + /* + Return from inflate(), updating the total counts and the check value. + If there was no progress during the inflate() call, return a buffer + error. Call updatewindow() to create and/or update the window state. +Note: a memory error from inflate() is non-recoverable. +*/ +inf_leave: + RESTORE(); + if (state->wsize || (out != strm->avail_out && state->mode < BAD && + (state->mode < CHECK || flush != Z_FINISH))) + if (updatewindow(strm, strm->next_out, out - strm->avail_out)) { + state->mode = MEM; + return Z_MEM_ERROR; + } + in -= strm->avail_in; + out -= strm->avail_out; + strm->total_in += in; + strm->total_out += out; + state->total += out; + if (state->wrap && out) + strm->adler = state->check = + UPDATE(state->check, strm->next_out - out, out); + strm->data_type = state->bits + (state->last ? 64 : 0) + + (state->mode == TYPE ? 128 : 0) + + (state->mode == LEN_ || state->mode == COPY_ ? 256 : 0); + if (((in == 0 && out == 0) || flush == Z_FINISH) && ret == Z_OK) + ret = Z_BUF_ERROR; + return ret; +} + +int ZEXPORT inflateEnd(z_streamp strm) +{ + struct inflate_state FAR *state; + if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (state->window != Z_NULL) ZFREE(strm, state->window); + ZFREE(strm, strm->state); + strm->state = Z_NULL; + Tracev((stderr, "inflate: end\n")); + return Z_OK; +} + +int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength) +{ + struct inflate_state FAR *state; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* copy dictionary */ + if (state->whave && dictionary != Z_NULL) { + zmemcpy(dictionary, state->window + state->wnext, + state->whave - state->wnext); + zmemcpy(dictionary + state->whave - state->wnext, + state->window, state->wnext); + } + if (dictLength != Z_NULL) + *dictLength = state->whave; + return Z_OK; +} + +int ZEXPORT inflateSetDictionary(z_streamp strm, const Bytef *dictionary, uInt dictLength) +{ + struct inflate_state FAR *state; + unsigned long dictid; + int ret; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (state->wrap != 0 && state->mode != DICT) + return Z_STREAM_ERROR; + + /* check for correct dictionary identifier */ + if (state->mode == DICT) { + dictid = adler32(0L, Z_NULL, 0); + dictid = adler32(dictid, dictionary, dictLength); + if (dictid != state->check) + return Z_DATA_ERROR; + } + + /* copy dictionary to window using updatewindow(), which will amend the + existing dictionary if appropriate */ + ret = updatewindow(strm, dictionary + dictLength, dictLength); + if (ret) { + state->mode = MEM; + return Z_MEM_ERROR; + } + state->havedict = 1; + Tracev((stderr, "inflate: dictionary set\n")); + return Z_OK; +} + +int ZEXPORT inflateGetHeader(z_streamp strm, gz_headerp head) +{ + struct inflate_state FAR *state; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if ((state->wrap & 2) == 0) return Z_STREAM_ERROR; + + /* save header structure */ + state->head = head; + head->done = 0; + return Z_OK; +} + +/* + Search buf[0..len-1] for the pattern: 0, 0, 0xff, 0xff. Return when found + or when out of input. When called, *have is the number of pattern bytes + found in order so far, in 0..3. On return *have is updated to the new + state. If on return *have equals four, then the pattern was found and the + return value is how many bytes were read including the last byte of the + pattern. If *have is less than four, then the pattern has not been found + yet and the return value is len. In the latter case, syncsearch() can be + called again with more data and the *have state. *have is initialized to + zero for the first call. + */ +local unsigned syncsearch(unsigned FAR *have, const unsigned char FAR *buf, unsigned len) +{ + unsigned got; + unsigned next; + + got = *have; + next = 0; + while (next < len && got < 4) { + if ((int)(buf[next]) == (got < 2 ? 0 : 0xff)) + got++; + else if (buf[next]) + got = 0; + else + got = 4 - got; + next++; + } + *have = got; + return next; +} + +int ZEXPORT inflateSync(z_streamp strm) +{ + unsigned len; /* number of bytes to look at or looked at */ + unsigned long in, out; /* temporary to save total_in and total_out */ + unsigned char buf[4]; /* to restore bit buffer to byte string */ + struct inflate_state FAR *state; + + /* check parameters */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (strm->avail_in == 0 && state->bits < 8) return Z_BUF_ERROR; + + /* if first time, start search in bit buffer */ + if (state->mode != SYNC) { + state->mode = SYNC; + state->hold <<= state->bits & 7; + state->bits -= state->bits & 7; + len = 0; + while (state->bits >= 8) { + buf[len++] = (unsigned char)(state->hold); + state->hold >>= 8; + state->bits -= 8; + } + state->have = 0; + syncsearch(&(state->have), buf, len); + } + + /* search available input */ + len = syncsearch(&(state->have), strm->next_in, strm->avail_in); + strm->avail_in -= len; + strm->next_in += len; + strm->total_in += len; + + /* return no joy or set up to restart inflate() on a new block */ + if (state->have != 4) return Z_DATA_ERROR; + in = strm->total_in; out = strm->total_out; + inflateReset(strm); + strm->total_in = in; strm->total_out = out; + state->mode = TYPE; + return Z_OK; +} + +/* + Returns true if inflate is currently at the end of a block generated by + Z_SYNC_FLUSH or Z_FULL_FLUSH. This function is used by one PPP + implementation to provide an additional safety check. PPP uses + Z_SYNC_FLUSH but removes the length bytes of the resulting empty stored + block. When decompressing, PPP checks that at the end of input packet, + inflate is waiting for these length bytes. + */ +int ZEXPORT inflateSyncPoint(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + return state->mode == STORED && state->bits == 0; +} + +int ZEXPORT inflateCopy(z_streamp dest, z_streamp source) +{ + struct inflate_state FAR *state; + struct inflate_state FAR *copy; + unsigned char FAR *window; + unsigned wsize; + + /* check input */ + if (dest == Z_NULL || source == Z_NULL || source->state == Z_NULL || + source->zalloc == Z_NULL || source->zfree == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)source->state; + + /* allocate space */ + copy = (struct inflate_state FAR *) + ZALLOC(source, 1, sizeof(struct inflate_state)); + if (copy == Z_NULL) return Z_MEM_ERROR; + window = Z_NULL; + if (state->window != Z_NULL) { + window = (unsigned char FAR *) + ZALLOC(source, 1U << state->wbits, sizeof(unsigned char)); + if (window == Z_NULL) { + ZFREE(source, copy); + return Z_MEM_ERROR; + } + } + + /* copy state */ + zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream)); + zmemcpy((voidpf)copy, (voidpf)state, sizeof(struct inflate_state)); + if (state->lencode >= state->codes && + state->lencode <= state->codes + ENOUGH - 1) { + copy->lencode = copy->codes + (state->lencode - state->codes); + copy->distcode = copy->codes + (state->distcode - state->codes); + } + copy->next = copy->codes + (state->next - state->codes); + if (window != Z_NULL) { + wsize = 1U << state->wbits; + zmemcpy(window, state->window, wsize); + } + copy->window = window; + dest->state = (struct internal_state FAR *)copy; + return Z_OK; +} + +int ZEXPORT inflateUndermine(z_streamp strm, int subvert) +{ + struct inflate_state FAR *state = NULL; + + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + state->sane = !subvert; +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + return Z_OK; +#else + state->sane = 1; + return Z_DATA_ERROR; +#endif +} + +long ZEXPORT inflateMark(z_streamp strm) +{ + struct inflate_state FAR *state = NULL; + + if (strm == Z_NULL || strm->state == Z_NULL) + return -1L << 16; + state = (struct inflate_state FAR *)strm->state; + return ((long)(state->back) << 16) + + (state->mode == COPY ? state->length : + (state->mode == MATCH ? state->was - state->length : 0)); +} diff --git a/deps/inflate.h b/deps/inflate.h new file mode 100644 index 0000000..dbc173a --- /dev/null +++ b/deps/inflate.h @@ -0,0 +1,127 @@ +/* inflate.h -- internal inflate state definition + * Copyright (C) 1995-2009 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* define NO_GZIP when compiling if you want to disable gzip header and + trailer decoding by inflate(). NO_GZIP would be used to avoid linking in + the crc code when it is not needed. For shared libraries, gzip decoding + should be left enabled. */ +#ifndef _INFLATE_H +#define _INFLATE_H + +#ifndef NO_GZIP +# define GUNZIP +#endif + +/* Possible inflate modes between inflate() calls */ +typedef enum { + HEAD, /* i: waiting for magic header */ + FLAGS, /* i: waiting for method and flags (gzip) */ + TIME, /* i: waiting for modification time (gzip) */ + OS, /* i: waiting for extra flags and operating system (gzip) */ + EXLEN, /* i: waiting for extra length (gzip) */ + EXTRA, /* i: waiting for extra bytes (gzip) */ + NAME, /* i: waiting for end of file name (gzip) */ + COMMENT, /* i: waiting for end of comment (gzip) */ + HCRC, /* i: waiting for header crc (gzip) */ + DICTID, /* i: waiting for dictionary check value */ + DICT, /* waiting for inflateSetDictionary() call */ + TYPE, /* i: waiting for type bits, including last-flag bit */ + TYPEDO, /* i: same, but skip check to exit inflate on new block */ + STORED, /* i: waiting for stored size (length and complement) */ + COPY_, /* i/o: same as COPY below, but only first time in */ + COPY, /* i/o: waiting for input or output to copy stored block */ + TABLE, /* i: waiting for dynamic block table lengths */ + LENLENS, /* i: waiting for code length code lengths */ + CODELENS, /* i: waiting for length/lit and distance code lengths */ + LEN_, /* i: same as LEN below, but only first time in */ + LEN, /* i: waiting for length/lit/eob code */ + LENEXT, /* i: waiting for length extra bits */ + DIST, /* i: waiting for distance code */ + DISTEXT, /* i: waiting for distance extra bits */ + MATCH, /* o: waiting for output space to copy string */ + LIT, /* o: waiting for output space to write literal */ + CHECK, /* i: waiting for 32-bit check value */ + LENGTH, /* i: waiting for 32-bit length (gzip) */ + DONE, /* finished check, done -- remain here until reset */ + BAD, /* got a data error -- remain here until reset */ + MEM, /* got an inflate() memory error -- remain here until reset */ + SYNC /* looking for synchronization bytes to restart inflate() */ +} inflate_mode; + +/* + State transitions between above modes - + + (most modes can go to BAD or MEM on error -- not shown for clarity) + + Process header: + HEAD -> (gzip) or (zlib) or (raw) + (gzip) -> FLAGS -> TIME -> OS -> EXLEN -> EXTRA -> NAME -> COMMENT -> + HCRC -> TYPE + (zlib) -> DICTID or TYPE + DICTID -> DICT -> TYPE + (raw) -> TYPEDO + Read deflate blocks: + TYPE -> TYPEDO -> STORED or TABLE or LEN_ or CHECK + STORED -> COPY_ -> COPY -> TYPE + TABLE -> LENLENS -> CODELENS -> LEN_ + LEN_ -> LEN + Read deflate codes in fixed or dynamic block: + LEN -> LENEXT or LIT or TYPE + LENEXT -> DIST -> DISTEXT -> MATCH -> LEN + LIT -> LEN + Process trailer: + CHECK -> LENGTH -> DONE + */ + +/* state maintained between inflate() calls. Approximately 10K bytes. */ +struct inflate_state { + inflate_mode mode; /* current inflate mode */ + int last; /* true if processing last block */ + int wrap; /* bit 0 true for zlib, bit 1 true for gzip */ + int havedict; /* true if dictionary provided */ + int flags; /* gzip header method and flags (0 if zlib) */ + unsigned dmax; /* zlib header max distance (INFLATE_STRICT) */ + unsigned long check; /* protected copy of check value */ + unsigned long total; /* protected copy of output count */ + gz_headerp head; /* where to save gzip header information */ + /* sliding window */ + unsigned wbits; /* log base 2 of requested window size */ + unsigned wsize; /* window size or zero if not using window */ + unsigned whave; /* valid bytes in the window */ + unsigned wnext; /* window write index */ + unsigned char FAR *window; /* allocated sliding window, if needed */ + /* bit accumulator */ + unsigned long hold; /* input bit accumulator */ + unsigned bits; /* number of bits in "in" */ + /* for string and stored block copying */ + unsigned length; /* literal or length of data to copy */ + unsigned offset; /* distance back to copy string from */ + /* for table and code decoding */ + unsigned extra; /* extra bits needed */ + /* fixed and dynamic code tables */ + code const FAR *lencode; /* starting table for length/literal codes */ + code const FAR *distcode; /* starting table for distance codes */ + unsigned lenbits; /* index bits for lencode */ + unsigned distbits; /* index bits for distcode */ + /* dynamic table building */ + unsigned ncode; /* number of code length code lengths */ + unsigned nlen; /* number of length code lengths */ + unsigned ndist; /* number of distance code lengths */ + unsigned have; /* number of code lengths in lens[] */ + code FAR *next; /* next available space in codes[] */ + unsigned short lens[320]; /* temporary storage for code lengths */ + unsigned short work[288]; /* work area for code table building */ + code codes[ENOUGH]; /* space for code tables */ + int sane; /* if false, allow invalid distance too far */ + int back; /* bits back of last unprocessed length/lit */ + unsigned was; /* initial length of match */ +}; + +#endif diff --git a/deps/inftrees.c b/deps/inftrees.c new file mode 100644 index 0000000..8b8a964 --- /dev/null +++ b/deps/inftrees.c @@ -0,0 +1,300 @@ +/* inftrees.c -- generate Huffman trees for efficient decoding + * Copyright (C) 1995-2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" + +#define MAXBITS 15 + +const char inflate_copyright[] = +" inflate 1.2.8 Copyright 1995-2013 Mark Adler "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ + +/* + Build a set of tables to decode the provided canonical Huffman code. + The code lengths are lens[0..codes-1]. The result starts at *table, + whose indices are 0..2^bits-1. work is a writable array of at least + lens shorts, which is used as a work area. type is the type of code + to be generated, CODES, LENS, or DISTS. On return, zero is success, + -1 is an invalid code, and +1 means that ENOUGH isn't enough. table + on return points to the next available entry's address. bits is the + requested root table index bits, and on return it is the actual root + table index bits. It will differ if the request is greater than the + longest code or if it is less than the shortest code. + */ +int ZLIB_INTERNAL inflate_table(codetype type, unsigned short FAR *lens, unsigned codes, code FAR * FAR *table, unsigned FAR *bits, unsigned short FAR *work) +{ + unsigned len; /* a code's length in bits */ + unsigned sym; /* index of code symbols */ + unsigned min, max; /* minimum and maximum code lengths */ + unsigned root; /* number of index bits for root table */ + unsigned curr; /* number of index bits for current table */ + unsigned drop; /* code bits to drop for sub-table */ + int left; /* number of prefix codes available */ + unsigned used; /* code entries in table used */ + unsigned huff; /* Huffman code */ + unsigned incr; /* for incrementing code, index */ + unsigned fill; /* index for replicating entries */ + unsigned low; /* low bits for current root entry */ + unsigned mask; /* mask for low root bits */ + code here; /* table entry for duplication */ + code FAR *next; /* next available space in table */ + const unsigned short FAR *base; /* base value table to use */ + const unsigned short FAR *extra; /* extra bits table to use */ + int end; /* use base and extra for symbol > end */ + unsigned short count[MAXBITS+1]; /* number of codes of each length */ + unsigned short offs[MAXBITS+1]; /* offsets in table for each length */ + static const unsigned short lbase[31] = { /* Length codes 257..285 base */ + 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31, + 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0}; + static const unsigned short lext[31] = { /* Length codes 257..285 extra */ + 16, 16, 16, 16, 16, 16, 16, 16, 17, 17, 17, 17, 18, 18, 18, 18, + 19, 19, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 16, 72, 78}; + static const unsigned short dbase[32] = { /* Distance codes 0..29 base */ + 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193, + 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145, + 8193, 12289, 16385, 24577, 0, 0}; + static const unsigned short dext[32] = { /* Distance codes 0..29 extra */ + 16, 16, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 21, 21, 22, 22, + 23, 23, 24, 24, 25, 25, 26, 26, 27, 27, + 28, 28, 29, 29, 64, 64}; + + /* + Process a set of code lengths to create a canonical Huffman code. The + code lengths are lens[0..codes-1]. Each length corresponds to the + symbols 0..codes-1. The Huffman code is generated by first sorting the + symbols by length from short to long, and retaining the symbol order + for codes with equal lengths. Then the code starts with all zero bits + for the first code of the shortest length, and the codes are integer + increments for the same length, and zeros are appended as the length + increases. For the deflate format, these bits are stored backwards + from their more natural integer increment ordering, and so when the + decoding tables are built in the large loop below, the integer codes + are incremented backwards. + + This routine assumes, but does not check, that all of the entries in + lens[] are in the range 0..MAXBITS. The caller must assure this. + 1..MAXBITS is interpreted as that code length. zero means that that + symbol does not occur in this code. + + The codes are sorted by computing a count of codes for each length, + creating from that a table of starting indices for each length in the + sorted table, and then entering the symbols in order in the sorted + table. The sorted table is work[], with that space being provided by + the caller. + + The length counts are used for other purposes as well, i.e. finding + the minimum and maximum length codes, determining if there are any + codes at all, checking for a valid set of lengths, and looking ahead + at length counts to determine sub-table sizes when building the + decoding tables. + */ + + /* accumulate lengths for codes (assumes lens[] all in 0..MAXBITS) */ + for (len = 0; len <= MAXBITS; len++) + count[len] = 0; + for (sym = 0; sym < codes; sym++) + count[lens[sym]]++; + + /* bound code lengths, force root to be within code lengths */ + root = *bits; + for (max = MAXBITS; max >= 1; max--) + if (count[max] != 0) break; + if (root > max) root = max; + if (max == 0) { /* no symbols to code at all */ + here.op = (unsigned char)64; /* invalid code marker */ + here.bits = (unsigned char)1; + here.val = (unsigned short)0; + *(*table)++ = here; /* make a table to force an error */ + *(*table)++ = here; + *bits = 1; + return 0; /* no symbols, but wait for decoding to report error */ + } + for (min = 1; min < max; min++) + if (count[min] != 0) break; + if (root < min) root = min; + + /* check for an over-subscribed or incomplete set of lengths */ + left = 1; + for (len = 1; len <= MAXBITS; len++) { + left <<= 1; + left -= count[len]; + if (left < 0) return -1; /* over-subscribed */ + } + if (left > 0 && (type == CODES || max != 1)) + return -1; /* incomplete set */ + + /* generate offsets into symbol table for each length for sorting */ + offs[1] = 0; + for (len = 1; len < MAXBITS; len++) + offs[len + 1] = offs[len] + count[len]; + + /* sort symbols by length, by symbol order within each length */ + for (sym = 0; sym < codes; sym++) + if (lens[sym] != 0) work[offs[lens[sym]]++] = (unsigned short)sym; + + /* + Create and fill in decoding tables. In this loop, the table being + filled is at next and has curr index bits. The code being used is huff + with length len. That code is converted to an index by dropping drop + bits off of the bottom. For codes where len is less than drop + curr, + those top drop + curr - len bits are incremented through all values to + fill the table with replicated entries. + + root is the number of index bits for the root table. When len exceeds + root, sub-tables are created pointed to by the root entry with an index + of the low root bits of huff. This is saved in low to check for when a + new sub-table should be started. drop is zero when the root table is + being filled, and drop is root when sub-tables are being filled. + + When a new sub-table is needed, it is necessary to look ahead in the + code lengths to determine what size sub-table is needed. The length + counts are used for this, and so count[] is decremented as codes are + entered in the tables. + + used keeps track of how many table entries have been allocated from the + provided *table space. It is checked for LENS and DIST tables against + the constants ENOUGH_LENS and ENOUGH_DISTS to guard against changes in + the initial root table size constants. See the comments in inftrees.h + for more information. + + sym increments through all symbols, and the loop terminates when + all codes of length max, i.e. all codes, have been processed. This + routine permits incomplete codes, so another loop after this one fills + in the rest of the decoding tables with invalid code markers. + */ + + /* set up for code type */ + switch (type) { + case CODES: + base = extra = work; /* dummy value--not used */ + end = 19; + break; + case LENS: + base = lbase; + base -= 257; + extra = lext; + extra -= 257; + end = 256; + break; + default: /* DISTS */ + base = dbase; + extra = dext; + end = -1; + } + + /* initialize state for loop */ + huff = 0; /* starting code */ + sym = 0; /* starting code symbol */ + len = min; /* starting code length */ + next = *table; /* current table to fill in */ + curr = root; /* current table index bits */ + drop = 0; /* current bits to drop from code for index */ + low = (unsigned)(-1); /* trigger new sub-table when len > root */ + used = 1U << root; /* use root table entries */ + mask = used - 1; /* mask for comparing low */ + + /* check available table space */ + if ((type == LENS && used > ENOUGH_LENS) || + (type == DISTS && used > ENOUGH_DISTS)) + return 1; + + /* process all codes and make table entries */ + for (;;) { + /* create table entry */ + here.bits = (unsigned char)(len - drop); + if ((int)(work[sym]) < end) { + here.op = (unsigned char)0; + here.val = work[sym]; + } + else if ((int)(work[sym]) > end) { + here.op = (unsigned char)(extra[work[sym]]); + here.val = base[work[sym]]; + } + else { + here.op = (unsigned char)(32 + 64); /* end of block */ + here.val = 0; + } + + /* replicate for those indices with low len bits equal to huff */ + incr = 1U << (len - drop); + fill = 1U << curr; + min = fill; /* save offset to next table */ + do { + fill -= incr; + next[(huff >> drop) + fill] = here; + } while (fill != 0); + + /* backwards increment the len-bit code huff */ + incr = 1U << (len - 1); + while (huff & incr) + incr >>= 1; + if (incr != 0) { + huff &= incr - 1; + huff += incr; + } + else + huff = 0; + + /* go to next symbol, update count, len */ + sym++; + if (--(count[len]) == 0) { + if (len == max) break; + len = lens[work[sym]]; + } + + /* create new sub-table if needed */ + if (len > root && (huff & mask) != low) { + /* if first time, transition to sub-tables */ + if (drop == 0) + drop = root; + + /* increment past last table */ + next += min; /* here min is 1 << curr */ + + /* determine length of next table */ + curr = len - drop; + left = (int)(1 << curr); + while (curr + drop < max) { + left -= count[curr + drop]; + if (left <= 0) break; + curr++; + left <<= 1; + } + + /* check for enough space */ + used += 1U << curr; + if ((type == LENS && used > ENOUGH_LENS) || + (type == DISTS && used > ENOUGH_DISTS)) + return 1; + + /* point entry in root table to sub-table */ + low = huff & mask; + (*table)[low].op = (unsigned char)curr; + (*table)[low].bits = (unsigned char)root; + (*table)[low].val = (unsigned short)(next - *table); + } + } + + /* fill in remaining table entry if code is incomplete (guaranteed to have + at most one remaining entry, since if the code is incomplete, the + maximum code length that was allowed to get this far is one bit) */ + if (huff != 0) { + here.op = (unsigned char)64; /* invalid code marker */ + here.bits = (unsigned char)(len - drop); + here.val = (unsigned short)0; + next[huff] = here; + } + + /* set return parameters */ + *table += used; + *bits = root; + return 0; +} diff --git a/deps/inftrees.h b/deps/inftrees.h new file mode 100644 index 0000000..cd9e67c --- /dev/null +++ b/deps/inftrees.h @@ -0,0 +1,67 @@ +/* inftrees.h -- header to use inftrees.c + * Copyright (C) 1995-2005, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +#ifndef _INFTREES_H +#define _INFTREES_H + +/* Structure for decoding tables. Each entry provides either the + information needed to do the operation requested by the code that + indexed that table entry, or it provides a pointer to another + table that indexes more bits of the code. op indicates whether + the entry is a pointer to another table, a literal, a length or + distance, an end-of-block, or an invalid code. For a table + pointer, the low four bits of op is the number of index bits of + that table. For a length or distance, the low four bits of op + is the number of extra bits to get after the code. bits is + the number of bits in this code or part of the code to drop off + of the bit buffer. val is the actual byte to output in the case + of a literal, the base length or distance, or the offset from + the current table to the next table. Each entry is four bytes. */ +typedef struct { + unsigned char op; /* operation, extra bits, table bits */ + unsigned char bits; /* bits in this part of the code */ + unsigned short val; /* offset in table or code value */ +} code; + +/* op values as set by inflate_table(): + 00000000 - literal + 0000tttt - table link, tttt != 0 is the number of table index bits + 0001eeee - length or distance, eeee is the number of extra bits + 01100000 - end of block + 01000000 - invalid code + */ + +/* Maximum size of the dynamic table. The maximum number of code structures is + 1444, which is the sum of 852 for literal/length codes and 592 for distance + codes. These values were found by exhaustive searches using the program + examples/enough.c found in the zlib distribtution. The arguments to that + program are the number of symbols, the initial root table size, and the + maximum bit length of a code. "enough 286 9 15" for literal/length codes + returns returns 852, and "enough 30 6 15" for distance codes returns 592. + The initial root table size (9 or 6) is found in the fifth argument of the + inflate_table() calls in inflate.c and infback.c. If the root table size is + changed, then these maximum sizes would be need to be recalculated and + updated. */ +#define ENOUGH_LENS 852 +#define ENOUGH_DISTS 592 +#define ENOUGH (ENOUGH_LENS+ENOUGH_DISTS) + +/* Type of code to build for inflate_table() */ +typedef enum { + CODES, + LENS, + DISTS +} codetype; + +int ZLIB_INTERNAL inflate_table OF((codetype type, unsigned short FAR *lens, + unsigned codes, code FAR * FAR *table, + unsigned FAR *bits, unsigned short FAR *work)); + +#endif diff --git a/deps/ioapi.c b/deps/ioapi.c new file mode 100644 index 0000000..767ac2f --- /dev/null +++ b/deps/ioapi.c @@ -0,0 +1,236 @@ +/* ioapi.h -- IO base function header for compress/uncompress .zip + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications for Zip64 support + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + +*/ + +#ifdef _WIN32 +#ifndef _CRT_SECURE_NO_WARNINGS +#define _CRT_SECURE_NO_WARNINGS +#endif +#endif + +#include "ioapi.h" + +voidpf call_zopen64 (const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode) +{ + if (pfilefunc->zfile_func64.zopen64_file != NULL) + return (*(pfilefunc->zfile_func64.zopen64_file)) (pfilefunc->zfile_func64.opaque,filename,mode); + else + { + return (*(pfilefunc->zopen32_file))(pfilefunc->zfile_func64.opaque,(const char*)filename,mode); + } +} + +long call_zseek64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin) +{ + if (pfilefunc->zfile_func64.zseek64_file != NULL) + return (*(pfilefunc->zfile_func64.zseek64_file)) (pfilefunc->zfile_func64.opaque,filestream,offset,origin); + else + { + uLong offsetTruncated = (uLong)offset; + if (offsetTruncated != offset) + return -1; + else + return (*(pfilefunc->zseek32_file))(pfilefunc->zfile_func64.opaque,filestream,offsetTruncated,origin); + } +} + +ZPOS64_T call_ztell64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream) +{ + if (pfilefunc->zfile_func64.zseek64_file != NULL) + return (*(pfilefunc->zfile_func64.ztell64_file)) (pfilefunc->zfile_func64.opaque,filestream); + else + { + uLong tell_uLong = (*(pfilefunc->ztell32_file))(pfilefunc->zfile_func64.opaque,filestream); + if ((tell_uLong) == ((uLong)-1)) + return (ZPOS64_T)-1; + else + return tell_uLong; + } +} + +void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32) +{ + p_filefunc64_32->zfile_func64.zopen64_file = NULL; + p_filefunc64_32->zopen32_file = p_filefunc32->zopen_file; + p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file; + p_filefunc64_32->zfile_func64.zread_file = p_filefunc32->zread_file; + p_filefunc64_32->zfile_func64.zwrite_file = p_filefunc32->zwrite_file; + p_filefunc64_32->zfile_func64.ztell64_file = NULL; + p_filefunc64_32->zfile_func64.zseek64_file = NULL; + p_filefunc64_32->zfile_func64.zclose_file = p_filefunc32->zclose_file; + p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file; + p_filefunc64_32->zfile_func64.opaque = p_filefunc32->opaque; + p_filefunc64_32->zseek32_file = p_filefunc32->zseek_file; + p_filefunc64_32->ztell32_file = p_filefunc32->ztell_file; +} + + + +static voidpf ZCALLBACK fopen_file_func OF((voidpf opaque, const char* filename, int mode)); +static uLong ZCALLBACK fread_file_func OF((voidpf opaque, voidpf stream, void* buf, uLong size)); +static uLong ZCALLBACK fwrite_file_func OF((voidpf opaque, voidpf stream, const void* buf,uLong size)); +static ZPOS64_T ZCALLBACK ftell64_file_func OF((voidpf opaque, voidpf stream)); +static long ZCALLBACK fseek64_file_func OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin)); +static int ZCALLBACK fclose_file_func OF((voidpf opaque, voidpf stream)); +static int ZCALLBACK ferror_file_func OF((voidpf opaque, voidpf stream)); + +static voidpf ZCALLBACK fopen_file_func (voidpf opaque, const char* filename, int mode) +{ + FILE* file = NULL; + const char* mode_fopen = NULL; + if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ) + mode_fopen = "rb"; + else + if (mode & ZLIB_FILEFUNC_MODE_EXISTING) + mode_fopen = "r+b"; + else + if (mode & ZLIB_FILEFUNC_MODE_CREATE) + mode_fopen = "wb"; + + if ((filename!=NULL) && (mode_fopen != NULL)) + file = fopen(filename, mode_fopen); + return file; +} + +static voidpf ZCALLBACK fopen64_file_func (voidpf opaque, const void* filename, int mode) +{ + FILE* file = NULL; + const char* mode_fopen = NULL; + if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ) + mode_fopen = "rb"; + else + if (mode & ZLIB_FILEFUNC_MODE_EXISTING) + mode_fopen = "r+b"; + else + if (mode & ZLIB_FILEFUNC_MODE_CREATE) + mode_fopen = "wb"; + + if ((filename!=NULL) && (mode_fopen != NULL)) + file = fopen((const char*)filename, mode_fopen); + return file; +} + + +static uLong ZCALLBACK fread_file_func (voidpf opaque, voidpf stream, void* buf, uLong size) +{ + uLong ret; + ret = (uLong)fread(buf, 1, (size_t)size, (FILE *)stream); + return ret; +} + +static uLong ZCALLBACK fwrite_file_func (voidpf opaque, voidpf stream, const void* buf, uLong size) +{ + uLong ret; + ret = (uLong)fwrite(buf, 1, (size_t)size, (FILE *)stream); + return ret; +} + +static long ZCALLBACK ftell_file_func (voidpf opaque, voidpf stream) +{ + long ret; + ret = ftell((FILE *)stream); + return ret; +} + + +static ZPOS64_T ZCALLBACK ftell64_file_func (voidpf opaque, voidpf stream) +{ + ZPOS64_T ret; + ret = ftell((FILE *)stream); + return ret; +} + +static long ZCALLBACK fseek_file_func (voidpf opaque, voidpf stream, uLong offset, int origin) +{ + int fseek_origin=0; + long ret; + switch (origin) + { + case ZLIB_FILEFUNC_SEEK_CUR : + fseek_origin = SEEK_CUR; + break; + case ZLIB_FILEFUNC_SEEK_END : + fseek_origin = SEEK_END; + break; + case ZLIB_FILEFUNC_SEEK_SET : + fseek_origin = SEEK_SET; + break; + default: return -1; + } + ret = 0; + if (fseek((FILE *)stream, offset, fseek_origin) != 0) + ret = -1; + return ret; +} + +static long ZCALLBACK fseek64_file_func (voidpf opaque, voidpf stream, ZPOS64_T offset, int origin) +{ + int fseek_origin=0; + long ret; + switch (origin) + { + case ZLIB_FILEFUNC_SEEK_CUR : + fseek_origin = SEEK_CUR; + break; + case ZLIB_FILEFUNC_SEEK_END : + fseek_origin = SEEK_END; + break; + case ZLIB_FILEFUNC_SEEK_SET : + fseek_origin = SEEK_SET; + break; + default: return -1; + } + ret = 0; + + if(fseek((FILE *)stream, (long)offset, fseek_origin) != 0) + ret = -1; + + return ret; +} + + +static int ZCALLBACK fclose_file_func (voidpf opaque, voidpf stream) +{ + int ret; + ret = fclose((FILE *)stream); + return ret; +} + +static int ZCALLBACK ferror_file_func (voidpf opaque, voidpf stream) +{ + int ret; + ret = ferror((FILE *)stream); + return ret; +} + +void fill_fopen_filefunc (zlib_filefunc_def *pzlib_filefunc_def) +{ + pzlib_filefunc_def->zopen_file = fopen_file_func; + pzlib_filefunc_def->zread_file = fread_file_func; + pzlib_filefunc_def->zwrite_file = fwrite_file_func; + pzlib_filefunc_def->ztell_file = ftell_file_func; + pzlib_filefunc_def->zseek_file = fseek_file_func; + pzlib_filefunc_def->zclose_file = fclose_file_func; + pzlib_filefunc_def->zerror_file = ferror_file_func; + pzlib_filefunc_def->opaque = NULL; +} + +void fill_fopen64_filefunc (zlib_filefunc64_def* pzlib_filefunc_def) +{ + pzlib_filefunc_def->zopen64_file = fopen64_file_func; + pzlib_filefunc_def->zread_file = fread_file_func; + pzlib_filefunc_def->zwrite_file = fwrite_file_func; + pzlib_filefunc_def->ztell64_file = ftell64_file_func; + pzlib_filefunc_def->zseek64_file = fseek64_file_func; + pzlib_filefunc_def->zclose_file = fclose_file_func; + pzlib_filefunc_def->zerror_file = ferror_file_func; + pzlib_filefunc_def->opaque = NULL; +} diff --git a/deps/ioapi.h b/deps/ioapi.h new file mode 100644 index 0000000..8309c4c --- /dev/null +++ b/deps/ioapi.h @@ -0,0 +1,200 @@ +/* ioapi.h -- IO base function header for compress/uncompress .zip + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications for Zip64 support + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + Changes + + Oct-2009 - Defined ZPOS64_T to fpos_t on windows and u_int64_t on linux. (might need to find a better why for this) + Oct-2009 - Change to fseeko64, ftello64 and fopen64 so large files would work on linux. + More if/def section may be needed to support other platforms + Oct-2009 - Defined fxxxx64 calls to normal fopen/ftell/fseek so they would compile on windows. + (but you should use iowin32.c for windows instead) + +*/ + +#ifndef _ZLIBIOAPI64_H +#define _ZLIBIOAPI64_H + +#if (!defined(_WIN32)) && (!defined(WIN32)) + + // Linux needs this to support file operation on files larger then 4+GB + // But might need better if/def to select just the platforms that needs them. + + #ifndef __USE_FILE_OFFSET64 + #define __USE_FILE_OFFSET64 + #endif + #ifndef __USE_LARGEFILE64 + #define __USE_LARGEFILE64 + #endif + #ifndef _LARGEFILE64_SOURCE + #define _LARGEFILE64_SOURCE + #endif + #ifndef _FILE_OFFSET_BIT + #define _FILE_OFFSET_BIT 64 + #endif +#endif + +#include <stdio.h> +#include <stdlib.h> +#include "zlib.h" + +#if defined(USE_FILE32API) +#define fopen64 fopen +#define ftello64 ftell +#define fseeko64 fseek +#else +#ifdef _MSC_VER + #define fopen64 fopen + #if (_MSC_VER >= 1400) && (!(defined(NO_MSCVER_FILE64_FUNC))) + #define ftello64 _ftelli64 + #define fseeko64 _fseeki64 + #else // old MSC + #define ftello64 ftell + #define fseeko64 fseek + #endif +#endif +#endif + +/* +#ifndef ZPOS64_T + #ifdef _WIN32 + #define ZPOS64_T fpos_t + #else + #include <stdint.h> + #define ZPOS64_T uint64_t + #endif +#endif +*/ + +#ifdef HAVE_MINIZIP64_CONF_H +#include "mz64conf.h" +#endif + +/* a type choosen by DEFINE */ +#ifdef HAVE_64BIT_INT_CUSTOM +typedef 64BIT_INT_CUSTOM_TYPE ZPOS64_T; +#else +#ifdef HAS_STDINT_H +#include "stdint.h" +typedef uint64_t ZPOS64_T; +#else + + +#if defined(_MSC_VER) || defined(__BORLANDC__) +typedef unsigned __int64 ZPOS64_T; +#else +typedef unsigned long long int ZPOS64_T; +#endif +#endif +#endif + + + +#ifdef __cplusplus +extern "C" { +#endif + + +#define ZLIB_FILEFUNC_SEEK_CUR (1) +#define ZLIB_FILEFUNC_SEEK_END (2) +#define ZLIB_FILEFUNC_SEEK_SET (0) + +#define ZLIB_FILEFUNC_MODE_READ (1) +#define ZLIB_FILEFUNC_MODE_WRITE (2) +#define ZLIB_FILEFUNC_MODE_READWRITEFILTER (3) + +#define ZLIB_FILEFUNC_MODE_EXISTING (4) +#define ZLIB_FILEFUNC_MODE_CREATE (8) + + +#ifndef ZCALLBACK + #if (defined(WIN32) || defined(_WIN32) || defined (WINDOWS) || defined (_WINDOWS)) && defined(CALLBACK) && defined (USEWINDOWS_CALLBACK) + #define ZCALLBACK CALLBACK + #else + #define ZCALLBACK + #endif +#endif + + + + +typedef voidpf (ZCALLBACK *open_file_func) OF((voidpf opaque, const char* filename, int mode)); +typedef uLong (ZCALLBACK *read_file_func) OF((voidpf opaque, voidpf stream, void* buf, uLong size)); +typedef uLong (ZCALLBACK *write_file_func) OF((voidpf opaque, voidpf stream, const void* buf, uLong size)); +typedef int (ZCALLBACK *close_file_func) OF((voidpf opaque, voidpf stream)); +typedef int (ZCALLBACK *testerror_file_func) OF((voidpf opaque, voidpf stream)); + +typedef long (ZCALLBACK *tell_file_func) OF((voidpf opaque, voidpf stream)); +typedef long (ZCALLBACK *seek_file_func) OF((voidpf opaque, voidpf stream, uLong offset, int origin)); + + +/* here is the "old" 32 bits structure structure */ +typedef struct zlib_filefunc_def_s +{ + open_file_func zopen_file; + read_file_func zread_file; + write_file_func zwrite_file; + tell_file_func ztell_file; + seek_file_func zseek_file; + close_file_func zclose_file; + testerror_file_func zerror_file; + voidpf opaque; +} zlib_filefunc_def; + +typedef ZPOS64_T (ZCALLBACK *tell64_file_func) OF((voidpf opaque, voidpf stream)); +typedef long (ZCALLBACK *seek64_file_func) OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin)); +typedef voidpf (ZCALLBACK *open64_file_func) OF((voidpf opaque, const void* filename, int mode)); + +typedef struct zlib_filefunc64_def_s +{ + open64_file_func zopen64_file; + read_file_func zread_file; + write_file_func zwrite_file; + tell64_file_func ztell64_file; + seek64_file_func zseek64_file; + close_file_func zclose_file; + testerror_file_func zerror_file; + voidpf opaque; +} zlib_filefunc64_def; + +void fill_fopen64_filefunc OF((zlib_filefunc64_def* pzlib_filefunc_def)); +void fill_fopen_filefunc OF((zlib_filefunc_def* pzlib_filefunc_def)); + +/* now internal definition, only for zip.c and unzip.h */ +typedef struct zlib_filefunc64_32_def_s +{ + zlib_filefunc64_def zfile_func64; + open_file_func zopen32_file; + tell_file_func ztell32_file; + seek_file_func zseek32_file; +} zlib_filefunc64_32_def; + + +#define ZREAD64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zread_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size)) +#define ZWRITE64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zwrite_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size)) +//#define ZTELL64(filefunc,filestream) ((*((filefunc).ztell64_file)) ((filefunc).opaque,filestream)) +//#define ZSEEK64(filefunc,filestream,pos,mode) ((*((filefunc).zseek64_file)) ((filefunc).opaque,filestream,pos,mode)) +#define ZCLOSE64(filefunc,filestream) ((*((filefunc).zfile_func64.zclose_file)) ((filefunc).zfile_func64.opaque,filestream)) +#define ZERROR64(filefunc,filestream) ((*((filefunc).zfile_func64.zerror_file)) ((filefunc).zfile_func64.opaque,filestream)) + +voidpf call_zopen64 OF((const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode)); +long call_zseek64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin)); +ZPOS64_T call_ztell64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream)); + +void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32); + +#define ZOPEN64(filefunc,filename,mode) (call_zopen64((&(filefunc)),(filename),(mode))) +#define ZTELL64(filefunc,filestream) (call_ztell64((&(filefunc)),(filestream))) +#define ZSEEK64(filefunc,filestream,pos,mode) (call_zseek64((&(filefunc)),(filestream),(pos),(mode))) + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/deps/trees.c b/deps/trees.c new file mode 100644 index 0000000..fa41a13 --- /dev/null +++ b/deps/trees.c @@ -0,0 +1,1177 @@ +/* trees.c -- output deflated data using Huffman coding + * Copyright (C) 1995-2012 Jean-loup Gailly + * detect_data_type() function provided freely by Cosmin Truta, 2006 + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process uses several Huffman trees. The more + * common source values are represented by shorter bit sequences. + * + * Each code tree is stored in a compressed form which is itself + * a Huffman encoding of the lengths of all the code strings (in + * ascending order by source values). The actual code strings are + * reconstructed from the lengths in the inflate process, as described + * in the deflate specification. + * + * REFERENCES + * + * Deutsch, L.P.,"'Deflate' Compressed Data Format Specification". + * Available in ftp.uu.net:/pub/archiving/zip/doc/deflate-1.1.doc + * + * Storer, James A. + * Data Compression: Methods and Theory, pp. 49-50. + * Computer Science Press, 1988. ISBN 0-7167-8156-5. + * + * Sedgewick, R. + * Algorithms, p290. + * Addison-Wesley, 1983. ISBN 0-201-06672-6. + */ + +/* @(#) $Id$ */ + +/* #define GEN_TREES_H */ + +#include "deflate.h" + +#ifdef DEBUG +# include <ctype.h> +#endif + +/* =========================================================================== + * Constants + */ + +#define MAX_BL_BITS 7 +/* Bit length codes must not exceed MAX_BL_BITS bits */ + +#define END_BLOCK 256 +/* end of block literal code */ + +#define REP_3_6 16 +/* repeat previous bit length 3-6 times (2 bits of repeat count) */ + +#define REPZ_3_10 17 +/* repeat a zero length 3-10 times (3 bits of repeat count) */ + +#define REPZ_11_138 18 +/* repeat a zero length 11-138 times (7 bits of repeat count) */ + +local const int extra_lbits[LENGTH_CODES] /* extra bits for each length code */ += {0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0}; + +local const int extra_dbits[D_CODES] /* extra bits for each distance code */ += {0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13}; + +local const int extra_blbits[BL_CODES]/* extra bits for each bit length code */ += {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7}; + +local const uch bl_order[BL_CODES] += {16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15}; +/* The lengths of the bit length codes are sent in order of decreasing + * probability, to avoid transmitting the lengths for unused bit length codes. + */ + +/* =========================================================================== + * Local data. These are initialized only once. + */ + +#define DIST_CODE_LEN 512 /* see definition of array dist_code below */ + +#if defined(GEN_TREES_H) || !defined(STDC) +/* non ANSI compilers may not accept trees.h */ + +local ct_data static_ltree[L_CODES+2]; +/* The static literal tree. Since the bit lengths are imposed, there is no + * need for the L_CODES extra codes used during heap construction. However + * The codes 286 and 287 are needed to build a canonical tree (see _tr_init + * below). + */ + +local ct_data static_dtree[D_CODES]; +/* The static distance tree. (Actually a trivial tree since all codes use + * 5 bits.) + */ + +uch _dist_code[DIST_CODE_LEN]; +/* Distance codes. The first 256 values correspond to the distances + * 3 .. 258, the last 256 values correspond to the top 8 bits of + * the 15 bit distances. + */ + +uch _length_code[MAX_MATCH-MIN_MATCH+1]; +/* length code for each normalized match length (0 == MIN_MATCH) */ + +local int base_length[LENGTH_CODES]; +/* First normalized length for each code (0 = MIN_MATCH) */ + +local int base_dist[D_CODES]; +/* First normalized distance for each code (0 = distance of 1) */ + +#else +# include "trees.h" +#endif /* GEN_TREES_H */ + +struct static_tree_desc_s { + const ct_data *static_tree; /* static tree or NULL */ + const intf *extra_bits; /* extra bits for each code or NULL */ + int extra_base; /* base index for extra_bits */ + int elems; /* max number of elements in the tree */ + int max_length; /* max bit length for the codes */ +}; + +local static_tree_desc static_l_desc = +{static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS}; + +local static_tree_desc static_d_desc = +{static_dtree, extra_dbits, 0, D_CODES, MAX_BITS}; + +local static_tree_desc static_bl_desc = +{(const ct_data *)0, extra_blbits, 0, BL_CODES, MAX_BL_BITS}; + +/* =========================================================================== + * Local (static) routines in this file. + */ + +local void tr_static_init OF((void)); +local void init_block OF((deflate_state *s)); +local void pqdownheap OF((deflate_state *s, ct_data *tree, int k)); +local void gen_bitlen OF((deflate_state *s, tree_desc *desc)); +local void gen_codes OF((ct_data *tree, int max_code, ushf *bl_count)); +local void build_tree OF((deflate_state *s, tree_desc *desc)); +local void scan_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local void send_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local int build_bl_tree OF((deflate_state *s)); +local void send_all_trees OF((deflate_state *s, int lcodes, int dcodes, + int blcodes)); +local void compress_block OF((deflate_state *s, const ct_data *ltree, + const ct_data *dtree)); +local int detect_data_type OF((deflate_state *s)); +local unsigned bi_reverse OF((unsigned value, int length)); +local void bi_windup OF((deflate_state *s)); +local void bi_flush OF((deflate_state *s)); +local void copy_block OF((deflate_state *s, charf *buf, unsigned len, + int header)); + +#ifdef GEN_TREES_H +local void gen_trees_header OF((void)); +#endif + +#ifndef DEBUG +# define send_code(s, c, tree) send_bits(s, tree[c].Code, tree[c].Len) +/* Send a code of the given tree. c and tree must not have side effects */ + +#else /* DEBUG */ +# define send_code(s, c, tree) \ +{ if (z_verbose>2) fprintf(stderr,"\ncd %3d ",(c)); \ + send_bits(s, tree[c].Code, tree[c].Len); } +#endif + +/* =========================================================================== + * Output a short LSB first on the stream. + * IN assertion: there is enough room in pendingBuf. + */ +#define put_short(s, w) { \ + put_byte(s, (uch)((w) & 0xff)); \ + put_byte(s, (uch)((ush)(w) >> 8)); \ +} + +/* =========================================================================== + * Send a value on a given number of bits. + * IN assertion: length <= 16 and value fits in length bits. + */ +#ifdef DEBUG +local void send_bits OF((deflate_state *s, int value, int length)); + +local void send_bits(deflate_state *s, int value, int length) +{ + Tracevv((stderr," l %2d v %4x ", length, value)); + Assert(length > 0 && length <= 15, "invalid length"); + s->bits_sent += (ulg)length; + + /* If not enough room in bi_buf, use (valid) bits from bi_buf and + * (16 - bi_valid) bits from value, leaving (width - (16-bi_valid)) + * unused bits in value. + */ + if (s->bi_valid > (int)Buf_size - length) { + s->bi_buf |= (ush)value << s->bi_valid; + put_short(s, s->bi_buf); + s->bi_buf = (ush)value >> (Buf_size - s->bi_valid); + s->bi_valid += length - Buf_size; + } else { + s->bi_buf |= (ush)value << s->bi_valid; + s->bi_valid += length; + } +} +#else /* !DEBUG */ + +#define send_bits(s, value, length) \ +{ int len = length;\ + if (s->bi_valid > (int)Buf_size - len) {\ + int val = value;\ + s->bi_buf |= (ush)val << s->bi_valid;\ + put_short(s, s->bi_buf);\ + s->bi_buf = (ush)val >> (Buf_size - s->bi_valid);\ + s->bi_valid += len - Buf_size;\ + } else {\ + s->bi_buf |= (ush)(value) << s->bi_valid;\ + s->bi_valid += len;\ + }\ +} +#endif /* DEBUG */ + + +/* the arguments must not have side effects */ + +/* =========================================================================== + * Initialize the various 'constant' tables. + */ +local void tr_static_init(void) +{ +#if defined(GEN_TREES_H) || !defined(STDC) + static int static_init_done = 0; + int n; /* iterates over tree elements */ + int bits; /* bit counter */ + int length; /* length value */ + int codes; /* code value */ + int dist; /* distance index */ + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + if (static_init_done) return; + + /* For some embedded targets, global variables are not initialized: */ +#ifdef NO_INIT_GLOBAL_POINTERS + static_l_desc.static_tree = static_ltree; + static_l_desc.extra_bits = extra_lbits; + static_d_desc.static_tree = static_dtree; + static_d_desc.extra_bits = extra_dbits; + static_bl_desc.extra_bits = extra_blbits; +#endif + + /* Initialize the mapping length (0..255) -> length code (0..28) */ + length = 0; + for (codes = 0; codes < LENGTH_CODES-1; codes++) { + base_length[codes] = length; + for (n = 0; n < (1<<extra_lbits[codes]); n++) { + _length_code[length++] = (uch)codes; + } + } + Assert (length == 256, "tr_static_init: length != 256"); + /* Note that the length 255 (match length 258) can be represented + * in two different ways: code 284 + 5 bits or code 285, so we + * overwrite length_code[255] to use the best encoding: + */ + _length_code[length-1] = (uch)codes; + + /* Initialize the mapping dist (0..32K) -> dist code (0..29) */ + dist = 0; + for (codes = 0 ; codes < 16; codes++) { + base_dist[codes] = dist; + for (n = 0; n < (1<<extra_dbits[codes]); n++) { + _dist_code[dist++] = (uch)codes; + } + } + Assert (dist == 256, "tr_static_init: dist != 256"); + dist >>= 7; /* from now on, all distances are divided by 128 */ + for ( ; codes < D_CODES; codes++) { + base_dist[codes] = dist << 7; + for (n = 0; n < (1<<(extra_dbits[codes]-7)); n++) { + _dist_code[256 + dist++] = (uch)codes; + } + } + Assert (dist == 256, "tr_static_init: 256+dist != 512"); + + /* Construct the codes of the static literal tree */ + for (bits = 0; bits <= MAX_BITS; bits++) bl_count[bits] = 0; + n = 0; + while (n <= 143) static_ltree[n++].Len = 8, bl_count[8]++; + while (n <= 255) static_ltree[n++].Len = 9, bl_count[9]++; + while (n <= 279) static_ltree[n++].Len = 7, bl_count[7]++; + while (n <= 287) static_ltree[n++].Len = 8, bl_count[8]++; + /* Codes 286 and 287 do not exist, but we must include them in the + * tree construction to get a canonical Huffman tree (longest code + * all ones) + */ + gen_codes((ct_data *)static_ltree, L_CODES+1, bl_count); + + /* The static distance tree is trivial: */ + for (n = 0; n < D_CODES; n++) { + static_dtree[n].Len = 5; + static_dtree[n].Code = bi_reverse((unsigned)n, 5); + } + static_init_done = 1; + +# ifdef GEN_TREES_H + gen_trees_header(); +# endif +#endif /* defined(GEN_TREES_H) || !defined(STDC) */ +} + +/* =========================================================================== + * Genererate the file trees.h describing the static trees. + */ +#ifdef GEN_TREES_H +# ifndef DEBUG +# include <stdio.h> +# endif + +# define SEPARATOR(i, last, width) \ + ((i) == (last)? "\n};\n\n" : \ + ((i) % (width) == (width)-1 ? ",\n" : ", ")) + +void gen_trees_header(void) +{ + FILE *header = fopen("trees.h", "w"); + int i; + + Assert (header != NULL, "Can't open trees.h"); + fprintf(header, + "/* header created automatically with -DGEN_TREES_H */\n\n"); + + fprintf(header, "local const ct_data static_ltree[L_CODES+2] = {\n"); + for (i = 0; i < L_CODES+2; i++) { + fprintf(header, "{{%3u},{%3u}}%s", static_ltree[i].Code, + static_ltree[i].Len, SEPARATOR(i, L_CODES+1, 5)); + } + + fprintf(header, "local const ct_data static_dtree[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "{{%2u},{%2u}}%s", static_dtree[i].Code, + static_dtree[i].Len, SEPARATOR(i, D_CODES-1, 5)); + } + + fprintf(header, "const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = {\n"); + for (i = 0; i < DIST_CODE_LEN; i++) { + fprintf(header, "%2u%s", _dist_code[i], + SEPARATOR(i, DIST_CODE_LEN-1, 20)); + } + + fprintf(header, + "const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= {\n"); + for (i = 0; i < MAX_MATCH-MIN_MATCH+1; i++) { + fprintf(header, "%2u%s", _length_code[i], + SEPARATOR(i, MAX_MATCH-MIN_MATCH, 20)); + } + + fprintf(header, "local const int base_length[LENGTH_CODES] = {\n"); + for (i = 0; i < LENGTH_CODES; i++) { + fprintf(header, "%1u%s", base_length[i], + SEPARATOR(i, LENGTH_CODES-1, 20)); + } + + fprintf(header, "local const int base_dist[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "%5u%s", base_dist[i], + SEPARATOR(i, D_CODES-1, 10)); + } + + fclose(header); +} +#endif /* GEN_TREES_H */ + +/* =========================================================================== + * Initialize the tree data structures for a new zlib stream. + */ +void ZLIB_INTERNAL _tr_init(deflate_state *s) +{ + tr_static_init(); + + s->l_desc.dyn_tree = s->dyn_ltree; + s->l_desc.stat_desc = &static_l_desc; + + s->d_desc.dyn_tree = s->dyn_dtree; + s->d_desc.stat_desc = &static_d_desc; + + s->bl_desc.dyn_tree = s->bl_tree; + s->bl_desc.stat_desc = &static_bl_desc; + + s->bi_buf = 0; + s->bi_valid = 0; +#ifdef DEBUG + s->compressed_len = 0L; + s->bits_sent = 0L; +#endif + + /* Initialize the first block of the first file: */ + init_block(s); +} + +/* =========================================================================== + * Initialize a new block. + */ +local void init_block(deflate_state *s) +{ + int n; /* iterates over tree elements */ + + /* Initialize the trees. */ + for (n = 0; n < L_CODES; n++) s->dyn_ltree[n].Freq = 0; + for (n = 0; n < D_CODES; n++) s->dyn_dtree[n].Freq = 0; + for (n = 0; n < BL_CODES; n++) s->bl_tree[n].Freq = 0; + + s->dyn_ltree[END_BLOCK].Freq = 1; + s->opt_len = s->static_len = 0L; + s->last_lit = s->matches = 0; +} + +#define SMALLEST 1 +/* Index within the heap array of least frequent node in the Huffman tree */ + + +/* =========================================================================== + * Remove the smallest element from the heap and recreate the heap with + * one less element. Updates heap and heap_len. + */ +#define pqremove(s, tree, top) \ +{\ + top = s->heap[SMALLEST]; \ + s->heap[SMALLEST] = s->heap[s->heap_len--]; \ + pqdownheap(s, tree, SMALLEST); \ +} + +/* =========================================================================== + * Compares to subtrees, using the tree depth as tie breaker when + * the subtrees have equal frequency. This minimizes the worst case length. + */ +#define smaller(tree, n, m, depth) \ + (tree[n].Freq < tree[m].Freq || \ + (tree[n].Freq == tree[m].Freq && depth[n] <= depth[m])) + +/* =========================================================================== + * Restore the heap property by moving down the tree starting at node k, + * exchanging a node with the smallest of its two sons if necessary, stopping + * when the heap property is re-established (each father smaller than its + * two sons). + */ +local void pqdownheap(deflate_state *s, ct_data *tree, int k) +{ + int v = s->heap[k]; + int j = k << 1; /* left son of k */ + while (j <= s->heap_len) { + /* Set j to the smallest of the two sons: */ + if (j < s->heap_len && + smaller(tree, s->heap[j+1], s->heap[j], s->depth)) { + j++; + } + /* Exit if v is smaller than both sons */ + if (smaller(tree, v, s->heap[j], s->depth)) break; + + /* Exchange v with the smallest son */ + s->heap[k] = s->heap[j]; k = j; + + /* And continue down the tree, setting j to the left son of k */ + j <<= 1; + } + s->heap[k] = v; +} + +/* =========================================================================== + * Compute the optimal bit lengths for a tree and update the total bit length + * for the current block. + * IN assertion: the fields freq and dad are set, heap[heap_max] and + * above are the tree nodes sorted by increasing frequency. + * OUT assertions: the field len is set to the optimal bit length, the + * array bl_count contains the frequencies for each bit length. + * The length opt_len is updated; static_len is also updated if stree is + * not null. + */ +local void gen_bitlen(deflate_state *s, tree_desc *desc) +{ + ct_data *tree = desc->dyn_tree; + int max_code = desc->max_code; + const ct_data *stree = desc->stat_desc->static_tree; + const intf *extra = desc->stat_desc->extra_bits; + int base = desc->stat_desc->extra_base; + int max_length = desc->stat_desc->max_length; + int h; /* heap index */ + int n, m; /* iterate over the tree elements */ + int bits; /* bit length */ + int xbits; /* extra bits */ + ush f; /* frequency */ + int overflow = 0; /* number of elements with bit length too large */ + + for (bits = 0; bits <= MAX_BITS; bits++) s->bl_count[bits] = 0; + + /* In a first pass, compute the optimal bit lengths (which may + * overflow in the case of the bit length tree). + */ + tree[s->heap[s->heap_max]].Len = 0; /* root of the heap */ + + for (h = s->heap_max+1; h < HEAP_SIZE; h++) { + n = s->heap[h]; + bits = tree[tree[n].Dad].Len + 1; + if (bits > max_length) bits = max_length, overflow++; + tree[n].Len = (ush)bits; + /* We overwrite tree[n].Dad which is no longer needed */ + + if (n > max_code) continue; /* not a leaf node */ + + s->bl_count[bits]++; + xbits = 0; + if (n >= base) xbits = extra[n-base]; + f = tree[n].Freq; + s->opt_len += (ulg)f * (bits + xbits); + if (stree) s->static_len += (ulg)f * (stree[n].Len + xbits); + } + if (overflow == 0) return; + + Trace((stderr,"\nbit length overflow\n")); + /* This happens for example on obj2 and pic of the Calgary corpus */ + + /* Find the first bit length which could increase: */ + do { + bits = max_length-1; + while (s->bl_count[bits] == 0) bits--; + s->bl_count[bits]--; /* move one leaf down the tree */ + s->bl_count[bits+1] += 2; /* move one overflow item as its brother */ + s->bl_count[max_length]--; + /* The brother of the overflow item also moves one step up, + * but this does not affect bl_count[max_length] + */ + overflow -= 2; + } while (overflow > 0); + + /* Now recompute all bit lengths, scanning in increasing frequency. + * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all + * lengths instead of fixing only the wrong ones. This idea is taken + * from 'ar' written by Haruhiko Okumura.) + */ + for (bits = max_length; bits != 0; bits--) { + n = s->bl_count[bits]; + while (n != 0) { + m = s->heap[--h]; + if (m > max_code) continue; + if ((unsigned) tree[m].Len != (unsigned) bits) { + Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits)); + s->opt_len += ((long)bits - (long)tree[m].Len) + *(long)tree[m].Freq; + tree[m].Len = (ush)bits; + } + n--; + } + } +} + +/* =========================================================================== + * Generate the codes for a given tree and bit counts (which need not be + * optimal). + * IN assertion: the array bl_count contains the bit length statistics for + * the given tree and the field len is set for all tree elements. + * OUT assertion: the field code is set for all tree elements of non + * zero code length. + */ +local void gen_codes (ct_data *tree, int max_code, ushf *bl_count) +{ + ush next_code[MAX_BITS+1]; /* next code value for each bit length */ + ush codes = 0; /* running code value */ + int bits; /* bit index */ + int n; /* code index */ + + /* The distribution counts are first used to generate the code values + * without bit reversal. + */ + for (bits = 1; bits <= MAX_BITS; bits++) { + next_code[bits] = codes = (codes + bl_count[bits-1]) << 1; + } + /* Check that the bit counts in bl_count are consistent. The last code + * must be all ones. + */ + Assert (codes + bl_count[MAX_BITS]-1 == (1<<MAX_BITS)-1, + "inconsistent bit counts"); + Tracev((stderr,"\ngen_codes: max_code %d ", max_code)); + + for (n = 0; n <= max_code; n++) { + int len = tree[n].Len; + if (len == 0) continue; + /* Now reverse the bits */ + tree[n].Code = bi_reverse(next_code[len]++, len); + + Tracecv(tree != static_ltree, (stderr,"\nn %3d %c l %2d c %4x (%x) ", + n, (isgraph(n) ? n : ' '), len, tree[n].Code, next_code[len]-1)); + } +} + +/* =========================================================================== + * Construct one Huffman tree and assigns the code bit strings and lengths. + * Update the total bit length for the current block. + * IN assertion: the field freq is set for all tree elements. + * OUT assertions: the fields len and code are set to the optimal bit length + * and corresponding code. The length opt_len is updated; static_len is + * also updated if stree is not null. The field max_code is set. + */ +local void build_tree(deflate_state *s, tree_desc *desc) +{ + ct_data *tree = desc->dyn_tree; + const ct_data *stree = desc->stat_desc->static_tree; + int elems = desc->stat_desc->elems; + int n, m; /* iterate over heap elements */ + int max_code = -1; /* largest code with non zero frequency */ + int node; /* new node being created */ + + /* Construct the initial heap, with least frequent element in + * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1]. + * heap[0] is not used. + */ + s->heap_len = 0, s->heap_max = HEAP_SIZE; + + for (n = 0; n < elems; n++) { + if (tree[n].Freq != 0) { + s->heap[++(s->heap_len)] = max_code = n; + s->depth[n] = 0; + } else { + tree[n].Len = 0; + } + } + + /* The pkzip format requires that at least one distance code exists, + * and that at least one bit should be sent even if there is only one + * possible code. So to avoid special checks later on we force at least + * two codes of non zero frequency. + */ + while (s->heap_len < 2) { + node = s->heap[++(s->heap_len)] = (max_code < 2 ? ++max_code : 0); + tree[node].Freq = 1; + s->depth[node] = 0; + s->opt_len--; if (stree) s->static_len -= stree[node].Len; + /* node is 0 or 1 so it does not have extra bits */ + } + desc->max_code = max_code; + + /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree, + * establish sub-heaps of increasing lengths: + */ + for (n = s->heap_len/2; n >= 1; n--) pqdownheap(s, tree, n); + + /* Construct the Huffman tree by repeatedly combining the least two + * frequent nodes. + */ + node = elems; /* next internal node of the tree */ + do { + pqremove(s, tree, n); /* n = node of least frequency */ + m = s->heap[SMALLEST]; /* m = node of next least frequency */ + + s->heap[--(s->heap_max)] = n; /* keep the nodes sorted by frequency */ + s->heap[--(s->heap_max)] = m; + + /* Create a new node father of n and m */ + tree[node].Freq = tree[n].Freq + tree[m].Freq; + s->depth[node] = (uch)((s->depth[n] >= s->depth[m] ? + s->depth[n] : s->depth[m]) + 1); + tree[n].Dad = tree[m].Dad = (ush)node; +#ifdef DUMP_BL_TREE + if (tree == s->bl_tree) { + fprintf(stderr,"\nnode %d(%d), sons %d(%d) %d(%d)", + node, tree[node].Freq, n, tree[n].Freq, m, tree[m].Freq); + } +#endif + /* and insert the new node in the heap */ + s->heap[SMALLEST] = node++; + pqdownheap(s, tree, SMALLEST); + + } while (s->heap_len >= 2); + + s->heap[--(s->heap_max)] = s->heap[SMALLEST]; + + /* At this point, the fields freq and dad are set. We can now + * generate the bit lengths. + */ + gen_bitlen(s, (tree_desc *)desc); + + /* The field len is now set, we can generate the bit codes */ + gen_codes ((ct_data *)tree, max_code, s->bl_count); +} + +/* =========================================================================== + * Scan a literal or distance tree to determine the frequencies of the codes + * in the bit length tree. + */ +local void scan_tree (deflate_state *s, ct_data *tree, int max_code) +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + if (nextlen == 0) max_count = 138, min_count = 3; + tree[max_code+1].Len = (ush)0xffff; /* guard */ + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + s->bl_tree[curlen].Freq += count; + } else if (curlen != 0) { + if (curlen != prevlen) s->bl_tree[curlen].Freq++; + s->bl_tree[REP_3_6].Freq++; + } else if (count <= 10) { + s->bl_tree[REPZ_3_10].Freq++; + } else { + s->bl_tree[REPZ_11_138].Freq++; + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Send a literal or distance tree in compressed form, using the codes in + * bl_tree. + */ +local void send_tree (deflate_state *s, ct_data *tree, int max_code) +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + /* tree[max_code+1].Len = -1; */ /* guard already set */ + if (nextlen == 0) max_count = 138, min_count = 3; + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + do { send_code(s, curlen, s->bl_tree); } while (--count != 0); + + } else if (curlen != 0) { + if (curlen != prevlen) { + send_code(s, curlen, s->bl_tree); count--; + } + Assert(count >= 3 && count <= 6, " 3_6?"); + send_code(s, REP_3_6, s->bl_tree); send_bits(s, count-3, 2); + + } else if (count <= 10) { + send_code(s, REPZ_3_10, s->bl_tree); send_bits(s, count-3, 3); + + } else { + send_code(s, REPZ_11_138, s->bl_tree); send_bits(s, count-11, 7); + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Construct the Huffman tree for the bit lengths and return the index in + * bl_order of the last bit length code to send. + */ +local int build_bl_tree(deflate_state *s) +{ + int max_blindex; /* index of last bit length code of non zero freq */ + + /* Determine the bit length frequencies for literal and distance trees */ + scan_tree(s, (ct_data *)s->dyn_ltree, s->l_desc.max_code); + scan_tree(s, (ct_data *)s->dyn_dtree, s->d_desc.max_code); + + /* Build the bit length tree: */ + build_tree(s, (tree_desc *)(&(s->bl_desc))); + /* opt_len now includes the length of the tree representations, except + * the lengths of the bit lengths codes and the 5+5+4 bits for the counts. + */ + + /* Determine the number of bit length codes to send. The pkzip format + * requires that at least 4 bit length codes be sent. (appnote.txt says + * 3 but the actual value used is 4.) + */ + for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) { + if (s->bl_tree[bl_order[max_blindex]].Len != 0) break; + } + /* Update opt_len to include the bit length tree and counts */ + s->opt_len += 3*(max_blindex+1) + 5+5+4; + Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld", + s->opt_len, s->static_len)); + + return max_blindex; +} + +/* =========================================================================== + * Send the header for a block using dynamic Huffman trees: the counts, the + * lengths of the bit length codes, the literal tree and the distance tree. + * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4. + */ +local void send_all_trees(deflate_state *s, int lcodes, int dcodes, int blcodes) +{ + int rank; /* index in bl_order */ + + Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes"); + Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES, + "too many codes"); + Tracev((stderr, "\nbl counts: ")); + send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */ + send_bits(s, dcodes-1, 5); + send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */ + for (rank = 0; rank < blcodes; rank++) { + Tracev((stderr, "\nbl code %2d ", bl_order[rank])); + send_bits(s, s->bl_tree[bl_order[rank]].Len, 3); + } + Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_ltree, lcodes-1); /* literal tree */ + Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_dtree, dcodes-1); /* distance tree */ + Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent)); +} + +/* =========================================================================== + * Send a stored block + */ +void ZLIB_INTERNAL _tr_stored_block(deflate_state *s, charf *buf, ulg stored_len, int last) +{ + send_bits(s, (STORED_BLOCK<<1)+last, 3); /* send block type */ +#ifdef DEBUG + s->compressed_len = (s->compressed_len + 3 + 7) & (ulg)~7L; + s->compressed_len += (stored_len + 4) << 3; +#endif + copy_block(s, buf, (unsigned)stored_len, 1); /* with header */ +} + +/* =========================================================================== + * Flush the bits in the bit buffer to pending output (leaves at most 7 bits) + */ +void ZLIB_INTERNAL _tr_flush_bits(deflate_state *s) +{ + bi_flush(s); +} + +/* =========================================================================== + * Send one empty static block to give enough lookahead for inflate. + * This takes 10 bits, of which 7 may remain in the bit buffer. + */ +void ZLIB_INTERNAL _tr_align(deflate_state *s) +{ + send_bits(s, STATIC_TREES<<1, 3); + send_code(s, END_BLOCK, static_ltree); +#ifdef DEBUG + s->compressed_len += 10L; /* 3 for block type, 7 for EOB */ +#endif + bi_flush(s); +} + +/* =========================================================================== + * Determine the best encoding for the current block: dynamic trees, static + * trees or store, and output the encoded block to the zip file. + */ +void ZLIB_INTERNAL _tr_flush_block(deflate_state *s, charf *buf, ulg stored_len, int last) +{ + ulg opt_lenb, static_lenb; /* opt_len and static_len in bytes */ + int max_blindex = 0; /* index of last bit length code of non zero freq */ + + /* Build the Huffman trees unless a stored block is forced */ + if (s->level > 0) { + + /* Check if the file is binary or text */ + if (s->strm->data_type == Z_UNKNOWN) + s->strm->data_type = detect_data_type(s); + + /* Construct the literal and distance trees */ + build_tree(s, (tree_desc *)(&(s->l_desc))); + Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + + build_tree(s, (tree_desc *)(&(s->d_desc))); + Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + /* At this point, opt_len and static_len are the total bit lengths of + * the compressed block data, excluding the tree representations. + */ + + /* Build the bit length tree for the above two trees, and get the index + * in bl_order of the last bit length code to send. + */ + max_blindex = build_bl_tree(s); + + /* Determine the best encoding. Compute the block lengths in bytes. */ + opt_lenb = (s->opt_len+3+7)>>3; + static_lenb = (s->static_len+3+7)>>3; + + Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ", + opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len, + s->last_lit)); + + if (static_lenb <= opt_lenb) opt_lenb = static_lenb; + + } else { + Assert(buf != (char*)0, "lost buf"); + opt_lenb = static_lenb = stored_len + 5; /* force a stored block */ + } + +#ifdef FORCE_STORED + if (buf != (char*)0) { /* force stored block */ +#else + if (stored_len+4 <= opt_lenb && buf != (char*)0) { + /* 4: two words for the lengths */ +#endif + /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE. + * Otherwise we can't have processed more than WSIZE input bytes since + * the last block flush, because compression would have been + * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to + * transform a block into a stored block. + */ + _tr_stored_block(s, buf, stored_len, last); + +#ifdef FORCE_STATIC + } else if (static_lenb >= 0) { /* force static trees */ +#else + } else if (s->strategy == Z_FIXED || static_lenb == opt_lenb) { +#endif + send_bits(s, (STATIC_TREES<<1)+last, 3); + compress_block(s, (const ct_data *)static_ltree, + (const ct_data *)static_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->static_len; +#endif + } else { + send_bits(s, (DYN_TREES<<1)+last, 3); + send_all_trees(s, s->l_desc.max_code+1, s->d_desc.max_code+1, + max_blindex+1); + compress_block(s, (const ct_data *)s->dyn_ltree, + (const ct_data *)s->dyn_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->opt_len; +#endif + } + Assert (s->compressed_len == s->bits_sent, "bad compressed size"); + /* The above check is made mod 2^32, for files larger than 512 MB + * and uLong implemented on 32 bits. + */ + init_block(s); + + if (last) { + bi_windup(s); +#ifdef DEBUG + s->compressed_len += 7; /* align on byte boundary */ +#endif + } + Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3, + s->compressed_len-7*last)); + } + + /* =========================================================================== + * Save the match info and tally the frequency counts. Return true if + * the current block must be flushed. + */ + int ZLIB_INTERNAL _tr_tally (deflate_state *s, unsigned dist, unsigned lc) + { + s->d_buf[s->last_lit] = (ush)dist; + s->l_buf[s->last_lit++] = (uch)lc; + if (dist == 0) { + /* lc is the unmatched char */ + s->dyn_ltree[lc].Freq++; + } else { + s->matches++; + /* Here, lc is the match length - MIN_MATCH */ + dist--; /* dist = match distance - 1 */ + Assert((ush)dist < (ush)MAX_DIST(s) && + (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) && + (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match"); + + s->dyn_ltree[_length_code[lc]+LITERALS+1].Freq++; + s->dyn_dtree[d_code(dist)].Freq++; + } + +#ifdef TRUNCATE_BLOCK + /* Try to guess if it is profitable to stop the current block here */ + if ((s->last_lit & 0x1fff) == 0 && s->level > 2) { + /* Compute an upper bound for the compressed length */ + ulg out_length = (ulg)s->last_lit*8L; + ulg in_length = (ulg)((long)s->strstart - s->block_start); + int dcode; + for (dcode = 0; dcode < D_CODES; dcode++) { + out_length += (ulg)s->dyn_dtree[dcode].Freq * + (5L+extra_dbits[dcode]); + } + out_length >>= 3; + Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ", + s->last_lit, in_length, out_length, + 100L - out_length*100L/in_length)); + if (s->matches < s->last_lit/2 && out_length < in_length/2) return 1; + } +#endif + return (s->last_lit == s->lit_bufsize-1); + /* We avoid equality with lit_bufsize because of wraparound at 64K + * on 16 bit machines and because stored blocks are restricted to + * 64K-1 bytes. + */ + } + + /* =========================================================================== + * Send the block data compressed using the given Huffman trees + */ + local void compress_block(deflate_state *s, const ct_data *ltree, const ct_data *dtree) + { + unsigned dist; /* distance of matched string */ + int lc; /* match length or unmatched char (if dist == 0) */ + unsigned lx = 0; /* running index in l_buf */ + unsigned codes; /* the code to send */ + int extra; /* number of extra bits to send */ + + if (s->last_lit != 0) do { + dist = s->d_buf[lx]; + lc = s->l_buf[lx++]; + if (dist == 0) { + send_code(s, lc, ltree); /* send a literal byte */ + Tracecv(isgraph(lc), (stderr," '%c' ", lc)); + } else { + /* Here, lc is the match length - MIN_MATCH */ + codes = _length_code[lc]; + send_code(s, codes + LITERALS+1, ltree); /* send the length code */ + extra = extra_lbits[codes]; + if (extra != 0) { + lc -= base_length[codes]; + send_bits(s, lc, extra); /* send the extra length bits */ + } + dist--; /* dist is now the match distance - 1 */ + codes = d_code(dist); + Assert (codes < D_CODES, "bad d_code"); + + send_code(s, codes, dtree); /* send the distance code */ + extra = extra_dbits[codes]; + if (extra != 0) { + dist -= base_dist[codes]; + send_bits(s, dist, extra); /* send the extra distance bits */ + } + } /* literal or match pair ? */ + + /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */ + Assert((uInt)(s->pending) < s->lit_bufsize + 2*lx, + "pendingBuf overflow"); + + } while (lx < s->last_lit); + + send_code(s, END_BLOCK, ltree); + } + + /* =========================================================================== + * Check if the data type is TEXT or BINARY, using the following algorithm: + * - TEXT if the two conditions below are satisfied: + * a) There are no non-portable control characters belonging to the + * "black list" (0..6, 14..25, 28..31). + * b) There is at least one printable character belonging to the + * "white list" (9 {TAB}, 10 {LF}, 13 {CR}, 32..255). + * - BINARY otherwise. + * - The following partially-portable control characters form a + * "gray list" that is ignored in this detection algorithm: + * (7 {BEL}, 8 {BS}, 11 {VT}, 12 {FF}, 26 {SUB}, 27 {ESC}). + * IN assertion: the fields Freq of dyn_ltree are set. + */ + local int detect_data_type(deflate_state *s) + { + /* black_mask is the bit mask of black-listed bytes + * set bits 0..6, 14..25, and 28..31 + * 0xf3ffc07f = binary 11110011111111111100000001111111 + */ + unsigned long black_mask = 0xf3ffc07fUL; + int n; + + /* Check for non-textual ("black-listed") bytes. */ + for (n = 0; n <= 31; n++, black_mask >>= 1) + if ((black_mask & 1) && (s->dyn_ltree[n].Freq != 0)) + return Z_BINARY; + + /* Check for textual ("white-listed") bytes. */ + if (s->dyn_ltree[9].Freq != 0 || s->dyn_ltree[10].Freq != 0 + || s->dyn_ltree[13].Freq != 0) + return Z_TEXT; + for (n = 32; n < LITERALS; n++) + if (s->dyn_ltree[n].Freq != 0) + return Z_TEXT; + + /* There are no "black-listed" or "white-listed" bytes: + * this stream either is empty or has tolerated ("gray-listed") bytes only. + */ + return Z_BINARY; + } + + /* =========================================================================== + * Reverse the first len bits of a code, using straightforward code (a faster + * method would use a table) + * IN assertion: 1 <= len <= 15 + */ + local unsigned bi_reverse(unsigned codes, int len) + { + register unsigned res = 0; + do { + res |= codes & 1; + codes >>= 1, res <<= 1; + } while (--len > 0); + return res >> 1; + } + + /* =========================================================================== + * Flush the bit buffer, keeping at most 7 bits in it. + */ + local void bi_flush(deflate_state *s) + { + if (s->bi_valid == 16) { + put_short(s, s->bi_buf); + s->bi_buf = 0; + s->bi_valid = 0; + } else if (s->bi_valid >= 8) { + put_byte(s, (Byte)s->bi_buf); + s->bi_buf >>= 8; + s->bi_valid -= 8; + } + } + + /* =========================================================================== + * Flush the bit buffer and align the output on a byte boundary + */ + local void bi_windup(deflate_state *s) + { + if (s->bi_valid > 8) { + put_short(s, s->bi_buf); + } else if (s->bi_valid > 0) { + put_byte(s, (Byte)s->bi_buf); + } + s->bi_buf = 0; + s->bi_valid = 0; +#ifdef DEBUG + s->bits_sent = (s->bits_sent+7) & ~7; +#endif + } + + /* =========================================================================== + * Copy a stored block, storing first the length and its + * one's complement if requested. + */ + local void copy_block(deflate_state *s, charf *buf, unsigned len, int header) + { + bi_windup(s); /* align on byte boundary */ + + if (header) { + put_short(s, (ush)len); + put_short(s, (ush)~len); +#ifdef DEBUG + s->bits_sent += 2*16; +#endif + } +#ifdef DEBUG + s->bits_sent += (ulg)len<<3; +#endif + while (len--) { + put_byte(s, *buf++); + } + } diff --git a/deps/trees.h b/deps/trees.h new file mode 100644 index 0000000..c0261b2 --- /dev/null +++ b/deps/trees.h @@ -0,0 +1,132 @@ +/* header created automatically with -DGEN_TREES_H */ +#ifndef _TREES_H +#define _TREES_H + +local const ct_data static_ltree[L_CODES+2] = { +{{ 12},{ 8}}, {{140},{ 8}}, {{ 76},{ 8}}, {{204},{ 8}}, {{ 44},{ 8}}, +{{172},{ 8}}, {{108},{ 8}}, {{236},{ 8}}, {{ 28},{ 8}}, {{156},{ 8}}, +{{ 92},{ 8}}, {{220},{ 8}}, {{ 60},{ 8}}, {{188},{ 8}}, {{124},{ 8}}, +{{252},{ 8}}, {{ 2},{ 8}}, {{130},{ 8}}, {{ 66},{ 8}}, {{194},{ 8}}, +{{ 34},{ 8}}, {{162},{ 8}}, {{ 98},{ 8}}, {{226},{ 8}}, {{ 18},{ 8}}, +{{146},{ 8}}, {{ 82},{ 8}}, {{210},{ 8}}, {{ 50},{ 8}}, {{178},{ 8}}, +{{114},{ 8}}, {{242},{ 8}}, {{ 10},{ 8}}, {{138},{ 8}}, {{ 74},{ 8}}, +{{202},{ 8}}, {{ 42},{ 8}}, {{170},{ 8}}, {{106},{ 8}}, {{234},{ 8}}, +{{ 26},{ 8}}, {{154},{ 8}}, {{ 90},{ 8}}, {{218},{ 8}}, {{ 58},{ 8}}, +{{186},{ 8}}, {{122},{ 8}}, {{250},{ 8}}, {{ 6},{ 8}}, {{134},{ 8}}, +{{ 70},{ 8}}, {{198},{ 8}}, {{ 38},{ 8}}, {{166},{ 8}}, {{102},{ 8}}, +{{230},{ 8}}, {{ 22},{ 8}}, {{150},{ 8}}, {{ 86},{ 8}}, {{214},{ 8}}, +{{ 54},{ 8}}, {{182},{ 8}}, {{118},{ 8}}, {{246},{ 8}}, {{ 14},{ 8}}, +{{142},{ 8}}, {{ 78},{ 8}}, {{206},{ 8}}, {{ 46},{ 8}}, {{174},{ 8}}, +{{110},{ 8}}, {{238},{ 8}}, {{ 30},{ 8}}, {{158},{ 8}}, {{ 94},{ 8}}, +{{222},{ 8}}, {{ 62},{ 8}}, {{190},{ 8}}, {{126},{ 8}}, {{254},{ 8}}, +{{ 1},{ 8}}, {{129},{ 8}}, {{ 65},{ 8}}, {{193},{ 8}}, {{ 33},{ 8}}, +{{161},{ 8}}, {{ 97},{ 8}}, {{225},{ 8}}, {{ 17},{ 8}}, {{145},{ 8}}, +{{ 81},{ 8}}, {{209},{ 8}}, {{ 49},{ 8}}, {{177},{ 8}}, {{113},{ 8}}, +{{241},{ 8}}, {{ 9},{ 8}}, {{137},{ 8}}, {{ 73},{ 8}}, {{201},{ 8}}, +{{ 41},{ 8}}, {{169},{ 8}}, {{105},{ 8}}, {{233},{ 8}}, {{ 25},{ 8}}, +{{153},{ 8}}, {{ 89},{ 8}}, {{217},{ 8}}, {{ 57},{ 8}}, {{185},{ 8}}, +{{121},{ 8}}, {{249},{ 8}}, {{ 5},{ 8}}, {{133},{ 8}}, {{ 69},{ 8}}, +{{197},{ 8}}, {{ 37},{ 8}}, {{165},{ 8}}, {{101},{ 8}}, {{229},{ 8}}, +{{ 21},{ 8}}, {{149},{ 8}}, {{ 85},{ 8}}, {{213},{ 8}}, {{ 53},{ 8}}, +{{181},{ 8}}, {{117},{ 8}}, {{245},{ 8}}, {{ 13},{ 8}}, {{141},{ 8}}, +{{ 77},{ 8}}, {{205},{ 8}}, {{ 45},{ 8}}, {{173},{ 8}}, {{109},{ 8}}, +{{237},{ 8}}, {{ 29},{ 8}}, {{157},{ 8}}, {{ 93},{ 8}}, {{221},{ 8}}, +{{ 61},{ 8}}, {{189},{ 8}}, {{125},{ 8}}, {{253},{ 8}}, {{ 19},{ 9}}, +{{275},{ 9}}, {{147},{ 9}}, {{403},{ 9}}, {{ 83},{ 9}}, {{339},{ 9}}, +{{211},{ 9}}, {{467},{ 9}}, {{ 51},{ 9}}, {{307},{ 9}}, {{179},{ 9}}, +{{435},{ 9}}, {{115},{ 9}}, {{371},{ 9}}, {{243},{ 9}}, {{499},{ 9}}, +{{ 11},{ 9}}, {{267},{ 9}}, {{139},{ 9}}, {{395},{ 9}}, {{ 75},{ 9}}, +{{331},{ 9}}, {{203},{ 9}}, {{459},{ 9}}, {{ 43},{ 9}}, {{299},{ 9}}, +{{171},{ 9}}, {{427},{ 9}}, {{107},{ 9}}, {{363},{ 9}}, {{235},{ 9}}, +{{491},{ 9}}, {{ 27},{ 9}}, {{283},{ 9}}, {{155},{ 9}}, {{411},{ 9}}, +{{ 91},{ 9}}, {{347},{ 9}}, {{219},{ 9}}, {{475},{ 9}}, {{ 59},{ 9}}, +{{315},{ 9}}, {{187},{ 9}}, {{443},{ 9}}, {{123},{ 9}}, {{379},{ 9}}, +{{251},{ 9}}, {{507},{ 9}}, {{ 7},{ 9}}, {{263},{ 9}}, {{135},{ 9}}, +{{391},{ 9}}, {{ 71},{ 9}}, {{327},{ 9}}, {{199},{ 9}}, {{455},{ 9}}, +{{ 39},{ 9}}, {{295},{ 9}}, {{167},{ 9}}, {{423},{ 9}}, {{103},{ 9}}, +{{359},{ 9}}, {{231},{ 9}}, {{487},{ 9}}, {{ 23},{ 9}}, {{279},{ 9}}, +{{151},{ 9}}, {{407},{ 9}}, {{ 87},{ 9}}, {{343},{ 9}}, {{215},{ 9}}, +{{471},{ 9}}, {{ 55},{ 9}}, {{311},{ 9}}, {{183},{ 9}}, {{439},{ 9}}, +{{119},{ 9}}, {{375},{ 9}}, {{247},{ 9}}, {{503},{ 9}}, {{ 15},{ 9}}, +{{271},{ 9}}, {{143},{ 9}}, {{399},{ 9}}, {{ 79},{ 9}}, {{335},{ 9}}, +{{207},{ 9}}, {{463},{ 9}}, {{ 47},{ 9}}, {{303},{ 9}}, {{175},{ 9}}, +{{431},{ 9}}, {{111},{ 9}}, {{367},{ 9}}, {{239},{ 9}}, {{495},{ 9}}, +{{ 31},{ 9}}, {{287},{ 9}}, {{159},{ 9}}, {{415},{ 9}}, {{ 95},{ 9}}, +{{351},{ 9}}, {{223},{ 9}}, {{479},{ 9}}, {{ 63},{ 9}}, {{319},{ 9}}, +{{191},{ 9}}, {{447},{ 9}}, {{127},{ 9}}, {{383},{ 9}}, {{255},{ 9}}, +{{511},{ 9}}, {{ 0},{ 7}}, {{ 64},{ 7}}, {{ 32},{ 7}}, {{ 96},{ 7}}, +{{ 16},{ 7}}, {{ 80},{ 7}}, {{ 48},{ 7}}, {{112},{ 7}}, {{ 8},{ 7}}, +{{ 72},{ 7}}, {{ 40},{ 7}}, {{104},{ 7}}, {{ 24},{ 7}}, {{ 88},{ 7}}, +{{ 56},{ 7}}, {{120},{ 7}}, {{ 4},{ 7}}, {{ 68},{ 7}}, {{ 36},{ 7}}, +{{100},{ 7}}, {{ 20},{ 7}}, {{ 84},{ 7}}, {{ 52},{ 7}}, {{116},{ 7}}, +{{ 3},{ 8}}, {{131},{ 8}}, {{ 67},{ 8}}, {{195},{ 8}}, {{ 35},{ 8}}, +{{163},{ 8}}, {{ 99},{ 8}}, {{227},{ 8}} +}; + +local const ct_data static_dtree[D_CODES] = { +{{ 0},{ 5}}, {{16},{ 5}}, {{ 8},{ 5}}, {{24},{ 5}}, {{ 4},{ 5}}, +{{20},{ 5}}, {{12},{ 5}}, {{28},{ 5}}, {{ 2},{ 5}}, {{18},{ 5}}, +{{10},{ 5}}, {{26},{ 5}}, {{ 6},{ 5}}, {{22},{ 5}}, {{14},{ 5}}, +{{30},{ 5}}, {{ 1},{ 5}}, {{17},{ 5}}, {{ 9},{ 5}}, {{25},{ 5}}, +{{ 5},{ 5}}, {{21},{ 5}}, {{13},{ 5}}, {{29},{ 5}}, {{ 3},{ 5}}, +{{19},{ 5}}, {{11},{ 5}}, {{27},{ 5}}, {{ 7},{ 5}}, {{23},{ 5}} +}; + +const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = { + 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8, + 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10, +10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, +11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, +12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17, +18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29 +}; + +const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= { + 0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12, +13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16, +17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19, +19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, +21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22, +22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28 +}; + +local const int base_length[LENGTH_CODES] = { +0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56, +64, 80, 96, 112, 128, 160, 192, 224, 0 +}; + +local const int base_dist[D_CODES] = { + 0, 1, 2, 3, 4, 6, 8, 12, 16, 24, + 32, 48, 64, 96, 128, 192, 256, 384, 512, 768, + 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576 +}; + + +#endif diff --git a/deps/uncompr.c b/deps/uncompr.c new file mode 100644 index 0000000..c7e30b3 --- /dev/null +++ b/deps/uncompr.c @@ -0,0 +1,55 @@ +/* uncompr.c -- decompress a memory buffer + * Copyright (C) 1995-2003, 2010 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include "zlib.h" + +/* =========================================================================== + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total + size of the destination buffer, which must be large enough to hold the + entire uncompressed data. (The size of the uncompressed data must have + been saved previously by the compressor and transmitted to the decompressor + by some mechanism outside the scope of this compression library.) + Upon exit, destLen is the actual size of the compressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted. + */ +int ZEXPORT uncompress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen) +{ + z_stream stream; + int err; + + stream.next_in = (Bytef *)source; + stream.avail_in = (uInt)sourceLen; + /* Check for source > 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; + + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = Z_NULL; + stream.zfree = Z_NULL; + + err = inflateInit(&stream); + if (err != Z_OK) return err; + + err = inflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + inflateEnd(&stream); + if (err == Z_NEED_DICT || (err == Z_BUF_ERROR && stream.avail_in == 0)) + return Z_DATA_ERROR; + return err; + } + *destLen = stream.total_out; + + err = inflateEnd(&stream); + return err; +} diff --git a/deps/unzip.c b/deps/unzip.c new file mode 100644 index 0000000..ba6abbf --- /dev/null +++ b/deps/unzip.c @@ -0,0 +1,2126 @@ +/* unzip.c -- IO for uncompress .zip files using zlib + Version 1.1, February 14h, 2010 + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications of Unzip for Zip64 + Copyright (C) 2007-2008 Even Rouault + + Modifications for Zip64 support on both zip and unzip + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + + ------------------------------------------------------------------------------------ + Decryption code comes from crypt.c by Info-ZIP but has been greatly reduced in terms of + compatibility with older software. The following is from the original crypt.c. + Code woven in by Terry Thorsen 1/2003. + + Copyright (c) 1990-2000 Info-ZIP. All rights reserved. + + See the accompanying file LICENSE, version 2000-Apr-09 or later + (the contents of which are also included in zip.h) for terms of use. + If, for some reason, all these files are missing, the Info-ZIP license + also may be found at: ftp://ftp.info-zip.org/pub/infozip/license.html + + crypt.c (full version) by Info-ZIP. Last revised: [see crypt.h] + + The encryption/decryption parts of this source code (as opposed to the + non-echoing password parts) were originally written in Europe. The + whole source package can be freely distributed, including from the USA. + (Prior to January 2000, re-export from the US was a violation of US law.) + + This encryption code is a direct transcription of the algorithm from + Roger Schlafly, described by Phil Katz in the file appnote.txt. This + file (appnote.txt) is distributed with the PKZIP program (even in the + version without encryption capabilities). + + ------------------------------------------------------------------------------------ + + Changes in unzip.c + + 2007-2008 - Even Rouault - Addition of cpl_unzGetCurrentFileZStreamPos + 2007-2008 - Even Rouault - Decoration of symbol names unz* -> cpl_unz* + 2007-2008 - Even Rouault - Remove old C style function prototypes + 2007-2008 - Even Rouault - Add unzip support for ZIP64 + + Copyright (C) 2007-2008 Even Rouault + + + Oct-2009 - Mathias Svensson - Removed cpl_* from symbol names (Even Rouault added them but since this is now moved to a new project (minizip64) I renamed them again). + Oct-2009 - Mathias Svensson - Fixed problem if uncompressed size was > 4G and compressed size was <4G + should only read the compressed/uncompressed size from the Zip64 format if + the size from normal header was 0xFFFFFFFF + Oct-2009 - Mathias Svensson - Applied some bug fixes from paches recived from Gilles Vollant + Oct-2009 - Mathias Svensson - Applied support to unzip files with compression mathod BZIP2 (bzip2 lib is required) + Patch created by Daniel Borca + + Jan-2010 - back to unzip and minizip 1.0 name scheme, with compatibility layer + + Copyright (C) 1998 - 2010 Gilles Vollant, Even Rouault, Mathias Svensson + +*/ + + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +#ifndef NOUNCRYPT +#define NOUNCRYPT +#endif + +#include "zlib.h" +#include "unzip.h" + +#ifdef STDC +# include <stddef.h> +# include <string.h> +# include <stdlib.h> +#endif +#ifdef NO_ERRNO_H +extern int errno; +#else +# include <errno.h> +#endif + + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + + +#ifndef CASESENSITIVITYDEFAULT_NO +# if !defined(unix) && !defined(CASESENSITIVITYDEFAULT_YES) +# define CASESENSITIVITYDEFAULT_NO +# endif +#endif + + +#ifndef UNZ_BUFSIZE +#define UNZ_BUFSIZE (16384) +#endif + +#ifndef UNZ_MAXFILENAMEINZIP +#define UNZ_MAXFILENAMEINZIP (256) +#endif + +#ifndef ALLOC +# define ALLOC(size) (malloc(size)) +#endif +#ifndef TRYFREE +# define TRYFREE(p) {if (p) free(p);} +#endif + +#define SIZECENTRALDIRITEM (0x2e) +#define SIZEZIPLOCALHEADER (0x1e) + + +const char unz_copyright[] = +" unzip 1.01 Copyright 1998-2004 Gilles Vollant - http://www.winimage.com/zLibDll"; + +/* unz_file_info_interntal contain internal info about a file in zipfile*/ +typedef struct unz_file_info64_internal_s +{ + ZPOS64_T offset_curfile;/* relative offset of local header 8 bytes */ +} unz_file_info64_internal; + + +/* file_in_zip_read_info_s contain internal information about a file in zipfile, + when reading and decompress it */ +typedef struct +{ + char *read_buffer; /* internal buffer for compressed data */ + z_stream stream; /* zLib stream structure for inflate */ + +#ifdef HAVE_BZIP2 + bz_stream bstream; /* bzLib stream structure for bziped */ +#endif + + ZPOS64_T pos_in_zipfile; /* position in byte on the zipfile, for fseek*/ + uLong stream_initialised; /* flag set if stream structure is initialised*/ + + ZPOS64_T offset_local_extrafield;/* offset of the local extra field */ + uInt size_local_extrafield;/* size of the local extra field */ + ZPOS64_T pos_local_extrafield; /* position in the local extra field in read*/ + ZPOS64_T total_out_64; + + uLong crc32; /* crc32 of all data uncompressed */ + uLong crc32_wait; /* crc32 we must obtain after decompress all */ + ZPOS64_T rest_read_compressed; /* number of byte to be decompressed */ + ZPOS64_T rest_read_uncompressed;/*number of byte to be obtained after decomp*/ + zlib_filefunc64_32_def z_filefunc; + voidpf filestream; /* io structore of the zipfile */ + uLong compression_method; /* compression method (0==store) */ + ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ + int raw; +} file_in_zip64_read_info_s; + + +/* unz64_s contain internal information about the zipfile +*/ +typedef struct +{ + zlib_filefunc64_32_def z_filefunc; + int is64bitOpenFunction; + voidpf filestream; /* io structore of the zipfile */ + unz_global_info64 gi; /* public global information */ + ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ + ZPOS64_T num_file; /* number of the current file in the zipfile*/ + ZPOS64_T pos_in_central_dir; /* pos of the current file in the central dir*/ + ZPOS64_T current_file_ok; /* flag about the usability of the current file*/ + ZPOS64_T central_pos; /* position of the beginning of the central dir*/ + + ZPOS64_T size_central_dir; /* size of the central directory */ + ZPOS64_T offset_central_dir; /* offset of start of central directory with + respect to the starting disk number */ + + unz_file_info64 cur_file_info; /* public info about the current file in zip*/ + unz_file_info64_internal cur_file_info_internal; /* private info about it*/ + file_in_zip64_read_info_s* pfile_in_zip_read; /* structure about the current + file if we are decompressing it */ + int encrypted; + + int isZip64; + +# ifndef NOUNCRYPT + unsigned long keys[3]; /* keys defining the pseudo-random sequence */ + const unsigned long* pcrc_32_tab; +# endif +} unz64_s; + + +#ifndef NOUNCRYPT +#include "crypt.h" +#endif + +/* =========================================================================== + Read a byte from a gz_stream; update next_in and avail_in. Return EOF + for end of file. + IN assertion: the stream s has been sucessfully opened for reading. + */ + + +local int unz64local_getByte OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + int *pi)); + +local int unz64local_getByte(const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, int *_pi) +{ + unsigned char c; + int err = (int)ZREAD64(*pzlib_filefunc_def,filestream,&c,1); + if (err==1) + { + *_pi = (int)c; + return UNZ_OK; + } + else + { + if (ZERROR64(*pzlib_filefunc_def,filestream)) + return UNZ_ERRNO; + else + return UNZ_EOF; + } +} + + +/* =========================================================================== + Reads a long in LSB order from the given gz_stream. Sets + */ +local int unz64local_getShort OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX)); + +local int unz64local_getShort (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX) +{ + uLong x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<8; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +local int unz64local_getLong OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX)); + +local int unz64local_getLong (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX) +{ + uLong x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<8; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<16; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x += ((uLong)i)<<24; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +local int unz64local_getLong64 OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + ZPOS64_T *pX)); + + +local int unz64local_getLong64 (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + ZPOS64_T *pX) +{ + ZPOS64_T x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (ZPOS64_T)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<8; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<16; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<24; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<32; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<40; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<48; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<56; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +/* My own strcmpi / strcasecmp */ +local int strcmpcasenosensitive_internal (const char* fileName1, const char* fileName2) +{ + for (;;) + { + char c1=*(fileName1++); + char c2=*(fileName2++); + if ((c1>='a') && (c1<='z')) + c1 -= 0x20; + if ((c2>='a') && (c2<='z')) + c2 -= 0x20; + if (c1=='\0') + return ((c2=='\0') ? 0 : -1); + if (c2=='\0') + return 1; + if (c1<c2) + return -1; + if (c1>c2) + return 1; + } +} + + +#ifdef CASESENSITIVITYDEFAULT_NO +#define CASESENSITIVITYDEFAULTVALUE 2 +#else +#define CASESENSITIVITYDEFAULTVALUE 1 +#endif + +#ifndef STRCMPCASENOSENTIVEFUNCTION +#define STRCMPCASENOSENTIVEFUNCTION strcmpcasenosensitive_internal +#endif + +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) + +*/ +extern int ZEXPORT unzStringFileNameCompare (const char* fileName1, + const char* fileName2, + int iCaseSensitivity) + +{ + if (iCaseSensitivity==0) + iCaseSensitivity=CASESENSITIVITYDEFAULTVALUE; + + if (iCaseSensitivity==1) + return strcmp(fileName1,fileName2); + + return STRCMPCASENOSENTIVEFUNCTION(fileName1,fileName2); +} + +#ifndef BUFREADCOMMENT +#define BUFREADCOMMENT (0x400) +#endif + +/* + Locate the Central directory of a zipfile (at the end, just before + the global comment) + */ +local ZPOS64_T unz64local_SearchCentralDir OF((const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream)); +local ZPOS64_T unz64local_SearchCentralDir(const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream) +{ + unsigned char* buf; + ZPOS64_T uSizeFile; + ZPOS64_T uBackRead; + ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */ + ZPOS64_T uPosFound=0; + + if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0) + return 0; + + + uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream); + + if (uMaxBack>uSizeFile) + uMaxBack = uSizeFile; + + buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4); + if (buf==NULL) + return 0; + + uBackRead = 4; + while (uBackRead<uMaxBack) + { + uLong uReadSize; + ZPOS64_T uReadPos ; + int i; + if (uBackRead+BUFREADCOMMENT>uMaxBack) + uBackRead = uMaxBack; + else + uBackRead+=BUFREADCOMMENT; + uReadPos = uSizeFile-uBackRead ; + + uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ? + (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos); + if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0) + break; + + if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize) + break; + + for (i=(int)uReadSize-3; (i--)>0;) + if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) && + ((*(buf+i+2))==0x05) && ((*(buf+i+3))==0x06)) + { + uPosFound = uReadPos+i; + break; + } + + if (uPosFound!=0) + break; + } + TRYFREE(buf); + return uPosFound; +} + + +/* + Locate the Central directory 64 of a zipfile (at the end, just before + the global comment) + */ +local ZPOS64_T unz64local_SearchCentralDir64 OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream)); + +local ZPOS64_T unz64local_SearchCentralDir64(const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream) +{ + unsigned char* buf; + ZPOS64_T uSizeFile; + ZPOS64_T uBackRead; + ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */ + ZPOS64_T uPosFound=0; + uLong uL; + ZPOS64_T relativeOffset; + + if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0) + return 0; + + + uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream); + + if (uMaxBack>uSizeFile) + uMaxBack = uSizeFile; + + buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4); + if (buf==NULL) + return 0; + + uBackRead = 4; + while (uBackRead<uMaxBack) + { + uLong uReadSize; + ZPOS64_T uReadPos; + int i; + if (uBackRead+BUFREADCOMMENT>uMaxBack) + uBackRead = uMaxBack; + else + uBackRead+=BUFREADCOMMENT; + uReadPos = uSizeFile-uBackRead ; + + uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ? + (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos); + if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0) + break; + + if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize) + break; + + for (i=(int)uReadSize-3; (i--)>0;) + if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) && + ((*(buf+i+2))==0x06) && ((*(buf+i+3))==0x07)) + { + uPosFound = uReadPos+i; + break; + } + + if (uPosFound!=0) + break; + } + TRYFREE(buf); + if (uPosFound == 0) + return 0; + + /* Zip64 end of central directory locator */ + if (ZSEEK64(*pzlib_filefunc_def,filestream, uPosFound,ZLIB_FILEFUNC_SEEK_SET)!=0) + return 0; + + /* the signature, already checked */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + + /* number of the disk with the start of the zip64 end of central directory */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + if (uL != 0) + return 0; + + /* relative offset of the zip64 end of central directory record */ + if (unz64local_getLong64(pzlib_filefunc_def,filestream,&relativeOffset)!=UNZ_OK) + return 0; + + /* total number of disks */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + if (uL != 1) + return 0; + + /* Goto end of central directory record */ + if (ZSEEK64(*pzlib_filefunc_def,filestream, relativeOffset,ZLIB_FILEFUNC_SEEK_SET)!=0) + return 0; + + /* the signature */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + + if (uL != 0x06064b50) + return 0; + + return relativeOffset; +} + +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows NT computer "c:\\test\\zlib114.zip" or on an Unix computer + "zlib/zlib114.zip". + If the zipfile cannot be opened (file doesn't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. + */ +local unzFile unzOpenInternal (const void *path, + zlib_filefunc64_32_def* pzlib_filefunc64_32_def, + int is64bitOpenFunction) +{ + unz64_s us; + unz64_s *s; + ZPOS64_T central_pos; + uLong uL; + + uLong number_disk; /* number of the current dist, used for + spaning ZIP, unsupported, always 0*/ + uLong number_disk_with_CD; /* number the the disk with central dir, used + for spaning ZIP, unsupported, always 0*/ + ZPOS64_T number_entry_CD; /* total number of entries in + the central dir + (same than number_entry on nospan) */ + + int err=UNZ_OK; + + if (unz_copyright[0]!=' ') + return NULL; + + us.z_filefunc.zseek32_file = NULL; + us.z_filefunc.ztell32_file = NULL; + if (pzlib_filefunc64_32_def==NULL) + fill_fopen64_filefunc(&us.z_filefunc.zfile_func64); + else + us.z_filefunc = *pzlib_filefunc64_32_def; + us.is64bitOpenFunction = is64bitOpenFunction; + + + + us.filestream = ZOPEN64(us.z_filefunc, + path, + ZLIB_FILEFUNC_MODE_READ | + ZLIB_FILEFUNC_MODE_EXISTING); + if (us.filestream==NULL) + return NULL; + + central_pos = unz64local_SearchCentralDir64(&us.z_filefunc,us.filestream); + if (central_pos) + { + uLong uS; + ZPOS64_T uL64; + + us.isZip64 = 1; + + if (ZSEEK64(us.z_filefunc, us.filestream, + central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + /* the signature, already checked */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + + /* size of zip64 end of central directory record */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&uL64)!=UNZ_OK) + err=UNZ_ERRNO; + + /* version made by */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK) + err=UNZ_ERRNO; + + /* version needed to extract */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of this disk */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of the disk with the start of the central directory */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central directory on this disk */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.gi.number_entry)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central directory */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&number_entry_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + if ((number_entry_CD!=us.gi.number_entry) || + (number_disk_with_CD!=0) || + (number_disk!=0)) + err=UNZ_BADZIPFILE; + + /* size of the central directory */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.size_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + /* offset of start of central directory with respect to the + starting disk number */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.offset_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + us.gi.size_comment = 0; + } + else + { + central_pos = unz64local_SearchCentralDir(&us.z_filefunc,us.filestream); + if (central_pos==0) + err=UNZ_ERRNO; + + us.isZip64 = 0; + + if (ZSEEK64(us.z_filefunc, us.filestream, + central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + /* the signature, already checked */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of this disk */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of the disk with the start of the central directory */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central dir on this disk */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.gi.number_entry = uL; + + /* total number of entries in the central dir */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + number_entry_CD = uL; + + if ((number_entry_CD!=us.gi.number_entry) || + (number_disk_with_CD!=0) || + (number_disk!=0)) + err=UNZ_BADZIPFILE; + + /* size of the central directory */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.size_central_dir = uL; + + /* offset of start of central directory with respect to the + starting disk number */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.offset_central_dir = uL; + + /* zipfile comment length */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&us.gi.size_comment)!=UNZ_OK) + err=UNZ_ERRNO; + } + + if ((central_pos<us.offset_central_dir+us.size_central_dir) && + (err==UNZ_OK)) + err=UNZ_BADZIPFILE; + + if (err!=UNZ_OK) + { + ZCLOSE64(us.z_filefunc, us.filestream); + return NULL; + } + + us.byte_before_the_zipfile = central_pos - + (us.offset_central_dir+us.size_central_dir); + us.central_pos = central_pos; + us.pfile_in_zip_read = NULL; + us.encrypted = 0; + + + s=(unz64_s*)ALLOC(sizeof(unz64_s)); + if( s != NULL) + { + *s=us; + unzGoToFirstFile((unzFile)s); + } + return (unzFile)s; +} + + +extern unzFile ZEXPORT unzOpen2 (const char *path, + zlib_filefunc_def* pzlib_filefunc32_def) +{ + if (pzlib_filefunc32_def != NULL) + { + zlib_filefunc64_32_def zlib_filefunc64_32_def_fill; + fill_zlib_filefunc64_32_def_from_filefunc32(&zlib_filefunc64_32_def_fill,pzlib_filefunc32_def); + return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 0); + } + else + return unzOpenInternal(path, NULL, 0); +} + +extern unzFile ZEXPORT unzOpen2_64 (const void *path, + zlib_filefunc64_def* pzlib_filefunc_def) +{ + if (pzlib_filefunc_def != NULL) + { + zlib_filefunc64_32_def zlib_filefunc64_32_def_fill; + zlib_filefunc64_32_def_fill.zfile_func64 = *pzlib_filefunc_def; + zlib_filefunc64_32_def_fill.ztell32_file = NULL; + zlib_filefunc64_32_def_fill.zseek32_file = NULL; + return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 1); + } + else + return unzOpenInternal(path, NULL, 1); +} + +extern unzFile ZEXPORT unzOpen (const char *path) +{ + return unzOpenInternal(path, NULL, 0); +} + +extern unzFile ZEXPORT unzOpen64 (const void *path) +{ + return unzOpenInternal(path, NULL, 1); +} + +/* + Close a ZipFile opened with unzipOpen. + If there is files inside the .Zip opened with unzipOpenCurrentFile (see later), + these files MUST be closed with unzipCloseCurrentFile before call unzipClose. + return UNZ_OK if there is no problem. */ +extern int ZEXPORT unzClose (unzFile file) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + if (s->pfile_in_zip_read!=NULL) + unzCloseCurrentFile(file); + + ZCLOSE64(s->z_filefunc, s->filestream); + TRYFREE(s); + return UNZ_OK; +} + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ +extern int ZEXPORT unzGetGlobalInfo64 (unzFile file, unz_global_info64* pglobal_info) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + *pglobal_info=s->gi; + return UNZ_OK; +} + +extern int ZEXPORT unzGetGlobalInfo (unzFile file, unz_global_info* pglobal_info32) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + /* to do : check if number_entry is not truncated */ + pglobal_info32->number_entry = (uLong)s->gi.number_entry; + pglobal_info32->size_comment = s->gi.size_comment; + return UNZ_OK; +} +/* + Translate date/time from Dos format to tm_unz (readable more easilty) + */ +local void unz64local_DosDateToTmuDate (ZPOS64_T ulDosDate, tm_unz* ptm) +{ + ZPOS64_T uDate; + uDate = (ZPOS64_T)(ulDosDate>>16); + ptm->tm_mday = (uInt)(uDate&0x1f) ; + ptm->tm_mon = (uInt)((((uDate)&0x1E0)/0x20)-1) ; + ptm->tm_year = (uInt)(((uDate&0x0FE00)/0x0200)+1980) ; + + ptm->tm_hour = (uInt) ((ulDosDate &0xF800)/0x800); + ptm->tm_min = (uInt) ((ulDosDate&0x7E0)/0x20) ; + ptm->tm_sec = (uInt) (2*(ulDosDate&0x1f)) ; +} + +/* + Get Info about the current file in the zipfile, with internal only info + */ +local int unz64local_GetCurrentFileInfoInternal OF((unzFile file, + unz_file_info64 *pfile_info, + unz_file_info64_internal + *pfile_info_internal, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); + +local int unz64local_GetCurrentFileInfoInternal (unzFile file, + unz_file_info64 *pfile_info, + unz_file_info64_internal + *pfile_info_internal, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize) +{ + unz64_s* s; + unz_file_info64 file_info; + unz_file_info64_internal file_info_internal; + int err=UNZ_OK; + uLong uMagic; + long lSeek=0; + uLong uL; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (ZSEEK64(s->z_filefunc, s->filestream, + s->pos_in_central_dir+s->byte_before_the_zipfile, + ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + + /* we check the magic */ + if (err==UNZ_OK) + { + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x02014b50) + err=UNZ_BADZIPFILE; + } + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version_needed) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.flag) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.compression_method) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.dosDate) != UNZ_OK) + err=UNZ_ERRNO; + + unz64local_DosDateToTmuDate(file_info.dosDate,&file_info.tmu_date); + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.crc) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info.compressed_size = uL; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info.uncompressed_size = uL; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_filename) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_extra) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_comment) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.disk_num_start) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.internal_fa) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.external_fa) != UNZ_OK) + err=UNZ_ERRNO; + + // relative offset of local header + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info_internal.offset_curfile = uL; + + lSeek+=file_info.size_filename; + if ((err==UNZ_OK) && (szFileName!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_filename<fileNameBufferSize) + { + *(szFileName+file_info.size_filename)='\0'; + uSizeRead = file_info.size_filename; + } + else + uSizeRead = fileNameBufferSize; + + if ((file_info.size_filename>0) && (fileNameBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,szFileName,uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + lSeek -= uSizeRead; + } + + // Read extrafield + if ((err==UNZ_OK) && (extraField!=NULL)) + { + ZPOS64_T uSizeRead ; + if (file_info.size_file_extra<extraFieldBufferSize) + uSizeRead = file_info.size_file_extra; + else + uSizeRead = extraFieldBufferSize; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + if ((file_info.size_file_extra>0) && (extraFieldBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,extraField,(uLong)uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + + lSeek += file_info.size_file_extra - (uLong)uSizeRead; + } + else + lSeek += file_info.size_file_extra; + + + if ((err==UNZ_OK) && (file_info.size_file_extra != 0)) + { + uLong acc = 0; + + // since lSeek now points to after the extra field we need to move back + lSeek -= file_info.size_file_extra; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + while(acc < file_info.size_file_extra) + { + uLong headerId; + uLong dataSize; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&headerId) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&dataSize) != UNZ_OK) + err=UNZ_ERRNO; + + /* ZIP64 extra fields */ + if (headerId == 0x0001) + { + uLong tmp; + + if(file_info.uncompressed_size == (ZPOS64_T)(unsigned long)-1) + { + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.uncompressed_size) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info.compressed_size == (ZPOS64_T)(unsigned long)-1) + { + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.compressed_size) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info_internal.offset_curfile == (ZPOS64_T)(unsigned long)-1) + { + /* Relative Header offset */ + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info_internal.offset_curfile) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info.disk_num_start == (unsigned long)-1) + { + /* Disk Start Number */ + if (unz64local_getLong(&s->z_filefunc, s->filestream,&tmp) != UNZ_OK) + err=UNZ_ERRNO; + } + + } + else + { + if (ZSEEK64(s->z_filefunc, s->filestream,dataSize,ZLIB_FILEFUNC_SEEK_CUR)!=0) + err=UNZ_ERRNO; + } + + acc += 2 + 2 + dataSize; + } + } + + if ((err==UNZ_OK) && (szComment!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_file_comment<commentBufferSize) + { + *(szComment+file_info.size_file_comment)='\0'; + uSizeRead = file_info.size_file_comment; + } + else + uSizeRead = commentBufferSize; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + if ((file_info.size_file_comment>0) && (commentBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,szComment,uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + lSeek+=file_info.size_file_comment - uSizeRead; + } + else + lSeek+=file_info.size_file_comment; + + + if ((err==UNZ_OK) && (pfile_info!=NULL)) + *pfile_info=file_info; + + if ((err==UNZ_OK) && (pfile_info_internal!=NULL)) + *pfile_info_internal=file_info_internal; + + return err; +} + + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. + */ +extern int ZEXPORT unzGetCurrentFileInfo64 (unzFile file, + unz_file_info64 * pfile_info, + char * szFileName, uLong fileNameBufferSize, + void *extraField, uLong extraFieldBufferSize, + char* szComment, uLong commentBufferSize) +{ + return unz64local_GetCurrentFileInfoInternal(file,pfile_info,NULL, + szFileName,fileNameBufferSize, + extraField,extraFieldBufferSize, + szComment,commentBufferSize); +} + +extern int ZEXPORT unzGetCurrentFileInfo (unzFile file, + unz_file_info * pfile_info, + char * szFileName, uLong fileNameBufferSize, + void *extraField, uLong extraFieldBufferSize, + char* szComment, uLong commentBufferSize) +{ + int err; + unz_file_info64 file_info64; + err = unz64local_GetCurrentFileInfoInternal(file,&file_info64,NULL, + szFileName,fileNameBufferSize, + extraField,extraFieldBufferSize, + szComment,commentBufferSize); + if (err==UNZ_OK) + { + pfile_info->version = file_info64.version; + pfile_info->version_needed = file_info64.version_needed; + pfile_info->flag = file_info64.flag; + pfile_info->compression_method = file_info64.compression_method; + pfile_info->dosDate = file_info64.dosDate; + pfile_info->crc = file_info64.crc; + + pfile_info->size_filename = file_info64.size_filename; + pfile_info->size_file_extra = file_info64.size_file_extra; + pfile_info->size_file_comment = file_info64.size_file_comment; + + pfile_info->disk_num_start = file_info64.disk_num_start; + pfile_info->internal_fa = file_info64.internal_fa; + pfile_info->external_fa = file_info64.external_fa; + + pfile_info->tmu_date = file_info64.tmu_date, + + + pfile_info->compressed_size = (uLong)file_info64.compressed_size; + pfile_info->uncompressed_size = (uLong)file_info64.uncompressed_size; + + } + return err; +} +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem + */ +extern int ZEXPORT unzGoToFirstFile (unzFile file) +{ + int err=UNZ_OK; + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + s->pos_in_central_dir=s->offset_central_dir; + s->num_file=0; + err=unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. + */ +extern int ZEXPORT unzGoToNextFile (unzFile file) +{ + unz64_s* s; + int err; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + if (s->gi.number_entry != 0xffff) /* 2^16 files overflow hack */ + if (s->num_file+1==s->gi.number_entry) + return UNZ_END_OF_LIST_OF_FILE; + + s->pos_in_central_dir += SIZECENTRALDIRITEM + s->cur_file_info.size_filename + + s->cur_file_info.size_file_extra + s->cur_file_info.size_file_comment ; + s->num_file++; + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + + +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzipStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found + */ +extern int ZEXPORT unzLocateFile (unzFile file, const char *szFileName, int iCaseSensitivity) +{ + unz64_s* s; + int err; + + /* We remember the 'current' position in the file so that we can jump + * back there if we fail. + */ + unz_file_info64 cur_file_infoSaved; + unz_file_info64_internal cur_file_info_internalSaved; + ZPOS64_T num_fileSaved; + ZPOS64_T pos_in_central_dirSaved; + + + if (file==NULL) + return UNZ_PARAMERROR; + + if (strlen(szFileName)>=UNZ_MAXFILENAMEINZIP) + return UNZ_PARAMERROR; + + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + + /* Save the current state */ + num_fileSaved = s->num_file; + pos_in_central_dirSaved = s->pos_in_central_dir; + cur_file_infoSaved = s->cur_file_info; + cur_file_info_internalSaved = s->cur_file_info_internal; + + err = unzGoToFirstFile(file); + + while (err == UNZ_OK) + { + char szCurrentFileName[UNZ_MAXFILENAMEINZIP+1]; + err = unzGetCurrentFileInfo64(file,NULL, + szCurrentFileName,sizeof(szCurrentFileName)-1, + NULL,0,NULL,0); + if (err == UNZ_OK) + { + if (unzStringFileNameCompare(szCurrentFileName, + szFileName,iCaseSensitivity)==0) + return UNZ_OK; + err = unzGoToNextFile(file); + } + } + + /* We failed, so restore the state of the 'current file' to where we + * were. + */ + s->num_file = num_fileSaved ; + s->pos_in_central_dir = pos_in_central_dirSaved ; + s->cur_file_info = cur_file_infoSaved; + s->cur_file_info_internal = cur_file_info_internalSaved; + return err; +} + + +/* +/////////////////////////////////////////// +// Contributed by Ryan Haksi (mailto://cryogen@infoserve.net) +// I need random access +// +// Further optimization could be realized by adding an ability +// to cache the directory in memory. The goal being a single +// comprehensive file read to put the file I need in a memory. +*/ + +/* + typedef struct unz_file_pos_s + { + ZPOS64_T pos_in_zip_directory; // offset in file + ZPOS64_T num_of_file; // # of file + } unz_file_pos; + */ + +extern int ZEXPORT unzGetFilePos64(unzFile file, unz64_file_pos* file_pos) +{ + unz64_s* s; + + if (file==NULL || file_pos==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + + file_pos->pos_in_zip_directory = s->pos_in_central_dir; + file_pos->num_of_file = s->num_file; + + return UNZ_OK; +} + +extern int ZEXPORT unzGetFilePos( + unzFile file, + unz_file_pos* file_pos) +{ + unz64_file_pos file_pos64; + int err = unzGetFilePos64(file,&file_pos64); + if (err==UNZ_OK) + { + file_pos->pos_in_zip_directory = (uLong)file_pos64.pos_in_zip_directory; + file_pos->num_of_file = (uLong)file_pos64.num_of_file; + } + return err; +} + +extern int ZEXPORT unzGoToFilePos64(unzFile file, const unz64_file_pos* file_pos) +{ + unz64_s* s; + int err; + + if (file==NULL || file_pos==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + /* jump to the right spot */ + s->pos_in_central_dir = file_pos->pos_in_zip_directory; + s->num_file = file_pos->num_of_file; + + /* set the current file */ + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + /* return results */ + s->current_file_ok = (err == UNZ_OK); + return err; +} + +extern int ZEXPORT unzGoToFilePos( + unzFile file, + unz_file_pos* file_pos) +{ + unz64_file_pos file_pos64; + if (file_pos == NULL) + return UNZ_PARAMERROR; + + file_pos64.pos_in_zip_directory = file_pos->pos_in_zip_directory; + file_pos64.num_of_file = file_pos->num_of_file; + return unzGoToFilePos64(file,&file_pos64); +} + +/* +// Unzip Helper Functions - should be here? +/////////////////////////////////////////// +*/ + +/* + Read the local header of the current zipfile + Check the coherency of the local header and info in the end of central + directory about this file + store in *piSizeVar the size of extra info in local header + (filename and size of extra field data) + */ +local int unz64local_CheckCurrentFileCoherencyHeader (unz64_s* s, uInt* piSizeVar, + ZPOS64_T * poffset_local_extrafield, + uInt * psize_local_extrafield) +{ + uLong uMagic,uData,uFlags; + uLong size_filename; + uLong size_extra_field; + int err=UNZ_OK; + + *piSizeVar = 0; + *poffset_local_extrafield = 0; + *psize_local_extrafield = 0; + + if (ZSEEK64(s->z_filefunc, s->filestream,s->cur_file_info_internal.offset_curfile + + s->byte_before_the_zipfile,ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + + if (err==UNZ_OK) + { + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x04034b50) + err=UNZ_BADZIPFILE; + } + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) + err=UNZ_ERRNO; + /* + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.wVersion)) + err=UNZ_BADZIPFILE; + */ + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uFlags) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compression_method)) + err=UNZ_BADZIPFILE; + + if ((err==UNZ_OK) && (s->cur_file_info.compression_method!=0) && + /* #ifdef HAVE_BZIP2 */ + (s->cur_file_info.compression_method!=Z_BZIP2ED) && + /* #endif */ + (s->cur_file_info.compression_method!=Z_DEFLATED)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* date/time */ + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* crc */ + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.crc) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size compr */ + err=UNZ_ERRNO; + else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.compressed_size) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size uncompr */ + err=UNZ_ERRNO; + else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.uncompressed_size) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_filename) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (size_filename!=s->cur_file_info.size_filename)) + err=UNZ_BADZIPFILE; + + *piSizeVar += (uInt)size_filename; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_extra_field) != UNZ_OK) + err=UNZ_ERRNO; + *poffset_local_extrafield= s->cur_file_info_internal.offset_curfile + + SIZEZIPLOCALHEADER + size_filename; + *psize_local_extrafield = (uInt)size_extra_field; + + *piSizeVar += (uInt)size_extra_field; + + return err; +} + +/* + Open for reading data the current file in the zipfile. + If there is no error and the file is opened, the return value is UNZ_OK. + */ +extern int ZEXPORT unzOpenCurrentFile3 (unzFile file, int* method, + int* level, int raw, const char* password) +{ + int err=UNZ_OK; + uInt iSizeVar; + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + ZPOS64_T offset_local_extrafield; /* offset of the local extra field */ + uInt size_local_extrafield; /* size of the local extra field */ +# ifndef NOUNCRYPT + char source[12]; +# else + if (password != NULL) + return UNZ_PARAMERROR; +# endif + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_PARAMERROR; + + if (s->pfile_in_zip_read != NULL) + unzCloseCurrentFile(file); + + if (unz64local_CheckCurrentFileCoherencyHeader(s,&iSizeVar, &offset_local_extrafield,&size_local_extrafield)!=UNZ_OK) + return UNZ_BADZIPFILE; + + pfile_in_zip_read_info = (file_in_zip64_read_info_s*)ALLOC(sizeof(file_in_zip64_read_info_s)); + if (pfile_in_zip_read_info==NULL) + return UNZ_INTERNALERROR; + + pfile_in_zip_read_info->read_buffer=(char*)ALLOC(UNZ_BUFSIZE); + pfile_in_zip_read_info->offset_local_extrafield = offset_local_extrafield; + pfile_in_zip_read_info->size_local_extrafield = size_local_extrafield; + pfile_in_zip_read_info->pos_local_extrafield=0; + pfile_in_zip_read_info->raw=raw; + + if (pfile_in_zip_read_info->read_buffer==NULL) + { + TRYFREE(pfile_in_zip_read_info); + return UNZ_INTERNALERROR; + } + + pfile_in_zip_read_info->stream_initialised=0; + + if (method!=NULL) + *method = (int)s->cur_file_info.compression_method; + + if (level!=NULL) + { + *level = 6; + switch (s->cur_file_info.flag & 0x06) + { + case 6 : *level = 1; break; + case 4 : *level = 2; break; + case 2 : *level = 9; break; + } + } + + if ((s->cur_file_info.compression_method!=0) && + /* #ifdef HAVE_BZIP2 */ + (s->cur_file_info.compression_method!=Z_BZIP2ED) && + /* #endif */ + (s->cur_file_info.compression_method!=Z_DEFLATED)) + + err=UNZ_BADZIPFILE; + + pfile_in_zip_read_info->crc32_wait=s->cur_file_info.crc; + pfile_in_zip_read_info->crc32=0; + pfile_in_zip_read_info->total_out_64=0; + pfile_in_zip_read_info->compression_method = s->cur_file_info.compression_method; + pfile_in_zip_read_info->filestream=s->filestream; + pfile_in_zip_read_info->z_filefunc=s->z_filefunc; + pfile_in_zip_read_info->byte_before_the_zipfile=s->byte_before_the_zipfile; + + pfile_in_zip_read_info->stream.total_out = 0; + + if ((s->cur_file_info.compression_method==Z_BZIP2ED) && (!raw)) + { +#ifdef HAVE_BZIP2 + pfile_in_zip_read_info->bstream.bzalloc = (void *(*) (void *, int, int))0; + pfile_in_zip_read_info->bstream.bzfree = (free_func)0; + pfile_in_zip_read_info->bstream.opaque = (voidpf)0; + pfile_in_zip_read_info->bstream.state = (voidpf)0; + + pfile_in_zip_read_info->stream.zalloc = (alloc_func)0; + pfile_in_zip_read_info->stream.zfree = (free_func)0; + pfile_in_zip_read_info->stream.opaque = (voidpf)0; + pfile_in_zip_read_info->stream.next_in = (voidpf)0; + pfile_in_zip_read_info->stream.avail_in = 0; + + err=BZ2_bzDecompressInit(&pfile_in_zip_read_info->bstream, 0, 0); + if (err == Z_OK) + pfile_in_zip_read_info->stream_initialised=Z_BZIP2ED; + else + { + TRYFREE(pfile_in_zip_read_info); + return err; + } +#else + pfile_in_zip_read_info->raw=1; +#endif + } + else if ((s->cur_file_info.compression_method==Z_DEFLATED) && (!raw)) + { + pfile_in_zip_read_info->stream.zalloc = Z_NULL; + pfile_in_zip_read_info->stream.zfree = Z_NULL; + pfile_in_zip_read_info->stream.opaque = (voidpf)0; + pfile_in_zip_read_info->stream.next_in = 0; + pfile_in_zip_read_info->stream.avail_in = 0; + + err=inflateInit2(&pfile_in_zip_read_info->stream, -MAX_WBITS); + if (err == Z_OK) + pfile_in_zip_read_info->stream_initialised=Z_DEFLATED; + else + { + TRYFREE(pfile_in_zip_read_info); + return err; + } + /* windowBits is passed < 0 to tell that there is no zlib header. + * Note that in this case inflate *requires* an extra "dummy" byte + * after the compressed stream in order to complete decompression and + * return Z_STREAM_END. + * In unzip, i don't wait absolutely Z_STREAM_END because I known the + * size of both compressed and uncompressed data + */ + } + pfile_in_zip_read_info->rest_read_compressed = + s->cur_file_info.compressed_size ; + pfile_in_zip_read_info->rest_read_uncompressed = + s->cur_file_info.uncompressed_size ; + + + pfile_in_zip_read_info->pos_in_zipfile = + s->cur_file_info_internal.offset_curfile + SIZEZIPLOCALHEADER + + iSizeVar; + + pfile_in_zip_read_info->stream.avail_in = (uInt)0; + + s->pfile_in_zip_read = pfile_in_zip_read_info; + s->encrypted = 0; + +# ifndef NOUNCRYPT + if (password != NULL) + { + int i; + s->pcrc_32_tab = get_crc_table(); + init_keys(password,s->keys,s->pcrc_32_tab); + if (ZSEEK64(s->z_filefunc, s->filestream, + s->pfile_in_zip_read->pos_in_zipfile + + s->pfile_in_zip_read->byte_before_the_zipfile, + SEEK_SET)!=0) + return UNZ_INTERNALERROR; + if(ZREAD64(s->z_filefunc, s->filestream,source, 12)<12) + return UNZ_INTERNALERROR; + + for (i = 0; i<12; i++) + zdecode(s->keys,s->pcrc_32_tab,source[i]); + + s->pfile_in_zip_read->pos_in_zipfile+=12; + s->encrypted=1; + } +# endif + + + return UNZ_OK; +} + +extern int ZEXPORT unzOpenCurrentFile (unzFile file) +{ + return unzOpenCurrentFile3(file, NULL, NULL, 0, NULL); +} + +extern int ZEXPORT unzOpenCurrentFilePassword (unzFile file, const char* password) +{ + return unzOpenCurrentFile3(file, NULL, NULL, 0, password); +} + +extern int ZEXPORT unzOpenCurrentFile2 (unzFile file, int* method, int* level, int raw) +{ + return unzOpenCurrentFile3(file, method, level, raw, NULL); +} + +/** Addition for GDAL : START */ + +extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64( unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + s=(unz64_s*)file; + if (file==NULL) + return 0; //UNZ_PARAMERROR; + pfile_in_zip_read_info=s->pfile_in_zip_read; + if (pfile_in_zip_read_info==NULL) + return 0; //UNZ_PARAMERROR; + return pfile_in_zip_read_info->pos_in_zipfile + + pfile_in_zip_read_info->byte_before_the_zipfile; +} + +/** Addition for GDAL : END */ + +/* + Read bytes from the current file. + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) + */ +extern int ZEXPORT unzReadCurrentFile (unzFile file, voidp buf, unsigned len) +{ + int err=UNZ_OK; + uInt iRead = 0; + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if (pfile_in_zip_read_info->read_buffer == NULL) + return UNZ_END_OF_LIST_OF_FILE; + if (len==0) + return 0; + + pfile_in_zip_read_info->stream.next_out = (Bytef*)buf; + + pfile_in_zip_read_info->stream.avail_out = (uInt)len; + + if ((len>pfile_in_zip_read_info->rest_read_uncompressed) && + (!(pfile_in_zip_read_info->raw))) + pfile_in_zip_read_info->stream.avail_out = + (uInt)pfile_in_zip_read_info->rest_read_uncompressed; + + if ((len>pfile_in_zip_read_info->rest_read_compressed+ + pfile_in_zip_read_info->stream.avail_in) && + (pfile_in_zip_read_info->raw)) + pfile_in_zip_read_info->stream.avail_out = + (uInt)pfile_in_zip_read_info->rest_read_compressed+ + pfile_in_zip_read_info->stream.avail_in; + + while (pfile_in_zip_read_info->stream.avail_out>0) + { + if ((pfile_in_zip_read_info->stream.avail_in==0) && + (pfile_in_zip_read_info->rest_read_compressed>0)) + { + uInt uReadThis = UNZ_BUFSIZE; + if (pfile_in_zip_read_info->rest_read_compressed<uReadThis) + uReadThis = (uInt)pfile_in_zip_read_info->rest_read_compressed; + if (uReadThis == 0) + return UNZ_EOF; + if (ZSEEK64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->pos_in_zipfile + + pfile_in_zip_read_info->byte_before_the_zipfile, + ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + if (ZREAD64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->read_buffer, + uReadThis)!=uReadThis) + return UNZ_ERRNO; + + +# ifndef NOUNCRYPT + if(s->encrypted) + { + uInt i; + for(i=0;i<uReadThis;i++) + pfile_in_zip_read_info->read_buffer[i] = + zdecode(s->keys,s->pcrc_32_tab, + pfile_in_zip_read_info->read_buffer[i]); + } +# endif + + + pfile_in_zip_read_info->pos_in_zipfile += uReadThis; + + pfile_in_zip_read_info->rest_read_compressed-=uReadThis; + + pfile_in_zip_read_info->stream.next_in = + (Bytef*)pfile_in_zip_read_info->read_buffer; + pfile_in_zip_read_info->stream.avail_in = (uInt)uReadThis; + } + + if ((pfile_in_zip_read_info->compression_method==0) || (pfile_in_zip_read_info->raw)) + { + uInt uDoCopy,i ; + + if ((pfile_in_zip_read_info->stream.avail_in == 0) && + (pfile_in_zip_read_info->rest_read_compressed == 0)) + return (iRead==0) ? UNZ_EOF : iRead; + + if (pfile_in_zip_read_info->stream.avail_out < + pfile_in_zip_read_info->stream.avail_in) + uDoCopy = pfile_in_zip_read_info->stream.avail_out ; + else + uDoCopy = pfile_in_zip_read_info->stream.avail_in ; + + for (i=0;i<uDoCopy;i++) + *(pfile_in_zip_read_info->stream.next_out+i) = + *(pfile_in_zip_read_info->stream.next_in+i); + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uDoCopy; + + pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32, + pfile_in_zip_read_info->stream.next_out, + uDoCopy); + pfile_in_zip_read_info->rest_read_uncompressed-=uDoCopy; + pfile_in_zip_read_info->stream.avail_in -= uDoCopy; + pfile_in_zip_read_info->stream.avail_out -= uDoCopy; + pfile_in_zip_read_info->stream.next_out += uDoCopy; + pfile_in_zip_read_info->stream.next_in += uDoCopy; + pfile_in_zip_read_info->stream.total_out += uDoCopy; + iRead += uDoCopy; + } + else if (pfile_in_zip_read_info->compression_method==Z_BZIP2ED) + { +#ifdef HAVE_BZIP2 + uLong uTotalOutBefore,uTotalOutAfter; + const Bytef *bufBefore; + uLong uOutThis; + + pfile_in_zip_read_info->bstream.next_in = (char*)pfile_in_zip_read_info->stream.next_in; + pfile_in_zip_read_info->bstream.avail_in = pfile_in_zip_read_info->stream.avail_in; + pfile_in_zip_read_info->bstream.total_in_lo32 = pfile_in_zip_read_info->stream.total_in; + pfile_in_zip_read_info->bstream.total_in_hi32 = 0; + pfile_in_zip_read_info->bstream.next_out = (char*)pfile_in_zip_read_info->stream.next_out; + pfile_in_zip_read_info->bstream.avail_out = pfile_in_zip_read_info->stream.avail_out; + pfile_in_zip_read_info->bstream.total_out_lo32 = pfile_in_zip_read_info->stream.total_out; + pfile_in_zip_read_info->bstream.total_out_hi32 = 0; + + uTotalOutBefore = pfile_in_zip_read_info->bstream.total_out_lo32; + bufBefore = (const Bytef *)pfile_in_zip_read_info->bstream.next_out; + + err=BZ2_bzDecompress(&pfile_in_zip_read_info->bstream); + + uTotalOutAfter = pfile_in_zip_read_info->bstream.total_out_lo32; + uOutThis = uTotalOutAfter-uTotalOutBefore; + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis; + + pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32,bufBefore, (uInt)(uOutThis)); + pfile_in_zip_read_info->rest_read_uncompressed -= uOutThis; + iRead += (uInt)(uTotalOutAfter - uTotalOutBefore); + + pfile_in_zip_read_info->stream.next_in = (Bytef*)pfile_in_zip_read_info->bstream.next_in; + pfile_in_zip_read_info->stream.avail_in = pfile_in_zip_read_info->bstream.avail_in; + pfile_in_zip_read_info->stream.total_in = pfile_in_zip_read_info->bstream.total_in_lo32; + pfile_in_zip_read_info->stream.next_out = (Bytef*)pfile_in_zip_read_info->bstream.next_out; + pfile_in_zip_read_info->stream.avail_out = pfile_in_zip_read_info->bstream.avail_out; + pfile_in_zip_read_info->stream.total_out = pfile_in_zip_read_info->bstream.total_out_lo32; + + if (err==BZ_STREAM_END) + return (iRead==0) ? UNZ_EOF : iRead; + if (err!=BZ_OK) + break; +#endif + } // end Z_BZIP2ED + else + { + ZPOS64_T uTotalOutBefore,uTotalOutAfter; + const Bytef *bufBefore; + ZPOS64_T uOutThis; + int flush=Z_SYNC_FLUSH; + + uTotalOutBefore = pfile_in_zip_read_info->stream.total_out; + bufBefore = pfile_in_zip_read_info->stream.next_out; + + /* + if ((pfile_in_zip_read_info->rest_read_uncompressed == + pfile_in_zip_read_info->stream.avail_out) && + (pfile_in_zip_read_info->rest_read_compressed == 0)) + flush = Z_FINISH; + */ + err=inflate(&pfile_in_zip_read_info->stream,flush); + + if ((err>=0) && (pfile_in_zip_read_info->stream.msg!=NULL)) + err = Z_DATA_ERROR; + + uTotalOutAfter = pfile_in_zip_read_info->stream.total_out; + uOutThis = uTotalOutAfter-uTotalOutBefore; + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis; + + pfile_in_zip_read_info->crc32 = + crc32(pfile_in_zip_read_info->crc32,bufBefore, + (uInt)(uOutThis)); + + pfile_in_zip_read_info->rest_read_uncompressed -= + uOutThis; + + iRead += (uInt)(uTotalOutAfter - uTotalOutBefore); + + if (err==Z_STREAM_END) + return (iRead==0) ? UNZ_EOF : iRead; + if (err!=Z_OK) + break; + } + } + + if (err==Z_OK) + return iRead; + return err; +} + + +/* + Give the current position in uncompressed data + */ +extern z_off_t ZEXPORT unztell (unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + return (z_off_t)pfile_in_zip_read_info->stream.total_out; +} + +extern ZPOS64_T ZEXPORT unztell64 (unzFile file) +{ + + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return (ZPOS64_T)-1; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return (ZPOS64_T)-1; + + return pfile_in_zip_read_info->total_out_64; +} + + +/* + return 1 if the end of file was reached, 0 elsewhere + */ +extern int ZEXPORT unzeof (unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + if (pfile_in_zip_read_info->rest_read_uncompressed == 0) + return 1; + else + return 0; +} + + + +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field that can be read + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code + */ +extern int ZEXPORT unzGetLocalExtrafield (unzFile file, voidp buf, unsigned len) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + uInt read_now; + ZPOS64_T size_to_read; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + size_to_read = (pfile_in_zip_read_info->size_local_extrafield - + pfile_in_zip_read_info->pos_local_extrafield); + + if (buf==NULL) + return (int)size_to_read; + + if (len>size_to_read) + read_now = (uInt)size_to_read; + else + read_now = (uInt)len ; + + if (read_now==0) + return 0; + + if (ZSEEK64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->offset_local_extrafield + + pfile_in_zip_read_info->pos_local_extrafield, + ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + if (ZREAD64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + buf,read_now)!=read_now) + return UNZ_ERRNO; + + return (int)read_now; +} + +/* + Close the file in zip opened with unzipOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good + */ +extern int ZEXPORT unzCloseCurrentFile (unzFile file) +{ + int err=UNZ_OK; + + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if ((pfile_in_zip_read_info->rest_read_uncompressed == 0) && + (!pfile_in_zip_read_info->raw)) + { + if (pfile_in_zip_read_info->crc32 != pfile_in_zip_read_info->crc32_wait) + err=UNZ_CRCERROR; + } + + + TRYFREE(pfile_in_zip_read_info->read_buffer); + pfile_in_zip_read_info->read_buffer = NULL; + if (pfile_in_zip_read_info->stream_initialised == Z_DEFLATED) + inflateEnd(&pfile_in_zip_read_info->stream); +#ifdef HAVE_BZIP2 + else if (pfile_in_zip_read_info->stream_initialised == Z_BZIP2ED) + BZ2_bzDecompressEnd(&pfile_in_zip_read_info->bstream); +#endif + + + pfile_in_zip_read_info->stream_initialised = 0; + TRYFREE(pfile_in_zip_read_info); + + s->pfile_in_zip_read=NULL; + + return err; +} + + +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 + */ +extern int ZEXPORT unzGetGlobalComment (unzFile file, char * szComment, uLong uSizeBuf) +{ + unz64_s* s; + uLong uReadThis ; + if (file==NULL) + return (int)UNZ_PARAMERROR; + s=(unz64_s*)file; + + uReadThis = uSizeBuf; + if (uReadThis>s->gi.size_comment) + uReadThis = s->gi.size_comment; + + if (ZSEEK64(s->z_filefunc,s->filestream,s->central_pos+22,ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + if (uReadThis>0) + { + *szComment='\0'; + if (ZREAD64(s->z_filefunc,s->filestream,szComment,uReadThis)!=uReadThis) + return UNZ_ERRNO; + } + + if ((szComment != NULL) && (uSizeBuf > s->gi.size_comment)) + *(szComment+s->gi.size_comment)='\0'; + return (int)uReadThis; +} + +/* Additions by RX '2004 */ +extern ZPOS64_T ZEXPORT unzGetOffset64(unzFile file) +{ + unz64_s* s; + + if (file==NULL) + return 0; //UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return 0; + if (s->gi.number_entry != 0 && s->gi.number_entry != 0xffff) + if (s->num_file==s->gi.number_entry) + return 0; + return s->pos_in_central_dir; +} + +extern uLong ZEXPORT unzGetOffset (unzFile file) +{ + ZPOS64_T offset64; + + if (file==NULL) + return 0; //UNZ_PARAMERROR; + offset64 = unzGetOffset64(file); + return (uLong)offset64; +} + +extern int ZEXPORT unzSetOffset64(unzFile file, ZPOS64_T pos) +{ + unz64_s* s; + int err; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + s->pos_in_central_dir = pos; + s->num_file = s->gi.number_entry; /* hack */ + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + +extern int ZEXPORT unzSetOffset (unzFile file, uLong pos) +{ + return unzSetOffset64(file,pos); +} diff --git a/deps/unzip.h b/deps/unzip.h new file mode 100644 index 0000000..3183968 --- /dev/null +++ b/deps/unzip.h @@ -0,0 +1,437 @@ +/* unzip.h -- IO for uncompress .zip files using zlib + Version 1.1, February 14h, 2010 + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications of Unzip for Zip64 + Copyright (C) 2007-2008 Even Rouault + + Modifications for Zip64 support on both zip and unzip + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + --------------------------------------------------------------------------------- + + Condition of use and distribution are the same than zlib : + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + --------------------------------------------------------------------------------- + + Changes + + See header of unzip64.c + +*/ + +#ifndef _unz64_H +#define _unz64_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef _ZLIB_H +#include "zlib.h" +#endif + +#ifndef _ZLIBIOAPI_H +#include "ioapi.h" +#endif + +#ifdef HAVE_BZIP2 +#include "bzlib.h" +#endif + +#define Z_BZIP2ED 12 + +#if defined(STRICTUNZIP) || defined(STRICTZIPUNZIP) +/* like the STRICT of WIN32, we define a pointer that cannot be converted + from (void*) without cast */ +typedef struct TagunzFile__ { int unused; } unzFile__; +typedef unzFile__ *unzFile; +#else +typedef voidp unzFile; +#endif + + +#define UNZ_OK (0) +#define UNZ_END_OF_LIST_OF_FILE (-100) +#define UNZ_ERRNO (Z_ERRNO) +#define UNZ_EOF (0) +#define UNZ_PARAMERROR (-102) +#define UNZ_BADZIPFILE (-103) +#define UNZ_INTERNALERROR (-104) +#define UNZ_CRCERROR (-105) + +/* tm_unz contain date/time info */ +typedef struct tm_unz_s +{ + uInt tm_sec; /* seconds after the minute - [0,59] */ + uInt tm_min; /* minutes after the hour - [0,59] */ + uInt tm_hour; /* hours since midnight - [0,23] */ + uInt tm_mday; /* day of the month - [1,31] */ + uInt tm_mon; /* months since January - [0,11] */ + uInt tm_year; /* years - [1980..2044] */ +} tm_unz; + +/* unz_global_info structure contain global data about the ZIPfile + These data comes from the end of central dir */ +typedef struct unz_global_info64_s +{ + ZPOS64_T number_entry; /* total number of entries in + the central dir on this disk */ + uLong size_comment; /* size of the global comment of the zipfile */ +} unz_global_info64; + +typedef struct unz_global_info_s +{ + uLong number_entry; /* total number of entries in + the central dir on this disk */ + uLong size_comment; /* size of the global comment of the zipfile */ +} unz_global_info; + +/* unz_file_info contain information about a file in the zipfile */ +typedef struct unz_file_info64_s +{ + uLong version; /* version made by 2 bytes */ + uLong version_needed; /* version needed to extract 2 bytes */ + uLong flag; /* general purpose bit flag 2 bytes */ + uLong compression_method; /* compression method 2 bytes */ + uLong dosDate; /* last mod file date in Dos fmt 4 bytes */ + uLong crc; /* crc-32 4 bytes */ + ZPOS64_T compressed_size; /* compressed size 8 bytes */ + ZPOS64_T uncompressed_size; /* uncompressed size 8 bytes */ + uLong size_filename; /* filename length 2 bytes */ + uLong size_file_extra; /* extra field length 2 bytes */ + uLong size_file_comment; /* file comment length 2 bytes */ + + uLong disk_num_start; /* disk number start 2 bytes */ + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ + + tm_unz tmu_date; +} unz_file_info64; + +typedef struct unz_file_info_s +{ + uLong version; /* version made by 2 bytes */ + uLong version_needed; /* version needed to extract 2 bytes */ + uLong flag; /* general purpose bit flag 2 bytes */ + uLong compression_method; /* compression method 2 bytes */ + uLong dosDate; /* last mod file date in Dos fmt 4 bytes */ + uLong crc; /* crc-32 4 bytes */ + uLong compressed_size; /* compressed size 4 bytes */ + uLong uncompressed_size; /* uncompressed size 4 bytes */ + uLong size_filename; /* filename length 2 bytes */ + uLong size_file_extra; /* extra field length 2 bytes */ + uLong size_file_comment; /* file comment length 2 bytes */ + + uLong disk_num_start; /* disk number start 2 bytes */ + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ + + tm_unz tmu_date; +} unz_file_info; + +extern int ZEXPORT unzStringFileNameCompare OF ((const char* fileName1, + const char* fileName2, + int iCaseSensitivity)); +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) +*/ + + +extern unzFile ZEXPORT unzOpen OF((const char *path)); +extern unzFile ZEXPORT unzOpen64 OF((const void *path)); +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows XP computer "c:\\zlib\\zlib113.zip" or on an Unix computer + "zlib/zlib113.zip". + If the zipfile cannot be opened (file don't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. + the "64" function take a const void* pointer, because the path is just the + value passed to the open64_file_func callback. + Under Windows, if UNICODE is defined, using fill_fopen64_filefunc, the path + is a pointer to a wide unicode string (LPCTSTR is LPCWSTR), so const char* + does not describe the reality +*/ + + +extern unzFile ZEXPORT unzOpen2 OF((const char *path, + zlib_filefunc_def* pzlib_filefunc_def)); +/* + Open a Zip file, like unzOpen, but provide a set of file low level API + for read/write the zip file (see ioapi.h) +*/ + +extern unzFile ZEXPORT unzOpen2_64 OF((const void *path, + zlib_filefunc64_def* pzlib_filefunc_def)); +/* + Open a Zip file, like unz64Open, but provide a set of file low level API + for read/write the zip file (see ioapi.h) +*/ + +extern int ZEXPORT unzClose OF((unzFile file)); +/* + Close a ZipFile opened with unzipOpen. + If there is files inside the .Zip opened with unzOpenCurrentFile (see later), + these files MUST be closed with unzipCloseCurrentFile before call unzipClose. + return UNZ_OK if there is no problem. */ + +extern int ZEXPORT unzGetGlobalInfo OF((unzFile file, + unz_global_info *pglobal_info)); + +extern int ZEXPORT unzGetGlobalInfo64 OF((unzFile file, + unz_global_info64 *pglobal_info)); +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ + + +extern int ZEXPORT unzGetGlobalComment OF((unzFile file, + char *szComment, + uLong uSizeBuf)); +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 +*/ + + +/***************************************************************************/ +/* Unzip package allow you browse the directory of the zipfile */ + +extern int ZEXPORT unzGoToFirstFile OF((unzFile file)); +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem +*/ + +extern int ZEXPORT unzGoToNextFile OF((unzFile file)); +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. +*/ + +extern int ZEXPORT unzLocateFile OF((unzFile file, + const char *szFileName, + int iCaseSensitivity)); +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found +*/ + + +/* ****************************************** */ +/* Ryan supplied functions */ +/* unz_file_info contain information about a file in the zipfile */ +typedef struct unz_file_pos_s +{ + uLong pos_in_zip_directory; /* offset in zip file directory */ + uLong num_of_file; /* # of file */ +} unz_file_pos; + +extern int ZEXPORT unzGetFilePos( + unzFile file, + unz_file_pos* file_pos); + +extern int ZEXPORT unzGoToFilePos( + unzFile file, + unz_file_pos* file_pos); + +typedef struct unz64_file_pos_s +{ + ZPOS64_T pos_in_zip_directory; /* offset in zip file directory */ + ZPOS64_T num_of_file; /* # of file */ +} unz64_file_pos; + +extern int ZEXPORT unzGetFilePos64( + unzFile file, + unz64_file_pos* file_pos); + +extern int ZEXPORT unzGoToFilePos64( + unzFile file, + const unz64_file_pos* file_pos); + +/* ****************************************** */ + +extern int ZEXPORT unzGetCurrentFileInfo64 OF((unzFile file, + unz_file_info64 *pfile_info, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); + +extern int ZEXPORT unzGetCurrentFileInfo OF((unzFile file, + unz_file_info *pfile_info, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); +/* + Get Info about the current file + if pfile_info!=NULL, the *pfile_info structure will contain somes info about + the current file + if szFileName!=NULL, the filemane string will be copied in szFileName + (fileNameBufferSize is the size of the buffer) + if extraField!=NULL, the extra field information will be copied in extraField + (extraFieldBufferSize is the size of the buffer). + This is the Central-header version of the extra field + if szComment!=NULL, the comment string of the file will be copied in szComment + (commentBufferSize is the size of the buffer) +*/ + + +/** Addition for GDAL : START */ + +extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64 OF((unzFile file)); + +/** Addition for GDAL : END */ + + +/***************************************************************************/ +/* for reading the content of the current zipfile, you can open it, read data + from it, and close it (you can close it before reading all the file) + */ + +extern int ZEXPORT unzOpenCurrentFile OF((unzFile file)); +/* + Open for reading data the current file in the zipfile. + If there is no error, the return value is UNZ_OK. +*/ + +extern int ZEXPORT unzOpenCurrentFilePassword OF((unzFile file, + const char* password)); +/* + Open for reading data the current file in the zipfile. + password is a crypting password + If there is no error, the return value is UNZ_OK. +*/ + +extern int ZEXPORT unzOpenCurrentFile2 OF((unzFile file, + int* method, + int* level, + int raw)); +/* + Same than unzOpenCurrentFile, but open for read raw the file (not uncompress) + if raw==1 + *method will receive method of compression, *level will receive level of + compression + note : you can set level parameter as NULL (if you did not want known level, + but you CANNOT set method parameter as NULL +*/ + +extern int ZEXPORT unzOpenCurrentFile3 OF((unzFile file, + int* method, + int* level, + int raw, + const char* password)); +/* + Same than unzOpenCurrentFile, but open for read raw the file (not uncompress) + if raw==1 + *method will receive method of compression, *level will receive level of + compression + note : you can set level parameter as NULL (if you did not want known level, + but you CANNOT set method parameter as NULL +*/ + + +extern int ZEXPORT unzCloseCurrentFile OF((unzFile file)); +/* + Close the file in zip opened with unzOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good +*/ + +extern int ZEXPORT unzReadCurrentFile OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read bytes from the current file (opened by unzOpenCurrentFile) + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) +*/ + +extern z_off_t ZEXPORT unztell OF((unzFile file)); + +extern ZPOS64_T ZEXPORT unztell64 OF((unzFile file)); +/* + Give the current position in uncompressed data +*/ + +extern int ZEXPORT unzeof OF((unzFile file)); +/* + return 1 if the end of file was reached, 0 elsewhere +*/ + +extern int ZEXPORT unzGetLocalExtrafield OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code +*/ + +/***************************************************************************/ + +/* Get the current file offset */ +extern ZPOS64_T ZEXPORT unzGetOffset64 (unzFile file); +extern uLong ZEXPORT unzGetOffset (unzFile file); + +/* Set the current file offset */ +extern int ZEXPORT unzSetOffset64 (unzFile file, ZPOS64_T pos); +extern int ZEXPORT unzSetOffset (unzFile file, uLong pos); + + + +#ifdef __cplusplus +} +#endif + +#endif /* _unz64_H */ diff --git a/deps/zconf.h b/deps/zconf.h new file mode 100644 index 0000000..9987a77 --- /dev/null +++ b/deps/zconf.h @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/deps/zconf.h.in b/deps/zconf.h.in new file mode 100644 index 0000000..9987a77 --- /dev/null +++ b/deps/zconf.h.in @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/deps/zlib/adler32.c b/deps/zlib/adler32.c new file mode 100644 index 0000000..cccb3a2 --- /dev/null +++ b/deps/zlib/adler32.c @@ -0,0 +1,75 @@ +/* adler32.c -- compute the Adler-32 checksum of a data stream + * Copyright (C) 1995-2003 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include <stdint.h> +#include <stddef.h> +#include "zutil.h" + +#define BASE 65521UL /* largest prime smaller than 65536 */ +#define NMAX 5552 +/* NMAX is the largest n such that 255n(n+1)/2 + (n+1)(BASE-1) <= 2^32-1 */ + +#define DO1(buf,i) {s1 += buf[i]; s2 += s1;} +#define DO2(buf,i) DO1(buf,i); DO1(buf,i+1); +#define DO4(buf,i) DO2(buf,i); DO2(buf,i+2); +#define DO8(buf,i) DO4(buf,i); DO4(buf,i+4); +#define DO16(buf) DO8(buf,0); DO8(buf,8); + +#ifdef NO_DIVIDE +# define MOD(a) \ + do { \ + if (a >= (BASE << 16)) a -= (BASE << 16); \ + if (a >= (BASE << 15)) a -= (BASE << 15); \ + if (a >= (BASE << 14)) a -= (BASE << 14); \ + if (a >= (BASE << 13)) a -= (BASE << 13); \ + if (a >= (BASE << 12)) a -= (BASE << 12); \ + if (a >= (BASE << 11)) a -= (BASE << 11); \ + if (a >= (BASE << 10)) a -= (BASE << 10); \ + if (a >= (BASE << 9)) a -= (BASE << 9); \ + if (a >= (BASE << 8)) a -= (BASE << 8); \ + if (a >= (BASE << 7)) a -= (BASE << 7); \ + if (a >= (BASE << 6)) a -= (BASE << 6); \ + if (a >= (BASE << 5)) a -= (BASE << 5); \ + if (a >= (BASE << 4)) a -= (BASE << 4); \ + if (a >= (BASE << 3)) a -= (BASE << 3); \ + if (a >= (BASE << 2)) a -= (BASE << 2); \ + if (a >= (BASE << 1)) a -= (BASE << 1); \ + if (a >= BASE) a -= BASE; \ + } while (0) +#else +# define MOD(a) a %= BASE +#endif + +/* ========================================================================= */ +uLong adler32(uLong adler, const Bytef *buf, uInt len) +{ + uint32_t s1 = adler & 0xffff; + uint32_t s2 = (adler >> 16) & 0xffff; + int k; + + if (buf == NULL) + return 1L; + + while (len > 0) { + k = len < NMAX ? (int)len : NMAX; + len -= k; + while (k >= 16) { + DO16(buf); + buf += 16; + k -= 16; + } + if (k != 0) do { + s1 += *buf++; + s2 += s1; + } while (--k); + MOD(s1); + MOD(s2); + } + return (s2 << 16) | s1; +} + diff --git a/deps/zlib/compress.c b/deps/zlib/compress.c new file mode 100644 index 0000000..48465bd --- /dev/null +++ b/deps/zlib/compress.c @@ -0,0 +1,70 @@ +/* compress.c -- compress a memory buffer + * Copyright (C) 1995-2005 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include "zlib.h" + +/* =========================================================================== + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least 0.1% larger than sourceLen plus + 12 bytes. Upon exit, destLen is the actual size of the compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. + */ +int ZEXPORT compress2 (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen, int level) +{ + z_stream stream; + int err; + + stream.next_in = (Bytef *)source; + stream.avail_in = (uInt)sourceLen; +#ifdef MAXSEG_64K + /* Check for source > 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; +#endif + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = Z_NULL; + stream.zfree = Z_NULL; + stream.opaque = (voidpf)0; + + err = deflateInit(&stream, level); + if (err != Z_OK) return err; + + err = deflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + deflateEnd(&stream); + return err == Z_OK ? Z_BUF_ERROR : err; + } + *destLen = stream.total_out; + + err = deflateEnd(&stream); + return err; +} + +/* =========================================================================== +*/ +int ZEXPORT compress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen) +{ + return compress2(dest, destLen, source, sourceLen, Z_DEFAULT_COMPRESSION); +} + +/* =========================================================================== + If the default memLevel or windowBits for deflateInit() is changed, then + this function needs to be updated. + */ +uLong ZEXPORT compressBound (uLong sourceLen) +{ + return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) + + (sourceLen >> 25) + 13; +} diff --git a/deps/zlib/crc32.c b/deps/zlib/crc32.c new file mode 100644 index 0000000..73369a2 --- /dev/null +++ b/deps/zlib/crc32.c @@ -0,0 +1,88 @@ +#ifndef _S_CRC32_H +#define _S_CRC32_H + +#ifdef __cplusplus +extern "C" { +#endif + + static const unsigned long crc_table[256] = { + 0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L, + 0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L, + 0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L, + 0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL, + 0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L, + 0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L, + 0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L, + 0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL, + 0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L, + 0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL, + 0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L, + 0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L, + 0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L, + 0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL, + 0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL, + 0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L, + 0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL, + 0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L, + 0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L, + 0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L, + 0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL, + 0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L, + 0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L, + 0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL, + 0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L, + 0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L, + 0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L, + 0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L, + 0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L, + 0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL, + 0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL, + 0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L, + 0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L, + 0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL, + 0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL, + 0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L, + 0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL, + 0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L, + 0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL, + 0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L, + 0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL, + 0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L, + 0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L, + 0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL, + 0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L, + 0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L, + 0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L, + 0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L, + 0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L, + 0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L, + 0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL, + 0x2d02ef8dL + }; + +#define DO1_CRC32(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8); +#define DO2_CRC32(buf) DO1_CRC32(buf); DO1_CRC32(buf); +#define DO4_CRC32(buf) DO2_CRC32(buf); DO2_CRC32(buf); +#define DO8_CRC32(buf) DO4_CRC32(buf); DO4_CRC32(buf); + + unsigned long crc32(unsigned long crc, const unsigned char *buf, unsigned int len) + { + if (buf == 0) return 0L; + crc = crc ^ 0xffffffffL; + while (len >= 8) + { + DO8_CRC32(buf); + len -= 8; + } + if (len) do { + DO1_CRC32(buf); + } while (--len); + return crc ^ 0xffffffffL; + } + +#ifdef __cplusplus +} +#endif + +#endif + diff --git a/deps/zlib/deflate.c b/deps/zlib/deflate.c new file mode 100644 index 0000000..f8fbc48 --- /dev/null +++ b/deps/zlib/deflate.c @@ -0,0 +1,1913 @@ +/* deflate.c -- compress data using the deflation algorithm + * Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process depends on being able to identify portions + * of the input text which are identical to earlier input (within a + * sliding window trailing behind the input currently being processed). + * + * The most straightforward technique turns out to be the fastest for + * most input files: try all possible matches and select the longest. + * The key feature of this algorithm is that insertions into the string + * dictionary are very simple and thus fast, and deletions are avoided + * completely. Insertions are performed at each input character, whereas + * string matches are performed only when the previous match ends. So it + * is preferable to spend more time in matches to allow very fast string + * insertions and avoid deletions. The matching algorithm for small + * strings is inspired from that of Rabin & Karp. A brute force approach + * is used to find longer strings when a small match has been found. + * A similar algorithm is used in comic (by Jan-Mark Wams) and freeze + * (by Leonid Broukhis). + * A previous version of this file used a more sophisticated algorithm + * (by Fiala and Greene) which is guaranteed to run in linear amortized + * time, but has a larger average cost, uses more memory and is patented. + * However the F&G algorithm may be faster for some highly redundant + * files if the parameter max_chain_length (described below) is too large. + * + * ACKNOWLEDGEMENTS + * + * The idea of lazy evaluation of matches is due to Jan-Mark Wams, and + * I found it in 'freeze' written by Leonid Broukhis. + * Thanks to many people for bug reports and testing. + * + * REFERENCES + * + * Deutsch, L.P.,"DEFLATE Compressed Data Format Specification". + * Available in http://tools.ietf.org/html/rfc1951 + * + * A description of the Rabin and Karp algorithm is given in the book + * "Algorithms" by R. Sedgewick, Addison-Wesley, p252. + * + * Fiala,E.R., and Greene,D.H. + * Data Compression with Finite Windows, Comm.ACM, 32,4 (1989) 490-595 + * + */ + +/* @(#) $Id$ */ + +#include "deflate.h" + +const char deflate_copyright[] = +" deflate 1.2.8 Copyright 1995-2013 Jean-loup Gailly and Mark Adler "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ + +/* =========================================================================== + * Function prototypes. + */ +typedef enum { + need_more, /* block not completed, need more input or more output */ + block_done, /* block flush performed */ + finish_started, /* finish started, need only more output at next deflate */ + finish_done /* finish done, accept no more input or output */ +} block_state; + +typedef block_state (*compress_func) OF((deflate_state *s, int flush)); +/* Compression function. Returns the block state after the call. */ + +local void fill_window OF((deflate_state *s)); +local block_state deflate_stored OF((deflate_state *s, int flush)); +local block_state deflate_fast OF((deflate_state *s, int flush)); +#ifndef FASTEST +local block_state deflate_slow OF((deflate_state *s, int flush)); +#endif +local block_state deflate_rle OF((deflate_state *s, int flush)); +local block_state deflate_huff OF((deflate_state *s, int flush)); +local void lm_init OF((deflate_state *s)); +local void putShortMSB OF((deflate_state *s, uInt b)); +local void flush_pending OF((z_streamp strm)); +local int read_buf OF((z_streamp strm, Bytef *buf, unsigned size)); +#ifdef ASMV +void match_init OF((void)); /* asm code initialization */ +uInt longest_match OF((deflate_state *s, IPos cur_match)); +#else +local uInt longest_match OF((deflate_state *s, IPos cur_match)); +#endif + +#ifdef DEBUG +local void check_match OF((deflate_state *s, IPos start, IPos match, + int length)); +#endif + +/* =========================================================================== + * Local data + */ + +#define NIL 0 +/* Tail of hash chains */ + +#ifndef TOO_FAR +# define TOO_FAR 4096 +#endif +/* Matches of length 3 are discarded if their distance exceeds TOO_FAR */ + +/* Values for max_lazy_match, good_match and max_chain_length, depending on + * the desired pack level (0..9). The values given below have been tuned to + * exclude worst case performance for pathological files. Better values may be + * found for specific files. + */ +typedef struct config_s { + ush good_length; /* reduce lazy search above this match length */ + ush max_lazy; /* do not perform lazy search above this match length */ + ush nice_length; /* quit search above this match length */ + ush max_chain; + compress_func func; +} config; + +#ifdef FASTEST +local const config configuration_table[2] = { + /* good lazy nice chain */ + /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */ + /* 1 */ {4, 4, 8, 4, deflate_fast}}; /* max speed, no lazy matches */ +#else +local const config configuration_table[10] = { + /* good lazy nice chain */ + /* 0 */ {0, 0, 0, 0, deflate_stored}, /* store only */ + /* 1 */ {4, 4, 8, 4, deflate_fast}, /* max speed, no lazy matches */ + /* 2 */ {4, 5, 16, 8, deflate_fast}, + /* 3 */ {4, 6, 32, 32, deflate_fast}, + + /* 4 */ {4, 4, 16, 16, deflate_slow}, /* lazy matches */ + /* 5 */ {8, 16, 32, 32, deflate_slow}, + /* 6 */ {8, 16, 128, 128, deflate_slow}, + /* 7 */ {8, 32, 128, 256, deflate_slow}, + /* 8 */ {32, 128, 258, 1024, deflate_slow}, + /* 9 */ {32, 258, 258, 4096, deflate_slow}}; /* max compression */ +#endif + +/* Note: the deflate() code requires max_lazy >= MIN_MATCH and max_chain >= 4 + * For deflate_fast() (levels <= 3) good is ignored and lazy has a different + * meaning. + */ + +#define EQUAL 0 +/* result of memcmp for equal strings */ + +/* rank Z_BLOCK between Z_NO_FLUSH and Z_PARTIAL_FLUSH */ +#define RANK(f) (((f) << 1) - ((f) > 4 ? 9 : 0)) + +/* =========================================================================== + * Update a hash value with the given input byte + * IN assertion: all calls to to UPDATE_HASH are made with consecutive + * input characters, so that a running hash key can be computed from the + * previous key instead of complete recalculation each time. + */ +#define UPDATE_HASH(s,h,c) (h = (((h)<<s->hash_shift) ^ (c)) & s->hash_mask) + + +/* =========================================================================== + * Insert string str in the dictionary and set match_head to the previous head + * of the hash chain (the most recent string with same hash key). Return + * the previous length of the hash chain. + * If this file is compiled with -DFASTEST, the compression level is forced + * to 1, and no hash chains are maintained. + * IN assertion: all calls to to INSERT_STRING are made with consecutive + * input characters and the first MIN_MATCH bytes of str are valid + * (except for the last MIN_MATCH-1 bytes of the input file). + */ +#ifdef FASTEST +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + match_head = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#else +#define INSERT_STRING(s, str, match_head) \ + (UPDATE_HASH(s, s->ins_h, s->window[(str) + (MIN_MATCH-1)]), \ + match_head = s->prev[(str) & s->w_mask] = s->head[s->ins_h], \ + s->head[s->ins_h] = (Pos)(str)) +#endif + +/* =========================================================================== + * Initialize the hash table (avoiding 64K overflow for 16 bit systems). + * prev[] will be initialized on the fly. + */ +#define CLEAR_HASH(s) \ + s->head[s->hash_size-1] = NIL; \ +zmemzero((Bytef *)s->head, (unsigned)(s->hash_size-1)*sizeof(*s->head)); + +int ZEXPORT deflateResetKeep (z_streamp strm); + +int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits); + +/* ========================================================================= */ +int ZEXPORT deflateInit_(z_streamp strm, int level, const char *version, int stream_size) +{ + return deflateInit2_(strm, level, Z_DEFLATED, MAX_WBITS, DEF_MEM_LEVEL, + Z_DEFAULT_STRATEGY, version, stream_size); + /* To do: ignore strm->next_in if we use it as window */ +} + +/* ========================================================================= */ +int ZEXPORT deflateInit2_(z_streamp strm, int level, int method, int windowBits, int memLevel, int strategy, + const char *version, int stream_size) +{ + deflate_state *s; + int wrap = 1; + static const char my_version[] = ZLIB_VERSION; + + ushf *overlay; + /* We overlay pending_buf and d_buf+l_buf. This works since the average + * output size for (length,distance) codes is <= 24 bits. + */ + + if (version == Z_NULL || version[0] != my_version[0] || + stream_size != sizeof(z_stream)) { + return Z_VERSION_ERROR; + } + if (strm == Z_NULL) return Z_STREAM_ERROR; + + strm->msg = Z_NULL; + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + +#ifdef FASTEST + if (level != 0) level = 1; +#else + if (level == Z_DEFAULT_COMPRESSION) level = 6; +#endif + + if (windowBits < 0) { /* suppress zlib wrapper */ + wrap = 0; + windowBits = -windowBits; + } +#ifdef GZIP + else if (windowBits > 15) { + wrap = 2; /* write gzip wrapper instead */ + windowBits -= 16; + } +#endif + if (memLevel < 1 || memLevel > MAX_MEM_LEVEL || method != Z_DEFLATED || + windowBits < 8 || windowBits > 15 || level < 0 || level > 9 || + strategy < 0 || strategy > Z_FIXED) { + return Z_STREAM_ERROR; + } + if (windowBits == 8) windowBits = 9; /* until 256-byte window bug fixed */ + s = (deflate_state *) ZALLOC(strm, 1, sizeof(deflate_state)); + if (s == Z_NULL) return Z_MEM_ERROR; + strm->state = (struct internal_state*)s; + s->strm = strm; + + s->wrap = wrap; + s->gzhead = Z_NULL; + s->w_bits = windowBits; + s->w_size = 1 << s->w_bits; + s->w_mask = s->w_size - 1; + + s->hash_bits = memLevel + 7; + s->hash_size = 1 << s->hash_bits; + s->hash_mask = s->hash_size - 1; + s->hash_shift = ((s->hash_bits+MIN_MATCH-1)/MIN_MATCH); + + s->window = (Bytef *) ZALLOC(strm, s->w_size, 2*sizeof(Byte)); + s->prev = (Posf *) ZALLOC(strm, s->w_size, sizeof(Pos)); + s->head = (Posf *) ZALLOC(strm, s->hash_size, sizeof(Pos)); + + s->high_water = 0; /* nothing written to s->window yet */ + + s->lit_bufsize = 1 << (memLevel + 6); /* 16K elements by default */ + + overlay = (ushf *) ZALLOC(strm, s->lit_bufsize, sizeof(ush)+2); + s->pending_buf = (uchf *) overlay; + s->pending_buf_size = (ulg)s->lit_bufsize * (sizeof(ush)+2L); + + if (s->window == Z_NULL || s->prev == Z_NULL || s->head == Z_NULL || + s->pending_buf == Z_NULL) { + s->status = FINISH_STATE; + strm->msg = ERR_MSG(Z_MEM_ERROR); + deflateEnd (strm); + return Z_MEM_ERROR; + } + s->d_buf = overlay + s->lit_bufsize/sizeof(ush); + s->l_buf = s->pending_buf + (1+sizeof(ush))*s->lit_bufsize; + + s->level = level; + s->strategy = strategy; + s->method = (Byte)method; + + return deflateReset(strm); +} + +/* ========================================================================= */ +int ZEXPORT deflateSetDictionary (z_streamp strm, const Bytef *dictionary, uInt dictLength) +{ + deflate_state *s; + uInt str, n; + int wrap; + unsigned avail; + unsigned char *next; + + if (strm == Z_NULL || strm->state == Z_NULL || dictionary == Z_NULL) + return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + wrap = s->wrap; + if (wrap == 2 || (wrap == 1 && s->status != INIT_STATE) || s->lookahead) + return Z_STREAM_ERROR; + + /* when using zlib wrappers, compute Adler-32 for provided dictionary */ + if (wrap == 1) + strm->adler = adler32(strm->adler, dictionary, dictLength); + s->wrap = 0; /* avoid computing Adler-32 in read_buf */ + + /* if dictionary would fill window, just replace the history */ + if (dictLength >= s->w_size) { + if (wrap == 0) { /* already empty otherwise */ + CLEAR_HASH(s); + s->strstart = 0; + s->block_start = 0L; + s->insert = 0; + } + dictionary += dictLength - s->w_size; /* use the tail */ + dictLength = s->w_size; + } + + /* insert dictionary into window and hash */ + avail = strm->avail_in; + next = strm->next_in; + strm->avail_in = dictLength; + strm->next_in = (Bytef *)dictionary; + fill_window(s); + while (s->lookahead >= MIN_MATCH) { + str = s->strstart; + n = s->lookahead - (MIN_MATCH-1); + do { + UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]); +#ifndef FASTEST + s->prev[str & s->w_mask] = s->head[s->ins_h]; +#endif + s->head[s->ins_h] = (Pos)str; + str++; + } while (--n); + s->strstart = str; + s->lookahead = MIN_MATCH-1; + fill_window(s); + } + s->strstart += s->lookahead; + s->block_start = (long)s->strstart; + s->insert = s->lookahead; + s->lookahead = 0; + s->match_length = s->prev_length = MIN_MATCH-1; + s->match_available = 0; + strm->next_in = next; + strm->avail_in = avail; + s->wrap = wrap; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateResetKeep (z_streamp strm) +{ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + strm->zalloc == Z_NULL || strm->zfree == Z_NULL) { + return Z_STREAM_ERROR; + } + + strm->total_in = strm->total_out = 0; + strm->msg = Z_NULL; /* use zfree if we ever allocate msg dynamically */ + strm->data_type = Z_UNKNOWN; + + s = (deflate_state *)strm->state; + s->pending = 0; + s->pending_out = s->pending_buf; + + if (s->wrap < 0) { + s->wrap = -s->wrap; /* was made negative by deflate(..., Z_FINISH); */ + } + s->status = s->wrap ? INIT_STATE : BUSY_STATE; + strm->adler = +#ifdef GZIP + s->wrap == 2 ? crc32(0L, Z_NULL, 0) : +#endif + adler32(0L, Z_NULL, 0); + s->last_flush = Z_NO_FLUSH; + + _tr_init(s); + + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateReset (z_streamp strm) +{ + int ret; + + ret = deflateResetKeep(strm); + if (ret == Z_OK) + lm_init((deflate_state*)strm->state); + return ret; +} + +/* ========================================================================= */ +int ZEXPORT deflateSetHeader (z_streamp strm, gz_headerp head) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + if (state->wrap != 2) + return Z_STREAM_ERROR; + state->gzhead = head; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflatePending (z_streamp strm, unsigned *pending, int *bits) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + if (pending != Z_NULL) + *pending = state->pending; + if (bits != Z_NULL) + *bits = state->bi_valid; + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflatePrime (z_streamp strm, int bits, int value) +{ + deflate_state *s; + int put; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + if ((Bytef *)(s->d_buf) < s->pending_out + ((Buf_size + 7) >> 3)) + return Z_BUF_ERROR; + do { + put = Buf_size - s->bi_valid; + if (put > bits) + put = bits; + s->bi_buf |= (ush)((value & ((1 << put) - 1)) << s->bi_valid); + s->bi_valid += put; + _tr_flush_bits(s); + value >>= put; + bits -= put; + } while (bits); + return Z_OK; +} + +/* ========================================================================= */ +int ZEXPORT deflateParams(z_streamp strm, int level, int strategy) +{ + deflate_state *s; + compress_func func; + int err = Z_OK; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + +#ifdef FASTEST + if (level != 0) level = 1; +#else + if (level == Z_DEFAULT_COMPRESSION) level = 6; +#endif + if (level < 0 || level > 9 || strategy < 0 || strategy > Z_FIXED) { + return Z_STREAM_ERROR; + } + func = configuration_table[s->level].func; + + if ((strategy != s->strategy || func != configuration_table[level].func) && + strm->total_in != 0) { + /* Flush the last buffer: */ + err = deflate(strm, Z_BLOCK); + if (err == Z_BUF_ERROR && s->pending == 0) + err = Z_OK; + } + if (s->level != level) { + s->level = level; + s->max_lazy_match = configuration_table[level].max_lazy; + s->good_match = configuration_table[level].good_length; + s->nice_match = configuration_table[level].nice_length; + s->max_chain_length = configuration_table[level].max_chain; + } + s->strategy = strategy; + return err; +} + +/* ========================================================================= */ +int ZEXPORT deflateTune(z_streamp strm, int good_length, int max_lazy, int nice_length, int max_chain) +{ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + s = (deflate_state*)strm->state; + s->good_match = good_length; + s->max_lazy_match = max_lazy; + s->nice_match = nice_length; + s->max_chain_length = max_chain; + return Z_OK; +} + +/* ========================================================================= + * For the default windowBits of 15 and memLevel of 8, this function returns + * a close to exact, as well as small, upper bound on the compressed size. + * They are coded as constants here for a reason--if the #define's are + * changed, then this function needs to be changed as well. The return + * value for 15 and 8 only works for those exact settings. + * + * For any setting other than those defaults for windowBits and memLevel, + * the value returned is a conservative worst case for the maximum expansion + * resulting from using fixed blocks instead of stored blocks, which deflate + * can emit on compressed data for some combinations of the parameters. + * + * This function could be more sophisticated to provide closer upper bounds for + * every combination of windowBits and memLevel. But even the conservative + * upper bound of about 14% expansion does not seem onerous for output buffer + * allocation. + */ +uLong ZEXPORT deflateBound(z_streamp strm, uLong sourceLen) +{ + deflate_state *s; + uLong complen, wraplen; + Bytef *str; + + /* conservative upper bound for compressed data */ + complen = sourceLen + + ((sourceLen + 7) >> 3) + ((sourceLen + 63) >> 6) + 5; + + /* if can't get parameters, return conservative bound plus zlib wrapper */ + if (strm == Z_NULL || strm->state == Z_NULL) + return complen + 6; + + /* compute wrapper length */ + s = (deflate_state*)strm->state; + switch (s->wrap) { + case 0: /* raw deflate */ + wraplen = 0; + break; + case 1: /* zlib wrapper */ + wraplen = 6 + (s->strstart ? 4 : 0); + break; + case 2: /* gzip wrapper */ + wraplen = 18; + if (s->gzhead != Z_NULL) { /* user-supplied gzip header */ + if (s->gzhead->extra != Z_NULL) + wraplen += 2 + s->gzhead->extra_len; + str = s->gzhead->name; + if (str != Z_NULL) + do { + wraplen++; + } while (*str++); + str = s->gzhead->comment; + if (str != Z_NULL) + do { + wraplen++; + } while (*str++); + if (s->gzhead->hcrc) + wraplen += 2; + } + break; + default: /* for compiler happiness */ + wraplen = 6; + } + + /* if not default parameters, return conservative bound */ + if (s->w_bits != 15 || s->hash_bits != 8 + 7) + return complen + wraplen; + + /* default settings: return tight bound for that case */ + return sourceLen + (sourceLen >> 12) + (sourceLen >> 14) + + (sourceLen >> 25) + 13 - 6 + wraplen; +} + +/* ========================================================================= + * Put a short in the pending buffer. The 16-bit value is put in MSB order. + * IN assertion: the stream state is correct and there is enough room in + * pending_buf. + */ +local void putShortMSB (deflate_state *s, uInt b) +{ + put_byte(s, (Byte)(b >> 8)); + put_byte(s, (Byte)(b & 0xff)); +} + +/* ========================================================================= + * Flush as much pending output as possible. All deflate() output goes + * through this function so some applications may wish to modify it + * to avoid allocating a large strm->next_out buffer and copying into it. + * (See also read_buf()). + */ +local void flush_pending(z_streamp strm) +{ + unsigned len; + deflate_state *s = (deflate_state*)strm->state; + + _tr_flush_bits(s); + len = s->pending; + if (len > strm->avail_out) len = strm->avail_out; + if (len == 0) return; + + zmemcpy(strm->next_out, s->pending_out, len); + strm->next_out += len; + s->pending_out += len; + strm->total_out += len; + strm->avail_out -= len; + s->pending -= len; + if (s->pending == 0) { + s->pending_out = s->pending_buf; + } +} + +/* ========================================================================= */ +int ZEXPORT deflate (z_streamp strm, int flush) +{ + int old_flush; /* value of flush param for previous deflate call */ + deflate_state *s; + + if (strm == Z_NULL || strm->state == Z_NULL || + flush > Z_BLOCK || flush < 0) { + return Z_STREAM_ERROR; + } + s = (deflate_state*)strm->state; + + if (strm->next_out == Z_NULL || + (strm->next_in == Z_NULL && strm->avail_in != 0) || + (s->status == FINISH_STATE && flush != Z_FINISH)) { + ERR_RETURN(strm, Z_STREAM_ERROR); + } + if (strm->avail_out == 0) ERR_RETURN(strm, Z_BUF_ERROR); + + s->strm = strm; /* just in case */ + old_flush = s->last_flush; + s->last_flush = flush; + + /* Write the header */ + if (s->status == INIT_STATE) { +#ifdef GZIP + if (s->wrap == 2) { + strm->adler = crc32(0L, Z_NULL, 0); + put_byte(s, 31); + put_byte(s, 139); + put_byte(s, 8); + if (s->gzhead == Z_NULL) { + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, 0); + put_byte(s, s->level == 9 ? 2 : + (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ? + 4 : 0)); + put_byte(s, OS_CODE); + s->status = BUSY_STATE; + } + else { + put_byte(s, (s->gzhead->text ? 1 : 0) + + (s->gzhead->hcrc ? 2 : 0) + + (s->gzhead->extra == Z_NULL ? 0 : 4) + + (s->gzhead->name == Z_NULL ? 0 : 8) + + (s->gzhead->comment == Z_NULL ? 0 : 16) + ); + put_byte(s, (Byte)(s->gzhead->time & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 8) & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 16) & 0xff)); + put_byte(s, (Byte)((s->gzhead->time >> 24) & 0xff)); + put_byte(s, s->level == 9 ? 2 : + (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2 ? + 4 : 0)); + put_byte(s, s->gzhead->os & 0xff); + if (s->gzhead->extra != Z_NULL) { + put_byte(s, s->gzhead->extra_len & 0xff); + put_byte(s, (s->gzhead->extra_len >> 8) & 0xff); + } + if (s->gzhead->hcrc) + strm->adler = crc32(strm->adler, s->pending_buf, + s->pending); + s->gzindex = 0; + s->status = EXTRA_STATE; + } + } + else +#endif + { + uInt header = (Z_DEFLATED + ((s->w_bits-8)<<4)) << 8; + uInt level_flags; + + if (s->strategy >= Z_HUFFMAN_ONLY || s->level < 2) + level_flags = 0; + else if (s->level < 6) + level_flags = 1; + else if (s->level == 6) + level_flags = 2; + else + level_flags = 3; + header |= (level_flags << 6); + if (s->strstart != 0) header |= PRESET_DICT; + header += 31 - (header % 31); + + s->status = BUSY_STATE; + putShortMSB(s, header); + + /* Save the adler32 of the preset dictionary: */ + if (s->strstart != 0) { + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + } + strm->adler = adler32(0L, Z_NULL, 0); + } + } +#ifdef GZIP + if (s->status == EXTRA_STATE) { + if (s->gzhead->extra != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + + while (s->gzindex < (s->gzhead->extra_len & 0xffff)) { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) + break; + } + put_byte(s, s->gzhead->extra[s->gzindex]); + s->gzindex++; + } + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (s->gzindex == s->gzhead->extra_len) { + s->gzindex = 0; + s->status = NAME_STATE; + } + } + else + s->status = NAME_STATE; + } + if (s->status == NAME_STATE) { + if (s->gzhead->name != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + int val; + + do { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) { + val = 1; + break; + } + } + val = s->gzhead->name[s->gzindex++]; + put_byte(s, val); + } while (val != 0); + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (val == 0) { + s->gzindex = 0; + s->status = COMMENT_STATE; + } + } + else + s->status = COMMENT_STATE; + } + if (s->status == COMMENT_STATE) { + if (s->gzhead->comment != Z_NULL) { + uInt beg = s->pending; /* start of bytes to update crc */ + int val; + + do { + if (s->pending == s->pending_buf_size) { + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + flush_pending(strm); + beg = s->pending; + if (s->pending == s->pending_buf_size) { + val = 1; + break; + } + } + val = s->gzhead->comment[s->gzindex++]; + put_byte(s, val); + } while (val != 0); + if (s->gzhead->hcrc && s->pending > beg) + strm->adler = crc32(strm->adler, s->pending_buf + beg, + s->pending - beg); + if (val == 0) + s->status = HCRC_STATE; + } + else + s->status = HCRC_STATE; + } + if (s->status == HCRC_STATE) { + if (s->gzhead->hcrc) { + if (s->pending + 2 > s->pending_buf_size) + flush_pending(strm); + if (s->pending + 2 <= s->pending_buf_size) { + put_byte(s, (Byte)(strm->adler & 0xff)); + put_byte(s, (Byte)((strm->adler >> 8) & 0xff)); + strm->adler = crc32(0L, Z_NULL, 0); + s->status = BUSY_STATE; + } + } + else + s->status = BUSY_STATE; + } +#endif + + /* Flush as much pending output as possible */ + if (s->pending != 0) { + flush_pending(strm); + if (strm->avail_out == 0) { + /* Since avail_out is 0, deflate will be called again with + * more output space, but possibly with both pending and + * avail_in equal to zero. There won't be anything to do, + * but this is not an error situation so make sure we + * return OK instead of BUF_ERROR at next call of deflate: + */ + s->last_flush = -1; + return Z_OK; + } + + /* Make sure there is something to do and avoid duplicate consecutive + * flushes. For repeated and useless calls with Z_FINISH, we keep + * returning Z_STREAM_END instead of Z_BUF_ERROR. + */ + } else if (strm->avail_in == 0 && RANK(flush) <= RANK(old_flush) && + flush != Z_FINISH) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* User must not provide more input after the first FINISH: */ + if (s->status == FINISH_STATE && strm->avail_in != 0) { + ERR_RETURN(strm, Z_BUF_ERROR); + } + + /* Start a new block or continue the current one. + */ + if (strm->avail_in != 0 || s->lookahead != 0 || + (flush != Z_NO_FLUSH && s->status != FINISH_STATE)) { + block_state bstate; + + bstate = s->strategy == Z_HUFFMAN_ONLY ? deflate_huff(s, flush) : + (s->strategy == Z_RLE ? deflate_rle(s, flush) : + (*(configuration_table[s->level].func))(s, flush)); + + if (bstate == finish_started || bstate == finish_done) { + s->status = FINISH_STATE; + } + if (bstate == need_more || bstate == finish_started) { + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR next call, see above */ + } + return Z_OK; + /* If flush != Z_NO_FLUSH && avail_out == 0, the next call + * of deflate should use the same flush parameter to make sure + * that the flush is complete. So we don't have to output an + * empty block here, this will be done at next call. This also + * ensures that for a very small output buffer, we emit at most + * one empty block. + */ + } + if (bstate == block_done) { + if (flush == Z_PARTIAL_FLUSH) { + _tr_align(s); + } else if (flush != Z_BLOCK) { /* FULL_FLUSH or SYNC_FLUSH */ + _tr_stored_block(s, (char*)0, 0L, 0); + /* For a full flush, this empty block will be recognized + * as a special marker by inflate_sync(). + */ + if (flush == Z_FULL_FLUSH) { + CLEAR_HASH(s); /* forget history */ + if (s->lookahead == 0) { + s->strstart = 0; + s->block_start = 0L; + s->insert = 0; + } + } + } + flush_pending(strm); + if (strm->avail_out == 0) { + s->last_flush = -1; /* avoid BUF_ERROR at next call, see above */ + return Z_OK; + } + } + } + Assert(strm->avail_out > 0, "bug2"); + + if (flush != Z_FINISH) return Z_OK; + if (s->wrap <= 0) return Z_STREAM_END; + + /* Write the trailer */ +#ifdef GZIP + if (s->wrap == 2) { + put_byte(s, (Byte)(strm->adler & 0xff)); + put_byte(s, (Byte)((strm->adler >> 8) & 0xff)); + put_byte(s, (Byte)((strm->adler >> 16) & 0xff)); + put_byte(s, (Byte)((strm->adler >> 24) & 0xff)); + put_byte(s, (Byte)(strm->total_in & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 8) & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 16) & 0xff)); + put_byte(s, (Byte)((strm->total_in >> 24) & 0xff)); + } + else +#endif + { + putShortMSB(s, (uInt)(strm->adler >> 16)); + putShortMSB(s, (uInt)(strm->adler & 0xffff)); + } + flush_pending(strm); + /* If avail_out is zero, the application will call deflate again + * to flush the rest. + */ + if (s->wrap > 0) s->wrap = -s->wrap; /* write the trailer only once! */ + return s->pending != 0 ? Z_OK : Z_STREAM_END; +} + +/* ========================================================================= */ +int ZEXPORT deflateEnd (z_streamp strm) +{ + struct internal_state_deflate *state; + int status; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct internal_state_deflate*)strm->state; + + status = state->status; + if (status != INIT_STATE && + status != EXTRA_STATE && + status != NAME_STATE && + status != COMMENT_STATE && + status != HCRC_STATE && + status != BUSY_STATE && + status != FINISH_STATE) { + return Z_STREAM_ERROR; + } + + /* Deallocate in reverse order of allocations: */ + TRY_FREE(strm, state->pending_buf); + TRY_FREE(strm, state->head); + TRY_FREE(strm, state->prev); + TRY_FREE(strm, state->window); + + ZFREE(strm, state); + state = Z_NULL; + + return status == BUSY_STATE ? Z_DATA_ERROR : Z_OK; +} + +/* ========================================================================= + * Copy the source state to the destination state. + * To simplify the source, this is not supported for 16-bit MSDOS (which + * doesn't have enough memory anyway to duplicate compression states). + */ +int ZEXPORT deflateCopy (z_streamp dest, z_streamp source) +{ +#ifdef MAXSEG_64K + return Z_STREAM_ERROR; +#else + deflate_state *ds; + deflate_state *ss; + ushf *overlay; + + + if (source == Z_NULL || dest == Z_NULL || source->state == Z_NULL) { + return Z_STREAM_ERROR; + } + + ss = (deflate_state*)source->state; + + zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream)); + + ds = (deflate_state *) ZALLOC(dest, 1, sizeof(deflate_state)); + if (ds == Z_NULL) return Z_MEM_ERROR; + dest->state = (struct internal_state FAR *) ds; + zmemcpy((voidpf)ds, (voidpf)ss, sizeof(deflate_state)); + ds->strm = dest; + + ds->window = (Bytef *) ZALLOC(dest, ds->w_size, 2*sizeof(Byte)); + ds->prev = (Posf *) ZALLOC(dest, ds->w_size, sizeof(Pos)); + ds->head = (Posf *) ZALLOC(dest, ds->hash_size, sizeof(Pos)); + overlay = (ushf *) ZALLOC(dest, ds->lit_bufsize, sizeof(ush)+2); + ds->pending_buf = (uchf *) overlay; + + if (ds->window == Z_NULL || ds->prev == Z_NULL || ds->head == Z_NULL || + ds->pending_buf == Z_NULL) { + deflateEnd (dest); + return Z_MEM_ERROR; + } + /* following zmemcpy do not work for 16-bit MSDOS */ + zmemcpy(ds->window, ss->window, ds->w_size * 2 * sizeof(Byte)); + zmemcpy((voidpf)ds->prev, (voidpf)ss->prev, ds->w_size * sizeof(Pos)); + zmemcpy((voidpf)ds->head, (voidpf)ss->head, ds->hash_size * sizeof(Pos)); + zmemcpy(ds->pending_buf, ss->pending_buf, (uInt)ds->pending_buf_size); + + ds->pending_out = ds->pending_buf + (ss->pending_out - ss->pending_buf); + ds->d_buf = overlay + ds->lit_bufsize/sizeof(ush); + ds->l_buf = ds->pending_buf + (1+sizeof(ush))*ds->lit_bufsize; + + ds->l_desc.dyn_tree = ds->dyn_ltree; + ds->d_desc.dyn_tree = ds->dyn_dtree; + ds->bl_desc.dyn_tree = ds->bl_tree; + + return Z_OK; +#endif /* MAXSEG_64K */ +} + +/* =========================================================================== + * Read a new buffer from the current input stream, update the adler32 + * and total number of bytes read. All deflate() input goes through + * this function so some applications may wish to modify it to avoid + * allocating a large strm->next_in buffer and copying from it. + * (See also flush_pending()). + */ +local int read_buf(z_streamp strm, Bytef *buf, unsigned size) +{ + struct internal_state_deflate *state = (struct internal_state_deflate*)strm->state; + unsigned len = strm->avail_in; + + if (len > size) len = size; + if (len == 0) return 0; + + strm->avail_in -= len; + + zmemcpy(buf, strm->next_in, len); + if (state->wrap == 1) { + strm->adler = adler32(strm->adler, buf, len); + } +#ifdef GZIP + else if (state->wrap == 2) { + strm->adler = crc32(strm->adler, buf, len); + } +#endif + strm->next_in += len; + strm->total_in += len; + + return (int)len; +} + +/* =========================================================================== + * Initialize the "longest match" routines for a new zlib stream + */ +local void lm_init (deflate_state *s) +{ + s->window_size = (ulg)2L*s->w_size; + + CLEAR_HASH(s); + + /* Set the default configuration parameters: + */ + s->max_lazy_match = configuration_table[s->level].max_lazy; + s->good_match = configuration_table[s->level].good_length; + s->nice_match = configuration_table[s->level].nice_length; + s->max_chain_length = configuration_table[s->level].max_chain; + + s->strstart = 0; + s->block_start = 0L; + s->lookahead = 0; + s->insert = 0; + s->match_length = s->prev_length = MIN_MATCH-1; + s->match_available = 0; + s->ins_h = 0; +#ifndef FASTEST +#ifdef ASMV + match_init(); /* initialize the asm code */ +#endif +#endif +} + +#ifndef FASTEST +/* =========================================================================== + * Set match_start to the longest match starting at the given string and + * return its length. Matches shorter or equal to prev_length are discarded, + * in which case the result is equal to prev_length and match_start is + * garbage. + * IN assertions: cur_match is the head of the hash chain for the current + * string (strstart) and its distance is <= MAX_DIST, and prev_length >= 1 + * OUT assertion: the match length is not greater than s->lookahead. + */ +#ifndef ASMV +/* For 80x86 and 680x0, an optimized version will be provided in match.asm or + * match.S. The code will be functionally equivalent. + */ +local uInt longest_match(deflate_state *s, IPos cur_match) +{ + unsigned chain_length = s->max_chain_length;/* max hash chain length */ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + int best_len = s->prev_length; /* best match length so far */ + int nice_match = s->nice_match; /* stop if match long enough */ + IPos limit = s->strstart > (IPos)MAX_DIST(s) ? + s->strstart - (IPos)MAX_DIST(s) : NIL; + /* Stop when cur_match becomes <= limit. To simplify the code, + * we prevent matches with the string of window index 0. + */ + Posf *prev = s->prev; + uInt wmask = s->w_mask; + +#ifdef UNALIGNED_OK + /* Compare two bytes at a time. Note: this is not always beneficial. + * Try with and without -DUNALIGNED_OK to check. + */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH - 1; + register ush scan_start = *(ushf*)scan; + register ush scan_end = *(ushf*)(scan+best_len-1); +#else + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + register Byte scan_end1 = scan[best_len-1]; + register Byte scan_end = scan[best_len]; +#endif + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + /* Do not waste too much time if we already have a good match: */ + if (s->prev_length >= s->good_match) { + chain_length >>= 2; + } + /* Do not look for matches beyond the end of the input. This is necessary + * to make deflate deterministic. + */ + if ((uInt)nice_match > s->lookahead) nice_match = s->lookahead; + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + do { + Assert(cur_match < s->strstart, "no future"); + match = s->window + cur_match; + + /* Skip to next match if the match length cannot increase + * or if the match length is less than 2. Note that the checks below + * for insufficient lookahead only occur occasionally for performance + * reasons. Therefore uninitialized memory will be accessed, and + * conditional jumps will be made that depend on those values. + * However the length of the match is limited to the lookahead, so + * the output of deflate is not affected by the uninitialized values. + */ +#if (defined(UNALIGNED_OK) && MAX_MATCH == 258) + /* This code assumes sizeof(unsigned short) == 2. Do not use + * UNALIGNED_OK if your compiler uses a different size. + */ + if (*(ushf*)(match+best_len-1) != scan_end || + *(ushf*)match != scan_start) continue; + + /* It is not necessary to compare scan[2] and match[2] since they are + * always equal when the other bytes match, given that the hash keys + * are equal and that HASH_BITS >= 8. Compare 2 bytes at a time at + * strstart+3, +5, ... up to strstart+257. We check for insufficient + * lookahead only every 4th comparison; the 128th check will be made + * at strstart+257. If MAX_MATCH-2 is not a multiple of 8, it is + * necessary to put more guard bytes at the end of the window, or + * to check more often for insufficient lookahead. + */ + Assert(scan[2] == match[2], "scan[2]?"); + scan++, match++; + do { + } while (*(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + *(ushf*)(scan+=2) == *(ushf*)(match+=2) && + scan < strend); + /* The funny "do {}" generates better code on most compilers */ + + /* Here, scan <= window+strstart+257 */ + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + if (*scan == *match) scan++; + + len = (MAX_MATCH - 1) - (int)(strend-scan); + scan = strend - (MAX_MATCH-1); + +#else /* UNALIGNED_OK */ + + if (match[best_len] != scan_end || + match[best_len-1] != scan_end1 || + *match != *scan || + *++match != scan[1]) continue; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match++; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + scan = strend - MAX_MATCH; + +#endif /* UNALIGNED_OK */ + + if (len > best_len) { + s->match_start = cur_match; + best_len = len; + if (len >= nice_match) break; +#ifdef UNALIGNED_OK + scan_end = *(ushf*)(scan+best_len-1); +#else + scan_end1 = scan[best_len-1]; + scan_end = scan[best_len]; +#endif + } + } while ((cur_match = prev[cur_match & wmask]) > limit + && --chain_length != 0); + + if ((uInt)best_len <= s->lookahead) return (uInt)best_len; + return s->lookahead; +} +#endif /* ASMV */ + +#else /* FASTEST */ + +/* --------------------------------------------------------------------------- + * Optimized version for FASTEST only + */ +local uInt longest_match(s, cur_match) + deflate_state *s; + IPos cur_match; /* current match */ +{ + register Bytef *scan = s->window + s->strstart; /* current string */ + register Bytef *match; /* matched string */ + register int len; /* length of current match */ + register Bytef *strend = s->window + s->strstart + MAX_MATCH; + + /* The code is optimized for HASH_BITS >= 8 and MAX_MATCH-2 multiple of 16. + * It is easy to get rid of this optimization if necessary. + */ + Assert(s->hash_bits >= 8 && MAX_MATCH == 258, "Code too clever"); + + Assert((ulg)s->strstart <= s->window_size-MIN_LOOKAHEAD, "need lookahead"); + + Assert(cur_match < s->strstart, "no future"); + + match = s->window + cur_match; + + /* Return failure if the match length is less than 2: + */ + if (match[0] != scan[0] || match[1] != scan[1]) return MIN_MATCH-1; + + /* The check at best_len-1 can be removed because it will be made + * again later. (This heuristic is not always a win.) + * It is not necessary to compare scan[2] and match[2] since they + * are always equal when the other bytes match, given that + * the hash keys are equal and that HASH_BITS >= 8. + */ + scan += 2, match += 2; + Assert(*scan == *match, "match[2]?"); + + /* We check for insufficient lookahead only every 8th comparison; + * the 256th check will be made at strstart+258. + */ + do { + } while (*++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + *++scan == *++match && *++scan == *++match && + scan < strend); + + Assert(scan <= s->window+(unsigned)(s->window_size-1), "wild scan"); + + len = MAX_MATCH - (int)(strend - scan); + + if (len < MIN_MATCH) return MIN_MATCH - 1; + + s->match_start = cur_match; + return (uInt)len <= s->lookahead ? (uInt)len : s->lookahead; +} + +#endif /* FASTEST */ + +#ifdef DEBUG +/* =========================================================================== + * Check that the match at match_start is indeed a match. + */ +local void check_match(s, start, match, length) + deflate_state *s; + IPos start, match; + int length; +{ + /* check that the match is indeed a match */ + if (zmemcmp(s->window + match, + s->window + start, length) != EQUAL) { + fprintf(stderr, " start %u, match %u, length %d\n", + start, match, length); + do { + fprintf(stderr, "%c%c", s->window[match++], s->window[start++]); + } while (--length != 0); + z_error("invalid match"); + } + if (z_verbose > 1) { + fprintf(stderr,"\\[%d,%d]", start-match, length); + do { putc(s->window[start++], stderr); } while (--length != 0); + } +} +#else +# define check_match(s, start, match, length) +#endif /* DEBUG */ + +/* =========================================================================== + * Fill the window when the lookahead becomes insufficient. + * Updates strstart and lookahead. + * + * IN assertion: lookahead < MIN_LOOKAHEAD + * OUT assertions: strstart <= window_size-MIN_LOOKAHEAD + * At least one byte has been read, or avail_in == 0; reads are + * performed for at least two bytes (required for the zip translate_eol + * option -- not supported here). + */ +local void fill_window(deflate_state *s) +{ + register unsigned n, m; + register Posf *p; + unsigned more; /* Amount of free space at the end of the window. */ + uInt wsize = s->w_size; + + Assert(s->lookahead < MIN_LOOKAHEAD, "already enough lookahead"); + + do { + more = (unsigned)(s->window_size -(ulg)s->lookahead -(ulg)s->strstart); + + /* Deal with !@#$% 64K limit: */ + if (sizeof(int) <= 2) { + if (more == 0 && s->strstart == 0 && s->lookahead == 0) { + more = wsize; + + } else if (more == (unsigned)(-1)) { + /* Very unlikely, but possible on 16 bit machine if + * strstart == 0 && lookahead == 1 (input done a byte at time) + */ + more--; + } + } + + /* If the window is almost full and there is insufficient lookahead, + * move the upper half to the lower one to make room in the upper half. + */ + if (s->strstart >= wsize+MAX_DIST(s)) { + + zmemcpy(s->window, s->window+wsize, (unsigned)wsize); + s->match_start -= wsize; + s->strstart -= wsize; /* we now have strstart >= MAX_DIST */ + s->block_start -= (long) wsize; + + /* Slide the hash table (could be avoided with 32 bit values + at the expense of memory usage). We slide even when level == 0 + to keep the hash table consistent if we switch back to level > 0 + later. (Using level 0 permanently is not an optimal usage of + zlib, so we don't care about this pathological case.) + */ + n = s->hash_size; + p = &s->head[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + } while (--n); + + n = wsize; +#ifndef FASTEST + p = &s->prev[n]; + do { + m = *--p; + *p = (Pos)(m >= wsize ? m-wsize : NIL); + /* If n is not on any hash chain, prev[n] is garbage but + * its value will never be used. + */ + } while (--n); +#endif + more += wsize; + } + if (s->strm->avail_in == 0) break; + + /* If there was no sliding: + * strstart <= WSIZE+MAX_DIST-1 && lookahead <= MIN_LOOKAHEAD - 1 && + * more == window_size - lookahead - strstart + * => more >= window_size - (MIN_LOOKAHEAD-1 + WSIZE + MAX_DIST-1) + * => more >= window_size - 2*WSIZE + 2 + * In the BIG_MEM or MMAP case (not yet supported), + * window_size == input_size + MIN_LOOKAHEAD && + * strstart + s->lookahead <= input_size => more >= MIN_LOOKAHEAD. + * Otherwise, window_size == 2*WSIZE so more >= 2. + * If there was sliding, more >= WSIZE. So in all cases, more >= 2. + */ + Assert(more >= 2, "more < 2"); + + n = read_buf(s->strm, s->window + s->strstart + s->lookahead, more); + s->lookahead += n; + + /* Initialize the hash value now that we have some input: */ + if (s->lookahead + s->insert >= MIN_MATCH) { + uInt str = s->strstart - s->insert; + s->ins_h = s->window[str]; + UPDATE_HASH(s, s->ins_h, s->window[str + 1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + while (s->insert) { + UPDATE_HASH(s, s->ins_h, s->window[str + MIN_MATCH-1]); +#ifndef FASTEST + s->prev[str & s->w_mask] = s->head[s->ins_h]; +#endif + s->head[s->ins_h] = (Pos)str; + str++; + s->insert--; + if (s->lookahead + s->insert < MIN_MATCH) + break; + } + } + /* If the whole input has less than MIN_MATCH bytes, ins_h is garbage, + * but this is not important since only literal bytes will be emitted. + */ + + } while (s->lookahead < MIN_LOOKAHEAD && s->strm->avail_in != 0); + + /* If the WIN_INIT bytes after the end of the current data have never been + * written, then zero those bytes in order to avoid memory check reports of + * the use of uninitialized (or uninitialised as Julian writes) bytes by + * the longest match routines. Update the high water mark for the next + * time through here. WIN_INIT is set to MAX_MATCH since the longest match + * routines allow scanning to strstart + MAX_MATCH, ignoring lookahead. + */ + if (s->high_water < s->window_size) { + ulg curr = s->strstart + (ulg)(s->lookahead); + ulg init; + + if (s->high_water < curr) { + /* Previous high water mark below current data -- zero WIN_INIT + * bytes or up to end of window, whichever is less. + */ + init = s->window_size - curr; + if (init > WIN_INIT) + init = WIN_INIT; + zmemzero(s->window + curr, (unsigned)init); + s->high_water = curr + init; + } + else if (s->high_water < (ulg)curr + WIN_INIT) { + /* High water mark at or above current data, but below current data + * plus WIN_INIT -- zero out to current data plus WIN_INIT, or up + * to end of window, whichever is less. + */ + init = (ulg)curr + WIN_INIT - s->high_water; + if (init > s->window_size - s->high_water) + init = s->window_size - s->high_water; + zmemzero(s->window + s->high_water, (unsigned)init); + s->high_water += init; + } + } + + Assert((ulg)s->strstart <= s->window_size - MIN_LOOKAHEAD, + "not enough room for search"); +} + +/* =========================================================================== + * Flush the current block, with given end-of-file flag. + * IN assertion: strstart is set to the end of the current match. + */ +#define FLUSH_BLOCK_ONLY(s, last) { \ + _tr_flush_block(s, (s->block_start >= 0L ? \ + (charf *)&s->window[(unsigned)s->block_start] : \ + (charf *)Z_NULL), \ + (ulg)((long)s->strstart - s->block_start), \ + (last)); \ + s->block_start = s->strstart; \ + flush_pending(s->strm); \ + Tracev((stderr,"[FLUSH]")); \ +} + +/* Same but force premature exit if necessary. */ +#define FLUSH_BLOCK(s, last) { \ + FLUSH_BLOCK_ONLY(s, last); \ + if (s->strm->avail_out == 0) return (last) ? finish_started : need_more; \ +} + +/* =========================================================================== + * Copy without compression as much as possible from the input stream, return + * the current block state. + * This function does not insert new strings in the dictionary since + * uncompressible data is probably not useful. This function is used + * only for the level=0 compression option. + * NOTE: this function should be optimized to avoid extra copying from + * window to pending_buf. + */ +local block_state deflate_stored(deflate_state *s, int flush) +{ + /* Stored blocks are limited to 0xffff bytes, pending_buf is limited + * to pending_buf_size, and each stored block has a 5 byte header: + */ + ulg max_block_size = 0xffff; + ulg max_start; + + if (max_block_size > s->pending_buf_size - 5) { + max_block_size = s->pending_buf_size - 5; + } + + /* Copy as much as possible from input to output: */ + for (;;) { + /* Fill the window as much as possible: */ + if (s->lookahead <= 1) { + + Assert(s->strstart < s->w_size+MAX_DIST(s) || + s->block_start >= (long)s->w_size, "slide too late"); + + fill_window(s); + if (s->lookahead == 0 && flush == Z_NO_FLUSH) return need_more; + + if (s->lookahead == 0) break; /* flush the current block */ + } + Assert(s->block_start >= 0L, "block gone"); + + s->strstart += s->lookahead; + s->lookahead = 0; + + /* Emit a stored block if pending_buf will be full: */ + max_start = s->block_start + max_block_size; + if (s->strstart == 0 || (ulg)s->strstart >= max_start) { + /* strstart == 0 is possible when wraparound on 16-bit machine */ + s->lookahead = (uInt)(s->strstart - max_start); + s->strstart = (uInt)max_start; + FLUSH_BLOCK(s, 0); + } + /* Flush if we may have to slide, otherwise block_start may become + * negative and the data will be gone: + */ + if (s->strstart - (uInt)s->block_start >= MAX_DIST(s)) { + FLUSH_BLOCK(s, 0); + } + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if ((long)s->strstart > s->block_start) + FLUSH_BLOCK(s, 0); + return block_done; +} + +/* =========================================================================== + * Compress as much as possible from the input stream, return the current + * block state. + * This function does not perform lazy evaluation of matches and inserts + * new strings in the dictionary only for unmatched strings or for short + * matches. It is used only for the fast compression options. + */ +local block_state deflate_fast(deflate_state *s, int flush) +{ + IPos hash_head; /* head of the hash chain */ + int bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = NIL; + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + * At this point we have always match_length < MIN_MATCH + */ + if (hash_head != NIL && s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s->match_length = longest_match (s, hash_head); + /* longest_match() sets match_start */ + } + if (s->match_length >= MIN_MATCH) { + check_match(s, s->strstart, s->match_start, s->match_length); + + _tr_tally_dist(s, s->strstart - s->match_start, + s->match_length - MIN_MATCH, bflush); + + s->lookahead -= s->match_length; + + /* Insert new strings in the hash table only if the match length + * is not too large. This saves time but degrades compression. + */ +#ifndef FASTEST + if (s->match_length <= s->max_insert_length && + s->lookahead >= MIN_MATCH) { + s->match_length--; /* string at strstart already in table */ + do { + s->strstart++; + INSERT_STRING(s, s->strstart, hash_head); + /* strstart never exceeds WSIZE-MAX_MATCH, so there are + * always MIN_MATCH bytes ahead. + */ + } while (--s->match_length != 0); + s->strstart++; + } else +#endif + { + s->strstart += s->match_length; + s->match_length = 0; + s->ins_h = s->window[s->strstart]; + UPDATE_HASH(s, s->ins_h, s->window[s->strstart+1]); +#if MIN_MATCH != 3 + Call UPDATE_HASH() MIN_MATCH-3 more times +#endif + /* If lookahead < MIN_MATCH, ins_h is garbage, but it does not + * matter since it will be recomputed at next deflate call. + */ + } + } else { + /* No match, output a literal byte */ + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + } + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} + +#ifndef FASTEST +/* =========================================================================== + * Same as above, but achieves better compression. We use a lazy + * evaluation for matches: a match is finally adopted only if there is + * no better match at the next window position. + */ +local block_state deflate_slow(deflate_state *s, int flush) +{ + IPos hash_head; /* head of hash chain */ + int bflush; /* set if current block must be flushed */ + + /* Process the input block. */ + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the next match, plus MIN_MATCH bytes to insert the + * string following the next match. + */ + if (s->lookahead < MIN_LOOKAHEAD) { + fill_window(s); + if (s->lookahead < MIN_LOOKAHEAD && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* Insert the string window[strstart .. strstart+2] in the + * dictionary, and set hash_head to the head of the hash chain: + */ + hash_head = NIL; + if (s->lookahead >= MIN_MATCH) { + INSERT_STRING(s, s->strstart, hash_head); + } + + /* Find the longest match, discarding those <= prev_length. + */ + s->prev_length = s->match_length, s->prev_match = s->match_start; + s->match_length = MIN_MATCH-1; + + if (hash_head != NIL && s->prev_length < s->max_lazy_match && + s->strstart - hash_head <= MAX_DIST(s)) { + /* To simplify the code, we prevent matches with the string + * of window index 0 (in particular we have to avoid a match + * of the string with itself at the start of the input file). + */ + s->match_length = longest_match (s, hash_head); + /* longest_match() sets match_start */ + + if (s->match_length <= 5 && (s->strategy == Z_FILTERED +#if TOO_FAR <= 32767 + || (s->match_length == MIN_MATCH && + s->strstart - s->match_start > TOO_FAR) +#endif + )) { + + /* If prev_match is also MIN_MATCH, match_start is garbage + * but we will ignore the current match anyway. + */ + s->match_length = MIN_MATCH-1; + } + } + /* If there was a match at the previous step and the current + * match is not better, output the previous match: + */ + if (s->prev_length >= MIN_MATCH && s->match_length <= s->prev_length) { + uInt max_insert = s->strstart + s->lookahead - MIN_MATCH; + /* Do not insert strings in hash table beyond this. */ + + check_match(s, s->strstart-1, s->prev_match, s->prev_length); + + _tr_tally_dist(s, s->strstart -1 - s->prev_match, + s->prev_length - MIN_MATCH, bflush); + + /* Insert in hash table all strings up to the end of the match. + * strstart-1 and strstart are already inserted. If there is not + * enough lookahead, the last two strings are not inserted in + * the hash table. + */ + s->lookahead -= s->prev_length-1; + s->prev_length -= 2; + do { + if (++s->strstart <= max_insert) { + INSERT_STRING(s, s->strstart, hash_head); + } + } while (--s->prev_length != 0); + s->match_available = 0; + s->match_length = MIN_MATCH-1; + s->strstart++; + + if (bflush) FLUSH_BLOCK(s, 0); + + } else if (s->match_available) { + /* If there was no match at the previous position, output a + * single literal. If there was a match but the current match + * is longer, truncate the previous match to a single literal. + */ + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + if (bflush) { + FLUSH_BLOCK_ONLY(s, 0); + } + s->strstart++; + s->lookahead--; + if (s->strm->avail_out == 0) return need_more; + } else { + /* There is no previous match to compare with, wait for + * the next step to decide. + */ + s->match_available = 1; + s->strstart++; + s->lookahead--; + } + } + Assert (flush != Z_NO_FLUSH, "no flush?"); + if (s->match_available) { + Tracevv((stderr,"%c", s->window[s->strstart-1])); + _tr_tally_lit(s, s->window[s->strstart-1], bflush); + s->match_available = 0; + } + s->insert = s->strstart < MIN_MATCH-1 ? s->strstart : MIN_MATCH-1; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} +#endif /* FASTEST */ + +/* =========================================================================== + * For Z_RLE, simply look for runs of bytes, generate matches only of distance + * one. Do not maintain a hash table. (It will be regenerated if this run of + * deflate switches away from Z_RLE.) + */ +local block_state deflate_rle(deflate_state *s, int flush) +{ + int bflush; /* set if current block must be flushed */ + uInt prev; /* byte at distance one to match */ + Bytef *scan, *strend; /* scan goes up to strend for length of run */ + + for (;;) { + /* Make sure that we always have enough lookahead, except + * at the end of the input file. We need MAX_MATCH bytes + * for the longest run, plus one for the unrolled loop. + */ + if (s->lookahead <= MAX_MATCH) { + fill_window(s); + if (s->lookahead <= MAX_MATCH && flush == Z_NO_FLUSH) { + return need_more; + } + if (s->lookahead == 0) break; /* flush the current block */ + } + + /* See how many times the previous byte repeats */ + s->match_length = 0; + if (s->lookahead >= MIN_MATCH && s->strstart > 0) { + scan = s->window + s->strstart - 1; + prev = *scan; + if (prev == *++scan && prev == *++scan && prev == *++scan) { + strend = s->window + s->strstart + MAX_MATCH; + do { + } while (prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + prev == *++scan && prev == *++scan && + scan < strend); + s->match_length = MAX_MATCH - (int)(strend - scan); + if (s->match_length > s->lookahead) + s->match_length = s->lookahead; + } + Assert(scan <= s->window+(uInt)(s->window_size-1), "wild scan"); + } + + /* Emit match if have run of MIN_MATCH or longer, else emit literal */ + if (s->match_length >= MIN_MATCH) { + check_match(s, s->strstart, s->strstart - 1, s->match_length); + + _tr_tally_dist(s, 1, s->match_length - MIN_MATCH, bflush); + + s->lookahead -= s->match_length; + s->strstart += s->match_length; + s->match_length = 0; + } else { + /* No match, output a literal byte */ + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + } + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} + +/* =========================================================================== + * For Z_HUFFMAN_ONLY, do not look for matches. Do not maintain a hash table. + * (It will be regenerated if this run of deflate switches away from Huffman.) + */ +local block_state deflate_huff(deflate_state *s, int flush) +{ + int bflush; /* set if current block must be flushed */ + + for (;;) { + /* Make sure that we have a literal to write. */ + if (s->lookahead == 0) { + fill_window(s); + if (s->lookahead == 0) { + if (flush == Z_NO_FLUSH) + return need_more; + break; /* flush the current block */ + } + } + + /* Output a literal byte */ + s->match_length = 0; + Tracevv((stderr,"%c", s->window[s->strstart])); + _tr_tally_lit (s, s->window[s->strstart], bflush); + s->lookahead--; + s->strstart++; + if (bflush) FLUSH_BLOCK(s, 0); + } + s->insert = 0; + if (flush == Z_FINISH) { + FLUSH_BLOCK(s, 1); + return finish_done; + } + if (s->last_lit) + FLUSH_BLOCK(s, 0); + return block_done; +} diff --git a/deps/zlib/deflate.h b/deps/zlib/deflate.h new file mode 100644 index 0000000..82fe93e --- /dev/null +++ b/deps/zlib/deflate.h @@ -0,0 +1,346 @@ +/* deflate.h -- internal compression state + * Copyright (C) 1995-2012 Jean-loup Gailly + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef DEFLATE_H +#define DEFLATE_H + +#include "zutil.h" + +/* define NO_GZIP when compiling if you want to disable gzip header and + trailer creation by deflate(). NO_GZIP would be used to avoid linking in + the crc code when it is not needed. For shared libraries, gzip encoding + should be left enabled. */ +#ifndef NO_GZIP +# define GZIP +#endif + +/* =========================================================================== + * Internal compression state. + */ + +#define LENGTH_CODES 29 +/* number of length codes, not counting the special END_BLOCK code */ + +#define LITERALS 256 +/* number of literal bytes 0..255 */ + +#define L_CODES (LITERALS+1+LENGTH_CODES) +/* number of Literal or Length codes, including the END_BLOCK code */ + +#define D_CODES 30 +/* number of distance codes */ + +#define BL_CODES 19 +/* number of codes used to transfer the bit lengths */ + +#define HEAP_SIZE (2*L_CODES+1) +/* maximum heap size */ + +#define MAX_BITS 15 +/* All codes must not exceed MAX_BITS bits */ + +#define Buf_size 16 +/* size of bit buffer in bi_buf */ + +#define INIT_STATE 42 +#define EXTRA_STATE 69 +#define NAME_STATE 73 +#define COMMENT_STATE 91 +#define HCRC_STATE 103 +#define BUSY_STATE 113 +#define FINISH_STATE 666 +/* Stream status */ + + +/* Data structure describing a single value and its code string. */ +typedef struct ct_data_s { + union { + ush freq; /* frequency count */ + ush code; /* bit string */ + } fc; + union { + ush dad; /* father node in Huffman tree */ + ush len; /* length of bit string */ + } dl; +} FAR ct_data; + +#define Freq fc.freq +#define Code fc.code +#define Dad dl.dad +#define Len dl.len + +typedef struct static_tree_desc_s static_tree_desc; + +typedef struct tree_desc_s { + ct_data *dyn_tree; /* the dynamic tree */ + int max_code; /* largest code with non zero frequency */ + static_tree_desc *stat_desc; /* the corresponding static tree */ +} FAR tree_desc; + +typedef ush Pos; +typedef Pos FAR Posf; +typedef unsigned IPos; + +/* A Pos is an index in the character window. We use short instead of int to + * save space in the various tables. IPos is used only for parameter passing. + */ + +typedef struct internal_state_deflate { + z_streamp strm; /* pointer back to this zlib stream */ + int status; /* as the name implies */ + Bytef *pending_buf; /* output still pending */ + ulg pending_buf_size; /* size of pending_buf */ + Bytef *pending_out; /* next pending byte to output to the stream */ + uInt pending; /* nb of bytes in the pending buffer */ + int wrap; /* bit 0 true for zlib, bit 1 true for gzip */ + gz_headerp gzhead; /* gzip header information to write */ + uInt gzindex; /* where in extra, name, or comment */ + Byte method; /* can only be DEFLATED */ + int last_flush; /* value of flush param for previous deflate call */ + + /* used by deflate.c: */ + + uInt w_size; /* LZ77 window size (32K by default) */ + uInt w_bits; /* log2(w_size) (8..16) */ + uInt w_mask; /* w_size - 1 */ + + Bytef *window; + /* Sliding window. Input bytes are read into the second half of the window, + * and move to the first half later to keep a dictionary of at least wSize + * bytes. With this organization, matches are limited to a distance of + * wSize-MAX_MATCH bytes, but this ensures that IO is always + * performed with a length multiple of the block size. Also, it limits + * the window size to 64K, which is quite useful on MSDOS. + * To do: use the user input buffer as sliding window. + */ + + ulg window_size; + /* Actual size of window: 2*wSize, except when the user input buffer + * is directly used as sliding window. + */ + + Posf *prev; + /* Link to older string with same hash index. To limit the size of this + * array to 64K, this link is maintained only for the last 32K strings. + * An index in this array is thus a window index modulo 32K. + */ + + Posf *head; /* Heads of the hash chains or NIL. */ + + uInt ins_h; /* hash index of string to be inserted */ + uInt hash_size; /* number of elements in hash table */ + uInt hash_bits; /* log2(hash_size) */ + uInt hash_mask; /* hash_size-1 */ + + uInt hash_shift; + /* Number of bits by which ins_h must be shifted at each input + * step. It must be such that after MIN_MATCH steps, the oldest + * byte no longer takes part in the hash key, that is: + * hash_shift * MIN_MATCH >= hash_bits + */ + + long block_start; + /* Window position at the beginning of the current output block. Gets + * negative when the window is moved backwards. + */ + + uInt match_length; /* length of best match */ + IPos prev_match; /* previous match */ + int match_available; /* set if previous match exists */ + uInt strstart; /* start of string to insert */ + uInt match_start; /* start of matching string */ + uInt lookahead; /* number of valid bytes ahead in window */ + + uInt prev_length; + /* Length of the best match at previous step. Matches not greater than this + * are discarded. This is used in the lazy match evaluation. + */ + + uInt max_chain_length; + /* To speed up deflation, hash chains are never searched beyond this + * length. A higher limit improves compression ratio but degrades the + * speed. + */ + + uInt max_lazy_match; + /* Attempt to find a better match only when the current match is strictly + * smaller than this value. This mechanism is used only for compression + * levels >= 4. + */ +# define max_insert_length max_lazy_match + /* Insert new strings in the hash table only if the match length is not + * greater than this length. This saves time but degrades compression. + * max_insert_length is used only for compression levels <= 3. + */ + + int level; /* compression level (1..9) */ + int strategy; /* favor or force Huffman coding*/ + + uInt good_match; + /* Use a faster search when the previous match is longer than this */ + + int nice_match; /* Stop searching when current match exceeds this */ + + /* used by trees.c: */ + /* Didn't use ct_data typedef below to suppress compiler warning */ + struct ct_data_s dyn_ltree[HEAP_SIZE]; /* literal and length tree */ + struct ct_data_s dyn_dtree[2*D_CODES+1]; /* distance tree */ + struct ct_data_s bl_tree[2*BL_CODES+1]; /* Huffman tree for bit lengths */ + + struct tree_desc_s l_desc; /* desc. for literal tree */ + struct tree_desc_s d_desc; /* desc. for distance tree */ + struct tree_desc_s bl_desc; /* desc. for bit length tree */ + + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + int heap[2*L_CODES+1]; /* heap used to build the Huffman trees */ + int heap_len; /* number of elements in the heap */ + int heap_max; /* element of largest frequency */ + /* The sons of heap[n] are heap[2*n] and heap[2*n+1]. heap[0] is not used. + * The same heap array is used to build all trees. + */ + + uch depth[2*L_CODES+1]; + /* Depth of each subtree used as tie breaker for trees of equal frequency + */ + + uchf *l_buf; /* buffer for literals or lengths */ + + uInt lit_bufsize; + /* Size of match buffer for literals/lengths. There are 4 reasons for + * limiting lit_bufsize to 64K: + * - frequencies can be kept in 16 bit counters + * - if compression is not successful for the first block, all input + * data is still in the window so we can still emit a stored block even + * when input comes from standard input. (This can also be done for + * all blocks if lit_bufsize is not greater than 32K.) + * - if compression is not successful for a file smaller than 64K, we can + * even emit a stored file instead of a stored block (saving 5 bytes). + * This is applicable only for zip (not gzip or zlib). + * - creating new Huffman trees less frequently may not provide fast + * adaptation to changes in the input data statistics. (Take for + * example a binary file with poorly compressible code followed by + * a highly compressible string table.) Smaller buffer sizes give + * fast adaptation but have of course the overhead of transmitting + * trees more frequently. + * - I can't count above 4 + */ + + uInt last_lit; /* running index in l_buf */ + + ushf *d_buf; + /* Buffer for distances. To simplify the code, d_buf and l_buf have + * the same number of elements. To use different lengths, an extra flag + * array would be necessary. + */ + + ulg opt_len; /* bit length of current block with optimal trees */ + ulg static_len; /* bit length of current block with static trees */ + uInt matches; /* number of string matches in current block */ + uInt insert; /* bytes at end of window left to insert */ + +#ifdef DEBUG + ulg compressed_len; /* total bit length of compressed file mod 2^32 */ + ulg bits_sent; /* bit length of compressed data sent mod 2^32 */ +#endif + + ush bi_buf; + /* Output buffer. bits are inserted starting at the bottom (least + * significant bits). + */ + int bi_valid; + /* Number of valid bits in bi_buf. All bits above the last valid bit + * are always zero. + */ + + ulg high_water; + /* High water mark offset in window for initialized bytes -- bytes above + * this are set to zero in order to avoid memory check warnings when + * longest match routines access bytes past the input. This is then + * updated to the new high water mark. + */ + +} deflate_state; + +/* Output a byte on the stream. + * IN assertion: there is enough room in pending_buf. + */ +#define put_byte(s, c) {s->pending_buf[s->pending++] = (c);} + + +#define MIN_LOOKAHEAD (MAX_MATCH+MIN_MATCH+1) +/* Minimum amount of lookahead, except at the end of the input file. + * See deflate.c for comments about the MIN_MATCH+1. + */ + +#define MAX_DIST(s) ((s)->w_size-MIN_LOOKAHEAD) +/* In order to simplify the code, particularly on 16 bit machines, match + * distances are limited to MAX_DIST instead of WSIZE. + */ + +#define WIN_INIT MAX_MATCH +/* Number of bytes after end of data in window to initialize in order to avoid + memory checker errors from longest match routines */ + + /* in trees.c */ +void ZLIB_INTERNAL _tr_init OF((deflate_state *s)); +int ZLIB_INTERNAL _tr_tally OF((deflate_state *s, unsigned dist, unsigned lc)); +void ZLIB_INTERNAL _tr_flush_block OF((deflate_state *s, charf *buf, + ulg stored_len, int last)); +void ZLIB_INTERNAL _tr_flush_bits OF((deflate_state *s)); +void ZLIB_INTERNAL _tr_align OF((deflate_state *s)); +void ZLIB_INTERNAL _tr_stored_block OF((deflate_state *s, charf *buf, + ulg stored_len, int last)); + +#define d_code(dist) \ + ((dist) < 256 ? _dist_code[dist] : _dist_code[256+((dist)>>7)]) +/* Mapping from a distance to a distance code. dist is the distance - 1 and + * must not have side effects. _dist_code[256] and _dist_code[257] are never + * used. + */ + +#ifndef DEBUG +/* Inline versions of _tr_tally for speed: */ + +#if defined(GEN_TREES_H) || !defined(STDC) + extern uch ZLIB_INTERNAL _length_code[]; + extern uch ZLIB_INTERNAL _dist_code[]; +#else + extern const uch ZLIB_INTERNAL _length_code[]; + extern const uch ZLIB_INTERNAL _dist_code[]; +#endif + +# define _tr_tally_lit(s, c, flush) \ + { uch cc = (c); \ + s->d_buf[s->last_lit] = 0; \ + s->l_buf[s->last_lit++] = cc; \ + s->dyn_ltree[cc].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +# define _tr_tally_dist(s, distance, length, flush) \ + { uch len = (length); \ + ush dist = (distance); \ + s->d_buf[s->last_lit] = dist; \ + s->l_buf[s->last_lit++] = len; \ + dist--; \ + s->dyn_ltree[_length_code[len]+LITERALS+1].Freq++; \ + s->dyn_dtree[d_code(dist)].Freq++; \ + flush = (s->last_lit == s->lit_bufsize-1); \ + } +#else +# define _tr_tally_lit(s, c, flush) flush = _tr_tally(s, 0, c) +# define _tr_tally_dist(s, distance, length, flush) \ + flush = _tr_tally(s, distance, length) +#endif + +#endif /* DEFLATE_H */ diff --git a/deps/zlib/gzclose.c b/deps/zlib/gzclose.c new file mode 100644 index 0000000..edeee03 --- /dev/null +++ b/deps/zlib/gzclose.c @@ -0,0 +1,27 @@ +/* gzclose.c -- zlib gzclose() function + * Copyright (C) 2004, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +extern int gzclose_w(gzFile file); +extern int gzclose_r(gzFile file); + +/* gzclose() is in a separate file so that it is linked in only if it is used. + That way the other gzclose functions can be used instead to avoid linking in + unneeded compression or decompression routines. */ +int gzclose(gzFile file) +{ +#ifndef NO_GZCOMPRESS + gz_statep state; + + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + return state->mode == GZ_READ ? gzclose_r(file) : gzclose_w(file); +#else + return gzclose_r(file); +#endif +} diff --git a/deps/zlib/gzfile.h b/deps/zlib/gzfile.h new file mode 100644 index 0000000..2df4842 --- /dev/null +++ b/deps/zlib/gzfile.h @@ -0,0 +1,12 @@ + +#ifndef _GZFILE_H +#define _GZFILE_H + +struct gzFile_s +{ + unsigned have; + unsigned char *next; + z_off64_t pos; +}; + +#endif diff --git a/deps/zlib/gzguts.h b/deps/zlib/gzguts.h new file mode 100644 index 0000000..6068d41 --- /dev/null +++ b/deps/zlib/gzguts.h @@ -0,0 +1,222 @@ +/* gzguts.h -- zlib internal header definitions for gz* operations + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#ifndef _GZGUTS_H +#define _GZGUTS_H + +#ifdef _LARGEFILE64_SOURCE +# ifndef _LARGEFILE_SOURCE +# define _LARGEFILE_SOURCE 1 +# endif +# ifdef _FILE_OFFSET_BITS +# undef _FILE_OFFSET_BITS +# endif +#endif + +#ifdef HAVE_HIDDEN +# define ZLIB_INTERNAL __attribute__((visibility ("hidden"))) +#else +# define ZLIB_INTERNAL +#endif + +#include <stdio.h> +#include "zlib.h" +#ifdef STDC +# include <string.h> +# include <stdlib.h> +# include <limits.h> +#endif +#include <fcntl.h> + +#ifdef _WIN32 +# include <stddef.h> +#else +# include <unistd.h> +#endif + +#if defined(__TURBOC__) || defined(_MSC_VER) || defined(_WIN32) +# include <io.h> +#endif + +#ifdef WINAPI_FAMILY +# define open _open +# define read _read +# define write _write +# define close _close +#endif + +#ifdef NO_DEFLATE /* for compatibility with old definition */ +# define NO_GZCOMPRESS +#endif + +#if defined(STDC99) || (defined(__TURBOC__) && __TURBOC__ >= 0x550) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#if defined(__CYGWIN__) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#if defined(MSDOS) && defined(__BORLANDC__) && (BORLANDC > 0x410) +# ifndef HAVE_VSNPRINTF +# define HAVE_VSNPRINTF +# endif +#endif + +#ifndef HAVE_VSNPRINTF +# ifdef MSDOS +/* vsnprintf may exist on some MS-DOS compilers (DJGPP?), + but for now we just assume it doesn't. */ +# define NO_vsnprintf +# endif +# ifdef __TURBOC__ +# define NO_vsnprintf +# endif +# ifdef WIN32 +/* In Win32, vsnprintf is available as the "non-ANSI" _vsnprintf. */ +# if !defined(vsnprintf) && !defined(NO_vsnprintf) +# if !defined(_MSC_VER) || ( defined(_MSC_VER) && _MSC_VER < 1500 ) +# define vsnprintf _vsnprintf +# endif +# endif +# endif +# ifdef __SASC +# define NO_vsnprintf +# endif +# ifdef VMS +# define NO_vsnprintf +# endif +# ifdef __OS400__ +# define NO_vsnprintf +# endif +# ifdef __MVS__ +# define NO_vsnprintf +# endif +#endif + +/* unlike snprintf (which is required in C99, yet still not supported by + Microsoft more than a decade later!), _snprintf does not guarantee null + termination of the result -- however this is only used in gzlib.c where + the result is assured to fit in the space provided */ +#ifdef _MSC_VER +# define snprintf _snprintf +#endif + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +/* gz* functions always use library allocation functions */ +#ifndef STDC + extern voidp malloc OF((uInt size)); + extern void free OF((voidpf ptr)); +#endif + +/* get errno and strerror definition */ +#if defined UNDER_CE +# include <windows.h> +# define zstrerror() gz_strwinerror((DWORD)GetLastError()) +#else +# ifndef NO_STRERROR +# include <errno.h> +# define zstrerror() strerror(errno) +# else +# define zstrerror() "stdio error (consult errno)" +# endif +#endif + +/* provide prototypes for these when building zlib without LFS */ +#if !defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0 +#ifndef z_off64_t +#define z_off64_t z_off_t +#endif + + gzFile gzopen64 OF((const char *, const char *)); + z_off64_t gzseek64 OF((gzFile, z_off64_t, int)); + z_off64_t gztell64 OF((gzFile)); + z_off64_t gzoffset64 OF((gzFile)); +#endif + +/* default memLevel */ +#if MAX_MEM_LEVEL >= 8 +# define DEF_MEM_LEVEL 8 +#else +# define DEF_MEM_LEVEL MAX_MEM_LEVEL +#endif + +/* default i/o buffer size -- double this for output when reading (this and + twice this must be able to fit in an unsigned type) */ +#define GZBUFSIZE 8192 + +/* gzip modes, also provide a little integrity check on the passed structure */ +#define GZ_NONE 0 +#define GZ_READ 7247 +#define GZ_WRITE 31153 +#define GZ_APPEND 1 /* mode set to GZ_WRITE after the file is opened */ + +/* values for gz_state how */ +#define LOOK 0 /* look for a gzip header */ +#define MODE_COPY 1 /* copy input directly */ +#define MODE_GZIP 2 /* decompress a gzip stream */ + +#include "gzfile.h" + +/* internal gzip file state data structure */ +typedef struct { + /* exposed contents for gzgetc() macro */ + struct gzFile_s x; /* "x" for exposed */ + /* x.have: number of bytes available at x.next */ + /* x.next: next output data to deliver or write */ + /* x.pos: current position in uncompressed data */ + /* used for both reading and writing */ + int mode; /* see gzip modes above */ + int fd; /* file descriptor */ + char *path; /* path or fd for error messages */ + unsigned size; /* buffer size, zero if not allocated yet */ + unsigned want; /* requested buffer size, default is GZBUFSIZE */ + unsigned char *in; /* input buffer */ + unsigned char *out; /* output buffer (double-sized when reading) */ + int direct; /* 0 if processing gzip, 1 if transparent */ + /* just for reading */ + int how; /* 0: get header, 1: copy, 2: decompress */ + z_off64_t start; /* where the gzip data started, for rewinding */ + int eof; /* true if end of input file reached */ + int past; /* true if read requested past end */ + /* just for writing */ + int level; /* compression level */ + int strategy; /* compression strategy */ + /* seek request */ + z_off64_t skip; /* amount to skip (already rewound if backwards) */ + int seek; /* true if seek request pending */ + /* error information */ + int err; /* error code */ + char *msg; /* error message */ + /* zlib inflate or deflate stream */ + z_stream strm; /* stream structure in-place (not a pointer) */ +} gz_state; +typedef gz_state FAR *gz_statep; + +/* shared functions */ +void ZLIB_INTERNAL gz_error OF((gz_statep, int, const char *)); +#if defined UNDER_CE +char ZLIB_INTERNAL *gz_strwinerror OF((DWORD error)); +#endif + +/* GT_OFF(x), where x is an unsigned value, is true if x > maximum z_off64_t + value -- needed when comparing unsigned to z_off64_t, which is signed + (possible z_off64_t types off_t, off64_t, and long are all signed) */ +#ifdef INT_MAX +# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > INT_MAX) +#else +unsigned ZLIB_INTERNAL gz_intmax OF((void)); +# define GT_OFF(x) (sizeof(int) == sizeof(z_off64_t) && (x) > gz_intmax()) +#endif + +#endif diff --git a/deps/zlib/gzlib.c b/deps/zlib/gzlib.c new file mode 100644 index 0000000..7443a75 --- /dev/null +++ b/deps/zlib/gzlib.c @@ -0,0 +1,604 @@ +/* gzlib.c -- zlib functions common to reading and writing gzip files + * Copyright (C) 2004, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +#if defined(_WIN32) && !defined(__BORLANDC__) +# define LSEEK _lseeki64 +#else +#if defined(_LARGEFILE64_SOURCE) && _LFS64_LARGEFILE-0 +# define LSEEK lseek64 +#else +# define LSEEK lseek +#endif +#endif + +/* Forward declarations */ +z_off_t ZEXPORT gzoffset(gzFile file); +int ZEXPORT gzbuffer(gzFile file, unsigned size); + +/* Local functions */ +local void gz_reset OF((gz_statep)); +local gzFile gz_open OF((const void *, int, const char *)); + +#if defined UNDER_CE + +/* Map the Windows error number in ERROR to a locale-dependent error message + string and return a pointer to it. Typically, the values for ERROR come + from GetLastError. + + The string pointed to shall not be modified by the application, but may be + overwritten by a subsequent call to gz_strwinerror + + The gz_strwinerror function does not change the current setting of + GetLastError. */ +char ZLIB_INTERNAL *gz_strwinerror (error) + DWORD error; +{ + static char buf[1024]; + + wchar_t *msgbuf; + DWORD lasterr = GetLastError(); + DWORD chars = FormatMessage(FORMAT_MESSAGE_FROM_SYSTEM + | FORMAT_MESSAGE_ALLOCATE_BUFFER, + NULL, + error, + 0, /* Default language */ + (LPVOID)&msgbuf, + 0, + NULL); + if (chars != 0) { + /* If there is an \r\n appended, zap it. */ + if (chars >= 2 + && msgbuf[chars - 2] == '\r' && msgbuf[chars - 1] == '\n') { + chars -= 2; + msgbuf[chars] = 0; + } + + if (chars > sizeof (buf) - 1) { + chars = sizeof (buf) - 1; + msgbuf[chars] = 0; + } + + wcstombs(buf, msgbuf, chars + 1); + LocalFree(msgbuf); + } + else { + sprintf(buf, "unknown win32 error (%ld)", error); + } + + SetLastError(lasterr); + return buf; +} + +#endif /* UNDER_CE */ + +/* Reset gzip file state */ +local void gz_reset(gz_statep state) +{ + state->x.have = 0; /* no output data available */ + if (state->mode == GZ_READ) { /* for reading ... */ + state->eof = 0; /* not at end of file */ + state->past = 0; /* have not read past end yet */ + state->how = LOOK; /* look for gzip header */ + } + state->seek = 0; /* no seek request pending */ + gz_error(state, Z_OK, NULL); /* clear error */ + state->x.pos = 0; /* no uncompressed data yet */ + state->strm.avail_in = 0; /* no input data yet */ +} + +/* Open a gzip file either by name or file descriptor. */ +local gzFile gz_open(const void *path, int fd, const char *mode) +{ + gz_statep state; + size_t len; + int oflag; +#ifdef O_CLOEXEC + int cloexec = 0; +#endif +#ifdef O_EXCL + int exclusive = 0; +#endif + + /* check input */ + if (path == NULL) + return NULL; + + /* allocate gzFile structure to return */ + state = (gz_statep)malloc(sizeof(gz_state)); + if (state == NULL) + return NULL; + state->size = 0; /* no buffers allocated yet */ + state->want = GZBUFSIZE; /* requested buffer size */ + state->msg = NULL; /* no error message yet */ + + /* interpret mode */ + state->mode = GZ_NONE; + state->level = Z_DEFAULT_COMPRESSION; + state->strategy = Z_DEFAULT_STRATEGY; + state->direct = 0; + while (*mode) { + if (*mode >= '0' && *mode <= '9') + state->level = *mode - '0'; + else + switch (*mode) { + case 'r': + state->mode = GZ_READ; + break; +#ifndef NO_GZCOMPRESS + case 'w': + state->mode = GZ_WRITE; + break; + case 'a': + state->mode = GZ_APPEND; + break; +#endif + case '+': /* can't read and write at the same time */ + free(state); + return NULL; + case 'b': /* ignore -- will request binary anyway */ + break; +#ifdef O_CLOEXEC + case 'e': + cloexec = 1; + break; +#endif +#ifdef O_EXCL + case 'x': + exclusive = 1; + break; +#endif + case 'f': + state->strategy = Z_FILTERED; + break; + case 'h': + state->strategy = Z_HUFFMAN_ONLY; + break; + case 'R': + state->strategy = Z_RLE; + break; + case 'F': + state->strategy = Z_FIXED; + break; + case 'T': + state->direct = 1; + break; + default: /* could consider as an error, but just ignore */ + ; + } + mode++; + } + + /* must provide an "r", "w", or "a" */ + if (state->mode == GZ_NONE) { + free(state); + return NULL; + } + + /* can't force transparent read */ + if (state->mode == GZ_READ) { + if (state->direct) { + free(state); + return NULL; + } + state->direct = 1; /* for empty file */ + } + + /* save the path name for error messages */ +#ifdef _WIN32 + if (fd == -2) { + len = wcstombs(NULL, (const wchar_t*)path, 0); + if (len == (size_t)-1) + len = 0; + } + else +#endif + len = strlen((const char *)path); + state->path = (char *)malloc(len + 1); + if (state->path == NULL) { + free(state); + return NULL; + } +#ifdef _WIN32 + if (fd == -2) + if (len) + wcstombs(state->path, (const wchar_t*)path, len + 1); + else + *(state->path) = 0; + else +#endif +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(state->path, len + 1, "%s", (const char *)path); +#else + strlcpy(state->path, path, sizeof(state->path)); +#endif + + /* compute the flags for open() */ + oflag = +#ifdef O_LARGEFILE + O_LARGEFILE | +#endif +#ifdef O_BINARY + O_BINARY | +#endif +#ifdef O_CLOEXEC + (cloexec ? O_CLOEXEC : 0) | +#endif + (state->mode == GZ_READ ? + O_RDONLY : + (O_WRONLY | O_CREAT | +#ifdef O_EXCL + (exclusive ? O_EXCL : 0) | +#endif + (state->mode == GZ_WRITE ? + O_TRUNC : + O_APPEND))); + + /* open the file with the appropriate flags (or just use fd) */ + state->fd = fd > -1 ? fd : ( +#ifdef _WIN32 + fd == -2 ? _wopen((const wchar_t*)path, oflag, 0666) : +#endif + open((const char *)path, oflag, 0666)); + if (state->fd == -1) { + free(state->path); + free(state); + return NULL; + } + if (state->mode == GZ_APPEND) + state->mode = GZ_WRITE; /* simplify later checks */ + + /* save the current position for rewinding (only if reading) */ + if (state->mode == GZ_READ) { + state->start = LSEEK(state->fd, 0, SEEK_CUR); + if (state->start == -1) state->start = 0; + } + + /* initialize stream */ + gz_reset(state); + + /* return stream */ + return (gzFile)state; +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzopen(const char *path, const char *mode) +{ + return gz_open(path, -1, mode); +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzopen64(const char *path, const char *mode) +{ + return gz_open(path, -1, mode); +} + +/* -- see zlib.h -- */ +gzFile ZEXPORT gzdopen(int fd, const char *mode) +{ + char *path; /* identifier for error messages */ + gzFile gz; + + if (fd == -1 || (path = (char *)malloc(7 + 3 * sizeof(int))) == NULL) + return NULL; +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(path, 7 + 3 * sizeof(int), "<fd:%d>", fd); /* for debugging */ +#else + sprintf(path, "<fd:%d>", fd); /* for debugging */ +#endif + gz = gz_open(path, fd, mode); + free(path); + return gz; +} + +/* -- see zlib.h -- */ +#ifdef _WIN32 +gzFile ZEXPORT gzopen_w(const wchar_t *path, const char *mode) +{ + return gz_open(path, -2, mode); +} +#endif + +/* -- see zlib.h -- */ +int ZEXPORT gzbuffer(gzFile file, unsigned size) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* make sure we haven't already allocated memory */ + if (state->size != 0) + return -1; + + /* check and set requested size */ + if (size < 2) + size = 2; /* need two bytes to check magic header */ + state->want = size; + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzrewind(gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* back up and start over */ + if (LSEEK(state->fd, state->start, SEEK_SET) == -1) + return -1; + gz_reset(state); + return 0; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gzseek64(gzFile file, z_off64_t offset, int whence) +{ + unsigned n; + z_off64_t ret; + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* check that there's no error */ + if (state->err != Z_OK && state->err != Z_BUF_ERROR) + return -1; + + /* can only seek from start or relative to current position */ + if (whence != SEEK_SET && whence != SEEK_CUR) + return -1; + + /* normalize offset to a SEEK_CUR specification */ + if (whence == SEEK_SET) + offset -= state->x.pos; + else if (state->seek) + offset += state->skip; + state->seek = 0; + + /* if within raw area while reading, just go there */ + if (state->mode == GZ_READ && state->how == MODE_COPY && + state->x.pos + offset >= 0) { + ret = LSEEK(state->fd, offset - state->x.have, SEEK_CUR); + if (ret == -1) + return -1; + state->x.have = 0; + state->eof = 0; + state->past = 0; + state->seek = 0; + gz_error(state, Z_OK, NULL); + state->strm.avail_in = 0; + state->x.pos += offset; + return state->x.pos; + } + + /* calculate skip amount, rewinding if needed for back seek when reading */ + if (offset < 0) { + if (state->mode != GZ_READ) /* writing -- can't go backwards */ + return -1; + offset += state->x.pos; + if (offset < 0) /* before start of file! */ + return -1; + if (gzrewind(file) == -1) /* rewind, then skip to offset */ + return -1; + } + + /* if reading, skip what's in output buffer (one less gzgetc() check) */ + if (state->mode == GZ_READ) { + n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > offset ? + (unsigned)offset : state->x.have; + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + offset -= n; + } + + /* request skip (if not zero) */ + if (offset) { + state->seek = 1; + state->skip = offset; + } + return state->x.pos + offset; +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gzseek(gzFile file, z_off_t offset, int whence) +{ + z_off64_t ret; + + ret = gzseek64(file, (z_off64_t)offset, whence); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gztell64(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* return position */ + return state->x.pos + (state->seek ? state->skip : 0); +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gztell(gzFile file) +{ + z_off64_t ret; + + ret = gztell64(file); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +z_off64_t ZEXPORT gzoffset64(gzFile file) +{ + z_off64_t offset; + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return -1; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return -1; + + /* compute and return effective offset in file */ + offset = LSEEK(state->fd, 0, SEEK_CUR); + if (offset == -1) + return -1; + if (state->mode == GZ_READ) /* reading */ + offset -= state->strm.avail_in; /* don't count buffered input */ + return offset; +} + +/* -- see zlib.h -- */ +z_off_t ZEXPORT gzoffset(gzFile file) +{ + z_off64_t ret = gzoffset64(file); + return ret == (z_off_t)ret ? (z_off_t)ret : -1; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzeof(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return 0; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return 0; + + /* return end-of-file state */ + return state->mode == GZ_READ ? state->past : 0; +} + +/* -- see zlib.h -- */ +const char * ZEXPORT gzerror(gzFile file, int *errnum) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return NULL; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return NULL; + + /* return error information */ + if (errnum != NULL) + *errnum = state->err; + return state->err == Z_MEM_ERROR ? "out of memory" : + (state->msg == NULL ? "" : state->msg); +} + +/* -- see zlib.h -- */ +void ZEXPORT gzclearerr(gzFile file) +{ + gz_statep state; + + /* get internal structure and check integrity */ + if (file == NULL) + return; + state = (gz_statep)file; + if (state->mode != GZ_READ && state->mode != GZ_WRITE) + return; + + /* clear error and end-of-file */ + if (state->mode == GZ_READ) { + state->eof = 0; + state->past = 0; + } + gz_error(state, Z_OK, NULL); +} + +/* Create an error message in allocated memory and set state->err and + state->msg accordingly. Free any previous error message already there. Do + not try to free or allocate space if the error is Z_MEM_ERROR (out of + memory). Simply save the error message as a static string. If there is an + allocation failure constructing the error message, then convert the error to + out of memory. */ +void ZLIB_INTERNAL gz_error(gz_statep state, int err, const char *msg) +{ + /* free previously allocated message and clear */ + if (state->msg != NULL) { + if (state->err != Z_MEM_ERROR) + free(state->msg); + state->msg = NULL; + } + + /* if fatal, set state->x.have to 0 so that the gzgetc() macro fails */ + if (err != Z_OK && err != Z_BUF_ERROR) + state->x.have = 0; + + /* set error code, and if no message, then done */ + state->err = err; + if (msg == NULL) + return; + + /* for an out of memory error, return literal string when requested */ + if (err == Z_MEM_ERROR) + return; + + /* construct error message with path */ + if ((state->msg = (char *)malloc(strlen(state->path) + strlen(msg) + 3)) == + NULL) { + state->err = Z_MEM_ERROR; + return; + } +#if !defined(NO_snprintf) && !defined(NO_vsnprintf) + snprintf(state->msg, strlen(state->path) + strlen(msg) + 3, + "%s%s%s", state->path, ": ", msg); +#else + strlcpy(state->msg, state->path, sizeof(state->msg)); + strlcat(state->msg, ": ", sizeof(state->msg)); + strlcat(state->msg, msg, sizeof(state->msg)); +#endif + return; +} + +#ifndef INT_MAX +/* portably return maximum value for an int (when limits.h presumed not + available) -- we need to do this to cover cases where 2's complement not + used, since C standard permits 1's complement and sign-bit representations, + otherwise we could just use ((unsigned)-1) >> 1 */ +unsigned ZLIB_INTERNAL gz_intmax() +{ + unsigned p, q; + + p = 1; + do { + q = p; + p <<= 1; + p++; + } while (p > q); + return q >> 1; +} +#endif diff --git a/deps/zlib/gzread.c b/deps/zlib/gzread.c new file mode 100644 index 0000000..7f6ec7e --- /dev/null +++ b/deps/zlib/gzread.c @@ -0,0 +1,575 @@ +/* gzread.c -- zlib functions for reading gzip files + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +/* Local functions */ +local int gz_load OF((gz_statep, unsigned char *, unsigned, unsigned *)); +local int gz_avail OF((gz_statep)); +local int gz_look OF((gz_statep)); +local int gz_decomp OF((gz_statep)); +local int gz_fetch OF((gz_statep)); +local int gz_skip OF((gz_statep, z_off64_t)); + +int ZEXPORT gzgetc_(gzFile file); + +/* Use read() to load a buffer -- return -1 on error, otherwise 0. Read from + state->fd, and update state->eof, state->err, and state->msg as appropriate. + This function needs to loop on read(), since read() is not guaranteed to + read the number of bytes requested, depending on the type of descriptor. */ +local int gz_load(gz_statep state, unsigned char *buf, unsigned len, unsigned *have) +{ + int ret; + + *have = 0; + do { + ret = read(state->fd, buf + *have, len - *have); + if (ret <= 0) + break; + *have += ret; + } while (*have < len); + if (ret < 0) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + if (ret == 0) + state->eof = 1; + return 0; +} + +/* Load up input buffer and set eof flag if last data loaded -- return -1 on + error, 0 otherwise. Note that the eof flag is set when the end of the input + file is reached, even though there may be unused data in the buffer. Once + that data has been used, no more attempts will be made to read the file. + If strm->avail_in != 0, then the current data is moved to the beginning of + the input buffer, and then the remainder of the buffer is loaded with the + available data from the input file. */ +local int gz_avail(gz_statep state) +{ + unsigned got; + z_streamp strm = &(state->strm); + + if (state->err != Z_OK && state->err != Z_BUF_ERROR) + return -1; + if (state->eof == 0) { + if (strm->avail_in) { /* copy what's there to the start */ + unsigned char *p = state->in; + unsigned const char *q = strm->next_in; + unsigned n = strm->avail_in; + do { + *p++ = *q++; + } while (--n); + } + if (gz_load(state, state->in + strm->avail_in, + state->size - strm->avail_in, &got) == -1) + return -1; + strm->avail_in += got; + strm->next_in = state->in; + } + return 0; +} + +/* Look for gzip header, set up for inflate or copy. state->x.have must be 0. + If this is the first time in, allocate required memory. state->how will be + left unchanged if there is no more input data available, will be set to COPY + if there is no gzip header and direct copying will be performed, or it will + be set to GZIP for decompression. If direct copying, then leftover input + data from the input buffer will be copied to the output buffer. In that + case, all further file reads will be directly to either the output buffer or + a user buffer. If decompressing, the inflate state will be initialized. + gz_look() will return 0 on success or -1 on failure. */ +local int gz_look(gz_statep state) +{ + z_streamp strm = &(state->strm); + + /* allocate read buffers and inflate memory */ + if (state->size == 0) { + /* allocate buffers */ + state->in = (unsigned char *)malloc(state->want); + state->out = (unsigned char *)malloc(state->want << 1); + if (state->in == NULL || state->out == NULL) { + if (state->out != NULL) + free(state->out); + if (state->in != NULL) + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + state->size = state->want; + + /* allocate inflate memory */ + state->strm.zalloc = Z_NULL; + state->strm.zfree = Z_NULL; + state->strm.opaque = Z_NULL; + state->strm.avail_in = 0; + state->strm.next_in = Z_NULL; + if (inflateInit2(&(state->strm), 15 + 16) != Z_OK) { /* gunzip */ + free(state->out); + free(state->in); + state->size = 0; + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + } + + /* get at least the magic bytes in the input buffer */ + if (strm->avail_in < 2) { + if (gz_avail(state) == -1) + return -1; + if (strm->avail_in == 0) + return 0; + } + + /* look for gzip magic bytes -- if there, do gzip decoding (note: there is + a logical dilemma here when considering the case of a partially written + gzip file, to wit, if a single 31 byte is written, then we cannot tell + whether this is a single-byte file, or just a partially written gzip + file -- for here we assume that if a gzip file is being written, then + the header will be written in a single operation, so that reading a + single byte is sufficient indication that it is not a gzip file) */ + if (strm->avail_in > 1 && + strm->next_in[0] == 31 && strm->next_in[1] == 139) { + inflateReset(strm); + state->how = MODE_GZIP; + state->direct = 0; + return 0; + } + + /* no gzip header -- if we were decoding gzip before, then this is trailing + garbage. Ignore the trailing garbage and finish. */ + if (state->direct == 0) { + strm->avail_in = 0; + state->eof = 1; + state->x.have = 0; + return 0; + } + + /* doing raw i/o, copy any leftover input to output -- this assumes that + the output buffer is larger than the input buffer, which also assures + space for gzungetc() */ + state->x.next = state->out; + if (strm->avail_in) { + memcpy(state->x.next, strm->next_in, strm->avail_in); + state->x.have = strm->avail_in; + strm->avail_in = 0; + } + state->how = MODE_COPY; + state->direct = 1; + return 0; +} + +/* Decompress from input to the provided next_out and avail_out in the state. + On return, state->x.have and state->x.next point to the just decompressed + data. If the gzip stream completes, state->how is reset to LOOK to look for + the next gzip stream or raw data, once state->x.have is depleted. Returns 0 + on success, -1 on failure. */ +local int gz_decomp(gz_statep state) +{ + int ret = Z_OK; + unsigned had; + z_streamp strm = &(state->strm); + + /* fill output buffer up to end of deflate stream */ + had = strm->avail_out; + do { + /* get more input for inflate() */ + if (strm->avail_in == 0 && gz_avail(state) == -1) + return -1; + if (strm->avail_in == 0) { + gz_error(state, Z_BUF_ERROR, "unexpected end of file"); + break; + } + + /* decompress and handle errors */ + ret = inflate(strm, Z_NO_FLUSH); + if (ret == Z_STREAM_ERROR || ret == Z_NEED_DICT) { + gz_error(state, Z_STREAM_ERROR, + "internal error: inflate stream corrupt"); + return -1; + } + if (ret == Z_MEM_ERROR) { + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + if (ret == Z_DATA_ERROR) { /* deflate stream invalid */ + gz_error(state, Z_DATA_ERROR, + strm->msg == NULL ? "compressed data error" : strm->msg); + return -1; + } + } while (strm->avail_out && ret != Z_STREAM_END); + + /* update available output */ + state->x.have = had - strm->avail_out; + state->x.next = strm->next_out - state->x.have; + + /* if the gzip stream completed successfully, look for another */ + if (ret == Z_STREAM_END) + state->how = LOOK; + + /* good decompression */ + return 0; +} + +/* Fetch data and put it in the output buffer. Assumes state->x.have is 0. + Data is either copied from the input file or decompressed from the input + file depending on state->how. If state->how is LOOK, then a gzip header is + looked for to determine whether to copy or decompress. Returns -1 on error, + otherwise 0. gz_fetch() will leave state->how as COPY or GZIP unless the + end of the input file has been reached and all data has been processed. */ +local int gz_fetch(gz_statep state) +{ + z_streamp strm = &(state->strm); + + do { + switch(state->how) { + case LOOK: /* -> LOOK, MODE_COPY (only if never GZIP), or MODE_GZIP */ + if (gz_look(state) == -1) + return -1; + if (state->how == LOOK) + return 0; + break; + case MODE_COPY: /* -> MODE_COPY */ + if (gz_load(state, state->out, state->size << 1, &(state->x.have)) + == -1) + return -1; + state->x.next = state->out; + return 0; + case MODE_GZIP: /* -> GZIP or LOOK (if end of gzip stream) */ + strm->avail_out = state->size << 1; + strm->next_out = state->out; + if (gz_decomp(state) == -1) + return -1; + } + } while (state->x.have == 0 && (!state->eof || strm->avail_in)); + return 0; +} + +/* Skip len uncompressed bytes of output. Return -1 on error, 0 on success. */ +local int gz_skip(gz_statep state, z_off64_t len) +{ + unsigned n; + + /* skip over len bytes or reach end-of-file, whichever comes first */ + while (len) + /* skip over whatever is in output buffer */ + if (state->x.have) { + n = GT_OFF(state->x.have) || (z_off64_t)state->x.have > len ? + (unsigned)len : state->x.have; + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + len -= n; + } + + /* output buffer empty -- return if we're at the end of the input */ + else if (state->eof && state->strm.avail_in == 0) + break; + + /* need more data to skip -- load up output buffer */ + else { + /* get more output, looking for header if required */ + if (gz_fetch(state) == -1) + return -1; + } + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzread(gzFile file, voidp buf, unsigned len) +{ + unsigned got, n; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* since an int is returned, make sure len fits in one, otherwise return + with an error (this avoids the flaw in the interface) */ + if ((int)len < 0) { + gz_error(state, Z_DATA_ERROR, "requested length does not fit in int"); + return -1; + } + + /* if len is zero, avoid unnecessary operations */ + if (len == 0) + return 0; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return -1; + } + + /* get len bytes to buf, or less than len if at the end */ + got = 0; + n = 0; + do { + /* first just try copying data from the output buffer */ + if (state->x.have) { + n = state->x.have > len ? len : state->x.have; + memcpy(buf, state->x.next, n); + state->x.next += n; + state->x.have -= n; + } + + /* output buffer empty -- return if we're at the end of the input */ + else if (state->eof && strm->avail_in == 0) { + state->past = 1; /* tried to read past end */ + break; + } + + /* need output data -- for small len or new stream load up our output + buffer */ + else if (state->how == LOOK || len < (state->size << 1)) { + /* get more output, looking for header if required */ + if (gz_fetch(state) == -1) + return -1; + continue; /* no progress yet -- go back to copy above */ + /* the copy above assures that we will leave with space in the + output buffer, allowing at least one gzungetc() to succeed */ + } + + /* large len -- read directly into user buffer */ + else if (state->how == MODE_COPY) { /* read directly */ + if (gz_load(state, (unsigned char *)buf, len, &n) == -1) + return -1; + } + + /* large len -- decompress directly into user buffer */ + else { /* state->how == GZIP */ + strm->avail_out = len; + strm->next_out = (unsigned char *)buf; + if (gz_decomp(state) == -1) + return -1; + n = state->x.have; + state->x.have = 0; + } + + /* update progress */ + len -= n; + buf = (char *)buf + n; + got += n; + state->x.pos += n; + } while (len); + + /* return number of bytes read into user buffer (will fit in int) */ + return (int)got; +} + +/* -- see zlib.h -- */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +#else +# undef gzgetc +#endif +int ZEXPORT gzgetc(gzFile file) +{ + int ret; + unsigned char buf[1]; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* try output buffer (no need to check for skip request) */ + if (state->x.have) { + state->x.have--; + state->x.pos++; + return *(state->x.next)++; + } + + /* nothing there -- try gzread() */ + ret = gzread(file, buf, 1); + return ret < 1 ? -1 : buf[0]; +} + +int ZEXPORT gzgetc_(gzFile file) +{ + return gzgetc(file); +} + +/* -- see zlib.h -- */ +int ZEXPORT gzungetc(int c, gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return -1; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return -1; + } + + /* can't push EOF */ + if (c < 0) + return -1; + + /* if output buffer empty, put byte at end (allows more pushing) */ + if (state->x.have == 0) { + state->x.have = 1; + state->x.next = state->out + (state->size << 1) - 1; + state->x.next[0] = c; + state->x.pos--; + state->past = 0; + return c; + } + + /* if no room, give up (must have already done a gzungetc()) */ + if (state->x.have == (state->size << 1)) { + gz_error(state, Z_DATA_ERROR, "out of room to push characters"); + return -1; + } + + /* slide output data if needed and insert byte before existing data */ + if (state->x.next == state->out) { + unsigned char *src = state->out + state->x.have; + unsigned char *dest = state->out + (state->size << 1); + while (src > state->out) + *--dest = *--src; + state->x.next = dest; + } + state->x.have++; + state->x.next--; + state->x.next[0] = c; + state->x.pos--; + state->past = 0; + return c; +} + +/* -- see zlib.h -- */ +char * ZEXPORT gzgets(gzFile file, char *buf, int len) +{ + unsigned left, n; + char *str; + unsigned char *eol; + gz_statep state; + + /* check parameters and get internal structure */ + if (file == NULL || buf == NULL || len < 1) + return NULL; + state = (gz_statep)file; + + /* check that we're reading and that there's no (serious) error */ + if (state->mode != GZ_READ || + (state->err != Z_OK && state->err != Z_BUF_ERROR)) + return NULL; + + /* process a skip request */ + if (state->seek) { + state->seek = 0; + if (gz_skip(state, state->skip) == -1) + return NULL; + } + + /* copy output bytes up to new line or len - 1, whichever comes first -- + append a terminating zero to the string (we don't check for a zero in + the contents, let the user worry about that) */ + str = buf; + left = (unsigned)len - 1; + if (left) do { + /* assure that something is in the output buffer */ + if (state->x.have == 0 && gz_fetch(state) == -1) + return NULL; /* error */ + if (state->x.have == 0) { /* end of file */ + state->past = 1; /* read past end */ + break; /* return what we have */ + } + + /* look for end-of-line in current output buffer */ + n = state->x.have > left ? left : state->x.have; + eol = (unsigned char *)memchr(state->x.next, '\n', n); + if (eol != NULL) + n = (unsigned)(eol - state->x.next) + 1; + + /* copy through end-of-line, or remainder if not found */ + memcpy(buf, state->x.next, n); + state->x.have -= n; + state->x.next += n; + state->x.pos += n; + left -= n; + buf += n; + } while (left && eol == NULL); + + /* return terminated string, or if nothing, end of file */ + if (buf == str) + return NULL; + buf[0] = 0; + return str; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzdirect(gzFile file) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return 0; + state = (gz_statep)file; + + /* if the state is not known, but we can find out, then do so (this is + mainly for right after a gzopen() or gzdopen()) */ + if (state->mode == GZ_READ && state->how == LOOK && state->x.have == 0) + (void)gz_look(state); + + /* return 1 if transparent, 0 if processing a gzip stream */ + return state->direct; +} + +/* -- see zlib.h -- */ +int gzclose_r(gzFile file) +{ + int ret, err; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + /* check that we're reading */ + if (state->mode != GZ_READ) + return Z_STREAM_ERROR; + + /* free memory and close file */ + if (state->size) { + inflateEnd(&(state->strm)); + free(state->out); + free(state->in); + } + err = state->err == Z_BUF_ERROR ? Z_BUF_ERROR : Z_OK; + gz_error(state, Z_OK, NULL); + free(state->path); + ret = close(state->fd); + free(state); + return ret ? Z_ERRNO : err; +} diff --git a/deps/zlib/gzwrite.c b/deps/zlib/gzwrite.c new file mode 100644 index 0000000..61b217e --- /dev/null +++ b/deps/zlib/gzwrite.c @@ -0,0 +1,557 @@ +/* gzwrite.c -- zlib functions for writing gzip files + * Copyright (C) 2004, 2005, 2010, 2011, 2012, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "gzguts.h" + +/* Local functions */ +local int gz_init OF((gz_statep)); +local int gz_comp OF((gz_statep, int)); +local int gz_zero OF((gz_statep, z_off64_t)); + +int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va); + +/* Initialize state for writing a gzip file. Mark initialization by setting + state->size to non-zero. Return -1 on failure or 0 on success. */ +local int gz_init(gz_statep state) +{ + int ret; + z_streamp strm = &(state->strm); + + /* allocate input buffer */ + state->in = (unsigned char *)malloc(state->want); + if (state->in == NULL) { + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + + /* only need output buffer and deflate state if compressing */ + if (!state->direct) { + /* allocate output buffer */ + state->out = (unsigned char *)malloc(state->want); + if (state->out == NULL) { + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + + /* allocate deflate memory, set up for gzip compression */ + strm->zalloc = Z_NULL; + strm->zfree = Z_NULL; + strm->opaque = Z_NULL; + ret = deflateInit2(strm, state->level, Z_DEFLATED, + MAX_WBITS + 16, DEF_MEM_LEVEL, state->strategy); + if (ret != Z_OK) { + free(state->out); + free(state->in); + gz_error(state, Z_MEM_ERROR, "out of memory"); + return -1; + } + } + + /* mark state as initialized */ + state->size = state->want; + + /* initialize write buffer if compressing */ + if (!state->direct) { + strm->avail_out = state->size; + strm->next_out = state->out; + state->x.next = strm->next_out; + } + return 0; +} + +/* Compress whatever is at avail_in and next_in and write to the output file. + Return -1 if there is an error writing to the output file, otherwise 0. + flush is assumed to be a valid deflate() flush value. If flush is Z_FINISH, + then the deflate() state is reset to start a new gzip stream. If gz->direct + is true, then simply write to the output file without compressing, and + ignore flush. */ +local int gz_comp(gz_statep state, int flush) +{ + int ret, got; + unsigned have; + z_streamp strm = &(state->strm); + + /* allocate memory if this is the first time through */ + if (state->size == 0 && gz_init(state) == -1) + return -1; + + /* write directly if requested */ + if (state->direct) { + got = write(state->fd, strm->next_in, strm->avail_in); + if (got < 0 || (unsigned)got != strm->avail_in) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + strm->avail_in = 0; + return 0; + } + + /* run deflate() on provided input until it produces no more output */ + ret = Z_OK; + do { + /* write out current buffer contents if full, or if flushing, but if + doing Z_FINISH then don't write until we get to Z_STREAM_END */ + if (strm->avail_out == 0 || (flush != Z_NO_FLUSH && + (flush != Z_FINISH || ret == Z_STREAM_END))) { + have = (unsigned)(strm->next_out - state->x.next); + if (have && ((got = write(state->fd, state->x.next, have)) < 0 || + (unsigned)got != have)) { + gz_error(state, Z_ERRNO, zstrerror()); + return -1; + } + if (strm->avail_out == 0) { + strm->avail_out = state->size; + strm->next_out = state->out; + } + state->x.next = strm->next_out; + } + + /* compress */ + have = strm->avail_out; + ret = deflate(strm, flush); + if (ret == Z_STREAM_ERROR) { + gz_error(state, Z_STREAM_ERROR, + "internal error: deflate stream corrupt"); + return -1; + } + have -= strm->avail_out; + } while (have); + + /* if that completed a deflate stream, allow another to start */ + if (flush == Z_FINISH) + deflateReset(strm); + + /* all done, no errors */ + return 0; +} + +/* Compress len zeros to output. Return -1 on error, 0 on success. */ +local int gz_zero(gz_statep state, z_off64_t len) +{ + int first; + unsigned n; + z_streamp strm = &(state->strm); + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return -1; + + /* compress len zeros (len guaranteed > 0) */ + first = 1; + while (len) { + n = GT_OFF(state->size) || (z_off64_t)state->size > len ? + (unsigned)len : state->size; + if (first) { + memset(state->in, 0, n); + first = 0; + } + strm->avail_in = n; + strm->next_in = state->in; + state->x.pos += n; + if (gz_comp(state, Z_NO_FLUSH) == -1) + return -1; + len -= n; + } + return 0; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzwrite(gzFile file, voidpc buf, unsigned len) +{ + unsigned put = len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return 0; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* since an int is returned, make sure len fits in one, otherwise return + with an error (this avoids the flaw in the interface) */ + if ((int)len < 0) { + gz_error(state, Z_DATA_ERROR, "requested length does not fit in int"); + return 0; + } + + /* if len is zero, avoid unnecessary operations */ + if (len == 0) + return 0; + + /* allocate memory if this is the first time through */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* for small len, copy to input buffer, otherwise compress directly */ + if (len < state->size) { + /* copy to input buffer, compress when full */ + do { + unsigned have, copy; + + if (strm->avail_in == 0) + strm->next_in = state->in; + have = (unsigned)((strm->next_in + strm->avail_in) - state->in); + copy = state->size - have; + if (copy > len) + copy = len; + memcpy(state->in + have, buf, copy); + strm->avail_in += copy; + state->x.pos += copy; + buf = (const char *)buf + copy; + len -= copy; + if (len && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + } while (len); + } + else { + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* directly compress user buffer to file */ + strm->avail_in = len; + strm->next_in = (Bytef *)buf; + state->x.pos += len; + if (gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + } + + /* input was all buffered or compressed (put will fit in int) */ + return (int)put; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzputc(gzFile file, int c) +{ + unsigned have; + unsigned char buf[1]; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return -1; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* try writing to input buffer for speed (state->size == 0 if buffer not + initialized) */ + if (state->size) { + if (strm->avail_in == 0) + strm->next_in = state->in; + have = (unsigned)((strm->next_in + strm->avail_in) - state->in); + if (have < state->size) { + state->in[have] = c; + strm->avail_in++; + state->x.pos++; + return c & 0xff; + } + } + + /* no room in buffer or not initialized, use gz_write() */ + buf[0] = c; + if (gzwrite(file, buf, 1) != 1) + return -1; + return c & 0xff; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzputs(gzFile file, const char *str) +{ + int ret; + unsigned len; + + /* write string */ + len = (unsigned)strlen(str); + ret = gzwrite(file, str, len); + return ret == 0 && len != 0 ? -1 : ret; +} + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +#include <stdarg.h> + +/* -- see zlib.h -- */ +int ZEXPORTVA gzvprintf(gzFile file, const char *format, va_list va) +{ + int size, len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* make sure we have some buffer space */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* do the printf() into the input buffer, put length in len */ + size = (int)(state->size); + state->in[size - 1] = 0; +#ifdef NO_vsnprintf +# ifdef HAS_vsprintf_void + (void)vsprintf((char *)(state->in), format, va); + for (len = 0; len < size; len++) + if (state->in[len] == 0) break; +# else + len = vsprintf((char *)(state->in), format, va); +# endif +#else +# ifdef HAS_vsnprintf_void + (void)vsnprintf((char *)(state->in), size, format, va); + len = strlen((char *)(state->in)); +# else + len = vsnprintf((char *)(state->in), size, format, va); +# endif +#endif + + /* check that printf() results fit in buffer */ + if (len <= 0 || len >= (int)size || state->in[size - 1] != 0) + return 0; + + /* update buffer and position, defer compression until needed */ + strm->avail_in = (unsigned)len; + strm->next_in = state->in; + state->x.pos += len; + return len; +} + +int ZEXPORTVA gzprintf(gzFile file, const char *format, ...) +{ + va_list va; + int ret; + + va_start(va, format); + ret = gzvprintf(file, format, va); + va_end(va); + return ret; +} + +#else /* !STDC && !Z_HAVE_STDARG_H */ + +/* -- see zlib.h -- */ +int ZEXPORTVA gzprintf (gzFile file, const char *format, int a1, int a2, int a3, int a4, int a5, int a6, int a7, int a8, int a9, int a10, + int a11, int a12, int a13, int a14, int a15, int a16, int a17, int a18, int a19, int a20) +{ + int size, len; + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that can really pass pointer in ints */ + if (sizeof(int) != sizeof(void *)) + return 0; + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return 0; + + /* make sure we have some buffer space */ + if (state->size == 0 && gz_init(state) == -1) + return 0; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return 0; + } + + /* consume whatever's left in the input buffer */ + if (strm->avail_in && gz_comp(state, Z_NO_FLUSH) == -1) + return 0; + + /* do the printf() into the input buffer, put length in len */ + size = (int)(state->size); + state->in[size - 1] = 0; +#ifdef NO_snprintf +# ifdef HAS_sprintf_void + sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); + for (len = 0; len < size; len++) + if (state->in[len] == 0) break; +# else + len = sprintf((char *)(state->in), format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); +# endif +#else +# ifdef HAS_snprintf_void + snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6, a7, a8, + a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, a19, a20); + len = strlen((char *)(state->in)); +# else + len = snprintf((char *)(state->in), size, format, a1, a2, a3, a4, a5, a6, + a7, a8, a9, a10, a11, a12, a13, a14, a15, a16, a17, a18, + a19, a20); +# endif +#endif + + /* check that printf() results fit in buffer */ + if (len <= 0 || len >= (int)size || state->in[size - 1] != 0) + return 0; + + /* update buffer and position, defer compression until needed */ + strm->avail_in = (unsigned)len; + strm->next_in = state->in; + state->x.pos += len; + return len; +} + +#endif + +/* -- see zlib.h -- */ +int ZEXPORT gzflush(gzFile file, int flush) +{ + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return -1; + state = (gz_statep)file; + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return Z_STREAM_ERROR; + + /* check flush parameter */ + if (flush < 0 || flush > Z_FINISH) + return Z_STREAM_ERROR; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* compress remaining data with requested flush */ + gz_comp(state, flush); + return state->err; +} + +/* -- see zlib.h -- */ +int ZEXPORT gzsetparams(gzFile file, int level, int strategy) +{ + gz_statep state; + z_streamp strm; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + strm = &(state->strm); + + /* check that we're writing and that there's no error */ + if (state->mode != GZ_WRITE || state->err != Z_OK) + return Z_STREAM_ERROR; + + /* if no change is requested, then do nothing */ + if (level == state->level && strategy == state->strategy) + return Z_OK; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + return -1; + } + + /* change compression parameters for subsequent input */ + if (state->size) { + /* flush previous input with previous parameters before changing */ + if (strm->avail_in && gz_comp(state, Z_PARTIAL_FLUSH) == -1) + return state->err; + deflateParams(strm, level, strategy); + } + state->level = level; + state->strategy = strategy; + return Z_OK; +} + +/* -- see zlib.h -- */ +int gzclose_w(gzFile file) +{ + int ret = Z_OK; + gz_statep state; + + /* get internal structure */ + if (file == NULL) + return Z_STREAM_ERROR; + state = (gz_statep)file; + + /* check that we're writing */ + if (state->mode != GZ_WRITE) + return Z_STREAM_ERROR; + + /* check for seek request */ + if (state->seek) { + state->seek = 0; + if (gz_zero(state, state->skip) == -1) + ret = state->err; + } + + /* flush, free memory, and close file */ + if (gz_comp(state, Z_FINISH) == -1) + ret = state->err; + if (state->size) { + if (!state->direct) { + (void)deflateEnd(&(state->strm)); + free(state->out); + } + free(state->in); + } + gz_error(state, Z_OK, NULL); + free(state->path); + if (close(state->fd) == -1) + ret = Z_ERRNO; + free(state); + return ret; +} diff --git a/deps/zlib/infback.c b/deps/zlib/infback.c new file mode 100644 index 0000000..7206cde --- /dev/null +++ b/deps/zlib/infback.c @@ -0,0 +1,628 @@ +/* infback.c -- inflate using a call-back interface + * Copyright (C) 1995-2011 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + This code is largely copied from inflate.c. Normally either infback.o or + inflate.o would be linked into an application--not both. The interface + with inffast.c is retained so that optimized assembler-coded versions of + inflate_fast() can be used with either inflate.c or infback.c. + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +/* function prototypes */ +local void fixedtables OF((struct inflate_state FAR *state)); + +/* + strm provides memory allocation functions in zalloc and zfree, or + Z_NULL to use the library memory allocation functions. + + windowBits is in the range 8..15, and window is a user-supplied + window and output buffer that is 2**windowBits bytes. + */ +int ZEXPORT inflateBackInit_(z_streamp strm, int windowBits, unsigned char FAR *window, const char *version, int stream_size) +{ + struct inflate_state FAR *state; + + if (version == Z_NULL || version[0] != ZLIB_VERSION[0] || + stream_size != (int)(sizeof(z_stream))) + return Z_VERSION_ERROR; + if (strm == Z_NULL || window == Z_NULL || + windowBits < 8 || windowBits > 15) + return Z_STREAM_ERROR; + strm->msg = Z_NULL; /* in case we return an error */ + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == Z_NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + state = (struct inflate_state FAR *)ZALLOC(strm, 1, + sizeof(struct inflate_state)); + if (state == Z_NULL) return Z_MEM_ERROR; + Tracev((stderr, "inflate: allocated\n")); + strm->state = (struct internal_state FAR *)state; + state->dmax = 32768U; + state->wbits = windowBits; + state->wsize = 1U << windowBits; + state->window = window; + state->wnext = 0; + state->whave = 0; + return Z_OK; +} + +/* + Return state with length and distance decoding tables and index sizes set to + fixed code decoding. Normally this returns fixed tables from inffixed.h. + If BUILDFIXED is defined, then instead this routine builds the tables the + first time it's called, and returns those tables the first time and + thereafter. This reduces the size of the code by about 2K bytes, in + exchange for a little execution time. However, BUILDFIXED should not be + used for threaded applications, since the rewriting of the tables and virgin + may not be thread-safe. + */ +local void fixedtables(struct inflate_state FAR *state) +{ +#ifdef BUILDFIXED + static int virgin = 1; + static code *lenfix, *distfix; + static code fixed[544]; + + /* build fixed huffman tables if first call (may not be thread safe) */ + if (virgin) { + unsigned sym, bits; + static code *next; + + /* literal/length table */ + sym = 0; + while (sym < 144) state->lens[sym++] = 8; + while (sym < 256) state->lens[sym++] = 9; + while (sym < 280) state->lens[sym++] = 7; + while (sym < 288) state->lens[sym++] = 8; + next = fixed; + lenfix = next; + bits = 9; + inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work); + + /* distance table */ + sym = 0; + while (sym < 32) state->lens[sym++] = 5; + distfix = next; + bits = 5; + inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work); + + /* do this just once */ + virgin = 0; + } +#else /* !BUILDFIXED */ +# include "inffixed.h" +#endif /* BUILDFIXED */ + state->lencode = lenfix; + state->lenbits = 9; + state->distcode = distfix; + state->distbits = 5; +} + +/* Macros for inflateBack(): */ + +/* Load returned state from inflate_fast() */ +#define LOAD() \ + do { \ + put = strm->next_out; \ + left = strm->avail_out; \ + next = strm->next_in; \ + have = strm->avail_in; \ + hold = state->hold; \ + bits = state->bits; \ + } while (0) + +/* Set state from registers for inflate_fast() */ +#define RESTORE() \ + do { \ + strm->next_out = put; \ + strm->avail_out = left; \ + strm->next_in = next; \ + strm->avail_in = have; \ + state->hold = hold; \ + state->bits = bits; \ + } while (0) + +/* Clear the input bit accumulator */ +#define INITBITS() \ + do { \ + hold = 0; \ + bits = 0; \ + } while (0) + +/* Assure that some input is available. If input is requested, but denied, + then return a Z_BUF_ERROR from inflateBack(). */ +#define PULL() \ + do { \ + if (have == 0) { \ + have = in(in_desc, &next); \ + if (have == 0) { \ + next = Z_NULL; \ + ret = Z_BUF_ERROR; \ + goto inf_leave; \ + } \ + } \ + } while (0) + +/* Get a byte of input into the bit accumulator, or return from inflateBack() + with an error if there is no input available. */ +#define PULLBYTE() \ + do { \ + PULL(); \ + have--; \ + hold += (unsigned long)(*next++) << bits; \ + bits += 8; \ + } while (0) + +/* Assure that there are at least n bits in the bit accumulator. If there is + not enough available input to do that, then return from inflateBack() with + an error. */ +#define NEEDBITS(n) \ + do { \ + while (bits < (unsigned)(n)) \ + PULLBYTE(); \ + } while (0) + +/* Return the low n bits of the bit accumulator (n < 16) */ +#define BITS(n) \ + ((unsigned)hold & ((1U << (n)) - 1)) + +/* Remove n bits from the bit accumulator */ +#define DROPBITS(n) \ + do { \ + hold >>= (n); \ + bits -= (unsigned)(n); \ + } while (0) + +/* Remove zero to seven bits as needed to go to a byte boundary */ +#define BYTEBITS() \ + do { \ + hold >>= bits & 7; \ + bits -= bits & 7; \ + } while (0) + +/* Assure that some output space is available, by writing out the window + if it's full. If the write fails, return from inflateBack() with a + Z_BUF_ERROR. */ +#define ROOM() \ + do { \ + if (left == 0) { \ + put = state->window; \ + left = state->wsize; \ + state->whave = left; \ + if (out(out_desc, put, left)) { \ + ret = Z_BUF_ERROR; \ + goto inf_leave; \ + } \ + } \ + } while (0) + +/* + strm provides the memory allocation functions and window buffer on input, + and provides information on the unused input on return. For Z_DATA_ERROR + returns, strm will also provide an error message. + + in() and out() are the call-back input and output functions. When + inflateBack() needs more input, it calls in(). When inflateBack() has + filled the window with output, or when it completes with data in the + window, it calls out() to write out the data. The application must not + change the provided input until in() is called again or inflateBack() + returns. The application must not change the window/output buffer until + inflateBack() returns. + + in() and out() are called with a descriptor parameter provided in the + inflateBack() call. This parameter can be a structure that provides the + information required to do the read or write, as well as accumulated + information on the input and output such as totals and check values. + + in() should return zero on failure. out() should return non-zero on + failure. If either in() or out() fails, than inflateBack() returns a + Z_BUF_ERROR. strm->next_in can be checked for Z_NULL to see whether it + was in() or out() that caused in the error. Otherwise, inflateBack() + returns Z_STREAM_END on success, Z_DATA_ERROR for an deflate format + error, or Z_MEM_ERROR if it could not allocate memory for the state. + inflateBack() can also return Z_STREAM_ERROR if the input parameters + are not correct, i.e. strm is Z_NULL or the state was not initialized. + */ +int ZEXPORT inflateBack(z_streamp strm, in_func in, void FAR *in_desc, out_func out, void FAR *out_desc) +{ + struct inflate_state FAR *state; + z_const unsigned char FAR *next; /* next input */ + unsigned char FAR *put; /* next output */ + unsigned have, left; /* available input and output */ + unsigned long hold; /* bit buffer */ + unsigned bits; /* bits in bit buffer */ + unsigned copy; /* number of stored or match bytes to copy */ + unsigned char FAR *from; /* where to copy match bytes from */ + code here; /* current decoding table entry */ + code last; /* parent table entry */ + unsigned len; /* length to copy for repeats, bits to drop */ + int ret; /* return code */ + static const unsigned short order[19] = /* permutation of code lengths */ + {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15}; + + /* Check that the strm exists and that the state was initialized */ + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* Reset the state */ + strm->msg = Z_NULL; + state->mode = TYPE; + state->last = 0; + state->whave = 0; + next = strm->next_in; + have = next != Z_NULL ? strm->avail_in : 0; + hold = 0; + bits = 0; + put = state->window; + left = state->wsize; + + /* Inflate until end of block marked as last */ + for (;;) + switch (state->mode) { + case TYPE: + /* determine and dispatch block type */ + if (state->last) { + BYTEBITS(); + state->mode = DONE; + break; + } + NEEDBITS(3); + state->last = BITS(1); + DROPBITS(1); + switch (BITS(2)) { + case 0: /* stored block */ + Tracev((stderr, "inflate: stored block%s\n", + state->last ? " (last)" : "")); + state->mode = STORED; + break; + case 1: /* fixed block */ + fixedtables(state); + Tracev((stderr, "inflate: fixed codes block%s\n", + state->last ? " (last)" : "")); + state->mode = LEN; /* decode codes */ + break; + case 2: /* dynamic block */ + Tracev((stderr, "inflate: dynamic codes block%s\n", + state->last ? " (last)" : "")); + state->mode = TABLE; + break; + case 3: + strm->msg = (char *)"invalid block type"; + state->mode = BAD; + } + DROPBITS(2); + break; + + case STORED: + /* get and verify stored block length */ + BYTEBITS(); /* go to byte boundary */ + NEEDBITS(32); + if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) { + strm->msg = (char *)"invalid stored block lengths"; + state->mode = BAD; + break; + } + state->length = (unsigned)hold & 0xffff; + Tracev((stderr, "inflate: stored length %u\n", + state->length)); + INITBITS(); + + /* copy stored block from input to output */ + while (state->length != 0) { + copy = state->length; + PULL(); + ROOM(); + if (copy > have) copy = have; + if (copy > left) copy = left; + zmemcpy(put, next, copy); + have -= copy; + next += copy; + left -= copy; + put += copy; + state->length -= copy; + } + Tracev((stderr, "inflate: stored end\n")); + state->mode = TYPE; + break; + + case TABLE: + /* get dynamic table entries descriptor */ + NEEDBITS(14); + state->nlen = BITS(5) + 257; + DROPBITS(5); + state->ndist = BITS(5) + 1; + DROPBITS(5); + state->ncode = BITS(4) + 4; + DROPBITS(4); +#ifndef PKZIP_BUG_WORKAROUND + if (state->nlen > 286 || state->ndist > 30) { + strm->msg = (char *)"too many length or distance symbols"; + state->mode = BAD; + break; + } +#endif + Tracev((stderr, "inflate: table sizes ok\n")); + + /* get code length code lengths (not a typo) */ + state->have = 0; + while (state->have < state->ncode) { + NEEDBITS(3); + state->lens[order[state->have++]] = (unsigned short)BITS(3); + DROPBITS(3); + } + while (state->have < 19) + state->lens[order[state->have++]] = 0; + state->next = state->codes; + state->lencode = (code const FAR *)(state->next); + state->lenbits = 7; + ret = inflate_table(CODES, state->lens, 19, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid code lengths set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: code lengths ok\n")); + + /* get length and distance code code lengths */ + state->have = 0; + while (state->have < state->nlen + state->ndist) { + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.val < 16) { + DROPBITS(here.bits); + state->lens[state->have++] = here.val; + } + else { + if (here.val == 16) { + NEEDBITS(here.bits + 2); + DROPBITS(here.bits); + if (state->have == 0) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + len = (unsigned)(state->lens[state->have - 1]); + copy = 3 + BITS(2); + DROPBITS(2); + } + else if (here.val == 17) { + NEEDBITS(here.bits + 3); + DROPBITS(here.bits); + len = 0; + copy = 3 + BITS(3); + DROPBITS(3); + } + else { + NEEDBITS(here.bits + 7); + DROPBITS(here.bits); + len = 0; + copy = 11 + BITS(7); + DROPBITS(7); + } + if (state->have + copy > state->nlen + state->ndist) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + while (copy--) + state->lens[state->have++] = (unsigned short)len; + } + } + + /* handle error breaks in while */ + if (state->mode == BAD) break; + + /* check for end-of-block code (better have one) */ + if (state->lens[256] == 0) { + strm->msg = (char *)"invalid code -- missing end-of-block"; + state->mode = BAD; + break; + } + + /* build code tables -- note: do not change the lenbits or distbits + values here (9 and 6) without reading the comments in inftrees.h + concerning the ENOUGH constants, which depend on those values */ + state->next = state->codes; + state->lencode = (code const FAR *)(state->next); + state->lenbits = 9; + ret = inflate_table(LENS, state->lens, state->nlen, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid literal/lengths set"; + state->mode = BAD; + break; + } + state->distcode = (code const FAR *)(state->next); + state->distbits = 6; + ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist, + &(state->next), &(state->distbits), state->work); + if (ret) { + strm->msg = (char *)"invalid distances set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: codes ok\n")); + state->mode = LEN; + + case LEN: + /* use inflate_fast() if we have enough input and output */ + if (have >= 6 && left >= 258) { + RESTORE(); + if (state->whave < state->wsize) + state->whave = state->wsize - left; + inflate_fast(strm, state->wsize); + LOAD(); + break; + } + + /* get a literal, length, or end-of-block code */ + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.op && (here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->lencode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + } + DROPBITS(here.bits); + state->length = (unsigned)here.val; + + /* process literal */ + if (here.op == 0) { + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + ROOM(); + *put++ = (unsigned char)(state->length); + left--; + state->mode = LEN; + break; + } + + /* process end of block */ + if (here.op & 32) { + Tracevv((stderr, "inflate: end of block\n")); + state->mode = TYPE; + break; + } + + /* invalid code */ + if (here.op & 64) { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + + /* length code -- get extra bits, if any */ + state->extra = (unsigned)(here.op) & 15; + if (state->extra != 0) { + NEEDBITS(state->extra); + state->length += BITS(state->extra); + DROPBITS(state->extra); + } + Tracevv((stderr, "inflate: length %u\n", state->length)); + + /* get distance code */ + for (;;) { + here = state->distcode[BITS(state->distbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if ((here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->distcode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + } + DROPBITS(here.bits); + if (here.op & 64) { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + state->offset = (unsigned)here.val; + + /* get distance extra bits, if any */ + state->extra = (unsigned)(here.op) & 15; + if (state->extra != 0) { + NEEDBITS(state->extra); + state->offset += BITS(state->extra); + DROPBITS(state->extra); + } + if (state->offset > state->wsize - (state->whave < state->wsize ? + left : 0)) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } + Tracevv((stderr, "inflate: distance %u\n", state->offset)); + + /* copy match from window to output */ + do { + ROOM(); + copy = state->wsize - state->offset; + if (copy < left) { + from = put + copy; + copy = left - copy; + } + else { + from = put - state->offset; + copy = left; + } + if (copy > state->length) copy = state->length; + state->length -= copy; + left -= copy; + do { + *put++ = *from++; + } while (--copy); + } while (state->length != 0); + break; + + case DONE: + /* inflate stream terminated properly -- write leftover output */ + ret = Z_STREAM_END; + if (left < state->wsize) { + if (out(out_desc, state->window, state->wsize - left)) + ret = Z_BUF_ERROR; + } + goto inf_leave; + + case BAD: + ret = Z_DATA_ERROR; + goto inf_leave; + + default: /* can't happen, but makes compilers happy */ + ret = Z_STREAM_ERROR; + goto inf_leave; + } + + /* Return unused input */ +inf_leave: + strm->next_in = next; + strm->avail_in = have; + return ret; +} + +int ZEXPORT inflateBackEnd(z_streamp strm) +{ + if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL) + return Z_STREAM_ERROR; + ZFREE(strm, strm->state); + strm->state = Z_NULL; + Tracev((stderr, "inflate: end\n")); + return Z_OK; +} diff --git a/deps/zlib/inffast.c b/deps/zlib/inffast.c new file mode 100644 index 0000000..a88859f --- /dev/null +++ b/deps/zlib/inffast.c @@ -0,0 +1,338 @@ +/* inffast.c -- fast decoding + * Copyright (C) 1995-2008, 2010, 2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +#ifndef ASMINF + +/* Allow machine dependent optimization for post-increment or pre-increment. + Based on testing to date, + Pre-increment preferred for: + - PowerPC G3 (Adler) + - MIPS R5000 (Randers-Pehrson) + Post-increment preferred for: + - none + No measurable difference: + - Pentium III (Anderson) + - M68060 (Nikl) + */ +#ifdef POSTINC +# define OFF 0 +# define PUP(a) *(a)++ +#else +# define OFF 1 +# define PUP(a) *++(a) +#endif + +/* + Decode literal, length, and distance codes and write out the resulting + literal and match bytes until either not enough input or output is + available, an end-of-block is encountered, or a data error is encountered. + When large enough input and output buffers are supplied to inflate(), for + example, a 16K input buffer and a 64K output buffer, more than 95% of the + inflate execution time is spent in this routine. + + Entry assumptions: + + state->mode == LEN + strm->avail_in >= 6 + strm->avail_out >= 258 + start >= strm->avail_out + state->bits < 8 + + On return, state->mode is one of: + + LEN -- ran out of enough output space or enough available input + TYPE -- reached end of block code, inflate() to interpret next block + BAD -- error in block data + +Notes: + +- The maximum input bits used by a length/distance pair is 15 bits for the +length code, 5 bits for the length extra, 15 bits for the distance code, +and 13 bits for the distance extra. This totals 48 bits, or six bytes. +Therefore if strm->avail_in >= 6, then there is enough input to avoid +checking for available input while decoding. + +- The maximum bytes that a single length/distance pair can output is 258 +bytes, which is the maximum length that can be coded. inflate_fast() +requires strm->avail_out >= 258 for each loop to avoid checking for +output space. +*/ +void ZLIB_INTERNAL inflate_fast(z_streamp strm, unsigned start) +{ + struct inflate_state FAR *state; + unsigned char FAR *in; /* local strm->next_in */ + unsigned char FAR *last; /* have enough input while in < last */ + unsigned char FAR *out; /* local strm->next_out */ + unsigned char FAR *beg; /* inflate()'s initial strm->next_out */ + unsigned char FAR *end; /* while out < end, enough space available */ +#ifdef INFLATE_STRICT + unsigned dmax; /* maximum distance from zlib header */ +#endif + unsigned wsize; /* window size or zero if not using window */ + unsigned whave; /* valid bytes in the window */ + unsigned wnext; /* window write index */ + unsigned char FAR *window; /* allocated sliding window, if wsize != 0 */ + unsigned long hold; /* local strm->hold */ + unsigned bits; /* local strm->bits */ + code const FAR *lcode; /* local strm->lencode */ + code const FAR *dcode; /* local strm->distcode */ + unsigned lmask; /* mask for first level of length codes */ + unsigned dmask; /* mask for first level of distance codes */ + code here; /* retrieved table entry */ + unsigned op; /* code bits, operation, extra bits, or */ + /* window position, window bytes to copy */ + unsigned len; /* match length, unused bytes */ + unsigned dist; /* match distance */ + unsigned char FAR *from; /* where to copy match from */ + + /* copy state to local variables */ + state = (struct inflate_state FAR *)strm->state; + in = strm->next_in - OFF; + last = in + (strm->avail_in - 5); + out = strm->next_out - OFF; + beg = out - (start - strm->avail_out); + end = out + (strm->avail_out - 257); +#ifdef INFLATE_STRICT + dmax = state->dmax; +#endif + wsize = state->wsize; + whave = state->whave; + wnext = state->wnext; + window = state->window; + hold = state->hold; + bits = state->bits; + lcode = state->lencode; + dcode = state->distcode; + lmask = (1U << state->lenbits) - 1; + dmask = (1U << state->distbits) - 1; + + /* decode literals and length/distances until end-of-block or not enough + input data or output space */ + do { + if (bits < 15) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + here = lcode[hold & lmask]; +dolen: + op = (unsigned)(here.bits); + hold >>= op; + bits -= op; + op = (unsigned)(here.op); + if (op == 0) { /* literal */ + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + PUP(out) = (unsigned char)(here.val); + } + else if (op & 16) { /* length base */ + len = (unsigned)(here.val); + op &= 15; /* number of extra bits */ + if (op) { + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + len += (unsigned)hold & ((1U << op) - 1); + hold >>= op; + bits -= op; + } + Tracevv((stderr, "inflate: length %u\n", len)); + if (bits < 15) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + here = dcode[hold & dmask]; +dodist: + op = (unsigned)(here.bits); + hold >>= op; + bits -= op; + op = (unsigned)(here.op); + if (op & 16) { /* distance base */ + dist = (unsigned)(here.val); + op &= 15; /* number of extra bits */ + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + if (bits < op) { + hold += (unsigned long)(PUP(in)) << bits; + bits += 8; + } + } + dist += (unsigned)hold & ((1U << op) - 1); +#ifdef INFLATE_STRICT + if (dist > dmax) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#endif + hold >>= op; + bits -= op; + Tracevv((stderr, "inflate: distance %u\n", dist)); + op = (unsigned)(out - beg); /* max distance in output */ + if (dist > op) { /* see if copy from window */ + op = dist - op; /* distance back in window */ + if (op > whave) { + if (state->sane) { + strm->msg = + (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + if (len <= op - whave) { + do { + PUP(out) = 0; + } while (--len); + continue; + } + len -= op - whave; + do { + PUP(out) = 0; + } while (--op > whave); + if (op == 0) { + from = out - dist; + do { + PUP(out) = PUP(from); + } while (--len); + continue; + } +#endif + } + from = window - OFF; + if (wnext == 0) { /* very common case */ + from += wsize - op; + if (op < len) { /* some from window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + else if (wnext < op) { /* wrap around window */ + from += wsize + wnext - op; + op -= wnext; + if (op < len) { /* some from end of window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = window - OFF; + if (wnext < len) { /* some from start of window */ + op = wnext; + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + } + else { /* contiguous in window */ + from += wnext - op; + if (op < len) { /* some from window */ + len -= op; + do { + PUP(out) = PUP(from); + } while (--op); + from = out - dist; /* rest from output */ + } + } + while (len > 2) { + PUP(out) = PUP(from); + PUP(out) = PUP(from); + PUP(out) = PUP(from); + len -= 3; + } + if (len) { + PUP(out) = PUP(from); + if (len > 1) + PUP(out) = PUP(from); + } + } + else { + from = out - dist; /* copy direct from output */ + do { /* minimum length is three */ + PUP(out) = PUP(from); + PUP(out) = PUP(from); + PUP(out) = PUP(from); + len -= 3; + } while (len > 2); + if (len) { + PUP(out) = PUP(from); + if (len > 1) + PUP(out) = PUP(from); + } + } + } + else if ((op & 64) == 0) { /* 2nd level distance code */ + here = dcode[here.val + (hold & ((1U << op) - 1))]; + goto dodist; + } + else { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + } + else if ((op & 64) == 0) { /* 2nd level length code */ + here = lcode[here.val + (hold & ((1U << op) - 1))]; + goto dolen; + } + else if (op & 32) { /* end-of-block */ + Tracevv((stderr, "inflate: end of block\n")); + state->mode = TYPE; + break; + } + else { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + } while (in < last && out < end); + + /* return unused bytes (on entry, bits < 8, so in won't go too far back) */ + len = bits >> 3; + in -= len; + bits -= len << 3; + hold &= (1U << bits) - 1; + + /* update state and return */ + strm->next_in = in + OFF; + strm->next_out = out + OFF; + strm->avail_in = (unsigned)(in < last ? 5 + (last - in) : 5 - (in - last)); + strm->avail_out = (unsigned)(out < end ? + 257 + (end - out) : 257 - (out - end)); + state->hold = hold; + state->bits = bits; + return; +} + +/* + inflate_fast() speedups that turned out slower (on a PowerPC G3 750CXe): + - Using bit fields for code structure + - Different op definition to avoid & for extra bits (do & for table bits) + - Three separate decoding do-loops for direct, window, and wnext == 0 + - Special case for distance > 1 copies to do overlapped load and store copy + - Explicit branch predictions (based on measured branch probabilities) + - Deferring match copy and interspersed it with decoding subsequent codes + - Swapping literal/length else + - Swapping window/direct else + - Larger unrolled copy loops (three is about right) + - Moving len -= 3 statement into middle of loop + */ + +#endif /* !ASMINF */ diff --git a/deps/zlib/inffast.h b/deps/zlib/inffast.h new file mode 100644 index 0000000..169a85a --- /dev/null +++ b/deps/zlib/inffast.h @@ -0,0 +1,15 @@ +/* inffast.h -- header to use inffast.c + * Copyright (C) 1995-2003, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ +#ifndef _INFFAST_H +#define _INFFAST_H + +void ZLIB_INTERNAL inflate_fast OF((z_streamp strm, unsigned start)); + +#endif diff --git a/deps/zlib/inffixed.h b/deps/zlib/inffixed.h new file mode 100644 index 0000000..238a55f --- /dev/null +++ b/deps/zlib/inffixed.h @@ -0,0 +1,99 @@ +#ifndef _INFFIXED_H +#define _INFFIXED_H + +/* inffixed.h -- table for decoding fixed codes + * Generated automatically by makefixed(). + */ + + /* WARNING: this file should *not* be used by applications. + It is part of the implementation of this library and is + subject to change. Applications should only use zlib.h. + */ + + static const code lenfix[512] = { + {96,7,0},{0,8,80},{0,8,16},{20,8,115},{18,7,31},{0,8,112},{0,8,48}, + {0,9,192},{16,7,10},{0,8,96},{0,8,32},{0,9,160},{0,8,0},{0,8,128}, + {0,8,64},{0,9,224},{16,7,6},{0,8,88},{0,8,24},{0,9,144},{19,7,59}, + {0,8,120},{0,8,56},{0,9,208},{17,7,17},{0,8,104},{0,8,40},{0,9,176}, + {0,8,8},{0,8,136},{0,8,72},{0,9,240},{16,7,4},{0,8,84},{0,8,20}, + {21,8,227},{19,7,43},{0,8,116},{0,8,52},{0,9,200},{17,7,13},{0,8,100}, + {0,8,36},{0,9,168},{0,8,4},{0,8,132},{0,8,68},{0,9,232},{16,7,8}, + {0,8,92},{0,8,28},{0,9,152},{20,7,83},{0,8,124},{0,8,60},{0,9,216}, + {18,7,23},{0,8,108},{0,8,44},{0,9,184},{0,8,12},{0,8,140},{0,8,76}, + {0,9,248},{16,7,3},{0,8,82},{0,8,18},{21,8,163},{19,7,35},{0,8,114}, + {0,8,50},{0,9,196},{17,7,11},{0,8,98},{0,8,34},{0,9,164},{0,8,2}, + {0,8,130},{0,8,66},{0,9,228},{16,7,7},{0,8,90},{0,8,26},{0,9,148}, + {20,7,67},{0,8,122},{0,8,58},{0,9,212},{18,7,19},{0,8,106},{0,8,42}, + {0,9,180},{0,8,10},{0,8,138},{0,8,74},{0,9,244},{16,7,5},{0,8,86}, + {0,8,22},{64,8,0},{19,7,51},{0,8,118},{0,8,54},{0,9,204},{17,7,15}, + {0,8,102},{0,8,38},{0,9,172},{0,8,6},{0,8,134},{0,8,70},{0,9,236}, + {16,7,9},{0,8,94},{0,8,30},{0,9,156},{20,7,99},{0,8,126},{0,8,62}, + {0,9,220},{18,7,27},{0,8,110},{0,8,46},{0,9,188},{0,8,14},{0,8,142}, + {0,8,78},{0,9,252},{96,7,0},{0,8,81},{0,8,17},{21,8,131},{18,7,31}, + {0,8,113},{0,8,49},{0,9,194},{16,7,10},{0,8,97},{0,8,33},{0,9,162}, + {0,8,1},{0,8,129},{0,8,65},{0,9,226},{16,7,6},{0,8,89},{0,8,25}, + {0,9,146},{19,7,59},{0,8,121},{0,8,57},{0,9,210},{17,7,17},{0,8,105}, + {0,8,41},{0,9,178},{0,8,9},{0,8,137},{0,8,73},{0,9,242},{16,7,4}, + {0,8,85},{0,8,21},{16,8,258},{19,7,43},{0,8,117},{0,8,53},{0,9,202}, + {17,7,13},{0,8,101},{0,8,37},{0,9,170},{0,8,5},{0,8,133},{0,8,69}, + {0,9,234},{16,7,8},{0,8,93},{0,8,29},{0,9,154},{20,7,83},{0,8,125}, + {0,8,61},{0,9,218},{18,7,23},{0,8,109},{0,8,45},{0,9,186},{0,8,13}, + {0,8,141},{0,8,77},{0,9,250},{16,7,3},{0,8,83},{0,8,19},{21,8,195}, + {19,7,35},{0,8,115},{0,8,51},{0,9,198},{17,7,11},{0,8,99},{0,8,35}, + {0,9,166},{0,8,3},{0,8,131},{0,8,67},{0,9,230},{16,7,7},{0,8,91}, + {0,8,27},{0,9,150},{20,7,67},{0,8,123},{0,8,59},{0,9,214},{18,7,19}, + {0,8,107},{0,8,43},{0,9,182},{0,8,11},{0,8,139},{0,8,75},{0,9,246}, + {16,7,5},{0,8,87},{0,8,23},{64,8,0},{19,7,51},{0,8,119},{0,8,55}, + {0,9,206},{17,7,15},{0,8,103},{0,8,39},{0,9,174},{0,8,7},{0,8,135}, + {0,8,71},{0,9,238},{16,7,9},{0,8,95},{0,8,31},{0,9,158},{20,7,99}, + {0,8,127},{0,8,63},{0,9,222},{18,7,27},{0,8,111},{0,8,47},{0,9,190}, + {0,8,15},{0,8,143},{0,8,79},{0,9,254},{96,7,0},{0,8,80},{0,8,16}, + {20,8,115},{18,7,31},{0,8,112},{0,8,48},{0,9,193},{16,7,10},{0,8,96}, + {0,8,32},{0,9,161},{0,8,0},{0,8,128},{0,8,64},{0,9,225},{16,7,6}, + {0,8,88},{0,8,24},{0,9,145},{19,7,59},{0,8,120},{0,8,56},{0,9,209}, + {17,7,17},{0,8,104},{0,8,40},{0,9,177},{0,8,8},{0,8,136},{0,8,72}, + {0,9,241},{16,7,4},{0,8,84},{0,8,20},{21,8,227},{19,7,43},{0,8,116}, + {0,8,52},{0,9,201},{17,7,13},{0,8,100},{0,8,36},{0,9,169},{0,8,4}, + {0,8,132},{0,8,68},{0,9,233},{16,7,8},{0,8,92},{0,8,28},{0,9,153}, + {20,7,83},{0,8,124},{0,8,60},{0,9,217},{18,7,23},{0,8,108},{0,8,44}, + {0,9,185},{0,8,12},{0,8,140},{0,8,76},{0,9,249},{16,7,3},{0,8,82}, + {0,8,18},{21,8,163},{19,7,35},{0,8,114},{0,8,50},{0,9,197},{17,7,11}, + {0,8,98},{0,8,34},{0,9,165},{0,8,2},{0,8,130},{0,8,66},{0,9,229}, + {16,7,7},{0,8,90},{0,8,26},{0,9,149},{20,7,67},{0,8,122},{0,8,58}, + {0,9,213},{18,7,19},{0,8,106},{0,8,42},{0,9,181},{0,8,10},{0,8,138}, + {0,8,74},{0,9,245},{16,7,5},{0,8,86},{0,8,22},{64,8,0},{19,7,51}, + {0,8,118},{0,8,54},{0,9,205},{17,7,15},{0,8,102},{0,8,38},{0,9,173}, + {0,8,6},{0,8,134},{0,8,70},{0,9,237},{16,7,9},{0,8,94},{0,8,30}, + {0,9,157},{20,7,99},{0,8,126},{0,8,62},{0,9,221},{18,7,27},{0,8,110}, + {0,8,46},{0,9,189},{0,8,14},{0,8,142},{0,8,78},{0,9,253},{96,7,0}, + {0,8,81},{0,8,17},{21,8,131},{18,7,31},{0,8,113},{0,8,49},{0,9,195}, + {16,7,10},{0,8,97},{0,8,33},{0,9,163},{0,8,1},{0,8,129},{0,8,65}, + {0,9,227},{16,7,6},{0,8,89},{0,8,25},{0,9,147},{19,7,59},{0,8,121}, + {0,8,57},{0,9,211},{17,7,17},{0,8,105},{0,8,41},{0,9,179},{0,8,9}, + {0,8,137},{0,8,73},{0,9,243},{16,7,4},{0,8,85},{0,8,21},{16,8,258}, + {19,7,43},{0,8,117},{0,8,53},{0,9,203},{17,7,13},{0,8,101},{0,8,37}, + {0,9,171},{0,8,5},{0,8,133},{0,8,69},{0,9,235},{16,7,8},{0,8,93}, + {0,8,29},{0,9,155},{20,7,83},{0,8,125},{0,8,61},{0,9,219},{18,7,23}, + {0,8,109},{0,8,45},{0,9,187},{0,8,13},{0,8,141},{0,8,77},{0,9,251}, + {16,7,3},{0,8,83},{0,8,19},{21,8,195},{19,7,35},{0,8,115},{0,8,51}, + {0,9,199},{17,7,11},{0,8,99},{0,8,35},{0,9,167},{0,8,3},{0,8,131}, + {0,8,67},{0,9,231},{16,7,7},{0,8,91},{0,8,27},{0,9,151},{20,7,67}, + {0,8,123},{0,8,59},{0,9,215},{18,7,19},{0,8,107},{0,8,43},{0,9,183}, + {0,8,11},{0,8,139},{0,8,75},{0,9,247},{16,7,5},{0,8,87},{0,8,23}, + {64,8,0},{19,7,51},{0,8,119},{0,8,55},{0,9,207},{17,7,15},{0,8,103}, + {0,8,39},{0,9,175},{0,8,7},{0,8,135},{0,8,71},{0,9,239},{16,7,9}, + {0,8,95},{0,8,31},{0,9,159},{20,7,99},{0,8,127},{0,8,63},{0,9,223}, + {18,7,27},{0,8,111},{0,8,47},{0,9,191},{0,8,15},{0,8,143},{0,8,79}, + {0,9,255} + }; + + static const code distfix[32] = { + {16,5,1},{23,5,257},{19,5,17},{27,5,4097},{17,5,5},{25,5,1025}, + {21,5,65},{29,5,16385},{16,5,3},{24,5,513},{20,5,33},{28,5,8193}, + {18,5,9},{26,5,2049},{22,5,129},{64,5,0},{16,5,2},{23,5,385}, + {19,5,25},{27,5,6145},{17,5,7},{25,5,1537},{21,5,97},{29,5,24577}, + {16,5,4},{24,5,769},{20,5,49},{28,5,12289},{18,5,13},{26,5,3073}, + {22,5,193},{64,5,0} + }; + +#endif diff --git a/deps/zlib/inflate.c b/deps/zlib/inflate.c new file mode 100644 index 0000000..0b4f0b7 --- /dev/null +++ b/deps/zlib/inflate.c @@ -0,0 +1,1489 @@ +/* inflate.c -- zlib decompression + * Copyright (C) 1995-2012 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * Change history: + * + * 1.2.beta0 24 Nov 2002 + * - First version -- complete rewrite of inflate to simplify code, avoid + * creation of window when not needed, minimize use of window when it is + * needed, make inffast.c even faster, implement gzip decoding, and to + * improve code readability and style over the previous zlib inflate code + * + * 1.2.beta1 25 Nov 2002 + * - Use pointers for available input and output checking in inffast.c + * - Remove input and output counters in inffast.c + * - Change inffast.c entry and loop from avail_in >= 7 to >= 6 + * - Remove unnecessary second byte pull from length extra in inffast.c + * - Unroll direct copy to three copies per loop in inffast.c + * + * 1.2.beta2 4 Dec 2002 + * - Change external routine names to reduce potential conflicts + * - Correct filename to inffixed.h for fixed tables in inflate.c + * - Make hbuf[] unsigned char to match parameter type in inflate.c + * - Change strm->next_out[-state->offset] to *(strm->next_out - state->offset) + * to avoid negation problem on Alphas (64 bit) in inflate.c + * + * 1.2.beta3 22 Dec 2002 + * - Add comments on state->bits assertion in inffast.c + * - Add comments on op field in inftrees.h + * - Fix bug in reuse of allocated window after inflateReset() + * - Remove bit fields--back to byte structure for speed + * - Remove distance extra == 0 check in inflate_fast()--only helps for lengths + * - Change post-increments to pre-increments in inflate_fast(), PPC biased? + * - Add compile time option, POSTINC, to use post-increments instead (Intel?) + * - Make MATCH copy in inflate() much faster for when inflate_fast() not used + * - Use local copies of stream next and avail values, as well as local bit + * buffer and bit count in inflate()--for speed when inflate_fast() not used + * + * 1.2.beta4 1 Jan 2003 + * - Split ptr - 257 statements in inflate_table() to avoid compiler warnings + * - Move a comment on output buffer sizes from inffast.c to inflate.c + * - Add comments in inffast.c to introduce the inflate_fast() routine + * - Rearrange window copies in inflate_fast() for speed and simplification + * - Unroll last copy for window match in inflate_fast() + * - Use local copies of window variables in inflate_fast() for speed + * - Pull out common wnext == 0 case for speed in inflate_fast() + * - Make op and len in inflate_fast() unsigned for consistency + * - Add FAR to lcode and dcode declarations in inflate_fast() + * - Simplified bad distance check in inflate_fast() + * - Added inflateBackInit(), inflateBack(), and inflateBackEnd() in new + * source file infback.c to provide a call-back interface to inflate for + * programs like gzip and unzip -- uses window as output buffer to avoid + * window copying + * + * 1.2.beta5 1 Jan 2003 + * - Improved inflateBack() interface to allow the caller to provide initial + * input in strm. + * - Fixed stored blocks bug in inflateBack() + * + * 1.2.beta6 4 Jan 2003 + * - Added comments in inffast.c on effectiveness of POSTINC + * - Typecasting all around to reduce compiler warnings + * - Changed loops from while (1) or do {} while (1) to for (;;), again to + * make compilers happy + * - Changed type of window in inflateBackInit() to unsigned char * + * + * 1.2.beta7 27 Jan 2003 + * - Changed many types to unsigned or unsigned short to avoid warnings + * - Added inflateCopy() function + * + * 1.2.0 9 Mar 2003 + * - Changed inflateBack() interface to provide separate opaque descriptors + * for the in() and out() functions + * - Changed inflateBack() argument and in_func typedef to swap the length + * and buffer address return values for the input function +* - Check next_in and next_out for Z_NULL on entry to inflate() + * + * The history for versions after 1.2.0 are in ChangeLog in zlib distribution. + */ + +#include "zutil.h" +#include "inftrees.h" +#include "inflate.h" +#include "inffast.h" + +#ifdef MAKEFIXED +# ifndef BUILDFIXED +# define BUILDFIXED +# endif +#endif + +#ifndef Z_TREES +#define Z_TREES 6 +#endif + + /* function prototypes */ +int ZEXPORT inflateReset2(z_streamp strm, int windowBits); + local void fixedtables OF((struct inflate_state FAR *state)); + local int updatewindow OF((z_streamp strm, const unsigned char FAR *end, + unsigned copy)); +#ifdef BUILDFIXED +void makefixed OF((void)); +#endif +local unsigned syncsearch OF((unsigned FAR *have, const unsigned char FAR *buf, + unsigned len)); + +long ZEXPORT inflateMark(z_streamp strm); + +int ZEXPORT inflateResetKeep(z_streamp strm); + +int ZEXPORT inflateUndermine(z_streamp strm, int subvert); + +int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength); + +int ZEXPORT inflateResetKeep(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + strm->total_in = strm->total_out = state->total = 0; + strm->msg = Z_NULL; + if (state->wrap) /* to support ill-conceived Java test suite */ + strm->adler = state->wrap & 1; + state->mode = HEAD; + state->last = 0; + state->havedict = 0; + state->dmax = 32768U; + state->head = Z_NULL; + state->hold = 0; + state->bits = 0; + state->lencode = state->distcode = state->next = state->codes; + state->sane = 1; + state->back = -1; + Tracev((stderr, "inflate: reset\n")); + return Z_OK; +} + +int ZEXPORT inflateReset(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + state->wsize = 0; + state->whave = 0; + state->wnext = 0; + return inflateResetKeep(strm); +} + +int ZEXPORT inflateReset2(z_streamp strm, int windowBits) +{ + int wrap; + struct inflate_state FAR *state = NULL; + + /* get the state */ + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* extract wrap request from windowBits parameter */ + if (windowBits < 0) { + wrap = 0; + windowBits = -windowBits; + } + else { + wrap = (windowBits >> 4) + 1; +#ifdef GUNZIP + if (windowBits < 48) + windowBits &= 15; +#endif + } + + /* set number of window bits, free window if different */ + if (windowBits && (windowBits < 8 || windowBits > 15)) + return Z_STREAM_ERROR; + if (state->window != Z_NULL && state->wbits != (unsigned)windowBits) { + ZFREE(strm, state->window); + state->window = Z_NULL; + } + + /* update state and reset the rest of it */ + state->wrap = wrap; + state->wbits = (unsigned)windowBits; + return inflateReset(strm); +} + +int ZEXPORT inflateInit2_(z_streamp strm, int windowBits, const char *version, int stream_size) +{ + int ret; + struct inflate_state FAR *state; + + if (version == Z_NULL || version[0] != ZLIB_VERSION[0] || + stream_size != (int)(sizeof(z_stream))) + return Z_VERSION_ERROR; + if (strm == Z_NULL) return Z_STREAM_ERROR; + strm->msg = Z_NULL; /* in case we return an error */ + if (strm->zalloc == (alloc_func)0) { +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zalloc = zcalloc; + strm->opaque = (voidpf)0; +#endif + } + if (strm->zfree == Z_NULL) +#ifdef Z_SOLO + return Z_STREAM_ERROR; +#else + strm->zfree = zcfree; +#endif + state = (struct inflate_state FAR *) + ZALLOC(strm, 1, sizeof(struct inflate_state)); + if (state == Z_NULL) return Z_MEM_ERROR; + Tracev((stderr, "inflate: allocated\n")); + strm->state = (struct internal_state FAR *)state; + state->window = Z_NULL; + ret = inflateReset2(strm, windowBits); + if (ret != Z_OK) { + ZFREE(strm, state); + strm->state = Z_NULL; + } + return ret; +} + +int ZEXPORT inflateInit_(z_streamp strm, const char *version, int stream_size) +{ + return inflateInit2_(strm, DEF_WBITS, version, stream_size); +} + +int ZEXPORT inflatePrime(z_streamp strm, int bits, int value) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (bits < 0) { + state->hold = 0; + state->bits = 0; + return Z_OK; + } + if (bits > 16 || state->bits + bits > 32) return Z_STREAM_ERROR; + value &= (1L << bits) - 1; + state->hold += value << state->bits; + state->bits += bits; + return Z_OK; +} + +/* + Return state with length and distance decoding tables and index sizes set to + fixed code decoding. Normally this returns fixed tables from inffixed.h. + If BUILDFIXED is defined, then instead this routine builds the tables the + first time it's called, and returns those tables the first time and + thereafter. This reduces the size of the code by about 2K bytes, in + exchange for a little execution time. However, BUILDFIXED should not be + used for threaded applications, since the rewriting of the tables and virgin + may not be thread-safe. + */ +local void fixedtables(struct inflate_state FAR *state) +{ +#ifdef BUILDFIXED + static int virgin = 1; + static code *lenfix, *distfix; + static code fixed[544]; + + /* build fixed huffman tables if first call (may not be thread safe) */ + if (virgin) { + unsigned sym, bits; + static code *next; + + /* literal/length table */ + sym = 0; + while (sym < 144) state->lens[sym++] = 8; + while (sym < 256) state->lens[sym++] = 9; + while (sym < 280) state->lens[sym++] = 7; + while (sym < 288) state->lens[sym++] = 8; + next = fixed; + lenfix = next; + bits = 9; + inflate_table(LENS, state->lens, 288, &(next), &(bits), state->work); + + /* distance table */ + sym = 0; + while (sym < 32) state->lens[sym++] = 5; + distfix = next; + bits = 5; + inflate_table(DISTS, state->lens, 32, &(next), &(bits), state->work); + + /* do this just once */ + virgin = 0; + } +#else /* !BUILDFIXED */ +# include "inffixed.h" +#endif /* BUILDFIXED */ + state->lencode = lenfix; + state->lenbits = 9; + state->distcode = distfix; + state->distbits = 5; +} + +#ifdef MAKEFIXED +#include <stdio.h> + +/* + Write out the inffixed.h that is #include'd above. Defining MAKEFIXED also + defines BUILDFIXED, so the tables are built on the fly. makefixed() writes + those tables to stdout, which would be piped to inffixed.h. A small program + can simply call makefixed to do this: + + void makefixed(void); + + int main(void) + { + makefixed(); + return 0; + } + + Then that can be linked with zlib built with MAKEFIXED defined and run: + + a.out > inffixed.h + */ +void makefixed(void) +{ + unsigned low, size; + struct inflate_state state; + + fixedtables(&state); + puts(" /* inffixed.h -- table for decoding fixed codes"); + puts(" * Generated automatically by makefixed()."); + puts(" */"); + puts(""); + puts(" /* WARNING: this file should *not* be used by applications."); + puts(" It is part of the implementation of this library and is"); + puts(" subject to change. Applications should only use zlib.h."); + puts(" */"); + puts(""); + size = 1U << 9; + printf(" static const code lenfix[%u] = {", size); + low = 0; + for (;;) { + if ((low % 7) == 0) printf("\n "); + printf("{%u,%u,%d}", (low & 127) == 99 ? 64 : state.lencode[low].op, + state.lencode[low].bits, state.lencode[low].val); + if (++low == size) break; + putchar(','); + } + puts("\n };"); + size = 1U << 5; + printf("\n static const code distfix[%u] = {", size); + low = 0; + for (;;) { + if ((low % 6) == 0) printf("\n "); + printf("{%u,%u,%d}", state.distcode[low].op, state.distcode[low].bits, + state.distcode[low].val); + if (++low == size) break; + putchar(','); + } + puts("\n };"); +} +#endif /* MAKEFIXED */ + +/* + Update the window with the last wsize (normally 32K) bytes written before + returning. If window does not exist yet, create it. This is only called + when a window is already in use, or when output has been written during this + inflate call, but the end of the deflate stream has not been reached yet. + It is also called to create a window for dictionary data when a dictionary + is loaded. + + Providing output buffers larger than 32K to inflate() should provide a speed + advantage, since only the last 32K of output is copied to the sliding window + upon return from inflate(), and since all distances after the first 32K of + output will fall in the output data, making match copies simpler and faster. + The advantage may be dependent on the size of the processor's data caches. + */ +local int updatewindow(z_streamp strm, const Bytef *end, unsigned copy) +{ + struct inflate_state FAR *state; + unsigned dist; + + state = (struct inflate_state FAR *)strm->state; + + /* if it hasn't been done already, allocate space for the window */ + if (state->window == Z_NULL) { + state->window = (unsigned char FAR *) + ZALLOC(strm, 1U << state->wbits, + sizeof(unsigned char)); + if (state->window == Z_NULL) return 1; + } + + /* if window not in use yet, initialize */ + if (state->wsize == 0) { + state->wsize = 1U << state->wbits; + state->wnext = 0; + state->whave = 0; + } + + /* copy state->wsize or less output bytes into the circular window */ + if (copy >= state->wsize) { + zmemcpy(state->window, end - state->wsize, state->wsize); + state->wnext = 0; + state->whave = state->wsize; + } + else { + dist = state->wsize - state->wnext; + if (dist > copy) dist = copy; + zmemcpy(state->window + state->wnext, end - copy, dist); + copy -= dist; + if (copy) { + zmemcpy(state->window, end - copy, copy); + state->wnext = copy; + state->whave = state->wsize; + } + else { + state->wnext += dist; + if (state->wnext == state->wsize) state->wnext = 0; + if (state->whave < state->wsize) state->whave += dist; + } + } + return 0; +} + +/* Macros for inflate(): */ + +/* check function to use adler32() for zlib or crc32() for gzip */ +#ifdef GUNZIP +# define UPDATE(check, buf, len) \ + (state->flags ? crc32(check, buf, len) : adler32(check, buf, len)) +#else +# define UPDATE(check, buf, len) adler32(check, buf, len) +#endif + +/* check macros for header crc */ +#ifdef GUNZIP +# define CRC2(check, word) \ + do { \ + hbuf[0] = (unsigned char)(word); \ + hbuf[1] = (unsigned char)((word) >> 8); \ + check = crc32(check, hbuf, 2); \ + } while (0) + +# define CRC4(check, word) \ + do { \ + hbuf[0] = (unsigned char)(word); \ + hbuf[1] = (unsigned char)((word) >> 8); \ + hbuf[2] = (unsigned char)((word) >> 16); \ + hbuf[3] = (unsigned char)((word) >> 24); \ + check = crc32(check, hbuf, 4); \ + } while (0) +#endif + +/* Load registers with state in inflate() for speed */ +#define LOAD() \ + do { \ + put = strm->next_out; \ + left = strm->avail_out; \ + next = strm->next_in; \ + have = strm->avail_in; \ + hold = state->hold; \ + bits = state->bits; \ + } while (0) + +/* Restore state from registers in inflate() */ +#define RESTORE() \ + do { \ + strm->next_out = put; \ + strm->avail_out = left; \ + strm->next_in = next; \ + strm->avail_in = have; \ + state->hold = hold; \ + state->bits = bits; \ + } while (0) + +/* Clear the input bit accumulator */ +#define INITBITS() \ + do { \ + hold = 0; \ + bits = 0; \ + } while (0) + +/* Get a byte of input into the bit accumulator, or return from inflate() + if there is no input available. */ +#define PULLBYTE() \ + do { \ + if (have == 0) goto inf_leave; \ + have--; \ + hold += (unsigned long)(*next++) << bits; \ + bits += 8; \ + } while (0) + +/* Assure that there are at least n bits in the bit accumulator. If there is + not enough available input to do that, then return from inflate(). */ +#define NEEDBITS(n) \ + do { \ + while (bits < (unsigned)(n)) \ + PULLBYTE(); \ + } while (0) + +/* Return the low n bits of the bit accumulator (n < 16) */ +#define BITS(n) \ + ((unsigned)hold & ((1U << (n)) - 1)) + +/* Remove n bits from the bit accumulator */ +#define DROPBITS(n) \ + do { \ + hold >>= (n); \ + bits -= (unsigned)(n); \ + } while (0) + +/* Remove zero to seven bits as needed to go to a byte boundary */ +#define BYTEBITS() \ + do { \ + hold >>= bits & 7; \ + bits -= bits & 7; \ + } while (0) + +/* + inflate() uses a state machine to process as much input data and generate as + much output data as possible before returning. The state machine is + structured roughly as follows: + + for (;;) switch (state) { + ... + case STATEn: + if (not enough input data or output space to make progress) + return; + ... make progress ... + state = STATEm; + break; + ... + } + + so when inflate() is called again, the same case is attempted again, and + if the appropriate resources are provided, the machine proceeds to the + next state. The NEEDBITS() macro is usually the way the state evaluates + whether it can proceed or should return. NEEDBITS() does the return if + the requested bits are not available. The typical use of the BITS macros +is: + +NEEDBITS(n); +... do something with BITS(n) ... +DROPBITS(n); + +where NEEDBITS(n) either returns from inflate() if there isn't enough +input left to load n bits into the accumulator, or it continues. BITS(n) +gives the low n bits in the accumulator. When done, DROPBITS(n) drops +the low n bits off the accumulator. INITBITS() clears the accumulator +and sets the number of available bits to zero. BYTEBITS() discards just +enough bits to put the accumulator on a byte boundary. After BYTEBITS() +and a NEEDBITS(8), then BITS(8) would return the next byte in the stream. + +NEEDBITS(n) uses PULLBYTE() to get an available byte of input, or to return +if there is no input available. The decoding of variable length codes uses +PULLBYTE() directly in order to pull just enough bytes to decode the next +code, and no more. + +Some states loop until they get enough input, making sure that enough +state information is maintained to continue the loop where it left off +if NEEDBITS() returns in the loop. For example, want, need, and keep +would all have to actually be part of the saved state in case NEEDBITS() +returns: + +case STATEw: +while (want < need) { +NEEDBITS(n); +keep[want++] = BITS(n); +DROPBITS(n); +} +state = STATEx; +case STATEx: + +As shown above, if the next state is also the next case, then the break +is omitted. + +A state may also return if there is not enough output space available to +complete that state. Those states are copying stored data, writing a +literal byte, and copying a matching string. + +When returning, a "goto inf_leave" is used to update the total counters, +update the check value, and determine whether any progress has been made +during that inflate() call in order to return the proper return code. +Progress is defined as a change in either strm->avail_in or strm->avail_out. +When there is a window, goto inf_leave will update the window with the last +output written. If a goto inf_leave occurs in the middle of decompression +and there is no window currently, goto inf_leave will create one and copy +output to the window for the next call of inflate(). + +In this implementation, the flush parameter of inflate() only affects the +return code (per zlib.h). inflate() always writes as much as possible to +strm->next_out, given the space available and the provided input--the effect +documented in zlib.h of Z_SYNC_FLUSH. Furthermore, inflate() always defers +the allocation of and copying into a sliding window until necessary, which +provides the effect documented in zlib.h for Z_FINISH when the entire input +stream available. So the only thing the flush parameter actually does is: +when flush is set to Z_FINISH, inflate() cannot return Z_OK. Instead it +will return Z_BUF_ERROR if it has not reached the end of the stream. +*/ + +int ZEXPORT inflate(z_streamp strm, int flush) +{ + struct inflate_state FAR *state; + unsigned char FAR *next; /* next input */ + unsigned char FAR *put; /* next output */ + unsigned have, left; /* available input and output */ + unsigned long hold; /* bit buffer */ + unsigned bits; /* bits in bit buffer */ + unsigned in, out; /* save starting available input and output */ + unsigned copy; /* number of stored or match bytes to copy */ + unsigned char FAR *from; /* where to copy match bytes from */ + code here; /* current decoding table entry */ + code last; /* parent table entry */ + unsigned len; /* length to copy for repeats, bits to drop */ + int ret; /* return code */ +#ifdef GUNZIP + unsigned char hbuf[4]; /* buffer for gzip header crc calculation */ +#endif + static const unsigned short order[19] = /* permutation of code lengths */ + {16, 17, 18, 0, 8, 7, 9, 6, 10, 5, 11, 4, 12, 3, 13, 2, 14, 1, 15}; + + if (strm == Z_NULL || strm->state == Z_NULL || strm->next_out == Z_NULL || + (strm->next_in == Z_NULL && strm->avail_in != 0)) + return Z_STREAM_ERROR; + + state = (struct inflate_state FAR *)strm->state; + if (state->mode == TYPE) state->mode = TYPEDO; /* skip check */ + LOAD(); + in = have; + out = left; + ret = Z_OK; + for (;;) + switch (state->mode) { + case HEAD: + if (state->wrap == 0) { + state->mode = TYPEDO; + break; + } + NEEDBITS(16); +#ifdef GUNZIP + if ((state->wrap & 2) && hold == 0x8b1f) { /* gzip header */ + state->check = crc32(0L, Z_NULL, 0); + CRC2(state->check, hold); + INITBITS(); + state->mode = FLAGS; + break; + } + state->flags = 0; /* expect zlib header */ + if (state->head != Z_NULL) + state->head->done = -1; + if (!(state->wrap & 1) || /* check if zlib header allowed */ +#else + if ( +#endif + ((BITS(8) << 8) + (hold >> 8)) % 31) { + strm->msg = (char *)"incorrect header check"; + state->mode = BAD; + break; + } + if (BITS(4) != Z_DEFLATED) { + strm->msg = (char *)"unknown compression method"; + state->mode = BAD; + break; + } + DROPBITS(4); + len = BITS(4) + 8; + if (state->wbits == 0) + state->wbits = len; + else if (len > state->wbits) { + strm->msg = (char *)"invalid window size"; + state->mode = BAD; + break; + } + state->dmax = 1U << len; + Tracev((stderr, "inflate: zlib header ok\n")); + strm->adler = state->check = adler32(0L, Z_NULL, 0); + state->mode = hold & 0x200 ? DICTID : TYPE; + INITBITS(); + break; +#ifdef GUNZIP + case FLAGS: + NEEDBITS(16); + state->flags = (int)(hold); + if ((state->flags & 0xff) != Z_DEFLATED) { + strm->msg = (char *)"unknown compression method"; + state->mode = BAD; + break; + } + if (state->flags & 0xe000) { + strm->msg = (char *)"unknown header flags set"; + state->mode = BAD; + break; + } + if (state->head != Z_NULL) + state->head->text = (int)((hold >> 8) & 1); + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + state->mode = TIME; + case TIME: + NEEDBITS(32); + if (state->head != Z_NULL) + state->head->time = hold; + if (state->flags & 0x0200) CRC4(state->check, hold); + INITBITS(); + state->mode = OS; + case OS: + NEEDBITS(16); + if (state->head != Z_NULL) { + state->head->xflags = (int)(hold & 0xff); + state->head->os = (int)(hold >> 8); + } + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + state->mode = EXLEN; + case EXLEN: + if (state->flags & 0x0400) { + NEEDBITS(16); + state->length = (unsigned)(hold); + if (state->head != Z_NULL) + state->head->extra_len = (unsigned)hold; + if (state->flags & 0x0200) CRC2(state->check, hold); + INITBITS(); + } + else if (state->head != Z_NULL) + state->head->extra = Z_NULL; + state->mode = EXTRA; + case EXTRA: + if (state->flags & 0x0400) { + copy = state->length; + if (copy > have) copy = have; + if (copy) { + if (state->head != Z_NULL && + state->head->extra != Z_NULL) { + len = state->head->extra_len - state->length; + zmemcpy(state->head->extra + len, next, + len + copy > state->head->extra_max ? + state->head->extra_max - len : copy); + } + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + state->length -= copy; + } + if (state->length) goto inf_leave; + } + state->length = 0; + state->mode = NAME; + case NAME: + if (state->flags & 0x0800) { + if (have == 0) goto inf_leave; + copy = 0; + do { + len = (unsigned)(next[copy++]); + if (state->head != Z_NULL && + state->head->name != Z_NULL && + state->length < state->head->name_max) + state->head->name[state->length++] = len; + } while (len && copy < have); + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + if (len) goto inf_leave; + } + else if (state->head != Z_NULL) + state->head->name = Z_NULL; + state->length = 0; + state->mode = COMMENT; + case COMMENT: + if (state->flags & 0x1000) { + if (have == 0) goto inf_leave; + copy = 0; + do { + len = (unsigned)(next[copy++]); + if (state->head != Z_NULL && + state->head->comment != Z_NULL && + state->length < state->head->comm_max) + state->head->comment[state->length++] = len; + } while (len && copy < have); + if (state->flags & 0x0200) + state->check = crc32(state->check, next, copy); + have -= copy; + next += copy; + if (len) goto inf_leave; + } + else if (state->head != Z_NULL) + state->head->comment = Z_NULL; + state->mode = HCRC; + case HCRC: + if (state->flags & 0x0200) { + NEEDBITS(16); + if (hold != (state->check & 0xffff)) { + strm->msg = (char *)"header crc mismatch"; + state->mode = BAD; + break; + } + INITBITS(); + } + if (state->head != Z_NULL) { + state->head->hcrc = (int)((state->flags >> 9) & 1); + state->head->done = 1; + } + strm->adler = state->check = crc32(0L, Z_NULL, 0); + state->mode = TYPE; + break; +#endif + case DICTID: + NEEDBITS(32); + strm->adler = state->check = ZSWAP32(hold); + INITBITS(); + state->mode = DICT; + case DICT: + if (state->havedict == 0) { + RESTORE(); + return Z_NEED_DICT; + } + strm->adler = state->check = adler32(0L, Z_NULL, 0); + state->mode = TYPE; + case TYPE: + if (flush == Z_BLOCK || flush == Z_TREES) goto inf_leave; + case TYPEDO: + if (state->last) { + BYTEBITS(); + state->mode = CHECK; + break; + } + NEEDBITS(3); + state->last = BITS(1); + DROPBITS(1); + switch (BITS(2)) { + case 0: /* stored block */ + Tracev((stderr, "inflate: stored block%s\n", + state->last ? " (last)" : "")); + state->mode = STORED; + break; + case 1: /* fixed block */ + fixedtables(state); + Tracev((stderr, "inflate: fixed codes block%s\n", + state->last ? " (last)" : "")); + state->mode = LEN_; /* decode codes */ + if (flush == Z_TREES) { + DROPBITS(2); + goto inf_leave; + } + break; + case 2: /* dynamic block */ + Tracev((stderr, "inflate: dynamic codes block%s\n", + state->last ? " (last)" : "")); + state->mode = TABLE; + break; + case 3: + strm->msg = (char *)"invalid block type"; + state->mode = BAD; + } + DROPBITS(2); + break; + case STORED: + BYTEBITS(); /* go to byte boundary */ + NEEDBITS(32); + if ((hold & 0xffff) != ((hold >> 16) ^ 0xffff)) { + strm->msg = (char *)"invalid stored block lengths"; + state->mode = BAD; + break; + } + state->length = (unsigned)hold & 0xffff; + Tracev((stderr, "inflate: stored length %u\n", + state->length)); + INITBITS(); + state->mode = COPY_; + if (flush == Z_TREES) goto inf_leave; + case COPY_: + state->mode = COPY; + case COPY: + copy = state->length; + if (copy) { + if (copy > have) copy = have; + if (copy > left) copy = left; + if (copy == 0) goto inf_leave; + zmemcpy(put, next, copy); + have -= copy; + next += copy; + left -= copy; + put += copy; + state->length -= copy; + break; + } + Tracev((stderr, "inflate: stored end\n")); + state->mode = TYPE; + break; + case TABLE: + NEEDBITS(14); + state->nlen = BITS(5) + 257; + DROPBITS(5); + state->ndist = BITS(5) + 1; + DROPBITS(5); + state->ncode = BITS(4) + 4; + DROPBITS(4); +#ifndef PKZIP_BUG_WORKAROUND + if (state->nlen > 286 || state->ndist > 30) { + strm->msg = (char *)"too many length or distance symbols"; + state->mode = BAD; + break; + } +#endif + Tracev((stderr, "inflate: table sizes ok\n")); + state->have = 0; + state->mode = LENLENS; + case LENLENS: + while (state->have < state->ncode) { + NEEDBITS(3); + state->lens[order[state->have++]] = (unsigned short)BITS(3); + DROPBITS(3); + } + while (state->have < 19) + state->lens[order[state->have++]] = 0; + state->next = state->codes; + state->lencode = (const code FAR *)(state->next); + state->lenbits = 7; + ret = inflate_table(CODES, state->lens, 19, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid code lengths set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: code lengths ok\n")); + state->have = 0; + state->mode = CODELENS; + case CODELENS: + while (state->have < state->nlen + state->ndist) { + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.val < 16) { + DROPBITS(here.bits); + state->lens[state->have++] = here.val; + } + else { + if (here.val == 16) { + NEEDBITS(here.bits + 2); + DROPBITS(here.bits); + if (state->have == 0) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + len = state->lens[state->have - 1]; + copy = 3 + BITS(2); + DROPBITS(2); + } + else if (here.val == 17) { + NEEDBITS(here.bits + 3); + DROPBITS(here.bits); + len = 0; + copy = 3 + BITS(3); + DROPBITS(3); + } + else { + NEEDBITS(here.bits + 7); + DROPBITS(here.bits); + len = 0; + copy = 11 + BITS(7); + DROPBITS(7); + } + if (state->have + copy > state->nlen + state->ndist) { + strm->msg = (char *)"invalid bit length repeat"; + state->mode = BAD; + break; + } + while (copy--) + state->lens[state->have++] = (unsigned short)len; + } + } + + /* handle error breaks in while */ + if (state->mode == BAD) break; + + /* check for end-of-block code (better have one) */ + if (state->lens[256] == 0) { + strm->msg = (char *)"invalid code -- missing end-of-block"; + state->mode = BAD; + break; + } + + /* build code tables -- note: do not change the lenbits or distbits + values here (9 and 6) without reading the comments in inftrees.h + concerning the ENOUGH constants, which depend on those values */ + state->next = state->codes; + state->lencode = (const code FAR *)(state->next); + state->lenbits = 9; + ret = inflate_table(LENS, state->lens, state->nlen, &(state->next), + &(state->lenbits), state->work); + if (ret) { + strm->msg = (char *)"invalid literal/lengths set"; + state->mode = BAD; + break; + } + state->distcode = (const code FAR *)(state->next); + state->distbits = 6; + ret = inflate_table(DISTS, state->lens + state->nlen, state->ndist, + &(state->next), &(state->distbits), state->work); + if (ret) { + strm->msg = (char *)"invalid distances set"; + state->mode = BAD; + break; + } + Tracev((stderr, "inflate: codes ok\n")); + state->mode = LEN_; + if (flush == Z_TREES) goto inf_leave; + case LEN_: + state->mode = LEN; + case LEN: + if (have >= 6 && left >= 258) { + RESTORE(); + inflate_fast(strm, out); + LOAD(); + if (state->mode == TYPE) + state->back = -1; + break; + } + state->back = 0; + for (;;) { + here = state->lencode[BITS(state->lenbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if (here.op && (here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->lencode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + state->back += last.bits; + } + DROPBITS(here.bits); + state->back += here.bits; + state->length = (unsigned)here.val; + if ((int)(here.op) == 0) { + Tracevv((stderr, here.val >= 0x20 && here.val < 0x7f ? + "inflate: literal '%c'\n" : + "inflate: literal 0x%02x\n", here.val)); + state->mode = LIT; + break; + } + if (here.op & 32) { + Tracevv((stderr, "inflate: end of block\n")); + state->back = -1; + state->mode = TYPE; + break; + } + if (here.op & 64) { + strm->msg = (char *)"invalid literal/length code"; + state->mode = BAD; + break; + } + state->extra = (unsigned)(here.op) & 15; + state->mode = LENEXT; + case LENEXT: + if (state->extra) { + NEEDBITS(state->extra); + state->length += BITS(state->extra); + DROPBITS(state->extra); + state->back += state->extra; + } + Tracevv((stderr, "inflate: length %u\n", state->length)); + state->was = state->length; + state->mode = DIST; + case DIST: + for (;;) { + here = state->distcode[BITS(state->distbits)]; + if ((unsigned)(here.bits) <= bits) break; + PULLBYTE(); + } + if ((here.op & 0xf0) == 0) { + last = here; + for (;;) { + here = state->distcode[last.val + + (BITS(last.bits + last.op) >> last.bits)]; + if ((unsigned)(last.bits + here.bits) <= bits) break; + PULLBYTE(); + } + DROPBITS(last.bits); + state->back += last.bits; + } + DROPBITS(here.bits); + state->back += here.bits; + if (here.op & 64) { + strm->msg = (char *)"invalid distance code"; + state->mode = BAD; + break; + } + state->offset = (unsigned)here.val; + state->extra = (unsigned)(here.op) & 15; + state->mode = DISTEXT; + case DISTEXT: + if (state->extra) { + NEEDBITS(state->extra); + state->offset += BITS(state->extra); + DROPBITS(state->extra); + state->back += state->extra; + } +#ifdef INFLATE_STRICT + if (state->offset > state->dmax) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#endif + Tracevv((stderr, "inflate: distance %u\n", state->offset)); + state->mode = MATCH; + case MATCH: + if (left == 0) goto inf_leave; + copy = out - left; + if (state->offset > copy) { /* copy from window */ + copy = state->offset - copy; + if (copy > state->whave) { + if (state->sane) { + strm->msg = (char *)"invalid distance too far back"; + state->mode = BAD; + break; + } +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + Trace((stderr, "inflate.c too far\n")); + copy -= state->whave; + if (copy > state->length) copy = state->length; + if (copy > left) copy = left; + left -= copy; + state->length -= copy; + do { + *put++ = 0; + } while (--copy); + if (state->length == 0) state->mode = LEN; + break; +#endif + } + if (copy > state->wnext) { + copy -= state->wnext; + from = state->window + (state->wsize - copy); + } + else + from = state->window + (state->wnext - copy); + if (copy > state->length) copy = state->length; + } + else { /* copy from output */ + from = put - state->offset; + copy = state->length; + } + if (copy > left) copy = left; + left -= copy; + state->length -= copy; + do { + *put++ = *from++; + } while (--copy); + if (state->length == 0) state->mode = LEN; + break; + case LIT: + if (left == 0) goto inf_leave; + *put++ = (unsigned char)(state->length); + left--; + state->mode = LEN; + break; + case CHECK: + if (state->wrap) { + NEEDBITS(32); + out -= left; + strm->total_out += out; + state->total += out; + if (out) + strm->adler = state->check = + UPDATE(state->check, put - out, out); + out = left; + if (( +#ifdef GUNZIP + state->flags ? hold : +#endif + ZSWAP32(hold)) != state->check) { + strm->msg = (char *)"incorrect data check"; + state->mode = BAD; + break; + } + INITBITS(); + Tracev((stderr, "inflate: check matches trailer\n")); + } +#ifdef GUNZIP + state->mode = LENGTH; + case LENGTH: + if (state->wrap && state->flags) { + NEEDBITS(32); + if (hold != (state->total & 0xffffffffUL)) { + strm->msg = (char *)"incorrect length check"; + state->mode = BAD; + break; + } + INITBITS(); + Tracev((stderr, "inflate: length matches trailer\n")); + } +#endif + state->mode = DONE; + case DONE: + ret = Z_STREAM_END; + goto inf_leave; + case BAD: + ret = Z_DATA_ERROR; + goto inf_leave; + case MEM: + return Z_MEM_ERROR; + case SYNC: + default: + return Z_STREAM_ERROR; + } + + /* + Return from inflate(), updating the total counts and the check value. + If there was no progress during the inflate() call, return a buffer + error. Call updatewindow() to create and/or update the window state. +Note: a memory error from inflate() is non-recoverable. +*/ +inf_leave: + RESTORE(); + if (state->wsize || (out != strm->avail_out && state->mode < BAD && + (state->mode < CHECK || flush != Z_FINISH))) + if (updatewindow(strm, strm->next_out, out - strm->avail_out)) { + state->mode = MEM; + return Z_MEM_ERROR; + } + in -= strm->avail_in; + out -= strm->avail_out; + strm->total_in += in; + strm->total_out += out; + state->total += out; + if (state->wrap && out) + strm->adler = state->check = + UPDATE(state->check, strm->next_out - out, out); + strm->data_type = state->bits + (state->last ? 64 : 0) + + (state->mode == TYPE ? 128 : 0) + + (state->mode == LEN_ || state->mode == COPY_ ? 256 : 0); + if (((in == 0 && out == 0) || flush == Z_FINISH) && ret == Z_OK) + ret = Z_BUF_ERROR; + return ret; +} + +int ZEXPORT inflateEnd(z_streamp strm) +{ + struct inflate_state FAR *state; + if (strm == Z_NULL || strm->state == Z_NULL || strm->zfree == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (state->window != Z_NULL) ZFREE(strm, state->window); + ZFREE(strm, strm->state); + strm->state = Z_NULL; + Tracev((stderr, "inflate: end\n")); + return Z_OK; +} + +int ZEXPORT inflateGetDictionary(z_streamp strm, Bytef *dictionary, uInt *dictLength) +{ + struct inflate_state FAR *state; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + + /* copy dictionary */ + if (state->whave && dictionary != Z_NULL) { + zmemcpy(dictionary, state->window + state->wnext, + state->whave - state->wnext); + zmemcpy(dictionary + state->whave - state->wnext, + state->window, state->wnext); + } + if (dictLength != Z_NULL) + *dictLength = state->whave; + return Z_OK; +} + +int ZEXPORT inflateSetDictionary(z_streamp strm, const Bytef *dictionary, uInt dictLength) +{ + struct inflate_state FAR *state; + unsigned long dictid; + int ret; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (state->wrap != 0 && state->mode != DICT) + return Z_STREAM_ERROR; + + /* check for correct dictionary identifier */ + if (state->mode == DICT) { + dictid = adler32(0L, Z_NULL, 0); + dictid = adler32(dictid, dictionary, dictLength); + if (dictid != state->check) + return Z_DATA_ERROR; + } + + /* copy dictionary to window using updatewindow(), which will amend the + existing dictionary if appropriate */ + ret = updatewindow(strm, dictionary + dictLength, dictLength); + if (ret) { + state->mode = MEM; + return Z_MEM_ERROR; + } + state->havedict = 1; + Tracev((stderr, "inflate: dictionary set\n")); + return Z_OK; +} + +int ZEXPORT inflateGetHeader(z_streamp strm, gz_headerp head) +{ + struct inflate_state FAR *state; + + /* check state */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if ((state->wrap & 2) == 0) return Z_STREAM_ERROR; + + /* save header structure */ + state->head = head; + head->done = 0; + return Z_OK; +} + +/* + Search buf[0..len-1] for the pattern: 0, 0, 0xff, 0xff. Return when found + or when out of input. When called, *have is the number of pattern bytes + found in order so far, in 0..3. On return *have is updated to the new + state. If on return *have equals four, then the pattern was found and the + return value is how many bytes were read including the last byte of the + pattern. If *have is less than four, then the pattern has not been found + yet and the return value is len. In the latter case, syncsearch() can be + called again with more data and the *have state. *have is initialized to + zero for the first call. + */ +local unsigned syncsearch(unsigned FAR *have, const unsigned char FAR *buf, unsigned len) +{ + unsigned got; + unsigned next; + + got = *have; + next = 0; + while (next < len && got < 4) { + if ((int)(buf[next]) == (got < 2 ? 0 : 0xff)) + got++; + else if (buf[next]) + got = 0; + else + got = 4 - got; + next++; + } + *have = got; + return next; +} + +int ZEXPORT inflateSync(z_streamp strm) +{ + unsigned len; /* number of bytes to look at or looked at */ + unsigned long in, out; /* temporary to save total_in and total_out */ + unsigned char buf[4]; /* to restore bit buffer to byte string */ + struct inflate_state FAR *state; + + /* check parameters */ + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + if (strm->avail_in == 0 && state->bits < 8) return Z_BUF_ERROR; + + /* if first time, start search in bit buffer */ + if (state->mode != SYNC) { + state->mode = SYNC; + state->hold <<= state->bits & 7; + state->bits -= state->bits & 7; + len = 0; + while (state->bits >= 8) { + buf[len++] = (unsigned char)(state->hold); + state->hold >>= 8; + state->bits -= 8; + } + state->have = 0; + syncsearch(&(state->have), buf, len); + } + + /* search available input */ + len = syncsearch(&(state->have), strm->next_in, strm->avail_in); + strm->avail_in -= len; + strm->next_in += len; + strm->total_in += len; + + /* return no joy or set up to restart inflate() on a new block */ + if (state->have != 4) return Z_DATA_ERROR; + in = strm->total_in; out = strm->total_out; + inflateReset(strm); + strm->total_in = in; strm->total_out = out; + state->mode = TYPE; + return Z_OK; +} + +/* + Returns true if inflate is currently at the end of a block generated by + Z_SYNC_FLUSH or Z_FULL_FLUSH. This function is used by one PPP + implementation to provide an additional safety check. PPP uses + Z_SYNC_FLUSH but removes the length bytes of the resulting empty stored + block. When decompressing, PPP checks that at the end of input packet, + inflate is waiting for these length bytes. + */ +int ZEXPORT inflateSyncPoint(z_streamp strm) +{ + struct inflate_state FAR *state; + + if (strm == Z_NULL || strm->state == Z_NULL) return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + return state->mode == STORED && state->bits == 0; +} + +int ZEXPORT inflateCopy(z_streamp dest, z_streamp source) +{ + struct inflate_state FAR *state; + struct inflate_state FAR *copy; + unsigned char FAR *window; + unsigned wsize; + + /* check input */ + if (dest == Z_NULL || source == Z_NULL || source->state == Z_NULL || + source->zalloc == Z_NULL || source->zfree == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)source->state; + + /* allocate space */ + copy = (struct inflate_state FAR *) + ZALLOC(source, 1, sizeof(struct inflate_state)); + if (copy == Z_NULL) return Z_MEM_ERROR; + window = Z_NULL; + if (state->window != Z_NULL) { + window = (unsigned char FAR *) + ZALLOC(source, 1U << state->wbits, sizeof(unsigned char)); + if (window == Z_NULL) { + ZFREE(source, copy); + return Z_MEM_ERROR; + } + } + + /* copy state */ + zmemcpy((voidpf)dest, (voidpf)source, sizeof(z_stream)); + zmemcpy((voidpf)copy, (voidpf)state, sizeof(struct inflate_state)); + if (state->lencode >= state->codes && + state->lencode <= state->codes + ENOUGH - 1) { + copy->lencode = copy->codes + (state->lencode - state->codes); + copy->distcode = copy->codes + (state->distcode - state->codes); + } + copy->next = copy->codes + (state->next - state->codes); + if (window != Z_NULL) { + wsize = 1U << state->wbits; + zmemcpy(window, state->window, wsize); + } + copy->window = window; + dest->state = (struct internal_state FAR *)copy; + return Z_OK; +} + +int ZEXPORT inflateUndermine(z_streamp strm, int subvert) +{ + struct inflate_state FAR *state = NULL; + + if (strm == Z_NULL || strm->state == Z_NULL) + return Z_STREAM_ERROR; + state = (struct inflate_state FAR *)strm->state; + state->sane = !subvert; +#ifdef INFLATE_ALLOW_INVALID_DISTANCE_TOOFAR_ARRR + return Z_OK; +#else + state->sane = 1; + return Z_DATA_ERROR; +#endif +} + +long ZEXPORT inflateMark(z_streamp strm) +{ + struct inflate_state FAR *state = NULL; + + if (strm == Z_NULL || strm->state == Z_NULL) + return -1L << 16; + state = (struct inflate_state FAR *)strm->state; + return ((long)(state->back) << 16) + + (state->mode == COPY ? state->length : + (state->mode == MATCH ? state->was - state->length : 0)); +} diff --git a/deps/zlib/inflate.h b/deps/zlib/inflate.h new file mode 100644 index 0000000..dbc173a --- /dev/null +++ b/deps/zlib/inflate.h @@ -0,0 +1,127 @@ +/* inflate.h -- internal inflate state definition + * Copyright (C) 1995-2009 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* define NO_GZIP when compiling if you want to disable gzip header and + trailer decoding by inflate(). NO_GZIP would be used to avoid linking in + the crc code when it is not needed. For shared libraries, gzip decoding + should be left enabled. */ +#ifndef _INFLATE_H +#define _INFLATE_H + +#ifndef NO_GZIP +# define GUNZIP +#endif + +/* Possible inflate modes between inflate() calls */ +typedef enum { + HEAD, /* i: waiting for magic header */ + FLAGS, /* i: waiting for method and flags (gzip) */ + TIME, /* i: waiting for modification time (gzip) */ + OS, /* i: waiting for extra flags and operating system (gzip) */ + EXLEN, /* i: waiting for extra length (gzip) */ + EXTRA, /* i: waiting for extra bytes (gzip) */ + NAME, /* i: waiting for end of file name (gzip) */ + COMMENT, /* i: waiting for end of comment (gzip) */ + HCRC, /* i: waiting for header crc (gzip) */ + DICTID, /* i: waiting for dictionary check value */ + DICT, /* waiting for inflateSetDictionary() call */ + TYPE, /* i: waiting for type bits, including last-flag bit */ + TYPEDO, /* i: same, but skip check to exit inflate on new block */ + STORED, /* i: waiting for stored size (length and complement) */ + COPY_, /* i/o: same as COPY below, but only first time in */ + COPY, /* i/o: waiting for input or output to copy stored block */ + TABLE, /* i: waiting for dynamic block table lengths */ + LENLENS, /* i: waiting for code length code lengths */ + CODELENS, /* i: waiting for length/lit and distance code lengths */ + LEN_, /* i: same as LEN below, but only first time in */ + LEN, /* i: waiting for length/lit/eob code */ + LENEXT, /* i: waiting for length extra bits */ + DIST, /* i: waiting for distance code */ + DISTEXT, /* i: waiting for distance extra bits */ + MATCH, /* o: waiting for output space to copy string */ + LIT, /* o: waiting for output space to write literal */ + CHECK, /* i: waiting for 32-bit check value */ + LENGTH, /* i: waiting for 32-bit length (gzip) */ + DONE, /* finished check, done -- remain here until reset */ + BAD, /* got a data error -- remain here until reset */ + MEM, /* got an inflate() memory error -- remain here until reset */ + SYNC /* looking for synchronization bytes to restart inflate() */ +} inflate_mode; + +/* + State transitions between above modes - + + (most modes can go to BAD or MEM on error -- not shown for clarity) + + Process header: + HEAD -> (gzip) or (zlib) or (raw) + (gzip) -> FLAGS -> TIME -> OS -> EXLEN -> EXTRA -> NAME -> COMMENT -> + HCRC -> TYPE + (zlib) -> DICTID or TYPE + DICTID -> DICT -> TYPE + (raw) -> TYPEDO + Read deflate blocks: + TYPE -> TYPEDO -> STORED or TABLE or LEN_ or CHECK + STORED -> COPY_ -> COPY -> TYPE + TABLE -> LENLENS -> CODELENS -> LEN_ + LEN_ -> LEN + Read deflate codes in fixed or dynamic block: + LEN -> LENEXT or LIT or TYPE + LENEXT -> DIST -> DISTEXT -> MATCH -> LEN + LIT -> LEN + Process trailer: + CHECK -> LENGTH -> DONE + */ + +/* state maintained between inflate() calls. Approximately 10K bytes. */ +struct inflate_state { + inflate_mode mode; /* current inflate mode */ + int last; /* true if processing last block */ + int wrap; /* bit 0 true for zlib, bit 1 true for gzip */ + int havedict; /* true if dictionary provided */ + int flags; /* gzip header method and flags (0 if zlib) */ + unsigned dmax; /* zlib header max distance (INFLATE_STRICT) */ + unsigned long check; /* protected copy of check value */ + unsigned long total; /* protected copy of output count */ + gz_headerp head; /* where to save gzip header information */ + /* sliding window */ + unsigned wbits; /* log base 2 of requested window size */ + unsigned wsize; /* window size or zero if not using window */ + unsigned whave; /* valid bytes in the window */ + unsigned wnext; /* window write index */ + unsigned char FAR *window; /* allocated sliding window, if needed */ + /* bit accumulator */ + unsigned long hold; /* input bit accumulator */ + unsigned bits; /* number of bits in "in" */ + /* for string and stored block copying */ + unsigned length; /* literal or length of data to copy */ + unsigned offset; /* distance back to copy string from */ + /* for table and code decoding */ + unsigned extra; /* extra bits needed */ + /* fixed and dynamic code tables */ + code const FAR *lencode; /* starting table for length/literal codes */ + code const FAR *distcode; /* starting table for distance codes */ + unsigned lenbits; /* index bits for lencode */ + unsigned distbits; /* index bits for distcode */ + /* dynamic table building */ + unsigned ncode; /* number of code length code lengths */ + unsigned nlen; /* number of length code lengths */ + unsigned ndist; /* number of distance code lengths */ + unsigned have; /* number of code lengths in lens[] */ + code FAR *next; /* next available space in codes[] */ + unsigned short lens[320]; /* temporary storage for code lengths */ + unsigned short work[288]; /* work area for code table building */ + code codes[ENOUGH]; /* space for code tables */ + int sane; /* if false, allow invalid distance too far */ + int back; /* bits back of last unprocessed length/lit */ + unsigned was; /* initial length of match */ +}; + +#endif diff --git a/deps/zlib/inftrees.c b/deps/zlib/inftrees.c new file mode 100644 index 0000000..8b8a964 --- /dev/null +++ b/deps/zlib/inftrees.c @@ -0,0 +1,300 @@ +/* inftrees.c -- generate Huffman trees for efficient decoding + * Copyright (C) 1995-2013 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +#include "zutil.h" +#include "inftrees.h" + +#define MAXBITS 15 + +const char inflate_copyright[] = +" inflate 1.2.8 Copyright 1995-2013 Mark Adler "; +/* + If you use the zlib library in a product, an acknowledgment is welcome + in the documentation of your product. If for some reason you cannot + include such an acknowledgment, I would appreciate that you keep this + copyright string in the executable of your product. + */ + +/* + Build a set of tables to decode the provided canonical Huffman code. + The code lengths are lens[0..codes-1]. The result starts at *table, + whose indices are 0..2^bits-1. work is a writable array of at least + lens shorts, which is used as a work area. type is the type of code + to be generated, CODES, LENS, or DISTS. On return, zero is success, + -1 is an invalid code, and +1 means that ENOUGH isn't enough. table + on return points to the next available entry's address. bits is the + requested root table index bits, and on return it is the actual root + table index bits. It will differ if the request is greater than the + longest code or if it is less than the shortest code. + */ +int ZLIB_INTERNAL inflate_table(codetype type, unsigned short FAR *lens, unsigned codes, code FAR * FAR *table, unsigned FAR *bits, unsigned short FAR *work) +{ + unsigned len; /* a code's length in bits */ + unsigned sym; /* index of code symbols */ + unsigned min, max; /* minimum and maximum code lengths */ + unsigned root; /* number of index bits for root table */ + unsigned curr; /* number of index bits for current table */ + unsigned drop; /* code bits to drop for sub-table */ + int left; /* number of prefix codes available */ + unsigned used; /* code entries in table used */ + unsigned huff; /* Huffman code */ + unsigned incr; /* for incrementing code, index */ + unsigned fill; /* index for replicating entries */ + unsigned low; /* low bits for current root entry */ + unsigned mask; /* mask for low root bits */ + code here; /* table entry for duplication */ + code FAR *next; /* next available space in table */ + const unsigned short FAR *base; /* base value table to use */ + const unsigned short FAR *extra; /* extra bits table to use */ + int end; /* use base and extra for symbol > end */ + unsigned short count[MAXBITS+1]; /* number of codes of each length */ + unsigned short offs[MAXBITS+1]; /* offsets in table for each length */ + static const unsigned short lbase[31] = { /* Length codes 257..285 base */ + 3, 4, 5, 6, 7, 8, 9, 10, 11, 13, 15, 17, 19, 23, 27, 31, + 35, 43, 51, 59, 67, 83, 99, 115, 131, 163, 195, 227, 258, 0, 0}; + static const unsigned short lext[31] = { /* Length codes 257..285 extra */ + 16, 16, 16, 16, 16, 16, 16, 16, 17, 17, 17, 17, 18, 18, 18, 18, + 19, 19, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 16, 72, 78}; + static const unsigned short dbase[32] = { /* Distance codes 0..29 base */ + 1, 2, 3, 4, 5, 7, 9, 13, 17, 25, 33, 49, 65, 97, 129, 193, + 257, 385, 513, 769, 1025, 1537, 2049, 3073, 4097, 6145, + 8193, 12289, 16385, 24577, 0, 0}; + static const unsigned short dext[32] = { /* Distance codes 0..29 extra */ + 16, 16, 16, 16, 17, 17, 18, 18, 19, 19, 20, 20, 21, 21, 22, 22, + 23, 23, 24, 24, 25, 25, 26, 26, 27, 27, + 28, 28, 29, 29, 64, 64}; + + /* + Process a set of code lengths to create a canonical Huffman code. The + code lengths are lens[0..codes-1]. Each length corresponds to the + symbols 0..codes-1. The Huffman code is generated by first sorting the + symbols by length from short to long, and retaining the symbol order + for codes with equal lengths. Then the code starts with all zero bits + for the first code of the shortest length, and the codes are integer + increments for the same length, and zeros are appended as the length + increases. For the deflate format, these bits are stored backwards + from their more natural integer increment ordering, and so when the + decoding tables are built in the large loop below, the integer codes + are incremented backwards. + + This routine assumes, but does not check, that all of the entries in + lens[] are in the range 0..MAXBITS. The caller must assure this. + 1..MAXBITS is interpreted as that code length. zero means that that + symbol does not occur in this code. + + The codes are sorted by computing a count of codes for each length, + creating from that a table of starting indices for each length in the + sorted table, and then entering the symbols in order in the sorted + table. The sorted table is work[], with that space being provided by + the caller. + + The length counts are used for other purposes as well, i.e. finding + the minimum and maximum length codes, determining if there are any + codes at all, checking for a valid set of lengths, and looking ahead + at length counts to determine sub-table sizes when building the + decoding tables. + */ + + /* accumulate lengths for codes (assumes lens[] all in 0..MAXBITS) */ + for (len = 0; len <= MAXBITS; len++) + count[len] = 0; + for (sym = 0; sym < codes; sym++) + count[lens[sym]]++; + + /* bound code lengths, force root to be within code lengths */ + root = *bits; + for (max = MAXBITS; max >= 1; max--) + if (count[max] != 0) break; + if (root > max) root = max; + if (max == 0) { /* no symbols to code at all */ + here.op = (unsigned char)64; /* invalid code marker */ + here.bits = (unsigned char)1; + here.val = (unsigned short)0; + *(*table)++ = here; /* make a table to force an error */ + *(*table)++ = here; + *bits = 1; + return 0; /* no symbols, but wait for decoding to report error */ + } + for (min = 1; min < max; min++) + if (count[min] != 0) break; + if (root < min) root = min; + + /* check for an over-subscribed or incomplete set of lengths */ + left = 1; + for (len = 1; len <= MAXBITS; len++) { + left <<= 1; + left -= count[len]; + if (left < 0) return -1; /* over-subscribed */ + } + if (left > 0 && (type == CODES || max != 1)) + return -1; /* incomplete set */ + + /* generate offsets into symbol table for each length for sorting */ + offs[1] = 0; + for (len = 1; len < MAXBITS; len++) + offs[len + 1] = offs[len] + count[len]; + + /* sort symbols by length, by symbol order within each length */ + for (sym = 0; sym < codes; sym++) + if (lens[sym] != 0) work[offs[lens[sym]]++] = (unsigned short)sym; + + /* + Create and fill in decoding tables. In this loop, the table being + filled is at next and has curr index bits. The code being used is huff + with length len. That code is converted to an index by dropping drop + bits off of the bottom. For codes where len is less than drop + curr, + those top drop + curr - len bits are incremented through all values to + fill the table with replicated entries. + + root is the number of index bits for the root table. When len exceeds + root, sub-tables are created pointed to by the root entry with an index + of the low root bits of huff. This is saved in low to check for when a + new sub-table should be started. drop is zero when the root table is + being filled, and drop is root when sub-tables are being filled. + + When a new sub-table is needed, it is necessary to look ahead in the + code lengths to determine what size sub-table is needed. The length + counts are used for this, and so count[] is decremented as codes are + entered in the tables. + + used keeps track of how many table entries have been allocated from the + provided *table space. It is checked for LENS and DIST tables against + the constants ENOUGH_LENS and ENOUGH_DISTS to guard against changes in + the initial root table size constants. See the comments in inftrees.h + for more information. + + sym increments through all symbols, and the loop terminates when + all codes of length max, i.e. all codes, have been processed. This + routine permits incomplete codes, so another loop after this one fills + in the rest of the decoding tables with invalid code markers. + */ + + /* set up for code type */ + switch (type) { + case CODES: + base = extra = work; /* dummy value--not used */ + end = 19; + break; + case LENS: + base = lbase; + base -= 257; + extra = lext; + extra -= 257; + end = 256; + break; + default: /* DISTS */ + base = dbase; + extra = dext; + end = -1; + } + + /* initialize state for loop */ + huff = 0; /* starting code */ + sym = 0; /* starting code symbol */ + len = min; /* starting code length */ + next = *table; /* current table to fill in */ + curr = root; /* current table index bits */ + drop = 0; /* current bits to drop from code for index */ + low = (unsigned)(-1); /* trigger new sub-table when len > root */ + used = 1U << root; /* use root table entries */ + mask = used - 1; /* mask for comparing low */ + + /* check available table space */ + if ((type == LENS && used > ENOUGH_LENS) || + (type == DISTS && used > ENOUGH_DISTS)) + return 1; + + /* process all codes and make table entries */ + for (;;) { + /* create table entry */ + here.bits = (unsigned char)(len - drop); + if ((int)(work[sym]) < end) { + here.op = (unsigned char)0; + here.val = work[sym]; + } + else if ((int)(work[sym]) > end) { + here.op = (unsigned char)(extra[work[sym]]); + here.val = base[work[sym]]; + } + else { + here.op = (unsigned char)(32 + 64); /* end of block */ + here.val = 0; + } + + /* replicate for those indices with low len bits equal to huff */ + incr = 1U << (len - drop); + fill = 1U << curr; + min = fill; /* save offset to next table */ + do { + fill -= incr; + next[(huff >> drop) + fill] = here; + } while (fill != 0); + + /* backwards increment the len-bit code huff */ + incr = 1U << (len - 1); + while (huff & incr) + incr >>= 1; + if (incr != 0) { + huff &= incr - 1; + huff += incr; + } + else + huff = 0; + + /* go to next symbol, update count, len */ + sym++; + if (--(count[len]) == 0) { + if (len == max) break; + len = lens[work[sym]]; + } + + /* create new sub-table if needed */ + if (len > root && (huff & mask) != low) { + /* if first time, transition to sub-tables */ + if (drop == 0) + drop = root; + + /* increment past last table */ + next += min; /* here min is 1 << curr */ + + /* determine length of next table */ + curr = len - drop; + left = (int)(1 << curr); + while (curr + drop < max) { + left -= count[curr + drop]; + if (left <= 0) break; + curr++; + left <<= 1; + } + + /* check for enough space */ + used += 1U << curr; + if ((type == LENS && used > ENOUGH_LENS) || + (type == DISTS && used > ENOUGH_DISTS)) + return 1; + + /* point entry in root table to sub-table */ + low = huff & mask; + (*table)[low].op = (unsigned char)curr; + (*table)[low].bits = (unsigned char)root; + (*table)[low].val = (unsigned short)(next - *table); + } + } + + /* fill in remaining table entry if code is incomplete (guaranteed to have + at most one remaining entry, since if the code is incomplete, the + maximum code length that was allowed to get this far is one bit) */ + if (huff != 0) { + here.op = (unsigned char)64; /* invalid code marker */ + here.bits = (unsigned char)(len - drop); + here.val = (unsigned short)0; + next[huff] = here; + } + + /* set return parameters */ + *table += used; + *bits = root; + return 0; +} diff --git a/deps/zlib/inftrees.h b/deps/zlib/inftrees.h new file mode 100644 index 0000000..cd9e67c --- /dev/null +++ b/deps/zlib/inftrees.h @@ -0,0 +1,67 @@ +/* inftrees.h -- header to use inftrees.c + * Copyright (C) 1995-2005, 2010 Mark Adler + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +#ifndef _INFTREES_H +#define _INFTREES_H + +/* Structure for decoding tables. Each entry provides either the + information needed to do the operation requested by the code that + indexed that table entry, or it provides a pointer to another + table that indexes more bits of the code. op indicates whether + the entry is a pointer to another table, a literal, a length or + distance, an end-of-block, or an invalid code. For a table + pointer, the low four bits of op is the number of index bits of + that table. For a length or distance, the low four bits of op + is the number of extra bits to get after the code. bits is + the number of bits in this code or part of the code to drop off + of the bit buffer. val is the actual byte to output in the case + of a literal, the base length or distance, or the offset from + the current table to the next table. Each entry is four bytes. */ +typedef struct { + unsigned char op; /* operation, extra bits, table bits */ + unsigned char bits; /* bits in this part of the code */ + unsigned short val; /* offset in table or code value */ +} code; + +/* op values as set by inflate_table(): + 00000000 - literal + 0000tttt - table link, tttt != 0 is the number of table index bits + 0001eeee - length or distance, eeee is the number of extra bits + 01100000 - end of block + 01000000 - invalid code + */ + +/* Maximum size of the dynamic table. The maximum number of code structures is + 1444, which is the sum of 852 for literal/length codes and 592 for distance + codes. These values were found by exhaustive searches using the program + examples/enough.c found in the zlib distribtution. The arguments to that + program are the number of symbols, the initial root table size, and the + maximum bit length of a code. "enough 286 9 15" for literal/length codes + returns returns 852, and "enough 30 6 15" for distance codes returns 592. + The initial root table size (9 or 6) is found in the fifth argument of the + inflate_table() calls in inflate.c and infback.c. If the root table size is + changed, then these maximum sizes would be need to be recalculated and + updated. */ +#define ENOUGH_LENS 852 +#define ENOUGH_DISTS 592 +#define ENOUGH (ENOUGH_LENS+ENOUGH_DISTS) + +/* Type of code to build for inflate_table() */ +typedef enum { + CODES, + LENS, + DISTS +} codetype; + +int ZLIB_INTERNAL inflate_table OF((codetype type, unsigned short FAR *lens, + unsigned codes, code FAR * FAR *table, + unsigned FAR *bits, unsigned short FAR *work)); + +#endif diff --git a/deps/zlib/ioapi.c b/deps/zlib/ioapi.c new file mode 100644 index 0000000..767ac2f --- /dev/null +++ b/deps/zlib/ioapi.c @@ -0,0 +1,236 @@ +/* ioapi.h -- IO base function header for compress/uncompress .zip + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications for Zip64 support + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + +*/ + +#ifdef _WIN32 +#ifndef _CRT_SECURE_NO_WARNINGS +#define _CRT_SECURE_NO_WARNINGS +#endif +#endif + +#include "ioapi.h" + +voidpf call_zopen64 (const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode) +{ + if (pfilefunc->zfile_func64.zopen64_file != NULL) + return (*(pfilefunc->zfile_func64.zopen64_file)) (pfilefunc->zfile_func64.opaque,filename,mode); + else + { + return (*(pfilefunc->zopen32_file))(pfilefunc->zfile_func64.opaque,(const char*)filename,mode); + } +} + +long call_zseek64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin) +{ + if (pfilefunc->zfile_func64.zseek64_file != NULL) + return (*(pfilefunc->zfile_func64.zseek64_file)) (pfilefunc->zfile_func64.opaque,filestream,offset,origin); + else + { + uLong offsetTruncated = (uLong)offset; + if (offsetTruncated != offset) + return -1; + else + return (*(pfilefunc->zseek32_file))(pfilefunc->zfile_func64.opaque,filestream,offsetTruncated,origin); + } +} + +ZPOS64_T call_ztell64 (const zlib_filefunc64_32_def* pfilefunc,voidpf filestream) +{ + if (pfilefunc->zfile_func64.zseek64_file != NULL) + return (*(pfilefunc->zfile_func64.ztell64_file)) (pfilefunc->zfile_func64.opaque,filestream); + else + { + uLong tell_uLong = (*(pfilefunc->ztell32_file))(pfilefunc->zfile_func64.opaque,filestream); + if ((tell_uLong) == ((uLong)-1)) + return (ZPOS64_T)-1; + else + return tell_uLong; + } +} + +void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32) +{ + p_filefunc64_32->zfile_func64.zopen64_file = NULL; + p_filefunc64_32->zopen32_file = p_filefunc32->zopen_file; + p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file; + p_filefunc64_32->zfile_func64.zread_file = p_filefunc32->zread_file; + p_filefunc64_32->zfile_func64.zwrite_file = p_filefunc32->zwrite_file; + p_filefunc64_32->zfile_func64.ztell64_file = NULL; + p_filefunc64_32->zfile_func64.zseek64_file = NULL; + p_filefunc64_32->zfile_func64.zclose_file = p_filefunc32->zclose_file; + p_filefunc64_32->zfile_func64.zerror_file = p_filefunc32->zerror_file; + p_filefunc64_32->zfile_func64.opaque = p_filefunc32->opaque; + p_filefunc64_32->zseek32_file = p_filefunc32->zseek_file; + p_filefunc64_32->ztell32_file = p_filefunc32->ztell_file; +} + + + +static voidpf ZCALLBACK fopen_file_func OF((voidpf opaque, const char* filename, int mode)); +static uLong ZCALLBACK fread_file_func OF((voidpf opaque, voidpf stream, void* buf, uLong size)); +static uLong ZCALLBACK fwrite_file_func OF((voidpf opaque, voidpf stream, const void* buf,uLong size)); +static ZPOS64_T ZCALLBACK ftell64_file_func OF((voidpf opaque, voidpf stream)); +static long ZCALLBACK fseek64_file_func OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin)); +static int ZCALLBACK fclose_file_func OF((voidpf opaque, voidpf stream)); +static int ZCALLBACK ferror_file_func OF((voidpf opaque, voidpf stream)); + +static voidpf ZCALLBACK fopen_file_func (voidpf opaque, const char* filename, int mode) +{ + FILE* file = NULL; + const char* mode_fopen = NULL; + if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ) + mode_fopen = "rb"; + else + if (mode & ZLIB_FILEFUNC_MODE_EXISTING) + mode_fopen = "r+b"; + else + if (mode & ZLIB_FILEFUNC_MODE_CREATE) + mode_fopen = "wb"; + + if ((filename!=NULL) && (mode_fopen != NULL)) + file = fopen(filename, mode_fopen); + return file; +} + +static voidpf ZCALLBACK fopen64_file_func (voidpf opaque, const void* filename, int mode) +{ + FILE* file = NULL; + const char* mode_fopen = NULL; + if ((mode & ZLIB_FILEFUNC_MODE_READWRITEFILTER)==ZLIB_FILEFUNC_MODE_READ) + mode_fopen = "rb"; + else + if (mode & ZLIB_FILEFUNC_MODE_EXISTING) + mode_fopen = "r+b"; + else + if (mode & ZLIB_FILEFUNC_MODE_CREATE) + mode_fopen = "wb"; + + if ((filename!=NULL) && (mode_fopen != NULL)) + file = fopen((const char*)filename, mode_fopen); + return file; +} + + +static uLong ZCALLBACK fread_file_func (voidpf opaque, voidpf stream, void* buf, uLong size) +{ + uLong ret; + ret = (uLong)fread(buf, 1, (size_t)size, (FILE *)stream); + return ret; +} + +static uLong ZCALLBACK fwrite_file_func (voidpf opaque, voidpf stream, const void* buf, uLong size) +{ + uLong ret; + ret = (uLong)fwrite(buf, 1, (size_t)size, (FILE *)stream); + return ret; +} + +static long ZCALLBACK ftell_file_func (voidpf opaque, voidpf stream) +{ + long ret; + ret = ftell((FILE *)stream); + return ret; +} + + +static ZPOS64_T ZCALLBACK ftell64_file_func (voidpf opaque, voidpf stream) +{ + ZPOS64_T ret; + ret = ftell((FILE *)stream); + return ret; +} + +static long ZCALLBACK fseek_file_func (voidpf opaque, voidpf stream, uLong offset, int origin) +{ + int fseek_origin=0; + long ret; + switch (origin) + { + case ZLIB_FILEFUNC_SEEK_CUR : + fseek_origin = SEEK_CUR; + break; + case ZLIB_FILEFUNC_SEEK_END : + fseek_origin = SEEK_END; + break; + case ZLIB_FILEFUNC_SEEK_SET : + fseek_origin = SEEK_SET; + break; + default: return -1; + } + ret = 0; + if (fseek((FILE *)stream, offset, fseek_origin) != 0) + ret = -1; + return ret; +} + +static long ZCALLBACK fseek64_file_func (voidpf opaque, voidpf stream, ZPOS64_T offset, int origin) +{ + int fseek_origin=0; + long ret; + switch (origin) + { + case ZLIB_FILEFUNC_SEEK_CUR : + fseek_origin = SEEK_CUR; + break; + case ZLIB_FILEFUNC_SEEK_END : + fseek_origin = SEEK_END; + break; + case ZLIB_FILEFUNC_SEEK_SET : + fseek_origin = SEEK_SET; + break; + default: return -1; + } + ret = 0; + + if(fseek((FILE *)stream, (long)offset, fseek_origin) != 0) + ret = -1; + + return ret; +} + + +static int ZCALLBACK fclose_file_func (voidpf opaque, voidpf stream) +{ + int ret; + ret = fclose((FILE *)stream); + return ret; +} + +static int ZCALLBACK ferror_file_func (voidpf opaque, voidpf stream) +{ + int ret; + ret = ferror((FILE *)stream); + return ret; +} + +void fill_fopen_filefunc (zlib_filefunc_def *pzlib_filefunc_def) +{ + pzlib_filefunc_def->zopen_file = fopen_file_func; + pzlib_filefunc_def->zread_file = fread_file_func; + pzlib_filefunc_def->zwrite_file = fwrite_file_func; + pzlib_filefunc_def->ztell_file = ftell_file_func; + pzlib_filefunc_def->zseek_file = fseek_file_func; + pzlib_filefunc_def->zclose_file = fclose_file_func; + pzlib_filefunc_def->zerror_file = ferror_file_func; + pzlib_filefunc_def->opaque = NULL; +} + +void fill_fopen64_filefunc (zlib_filefunc64_def* pzlib_filefunc_def) +{ + pzlib_filefunc_def->zopen64_file = fopen64_file_func; + pzlib_filefunc_def->zread_file = fread_file_func; + pzlib_filefunc_def->zwrite_file = fwrite_file_func; + pzlib_filefunc_def->ztell64_file = ftell64_file_func; + pzlib_filefunc_def->zseek64_file = fseek64_file_func; + pzlib_filefunc_def->zclose_file = fclose_file_func; + pzlib_filefunc_def->zerror_file = ferror_file_func; + pzlib_filefunc_def->opaque = NULL; +} diff --git a/deps/zlib/ioapi.h b/deps/zlib/ioapi.h new file mode 100644 index 0000000..8309c4c --- /dev/null +++ b/deps/zlib/ioapi.h @@ -0,0 +1,200 @@ +/* ioapi.h -- IO base function header for compress/uncompress .zip + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications for Zip64 support + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + Changes + + Oct-2009 - Defined ZPOS64_T to fpos_t on windows and u_int64_t on linux. (might need to find a better why for this) + Oct-2009 - Change to fseeko64, ftello64 and fopen64 so large files would work on linux. + More if/def section may be needed to support other platforms + Oct-2009 - Defined fxxxx64 calls to normal fopen/ftell/fseek so they would compile on windows. + (but you should use iowin32.c for windows instead) + +*/ + +#ifndef _ZLIBIOAPI64_H +#define _ZLIBIOAPI64_H + +#if (!defined(_WIN32)) && (!defined(WIN32)) + + // Linux needs this to support file operation on files larger then 4+GB + // But might need better if/def to select just the platforms that needs them. + + #ifndef __USE_FILE_OFFSET64 + #define __USE_FILE_OFFSET64 + #endif + #ifndef __USE_LARGEFILE64 + #define __USE_LARGEFILE64 + #endif + #ifndef _LARGEFILE64_SOURCE + #define _LARGEFILE64_SOURCE + #endif + #ifndef _FILE_OFFSET_BIT + #define _FILE_OFFSET_BIT 64 + #endif +#endif + +#include <stdio.h> +#include <stdlib.h> +#include "zlib.h" + +#if defined(USE_FILE32API) +#define fopen64 fopen +#define ftello64 ftell +#define fseeko64 fseek +#else +#ifdef _MSC_VER + #define fopen64 fopen + #if (_MSC_VER >= 1400) && (!(defined(NO_MSCVER_FILE64_FUNC))) + #define ftello64 _ftelli64 + #define fseeko64 _fseeki64 + #else // old MSC + #define ftello64 ftell + #define fseeko64 fseek + #endif +#endif +#endif + +/* +#ifndef ZPOS64_T + #ifdef _WIN32 + #define ZPOS64_T fpos_t + #else + #include <stdint.h> + #define ZPOS64_T uint64_t + #endif +#endif +*/ + +#ifdef HAVE_MINIZIP64_CONF_H +#include "mz64conf.h" +#endif + +/* a type choosen by DEFINE */ +#ifdef HAVE_64BIT_INT_CUSTOM +typedef 64BIT_INT_CUSTOM_TYPE ZPOS64_T; +#else +#ifdef HAS_STDINT_H +#include "stdint.h" +typedef uint64_t ZPOS64_T; +#else + + +#if defined(_MSC_VER) || defined(__BORLANDC__) +typedef unsigned __int64 ZPOS64_T; +#else +typedef unsigned long long int ZPOS64_T; +#endif +#endif +#endif + + + +#ifdef __cplusplus +extern "C" { +#endif + + +#define ZLIB_FILEFUNC_SEEK_CUR (1) +#define ZLIB_FILEFUNC_SEEK_END (2) +#define ZLIB_FILEFUNC_SEEK_SET (0) + +#define ZLIB_FILEFUNC_MODE_READ (1) +#define ZLIB_FILEFUNC_MODE_WRITE (2) +#define ZLIB_FILEFUNC_MODE_READWRITEFILTER (3) + +#define ZLIB_FILEFUNC_MODE_EXISTING (4) +#define ZLIB_FILEFUNC_MODE_CREATE (8) + + +#ifndef ZCALLBACK + #if (defined(WIN32) || defined(_WIN32) || defined (WINDOWS) || defined (_WINDOWS)) && defined(CALLBACK) && defined (USEWINDOWS_CALLBACK) + #define ZCALLBACK CALLBACK + #else + #define ZCALLBACK + #endif +#endif + + + + +typedef voidpf (ZCALLBACK *open_file_func) OF((voidpf opaque, const char* filename, int mode)); +typedef uLong (ZCALLBACK *read_file_func) OF((voidpf opaque, voidpf stream, void* buf, uLong size)); +typedef uLong (ZCALLBACK *write_file_func) OF((voidpf opaque, voidpf stream, const void* buf, uLong size)); +typedef int (ZCALLBACK *close_file_func) OF((voidpf opaque, voidpf stream)); +typedef int (ZCALLBACK *testerror_file_func) OF((voidpf opaque, voidpf stream)); + +typedef long (ZCALLBACK *tell_file_func) OF((voidpf opaque, voidpf stream)); +typedef long (ZCALLBACK *seek_file_func) OF((voidpf opaque, voidpf stream, uLong offset, int origin)); + + +/* here is the "old" 32 bits structure structure */ +typedef struct zlib_filefunc_def_s +{ + open_file_func zopen_file; + read_file_func zread_file; + write_file_func zwrite_file; + tell_file_func ztell_file; + seek_file_func zseek_file; + close_file_func zclose_file; + testerror_file_func zerror_file; + voidpf opaque; +} zlib_filefunc_def; + +typedef ZPOS64_T (ZCALLBACK *tell64_file_func) OF((voidpf opaque, voidpf stream)); +typedef long (ZCALLBACK *seek64_file_func) OF((voidpf opaque, voidpf stream, ZPOS64_T offset, int origin)); +typedef voidpf (ZCALLBACK *open64_file_func) OF((voidpf opaque, const void* filename, int mode)); + +typedef struct zlib_filefunc64_def_s +{ + open64_file_func zopen64_file; + read_file_func zread_file; + write_file_func zwrite_file; + tell64_file_func ztell64_file; + seek64_file_func zseek64_file; + close_file_func zclose_file; + testerror_file_func zerror_file; + voidpf opaque; +} zlib_filefunc64_def; + +void fill_fopen64_filefunc OF((zlib_filefunc64_def* pzlib_filefunc_def)); +void fill_fopen_filefunc OF((zlib_filefunc_def* pzlib_filefunc_def)); + +/* now internal definition, only for zip.c and unzip.h */ +typedef struct zlib_filefunc64_32_def_s +{ + zlib_filefunc64_def zfile_func64; + open_file_func zopen32_file; + tell_file_func ztell32_file; + seek_file_func zseek32_file; +} zlib_filefunc64_32_def; + + +#define ZREAD64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zread_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size)) +#define ZWRITE64(filefunc,filestream,buf,size) ((*((filefunc).zfile_func64.zwrite_file)) ((filefunc).zfile_func64.opaque,filestream,buf,size)) +//#define ZTELL64(filefunc,filestream) ((*((filefunc).ztell64_file)) ((filefunc).opaque,filestream)) +//#define ZSEEK64(filefunc,filestream,pos,mode) ((*((filefunc).zseek64_file)) ((filefunc).opaque,filestream,pos,mode)) +#define ZCLOSE64(filefunc,filestream) ((*((filefunc).zfile_func64.zclose_file)) ((filefunc).zfile_func64.opaque,filestream)) +#define ZERROR64(filefunc,filestream) ((*((filefunc).zfile_func64.zerror_file)) ((filefunc).zfile_func64.opaque,filestream)) + +voidpf call_zopen64 OF((const zlib_filefunc64_32_def* pfilefunc,const void*filename,int mode)); +long call_zseek64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream, ZPOS64_T offset, int origin)); +ZPOS64_T call_ztell64 OF((const zlib_filefunc64_32_def* pfilefunc,voidpf filestream)); + +void fill_zlib_filefunc64_32_def_from_filefunc32(zlib_filefunc64_32_def* p_filefunc64_32,const zlib_filefunc_def* p_filefunc32); + +#define ZOPEN64(filefunc,filename,mode) (call_zopen64((&(filefunc)),(filename),(mode))) +#define ZTELL64(filefunc,filestream) (call_ztell64((&(filefunc)),(filestream))) +#define ZSEEK64(filefunc,filestream,pos,mode) (call_zseek64((&(filefunc)),(filestream),(pos),(mode))) + +#ifdef __cplusplus +} +#endif + +#endif diff --git a/deps/zlib/trees.c b/deps/zlib/trees.c new file mode 100644 index 0000000..fa41a13 --- /dev/null +++ b/deps/zlib/trees.c @@ -0,0 +1,1177 @@ +/* trees.c -- output deflated data using Huffman coding + * Copyright (C) 1995-2012 Jean-loup Gailly + * detect_data_type() function provided freely by Cosmin Truta, 2006 + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* + * ALGORITHM + * + * The "deflation" process uses several Huffman trees. The more + * common source values are represented by shorter bit sequences. + * + * Each code tree is stored in a compressed form which is itself + * a Huffman encoding of the lengths of all the code strings (in + * ascending order by source values). The actual code strings are + * reconstructed from the lengths in the inflate process, as described + * in the deflate specification. + * + * REFERENCES + * + * Deutsch, L.P.,"'Deflate' Compressed Data Format Specification". + * Available in ftp.uu.net:/pub/archiving/zip/doc/deflate-1.1.doc + * + * Storer, James A. + * Data Compression: Methods and Theory, pp. 49-50. + * Computer Science Press, 1988. ISBN 0-7167-8156-5. + * + * Sedgewick, R. + * Algorithms, p290. + * Addison-Wesley, 1983. ISBN 0-201-06672-6. + */ + +/* @(#) $Id$ */ + +/* #define GEN_TREES_H */ + +#include "deflate.h" + +#ifdef DEBUG +# include <ctype.h> +#endif + +/* =========================================================================== + * Constants + */ + +#define MAX_BL_BITS 7 +/* Bit length codes must not exceed MAX_BL_BITS bits */ + +#define END_BLOCK 256 +/* end of block literal code */ + +#define REP_3_6 16 +/* repeat previous bit length 3-6 times (2 bits of repeat count) */ + +#define REPZ_3_10 17 +/* repeat a zero length 3-10 times (3 bits of repeat count) */ + +#define REPZ_11_138 18 +/* repeat a zero length 11-138 times (7 bits of repeat count) */ + +local const int extra_lbits[LENGTH_CODES] /* extra bits for each length code */ += {0,0,0,0,0,0,0,0,1,1,1,1,2,2,2,2,3,3,3,3,4,4,4,4,5,5,5,5,0}; + +local const int extra_dbits[D_CODES] /* extra bits for each distance code */ += {0,0,0,0,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13}; + +local const int extra_blbits[BL_CODES]/* extra bits for each bit length code */ += {0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,2,3,7}; + +local const uch bl_order[BL_CODES] += {16,17,18,0,8,7,9,6,10,5,11,4,12,3,13,2,14,1,15}; +/* The lengths of the bit length codes are sent in order of decreasing + * probability, to avoid transmitting the lengths for unused bit length codes. + */ + +/* =========================================================================== + * Local data. These are initialized only once. + */ + +#define DIST_CODE_LEN 512 /* see definition of array dist_code below */ + +#if defined(GEN_TREES_H) || !defined(STDC) +/* non ANSI compilers may not accept trees.h */ + +local ct_data static_ltree[L_CODES+2]; +/* The static literal tree. Since the bit lengths are imposed, there is no + * need for the L_CODES extra codes used during heap construction. However + * The codes 286 and 287 are needed to build a canonical tree (see _tr_init + * below). + */ + +local ct_data static_dtree[D_CODES]; +/* The static distance tree. (Actually a trivial tree since all codes use + * 5 bits.) + */ + +uch _dist_code[DIST_CODE_LEN]; +/* Distance codes. The first 256 values correspond to the distances + * 3 .. 258, the last 256 values correspond to the top 8 bits of + * the 15 bit distances. + */ + +uch _length_code[MAX_MATCH-MIN_MATCH+1]; +/* length code for each normalized match length (0 == MIN_MATCH) */ + +local int base_length[LENGTH_CODES]; +/* First normalized length for each code (0 = MIN_MATCH) */ + +local int base_dist[D_CODES]; +/* First normalized distance for each code (0 = distance of 1) */ + +#else +# include "trees.h" +#endif /* GEN_TREES_H */ + +struct static_tree_desc_s { + const ct_data *static_tree; /* static tree or NULL */ + const intf *extra_bits; /* extra bits for each code or NULL */ + int extra_base; /* base index for extra_bits */ + int elems; /* max number of elements in the tree */ + int max_length; /* max bit length for the codes */ +}; + +local static_tree_desc static_l_desc = +{static_ltree, extra_lbits, LITERALS+1, L_CODES, MAX_BITS}; + +local static_tree_desc static_d_desc = +{static_dtree, extra_dbits, 0, D_CODES, MAX_BITS}; + +local static_tree_desc static_bl_desc = +{(const ct_data *)0, extra_blbits, 0, BL_CODES, MAX_BL_BITS}; + +/* =========================================================================== + * Local (static) routines in this file. + */ + +local void tr_static_init OF((void)); +local void init_block OF((deflate_state *s)); +local void pqdownheap OF((deflate_state *s, ct_data *tree, int k)); +local void gen_bitlen OF((deflate_state *s, tree_desc *desc)); +local void gen_codes OF((ct_data *tree, int max_code, ushf *bl_count)); +local void build_tree OF((deflate_state *s, tree_desc *desc)); +local void scan_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local void send_tree OF((deflate_state *s, ct_data *tree, int max_code)); +local int build_bl_tree OF((deflate_state *s)); +local void send_all_trees OF((deflate_state *s, int lcodes, int dcodes, + int blcodes)); +local void compress_block OF((deflate_state *s, const ct_data *ltree, + const ct_data *dtree)); +local int detect_data_type OF((deflate_state *s)); +local unsigned bi_reverse OF((unsigned value, int length)); +local void bi_windup OF((deflate_state *s)); +local void bi_flush OF((deflate_state *s)); +local void copy_block OF((deflate_state *s, charf *buf, unsigned len, + int header)); + +#ifdef GEN_TREES_H +local void gen_trees_header OF((void)); +#endif + +#ifndef DEBUG +# define send_code(s, c, tree) send_bits(s, tree[c].Code, tree[c].Len) +/* Send a code of the given tree. c and tree must not have side effects */ + +#else /* DEBUG */ +# define send_code(s, c, tree) \ +{ if (z_verbose>2) fprintf(stderr,"\ncd %3d ",(c)); \ + send_bits(s, tree[c].Code, tree[c].Len); } +#endif + +/* =========================================================================== + * Output a short LSB first on the stream. + * IN assertion: there is enough room in pendingBuf. + */ +#define put_short(s, w) { \ + put_byte(s, (uch)((w) & 0xff)); \ + put_byte(s, (uch)((ush)(w) >> 8)); \ +} + +/* =========================================================================== + * Send a value on a given number of bits. + * IN assertion: length <= 16 and value fits in length bits. + */ +#ifdef DEBUG +local void send_bits OF((deflate_state *s, int value, int length)); + +local void send_bits(deflate_state *s, int value, int length) +{ + Tracevv((stderr," l %2d v %4x ", length, value)); + Assert(length > 0 && length <= 15, "invalid length"); + s->bits_sent += (ulg)length; + + /* If not enough room in bi_buf, use (valid) bits from bi_buf and + * (16 - bi_valid) bits from value, leaving (width - (16-bi_valid)) + * unused bits in value. + */ + if (s->bi_valid > (int)Buf_size - length) { + s->bi_buf |= (ush)value << s->bi_valid; + put_short(s, s->bi_buf); + s->bi_buf = (ush)value >> (Buf_size - s->bi_valid); + s->bi_valid += length - Buf_size; + } else { + s->bi_buf |= (ush)value << s->bi_valid; + s->bi_valid += length; + } +} +#else /* !DEBUG */ + +#define send_bits(s, value, length) \ +{ int len = length;\ + if (s->bi_valid > (int)Buf_size - len) {\ + int val = value;\ + s->bi_buf |= (ush)val << s->bi_valid;\ + put_short(s, s->bi_buf);\ + s->bi_buf = (ush)val >> (Buf_size - s->bi_valid);\ + s->bi_valid += len - Buf_size;\ + } else {\ + s->bi_buf |= (ush)(value) << s->bi_valid;\ + s->bi_valid += len;\ + }\ +} +#endif /* DEBUG */ + + +/* the arguments must not have side effects */ + +/* =========================================================================== + * Initialize the various 'constant' tables. + */ +local void tr_static_init(void) +{ +#if defined(GEN_TREES_H) || !defined(STDC) + static int static_init_done = 0; + int n; /* iterates over tree elements */ + int bits; /* bit counter */ + int length; /* length value */ + int codes; /* code value */ + int dist; /* distance index */ + ush bl_count[MAX_BITS+1]; + /* number of codes at each bit length for an optimal tree */ + + if (static_init_done) return; + + /* For some embedded targets, global variables are not initialized: */ +#ifdef NO_INIT_GLOBAL_POINTERS + static_l_desc.static_tree = static_ltree; + static_l_desc.extra_bits = extra_lbits; + static_d_desc.static_tree = static_dtree; + static_d_desc.extra_bits = extra_dbits; + static_bl_desc.extra_bits = extra_blbits; +#endif + + /* Initialize the mapping length (0..255) -> length code (0..28) */ + length = 0; + for (codes = 0; codes < LENGTH_CODES-1; codes++) { + base_length[codes] = length; + for (n = 0; n < (1<<extra_lbits[codes]); n++) { + _length_code[length++] = (uch)codes; + } + } + Assert (length == 256, "tr_static_init: length != 256"); + /* Note that the length 255 (match length 258) can be represented + * in two different ways: code 284 + 5 bits or code 285, so we + * overwrite length_code[255] to use the best encoding: + */ + _length_code[length-1] = (uch)codes; + + /* Initialize the mapping dist (0..32K) -> dist code (0..29) */ + dist = 0; + for (codes = 0 ; codes < 16; codes++) { + base_dist[codes] = dist; + for (n = 0; n < (1<<extra_dbits[codes]); n++) { + _dist_code[dist++] = (uch)codes; + } + } + Assert (dist == 256, "tr_static_init: dist != 256"); + dist >>= 7; /* from now on, all distances are divided by 128 */ + for ( ; codes < D_CODES; codes++) { + base_dist[codes] = dist << 7; + for (n = 0; n < (1<<(extra_dbits[codes]-7)); n++) { + _dist_code[256 + dist++] = (uch)codes; + } + } + Assert (dist == 256, "tr_static_init: 256+dist != 512"); + + /* Construct the codes of the static literal tree */ + for (bits = 0; bits <= MAX_BITS; bits++) bl_count[bits] = 0; + n = 0; + while (n <= 143) static_ltree[n++].Len = 8, bl_count[8]++; + while (n <= 255) static_ltree[n++].Len = 9, bl_count[9]++; + while (n <= 279) static_ltree[n++].Len = 7, bl_count[7]++; + while (n <= 287) static_ltree[n++].Len = 8, bl_count[8]++; + /* Codes 286 and 287 do not exist, but we must include them in the + * tree construction to get a canonical Huffman tree (longest code + * all ones) + */ + gen_codes((ct_data *)static_ltree, L_CODES+1, bl_count); + + /* The static distance tree is trivial: */ + for (n = 0; n < D_CODES; n++) { + static_dtree[n].Len = 5; + static_dtree[n].Code = bi_reverse((unsigned)n, 5); + } + static_init_done = 1; + +# ifdef GEN_TREES_H + gen_trees_header(); +# endif +#endif /* defined(GEN_TREES_H) || !defined(STDC) */ +} + +/* =========================================================================== + * Genererate the file trees.h describing the static trees. + */ +#ifdef GEN_TREES_H +# ifndef DEBUG +# include <stdio.h> +# endif + +# define SEPARATOR(i, last, width) \ + ((i) == (last)? "\n};\n\n" : \ + ((i) % (width) == (width)-1 ? ",\n" : ", ")) + +void gen_trees_header(void) +{ + FILE *header = fopen("trees.h", "w"); + int i; + + Assert (header != NULL, "Can't open trees.h"); + fprintf(header, + "/* header created automatically with -DGEN_TREES_H */\n\n"); + + fprintf(header, "local const ct_data static_ltree[L_CODES+2] = {\n"); + for (i = 0; i < L_CODES+2; i++) { + fprintf(header, "{{%3u},{%3u}}%s", static_ltree[i].Code, + static_ltree[i].Len, SEPARATOR(i, L_CODES+1, 5)); + } + + fprintf(header, "local const ct_data static_dtree[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "{{%2u},{%2u}}%s", static_dtree[i].Code, + static_dtree[i].Len, SEPARATOR(i, D_CODES-1, 5)); + } + + fprintf(header, "const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = {\n"); + for (i = 0; i < DIST_CODE_LEN; i++) { + fprintf(header, "%2u%s", _dist_code[i], + SEPARATOR(i, DIST_CODE_LEN-1, 20)); + } + + fprintf(header, + "const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= {\n"); + for (i = 0; i < MAX_MATCH-MIN_MATCH+1; i++) { + fprintf(header, "%2u%s", _length_code[i], + SEPARATOR(i, MAX_MATCH-MIN_MATCH, 20)); + } + + fprintf(header, "local const int base_length[LENGTH_CODES] = {\n"); + for (i = 0; i < LENGTH_CODES; i++) { + fprintf(header, "%1u%s", base_length[i], + SEPARATOR(i, LENGTH_CODES-1, 20)); + } + + fprintf(header, "local const int base_dist[D_CODES] = {\n"); + for (i = 0; i < D_CODES; i++) { + fprintf(header, "%5u%s", base_dist[i], + SEPARATOR(i, D_CODES-1, 10)); + } + + fclose(header); +} +#endif /* GEN_TREES_H */ + +/* =========================================================================== + * Initialize the tree data structures for a new zlib stream. + */ +void ZLIB_INTERNAL _tr_init(deflate_state *s) +{ + tr_static_init(); + + s->l_desc.dyn_tree = s->dyn_ltree; + s->l_desc.stat_desc = &static_l_desc; + + s->d_desc.dyn_tree = s->dyn_dtree; + s->d_desc.stat_desc = &static_d_desc; + + s->bl_desc.dyn_tree = s->bl_tree; + s->bl_desc.stat_desc = &static_bl_desc; + + s->bi_buf = 0; + s->bi_valid = 0; +#ifdef DEBUG + s->compressed_len = 0L; + s->bits_sent = 0L; +#endif + + /* Initialize the first block of the first file: */ + init_block(s); +} + +/* =========================================================================== + * Initialize a new block. + */ +local void init_block(deflate_state *s) +{ + int n; /* iterates over tree elements */ + + /* Initialize the trees. */ + for (n = 0; n < L_CODES; n++) s->dyn_ltree[n].Freq = 0; + for (n = 0; n < D_CODES; n++) s->dyn_dtree[n].Freq = 0; + for (n = 0; n < BL_CODES; n++) s->bl_tree[n].Freq = 0; + + s->dyn_ltree[END_BLOCK].Freq = 1; + s->opt_len = s->static_len = 0L; + s->last_lit = s->matches = 0; +} + +#define SMALLEST 1 +/* Index within the heap array of least frequent node in the Huffman tree */ + + +/* =========================================================================== + * Remove the smallest element from the heap and recreate the heap with + * one less element. Updates heap and heap_len. + */ +#define pqremove(s, tree, top) \ +{\ + top = s->heap[SMALLEST]; \ + s->heap[SMALLEST] = s->heap[s->heap_len--]; \ + pqdownheap(s, tree, SMALLEST); \ +} + +/* =========================================================================== + * Compares to subtrees, using the tree depth as tie breaker when + * the subtrees have equal frequency. This minimizes the worst case length. + */ +#define smaller(tree, n, m, depth) \ + (tree[n].Freq < tree[m].Freq || \ + (tree[n].Freq == tree[m].Freq && depth[n] <= depth[m])) + +/* =========================================================================== + * Restore the heap property by moving down the tree starting at node k, + * exchanging a node with the smallest of its two sons if necessary, stopping + * when the heap property is re-established (each father smaller than its + * two sons). + */ +local void pqdownheap(deflate_state *s, ct_data *tree, int k) +{ + int v = s->heap[k]; + int j = k << 1; /* left son of k */ + while (j <= s->heap_len) { + /* Set j to the smallest of the two sons: */ + if (j < s->heap_len && + smaller(tree, s->heap[j+1], s->heap[j], s->depth)) { + j++; + } + /* Exit if v is smaller than both sons */ + if (smaller(tree, v, s->heap[j], s->depth)) break; + + /* Exchange v with the smallest son */ + s->heap[k] = s->heap[j]; k = j; + + /* And continue down the tree, setting j to the left son of k */ + j <<= 1; + } + s->heap[k] = v; +} + +/* =========================================================================== + * Compute the optimal bit lengths for a tree and update the total bit length + * for the current block. + * IN assertion: the fields freq and dad are set, heap[heap_max] and + * above are the tree nodes sorted by increasing frequency. + * OUT assertions: the field len is set to the optimal bit length, the + * array bl_count contains the frequencies for each bit length. + * The length opt_len is updated; static_len is also updated if stree is + * not null. + */ +local void gen_bitlen(deflate_state *s, tree_desc *desc) +{ + ct_data *tree = desc->dyn_tree; + int max_code = desc->max_code; + const ct_data *stree = desc->stat_desc->static_tree; + const intf *extra = desc->stat_desc->extra_bits; + int base = desc->stat_desc->extra_base; + int max_length = desc->stat_desc->max_length; + int h; /* heap index */ + int n, m; /* iterate over the tree elements */ + int bits; /* bit length */ + int xbits; /* extra bits */ + ush f; /* frequency */ + int overflow = 0; /* number of elements with bit length too large */ + + for (bits = 0; bits <= MAX_BITS; bits++) s->bl_count[bits] = 0; + + /* In a first pass, compute the optimal bit lengths (which may + * overflow in the case of the bit length tree). + */ + tree[s->heap[s->heap_max]].Len = 0; /* root of the heap */ + + for (h = s->heap_max+1; h < HEAP_SIZE; h++) { + n = s->heap[h]; + bits = tree[tree[n].Dad].Len + 1; + if (bits > max_length) bits = max_length, overflow++; + tree[n].Len = (ush)bits; + /* We overwrite tree[n].Dad which is no longer needed */ + + if (n > max_code) continue; /* not a leaf node */ + + s->bl_count[bits]++; + xbits = 0; + if (n >= base) xbits = extra[n-base]; + f = tree[n].Freq; + s->opt_len += (ulg)f * (bits + xbits); + if (stree) s->static_len += (ulg)f * (stree[n].Len + xbits); + } + if (overflow == 0) return; + + Trace((stderr,"\nbit length overflow\n")); + /* This happens for example on obj2 and pic of the Calgary corpus */ + + /* Find the first bit length which could increase: */ + do { + bits = max_length-1; + while (s->bl_count[bits] == 0) bits--; + s->bl_count[bits]--; /* move one leaf down the tree */ + s->bl_count[bits+1] += 2; /* move one overflow item as its brother */ + s->bl_count[max_length]--; + /* The brother of the overflow item also moves one step up, + * but this does not affect bl_count[max_length] + */ + overflow -= 2; + } while (overflow > 0); + + /* Now recompute all bit lengths, scanning in increasing frequency. + * h is still equal to HEAP_SIZE. (It is simpler to reconstruct all + * lengths instead of fixing only the wrong ones. This idea is taken + * from 'ar' written by Haruhiko Okumura.) + */ + for (bits = max_length; bits != 0; bits--) { + n = s->bl_count[bits]; + while (n != 0) { + m = s->heap[--h]; + if (m > max_code) continue; + if ((unsigned) tree[m].Len != (unsigned) bits) { + Trace((stderr,"code %d bits %d->%d\n", m, tree[m].Len, bits)); + s->opt_len += ((long)bits - (long)tree[m].Len) + *(long)tree[m].Freq; + tree[m].Len = (ush)bits; + } + n--; + } + } +} + +/* =========================================================================== + * Generate the codes for a given tree and bit counts (which need not be + * optimal). + * IN assertion: the array bl_count contains the bit length statistics for + * the given tree and the field len is set for all tree elements. + * OUT assertion: the field code is set for all tree elements of non + * zero code length. + */ +local void gen_codes (ct_data *tree, int max_code, ushf *bl_count) +{ + ush next_code[MAX_BITS+1]; /* next code value for each bit length */ + ush codes = 0; /* running code value */ + int bits; /* bit index */ + int n; /* code index */ + + /* The distribution counts are first used to generate the code values + * without bit reversal. + */ + for (bits = 1; bits <= MAX_BITS; bits++) { + next_code[bits] = codes = (codes + bl_count[bits-1]) << 1; + } + /* Check that the bit counts in bl_count are consistent. The last code + * must be all ones. + */ + Assert (codes + bl_count[MAX_BITS]-1 == (1<<MAX_BITS)-1, + "inconsistent bit counts"); + Tracev((stderr,"\ngen_codes: max_code %d ", max_code)); + + for (n = 0; n <= max_code; n++) { + int len = tree[n].Len; + if (len == 0) continue; + /* Now reverse the bits */ + tree[n].Code = bi_reverse(next_code[len]++, len); + + Tracecv(tree != static_ltree, (stderr,"\nn %3d %c l %2d c %4x (%x) ", + n, (isgraph(n) ? n : ' '), len, tree[n].Code, next_code[len]-1)); + } +} + +/* =========================================================================== + * Construct one Huffman tree and assigns the code bit strings and lengths. + * Update the total bit length for the current block. + * IN assertion: the field freq is set for all tree elements. + * OUT assertions: the fields len and code are set to the optimal bit length + * and corresponding code. The length opt_len is updated; static_len is + * also updated if stree is not null. The field max_code is set. + */ +local void build_tree(deflate_state *s, tree_desc *desc) +{ + ct_data *tree = desc->dyn_tree; + const ct_data *stree = desc->stat_desc->static_tree; + int elems = desc->stat_desc->elems; + int n, m; /* iterate over heap elements */ + int max_code = -1; /* largest code with non zero frequency */ + int node; /* new node being created */ + + /* Construct the initial heap, with least frequent element in + * heap[SMALLEST]. The sons of heap[n] are heap[2*n] and heap[2*n+1]. + * heap[0] is not used. + */ + s->heap_len = 0, s->heap_max = HEAP_SIZE; + + for (n = 0; n < elems; n++) { + if (tree[n].Freq != 0) { + s->heap[++(s->heap_len)] = max_code = n; + s->depth[n] = 0; + } else { + tree[n].Len = 0; + } + } + + /* The pkzip format requires that at least one distance code exists, + * and that at least one bit should be sent even if there is only one + * possible code. So to avoid special checks later on we force at least + * two codes of non zero frequency. + */ + while (s->heap_len < 2) { + node = s->heap[++(s->heap_len)] = (max_code < 2 ? ++max_code : 0); + tree[node].Freq = 1; + s->depth[node] = 0; + s->opt_len--; if (stree) s->static_len -= stree[node].Len; + /* node is 0 or 1 so it does not have extra bits */ + } + desc->max_code = max_code; + + /* The elements heap[heap_len/2+1 .. heap_len] are leaves of the tree, + * establish sub-heaps of increasing lengths: + */ + for (n = s->heap_len/2; n >= 1; n--) pqdownheap(s, tree, n); + + /* Construct the Huffman tree by repeatedly combining the least two + * frequent nodes. + */ + node = elems; /* next internal node of the tree */ + do { + pqremove(s, tree, n); /* n = node of least frequency */ + m = s->heap[SMALLEST]; /* m = node of next least frequency */ + + s->heap[--(s->heap_max)] = n; /* keep the nodes sorted by frequency */ + s->heap[--(s->heap_max)] = m; + + /* Create a new node father of n and m */ + tree[node].Freq = tree[n].Freq + tree[m].Freq; + s->depth[node] = (uch)((s->depth[n] >= s->depth[m] ? + s->depth[n] : s->depth[m]) + 1); + tree[n].Dad = tree[m].Dad = (ush)node; +#ifdef DUMP_BL_TREE + if (tree == s->bl_tree) { + fprintf(stderr,"\nnode %d(%d), sons %d(%d) %d(%d)", + node, tree[node].Freq, n, tree[n].Freq, m, tree[m].Freq); + } +#endif + /* and insert the new node in the heap */ + s->heap[SMALLEST] = node++; + pqdownheap(s, tree, SMALLEST); + + } while (s->heap_len >= 2); + + s->heap[--(s->heap_max)] = s->heap[SMALLEST]; + + /* At this point, the fields freq and dad are set. We can now + * generate the bit lengths. + */ + gen_bitlen(s, (tree_desc *)desc); + + /* The field len is now set, we can generate the bit codes */ + gen_codes ((ct_data *)tree, max_code, s->bl_count); +} + +/* =========================================================================== + * Scan a literal or distance tree to determine the frequencies of the codes + * in the bit length tree. + */ +local void scan_tree (deflate_state *s, ct_data *tree, int max_code) +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + if (nextlen == 0) max_count = 138, min_count = 3; + tree[max_code+1].Len = (ush)0xffff; /* guard */ + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + s->bl_tree[curlen].Freq += count; + } else if (curlen != 0) { + if (curlen != prevlen) s->bl_tree[curlen].Freq++; + s->bl_tree[REP_3_6].Freq++; + } else if (count <= 10) { + s->bl_tree[REPZ_3_10].Freq++; + } else { + s->bl_tree[REPZ_11_138].Freq++; + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Send a literal or distance tree in compressed form, using the codes in + * bl_tree. + */ +local void send_tree (deflate_state *s, ct_data *tree, int max_code) +{ + int n; /* iterates over all tree elements */ + int prevlen = -1; /* last emitted length */ + int curlen; /* length of current code */ + int nextlen = tree[0].Len; /* length of next code */ + int count = 0; /* repeat count of the current code */ + int max_count = 7; /* max repeat count */ + int min_count = 4; /* min repeat count */ + + /* tree[max_code+1].Len = -1; */ /* guard already set */ + if (nextlen == 0) max_count = 138, min_count = 3; + + for (n = 0; n <= max_code; n++) { + curlen = nextlen; nextlen = tree[n+1].Len; + if (++count < max_count && curlen == nextlen) { + continue; + } else if (count < min_count) { + do { send_code(s, curlen, s->bl_tree); } while (--count != 0); + + } else if (curlen != 0) { + if (curlen != prevlen) { + send_code(s, curlen, s->bl_tree); count--; + } + Assert(count >= 3 && count <= 6, " 3_6?"); + send_code(s, REP_3_6, s->bl_tree); send_bits(s, count-3, 2); + + } else if (count <= 10) { + send_code(s, REPZ_3_10, s->bl_tree); send_bits(s, count-3, 3); + + } else { + send_code(s, REPZ_11_138, s->bl_tree); send_bits(s, count-11, 7); + } + count = 0; prevlen = curlen; + if (nextlen == 0) { + max_count = 138, min_count = 3; + } else if (curlen == nextlen) { + max_count = 6, min_count = 3; + } else { + max_count = 7, min_count = 4; + } + } +} + +/* =========================================================================== + * Construct the Huffman tree for the bit lengths and return the index in + * bl_order of the last bit length code to send. + */ +local int build_bl_tree(deflate_state *s) +{ + int max_blindex; /* index of last bit length code of non zero freq */ + + /* Determine the bit length frequencies for literal and distance trees */ + scan_tree(s, (ct_data *)s->dyn_ltree, s->l_desc.max_code); + scan_tree(s, (ct_data *)s->dyn_dtree, s->d_desc.max_code); + + /* Build the bit length tree: */ + build_tree(s, (tree_desc *)(&(s->bl_desc))); + /* opt_len now includes the length of the tree representations, except + * the lengths of the bit lengths codes and the 5+5+4 bits for the counts. + */ + + /* Determine the number of bit length codes to send. The pkzip format + * requires that at least 4 bit length codes be sent. (appnote.txt says + * 3 but the actual value used is 4.) + */ + for (max_blindex = BL_CODES-1; max_blindex >= 3; max_blindex--) { + if (s->bl_tree[bl_order[max_blindex]].Len != 0) break; + } + /* Update opt_len to include the bit length tree and counts */ + s->opt_len += 3*(max_blindex+1) + 5+5+4; + Tracev((stderr, "\ndyn trees: dyn %ld, stat %ld", + s->opt_len, s->static_len)); + + return max_blindex; +} + +/* =========================================================================== + * Send the header for a block using dynamic Huffman trees: the counts, the + * lengths of the bit length codes, the literal tree and the distance tree. + * IN assertion: lcodes >= 257, dcodes >= 1, blcodes >= 4. + */ +local void send_all_trees(deflate_state *s, int lcodes, int dcodes, int blcodes) +{ + int rank; /* index in bl_order */ + + Assert (lcodes >= 257 && dcodes >= 1 && blcodes >= 4, "not enough codes"); + Assert (lcodes <= L_CODES && dcodes <= D_CODES && blcodes <= BL_CODES, + "too many codes"); + Tracev((stderr, "\nbl counts: ")); + send_bits(s, lcodes-257, 5); /* not +255 as stated in appnote.txt */ + send_bits(s, dcodes-1, 5); + send_bits(s, blcodes-4, 4); /* not -3 as stated in appnote.txt */ + for (rank = 0; rank < blcodes; rank++) { + Tracev((stderr, "\nbl code %2d ", bl_order[rank])); + send_bits(s, s->bl_tree[bl_order[rank]].Len, 3); + } + Tracev((stderr, "\nbl tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_ltree, lcodes-1); /* literal tree */ + Tracev((stderr, "\nlit tree: sent %ld", s->bits_sent)); + + send_tree(s, (ct_data *)s->dyn_dtree, dcodes-1); /* distance tree */ + Tracev((stderr, "\ndist tree: sent %ld", s->bits_sent)); +} + +/* =========================================================================== + * Send a stored block + */ +void ZLIB_INTERNAL _tr_stored_block(deflate_state *s, charf *buf, ulg stored_len, int last) +{ + send_bits(s, (STORED_BLOCK<<1)+last, 3); /* send block type */ +#ifdef DEBUG + s->compressed_len = (s->compressed_len + 3 + 7) & (ulg)~7L; + s->compressed_len += (stored_len + 4) << 3; +#endif + copy_block(s, buf, (unsigned)stored_len, 1); /* with header */ +} + +/* =========================================================================== + * Flush the bits in the bit buffer to pending output (leaves at most 7 bits) + */ +void ZLIB_INTERNAL _tr_flush_bits(deflate_state *s) +{ + bi_flush(s); +} + +/* =========================================================================== + * Send one empty static block to give enough lookahead for inflate. + * This takes 10 bits, of which 7 may remain in the bit buffer. + */ +void ZLIB_INTERNAL _tr_align(deflate_state *s) +{ + send_bits(s, STATIC_TREES<<1, 3); + send_code(s, END_BLOCK, static_ltree); +#ifdef DEBUG + s->compressed_len += 10L; /* 3 for block type, 7 for EOB */ +#endif + bi_flush(s); +} + +/* =========================================================================== + * Determine the best encoding for the current block: dynamic trees, static + * trees or store, and output the encoded block to the zip file. + */ +void ZLIB_INTERNAL _tr_flush_block(deflate_state *s, charf *buf, ulg stored_len, int last) +{ + ulg opt_lenb, static_lenb; /* opt_len and static_len in bytes */ + int max_blindex = 0; /* index of last bit length code of non zero freq */ + + /* Build the Huffman trees unless a stored block is forced */ + if (s->level > 0) { + + /* Check if the file is binary or text */ + if (s->strm->data_type == Z_UNKNOWN) + s->strm->data_type = detect_data_type(s); + + /* Construct the literal and distance trees */ + build_tree(s, (tree_desc *)(&(s->l_desc))); + Tracev((stderr, "\nlit data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + + build_tree(s, (tree_desc *)(&(s->d_desc))); + Tracev((stderr, "\ndist data: dyn %ld, stat %ld", s->opt_len, + s->static_len)); + /* At this point, opt_len and static_len are the total bit lengths of + * the compressed block data, excluding the tree representations. + */ + + /* Build the bit length tree for the above two trees, and get the index + * in bl_order of the last bit length code to send. + */ + max_blindex = build_bl_tree(s); + + /* Determine the best encoding. Compute the block lengths in bytes. */ + opt_lenb = (s->opt_len+3+7)>>3; + static_lenb = (s->static_len+3+7)>>3; + + Tracev((stderr, "\nopt %lu(%lu) stat %lu(%lu) stored %lu lit %u ", + opt_lenb, s->opt_len, static_lenb, s->static_len, stored_len, + s->last_lit)); + + if (static_lenb <= opt_lenb) opt_lenb = static_lenb; + + } else { + Assert(buf != (char*)0, "lost buf"); + opt_lenb = static_lenb = stored_len + 5; /* force a stored block */ + } + +#ifdef FORCE_STORED + if (buf != (char*)0) { /* force stored block */ +#else + if (stored_len+4 <= opt_lenb && buf != (char*)0) { + /* 4: two words for the lengths */ +#endif + /* The test buf != NULL is only necessary if LIT_BUFSIZE > WSIZE. + * Otherwise we can't have processed more than WSIZE input bytes since + * the last block flush, because compression would have been + * successful. If LIT_BUFSIZE <= WSIZE, it is never too late to + * transform a block into a stored block. + */ + _tr_stored_block(s, buf, stored_len, last); + +#ifdef FORCE_STATIC + } else if (static_lenb >= 0) { /* force static trees */ +#else + } else if (s->strategy == Z_FIXED || static_lenb == opt_lenb) { +#endif + send_bits(s, (STATIC_TREES<<1)+last, 3); + compress_block(s, (const ct_data *)static_ltree, + (const ct_data *)static_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->static_len; +#endif + } else { + send_bits(s, (DYN_TREES<<1)+last, 3); + send_all_trees(s, s->l_desc.max_code+1, s->d_desc.max_code+1, + max_blindex+1); + compress_block(s, (const ct_data *)s->dyn_ltree, + (const ct_data *)s->dyn_dtree); +#ifdef DEBUG + s->compressed_len += 3 + s->opt_len; +#endif + } + Assert (s->compressed_len == s->bits_sent, "bad compressed size"); + /* The above check is made mod 2^32, for files larger than 512 MB + * and uLong implemented on 32 bits. + */ + init_block(s); + + if (last) { + bi_windup(s); +#ifdef DEBUG + s->compressed_len += 7; /* align on byte boundary */ +#endif + } + Tracev((stderr,"\ncomprlen %lu(%lu) ", s->compressed_len>>3, + s->compressed_len-7*last)); + } + + /* =========================================================================== + * Save the match info and tally the frequency counts. Return true if + * the current block must be flushed. + */ + int ZLIB_INTERNAL _tr_tally (deflate_state *s, unsigned dist, unsigned lc) + { + s->d_buf[s->last_lit] = (ush)dist; + s->l_buf[s->last_lit++] = (uch)lc; + if (dist == 0) { + /* lc is the unmatched char */ + s->dyn_ltree[lc].Freq++; + } else { + s->matches++; + /* Here, lc is the match length - MIN_MATCH */ + dist--; /* dist = match distance - 1 */ + Assert((ush)dist < (ush)MAX_DIST(s) && + (ush)lc <= (ush)(MAX_MATCH-MIN_MATCH) && + (ush)d_code(dist) < (ush)D_CODES, "_tr_tally: bad match"); + + s->dyn_ltree[_length_code[lc]+LITERALS+1].Freq++; + s->dyn_dtree[d_code(dist)].Freq++; + } + +#ifdef TRUNCATE_BLOCK + /* Try to guess if it is profitable to stop the current block here */ + if ((s->last_lit & 0x1fff) == 0 && s->level > 2) { + /* Compute an upper bound for the compressed length */ + ulg out_length = (ulg)s->last_lit*8L; + ulg in_length = (ulg)((long)s->strstart - s->block_start); + int dcode; + for (dcode = 0; dcode < D_CODES; dcode++) { + out_length += (ulg)s->dyn_dtree[dcode].Freq * + (5L+extra_dbits[dcode]); + } + out_length >>= 3; + Tracev((stderr,"\nlast_lit %u, in %ld, out ~%ld(%ld%%) ", + s->last_lit, in_length, out_length, + 100L - out_length*100L/in_length)); + if (s->matches < s->last_lit/2 && out_length < in_length/2) return 1; + } +#endif + return (s->last_lit == s->lit_bufsize-1); + /* We avoid equality with lit_bufsize because of wraparound at 64K + * on 16 bit machines and because stored blocks are restricted to + * 64K-1 bytes. + */ + } + + /* =========================================================================== + * Send the block data compressed using the given Huffman trees + */ + local void compress_block(deflate_state *s, const ct_data *ltree, const ct_data *dtree) + { + unsigned dist; /* distance of matched string */ + int lc; /* match length or unmatched char (if dist == 0) */ + unsigned lx = 0; /* running index in l_buf */ + unsigned codes; /* the code to send */ + int extra; /* number of extra bits to send */ + + if (s->last_lit != 0) do { + dist = s->d_buf[lx]; + lc = s->l_buf[lx++]; + if (dist == 0) { + send_code(s, lc, ltree); /* send a literal byte */ + Tracecv(isgraph(lc), (stderr," '%c' ", lc)); + } else { + /* Here, lc is the match length - MIN_MATCH */ + codes = _length_code[lc]; + send_code(s, codes + LITERALS+1, ltree); /* send the length code */ + extra = extra_lbits[codes]; + if (extra != 0) { + lc -= base_length[codes]; + send_bits(s, lc, extra); /* send the extra length bits */ + } + dist--; /* dist is now the match distance - 1 */ + codes = d_code(dist); + Assert (codes < D_CODES, "bad d_code"); + + send_code(s, codes, dtree); /* send the distance code */ + extra = extra_dbits[codes]; + if (extra != 0) { + dist -= base_dist[codes]; + send_bits(s, dist, extra); /* send the extra distance bits */ + } + } /* literal or match pair ? */ + + /* Check that the overlay between pending_buf and d_buf+l_buf is ok: */ + Assert((uInt)(s->pending) < s->lit_bufsize + 2*lx, + "pendingBuf overflow"); + + } while (lx < s->last_lit); + + send_code(s, END_BLOCK, ltree); + } + + /* =========================================================================== + * Check if the data type is TEXT or BINARY, using the following algorithm: + * - TEXT if the two conditions below are satisfied: + * a) There are no non-portable control characters belonging to the + * "black list" (0..6, 14..25, 28..31). + * b) There is at least one printable character belonging to the + * "white list" (9 {TAB}, 10 {LF}, 13 {CR}, 32..255). + * - BINARY otherwise. + * - The following partially-portable control characters form a + * "gray list" that is ignored in this detection algorithm: + * (7 {BEL}, 8 {BS}, 11 {VT}, 12 {FF}, 26 {SUB}, 27 {ESC}). + * IN assertion: the fields Freq of dyn_ltree are set. + */ + local int detect_data_type(deflate_state *s) + { + /* black_mask is the bit mask of black-listed bytes + * set bits 0..6, 14..25, and 28..31 + * 0xf3ffc07f = binary 11110011111111111100000001111111 + */ + unsigned long black_mask = 0xf3ffc07fUL; + int n; + + /* Check for non-textual ("black-listed") bytes. */ + for (n = 0; n <= 31; n++, black_mask >>= 1) + if ((black_mask & 1) && (s->dyn_ltree[n].Freq != 0)) + return Z_BINARY; + + /* Check for textual ("white-listed") bytes. */ + if (s->dyn_ltree[9].Freq != 0 || s->dyn_ltree[10].Freq != 0 + || s->dyn_ltree[13].Freq != 0) + return Z_TEXT; + for (n = 32; n < LITERALS; n++) + if (s->dyn_ltree[n].Freq != 0) + return Z_TEXT; + + /* There are no "black-listed" or "white-listed" bytes: + * this stream either is empty or has tolerated ("gray-listed") bytes only. + */ + return Z_BINARY; + } + + /* =========================================================================== + * Reverse the first len bits of a code, using straightforward code (a faster + * method would use a table) + * IN assertion: 1 <= len <= 15 + */ + local unsigned bi_reverse(unsigned codes, int len) + { + register unsigned res = 0; + do { + res |= codes & 1; + codes >>= 1, res <<= 1; + } while (--len > 0); + return res >> 1; + } + + /* =========================================================================== + * Flush the bit buffer, keeping at most 7 bits in it. + */ + local void bi_flush(deflate_state *s) + { + if (s->bi_valid == 16) { + put_short(s, s->bi_buf); + s->bi_buf = 0; + s->bi_valid = 0; + } else if (s->bi_valid >= 8) { + put_byte(s, (Byte)s->bi_buf); + s->bi_buf >>= 8; + s->bi_valid -= 8; + } + } + + /* =========================================================================== + * Flush the bit buffer and align the output on a byte boundary + */ + local void bi_windup(deflate_state *s) + { + if (s->bi_valid > 8) { + put_short(s, s->bi_buf); + } else if (s->bi_valid > 0) { + put_byte(s, (Byte)s->bi_buf); + } + s->bi_buf = 0; + s->bi_valid = 0; +#ifdef DEBUG + s->bits_sent = (s->bits_sent+7) & ~7; +#endif + } + + /* =========================================================================== + * Copy a stored block, storing first the length and its + * one's complement if requested. + */ + local void copy_block(deflate_state *s, charf *buf, unsigned len, int header) + { + bi_windup(s); /* align on byte boundary */ + + if (header) { + put_short(s, (ush)len); + put_short(s, (ush)~len); +#ifdef DEBUG + s->bits_sent += 2*16; +#endif + } +#ifdef DEBUG + s->bits_sent += (ulg)len<<3; +#endif + while (len--) { + put_byte(s, *buf++); + } + } diff --git a/deps/zlib/trees.h b/deps/zlib/trees.h new file mode 100644 index 0000000..c0261b2 --- /dev/null +++ b/deps/zlib/trees.h @@ -0,0 +1,132 @@ +/* header created automatically with -DGEN_TREES_H */ +#ifndef _TREES_H +#define _TREES_H + +local const ct_data static_ltree[L_CODES+2] = { +{{ 12},{ 8}}, {{140},{ 8}}, {{ 76},{ 8}}, {{204},{ 8}}, {{ 44},{ 8}}, +{{172},{ 8}}, {{108},{ 8}}, {{236},{ 8}}, {{ 28},{ 8}}, {{156},{ 8}}, +{{ 92},{ 8}}, {{220},{ 8}}, {{ 60},{ 8}}, {{188},{ 8}}, {{124},{ 8}}, +{{252},{ 8}}, {{ 2},{ 8}}, {{130},{ 8}}, {{ 66},{ 8}}, {{194},{ 8}}, +{{ 34},{ 8}}, {{162},{ 8}}, {{ 98},{ 8}}, {{226},{ 8}}, {{ 18},{ 8}}, +{{146},{ 8}}, {{ 82},{ 8}}, {{210},{ 8}}, {{ 50},{ 8}}, {{178},{ 8}}, +{{114},{ 8}}, {{242},{ 8}}, {{ 10},{ 8}}, {{138},{ 8}}, {{ 74},{ 8}}, +{{202},{ 8}}, {{ 42},{ 8}}, {{170},{ 8}}, {{106},{ 8}}, {{234},{ 8}}, +{{ 26},{ 8}}, {{154},{ 8}}, {{ 90},{ 8}}, {{218},{ 8}}, {{ 58},{ 8}}, +{{186},{ 8}}, {{122},{ 8}}, {{250},{ 8}}, {{ 6},{ 8}}, {{134},{ 8}}, +{{ 70},{ 8}}, {{198},{ 8}}, {{ 38},{ 8}}, {{166},{ 8}}, {{102},{ 8}}, +{{230},{ 8}}, {{ 22},{ 8}}, {{150},{ 8}}, {{ 86},{ 8}}, {{214},{ 8}}, +{{ 54},{ 8}}, {{182},{ 8}}, {{118},{ 8}}, {{246},{ 8}}, {{ 14},{ 8}}, +{{142},{ 8}}, {{ 78},{ 8}}, {{206},{ 8}}, {{ 46},{ 8}}, {{174},{ 8}}, +{{110},{ 8}}, {{238},{ 8}}, {{ 30},{ 8}}, {{158},{ 8}}, {{ 94},{ 8}}, +{{222},{ 8}}, {{ 62},{ 8}}, {{190},{ 8}}, {{126},{ 8}}, {{254},{ 8}}, +{{ 1},{ 8}}, {{129},{ 8}}, {{ 65},{ 8}}, {{193},{ 8}}, {{ 33},{ 8}}, +{{161},{ 8}}, {{ 97},{ 8}}, {{225},{ 8}}, {{ 17},{ 8}}, {{145},{ 8}}, +{{ 81},{ 8}}, {{209},{ 8}}, {{ 49},{ 8}}, {{177},{ 8}}, {{113},{ 8}}, +{{241},{ 8}}, {{ 9},{ 8}}, {{137},{ 8}}, {{ 73},{ 8}}, {{201},{ 8}}, +{{ 41},{ 8}}, {{169},{ 8}}, {{105},{ 8}}, {{233},{ 8}}, {{ 25},{ 8}}, +{{153},{ 8}}, {{ 89},{ 8}}, {{217},{ 8}}, {{ 57},{ 8}}, {{185},{ 8}}, +{{121},{ 8}}, {{249},{ 8}}, {{ 5},{ 8}}, {{133},{ 8}}, {{ 69},{ 8}}, +{{197},{ 8}}, {{ 37},{ 8}}, {{165},{ 8}}, {{101},{ 8}}, {{229},{ 8}}, +{{ 21},{ 8}}, {{149},{ 8}}, {{ 85},{ 8}}, {{213},{ 8}}, {{ 53},{ 8}}, +{{181},{ 8}}, {{117},{ 8}}, {{245},{ 8}}, {{ 13},{ 8}}, {{141},{ 8}}, +{{ 77},{ 8}}, {{205},{ 8}}, {{ 45},{ 8}}, {{173},{ 8}}, {{109},{ 8}}, +{{237},{ 8}}, {{ 29},{ 8}}, {{157},{ 8}}, {{ 93},{ 8}}, {{221},{ 8}}, +{{ 61},{ 8}}, {{189},{ 8}}, {{125},{ 8}}, {{253},{ 8}}, {{ 19},{ 9}}, +{{275},{ 9}}, {{147},{ 9}}, {{403},{ 9}}, {{ 83},{ 9}}, {{339},{ 9}}, +{{211},{ 9}}, {{467},{ 9}}, {{ 51},{ 9}}, {{307},{ 9}}, {{179},{ 9}}, +{{435},{ 9}}, {{115},{ 9}}, {{371},{ 9}}, {{243},{ 9}}, {{499},{ 9}}, +{{ 11},{ 9}}, {{267},{ 9}}, {{139},{ 9}}, {{395},{ 9}}, {{ 75},{ 9}}, +{{331},{ 9}}, {{203},{ 9}}, {{459},{ 9}}, {{ 43},{ 9}}, {{299},{ 9}}, +{{171},{ 9}}, {{427},{ 9}}, {{107},{ 9}}, {{363},{ 9}}, {{235},{ 9}}, +{{491},{ 9}}, {{ 27},{ 9}}, {{283},{ 9}}, {{155},{ 9}}, {{411},{ 9}}, +{{ 91},{ 9}}, {{347},{ 9}}, {{219},{ 9}}, {{475},{ 9}}, {{ 59},{ 9}}, +{{315},{ 9}}, {{187},{ 9}}, {{443},{ 9}}, {{123},{ 9}}, {{379},{ 9}}, +{{251},{ 9}}, {{507},{ 9}}, {{ 7},{ 9}}, {{263},{ 9}}, {{135},{ 9}}, +{{391},{ 9}}, {{ 71},{ 9}}, {{327},{ 9}}, {{199},{ 9}}, {{455},{ 9}}, +{{ 39},{ 9}}, {{295},{ 9}}, {{167},{ 9}}, {{423},{ 9}}, {{103},{ 9}}, +{{359},{ 9}}, {{231},{ 9}}, {{487},{ 9}}, {{ 23},{ 9}}, {{279},{ 9}}, +{{151},{ 9}}, {{407},{ 9}}, {{ 87},{ 9}}, {{343},{ 9}}, {{215},{ 9}}, +{{471},{ 9}}, {{ 55},{ 9}}, {{311},{ 9}}, {{183},{ 9}}, {{439},{ 9}}, +{{119},{ 9}}, {{375},{ 9}}, {{247},{ 9}}, {{503},{ 9}}, {{ 15},{ 9}}, +{{271},{ 9}}, {{143},{ 9}}, {{399},{ 9}}, {{ 79},{ 9}}, {{335},{ 9}}, +{{207},{ 9}}, {{463},{ 9}}, {{ 47},{ 9}}, {{303},{ 9}}, {{175},{ 9}}, +{{431},{ 9}}, {{111},{ 9}}, {{367},{ 9}}, {{239},{ 9}}, {{495},{ 9}}, +{{ 31},{ 9}}, {{287},{ 9}}, {{159},{ 9}}, {{415},{ 9}}, {{ 95},{ 9}}, +{{351},{ 9}}, {{223},{ 9}}, {{479},{ 9}}, {{ 63},{ 9}}, {{319},{ 9}}, +{{191},{ 9}}, {{447},{ 9}}, {{127},{ 9}}, {{383},{ 9}}, {{255},{ 9}}, +{{511},{ 9}}, {{ 0},{ 7}}, {{ 64},{ 7}}, {{ 32},{ 7}}, {{ 96},{ 7}}, +{{ 16},{ 7}}, {{ 80},{ 7}}, {{ 48},{ 7}}, {{112},{ 7}}, {{ 8},{ 7}}, +{{ 72},{ 7}}, {{ 40},{ 7}}, {{104},{ 7}}, {{ 24},{ 7}}, {{ 88},{ 7}}, +{{ 56},{ 7}}, {{120},{ 7}}, {{ 4},{ 7}}, {{ 68},{ 7}}, {{ 36},{ 7}}, +{{100},{ 7}}, {{ 20},{ 7}}, {{ 84},{ 7}}, {{ 52},{ 7}}, {{116},{ 7}}, +{{ 3},{ 8}}, {{131},{ 8}}, {{ 67},{ 8}}, {{195},{ 8}}, {{ 35},{ 8}}, +{{163},{ 8}}, {{ 99},{ 8}}, {{227},{ 8}} +}; + +local const ct_data static_dtree[D_CODES] = { +{{ 0},{ 5}}, {{16},{ 5}}, {{ 8},{ 5}}, {{24},{ 5}}, {{ 4},{ 5}}, +{{20},{ 5}}, {{12},{ 5}}, {{28},{ 5}}, {{ 2},{ 5}}, {{18},{ 5}}, +{{10},{ 5}}, {{26},{ 5}}, {{ 6},{ 5}}, {{22},{ 5}}, {{14},{ 5}}, +{{30},{ 5}}, {{ 1},{ 5}}, {{17},{ 5}}, {{ 9},{ 5}}, {{25},{ 5}}, +{{ 5},{ 5}}, {{21},{ 5}}, {{13},{ 5}}, {{29},{ 5}}, {{ 3},{ 5}}, +{{19},{ 5}}, {{11},{ 5}}, {{27},{ 5}}, {{ 7},{ 5}}, {{23},{ 5}} +}; + +const uch ZLIB_INTERNAL _dist_code[DIST_CODE_LEN] = { + 0, 1, 2, 3, 4, 4, 5, 5, 6, 6, 6, 6, 7, 7, 7, 7, 8, 8, 8, 8, + 8, 8, 8, 8, 9, 9, 9, 9, 9, 9, 9, 9, 10, 10, 10, 10, 10, 10, 10, 10, +10, 10, 10, 10, 10, 10, 10, 10, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, 11, +11, 11, 11, 11, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, +12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 12, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, 13, +13, 13, 13, 13, 13, 13, 13, 13, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, +14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 14, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, +15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 15, 0, 0, 16, 17, +18, 18, 19, 19, 20, 20, 20, 20, 21, 21, 21, 21, 22, 22, 22, 22, 22, 22, 22, 22, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, 28, +28, 28, 28, 28, 28, 28, 28, 28, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, +29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29, 29 +}; + +const uch ZLIB_INTERNAL _length_code[MAX_MATCH-MIN_MATCH+1]= { + 0, 1, 2, 3, 4, 5, 6, 7, 8, 8, 9, 9, 10, 10, 11, 11, 12, 12, 12, 12, +13, 13, 13, 13, 14, 14, 14, 14, 15, 15, 15, 15, 16, 16, 16, 16, 16, 16, 16, 16, +17, 17, 17, 17, 17, 17, 17, 17, 18, 18, 18, 18, 18, 18, 18, 18, 19, 19, 19, 19, +19, 19, 19, 19, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, 20, +21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 21, 22, 22, 22, 22, +22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 22, 23, 23, 23, 23, 23, 23, 23, 23, +23, 23, 23, 23, 23, 23, 23, 23, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, 24, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, +25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 25, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, 26, +26, 26, 26, 26, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, +27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 27, 28 +}; + +local const int base_length[LENGTH_CODES] = { +0, 1, 2, 3, 4, 5, 6, 7, 8, 10, 12, 14, 16, 20, 24, 28, 32, 40, 48, 56, +64, 80, 96, 112, 128, 160, 192, 224, 0 +}; + +local const int base_dist[D_CODES] = { + 0, 1, 2, 3, 4, 6, 8, 12, 16, 24, + 32, 48, 64, 96, 128, 192, 256, 384, 512, 768, + 1024, 1536, 2048, 3072, 4096, 6144, 8192, 12288, 16384, 24576 +}; + + +#endif diff --git a/deps/zlib/uncompr.c b/deps/zlib/uncompr.c new file mode 100644 index 0000000..c7e30b3 --- /dev/null +++ b/deps/zlib/uncompr.c @@ -0,0 +1,55 @@ +/* uncompr.c -- decompress a memory buffer + * Copyright (C) 1995-2003, 2010 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#define ZLIB_INTERNAL +#include "zlib.h" + +/* =========================================================================== + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total + size of the destination buffer, which must be large enough to hold the + entire uncompressed data. (The size of the uncompressed data must have + been saved previously by the compressor and transmitted to the decompressor + by some mechanism outside the scope of this compression library.) + Upon exit, destLen is the actual size of the compressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted. + */ +int ZEXPORT uncompress (Bytef *dest, uLongf *destLen, const Bytef *source, uLong sourceLen) +{ + z_stream stream; + int err; + + stream.next_in = (Bytef *)source; + stream.avail_in = (uInt)sourceLen; + /* Check for source > 64K on 16-bit machine: */ + if ((uLong)stream.avail_in != sourceLen) return Z_BUF_ERROR; + + stream.next_out = dest; + stream.avail_out = (uInt)*destLen; + if ((uLong)stream.avail_out != *destLen) return Z_BUF_ERROR; + + stream.zalloc = Z_NULL; + stream.zfree = Z_NULL; + + err = inflateInit(&stream); + if (err != Z_OK) return err; + + err = inflate(&stream, Z_FINISH); + if (err != Z_STREAM_END) { + inflateEnd(&stream); + if (err == Z_NEED_DICT || (err == Z_BUF_ERROR && stream.avail_in == 0)) + return Z_DATA_ERROR; + return err; + } + *destLen = stream.total_out; + + err = inflateEnd(&stream); + return err; +} diff --git a/deps/zlib/unzip.c b/deps/zlib/unzip.c new file mode 100644 index 0000000..ba6abbf --- /dev/null +++ b/deps/zlib/unzip.c @@ -0,0 +1,2126 @@ +/* unzip.c -- IO for uncompress .zip files using zlib + Version 1.1, February 14h, 2010 + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications of Unzip for Zip64 + Copyright (C) 2007-2008 Even Rouault + + Modifications for Zip64 support on both zip and unzip + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + + ------------------------------------------------------------------------------------ + Decryption code comes from crypt.c by Info-ZIP but has been greatly reduced in terms of + compatibility with older software. The following is from the original crypt.c. + Code woven in by Terry Thorsen 1/2003. + + Copyright (c) 1990-2000 Info-ZIP. All rights reserved. + + See the accompanying file LICENSE, version 2000-Apr-09 or later + (the contents of which are also included in zip.h) for terms of use. + If, for some reason, all these files are missing, the Info-ZIP license + also may be found at: ftp://ftp.info-zip.org/pub/infozip/license.html + + crypt.c (full version) by Info-ZIP. Last revised: [see crypt.h] + + The encryption/decryption parts of this source code (as opposed to the + non-echoing password parts) were originally written in Europe. The + whole source package can be freely distributed, including from the USA. + (Prior to January 2000, re-export from the US was a violation of US law.) + + This encryption code is a direct transcription of the algorithm from + Roger Schlafly, described by Phil Katz in the file appnote.txt. This + file (appnote.txt) is distributed with the PKZIP program (even in the + version without encryption capabilities). + + ------------------------------------------------------------------------------------ + + Changes in unzip.c + + 2007-2008 - Even Rouault - Addition of cpl_unzGetCurrentFileZStreamPos + 2007-2008 - Even Rouault - Decoration of symbol names unz* -> cpl_unz* + 2007-2008 - Even Rouault - Remove old C style function prototypes + 2007-2008 - Even Rouault - Add unzip support for ZIP64 + + Copyright (C) 2007-2008 Even Rouault + + + Oct-2009 - Mathias Svensson - Removed cpl_* from symbol names (Even Rouault added them but since this is now moved to a new project (minizip64) I renamed them again). + Oct-2009 - Mathias Svensson - Fixed problem if uncompressed size was > 4G and compressed size was <4G + should only read the compressed/uncompressed size from the Zip64 format if + the size from normal header was 0xFFFFFFFF + Oct-2009 - Mathias Svensson - Applied some bug fixes from paches recived from Gilles Vollant + Oct-2009 - Mathias Svensson - Applied support to unzip files with compression mathod BZIP2 (bzip2 lib is required) + Patch created by Daniel Borca + + Jan-2010 - back to unzip and minizip 1.0 name scheme, with compatibility layer + + Copyright (C) 1998 - 2010 Gilles Vollant, Even Rouault, Mathias Svensson + +*/ + + +#include <stdio.h> +#include <stdlib.h> +#include <string.h> + +#ifndef NOUNCRYPT +#define NOUNCRYPT +#endif + +#include "zlib.h" +#include "unzip.h" + +#ifdef STDC +# include <stddef.h> +# include <string.h> +# include <stdlib.h> +#endif +#ifdef NO_ERRNO_H +extern int errno; +#else +# include <errno.h> +#endif + + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + + +#ifndef CASESENSITIVITYDEFAULT_NO +# if !defined(unix) && !defined(CASESENSITIVITYDEFAULT_YES) +# define CASESENSITIVITYDEFAULT_NO +# endif +#endif + + +#ifndef UNZ_BUFSIZE +#define UNZ_BUFSIZE (16384) +#endif + +#ifndef UNZ_MAXFILENAMEINZIP +#define UNZ_MAXFILENAMEINZIP (256) +#endif + +#ifndef ALLOC +# define ALLOC(size) (malloc(size)) +#endif +#ifndef TRYFREE +# define TRYFREE(p) {if (p) free(p);} +#endif + +#define SIZECENTRALDIRITEM (0x2e) +#define SIZEZIPLOCALHEADER (0x1e) + + +const char unz_copyright[] = +" unzip 1.01 Copyright 1998-2004 Gilles Vollant - http://www.winimage.com/zLibDll"; + +/* unz_file_info_interntal contain internal info about a file in zipfile*/ +typedef struct unz_file_info64_internal_s +{ + ZPOS64_T offset_curfile;/* relative offset of local header 8 bytes */ +} unz_file_info64_internal; + + +/* file_in_zip_read_info_s contain internal information about a file in zipfile, + when reading and decompress it */ +typedef struct +{ + char *read_buffer; /* internal buffer for compressed data */ + z_stream stream; /* zLib stream structure for inflate */ + +#ifdef HAVE_BZIP2 + bz_stream bstream; /* bzLib stream structure for bziped */ +#endif + + ZPOS64_T pos_in_zipfile; /* position in byte on the zipfile, for fseek*/ + uLong stream_initialised; /* flag set if stream structure is initialised*/ + + ZPOS64_T offset_local_extrafield;/* offset of the local extra field */ + uInt size_local_extrafield;/* size of the local extra field */ + ZPOS64_T pos_local_extrafield; /* position in the local extra field in read*/ + ZPOS64_T total_out_64; + + uLong crc32; /* crc32 of all data uncompressed */ + uLong crc32_wait; /* crc32 we must obtain after decompress all */ + ZPOS64_T rest_read_compressed; /* number of byte to be decompressed */ + ZPOS64_T rest_read_uncompressed;/*number of byte to be obtained after decomp*/ + zlib_filefunc64_32_def z_filefunc; + voidpf filestream; /* io structore of the zipfile */ + uLong compression_method; /* compression method (0==store) */ + ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ + int raw; +} file_in_zip64_read_info_s; + + +/* unz64_s contain internal information about the zipfile +*/ +typedef struct +{ + zlib_filefunc64_32_def z_filefunc; + int is64bitOpenFunction; + voidpf filestream; /* io structore of the zipfile */ + unz_global_info64 gi; /* public global information */ + ZPOS64_T byte_before_the_zipfile;/* byte before the zipfile, (>0 for sfx)*/ + ZPOS64_T num_file; /* number of the current file in the zipfile*/ + ZPOS64_T pos_in_central_dir; /* pos of the current file in the central dir*/ + ZPOS64_T current_file_ok; /* flag about the usability of the current file*/ + ZPOS64_T central_pos; /* position of the beginning of the central dir*/ + + ZPOS64_T size_central_dir; /* size of the central directory */ + ZPOS64_T offset_central_dir; /* offset of start of central directory with + respect to the starting disk number */ + + unz_file_info64 cur_file_info; /* public info about the current file in zip*/ + unz_file_info64_internal cur_file_info_internal; /* private info about it*/ + file_in_zip64_read_info_s* pfile_in_zip_read; /* structure about the current + file if we are decompressing it */ + int encrypted; + + int isZip64; + +# ifndef NOUNCRYPT + unsigned long keys[3]; /* keys defining the pseudo-random sequence */ + const unsigned long* pcrc_32_tab; +# endif +} unz64_s; + + +#ifndef NOUNCRYPT +#include "crypt.h" +#endif + +/* =========================================================================== + Read a byte from a gz_stream; update next_in and avail_in. Return EOF + for end of file. + IN assertion: the stream s has been sucessfully opened for reading. + */ + + +local int unz64local_getByte OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + int *pi)); + +local int unz64local_getByte(const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, int *_pi) +{ + unsigned char c; + int err = (int)ZREAD64(*pzlib_filefunc_def,filestream,&c,1); + if (err==1) + { + *_pi = (int)c; + return UNZ_OK; + } + else + { + if (ZERROR64(*pzlib_filefunc_def,filestream)) + return UNZ_ERRNO; + else + return UNZ_EOF; + } +} + + +/* =========================================================================== + Reads a long in LSB order from the given gz_stream. Sets + */ +local int unz64local_getShort OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX)); + +local int unz64local_getShort (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX) +{ + uLong x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<8; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +local int unz64local_getLong OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX)); + +local int unz64local_getLong (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + uLong *pX) +{ + uLong x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (uLong)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<8; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((uLong)i)<<16; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x += ((uLong)i)<<24; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +local int unz64local_getLong64 OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + ZPOS64_T *pX)); + + +local int unz64local_getLong64 (const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream, + ZPOS64_T *pX) +{ + ZPOS64_T x ; + int i = 0; + int err; + + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x = (ZPOS64_T)i; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<8; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<16; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<24; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<32; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<40; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<48; + + if (err==UNZ_OK) + err = unz64local_getByte(pzlib_filefunc_def,filestream,&i); + x |= ((ZPOS64_T)i)<<56; + + if (err==UNZ_OK) + *pX = x; + else + *pX = 0; + return err; +} + +/* My own strcmpi / strcasecmp */ +local int strcmpcasenosensitive_internal (const char* fileName1, const char* fileName2) +{ + for (;;) + { + char c1=*(fileName1++); + char c2=*(fileName2++); + if ((c1>='a') && (c1<='z')) + c1 -= 0x20; + if ((c2>='a') && (c2<='z')) + c2 -= 0x20; + if (c1=='\0') + return ((c2=='\0') ? 0 : -1); + if (c2=='\0') + return 1; + if (c1<c2) + return -1; + if (c1>c2) + return 1; + } +} + + +#ifdef CASESENSITIVITYDEFAULT_NO +#define CASESENSITIVITYDEFAULTVALUE 2 +#else +#define CASESENSITIVITYDEFAULTVALUE 1 +#endif + +#ifndef STRCMPCASENOSENTIVEFUNCTION +#define STRCMPCASENOSENTIVEFUNCTION strcmpcasenosensitive_internal +#endif + +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) + +*/ +extern int ZEXPORT unzStringFileNameCompare (const char* fileName1, + const char* fileName2, + int iCaseSensitivity) + +{ + if (iCaseSensitivity==0) + iCaseSensitivity=CASESENSITIVITYDEFAULTVALUE; + + if (iCaseSensitivity==1) + return strcmp(fileName1,fileName2); + + return STRCMPCASENOSENTIVEFUNCTION(fileName1,fileName2); +} + +#ifndef BUFREADCOMMENT +#define BUFREADCOMMENT (0x400) +#endif + +/* + Locate the Central directory of a zipfile (at the end, just before + the global comment) + */ +local ZPOS64_T unz64local_SearchCentralDir OF((const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream)); +local ZPOS64_T unz64local_SearchCentralDir(const zlib_filefunc64_32_def* pzlib_filefunc_def, voidpf filestream) +{ + unsigned char* buf; + ZPOS64_T uSizeFile; + ZPOS64_T uBackRead; + ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */ + ZPOS64_T uPosFound=0; + + if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0) + return 0; + + + uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream); + + if (uMaxBack>uSizeFile) + uMaxBack = uSizeFile; + + buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4); + if (buf==NULL) + return 0; + + uBackRead = 4; + while (uBackRead<uMaxBack) + { + uLong uReadSize; + ZPOS64_T uReadPos ; + int i; + if (uBackRead+BUFREADCOMMENT>uMaxBack) + uBackRead = uMaxBack; + else + uBackRead+=BUFREADCOMMENT; + uReadPos = uSizeFile-uBackRead ; + + uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ? + (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos); + if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0) + break; + + if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize) + break; + + for (i=(int)uReadSize-3; (i--)>0;) + if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) && + ((*(buf+i+2))==0x05) && ((*(buf+i+3))==0x06)) + { + uPosFound = uReadPos+i; + break; + } + + if (uPosFound!=0) + break; + } + TRYFREE(buf); + return uPosFound; +} + + +/* + Locate the Central directory 64 of a zipfile (at the end, just before + the global comment) + */ +local ZPOS64_T unz64local_SearchCentralDir64 OF(( + const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream)); + +local ZPOS64_T unz64local_SearchCentralDir64(const zlib_filefunc64_32_def* pzlib_filefunc_def, + voidpf filestream) +{ + unsigned char* buf; + ZPOS64_T uSizeFile; + ZPOS64_T uBackRead; + ZPOS64_T uMaxBack=0xffff; /* maximum size of global comment */ + ZPOS64_T uPosFound=0; + uLong uL; + ZPOS64_T relativeOffset; + + if (ZSEEK64(*pzlib_filefunc_def,filestream,0,ZLIB_FILEFUNC_SEEK_END) != 0) + return 0; + + + uSizeFile = ZTELL64(*pzlib_filefunc_def,filestream); + + if (uMaxBack>uSizeFile) + uMaxBack = uSizeFile; + + buf = (unsigned char*)ALLOC(BUFREADCOMMENT+4); + if (buf==NULL) + return 0; + + uBackRead = 4; + while (uBackRead<uMaxBack) + { + uLong uReadSize; + ZPOS64_T uReadPos; + int i; + if (uBackRead+BUFREADCOMMENT>uMaxBack) + uBackRead = uMaxBack; + else + uBackRead+=BUFREADCOMMENT; + uReadPos = uSizeFile-uBackRead ; + + uReadSize = ((BUFREADCOMMENT+4) < (uSizeFile-uReadPos)) ? + (BUFREADCOMMENT+4) : (uLong)(uSizeFile-uReadPos); + if (ZSEEK64(*pzlib_filefunc_def,filestream,uReadPos,ZLIB_FILEFUNC_SEEK_SET)!=0) + break; + + if (ZREAD64(*pzlib_filefunc_def,filestream,buf,uReadSize)!=uReadSize) + break; + + for (i=(int)uReadSize-3; (i--)>0;) + if (((*(buf+i))==0x50) && ((*(buf+i+1))==0x4b) && + ((*(buf+i+2))==0x06) && ((*(buf+i+3))==0x07)) + { + uPosFound = uReadPos+i; + break; + } + + if (uPosFound!=0) + break; + } + TRYFREE(buf); + if (uPosFound == 0) + return 0; + + /* Zip64 end of central directory locator */ + if (ZSEEK64(*pzlib_filefunc_def,filestream, uPosFound,ZLIB_FILEFUNC_SEEK_SET)!=0) + return 0; + + /* the signature, already checked */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + + /* number of the disk with the start of the zip64 end of central directory */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + if (uL != 0) + return 0; + + /* relative offset of the zip64 end of central directory record */ + if (unz64local_getLong64(pzlib_filefunc_def,filestream,&relativeOffset)!=UNZ_OK) + return 0; + + /* total number of disks */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + if (uL != 1) + return 0; + + /* Goto end of central directory record */ + if (ZSEEK64(*pzlib_filefunc_def,filestream, relativeOffset,ZLIB_FILEFUNC_SEEK_SET)!=0) + return 0; + + /* the signature */ + if (unz64local_getLong(pzlib_filefunc_def,filestream,&uL)!=UNZ_OK) + return 0; + + if (uL != 0x06064b50) + return 0; + + return relativeOffset; +} + +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows NT computer "c:\\test\\zlib114.zip" or on an Unix computer + "zlib/zlib114.zip". + If the zipfile cannot be opened (file doesn't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. + */ +local unzFile unzOpenInternal (const void *path, + zlib_filefunc64_32_def* pzlib_filefunc64_32_def, + int is64bitOpenFunction) +{ + unz64_s us; + unz64_s *s; + ZPOS64_T central_pos; + uLong uL; + + uLong number_disk; /* number of the current dist, used for + spaning ZIP, unsupported, always 0*/ + uLong number_disk_with_CD; /* number the the disk with central dir, used + for spaning ZIP, unsupported, always 0*/ + ZPOS64_T number_entry_CD; /* total number of entries in + the central dir + (same than number_entry on nospan) */ + + int err=UNZ_OK; + + if (unz_copyright[0]!=' ') + return NULL; + + us.z_filefunc.zseek32_file = NULL; + us.z_filefunc.ztell32_file = NULL; + if (pzlib_filefunc64_32_def==NULL) + fill_fopen64_filefunc(&us.z_filefunc.zfile_func64); + else + us.z_filefunc = *pzlib_filefunc64_32_def; + us.is64bitOpenFunction = is64bitOpenFunction; + + + + us.filestream = ZOPEN64(us.z_filefunc, + path, + ZLIB_FILEFUNC_MODE_READ | + ZLIB_FILEFUNC_MODE_EXISTING); + if (us.filestream==NULL) + return NULL; + + central_pos = unz64local_SearchCentralDir64(&us.z_filefunc,us.filestream); + if (central_pos) + { + uLong uS; + ZPOS64_T uL64; + + us.isZip64 = 1; + + if (ZSEEK64(us.z_filefunc, us.filestream, + central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + /* the signature, already checked */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + + /* size of zip64 end of central directory record */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&uL64)!=UNZ_OK) + err=UNZ_ERRNO; + + /* version made by */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK) + err=UNZ_ERRNO; + + /* version needed to extract */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uS)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of this disk */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of the disk with the start of the central directory */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central directory on this disk */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.gi.number_entry)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central directory */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&number_entry_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + if ((number_entry_CD!=us.gi.number_entry) || + (number_disk_with_CD!=0) || + (number_disk!=0)) + err=UNZ_BADZIPFILE; + + /* size of the central directory */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.size_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + /* offset of start of central directory with respect to the + starting disk number */ + if (unz64local_getLong64(&us.z_filefunc, us.filestream,&us.offset_central_dir)!=UNZ_OK) + err=UNZ_ERRNO; + + us.gi.size_comment = 0; + } + else + { + central_pos = unz64local_SearchCentralDir(&us.z_filefunc,us.filestream); + if (central_pos==0) + err=UNZ_ERRNO; + + us.isZip64 = 0; + + if (ZSEEK64(us.z_filefunc, us.filestream, + central_pos,ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + /* the signature, already checked */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of this disk */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk)!=UNZ_OK) + err=UNZ_ERRNO; + + /* number of the disk with the start of the central directory */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&number_disk_with_CD)!=UNZ_OK) + err=UNZ_ERRNO; + + /* total number of entries in the central dir on this disk */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.gi.number_entry = uL; + + /* total number of entries in the central dir */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + number_entry_CD = uL; + + if ((number_entry_CD!=us.gi.number_entry) || + (number_disk_with_CD!=0) || + (number_disk!=0)) + err=UNZ_BADZIPFILE; + + /* size of the central directory */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.size_central_dir = uL; + + /* offset of start of central directory with respect to the + starting disk number */ + if (unz64local_getLong(&us.z_filefunc, us.filestream,&uL)!=UNZ_OK) + err=UNZ_ERRNO; + us.offset_central_dir = uL; + + /* zipfile comment length */ + if (unz64local_getShort(&us.z_filefunc, us.filestream,&us.gi.size_comment)!=UNZ_OK) + err=UNZ_ERRNO; + } + + if ((central_pos<us.offset_central_dir+us.size_central_dir) && + (err==UNZ_OK)) + err=UNZ_BADZIPFILE; + + if (err!=UNZ_OK) + { + ZCLOSE64(us.z_filefunc, us.filestream); + return NULL; + } + + us.byte_before_the_zipfile = central_pos - + (us.offset_central_dir+us.size_central_dir); + us.central_pos = central_pos; + us.pfile_in_zip_read = NULL; + us.encrypted = 0; + + + s=(unz64_s*)ALLOC(sizeof(unz64_s)); + if( s != NULL) + { + *s=us; + unzGoToFirstFile((unzFile)s); + } + return (unzFile)s; +} + + +extern unzFile ZEXPORT unzOpen2 (const char *path, + zlib_filefunc_def* pzlib_filefunc32_def) +{ + if (pzlib_filefunc32_def != NULL) + { + zlib_filefunc64_32_def zlib_filefunc64_32_def_fill; + fill_zlib_filefunc64_32_def_from_filefunc32(&zlib_filefunc64_32_def_fill,pzlib_filefunc32_def); + return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 0); + } + else + return unzOpenInternal(path, NULL, 0); +} + +extern unzFile ZEXPORT unzOpen2_64 (const void *path, + zlib_filefunc64_def* pzlib_filefunc_def) +{ + if (pzlib_filefunc_def != NULL) + { + zlib_filefunc64_32_def zlib_filefunc64_32_def_fill; + zlib_filefunc64_32_def_fill.zfile_func64 = *pzlib_filefunc_def; + zlib_filefunc64_32_def_fill.ztell32_file = NULL; + zlib_filefunc64_32_def_fill.zseek32_file = NULL; + return unzOpenInternal(path, &zlib_filefunc64_32_def_fill, 1); + } + else + return unzOpenInternal(path, NULL, 1); +} + +extern unzFile ZEXPORT unzOpen (const char *path) +{ + return unzOpenInternal(path, NULL, 0); +} + +extern unzFile ZEXPORT unzOpen64 (const void *path) +{ + return unzOpenInternal(path, NULL, 1); +} + +/* + Close a ZipFile opened with unzipOpen. + If there is files inside the .Zip opened with unzipOpenCurrentFile (see later), + these files MUST be closed with unzipCloseCurrentFile before call unzipClose. + return UNZ_OK if there is no problem. */ +extern int ZEXPORT unzClose (unzFile file) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + if (s->pfile_in_zip_read!=NULL) + unzCloseCurrentFile(file); + + ZCLOSE64(s->z_filefunc, s->filestream); + TRYFREE(s); + return UNZ_OK; +} + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ +extern int ZEXPORT unzGetGlobalInfo64 (unzFile file, unz_global_info64* pglobal_info) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + *pglobal_info=s->gi; + return UNZ_OK; +} + +extern int ZEXPORT unzGetGlobalInfo (unzFile file, unz_global_info* pglobal_info32) +{ + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + /* to do : check if number_entry is not truncated */ + pglobal_info32->number_entry = (uLong)s->gi.number_entry; + pglobal_info32->size_comment = s->gi.size_comment; + return UNZ_OK; +} +/* + Translate date/time from Dos format to tm_unz (readable more easilty) + */ +local void unz64local_DosDateToTmuDate (ZPOS64_T ulDosDate, tm_unz* ptm) +{ + ZPOS64_T uDate; + uDate = (ZPOS64_T)(ulDosDate>>16); + ptm->tm_mday = (uInt)(uDate&0x1f) ; + ptm->tm_mon = (uInt)((((uDate)&0x1E0)/0x20)-1) ; + ptm->tm_year = (uInt)(((uDate&0x0FE00)/0x0200)+1980) ; + + ptm->tm_hour = (uInt) ((ulDosDate &0xF800)/0x800); + ptm->tm_min = (uInt) ((ulDosDate&0x7E0)/0x20) ; + ptm->tm_sec = (uInt) (2*(ulDosDate&0x1f)) ; +} + +/* + Get Info about the current file in the zipfile, with internal only info + */ +local int unz64local_GetCurrentFileInfoInternal OF((unzFile file, + unz_file_info64 *pfile_info, + unz_file_info64_internal + *pfile_info_internal, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); + +local int unz64local_GetCurrentFileInfoInternal (unzFile file, + unz_file_info64 *pfile_info, + unz_file_info64_internal + *pfile_info_internal, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize) +{ + unz64_s* s; + unz_file_info64 file_info; + unz_file_info64_internal file_info_internal; + int err=UNZ_OK; + uLong uMagic; + long lSeek=0; + uLong uL; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (ZSEEK64(s->z_filefunc, s->filestream, + s->pos_in_central_dir+s->byte_before_the_zipfile, + ZLIB_FILEFUNC_SEEK_SET)!=0) + err=UNZ_ERRNO; + + + /* we check the magic */ + if (err==UNZ_OK) + { + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x02014b50) + err=UNZ_BADZIPFILE; + } + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.version_needed) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.flag) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.compression_method) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.dosDate) != UNZ_OK) + err=UNZ_ERRNO; + + unz64local_DosDateToTmuDate(file_info.dosDate,&file_info.tmu_date); + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.crc) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info.compressed_size = uL; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info.uncompressed_size = uL; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_filename) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_extra) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.size_file_comment) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.disk_num_start) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&file_info.internal_fa) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&file_info.external_fa) != UNZ_OK) + err=UNZ_ERRNO; + + // relative offset of local header + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uL) != UNZ_OK) + err=UNZ_ERRNO; + file_info_internal.offset_curfile = uL; + + lSeek+=file_info.size_filename; + if ((err==UNZ_OK) && (szFileName!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_filename<fileNameBufferSize) + { + *(szFileName+file_info.size_filename)='\0'; + uSizeRead = file_info.size_filename; + } + else + uSizeRead = fileNameBufferSize; + + if ((file_info.size_filename>0) && (fileNameBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,szFileName,uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + lSeek -= uSizeRead; + } + + // Read extrafield + if ((err==UNZ_OK) && (extraField!=NULL)) + { + ZPOS64_T uSizeRead ; + if (file_info.size_file_extra<extraFieldBufferSize) + uSizeRead = file_info.size_file_extra; + else + uSizeRead = extraFieldBufferSize; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + if ((file_info.size_file_extra>0) && (extraFieldBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,extraField,(uLong)uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + + lSeek += file_info.size_file_extra - (uLong)uSizeRead; + } + else + lSeek += file_info.size_file_extra; + + + if ((err==UNZ_OK) && (file_info.size_file_extra != 0)) + { + uLong acc = 0; + + // since lSeek now points to after the extra field we need to move back + lSeek -= file_info.size_file_extra; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + while(acc < file_info.size_file_extra) + { + uLong headerId; + uLong dataSize; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&headerId) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&dataSize) != UNZ_OK) + err=UNZ_ERRNO; + + /* ZIP64 extra fields */ + if (headerId == 0x0001) + { + uLong tmp; + + if(file_info.uncompressed_size == (ZPOS64_T)(unsigned long)-1) + { + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.uncompressed_size) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info.compressed_size == (ZPOS64_T)(unsigned long)-1) + { + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info.compressed_size) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info_internal.offset_curfile == (ZPOS64_T)(unsigned long)-1) + { + /* Relative Header offset */ + if (unz64local_getLong64(&s->z_filefunc, s->filestream,&file_info_internal.offset_curfile) != UNZ_OK) + err=UNZ_ERRNO; + } + + if(file_info.disk_num_start == (unsigned long)-1) + { + /* Disk Start Number */ + if (unz64local_getLong(&s->z_filefunc, s->filestream,&tmp) != UNZ_OK) + err=UNZ_ERRNO; + } + + } + else + { + if (ZSEEK64(s->z_filefunc, s->filestream,dataSize,ZLIB_FILEFUNC_SEEK_CUR)!=0) + err=UNZ_ERRNO; + } + + acc += 2 + 2 + dataSize; + } + } + + if ((err==UNZ_OK) && (szComment!=NULL)) + { + uLong uSizeRead ; + if (file_info.size_file_comment<commentBufferSize) + { + *(szComment+file_info.size_file_comment)='\0'; + uSizeRead = file_info.size_file_comment; + } + else + uSizeRead = commentBufferSize; + + if (lSeek!=0) + { + if (ZSEEK64(s->z_filefunc, s->filestream,lSeek,ZLIB_FILEFUNC_SEEK_CUR)==0) + lSeek=0; + else + err=UNZ_ERRNO; + } + + if ((file_info.size_file_comment>0) && (commentBufferSize>0)) + if (ZREAD64(s->z_filefunc, s->filestream,szComment,uSizeRead)!=uSizeRead) + err=UNZ_ERRNO; + lSeek+=file_info.size_file_comment - uSizeRead; + } + else + lSeek+=file_info.size_file_comment; + + + if ((err==UNZ_OK) && (pfile_info!=NULL)) + *pfile_info=file_info; + + if ((err==UNZ_OK) && (pfile_info_internal!=NULL)) + *pfile_info_internal=file_info_internal; + + return err; +} + + + +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. + */ +extern int ZEXPORT unzGetCurrentFileInfo64 (unzFile file, + unz_file_info64 * pfile_info, + char * szFileName, uLong fileNameBufferSize, + void *extraField, uLong extraFieldBufferSize, + char* szComment, uLong commentBufferSize) +{ + return unz64local_GetCurrentFileInfoInternal(file,pfile_info,NULL, + szFileName,fileNameBufferSize, + extraField,extraFieldBufferSize, + szComment,commentBufferSize); +} + +extern int ZEXPORT unzGetCurrentFileInfo (unzFile file, + unz_file_info * pfile_info, + char * szFileName, uLong fileNameBufferSize, + void *extraField, uLong extraFieldBufferSize, + char* szComment, uLong commentBufferSize) +{ + int err; + unz_file_info64 file_info64; + err = unz64local_GetCurrentFileInfoInternal(file,&file_info64,NULL, + szFileName,fileNameBufferSize, + extraField,extraFieldBufferSize, + szComment,commentBufferSize); + if (err==UNZ_OK) + { + pfile_info->version = file_info64.version; + pfile_info->version_needed = file_info64.version_needed; + pfile_info->flag = file_info64.flag; + pfile_info->compression_method = file_info64.compression_method; + pfile_info->dosDate = file_info64.dosDate; + pfile_info->crc = file_info64.crc; + + pfile_info->size_filename = file_info64.size_filename; + pfile_info->size_file_extra = file_info64.size_file_extra; + pfile_info->size_file_comment = file_info64.size_file_comment; + + pfile_info->disk_num_start = file_info64.disk_num_start; + pfile_info->internal_fa = file_info64.internal_fa; + pfile_info->external_fa = file_info64.external_fa; + + pfile_info->tmu_date = file_info64.tmu_date, + + + pfile_info->compressed_size = (uLong)file_info64.compressed_size; + pfile_info->uncompressed_size = (uLong)file_info64.uncompressed_size; + + } + return err; +} +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem + */ +extern int ZEXPORT unzGoToFirstFile (unzFile file) +{ + int err=UNZ_OK; + unz64_s* s; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + s->pos_in_central_dir=s->offset_central_dir; + s->num_file=0; + err=unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. + */ +extern int ZEXPORT unzGoToNextFile (unzFile file) +{ + unz64_s* s; + int err; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + if (s->gi.number_entry != 0xffff) /* 2^16 files overflow hack */ + if (s->num_file+1==s->gi.number_entry) + return UNZ_END_OF_LIST_OF_FILE; + + s->pos_in_central_dir += SIZECENTRALDIRITEM + s->cur_file_info.size_filename + + s->cur_file_info.size_file_extra + s->cur_file_info.size_file_comment ; + s->num_file++; + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + + +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzipStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found + */ +extern int ZEXPORT unzLocateFile (unzFile file, const char *szFileName, int iCaseSensitivity) +{ + unz64_s* s; + int err; + + /* We remember the 'current' position in the file so that we can jump + * back there if we fail. + */ + unz_file_info64 cur_file_infoSaved; + unz_file_info64_internal cur_file_info_internalSaved; + ZPOS64_T num_fileSaved; + ZPOS64_T pos_in_central_dirSaved; + + + if (file==NULL) + return UNZ_PARAMERROR; + + if (strlen(szFileName)>=UNZ_MAXFILENAMEINZIP) + return UNZ_PARAMERROR; + + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + + /* Save the current state */ + num_fileSaved = s->num_file; + pos_in_central_dirSaved = s->pos_in_central_dir; + cur_file_infoSaved = s->cur_file_info; + cur_file_info_internalSaved = s->cur_file_info_internal; + + err = unzGoToFirstFile(file); + + while (err == UNZ_OK) + { + char szCurrentFileName[UNZ_MAXFILENAMEINZIP+1]; + err = unzGetCurrentFileInfo64(file,NULL, + szCurrentFileName,sizeof(szCurrentFileName)-1, + NULL,0,NULL,0); + if (err == UNZ_OK) + { + if (unzStringFileNameCompare(szCurrentFileName, + szFileName,iCaseSensitivity)==0) + return UNZ_OK; + err = unzGoToNextFile(file); + } + } + + /* We failed, so restore the state of the 'current file' to where we + * were. + */ + s->num_file = num_fileSaved ; + s->pos_in_central_dir = pos_in_central_dirSaved ; + s->cur_file_info = cur_file_infoSaved; + s->cur_file_info_internal = cur_file_info_internalSaved; + return err; +} + + +/* +/////////////////////////////////////////// +// Contributed by Ryan Haksi (mailto://cryogen@infoserve.net) +// I need random access +// +// Further optimization could be realized by adding an ability +// to cache the directory in memory. The goal being a single +// comprehensive file read to put the file I need in a memory. +*/ + +/* + typedef struct unz_file_pos_s + { + ZPOS64_T pos_in_zip_directory; // offset in file + ZPOS64_T num_of_file; // # of file + } unz_file_pos; + */ + +extern int ZEXPORT unzGetFilePos64(unzFile file, unz64_file_pos* file_pos) +{ + unz64_s* s; + + if (file==NULL || file_pos==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_END_OF_LIST_OF_FILE; + + file_pos->pos_in_zip_directory = s->pos_in_central_dir; + file_pos->num_of_file = s->num_file; + + return UNZ_OK; +} + +extern int ZEXPORT unzGetFilePos( + unzFile file, + unz_file_pos* file_pos) +{ + unz64_file_pos file_pos64; + int err = unzGetFilePos64(file,&file_pos64); + if (err==UNZ_OK) + { + file_pos->pos_in_zip_directory = (uLong)file_pos64.pos_in_zip_directory; + file_pos->num_of_file = (uLong)file_pos64.num_of_file; + } + return err; +} + +extern int ZEXPORT unzGoToFilePos64(unzFile file, const unz64_file_pos* file_pos) +{ + unz64_s* s; + int err; + + if (file==NULL || file_pos==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + /* jump to the right spot */ + s->pos_in_central_dir = file_pos->pos_in_zip_directory; + s->num_file = file_pos->num_of_file; + + /* set the current file */ + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + /* return results */ + s->current_file_ok = (err == UNZ_OK); + return err; +} + +extern int ZEXPORT unzGoToFilePos( + unzFile file, + unz_file_pos* file_pos) +{ + unz64_file_pos file_pos64; + if (file_pos == NULL) + return UNZ_PARAMERROR; + + file_pos64.pos_in_zip_directory = file_pos->pos_in_zip_directory; + file_pos64.num_of_file = file_pos->num_of_file; + return unzGoToFilePos64(file,&file_pos64); +} + +/* +// Unzip Helper Functions - should be here? +/////////////////////////////////////////// +*/ + +/* + Read the local header of the current zipfile + Check the coherency of the local header and info in the end of central + directory about this file + store in *piSizeVar the size of extra info in local header + (filename and size of extra field data) + */ +local int unz64local_CheckCurrentFileCoherencyHeader (unz64_s* s, uInt* piSizeVar, + ZPOS64_T * poffset_local_extrafield, + uInt * psize_local_extrafield) +{ + uLong uMagic,uData,uFlags; + uLong size_filename; + uLong size_extra_field; + int err=UNZ_OK; + + *piSizeVar = 0; + *poffset_local_extrafield = 0; + *psize_local_extrafield = 0; + + if (ZSEEK64(s->z_filefunc, s->filestream,s->cur_file_info_internal.offset_curfile + + s->byte_before_the_zipfile,ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + + if (err==UNZ_OK) + { + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uMagic) != UNZ_OK) + err=UNZ_ERRNO; + else if (uMagic!=0x04034b50) + err=UNZ_BADZIPFILE; + } + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) + err=UNZ_ERRNO; + /* + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.wVersion)) + err=UNZ_BADZIPFILE; + */ + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uFlags) != UNZ_OK) + err=UNZ_ERRNO; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.compression_method)) + err=UNZ_BADZIPFILE; + + if ((err==UNZ_OK) && (s->cur_file_info.compression_method!=0) && + /* #ifdef HAVE_BZIP2 */ + (s->cur_file_info.compression_method!=Z_BZIP2ED) && + /* #endif */ + (s->cur_file_info.compression_method!=Z_DEFLATED)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* date/time */ + err=UNZ_ERRNO; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* crc */ + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (uData!=s->cur_file_info.crc) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size compr */ + err=UNZ_ERRNO; + else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.compressed_size) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getLong(&s->z_filefunc, s->filestream,&uData) != UNZ_OK) /* size uncompr */ + err=UNZ_ERRNO; + else if (uData != 0xFFFFFFFF && (err==UNZ_OK) && (uData!=s->cur_file_info.uncompressed_size) && ((uFlags & 8)==0)) + err=UNZ_BADZIPFILE; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_filename) != UNZ_OK) + err=UNZ_ERRNO; + else if ((err==UNZ_OK) && (size_filename!=s->cur_file_info.size_filename)) + err=UNZ_BADZIPFILE; + + *piSizeVar += (uInt)size_filename; + + if (unz64local_getShort(&s->z_filefunc, s->filestream,&size_extra_field) != UNZ_OK) + err=UNZ_ERRNO; + *poffset_local_extrafield= s->cur_file_info_internal.offset_curfile + + SIZEZIPLOCALHEADER + size_filename; + *psize_local_extrafield = (uInt)size_extra_field; + + *piSizeVar += (uInt)size_extra_field; + + return err; +} + +/* + Open for reading data the current file in the zipfile. + If there is no error and the file is opened, the return value is UNZ_OK. + */ +extern int ZEXPORT unzOpenCurrentFile3 (unzFile file, int* method, + int* level, int raw, const char* password) +{ + int err=UNZ_OK; + uInt iSizeVar; + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + ZPOS64_T offset_local_extrafield; /* offset of the local extra field */ + uInt size_local_extrafield; /* size of the local extra field */ +# ifndef NOUNCRYPT + char source[12]; +# else + if (password != NULL) + return UNZ_PARAMERROR; +# endif + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return UNZ_PARAMERROR; + + if (s->pfile_in_zip_read != NULL) + unzCloseCurrentFile(file); + + if (unz64local_CheckCurrentFileCoherencyHeader(s,&iSizeVar, &offset_local_extrafield,&size_local_extrafield)!=UNZ_OK) + return UNZ_BADZIPFILE; + + pfile_in_zip_read_info = (file_in_zip64_read_info_s*)ALLOC(sizeof(file_in_zip64_read_info_s)); + if (pfile_in_zip_read_info==NULL) + return UNZ_INTERNALERROR; + + pfile_in_zip_read_info->read_buffer=(char*)ALLOC(UNZ_BUFSIZE); + pfile_in_zip_read_info->offset_local_extrafield = offset_local_extrafield; + pfile_in_zip_read_info->size_local_extrafield = size_local_extrafield; + pfile_in_zip_read_info->pos_local_extrafield=0; + pfile_in_zip_read_info->raw=raw; + + if (pfile_in_zip_read_info->read_buffer==NULL) + { + TRYFREE(pfile_in_zip_read_info); + return UNZ_INTERNALERROR; + } + + pfile_in_zip_read_info->stream_initialised=0; + + if (method!=NULL) + *method = (int)s->cur_file_info.compression_method; + + if (level!=NULL) + { + *level = 6; + switch (s->cur_file_info.flag & 0x06) + { + case 6 : *level = 1; break; + case 4 : *level = 2; break; + case 2 : *level = 9; break; + } + } + + if ((s->cur_file_info.compression_method!=0) && + /* #ifdef HAVE_BZIP2 */ + (s->cur_file_info.compression_method!=Z_BZIP2ED) && + /* #endif */ + (s->cur_file_info.compression_method!=Z_DEFLATED)) + + err=UNZ_BADZIPFILE; + + pfile_in_zip_read_info->crc32_wait=s->cur_file_info.crc; + pfile_in_zip_read_info->crc32=0; + pfile_in_zip_read_info->total_out_64=0; + pfile_in_zip_read_info->compression_method = s->cur_file_info.compression_method; + pfile_in_zip_read_info->filestream=s->filestream; + pfile_in_zip_read_info->z_filefunc=s->z_filefunc; + pfile_in_zip_read_info->byte_before_the_zipfile=s->byte_before_the_zipfile; + + pfile_in_zip_read_info->stream.total_out = 0; + + if ((s->cur_file_info.compression_method==Z_BZIP2ED) && (!raw)) + { +#ifdef HAVE_BZIP2 + pfile_in_zip_read_info->bstream.bzalloc = (void *(*) (void *, int, int))0; + pfile_in_zip_read_info->bstream.bzfree = (free_func)0; + pfile_in_zip_read_info->bstream.opaque = (voidpf)0; + pfile_in_zip_read_info->bstream.state = (voidpf)0; + + pfile_in_zip_read_info->stream.zalloc = (alloc_func)0; + pfile_in_zip_read_info->stream.zfree = (free_func)0; + pfile_in_zip_read_info->stream.opaque = (voidpf)0; + pfile_in_zip_read_info->stream.next_in = (voidpf)0; + pfile_in_zip_read_info->stream.avail_in = 0; + + err=BZ2_bzDecompressInit(&pfile_in_zip_read_info->bstream, 0, 0); + if (err == Z_OK) + pfile_in_zip_read_info->stream_initialised=Z_BZIP2ED; + else + { + TRYFREE(pfile_in_zip_read_info); + return err; + } +#else + pfile_in_zip_read_info->raw=1; +#endif + } + else if ((s->cur_file_info.compression_method==Z_DEFLATED) && (!raw)) + { + pfile_in_zip_read_info->stream.zalloc = Z_NULL; + pfile_in_zip_read_info->stream.zfree = Z_NULL; + pfile_in_zip_read_info->stream.opaque = (voidpf)0; + pfile_in_zip_read_info->stream.next_in = 0; + pfile_in_zip_read_info->stream.avail_in = 0; + + err=inflateInit2(&pfile_in_zip_read_info->stream, -MAX_WBITS); + if (err == Z_OK) + pfile_in_zip_read_info->stream_initialised=Z_DEFLATED; + else + { + TRYFREE(pfile_in_zip_read_info); + return err; + } + /* windowBits is passed < 0 to tell that there is no zlib header. + * Note that in this case inflate *requires* an extra "dummy" byte + * after the compressed stream in order to complete decompression and + * return Z_STREAM_END. + * In unzip, i don't wait absolutely Z_STREAM_END because I known the + * size of both compressed and uncompressed data + */ + } + pfile_in_zip_read_info->rest_read_compressed = + s->cur_file_info.compressed_size ; + pfile_in_zip_read_info->rest_read_uncompressed = + s->cur_file_info.uncompressed_size ; + + + pfile_in_zip_read_info->pos_in_zipfile = + s->cur_file_info_internal.offset_curfile + SIZEZIPLOCALHEADER + + iSizeVar; + + pfile_in_zip_read_info->stream.avail_in = (uInt)0; + + s->pfile_in_zip_read = pfile_in_zip_read_info; + s->encrypted = 0; + +# ifndef NOUNCRYPT + if (password != NULL) + { + int i; + s->pcrc_32_tab = get_crc_table(); + init_keys(password,s->keys,s->pcrc_32_tab); + if (ZSEEK64(s->z_filefunc, s->filestream, + s->pfile_in_zip_read->pos_in_zipfile + + s->pfile_in_zip_read->byte_before_the_zipfile, + SEEK_SET)!=0) + return UNZ_INTERNALERROR; + if(ZREAD64(s->z_filefunc, s->filestream,source, 12)<12) + return UNZ_INTERNALERROR; + + for (i = 0; i<12; i++) + zdecode(s->keys,s->pcrc_32_tab,source[i]); + + s->pfile_in_zip_read->pos_in_zipfile+=12; + s->encrypted=1; + } +# endif + + + return UNZ_OK; +} + +extern int ZEXPORT unzOpenCurrentFile (unzFile file) +{ + return unzOpenCurrentFile3(file, NULL, NULL, 0, NULL); +} + +extern int ZEXPORT unzOpenCurrentFilePassword (unzFile file, const char* password) +{ + return unzOpenCurrentFile3(file, NULL, NULL, 0, password); +} + +extern int ZEXPORT unzOpenCurrentFile2 (unzFile file, int* method, int* level, int raw) +{ + return unzOpenCurrentFile3(file, method, level, raw, NULL); +} + +/** Addition for GDAL : START */ + +extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64( unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + s=(unz64_s*)file; + if (file==NULL) + return 0; //UNZ_PARAMERROR; + pfile_in_zip_read_info=s->pfile_in_zip_read; + if (pfile_in_zip_read_info==NULL) + return 0; //UNZ_PARAMERROR; + return pfile_in_zip_read_info->pos_in_zipfile + + pfile_in_zip_read_info->byte_before_the_zipfile; +} + +/** Addition for GDAL : END */ + +/* + Read bytes from the current file. + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) + */ +extern int ZEXPORT unzReadCurrentFile (unzFile file, voidp buf, unsigned len) +{ + int err=UNZ_OK; + uInt iRead = 0; + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if (pfile_in_zip_read_info->read_buffer == NULL) + return UNZ_END_OF_LIST_OF_FILE; + if (len==0) + return 0; + + pfile_in_zip_read_info->stream.next_out = (Bytef*)buf; + + pfile_in_zip_read_info->stream.avail_out = (uInt)len; + + if ((len>pfile_in_zip_read_info->rest_read_uncompressed) && + (!(pfile_in_zip_read_info->raw))) + pfile_in_zip_read_info->stream.avail_out = + (uInt)pfile_in_zip_read_info->rest_read_uncompressed; + + if ((len>pfile_in_zip_read_info->rest_read_compressed+ + pfile_in_zip_read_info->stream.avail_in) && + (pfile_in_zip_read_info->raw)) + pfile_in_zip_read_info->stream.avail_out = + (uInt)pfile_in_zip_read_info->rest_read_compressed+ + pfile_in_zip_read_info->stream.avail_in; + + while (pfile_in_zip_read_info->stream.avail_out>0) + { + if ((pfile_in_zip_read_info->stream.avail_in==0) && + (pfile_in_zip_read_info->rest_read_compressed>0)) + { + uInt uReadThis = UNZ_BUFSIZE; + if (pfile_in_zip_read_info->rest_read_compressed<uReadThis) + uReadThis = (uInt)pfile_in_zip_read_info->rest_read_compressed; + if (uReadThis == 0) + return UNZ_EOF; + if (ZSEEK64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->pos_in_zipfile + + pfile_in_zip_read_info->byte_before_the_zipfile, + ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + if (ZREAD64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->read_buffer, + uReadThis)!=uReadThis) + return UNZ_ERRNO; + + +# ifndef NOUNCRYPT + if(s->encrypted) + { + uInt i; + for(i=0;i<uReadThis;i++) + pfile_in_zip_read_info->read_buffer[i] = + zdecode(s->keys,s->pcrc_32_tab, + pfile_in_zip_read_info->read_buffer[i]); + } +# endif + + + pfile_in_zip_read_info->pos_in_zipfile += uReadThis; + + pfile_in_zip_read_info->rest_read_compressed-=uReadThis; + + pfile_in_zip_read_info->stream.next_in = + (Bytef*)pfile_in_zip_read_info->read_buffer; + pfile_in_zip_read_info->stream.avail_in = (uInt)uReadThis; + } + + if ((pfile_in_zip_read_info->compression_method==0) || (pfile_in_zip_read_info->raw)) + { + uInt uDoCopy,i ; + + if ((pfile_in_zip_read_info->stream.avail_in == 0) && + (pfile_in_zip_read_info->rest_read_compressed == 0)) + return (iRead==0) ? UNZ_EOF : iRead; + + if (pfile_in_zip_read_info->stream.avail_out < + pfile_in_zip_read_info->stream.avail_in) + uDoCopy = pfile_in_zip_read_info->stream.avail_out ; + else + uDoCopy = pfile_in_zip_read_info->stream.avail_in ; + + for (i=0;i<uDoCopy;i++) + *(pfile_in_zip_read_info->stream.next_out+i) = + *(pfile_in_zip_read_info->stream.next_in+i); + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uDoCopy; + + pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32, + pfile_in_zip_read_info->stream.next_out, + uDoCopy); + pfile_in_zip_read_info->rest_read_uncompressed-=uDoCopy; + pfile_in_zip_read_info->stream.avail_in -= uDoCopy; + pfile_in_zip_read_info->stream.avail_out -= uDoCopy; + pfile_in_zip_read_info->stream.next_out += uDoCopy; + pfile_in_zip_read_info->stream.next_in += uDoCopy; + pfile_in_zip_read_info->stream.total_out += uDoCopy; + iRead += uDoCopy; + } + else if (pfile_in_zip_read_info->compression_method==Z_BZIP2ED) + { +#ifdef HAVE_BZIP2 + uLong uTotalOutBefore,uTotalOutAfter; + const Bytef *bufBefore; + uLong uOutThis; + + pfile_in_zip_read_info->bstream.next_in = (char*)pfile_in_zip_read_info->stream.next_in; + pfile_in_zip_read_info->bstream.avail_in = pfile_in_zip_read_info->stream.avail_in; + pfile_in_zip_read_info->bstream.total_in_lo32 = pfile_in_zip_read_info->stream.total_in; + pfile_in_zip_read_info->bstream.total_in_hi32 = 0; + pfile_in_zip_read_info->bstream.next_out = (char*)pfile_in_zip_read_info->stream.next_out; + pfile_in_zip_read_info->bstream.avail_out = pfile_in_zip_read_info->stream.avail_out; + pfile_in_zip_read_info->bstream.total_out_lo32 = pfile_in_zip_read_info->stream.total_out; + pfile_in_zip_read_info->bstream.total_out_hi32 = 0; + + uTotalOutBefore = pfile_in_zip_read_info->bstream.total_out_lo32; + bufBefore = (const Bytef *)pfile_in_zip_read_info->bstream.next_out; + + err=BZ2_bzDecompress(&pfile_in_zip_read_info->bstream); + + uTotalOutAfter = pfile_in_zip_read_info->bstream.total_out_lo32; + uOutThis = uTotalOutAfter-uTotalOutBefore; + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis; + + pfile_in_zip_read_info->crc32 = crc32(pfile_in_zip_read_info->crc32,bufBefore, (uInt)(uOutThis)); + pfile_in_zip_read_info->rest_read_uncompressed -= uOutThis; + iRead += (uInt)(uTotalOutAfter - uTotalOutBefore); + + pfile_in_zip_read_info->stream.next_in = (Bytef*)pfile_in_zip_read_info->bstream.next_in; + pfile_in_zip_read_info->stream.avail_in = pfile_in_zip_read_info->bstream.avail_in; + pfile_in_zip_read_info->stream.total_in = pfile_in_zip_read_info->bstream.total_in_lo32; + pfile_in_zip_read_info->stream.next_out = (Bytef*)pfile_in_zip_read_info->bstream.next_out; + pfile_in_zip_read_info->stream.avail_out = pfile_in_zip_read_info->bstream.avail_out; + pfile_in_zip_read_info->stream.total_out = pfile_in_zip_read_info->bstream.total_out_lo32; + + if (err==BZ_STREAM_END) + return (iRead==0) ? UNZ_EOF : iRead; + if (err!=BZ_OK) + break; +#endif + } // end Z_BZIP2ED + else + { + ZPOS64_T uTotalOutBefore,uTotalOutAfter; + const Bytef *bufBefore; + ZPOS64_T uOutThis; + int flush=Z_SYNC_FLUSH; + + uTotalOutBefore = pfile_in_zip_read_info->stream.total_out; + bufBefore = pfile_in_zip_read_info->stream.next_out; + + /* + if ((pfile_in_zip_read_info->rest_read_uncompressed == + pfile_in_zip_read_info->stream.avail_out) && + (pfile_in_zip_read_info->rest_read_compressed == 0)) + flush = Z_FINISH; + */ + err=inflate(&pfile_in_zip_read_info->stream,flush); + + if ((err>=0) && (pfile_in_zip_read_info->stream.msg!=NULL)) + err = Z_DATA_ERROR; + + uTotalOutAfter = pfile_in_zip_read_info->stream.total_out; + uOutThis = uTotalOutAfter-uTotalOutBefore; + + pfile_in_zip_read_info->total_out_64 = pfile_in_zip_read_info->total_out_64 + uOutThis; + + pfile_in_zip_read_info->crc32 = + crc32(pfile_in_zip_read_info->crc32,bufBefore, + (uInt)(uOutThis)); + + pfile_in_zip_read_info->rest_read_uncompressed -= + uOutThis; + + iRead += (uInt)(uTotalOutAfter - uTotalOutBefore); + + if (err==Z_STREAM_END) + return (iRead==0) ? UNZ_EOF : iRead; + if (err!=Z_OK) + break; + } + } + + if (err==Z_OK) + return iRead; + return err; +} + + +/* + Give the current position in uncompressed data + */ +extern z_off_t ZEXPORT unztell (unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + return (z_off_t)pfile_in_zip_read_info->stream.total_out; +} + +extern ZPOS64_T ZEXPORT unztell64 (unzFile file) +{ + + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return (ZPOS64_T)-1; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return (ZPOS64_T)-1; + + return pfile_in_zip_read_info->total_out_64; +} + + +/* + return 1 if the end of file was reached, 0 elsewhere + */ +extern int ZEXPORT unzeof (unzFile file) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + if (pfile_in_zip_read_info->rest_read_uncompressed == 0) + return 1; + else + return 0; +} + + + +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field that can be read + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code + */ +extern int ZEXPORT unzGetLocalExtrafield (unzFile file, voidp buf, unsigned len) +{ + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + uInt read_now; + ZPOS64_T size_to_read; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + size_to_read = (pfile_in_zip_read_info->size_local_extrafield - + pfile_in_zip_read_info->pos_local_extrafield); + + if (buf==NULL) + return (int)size_to_read; + + if (len>size_to_read) + read_now = (uInt)size_to_read; + else + read_now = (uInt)len ; + + if (read_now==0) + return 0; + + if (ZSEEK64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + pfile_in_zip_read_info->offset_local_extrafield + + pfile_in_zip_read_info->pos_local_extrafield, + ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + if (ZREAD64(pfile_in_zip_read_info->z_filefunc, + pfile_in_zip_read_info->filestream, + buf,read_now)!=read_now) + return UNZ_ERRNO; + + return (int)read_now; +} + +/* + Close the file in zip opened with unzipOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good + */ +extern int ZEXPORT unzCloseCurrentFile (unzFile file) +{ + int err=UNZ_OK; + + unz64_s* s; + file_in_zip64_read_info_s* pfile_in_zip_read_info; + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + pfile_in_zip_read_info=s->pfile_in_zip_read; + + if (pfile_in_zip_read_info==NULL) + return UNZ_PARAMERROR; + + + if ((pfile_in_zip_read_info->rest_read_uncompressed == 0) && + (!pfile_in_zip_read_info->raw)) + { + if (pfile_in_zip_read_info->crc32 != pfile_in_zip_read_info->crc32_wait) + err=UNZ_CRCERROR; + } + + + TRYFREE(pfile_in_zip_read_info->read_buffer); + pfile_in_zip_read_info->read_buffer = NULL; + if (pfile_in_zip_read_info->stream_initialised == Z_DEFLATED) + inflateEnd(&pfile_in_zip_read_info->stream); +#ifdef HAVE_BZIP2 + else if (pfile_in_zip_read_info->stream_initialised == Z_BZIP2ED) + BZ2_bzDecompressEnd(&pfile_in_zip_read_info->bstream); +#endif + + + pfile_in_zip_read_info->stream_initialised = 0; + TRYFREE(pfile_in_zip_read_info); + + s->pfile_in_zip_read=NULL; + + return err; +} + + +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 + */ +extern int ZEXPORT unzGetGlobalComment (unzFile file, char * szComment, uLong uSizeBuf) +{ + unz64_s* s; + uLong uReadThis ; + if (file==NULL) + return (int)UNZ_PARAMERROR; + s=(unz64_s*)file; + + uReadThis = uSizeBuf; + if (uReadThis>s->gi.size_comment) + uReadThis = s->gi.size_comment; + + if (ZSEEK64(s->z_filefunc,s->filestream,s->central_pos+22,ZLIB_FILEFUNC_SEEK_SET)!=0) + return UNZ_ERRNO; + + if (uReadThis>0) + { + *szComment='\0'; + if (ZREAD64(s->z_filefunc,s->filestream,szComment,uReadThis)!=uReadThis) + return UNZ_ERRNO; + } + + if ((szComment != NULL) && (uSizeBuf > s->gi.size_comment)) + *(szComment+s->gi.size_comment)='\0'; + return (int)uReadThis; +} + +/* Additions by RX '2004 */ +extern ZPOS64_T ZEXPORT unzGetOffset64(unzFile file) +{ + unz64_s* s; + + if (file==NULL) + return 0; //UNZ_PARAMERROR; + s=(unz64_s*)file; + if (!s->current_file_ok) + return 0; + if (s->gi.number_entry != 0 && s->gi.number_entry != 0xffff) + if (s->num_file==s->gi.number_entry) + return 0; + return s->pos_in_central_dir; +} + +extern uLong ZEXPORT unzGetOffset (unzFile file) +{ + ZPOS64_T offset64; + + if (file==NULL) + return 0; //UNZ_PARAMERROR; + offset64 = unzGetOffset64(file); + return (uLong)offset64; +} + +extern int ZEXPORT unzSetOffset64(unzFile file, ZPOS64_T pos) +{ + unz64_s* s; + int err; + + if (file==NULL) + return UNZ_PARAMERROR; + s=(unz64_s*)file; + + s->pos_in_central_dir = pos; + s->num_file = s->gi.number_entry; /* hack */ + err = unz64local_GetCurrentFileInfoInternal(file,&s->cur_file_info, + &s->cur_file_info_internal, + NULL,0,NULL,0,NULL,0); + s->current_file_ok = (err == UNZ_OK); + return err; +} + +extern int ZEXPORT unzSetOffset (unzFile file, uLong pos) +{ + return unzSetOffset64(file,pos); +} diff --git a/deps/zlib/unzip.h b/deps/zlib/unzip.h new file mode 100644 index 0000000..3183968 --- /dev/null +++ b/deps/zlib/unzip.h @@ -0,0 +1,437 @@ +/* unzip.h -- IO for uncompress .zip files using zlib + Version 1.1, February 14h, 2010 + part of the MiniZip project - ( http://www.winimage.com/zLibDll/minizip.html ) + + Copyright (C) 1998-2010 Gilles Vollant (minizip) ( http://www.winimage.com/zLibDll/minizip.html ) + + Modifications of Unzip for Zip64 + Copyright (C) 2007-2008 Even Rouault + + Modifications for Zip64 support on both zip and unzip + Copyright (C) 2009-2010 Mathias Svensson ( http://result42.com ) + + For more info read MiniZip_info.txt + + --------------------------------------------------------------------------------- + + Condition of use and distribution are the same than zlib : + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + --------------------------------------------------------------------------------- + + Changes + + See header of unzip64.c + +*/ + +#ifndef _unz64_H +#define _unz64_H + +#ifdef __cplusplus +extern "C" { +#endif + +#ifndef _ZLIB_H +#include "zlib.h" +#endif + +#ifndef _ZLIBIOAPI_H +#include "ioapi.h" +#endif + +#ifdef HAVE_BZIP2 +#include "bzlib.h" +#endif + +#define Z_BZIP2ED 12 + +#if defined(STRICTUNZIP) || defined(STRICTZIPUNZIP) +/* like the STRICT of WIN32, we define a pointer that cannot be converted + from (void*) without cast */ +typedef struct TagunzFile__ { int unused; } unzFile__; +typedef unzFile__ *unzFile; +#else +typedef voidp unzFile; +#endif + + +#define UNZ_OK (0) +#define UNZ_END_OF_LIST_OF_FILE (-100) +#define UNZ_ERRNO (Z_ERRNO) +#define UNZ_EOF (0) +#define UNZ_PARAMERROR (-102) +#define UNZ_BADZIPFILE (-103) +#define UNZ_INTERNALERROR (-104) +#define UNZ_CRCERROR (-105) + +/* tm_unz contain date/time info */ +typedef struct tm_unz_s +{ + uInt tm_sec; /* seconds after the minute - [0,59] */ + uInt tm_min; /* minutes after the hour - [0,59] */ + uInt tm_hour; /* hours since midnight - [0,23] */ + uInt tm_mday; /* day of the month - [1,31] */ + uInt tm_mon; /* months since January - [0,11] */ + uInt tm_year; /* years - [1980..2044] */ +} tm_unz; + +/* unz_global_info structure contain global data about the ZIPfile + These data comes from the end of central dir */ +typedef struct unz_global_info64_s +{ + ZPOS64_T number_entry; /* total number of entries in + the central dir on this disk */ + uLong size_comment; /* size of the global comment of the zipfile */ +} unz_global_info64; + +typedef struct unz_global_info_s +{ + uLong number_entry; /* total number of entries in + the central dir on this disk */ + uLong size_comment; /* size of the global comment of the zipfile */ +} unz_global_info; + +/* unz_file_info contain information about a file in the zipfile */ +typedef struct unz_file_info64_s +{ + uLong version; /* version made by 2 bytes */ + uLong version_needed; /* version needed to extract 2 bytes */ + uLong flag; /* general purpose bit flag 2 bytes */ + uLong compression_method; /* compression method 2 bytes */ + uLong dosDate; /* last mod file date in Dos fmt 4 bytes */ + uLong crc; /* crc-32 4 bytes */ + ZPOS64_T compressed_size; /* compressed size 8 bytes */ + ZPOS64_T uncompressed_size; /* uncompressed size 8 bytes */ + uLong size_filename; /* filename length 2 bytes */ + uLong size_file_extra; /* extra field length 2 bytes */ + uLong size_file_comment; /* file comment length 2 bytes */ + + uLong disk_num_start; /* disk number start 2 bytes */ + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ + + tm_unz tmu_date; +} unz_file_info64; + +typedef struct unz_file_info_s +{ + uLong version; /* version made by 2 bytes */ + uLong version_needed; /* version needed to extract 2 bytes */ + uLong flag; /* general purpose bit flag 2 bytes */ + uLong compression_method; /* compression method 2 bytes */ + uLong dosDate; /* last mod file date in Dos fmt 4 bytes */ + uLong crc; /* crc-32 4 bytes */ + uLong compressed_size; /* compressed size 4 bytes */ + uLong uncompressed_size; /* uncompressed size 4 bytes */ + uLong size_filename; /* filename length 2 bytes */ + uLong size_file_extra; /* extra field length 2 bytes */ + uLong size_file_comment; /* file comment length 2 bytes */ + + uLong disk_num_start; /* disk number start 2 bytes */ + uLong internal_fa; /* internal file attributes 2 bytes */ + uLong external_fa; /* external file attributes 4 bytes */ + + tm_unz tmu_date; +} unz_file_info; + +extern int ZEXPORT unzStringFileNameCompare OF ((const char* fileName1, + const char* fileName2, + int iCaseSensitivity)); +/* + Compare two filename (fileName1,fileName2). + If iCaseSenisivity = 1, comparision is case sensitivity (like strcmp) + If iCaseSenisivity = 2, comparision is not case sensitivity (like strcmpi + or strcasecmp) + If iCaseSenisivity = 0, case sensitivity is defaut of your operating system + (like 1 on Unix, 2 on Windows) +*/ + + +extern unzFile ZEXPORT unzOpen OF((const char *path)); +extern unzFile ZEXPORT unzOpen64 OF((const void *path)); +/* + Open a Zip file. path contain the full pathname (by example, + on a Windows XP computer "c:\\zlib\\zlib113.zip" or on an Unix computer + "zlib/zlib113.zip". + If the zipfile cannot be opened (file don't exist or in not valid), the + return value is NULL. + Else, the return value is a unzFile Handle, usable with other function + of this unzip package. + the "64" function take a const void* pointer, because the path is just the + value passed to the open64_file_func callback. + Under Windows, if UNICODE is defined, using fill_fopen64_filefunc, the path + is a pointer to a wide unicode string (LPCTSTR is LPCWSTR), so const char* + does not describe the reality +*/ + + +extern unzFile ZEXPORT unzOpen2 OF((const char *path, + zlib_filefunc_def* pzlib_filefunc_def)); +/* + Open a Zip file, like unzOpen, but provide a set of file low level API + for read/write the zip file (see ioapi.h) +*/ + +extern unzFile ZEXPORT unzOpen2_64 OF((const void *path, + zlib_filefunc64_def* pzlib_filefunc_def)); +/* + Open a Zip file, like unz64Open, but provide a set of file low level API + for read/write the zip file (see ioapi.h) +*/ + +extern int ZEXPORT unzClose OF((unzFile file)); +/* + Close a ZipFile opened with unzipOpen. + If there is files inside the .Zip opened with unzOpenCurrentFile (see later), + these files MUST be closed with unzipCloseCurrentFile before call unzipClose. + return UNZ_OK if there is no problem. */ + +extern int ZEXPORT unzGetGlobalInfo OF((unzFile file, + unz_global_info *pglobal_info)); + +extern int ZEXPORT unzGetGlobalInfo64 OF((unzFile file, + unz_global_info64 *pglobal_info)); +/* + Write info about the ZipFile in the *pglobal_info structure. + No preparation of the structure is needed + return UNZ_OK if there is no problem. */ + + +extern int ZEXPORT unzGetGlobalComment OF((unzFile file, + char *szComment, + uLong uSizeBuf)); +/* + Get the global comment string of the ZipFile, in the szComment buffer. + uSizeBuf is the size of the szComment buffer. + return the number of byte copied or an error code <0 +*/ + + +/***************************************************************************/ +/* Unzip package allow you browse the directory of the zipfile */ + +extern int ZEXPORT unzGoToFirstFile OF((unzFile file)); +/* + Set the current file of the zipfile to the first file. + return UNZ_OK if there is no problem +*/ + +extern int ZEXPORT unzGoToNextFile OF((unzFile file)); +/* + Set the current file of the zipfile to the next file. + return UNZ_OK if there is no problem + return UNZ_END_OF_LIST_OF_FILE if the actual file was the latest. +*/ + +extern int ZEXPORT unzLocateFile OF((unzFile file, + const char *szFileName, + int iCaseSensitivity)); +/* + Try locate the file szFileName in the zipfile. + For the iCaseSensitivity signification, see unzStringFileNameCompare + + return value : + UNZ_OK if the file is found. It becomes the current file. + UNZ_END_OF_LIST_OF_FILE if the file is not found +*/ + + +/* ****************************************** */ +/* Ryan supplied functions */ +/* unz_file_info contain information about a file in the zipfile */ +typedef struct unz_file_pos_s +{ + uLong pos_in_zip_directory; /* offset in zip file directory */ + uLong num_of_file; /* # of file */ +} unz_file_pos; + +extern int ZEXPORT unzGetFilePos( + unzFile file, + unz_file_pos* file_pos); + +extern int ZEXPORT unzGoToFilePos( + unzFile file, + unz_file_pos* file_pos); + +typedef struct unz64_file_pos_s +{ + ZPOS64_T pos_in_zip_directory; /* offset in zip file directory */ + ZPOS64_T num_of_file; /* # of file */ +} unz64_file_pos; + +extern int ZEXPORT unzGetFilePos64( + unzFile file, + unz64_file_pos* file_pos); + +extern int ZEXPORT unzGoToFilePos64( + unzFile file, + const unz64_file_pos* file_pos); + +/* ****************************************** */ + +extern int ZEXPORT unzGetCurrentFileInfo64 OF((unzFile file, + unz_file_info64 *pfile_info, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); + +extern int ZEXPORT unzGetCurrentFileInfo OF((unzFile file, + unz_file_info *pfile_info, + char *szFileName, + uLong fileNameBufferSize, + void *extraField, + uLong extraFieldBufferSize, + char *szComment, + uLong commentBufferSize)); +/* + Get Info about the current file + if pfile_info!=NULL, the *pfile_info structure will contain somes info about + the current file + if szFileName!=NULL, the filemane string will be copied in szFileName + (fileNameBufferSize is the size of the buffer) + if extraField!=NULL, the extra field information will be copied in extraField + (extraFieldBufferSize is the size of the buffer). + This is the Central-header version of the extra field + if szComment!=NULL, the comment string of the file will be copied in szComment + (commentBufferSize is the size of the buffer) +*/ + + +/** Addition for GDAL : START */ + +extern ZPOS64_T ZEXPORT unzGetCurrentFileZStreamPos64 OF((unzFile file)); + +/** Addition for GDAL : END */ + + +/***************************************************************************/ +/* for reading the content of the current zipfile, you can open it, read data + from it, and close it (you can close it before reading all the file) + */ + +extern int ZEXPORT unzOpenCurrentFile OF((unzFile file)); +/* + Open for reading data the current file in the zipfile. + If there is no error, the return value is UNZ_OK. +*/ + +extern int ZEXPORT unzOpenCurrentFilePassword OF((unzFile file, + const char* password)); +/* + Open for reading data the current file in the zipfile. + password is a crypting password + If there is no error, the return value is UNZ_OK. +*/ + +extern int ZEXPORT unzOpenCurrentFile2 OF((unzFile file, + int* method, + int* level, + int raw)); +/* + Same than unzOpenCurrentFile, but open for read raw the file (not uncompress) + if raw==1 + *method will receive method of compression, *level will receive level of + compression + note : you can set level parameter as NULL (if you did not want known level, + but you CANNOT set method parameter as NULL +*/ + +extern int ZEXPORT unzOpenCurrentFile3 OF((unzFile file, + int* method, + int* level, + int raw, + const char* password)); +/* + Same than unzOpenCurrentFile, but open for read raw the file (not uncompress) + if raw==1 + *method will receive method of compression, *level will receive level of + compression + note : you can set level parameter as NULL (if you did not want known level, + but you CANNOT set method parameter as NULL +*/ + + +extern int ZEXPORT unzCloseCurrentFile OF((unzFile file)); +/* + Close the file in zip opened with unzOpenCurrentFile + Return UNZ_CRCERROR if all the file was read but the CRC is not good +*/ + +extern int ZEXPORT unzReadCurrentFile OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read bytes from the current file (opened by unzOpenCurrentFile) + buf contain buffer where data must be copied + len the size of buf. + + return the number of byte copied if somes bytes are copied + return 0 if the end of file was reached + return <0 with error code if there is an error + (UNZ_ERRNO for IO error, or zLib error for uncompress error) +*/ + +extern z_off_t ZEXPORT unztell OF((unzFile file)); + +extern ZPOS64_T ZEXPORT unztell64 OF((unzFile file)); +/* + Give the current position in uncompressed data +*/ + +extern int ZEXPORT unzeof OF((unzFile file)); +/* + return 1 if the end of file was reached, 0 elsewhere +*/ + +extern int ZEXPORT unzGetLocalExtrafield OF((unzFile file, + voidp buf, + unsigned len)); +/* + Read extra field from the current file (opened by unzOpenCurrentFile) + This is the local-header version of the extra field (sometimes, there is + more info in the local-header version than in the central-header) + + if buf==NULL, it return the size of the local extra field + + if buf!=NULL, len is the size of the buffer, the extra header is copied in + buf. + the return value is the number of bytes copied in buf, or (if <0) + the error code +*/ + +/***************************************************************************/ + +/* Get the current file offset */ +extern ZPOS64_T ZEXPORT unzGetOffset64 (unzFile file); +extern uLong ZEXPORT unzGetOffset (unzFile file); + +/* Set the current file offset */ +extern int ZEXPORT unzSetOffset64 (unzFile file, ZPOS64_T pos); +extern int ZEXPORT unzSetOffset (unzFile file, uLong pos); + + + +#ifdef __cplusplus +} +#endif + +#endif /* _unz64_H */ diff --git a/deps/zlib/zconf.h b/deps/zlib/zconf.h new file mode 100644 index 0000000..9987a77 --- /dev/null +++ b/deps/zlib/zconf.h @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/deps/zlib/zconf.h.in b/deps/zlib/zconf.h.in new file mode 100644 index 0000000..9987a77 --- /dev/null +++ b/deps/zlib/zconf.h.in @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#ifdef HAVE_UNISTD_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#ifdef HAVE_STDARG_H /* may be set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/deps/zlib/zlib.h b/deps/zlib/zlib.h new file mode 100644 index 0000000..aa5935d --- /dev/null +++ b/deps/zlib/zlib.h @@ -0,0 +1,1763 @@ +/* zlib.h -- interface of the 'zlib' general purpose compression library + version 1.2.8, April 28th, 2013 + + Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + + + The data format used by the zlib library is described by RFCs (Request for + Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950 + (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format). +*/ + +#ifndef ZLIB_H +#define ZLIB_H + +#include "zconf.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#define ZLIB_VERSION "1.2.8" +#define ZLIB_VERNUM 0x1280 +#define ZLIB_VER_MAJOR 1 +#define ZLIB_VER_MINOR 2 +#define ZLIB_VER_REVISION 8 +#define ZLIB_VER_SUBREVISION 0 + +/* + The 'zlib' compression library provides in-memory compression and + decompression functions, including integrity checks of the uncompressed data. + This version of the library supports only one compression method (deflation) + but other algorithms will be added later and will have the same stream + interface. + + Compression can be done in a single step if the buffers are large enough, + or can be done by repeated calls of the compression function. In the latter + case, the application must provide more input and/or consume the output + (providing more output space) before each call. + + The compressed data format used by default by the in-memory functions is + the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped + around a deflate stream, which is itself documented in RFC 1951. + + The library also supports reading and writing files in gzip (.gz) format + with an interface similar to that of stdio using the functions that start + with "gz". The gzip format is different from the zlib format. gzip is a + gzip wrapper, documented in RFC 1952, wrapped around a deflate stream. + + This library can optionally read and write gzip streams in memory as well. + + The zlib format was designed to be compact and fast for use in memory + and on communications channels. The gzip format was designed for single- + file compression on file systems, has a larger header than zlib to maintain + directory information, and uses a different, slower check method than zlib. + + The library does not install any signal handler. The decoder checks + the consistency of the compressed data, so the library should never crash + even in case of corrupted input. +*/ + +typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size)); +typedef void (*free_func) OF((voidpf opaque, voidpf address)); + +struct internal_state; + +typedef struct z_stream_s { + z_const Bytef *next_in; /* next input byte */ + uInt avail_in; /* number of bytes available at next_in */ + uLong total_in; /* total number of input bytes read so far */ + + Bytef *next_out; /* next output byte should be put there */ + uInt avail_out; /* remaining free space at next_out */ + uLong total_out; /* total number of bytes output so far */ + + z_const char *msg; /* last error message, NULL if no error */ + void *state; /* not visible by applications */ + + alloc_func zalloc; /* used to allocate the internal state */ + free_func zfree; /* used to free the internal state */ + voidpf opaque; /* private data object passed to zalloc and zfree */ + + int data_type; /* best guess about the data type: binary or text */ + uLong adler; /* adler32 value of the uncompressed data */ + uLong reserved; /* reserved for future use */ +} z_stream; + +typedef z_stream FAR *z_streamp; + +/* + gzip header information passed to and from zlib routines. See RFC 1952 + for more details on the meanings of these fields. +*/ +typedef struct gz_header_s { + int text; /* true if compressed data believed to be text */ + uLong time; /* modification time */ + int xflags; /* extra flags (not used when writing a gzip file) */ + int os; /* operating system */ + Bytef *extra; /* pointer to extra field or Z_NULL if none */ + uInt extra_len; /* extra field length (valid if extra != Z_NULL) */ + uInt extra_max; /* space at extra (only when reading header) */ + Bytef *name; /* pointer to zero-terminated file name or Z_NULL */ + uInt name_max; /* space at name (only when reading header) */ + Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */ + uInt comm_max; /* space at comment (only when reading header) */ + int hcrc; /* true if there was or will be a header crc */ + int done; /* true when done reading gzip header (not used + when writing a gzip file) */ +} gz_header; + +typedef gz_header FAR *gz_headerp; + +/* + The application must update next_in and avail_in when avail_in has dropped + to zero. It must update next_out and avail_out when avail_out has dropped + to zero. The application must initialize zalloc, zfree and opaque before + calling the init function. All other fields are set by the compression + library and must not be updated by the application. + + The opaque value provided by the application will be passed as the first + parameter for calls of zalloc and zfree. This can be useful for custom + memory management. The compression library attaches no meaning to the + opaque value. + + zalloc must return Z_NULL if there is not enough memory for the object. + If zlib is used in a multi-threaded application, zalloc and zfree must be + thread safe. + + On 16-bit systems, the functions zalloc and zfree must be able to allocate + exactly 65536 bytes, but will not be required to allocate more than this if + the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers + returned by zalloc for objects of exactly 65536 bytes *must* have their + offset normalized to zero. The default allocation function provided by this + library ensures this (see zutil.c). To reduce memory requirements and avoid + any allocation of 64K objects, at the expense of compression ratio, compile + the library with -DMAX_WBITS=14 (see zconf.h). + + The fields total_in and total_out can be used for statistics or progress + reports. After compression, total_in holds the total size of the + uncompressed data and may be saved for use in the decompressor (particularly + if the decompressor wants to decompress everything in a single step). +*/ + + /* constants */ + +#define Z_NO_FLUSH 0 +#define Z_PARTIAL_FLUSH 1 +#define Z_SYNC_FLUSH 2 +#define Z_FULL_FLUSH 3 +#define Z_FINISH 4 +#define Z_BLOCK 5 +#define Z_TREES 6 +/* Allowed flush values; see deflate() and inflate() below for details */ + +#define Z_OK 0 +#define Z_STREAM_END 1 +#define Z_NEED_DICT 2 +#define Z_ERRNO (-1) +#define Z_STREAM_ERROR (-2) +#define Z_DATA_ERROR (-3) +#define Z_MEM_ERROR (-4) +#define Z_BUF_ERROR (-5) +#define Z_VERSION_ERROR (-6) +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ + +#define Z_NO_COMPRESSION 0 +#define Z_BEST_SPEED 1 +#define Z_BEST_COMPRESSION 9 +#define Z_DEFAULT_COMPRESSION (-1) +/* compression levels */ + +#define Z_FILTERED 1 +#define Z_HUFFMAN_ONLY 2 +#define Z_RLE 3 +#define Z_FIXED 4 +#define Z_DEFAULT_STRATEGY 0 +/* compression strategy; see deflateInit2() below for details */ + +#define Z_BINARY 0 +#define Z_TEXT 1 +#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */ +#define Z_UNKNOWN 2 +/* Possible values of the data_type field (though see inflate()) */ + +#define Z_DEFLATED 8 +/* The deflate compression method (the only one supported in this version) */ + +#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */ + +#define zlib_version zlibVersion() +/* for compatibility with versions < 1.0.2 */ + + + /* basic functions */ + +ZEXTERN const char * ZEXPORT zlibVersion OF((void)); +/* The application can compare zlibVersion and ZLIB_VERSION for consistency. + If the first character differs, the library code actually used is not + compatible with the zlib.h header file used by the application. This check + is automatically made by deflateInit and inflateInit. + */ + +/* +ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level)); + + Initializes the internal stream state for compression. The fields + zalloc, zfree and opaque must be initialized before by the caller. If + zalloc and zfree are set to Z_NULL, deflateInit updates them to use default + allocation functions. + + The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9: + 1 gives best speed, 9 gives best compression, 0 gives no compression at all + (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION + requests a default compromise between speed and compression (currently + equivalent to level 6). + + deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if level is not a valid compression level, or + Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible + with the version assumed by the caller (ZLIB_VERSION). msg is set to null + if there is no error message. deflateInit does not perform any compression: + this will be done by deflate(). +*/ + + +ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush)); +/* + deflate compresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. deflate performs one or both of the + following actions: + + - Compress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in and avail_in are updated and + processing will resume at this point for the next call of deflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. This action is forced if the parameter flush is non zero. + Forcing flush frequently degrades the compression ratio, so this parameter + should be set only when necessary (in interactive applications). Some + output may be provided even if flush is not set. + + Before the call of deflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating avail_in or avail_out accordingly; avail_out should + never be zero before the call. The application can consume the compressed + output when it wants, for example when the output buffer is full (avail_out + == 0), or after each call of deflate(). If deflate returns Z_OK and with + zero avail_out, it must be called again after making room in the output + buffer because there might be more output pending. + + Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to + decide how much data to accumulate before producing output, in order to + maximize compression. + + If the parameter flush is set to Z_SYNC_FLUSH, all pending output is + flushed to the output buffer and the output is aligned on a byte boundary, so + that the decompressor can get all input data available so far. (In + particular avail_in is zero after the call if enough output space has been + provided before the call.) Flushing may degrade compression for some + compression algorithms and so it should be used only when necessary. This + completes the current deflate block and follows it with an empty stored block + that is three bits plus filler bits to the next byte, followed by four bytes + (00 00 ff ff). + + If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the + output buffer, but the output is not aligned to a byte boundary. All of the + input data so far will be available to the decompressor, as for Z_SYNC_FLUSH. + This completes the current deflate block and follows it with an empty fixed + codes block that is 10 bits long. This assures that enough bytes are output + in order for the decompressor to finish the block before the empty fixed code + block. + + If flush is set to Z_BLOCK, a deflate block is completed and emitted, as + for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to + seven bits of the current block are held to be written as the next byte after + the next deflate block is completed. In this case, the decompressor may not + be provided enough bits at this point in order to complete decompression of + the data provided so far to the compressor. It may need to wait for the next + block to be emitted. This is for advanced applications that need to control + the emission of deflate blocks. + + If flush is set to Z_FULL_FLUSH, all output is flushed as with + Z_SYNC_FLUSH, and the compression state is reset so that decompression can + restart from this point if previous compressed data has been damaged or if + random access is desired. Using Z_FULL_FLUSH too often can seriously degrade + compression. + + If deflate returns with avail_out == 0, this function must be called again + with the same value of the flush parameter and more output space (updated + avail_out), until the flush is complete (deflate returns with non-zero + avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that + avail_out is greater than six to avoid repeated flush markers due to + avail_out == 0 on return. + + If the parameter flush is set to Z_FINISH, pending input is processed, + pending output is flushed and deflate returns with Z_STREAM_END if there was + enough output space; if deflate returns with Z_OK, this function must be + called again with Z_FINISH and more output space (updated avail_out) but no + more input data, until it returns with Z_STREAM_END or an error. After + deflate has returned Z_STREAM_END, the only possible operations on the stream + are deflateReset or deflateEnd. + + Z_FINISH can be used immediately after deflateInit if all the compression + is to be done in a single step. In this case, avail_out must be at least the + value returned by deflateBound (see below). Then deflate is guaranteed to + return Z_STREAM_END. If not enough output space is provided, deflate will + not return Z_STREAM_END, and it must be called again as described above. + + deflate() sets strm->adler to the adler32 checksum of all input read + so far (that is, total_in bytes). + + deflate() may update strm->data_type if it can make a good guess about + the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered + binary. This field is only for information purposes and does not affect the + compression algorithm in any manner. + + deflate() returns Z_OK if some progress has been made (more input + processed or more output produced), Z_STREAM_END if all input has been + consumed and all output has been produced (only when flush is set to + Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example + if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible + (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not + fatal, and deflate() can be called again with more input and more output + space to continue compressing. +*/ + + +ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the + stream state was inconsistent, Z_DATA_ERROR if the stream was freed + prematurely (some input or output was discarded). In the error case, msg + may be set but then points to a static string (which must not be + deallocated). +*/ + + +/* +ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm)); + + Initializes the internal stream state for decompression. The fields + next_in, avail_in, zalloc, zfree and opaque must be initialized before by + the caller. If next_in is not Z_NULL and avail_in is large enough (the + exact value depends on the compression method), inflateInit determines the + compression method from the zlib header and allocates all data structures + accordingly; otherwise the allocation will be deferred to the first call of + inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to + use default allocation functions. + + inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit() does not process any header information -- that is deferred + until inflate() is called. +*/ + + +ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush)); +/* + inflate decompresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. inflate performs one or both of the + following actions: + + - Decompress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in is updated and processing will + resume at this point for the next call of inflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. inflate() provides as much output as possible, until there is + no more input data or no more space in the output buffer (see below about + the flush parameter). + + Before the call of inflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating the next_* and avail_* values accordingly. The + application can consume the uncompressed output when it wants, for example + when the output buffer is full (avail_out == 0), or after each call of + inflate(). If inflate returns Z_OK and with zero avail_out, it must be + called again after making room in the output buffer because there might be + more output pending. + + The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH, + Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much + output as possible to the output buffer. Z_BLOCK requests that inflate() + stop if and when it gets to the next deflate block boundary. When decoding + the zlib or gzip format, this will cause inflate() to return immediately + after the header and before the first block. When doing a raw inflate, + inflate() will go ahead and process the first block, and will return when it + gets to the end of that block, or when it runs out of data. + + The Z_BLOCK option assists in appending to or combining deflate streams. + Also to assist in this, on return inflate() will set strm->data_type to the + number of unused bits in the last byte taken from strm->next_in, plus 64 if + inflate() is currently decoding the last block in the deflate stream, plus + 128 if inflate() returned immediately after decoding an end-of-block code or + decoding the complete header up to just before the first byte of the deflate + stream. The end-of-block will not be indicated until all of the uncompressed + data from that block has been written to strm->next_out. The number of + unused bits may in general be greater than seven, except when bit 7 of + data_type is set, in which case the number of unused bits will be less than + eight. data_type is set as noted here every time inflate() returns for all + flush options, and so can be used to determine the amount of currently + consumed input in bits. + + The Z_TREES option behaves as Z_BLOCK does, but it also returns when the + end of each deflate block header is reached, before any actual data in that + block is decoded. This allows the caller to determine the length of the + deflate block header for later use in random access within a deflate block. + 256 is added to the value of strm->data_type when inflate() returns + immediately after reaching the end of the deflate block header. + + inflate() should normally be called until it returns Z_STREAM_END or an + error. However if all decompression is to be performed in a single step (a + single call of inflate), the parameter flush should be set to Z_FINISH. In + this case all pending input is processed and all pending output is flushed; + avail_out must be large enough to hold all of the uncompressed data for the + operation to complete. (The size of the uncompressed data may have been + saved by the compressor for this purpose.) The use of Z_FINISH is not + required to perform an inflation in one step. However it may be used to + inform inflate that a faster approach can be used for the single inflate() + call. Z_FINISH also informs inflate to not maintain a sliding window if the + stream completes, which reduces inflate's memory footprint. If the stream + does not complete, either because not all of the stream is provided or not + enough output space is provided, then a sliding window will be allocated and + inflate() can be called again to continue the operation as if Z_NO_FLUSH had + been used. + + In this implementation, inflate() always flushes as much output as + possible to the output buffer, and always uses the faster approach on the + first call. So the effects of the flush parameter in this implementation are + on the return value of inflate() as noted below, when inflate() returns early + when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of + memory for a sliding window when Z_FINISH is used. + + If a preset dictionary is needed after this call (see inflateSetDictionary + below), inflate sets strm->adler to the Adler-32 checksum of the dictionary + chosen by the compressor and returns Z_NEED_DICT; otherwise it sets + strm->adler to the Adler-32 checksum of all output produced so far (that is, + total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described + below. At the end of the stream, inflate() checks that its computed adler32 + checksum is equal to that saved by the compressor and returns Z_STREAM_END + only if the checksum is correct. + + inflate() can decompress and check either zlib-wrapped or gzip-wrapped + deflate data. The header type is detected automatically, if requested when + initializing with inflateInit2(). Any information contained in the gzip + header is not retained, so applications that need that information should + instead use raw inflate, see inflateInit2() below, or inflateBack() and + perform their own processing of the gzip header and trailer. When processing + gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output + producted so far. The CRC-32 is checked against the gzip trailer. + + inflate() returns Z_OK if some progress has been made (more input processed + or more output produced), Z_STREAM_END if the end of the compressed data has + been reached and all uncompressed output has been produced, Z_NEED_DICT if a + preset dictionary is needed at this point, Z_DATA_ERROR if the input data was + corrupted (input stream not conforming to the zlib format or incorrect check + value), Z_STREAM_ERROR if the stream structure was inconsistent (for example + next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory, + Z_BUF_ERROR if no progress is possible or if there was not enough room in the + output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and + inflate() can be called again with more input and more output space to + continue decompressing. If Z_DATA_ERROR is returned, the application may + then call inflateSync() to look for a good compression block if a partial + recovery of the data is desired. +*/ + + +ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state + was inconsistent. In the error case, msg may be set but then points to a + static string (which must not be deallocated). +*/ + + + /* Advanced functions */ + +/* + The following functions are needed only in some special applications. +*/ + +/* +ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm, + int level, + int method, + int windowBits, + int memLevel, + int strategy)); + + This is another version of deflateInit with more compression options. The + fields next_in, zalloc, zfree and opaque must be initialized before by the + caller. + + The method parameter is the compression method. It must be Z_DEFLATED in + this version of the library. + + The windowBits parameter is the base two logarithm of the window size + (the size of the history buffer). It should be in the range 8..15 for this + version of the library. Larger values of this parameter result in better + compression at the expense of memory usage. The default value is 15 if + deflateInit is used instead. + + windowBits can also be -8..-15 for raw deflate. In this case, -windowBits + determines the window size. deflate() will then generate raw deflate data + with no zlib header or trailer, and will not compute an adler32 check value. + + windowBits can also be greater than 15 for optional gzip encoding. Add + 16 to windowBits to write a simple gzip header and trailer around the + compressed data instead of a zlib wrapper. The gzip header will have no + file name, no extra data, no comment, no modification time (set to zero), no + header crc, and the operating system will be set to 255 (unknown). If a + gzip stream is being written, strm->adler is a crc32 instead of an adler32. + + The memLevel parameter specifies how much memory should be allocated + for the internal compression state. memLevel=1 uses minimum memory but is + slow and reduces compression ratio; memLevel=9 uses maximum memory for + optimal speed. The default value is 8. See zconf.h for total memory usage + as a function of windowBits and memLevel. + + The strategy parameter is used to tune the compression algorithm. Use the + value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a + filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no + string match), or Z_RLE to limit match distances to one (run-length + encoding). Filtered data consists mostly of small values with a somewhat + random distribution. In this case, the compression algorithm is tuned to + compress them better. The effect of Z_FILTERED is to force more Huffman + coding and less string matching; it is somewhat intermediate between + Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as + fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The + strategy parameter only affects the compression ratio but not the + correctness of the compressed output even if it is not set appropriately. + Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler + decoder for special applications. + + deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid + method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is + incompatible with the version assumed by the caller (ZLIB_VERSION). msg is + set to null if there is no error message. deflateInit2 does not perform any + compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the compression dictionary from the given byte sequence + without producing any compressed output. When using the zlib format, this + function must be called immediately after deflateInit, deflateInit2 or + deflateReset, and before any call of deflate. When doing raw deflate, this + function must be called either before any call of deflate, or immediately + after the completion of a deflate block, i.e. after all input has been + consumed and all output has been delivered when using any of the flush + options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The + compressor and decompressor must use exactly the same dictionary (see + inflateSetDictionary). + + The dictionary should consist of strings (byte sequences) that are likely + to be encountered later in the data to be compressed, with the most commonly + used strings preferably put towards the end of the dictionary. Using a + dictionary is most useful when the data to be compressed is short and can be + predicted with good accuracy; the data can then be compressed better than + with the default empty dictionary. + + Depending on the size of the compression data structures selected by + deflateInit or deflateInit2, a part of the dictionary may in effect be + discarded, for example if the dictionary is larger than the window size + provided in deflateInit or deflateInit2. Thus the strings most likely to be + useful should be put at the end of the dictionary, not at the front. In + addition, the current implementation of deflate will use at most the window + size minus 262 bytes of the provided dictionary. + + Upon return of this function, strm->adler is set to the adler32 value + of the dictionary; the decompressor may later use this value to determine + which dictionary has been used by the compressor. (The adler32 value + applies to the whole dictionary even if only a subset of the dictionary is + actually used by the compressor.) If a raw deflate was requested, then the + adler32 value is not computed and strm->adler is not set. + + deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent (for example if deflate has already been called for this stream + or if not at a block boundary for raw deflate). deflateSetDictionary does + not perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when several compression strategies will be + tried, for example when there are several ways of pre-processing the input + data with a filter. The streams that will be discarded should then be freed + by calling deflateEnd. Note that deflateCopy duplicates the internal + compression state which can be quite large, so this strategy is slow and can + consume lots of memory. + + deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm)); +/* + This function is equivalent to deflateEnd followed by deflateInit, + but does not free and reallocate all the internal compression state. The + stream will keep the same compression level and any other attributes that + may have been set by deflateInit2. + + deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm, + int level, + int strategy)); +/* + Dynamically update the compression level and compression strategy. The + interpretation of level and strategy is as in deflateInit2. This can be + used to switch between compression and straight copy of the input data, or + to switch to a different kind of input data requiring a different strategy. + If the compression level is changed, the input available so far is + compressed with the old level (and may be flushed); the new level will take + effect only at the next call of deflate(). + + Before the call of deflateParams, the stream state must be set as for + a call of deflate(), since the currently available input may have to be + compressed and flushed. In particular, strm->avail_out must be non-zero. + + deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source + stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if + strm->avail_out was zero. +*/ + +ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm, + int good_length, + int max_lazy, + int nice_length, + int max_chain)); +/* + Fine tune deflate's internal compression parameters. This should only be + used by someone who understands the algorithm used by zlib's deflate for + searching for the best matching string, and even then only by the most + fanatic optimizer trying to squeeze out the last compressed bit for their + specific input data. Read the deflate.c source code for the meaning of the + max_lazy, good_length, nice_length, and max_chain parameters. + + deflateTune() can be called after deflateInit() or deflateInit2(), and + returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream. + */ + +ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm, + uLong sourceLen)); +/* + deflateBound() returns an upper bound on the compressed size after + deflation of sourceLen bytes. It must be called after deflateInit() or + deflateInit2(), and after deflateSetHeader(), if used. This would be used + to allocate an output buffer for deflation in a single pass, and so would be + called before deflate(). If that first deflate() call is provided the + sourceLen input bytes, an output buffer allocated to the size returned by + deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed + to return Z_STREAM_END. Note that it is possible for the compressed size to + be larger than the value returned by deflateBound() if flush options other + than Z_FINISH or Z_NO_FLUSH are used. +*/ + +ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm, + unsigned *pending, + int *bits)); +/* + deflatePending() returns the number of bytes and bits of output that have + been generated, but not yet provided in the available output. The bytes not + provided would be due to the available output space having being consumed. + The number of bits of output not provided are between 0 and 7, where they + await more bits to join them in order to fill out a full byte. If pending + or bits are Z_NULL, then those values are not set. + + deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. + */ + +ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + deflatePrime() inserts bits in the deflate output stream. The intent + is that this function is used to start off the deflate output with the bits + leftover from a previous deflate stream when appending to it. As such, this + function can only be used for raw deflate, and must be used before the first + deflate() call after a deflateInit2() or deflateReset(). bits must be less + than or equal to 16, and that many of the least significant bits of value + will be inserted in the output. + + deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough + room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm, + gz_headerp head)); +/* + deflateSetHeader() provides gzip header information for when a gzip + stream is requested by deflateInit2(). deflateSetHeader() may be called + after deflateInit2() or deflateReset() and before the first call of + deflate(). The text, time, os, extra field, name, and comment information + in the provided gz_header structure are written to the gzip header (xflag is + ignored -- the extra flags are set according to the compression level). The + caller must assure that, if not Z_NULL, name and comment are terminated with + a zero byte, and that if extra is not Z_NULL, that extra_len bytes are + available there. If hcrc is true, a gzip header crc is included. Note that + the current versions of the command-line version of gzip (up through version + 1.3.x) do not support header crc's, and will report that it is a "multi-part + gzip file" and give up. + + If deflateSetHeader is not used, the default gzip header has text false, + the time set to zero, and os set to 255, with no extra, name, or comment + fields. The gzip header is returned to the default state by deflateReset(). + + deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm, + int windowBits)); + + This is another version of inflateInit with an extra parameter. The + fields next_in, avail_in, zalloc, zfree and opaque must be initialized + before by the caller. + + The windowBits parameter is the base two logarithm of the maximum window + size (the size of the history buffer). It should be in the range 8..15 for + this version of the library. The default value is 15 if inflateInit is used + instead. windowBits must be greater than or equal to the windowBits value + provided to deflateInit2() while compressing, or it must be equal to 15 if + deflateInit2() was not used. If a compressed stream with a larger window + size is given as input, inflate() will return with the error code + Z_DATA_ERROR instead of trying to allocate a larger window. + + windowBits can also be zero to request that inflate use the window size in + the zlib header of the compressed stream. + + windowBits can also be -8..-15 for raw inflate. In this case, -windowBits + determines the window size. inflate() will then process raw deflate data, + not looking for a zlib or gzip header, not generating a check value, and not + looking for any check values for comparison at the end of the stream. This + is for use with other formats that use the deflate compressed data format + such as zip. Those formats provide their own check values. If a custom + format is developed using the raw deflate format for compressed data, it is + recommended that a check value such as an adler32 or a crc32 be applied to + the uncompressed data as is done in the zlib, gzip, and zip formats. For + most applications, the zlib format should be used as is. Note that comments + above on the use in deflateInit2() applies to the magnitude of windowBits. + + windowBits can also be greater than 15 for optional gzip decoding. Add + 32 to windowBits to enable zlib and gzip decoding with automatic header + detection, or add 16 to decode only the gzip format (the zlib format will + return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a + crc32 instead of an adler32. + + inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit2 does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit2() does not process any header information -- that is + deferred until inflate() is called. +*/ + +ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the decompression dictionary from the given uncompressed byte + sequence. This function must be called immediately after a call of inflate, + if that call returned Z_NEED_DICT. The dictionary chosen by the compressor + can be determined from the adler32 value returned by that call of inflate. + The compressor and decompressor must use exactly the same dictionary (see + deflateSetDictionary). For raw inflate, this function can be called at any + time to set the dictionary. If the provided dictionary is smaller than the + window and there is already data in the window, then the provided dictionary + will amend what's there. The application must insure that the dictionary + that was used for compression is provided. + + inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the + expected one (incorrect adler32 value). inflateSetDictionary does not + perform any decompression: this will be done by subsequent calls of + inflate(). +*/ + +ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm, + Bytef *dictionary, + uInt *dictLength)); +/* + Returns the sliding dictionary being maintained by inflate. dictLength is + set to the number of bytes in the dictionary, and that many bytes are copied + to dictionary. dictionary must have enough space, where 32768 bytes is + always enough. If inflateGetDictionary() is called with dictionary equal to + Z_NULL, then only the dictionary length is returned, and nothing is copied. + Similary, if dictLength is Z_NULL, then it is not set. + + inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the + stream state is inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm)); +/* + Skips invalid compressed data until a possible full flush point (see above + for the description of deflate with Z_FULL_FLUSH) can be found, or until all + available input is skipped. No output is provided. + + inflateSync searches for a 00 00 FF FF pattern in the compressed data. + All full flush points have this pattern, but not all occurrences of this + pattern are full flush points. + + inflateSync returns Z_OK if a possible full flush point has been found, + Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point + has been found, or Z_STREAM_ERROR if the stream structure was inconsistent. + In the success case, the application may save the current current value of + total_in which indicates where valid compressed data was found. In the + error case, the application may repeatedly call inflateSync, providing more + input each time, until success or end of the input data. +*/ + +ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when randomly accessing a large stream. The + first pass through the stream can periodically record the inflate state, + allowing restarting inflate at those points when randomly accessing the + stream. + + inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm)); +/* + This function is equivalent to inflateEnd followed by inflateInit, + but does not free and reallocate all the internal decompression state. The + stream will keep attributes that may have been set by inflateInit2. + + inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm, + int windowBits)); +/* + This function is the same as inflateReset, but it also permits changing + the wrap and window size requests. The windowBits parameter is interpreted + the same as it is for inflateInit2. + + inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL), or if + the windowBits parameter is invalid. +*/ + +ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + This function inserts bits in the inflate input stream. The intent is + that this function is used to start inflating at a bit position in the + middle of a byte. The provided bits will be used before any bytes are used + from next_in. This function should only be used with raw inflate, and + should be used before the first inflate() call after inflateInit2() or + inflateReset(). bits must be less than or equal to 16, and that many of the + least significant bits of value will be inserted in the input. + + If bits is negative, then the input stream bit buffer is emptied. Then + inflatePrime() can be called again to put bits in the buffer. This is used + to clear out bits leftover after feeding inflate a block description prior + to feeding inflate codes. + + inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm)); +/* + This function returns two values, one in the lower 16 bits of the return + value, and the other in the remaining upper bits, obtained by shifting the + return value down 16 bits. If the upper value is -1 and the lower value is + zero, then inflate() is currently decoding information outside of a block. + If the upper value is -1 and the lower value is non-zero, then inflate is in + the middle of a stored block, with the lower value equaling the number of + bytes from the input remaining to copy. If the upper value is not -1, then + it is the number of bits back from the current bit position in the input of + the code (literal or length/distance pair) currently being processed. In + that case the lower value is the number of bytes already emitted for that + code. + + A code is being processed if inflate is waiting for more input to complete + decoding of the code, or if it has completed decoding but is waiting for + more output space to write the literal or match data. + + inflateMark() is used to mark locations in the input data for random + access, which may be at bit positions, and to note those cases where the + output of a code may span boundaries of random access blocks. The current + location in the input stream can be determined from avail_in and data_type + as noted in the description for the Z_BLOCK flush parameter for inflate. + + inflateMark returns the value noted above or -1 << 16 if the provided + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm, + gz_headerp head)); +/* + inflateGetHeader() requests that gzip header information be stored in the + provided gz_header structure. inflateGetHeader() may be called after + inflateInit2() or inflateReset(), and before the first call of inflate(). + As inflate() processes the gzip stream, head->done is zero until the header + is completed, at which time head->done is set to one. If a zlib stream is + being decoded, then head->done is set to -1 to indicate that there will be + no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be + used to force inflate() to return immediately after header processing is + complete and before any actual data is decompressed. + + The text, time, xflags, and os fields are filled in with the gzip header + contents. hcrc is set to true if there is a header CRC. (The header CRC + was valid if done is set to one.) If extra is not Z_NULL, then extra_max + contains the maximum number of bytes to write to extra. Once done is true, + extra_len contains the actual extra field length, and extra contains the + extra field, or that field truncated if extra_max is less than extra_len. + If name is not Z_NULL, then up to name_max characters are written there, + terminated with a zero unless the length is greater than name_max. If + comment is not Z_NULL, then up to comm_max characters are written there, + terminated with a zero unless the length is greater than comm_max. When any + of extra, name, or comment are not Z_NULL and the respective field is not + present in the header, then that field is set to Z_NULL to signal its + absence. This allows the use of deflateSetHeader() with the returned + structure to duplicate the header. However if those fields are set to + allocated memory, then the application will need to save those pointers + elsewhere so that they can be eventually freed. + + If inflateGetHeader is not used, then the header information is simply + discarded. The header is always checked for validity, including the header + CRC if present. inflateReset() will reset the process to discard the header + information. The application would need to call inflateGetHeader() again to + retrieve the header from the next gzip stream. + + inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits, + unsigned char FAR *window)); + + Initialize the internal stream state for decompression using inflateBack() + calls. The fields zalloc, zfree and opaque in strm must be initialized + before the call. If zalloc and zfree are Z_NULL, then the default library- + derived memory allocation routines are used. windowBits is the base two + logarithm of the window size, in the range 8..15. window is a caller + supplied buffer of that size. Except for special applications where it is + assured that deflate was used with small window sizes, windowBits must be 15 + and a 32K byte window must be supplied to be able to decompress general + deflate streams. + + See inflateBack() for the usage of these routines. + + inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of + the parameters are invalid, Z_MEM_ERROR if the internal state could not be + allocated, or Z_VERSION_ERROR if the version of the library does not match + the version of the header file. +*/ + +typedef unsigned (*in_func) OF((void FAR *, + z_const unsigned char FAR * FAR *)); +typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned)); + +ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm, + in_func in, void FAR *in_desc, + out_func out, void FAR *out_desc)); +/* + inflateBack() does a raw inflate with a single call using a call-back + interface for input and output. This is potentially more efficient than + inflate() for file i/o applications, in that it avoids copying between the + output and the sliding window by simply making the window itself the output + buffer. inflate() can be faster on modern CPUs when used with large + buffers. inflateBack() trusts the application to not change the output + buffer passed by the output function, at least until inflateBack() returns. + + inflateBackInit() must be called first to allocate the internal state + and to initialize the state with the user-provided window buffer. + inflateBack() may then be used multiple times to inflate a complete, raw + deflate stream with each call. inflateBackEnd() is then called to free the + allocated state. + + A raw deflate stream is one with no zlib or gzip header or trailer. + This routine would normally be used in a utility that reads zip or gzip + files and writes out uncompressed files. The utility would decode the + header and process the trailer on its own, hence this routine expects only + the raw deflate stream to decompress. This is different from the normal + behavior of inflate(), which expects either a zlib or gzip header and + trailer around the deflate stream. + + inflateBack() uses two subroutines supplied by the caller that are then + called by inflateBack() for input and output. inflateBack() calls those + routines until it reads a complete deflate stream and writes out all of the + uncompressed data, or until it encounters an error. The function's + parameters and return types are defined above in the in_func and out_func + typedefs. inflateBack() will call in(in_desc, &buf) which should return the + number of bytes of provided input, and a pointer to that input in buf. If + there is no input available, in() must return zero--buf is ignored in that + case--and inflateBack() will return a buffer error. inflateBack() will call + out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out() + should return zero on success, or non-zero on failure. If out() returns + non-zero, inflateBack() will return with an error. Neither in() nor out() + are permitted to change the contents of the window provided to + inflateBackInit(), which is also the buffer that out() uses to write from. + The length written by out() will be at most the window size. Any non-zero + amount of input may be provided by in(). + + For convenience, inflateBack() can be provided input on the first call by + setting strm->next_in and strm->avail_in. If that input is exhausted, then + in() will be called. Therefore strm->next_in must be initialized before + calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called + immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in + must also be initialized, and then if strm->avail_in is not zero, input will + initially be taken from strm->next_in[0 .. strm->avail_in - 1]. + + The in_desc and out_desc parameters of inflateBack() is passed as the + first parameter of in() and out() respectively when they are called. These + descriptors can be optionally used to pass any information that the caller- + supplied in() and out() functions need to do their job. + + On return, inflateBack() will set strm->next_in and strm->avail_in to + pass back any unused input that was provided by the last in() call. The + return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR + if in() or out() returned an error, Z_DATA_ERROR if there was a format error + in the deflate stream (in which case strm->msg is set to indicate the nature + of the error), or Z_STREAM_ERROR if the stream was not properly initialized. + In the case of Z_BUF_ERROR, an input or output error can be distinguished + using strm->next_in which will be Z_NULL only if in() returned an error. If + strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning + non-zero. (in() will always be called before out(), so strm->next_in is + assured to be defined if out() returns non-zero.) Note that inflateBack() + cannot return Z_OK. +*/ + +ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm)); +/* + All memory allocated by inflateBackInit() is freed. + + inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream + state was inconsistent. +*/ + +ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void)); +/* Return flags indicating compile-time options. + + Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other: + 1.0: size of uInt + 3.2: size of uLong + 5.4: size of voidpf (pointer) + 7.6: size of z_off_t + + Compiler, assembler, and debug options: + 8: DEBUG + 9: ASMV or ASMINF -- use ASM code + 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention + 11: 0 (reserved) + + One-time table building (smaller code, but not thread-safe if true): + 12: BUILDFIXED -- build static block decoding tables when needed + 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed + 14,15: 0 (reserved) + + Library content (indicates missing functionality): + 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking + deflate code when not needed) + 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect + and decode gzip streams (to avoid linking crc code) + 18-19: 0 (reserved) + + Operation variations (changes in library functionality): + 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate + 21: FASTEST -- deflate algorithm with only one, lowest compression level + 22,23: 0 (reserved) + + The sprintf variant used by gzprintf (zero is best): + 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format + 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure! + 26: 0 = returns value, 1 = void -- 1 means inferred string length returned + + Remainder: + 27-31: 0 (reserved) + */ + +#ifndef Z_SOLO + + /* utility functions */ + +/* + The following utility functions are implemented on top of the basic + stream-oriented functions. To simplify the interface, some default options + are assumed (compression level and memory usage, standard memory allocation + functions). The source code of these utility functions can be modified if + you need special options. +*/ + +ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Compresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer. +*/ + +ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen, + int level)); +/* + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. +*/ + +ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen)); +/* + compressBound() returns an upper bound on the compressed size after + compress() or compress2() on sourceLen bytes. It would be used before a + compress() or compress2() call to allocate the destination buffer. +*/ + +ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be large enough to hold the entire + uncompressed data. (The size of the uncompressed data must have been saved + previously by the compressor and transmitted to the decompressor by some + mechanism outside the scope of this compression library.) Upon exit, destLen + is the actual size of the uncompressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In + the case where there is not enough room, uncompress() will fill the output + buffer with the uncompressed data up to that point. +*/ + + /* gzip file access functions */ + +/* + This library supports reading and writing files in gzip (.gz) format with + an interface similar to that of stdio, using the functions that start with + "gz". The gzip format is different from the zlib format. gzip is a gzip + wrapper, documented in RFC 1952, wrapped around a deflate stream. +*/ + +typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */ + +/* +ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode)); + + Opens a gzip (.gz) file for reading or writing. The mode parameter is as + in fopen ("rb" or "wb") but can also include a compression level ("wb9") or + a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only + compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F' + for fixed code compression as in "wb9F". (See the description of + deflateInit2 for more information about the strategy parameter.) 'T' will + request transparent writing or appending with no compression and not using + the gzip format. + + "a" can be used instead of "w" to request that the gzip stream that will + be written be appended to the file. "+" will result in an error, since + reading and writing to the same gzip file is not supported. The addition of + "x" when writing will create the file exclusively, which fails if the file + already exists. On systems that support it, the addition of "e" when + reading or writing will set the flag to close the file on an execve() call. + + These functions, as well as gzip, will read and decode a sequence of gzip + streams in a file. The append function of gzopen() can be used to create + such a file. (Also see gzflush() for another way to do this.) When + appending, gzopen does not test whether the file begins with a gzip stream, + nor does it look for the end of the gzip streams to begin appending. gzopen + will simply append a gzip stream to the existing file. + + gzopen can be used to read a file which is not in gzip format; in this + case gzread will directly read from the file without decompression. When + reading, this will be detected automatically by looking for the magic two- + byte gzip header. + + gzopen returns NULL if the file could not be opened, if there was + insufficient memory to allocate the gzFile state, or if an invalid mode was + specified (an 'r', 'w', or 'a' was not provided, or '+' was provided). + errno can be checked to determine if the reason gzopen failed was that the + file could not be opened. +*/ + +ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode)); +/* + gzdopen associates a gzFile with the file descriptor fd. File descriptors + are obtained from calls like open, dup, creat, pipe or fileno (if the file + has been previously opened with fopen). The mode parameter is as in gzopen. + + The next call of gzclose on the returned gzFile will also close the file + descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor + fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd, + mode);. The duplicated descriptor should be saved to avoid a leak, since + gzdopen does not close fd if it fails. If you are using fileno() to get the + file descriptor from a FILE *, then you will have to use dup() to avoid + double-close()ing the file descriptor. Both gzclose() and fclose() will + close the associated file descriptor, so they need to have different file + descriptors. + + gzdopen returns NULL if there was insufficient memory to allocate the + gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not + provided, or '+' was provided), or if fd is -1. The file descriptor is not + used until the next gz* read, write, seek, or close operation, so gzdopen + will not detect if fd is invalid (unless fd is -1). +*/ + +ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size)); +/* + Set the internal buffer size used by this library's functions. The + default buffer size is 8192 bytes. This function must be called after + gzopen() or gzdopen(), and before any other calls that read or write the + file. The buffer memory allocation is always deferred to the first read or + write. Two buffers are allocated, either both of the specified size when + writing, or one of the specified size and the other twice that size when + reading. A larger buffer size of, for example, 64K or 128K bytes will + noticeably increase the speed of decompression (reading). + + The new buffer size also affects the maximum length for gzprintf(). + + gzbuffer() returns 0 on success, or -1 on failure, such as being called + too late. +*/ + +ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy)); +/* + Dynamically update the compression level or strategy. See the description + of deflateInit2 for the meaning of these parameters. + + gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not + opened for writing. +*/ + +ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len)); +/* + Reads the given number of uncompressed bytes from the compressed file. If + the input file is not in gzip format, gzread copies the given number of + bytes into the buffer directly from the file. + + After reaching the end of a gzip stream in the input, gzread will continue + to read, looking for another gzip stream. Any number of gzip streams may be + concatenated in the input file, and will all be decompressed by gzread(). + If something other than a gzip stream is encountered after a gzip stream, + that remaining trailing garbage is ignored (and no error is returned). + + gzread can be used to read a gzip file that is being concurrently written. + Upon reaching the end of the input, gzread will return with the available + data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then + gzclearerr can be used to clear the end of file indicator in order to permit + gzread to be tried again. Z_OK indicates that a gzip stream was completed + on the last gzread. Z_BUF_ERROR indicates that the input file ended in the + middle of a gzip stream. Note that gzread does not return -1 in the event + of an incomplete gzip stream. This error is deferred until gzclose(), which + will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip + stream. Alternatively, gzerror can be used before gzclose to detect this + case. + + gzread returns the number of uncompressed bytes actually read, less than + len for end of file, or -1 for error. +*/ + +ZEXTERN int ZEXPORT gzwrite OF((gzFile file, + voidpc buf, unsigned len)); +/* + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of uncompressed bytes written or 0 in case of + error. +*/ + +ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...)); +/* + Converts, formats, and writes the arguments to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written, or 0 in case of error. The number of + uncompressed bytes written is limited to 8191, or one less than the buffer + size given to gzbuffer(). The caller should assure that this limit is not + exceeded. If it is exceeded, then gzprintf() will return an error (0) with + nothing written. In this case, there may also be a buffer overflow with + unpredictable consequences, which is possible only if zlib was compiled with + the insecure functions sprintf() or vsprintf() because the secure snprintf() + or vsnprintf() functions were not available. This can be determined using + zlibCompileFlags(). +*/ + +ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s)); +/* + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + + gzputs returns the number of characters written, or -1 in case of error. +*/ + +ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len)); +/* + Reads bytes from the compressed file until len-1 characters are read, or a + newline character is read and transferred to buf, or an end-of-file + condition is encountered. If any characters are read or if len == 1, the + string is terminated with a null character. If no characters are read due + to an end-of-file or len < 1, then the buffer is left untouched. + + gzgets returns buf which is a null-terminated string, or it returns NULL + for end-of-file or in case of error. If there was an error, the contents at + buf are indeterminate. +*/ + +ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c)); +/* + Writes c, converted to an unsigned char, into the compressed file. gzputc + returns the value that was written, or -1 in case of error. +*/ + +ZEXTERN int ZEXPORT gzgetc OF((gzFile file)); +/* + Reads one byte from the compressed file. gzgetc returns this byte or -1 + in case of end of file or error. This is implemented as a macro for speed. + As such, it does not do all of the checking the other functions do. I.e. + it does not check to see if file is NULL, nor whether the structure file + points to has been clobbered or not. +*/ + +ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file)); +/* + Push one character back onto the stream to be read as the first character + on the next read. At least one character of push-back is allowed. + gzungetc() returns the character pushed, or -1 on failure. gzungetc() will + fail if c is -1, and may fail if a character has been pushed but not read + yet. If gzungetc is used immediately after gzopen or gzdopen, at least the + output buffer size of pushed characters is allowed. (See gzbuffer above.) + The pushed character will be discarded if the stream is repositioned with + gzseek() or gzrewind(). +*/ + +ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush)); +/* + Flushes all pending output into the compressed file. The parameter flush + is as in the deflate() function. The return value is the zlib error number + (see function gzerror below). gzflush is only permitted when writing. + + If the flush parameter is Z_FINISH, the remaining data is written and the + gzip stream is completed in the output. If gzwrite() is called again, a new + gzip stream will be started in the output. gzread() is able to read such + concatented gzip streams. + + gzflush should be called only when strictly necessary because it will + degrade compression if called too often. +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file, + z_off_t offset, int whence)); + + Sets the starting position for the next gzread or gzwrite on the given + compressed file. The offset represents a number of bytes in the + uncompressed data stream. The whence parameter is defined as in lseek(2); + the value SEEK_END is not supported. + + If the file is opened for reading, this function is emulated but can be + extremely slow. If the file is opened for writing, only forward seeks are + supported; gzseek then compresses a sequence of zeroes up to the new + starting position. + + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error, in + particular if the file is opened for writing and the new starting position + would be before the current position. +*/ + +ZEXTERN int ZEXPORT gzrewind OF((gzFile file)); +/* + Rewinds the given file. This function is supported only for reading. + + gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file)); + + Returns the starting position for the next gzread or gzwrite on the given + compressed file. This position represents a number of bytes in the + uncompressed data stream, and is zero when starting, even if appending or + reading a gzip stream from the middle of a file using gzdopen(). + + gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file)); + + Returns the current offset in the file being read or written. This offset + includes the count of bytes that precede the gzip stream, for example when + appending or when using gzdopen() for reading. When reading, the offset + does not include as yet unused buffered input. This information can be used + for a progress indicator. On error, gzoffset() returns -1. +*/ + +ZEXTERN int ZEXPORT gzeof OF((gzFile file)); +/* + Returns true (1) if the end-of-file indicator has been set while reading, + false (0) otherwise. Note that the end-of-file indicator is set only if the + read tried to go past the end of the input, but came up short. Therefore, + just like feof(), gzeof() may return false even if there is no more data to + read, in the event that the last read request was for the exact number of + bytes remaining in the input file. This will happen if the input file size + is an exact multiple of the buffer size. + + If gzeof() returns true, then the read functions will return no more data, + unless the end-of-file indicator is reset by gzclearerr() and the input file + has grown since the previous end of file was detected. +*/ + +ZEXTERN int ZEXPORT gzdirect OF((gzFile file)); +/* + Returns true (1) if file is being copied directly while reading, or false + (0) if file is a gzip stream being decompressed. + + If the input file is empty, gzdirect() will return true, since the input + does not contain a gzip stream. + + If gzdirect() is used immediately after gzopen() or gzdopen() it will + cause buffers to be allocated to allow reading the file to determine if it + is a gzip file. Therefore if gzbuffer() is used, it should be called before + gzdirect(). + + When writing, gzdirect() returns true (1) if transparent writing was + requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note: + gzdirect() is not needed when writing. Transparent writing must be + explicitly requested, so the application already knows the answer. When + linking statically, using gzdirect() will include all of the zlib code for + gzip file reading and decompression, which may not be desired.) +*/ + +ZEXTERN int ZEXPORT gzclose OF((gzFile file)); +/* + Flushes all pending output if necessary, closes the compressed file and + deallocates the (de)compression state. Note that once file is closed, you + cannot call gzerror with file, since its structures have been deallocated. + gzclose must not be called more than once on the same file, just as free + must not be called more than once on the same allocation. + + gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a + file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the + last read ended in the middle of a gzip stream, or Z_OK on success. +*/ + +ZEXTERN int ZEXPORT gzclose_r OF((gzFile file)); +ZEXTERN int ZEXPORT gzclose_w OF((gzFile file)); +/* + Same as gzclose(), but gzclose_r() is only for use when reading, and + gzclose_w() is only for use when writing or appending. The advantage to + using these instead of gzclose() is that they avoid linking in zlib + compression or decompression code that is not used when only reading or only + writing respectively. If gzclose() is used, then both compression and + decompression code will be included the application when linking to a static + zlib library. +*/ + +ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum)); +/* + Returns the error message for the last error which occurred on the given + compressed file. errnum is set to zlib error number. If an error occurred + in the file system and not in the compression library, errnum is set to + Z_ERRNO and the application may consult errno to get the exact error code. + + The application must not modify the returned string. Future calls to + this function may invalidate the previously returned string. If file is + closed, then the string previously returned by gzerror will no longer be + available. + + gzerror() should be used to distinguish errors from end-of-file for those + functions above that do not distinguish those cases in their return values. +*/ + +ZEXTERN void ZEXPORT gzclearerr OF((gzFile file)); +/* + Clears the error and end-of-file flags for file. This is analogous to the + clearerr() function in stdio. This is useful for continuing to read a gzip + file that is being written concurrently. +*/ + +#endif /* !Z_SOLO */ + + /* checksum functions */ + +/* + These functions are not related to compression but are exported + anyway because they might be useful in applications using the compression + library. +*/ + +ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len)); +/* + Update a running Adler-32 checksum with the bytes buf[0..len-1] and + return the updated checksum. If buf is Z_NULL, this function returns the + required initial value for the checksum. + + An Adler-32 checksum is almost as reliable as a CRC32 but can be computed + much faster. + + Usage example: + + uLong adler = adler32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + adler = adler32(adler, buffer, length); + } + if (adler != original_adler) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2, + z_off_t len2)); + + Combine two Adler-32 checksums into one. For two sequences of bytes, seq1 + and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for + each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of + seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note + that the z_off_t type (like off_t) is a signed integer. If len2 is + negative, the result has no meaning or utility. +*/ + +ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len)); +/* + Update a running CRC-32 with the bytes buf[0..len-1] and return the + updated CRC-32. If buf is Z_NULL, this function returns the required + initial value for the crc. Pre- and post-conditioning (one's complement) is + performed within this function so it shouldn't be done by the application. + + Usage example: + + uLong crc = crc32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + crc = crc32(crc, buffer, length); + } + if (crc != original_crc) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2)); + + Combine two CRC-32 check values into one. For two sequences of bytes, + seq1 and seq2 with lengths len1 and len2, CRC-32 check values were + calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32 + check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and + len2. +*/ + + + /* various hacks, don't look :) */ + +/* deflateInit and inflateInit are macros to allow checking the zlib version + * and the compiler's view of z_stream: + */ +ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method, + int windowBits, int memLevel, + int strategy, const char *version, + int stream_size)); +ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits, + unsigned char FAR *window, + const char *version, + int stream_size)); +#define deflateInit(strm, level) \ + deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit(strm) \ + inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream)) +#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \ + deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\ + (strategy), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit2(strm, windowBits) \ + inflateInit2_((strm), (windowBits), ZLIB_VERSION, \ + (int)sizeof(z_stream)) +#define inflateBackInit(strm, windowBits, window) \ + inflateBackInit_((strm), (windowBits), (window), \ + ZLIB_VERSION, (int)sizeof(z_stream)) + +#ifndef Z_SOLO + +/* gzgetc() macro and its supporting function and exposed data structure. Note + * that the real internal state is much larger than the exposed structure. + * This abbreviated structure exposes just enough for the gzgetc() macro. The + * user should not mess with these exposed elements, since their names or + * behavior could change in the future, perhaps even capriciously. They can + * only be used by the gzgetc() macro. You have been warned. + */ +ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +# define z_gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#else +# define gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#endif + +/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or + * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if + * both are true, the application gets the *64 functions, and the regular + * functions are changed to 64 bits) -- in case these are set on systems + * without large file support, _LFS64_LARGEFILE must also be true + */ +#ifdef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int)); + ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t)); +#endif + +#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64) +# ifdef Z_PREFIX_SET +# define z_gzopen z_gzopen64 +# define z_gzseek z_gzseek64 +# define z_gztell z_gztell64 +# define z_gzoffset z_gzoffset64 +# define z_adler32_combine z_adler32_combine64 +# define z_crc32_combine z_crc32_combine64 +# else +# define gzopen gzopen64 +# define gzseek gzseek64 +# define gztell gztell64 +# define gzoffset gzoffset64 +# define adler32_combine adler32_combine64 +# define crc32_combine crc32_combine64 +# endif +# ifndef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +# endif +#else + ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); +#endif + +#else /* Z_SOLO */ + + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); + +#endif /* !Z_SOLO */ + +/* hack for buggy compilers */ +#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL) + struct internal_state {int dummy;}; +#endif + +/* undocumented functions */ +ZEXTERN const char * ZEXPORT zError OF((int)); +ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp)); +ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void)); +ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int)); +ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp)); +ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp)); +#if defined(_WIN32) && !defined(Z_SOLO) +ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path, + const char *mode)); +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file, + const char *format, + va_list va)); +# endif +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* ZLIB_H */ diff --git a/deps/zlib/zutil.c b/deps/zlib/zutil.c new file mode 100644 index 0000000..c9353fe --- /dev/null +++ b/deps/zlib/zutil.c @@ -0,0 +1,305 @@ +/* zutil.c -- target dependent utility functions for the compression library + * Copyright (C) 1995-2005, 2010, 2011, 2012 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zutil.h" +#ifndef Z_SOLO +# include "gzguts.h" +#endif + +char * const z_errmsg[10] = { + "need dictionary", /* Z_NEED_DICT 2 */ + "stream end", /* Z_STREAM_END 1 */ + "", /* Z_OK 0 */ + "file error", /* Z_ERRNO (-1) */ + "stream error", /* Z_STREAM_ERROR (-2) */ + "data error", /* Z_DATA_ERROR (-3) */ + "insufficient memory", /* Z_MEM_ERROR (-4) */ + "buffer error", /* Z_BUF_ERROR (-5) */ + "incompatible version",/* Z_VERSION_ERROR (-6) */ + ""}; + + +const char * ZEXPORT zlibVersion(void) +{ + return ZLIB_VERSION; +} + +uLong ZEXPORT zlibCompileFlags(void) +{ + uLong flags; + + flags = 0; + switch ((int)(sizeof(uInt))) { + case 2: break; + case 4: flags += 1; break; + case 8: flags += 2; break; + default: flags += 3; + } + switch ((int)(sizeof(uLong))) { + case 2: break; + case 4: flags += 1 << 2; break; + case 8: flags += 2 << 2; break; + default: flags += 3 << 2; + } + switch ((int)(sizeof(voidpf))) { + case 2: break; + case 4: flags += 1 << 4; break; + case 8: flags += 2 << 4; break; + default: flags += 3 << 4; + } + switch ((int)(sizeof(z_off_t))) { + case 2: break; + case 4: flags += 1 << 6; break; + case 8: flags += 2 << 6; break; + default: flags += 3 << 6; + } +#ifdef DEBUG + flags += 1 << 8; +#endif +#if defined(ASMV) || defined(ASMINF) + flags += 1 << 9; +#endif +#ifdef ZLIB_WINAPI + flags += 1 << 10; +#endif +#ifdef BUILDFIXED + flags += 1 << 12; +#endif +#ifdef DYNAMIC_CRC_TABLE + flags += 1 << 13; +#endif +#ifdef NO_GZCOMPRESS + flags += 1L << 16; +#endif +#ifdef NO_GZIP + flags += 1L << 17; +#endif +#ifdef PKZIP_BUG_WORKAROUND + flags += 1L << 20; +#endif +#ifdef FASTEST + flags += 1L << 21; +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifdef NO_vsnprintf + flags += 1L << 25; +# ifdef HAS_vsprintf_void + flags += 1L << 26; +# endif +# else +# ifdef HAS_vsnprintf_void + flags += 1L << 26; +# endif +# endif +#else + flags += 1L << 24; +# ifdef NO_snprintf + flags += 1L << 25; +# ifdef HAS_sprintf_void + flags += 1L << 26; +# endif +# else +# ifdef HAS_snprintf_void + flags += 1L << 26; +# endif +# endif +#endif + return flags; +} + +#ifdef DEBUG + +# ifndef verbose +# define verbose 0 +# endif +int ZLIB_INTERNAL z_verbose = verbose; + +void ZLIB_INTERNAL z_error (char *m) +{ + fprintf(stderr, "%s\n", m); + exit(1); +} +#endif + +/* exported to allow conversion of error code to string for compress() and + * uncompress() + */ +const char * ZEXPORT zError(int err) +{ + return ERR_MSG(err); +} + +#if defined(_WIN32_WCE) +/* The Microsoft C Run-Time Library for Windows CE doesn't have + * errno. We define it as a global variable to simplify porting. + * Its value is always 0 and should not be used. + */ +int errno = 0; +#endif + +#ifndef HAVE_MEMCPY + +void ZLIB_INTERNAL zmemcpy(Bytef *dest, const Bytef *source, uInt len) +{ + if (len == 0) return; + do { + *dest++ = *source++; /* ??? to be unrolled */ + } while (--len != 0); +} + +int ZLIB_INTERNAL zmemcmp(const Bytef *s1, const Bytef *s2, uInt len) +{ + uInt j; + + for (j = 0; j < len; j++) { + if (s1[j] != s2[j]) return 2*(s1[j] > s2[j])-1; + } + return 0; +} + +void ZLIB_INTERNAL zmemzero(Bytef *dest, uInt len) +{ + if (len == 0) return; + do { + *dest++ = 0; /* ??? to be unrolled */ + } while (--len != 0); +} +#endif + +#ifndef Z_SOLO + +#ifdef SYS16BIT + +#ifdef __TURBOC__ +/* Turbo C in 16-bit mode */ + +# define MY_ZCALLOC + +/* Turbo C malloc() does not allow dynamic allocation of 64K bytes + * and farmalloc(64K) returns a pointer with an offset of 8, so we + * must fix the pointer. Warning: the pointer must be put back to its + * original form in order to free it, use zcfree(). + */ + +#define MAX_PTR 10 +/* 10*64K = 640K */ + +local int next_ptr = 0; + +typedef struct ptr_table_s { + voidpf org_ptr; + voidpf new_ptr; +} ptr_table; + +local ptr_table table[MAX_PTR]; +/* This table is used to remember the original form of pointers + * to large buffers (64K). Such pointers are normalized with a zero offset. + * Since MSDOS is not a preemptive multitasking OS, this table is not + * protected from concurrent access. This hack doesn't work anyway on + * a protected system like OS/2. Use Microsoft C instead. + */ + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + voidpf buf = opaque; /* just to make some compilers happy */ + ulg bsize = (ulg)items*size; + + /* If we allocate less than 65520 bytes, we assume that farmalloc + * will return a usable pointer which doesn't have to be normalized. + */ + if (bsize < 65520L) { + buf = farmalloc(bsize); + if (*(ush*)&buf != 0) return buf; + } else { + buf = farmalloc(bsize + 16L); + } + if (buf == NULL || next_ptr >= MAX_PTR) return NULL; + table[next_ptr].org_ptr = buf; + + /* Normalize the pointer to seg:0 */ + *((ush*)&buf+1) += ((ush)((uch*)buf-0) + 15) >> 4; + *(ush*)&buf = 0; + table[next_ptr++].new_ptr = buf; + return buf; +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + int n; + if (*(ush*)&ptr != 0) { /* object < 64K */ + farfree(ptr); + return; + } + /* Find the original pointer */ + for (n = 0; n < next_ptr; n++) { + if (ptr != table[n].new_ptr) continue; + + farfree(table[n].org_ptr); + while (++n < next_ptr) { + table[n-1] = table[n]; + } + next_ptr--; + return; + } + ptr = opaque; /* just to make some compilers happy */ + Assert(0, "zcfree: ptr not found"); +} + +#endif /* __TURBOC__ */ + + +#ifdef M_I86 +/* Microsoft C in 16-bit mode */ + +# define MY_ZCALLOC + +#if (!defined(_MSC_VER) || (_MSC_VER <= 600)) +# define _halloc halloc +# define _hfree hfree +#endif + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, uInt items, uInt size) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + return _halloc((long)items, size); +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + _hfree(ptr); +} + +#endif /* M_I86 */ + +#endif /* SYS16BIT */ + + +#ifndef MY_ZCALLOC /* Any system without a special alloc function */ + +#ifndef STDC +extern voidp malloc OF((uInt size)); +extern voidp calloc OF((uInt items, uInt size)); +extern void free OF((voidpf ptr)); +#endif + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + if (opaque) items += size - size; /* make compiler happy */ + return sizeof(uInt) > 2 ? (voidpf)malloc(items * size) : + (voidpf)calloc(items, size); +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + free(ptr); + if (opaque) return; /* make compiler happy */ +} + +#endif /* MY_ZCALLOC */ + +#endif /* !Z_SOLO */ diff --git a/deps/zlib/zutil.h b/deps/zlib/zutil.h new file mode 100644 index 0000000..5c6929f --- /dev/null +++ b/deps/zlib/zutil.h @@ -0,0 +1,253 @@ +/* zutil.h -- internal interface and configuration of the compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef ZUTIL_H +#define ZUTIL_H + +#ifdef HAVE_HIDDEN +# define ZLIB_INTERNAL __attribute__((visibility ("hidden"))) +#else +# define ZLIB_INTERNAL +#endif + +#include "zlib.h" + +#if defined(STDC) && !defined(Z_SOLO) +# if !(defined(_WIN32_WCE) && defined(_MSC_VER)) +# include <stddef.h> +# endif +# include <string.h> +# include <stdlib.h> +#endif + +#ifdef Z_SOLO + typedef long ptrdiff_t; /* guess -- will be caught if guess is wrong */ +#endif + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +typedef unsigned char uch; +typedef uch FAR uchf; +typedef unsigned short ush; +typedef ush FAR ushf; +typedef unsigned long ulg; + +extern char * const z_errmsg[10]; /* indexed by 2-zlib_error */ +/* (size given to avoid silly warnings with Visual C++) */ + +#define ERR_MSG(err) z_errmsg[Z_NEED_DICT-(err)] + +#define ERR_RETURN(strm,err) \ + return (strm->msg = ERR_MSG(err), (err)) +/* To be used only when the state is known to be valid */ + + /* common constants */ + +#ifndef DEF_WBITS +# define DEF_WBITS MAX_WBITS +#endif +/* default windowBits for decompression. MAX_WBITS is for compression only */ + +#if MAX_MEM_LEVEL >= 8 +# define DEF_MEM_LEVEL 8 +#else +# define DEF_MEM_LEVEL MAX_MEM_LEVEL +#endif +/* default memLevel */ + +#define STORED_BLOCK 0 +#define STATIC_TREES 1 +#define DYN_TREES 2 +/* The three kinds of block type */ + +#define MIN_MATCH 3 +#define MAX_MATCH 258 +/* The minimum and maximum match lengths */ + +#define PRESET_DICT 0x20 /* preset dictionary flag in zlib header */ + + /* target dependencies */ + +#if defined(MSDOS) || (defined(WINDOWS) && !defined(WIN32)) +# define OS_CODE 0x00 +# ifndef Z_SOLO +# if defined(__TURBOC__) || defined(__BORLANDC__) +# if (__STDC__ == 1) && (defined(__LARGE__) || defined(__COMPACT__)) + /* Allow compilation with ANSI keywords only enabled */ + void _Cdecl farfree( void *block ); + void *_Cdecl farmalloc( unsigned long nbytes ); +# else +# include <alloc.h> +# endif +# else /* MSC or DJGPP */ +# include <malloc.h> +# endif +# endif +#endif + +#ifdef AMIGA +# define OS_CODE 0x01 +#endif + +#if defined(VAXC) || defined(VMS) +# define OS_CODE 0x02 +# define F_OPEN(name, mode) \ + fopen((name), (mode), "mbc=60", "ctx=stm", "rfm=fix", "mrs=512") +#endif + +#if defined(ATARI) || defined(atarist) +# define OS_CODE 0x05 +#endif + +#ifdef OS2 +# define OS_CODE 0x06 +# if defined(M_I86) && !defined(Z_SOLO) +# include <malloc.h> +# endif +#endif + +#if defined(MACOS) || defined(TARGET_OS_MAC) +# define OS_CODE 0x07 +# ifndef Z_SOLO +# if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os +# include <unix.h> /* for fdopen */ +# else +# ifndef fdopen +# define fdopen(fd,mode) NULL /* No fdopen() */ +# endif +# endif +# endif +#endif + +#ifdef TOPS20 +# define OS_CODE 0x0a +#endif + +#ifdef WIN32 +# ifndef __CYGWIN__ /* Cygwin is Unix, not Win32 */ +# define OS_CODE 0x0b +# endif +#endif + +#ifdef __50SERIES /* Prime/PRIMOS */ +# define OS_CODE 0x0f +#endif + +#if defined(_BEOS_) || defined(RISCOS) +# define fdopen(fd,mode) NULL /* No fdopen() */ +#endif + +#if (defined(_MSC_VER) && (_MSC_VER > 600)) && !defined __INTERIX +# if defined(_WIN32_WCE) +# define fdopen(fd,mode) NULL /* No fdopen() */ +# ifndef _PTRDIFF_T_DEFINED + typedef int ptrdiff_t; +# define _PTRDIFF_T_DEFINED +# endif +# else +# define fdopen(fd,type) _fdopen(fd,type) +# endif +#endif + +#if defined(__BORLANDC__) && !defined(MSDOS) + #pragma warn -8004 + #pragma warn -8008 + #pragma warn -8066 +#endif + +/* provide prototypes for these when building zlib without LFS */ +#if !defined(_WIN32) && \ + (!defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0) + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +#endif + + /* common defaults */ + +#ifndef OS_CODE +# define OS_CODE 0x03 /* assume Unix */ +#endif + +#ifndef F_OPEN +# define F_OPEN(name, mode) fopen((name), (mode)) +#endif + + /* functions */ + +#if defined(pyr) || defined(Z_SOLO) +# define NO_MEMCPY +#endif +#if defined(SMALL_MEDIUM) && !defined(_MSC_VER) && !defined(__SC__) + /* Use our own functions for small and medium model with MSC <= 5.0. + * You may have to use the same strategy for Borland C (untested). + * The __SC__ check is for Symantec. + */ +# define NO_MEMCPY +#endif +#if defined(STDC) && !defined(HAVE_MEMCPY) && !defined(NO_MEMCPY) +# define HAVE_MEMCPY +#endif +#ifdef HAVE_MEMCPY +# ifdef SMALL_MEDIUM /* MSDOS small or medium model */ +# define zmemcpy _fmemcpy +# define zmemcmp _fmemcmp +# define zmemzero(dest, len) _fmemset(dest, 0, len) +# else +# define zmemcpy memcpy +# define zmemcmp memcmp +# define zmemzero(dest, len) memset(dest, 0, len) +# endif +#else + void ZLIB_INTERNAL zmemcpy OF((Bytef* dest, const Bytef* source, uInt len)); + int ZLIB_INTERNAL zmemcmp OF((const Bytef* s1, const Bytef* s2, uInt len)); + void ZLIB_INTERNAL zmemzero OF((Bytef* dest, uInt len)); +#endif + +/* Diagnostic functions */ +#ifdef DEBUG +# include <stdio.h> + extern int ZLIB_INTERNAL z_verbose; + extern void ZLIB_INTERNAL z_error OF((char *m)); +# define Assert(cond,msg) {if(!(cond)) z_error(msg);} +# define Trace(x) {if (z_verbose>=0) fprintf x ;} +# define Tracev(x) {if (z_verbose>0) fprintf x ;} +# define Tracevv(x) {if (z_verbose>1) fprintf x ;} +# define Tracec(c,x) {if (z_verbose>0 && (c)) fprintf x ;} +# define Tracecv(c,x) {if (z_verbose>1 && (c)) fprintf x ;} +#else +# define Assert(cond,msg) +# define Trace(x) +# define Tracev(x) +# define Tracevv(x) +# define Tracec(c,x) +# define Tracecv(c,x) +#endif + +#ifndef Z_SOLO + voidpf ZLIB_INTERNAL zcalloc OF((voidpf opaque, unsigned items, + unsigned size)); + void ZLIB_INTERNAL zcfree OF((voidpf opaque, voidpf ptr)); +#endif + +#define ZALLOC(strm, items, size) \ + (*((strm)->zalloc))((strm)->opaque, (items), (size)) +#define ZFREE(strm, addr) (*((strm)->zfree))((strm)->opaque, (voidpf)(addr)) +#define TRY_FREE(s, p) {if (p) ZFREE(s, p);} + +/* Reverse the bytes in a 32-bit value */ +#define ZSWAP32(q) ((((q) >> 24) & 0xff) + (((q) >> 8) & 0xff00) + \ + (((q) & 0xff00) << 8) + (((q) & 0xff) << 24)) + +#endif /* ZUTIL_H */ diff --git a/deps/zutil.c b/deps/zutil.c new file mode 100644 index 0000000..c9353fe --- /dev/null +++ b/deps/zutil.c @@ -0,0 +1,305 @@ +/* zutil.c -- target dependent utility functions for the compression library + * Copyright (C) 1995-2005, 2010, 2011, 2012 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#include "zutil.h" +#ifndef Z_SOLO +# include "gzguts.h" +#endif + +char * const z_errmsg[10] = { + "need dictionary", /* Z_NEED_DICT 2 */ + "stream end", /* Z_STREAM_END 1 */ + "", /* Z_OK 0 */ + "file error", /* Z_ERRNO (-1) */ + "stream error", /* Z_STREAM_ERROR (-2) */ + "data error", /* Z_DATA_ERROR (-3) */ + "insufficient memory", /* Z_MEM_ERROR (-4) */ + "buffer error", /* Z_BUF_ERROR (-5) */ + "incompatible version",/* Z_VERSION_ERROR (-6) */ + ""}; + + +const char * ZEXPORT zlibVersion(void) +{ + return ZLIB_VERSION; +} + +uLong ZEXPORT zlibCompileFlags(void) +{ + uLong flags; + + flags = 0; + switch ((int)(sizeof(uInt))) { + case 2: break; + case 4: flags += 1; break; + case 8: flags += 2; break; + default: flags += 3; + } + switch ((int)(sizeof(uLong))) { + case 2: break; + case 4: flags += 1 << 2; break; + case 8: flags += 2 << 2; break; + default: flags += 3 << 2; + } + switch ((int)(sizeof(voidpf))) { + case 2: break; + case 4: flags += 1 << 4; break; + case 8: flags += 2 << 4; break; + default: flags += 3 << 4; + } + switch ((int)(sizeof(z_off_t))) { + case 2: break; + case 4: flags += 1 << 6; break; + case 8: flags += 2 << 6; break; + default: flags += 3 << 6; + } +#ifdef DEBUG + flags += 1 << 8; +#endif +#if defined(ASMV) || defined(ASMINF) + flags += 1 << 9; +#endif +#ifdef ZLIB_WINAPI + flags += 1 << 10; +#endif +#ifdef BUILDFIXED + flags += 1 << 12; +#endif +#ifdef DYNAMIC_CRC_TABLE + flags += 1 << 13; +#endif +#ifdef NO_GZCOMPRESS + flags += 1L << 16; +#endif +#ifdef NO_GZIP + flags += 1L << 17; +#endif +#ifdef PKZIP_BUG_WORKAROUND + flags += 1L << 20; +#endif +#ifdef FASTEST + flags += 1L << 21; +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifdef NO_vsnprintf + flags += 1L << 25; +# ifdef HAS_vsprintf_void + flags += 1L << 26; +# endif +# else +# ifdef HAS_vsnprintf_void + flags += 1L << 26; +# endif +# endif +#else + flags += 1L << 24; +# ifdef NO_snprintf + flags += 1L << 25; +# ifdef HAS_sprintf_void + flags += 1L << 26; +# endif +# else +# ifdef HAS_snprintf_void + flags += 1L << 26; +# endif +# endif +#endif + return flags; +} + +#ifdef DEBUG + +# ifndef verbose +# define verbose 0 +# endif +int ZLIB_INTERNAL z_verbose = verbose; + +void ZLIB_INTERNAL z_error (char *m) +{ + fprintf(stderr, "%s\n", m); + exit(1); +} +#endif + +/* exported to allow conversion of error code to string for compress() and + * uncompress() + */ +const char * ZEXPORT zError(int err) +{ + return ERR_MSG(err); +} + +#if defined(_WIN32_WCE) +/* The Microsoft C Run-Time Library for Windows CE doesn't have + * errno. We define it as a global variable to simplify porting. + * Its value is always 0 and should not be used. + */ +int errno = 0; +#endif + +#ifndef HAVE_MEMCPY + +void ZLIB_INTERNAL zmemcpy(Bytef *dest, const Bytef *source, uInt len) +{ + if (len == 0) return; + do { + *dest++ = *source++; /* ??? to be unrolled */ + } while (--len != 0); +} + +int ZLIB_INTERNAL zmemcmp(const Bytef *s1, const Bytef *s2, uInt len) +{ + uInt j; + + for (j = 0; j < len; j++) { + if (s1[j] != s2[j]) return 2*(s1[j] > s2[j])-1; + } + return 0; +} + +void ZLIB_INTERNAL zmemzero(Bytef *dest, uInt len) +{ + if (len == 0) return; + do { + *dest++ = 0; /* ??? to be unrolled */ + } while (--len != 0); +} +#endif + +#ifndef Z_SOLO + +#ifdef SYS16BIT + +#ifdef __TURBOC__ +/* Turbo C in 16-bit mode */ + +# define MY_ZCALLOC + +/* Turbo C malloc() does not allow dynamic allocation of 64K bytes + * and farmalloc(64K) returns a pointer with an offset of 8, so we + * must fix the pointer. Warning: the pointer must be put back to its + * original form in order to free it, use zcfree(). + */ + +#define MAX_PTR 10 +/* 10*64K = 640K */ + +local int next_ptr = 0; + +typedef struct ptr_table_s { + voidpf org_ptr; + voidpf new_ptr; +} ptr_table; + +local ptr_table table[MAX_PTR]; +/* This table is used to remember the original form of pointers + * to large buffers (64K). Such pointers are normalized with a zero offset. + * Since MSDOS is not a preemptive multitasking OS, this table is not + * protected from concurrent access. This hack doesn't work anyway on + * a protected system like OS/2. Use Microsoft C instead. + */ + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + voidpf buf = opaque; /* just to make some compilers happy */ + ulg bsize = (ulg)items*size; + + /* If we allocate less than 65520 bytes, we assume that farmalloc + * will return a usable pointer which doesn't have to be normalized. + */ + if (bsize < 65520L) { + buf = farmalloc(bsize); + if (*(ush*)&buf != 0) return buf; + } else { + buf = farmalloc(bsize + 16L); + } + if (buf == NULL || next_ptr >= MAX_PTR) return NULL; + table[next_ptr].org_ptr = buf; + + /* Normalize the pointer to seg:0 */ + *((ush*)&buf+1) += ((ush)((uch*)buf-0) + 15) >> 4; + *(ush*)&buf = 0; + table[next_ptr++].new_ptr = buf; + return buf; +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + int n; + if (*(ush*)&ptr != 0) { /* object < 64K */ + farfree(ptr); + return; + } + /* Find the original pointer */ + for (n = 0; n < next_ptr; n++) { + if (ptr != table[n].new_ptr) continue; + + farfree(table[n].org_ptr); + while (++n < next_ptr) { + table[n-1] = table[n]; + } + next_ptr--; + return; + } + ptr = opaque; /* just to make some compilers happy */ + Assert(0, "zcfree: ptr not found"); +} + +#endif /* __TURBOC__ */ + + +#ifdef M_I86 +/* Microsoft C in 16-bit mode */ + +# define MY_ZCALLOC + +#if (!defined(_MSC_VER) || (_MSC_VER <= 600)) +# define _halloc halloc +# define _hfree hfree +#endif + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, uInt items, uInt size) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + return _halloc((long)items, size); +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + if (opaque) opaque = 0; /* to make compiler happy */ + _hfree(ptr); +} + +#endif /* M_I86 */ + +#endif /* SYS16BIT */ + + +#ifndef MY_ZCALLOC /* Any system without a special alloc function */ + +#ifndef STDC +extern voidp malloc OF((uInt size)); +extern voidp calloc OF((uInt items, uInt size)); +extern void free OF((voidpf ptr)); +#endif + +voidpf ZLIB_INTERNAL zcalloc (voidpf opaque, unsigned items, unsigned size) +{ + if (opaque) items += size - size; /* make compiler happy */ + return sizeof(uInt) > 2 ? (voidpf)malloc(items * size) : + (voidpf)calloc(items, size); +} + +void ZLIB_INTERNAL zcfree (voidpf opaque, voidpf ptr) +{ + free(ptr); + if (opaque) return; /* make compiler happy */ +} + +#endif /* MY_ZCALLOC */ + +#endif /* !Z_SOLO */ diff --git a/deps/zutil.h b/deps/zutil.h new file mode 100644 index 0000000..5c6929f --- /dev/null +++ b/deps/zutil.h @@ -0,0 +1,253 @@ +/* zutil.h -- internal interface and configuration of the compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* WARNING: this file should *not* be used by applications. It is + part of the implementation of the compression library and is + subject to change. Applications should only use zlib.h. + */ + +/* @(#) $Id$ */ + +#ifndef ZUTIL_H +#define ZUTIL_H + +#ifdef HAVE_HIDDEN +# define ZLIB_INTERNAL __attribute__((visibility ("hidden"))) +#else +# define ZLIB_INTERNAL +#endif + +#include "zlib.h" + +#if defined(STDC) && !defined(Z_SOLO) +# if !(defined(_WIN32_WCE) && defined(_MSC_VER)) +# include <stddef.h> +# endif +# include <string.h> +# include <stdlib.h> +#endif + +#ifdef Z_SOLO + typedef long ptrdiff_t; /* guess -- will be caught if guess is wrong */ +#endif + +#ifndef local +# define local static +#endif +/* compile with -Dlocal if your debugger can't find static symbols */ + +typedef unsigned char uch; +typedef uch FAR uchf; +typedef unsigned short ush; +typedef ush FAR ushf; +typedef unsigned long ulg; + +extern char * const z_errmsg[10]; /* indexed by 2-zlib_error */ +/* (size given to avoid silly warnings with Visual C++) */ + +#define ERR_MSG(err) z_errmsg[Z_NEED_DICT-(err)] + +#define ERR_RETURN(strm,err) \ + return (strm->msg = ERR_MSG(err), (err)) +/* To be used only when the state is known to be valid */ + + /* common constants */ + +#ifndef DEF_WBITS +# define DEF_WBITS MAX_WBITS +#endif +/* default windowBits for decompression. MAX_WBITS is for compression only */ + +#if MAX_MEM_LEVEL >= 8 +# define DEF_MEM_LEVEL 8 +#else +# define DEF_MEM_LEVEL MAX_MEM_LEVEL +#endif +/* default memLevel */ + +#define STORED_BLOCK 0 +#define STATIC_TREES 1 +#define DYN_TREES 2 +/* The three kinds of block type */ + +#define MIN_MATCH 3 +#define MAX_MATCH 258 +/* The minimum and maximum match lengths */ + +#define PRESET_DICT 0x20 /* preset dictionary flag in zlib header */ + + /* target dependencies */ + +#if defined(MSDOS) || (defined(WINDOWS) && !defined(WIN32)) +# define OS_CODE 0x00 +# ifndef Z_SOLO +# if defined(__TURBOC__) || defined(__BORLANDC__) +# if (__STDC__ == 1) && (defined(__LARGE__) || defined(__COMPACT__)) + /* Allow compilation with ANSI keywords only enabled */ + void _Cdecl farfree( void *block ); + void *_Cdecl farmalloc( unsigned long nbytes ); +# else +# include <alloc.h> +# endif +# else /* MSC or DJGPP */ +# include <malloc.h> +# endif +# endif +#endif + +#ifdef AMIGA +# define OS_CODE 0x01 +#endif + +#if defined(VAXC) || defined(VMS) +# define OS_CODE 0x02 +# define F_OPEN(name, mode) \ + fopen((name), (mode), "mbc=60", "ctx=stm", "rfm=fix", "mrs=512") +#endif + +#if defined(ATARI) || defined(atarist) +# define OS_CODE 0x05 +#endif + +#ifdef OS2 +# define OS_CODE 0x06 +# if defined(M_I86) && !defined(Z_SOLO) +# include <malloc.h> +# endif +#endif + +#if defined(MACOS) || defined(TARGET_OS_MAC) +# define OS_CODE 0x07 +# ifndef Z_SOLO +# if defined(__MWERKS__) && __dest_os != __be_os && __dest_os != __win32_os +# include <unix.h> /* for fdopen */ +# else +# ifndef fdopen +# define fdopen(fd,mode) NULL /* No fdopen() */ +# endif +# endif +# endif +#endif + +#ifdef TOPS20 +# define OS_CODE 0x0a +#endif + +#ifdef WIN32 +# ifndef __CYGWIN__ /* Cygwin is Unix, not Win32 */ +# define OS_CODE 0x0b +# endif +#endif + +#ifdef __50SERIES /* Prime/PRIMOS */ +# define OS_CODE 0x0f +#endif + +#if defined(_BEOS_) || defined(RISCOS) +# define fdopen(fd,mode) NULL /* No fdopen() */ +#endif + +#if (defined(_MSC_VER) && (_MSC_VER > 600)) && !defined __INTERIX +# if defined(_WIN32_WCE) +# define fdopen(fd,mode) NULL /* No fdopen() */ +# ifndef _PTRDIFF_T_DEFINED + typedef int ptrdiff_t; +# define _PTRDIFF_T_DEFINED +# endif +# else +# define fdopen(fd,type) _fdopen(fd,type) +# endif +#endif + +#if defined(__BORLANDC__) && !defined(MSDOS) + #pragma warn -8004 + #pragma warn -8008 + #pragma warn -8066 +#endif + +/* provide prototypes for these when building zlib without LFS */ +#if !defined(_WIN32) && \ + (!defined(_LARGEFILE64_SOURCE) || _LFS64_LARGEFILE-0 == 0) + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +#endif + + /* common defaults */ + +#ifndef OS_CODE +# define OS_CODE 0x03 /* assume Unix */ +#endif + +#ifndef F_OPEN +# define F_OPEN(name, mode) fopen((name), (mode)) +#endif + + /* functions */ + +#if defined(pyr) || defined(Z_SOLO) +# define NO_MEMCPY +#endif +#if defined(SMALL_MEDIUM) && !defined(_MSC_VER) && !defined(__SC__) + /* Use our own functions for small and medium model with MSC <= 5.0. + * You may have to use the same strategy for Borland C (untested). + * The __SC__ check is for Symantec. + */ +# define NO_MEMCPY +#endif +#if defined(STDC) && !defined(HAVE_MEMCPY) && !defined(NO_MEMCPY) +# define HAVE_MEMCPY +#endif +#ifdef HAVE_MEMCPY +# ifdef SMALL_MEDIUM /* MSDOS small or medium model */ +# define zmemcpy _fmemcpy +# define zmemcmp _fmemcmp +# define zmemzero(dest, len) _fmemset(dest, 0, len) +# else +# define zmemcpy memcpy +# define zmemcmp memcmp +# define zmemzero(dest, len) memset(dest, 0, len) +# endif +#else + void ZLIB_INTERNAL zmemcpy OF((Bytef* dest, const Bytef* source, uInt len)); + int ZLIB_INTERNAL zmemcmp OF((const Bytef* s1, const Bytef* s2, uInt len)); + void ZLIB_INTERNAL zmemzero OF((Bytef* dest, uInt len)); +#endif + +/* Diagnostic functions */ +#ifdef DEBUG +# include <stdio.h> + extern int ZLIB_INTERNAL z_verbose; + extern void ZLIB_INTERNAL z_error OF((char *m)); +# define Assert(cond,msg) {if(!(cond)) z_error(msg);} +# define Trace(x) {if (z_verbose>=0) fprintf x ;} +# define Tracev(x) {if (z_verbose>0) fprintf x ;} +# define Tracevv(x) {if (z_verbose>1) fprintf x ;} +# define Tracec(c,x) {if (z_verbose>0 && (c)) fprintf x ;} +# define Tracecv(c,x) {if (z_verbose>1 && (c)) fprintf x ;} +#else +# define Assert(cond,msg) +# define Trace(x) +# define Tracev(x) +# define Tracevv(x) +# define Tracec(c,x) +# define Tracecv(c,x) +#endif + +#ifndef Z_SOLO + voidpf ZLIB_INTERNAL zcalloc OF((voidpf opaque, unsigned items, + unsigned size)); + void ZLIB_INTERNAL zcfree OF((voidpf opaque, voidpf ptr)); +#endif + +#define ZALLOC(strm, items, size) \ + (*((strm)->zalloc))((strm)->opaque, (items), (size)) +#define ZFREE(strm, addr) (*((strm)->zfree))((strm)->opaque, (voidpf)(addr)) +#define TRY_FREE(s, p) {if (p) ZFREE(s, p);} + +/* Reverse the bytes in a 32-bit value */ +#define ZSWAP32(q) ((((q) >> 24) & 0xff) + (((q) >> 8) & 0xff00) + \ + (((q) & 0xff00) << 8) + (((q) & 0xff) << 24)) + +#endif /* ZUTIL_H */ diff --git a/frontend/320240/caanoo.gpe b/frontend/320240/caanoo.gpe deleted file mode 100755 index 9d6154a..0000000 --- a/frontend/320240/caanoo.gpe +++ /dev/null @@ -1,23 +0,0 @@ -#!/bin/sh - -# Wiz's timings are already good, apply this for Caanoo -if [ -e /dev/accel ]; then - ./pollux_set "ram_timings=3,9,4,1,1,1,1" -fi - -# the sync mount causes problems when writing saves, -# probably due to many write calls, so have to get rid of it -if grep mmcblk /proc/mounts | grep -q '\<sync\>'; then - oldmount=`grep mmcblk /proc/mounts | grep '\<sync\>' | awk '{print $4}'` - mount /dev/mmcblk0p1 /mnt/sd/ -o remount,dirsync,noatime -fi - -./pcsx "$@" -sync - -if [ -n "$oldmount" ]; then - mount /dev/mmcblk0p1 /mnt/sd/ -o remount,$oldmount -fi - -cd /usr/gp2x -exec ./gp2xmenu diff --git a/frontend/320240/haptic_s.cfg b/frontend/320240/haptic_s.cfg deleted file mode 100644 index 624056d..0000000 --- a/frontend/320240/haptic_s.cfg +++ /dev/null @@ -1,3 +0,0 @@ -0 126 -100 -126 -115 0 diff --git a/frontend/320240/haptic_w.cfg b/frontend/320240/haptic_w.cfg deleted file mode 100644 index 3585a71..0000000 --- a/frontend/320240/haptic_w.cfg +++ /dev/null @@ -1,3 +0,0 @@ -0 54 -100 -126 -105 0 diff --git a/frontend/320240/pcsx26.png b/frontend/320240/pcsx26.png Binary files differdeleted file mode 100644 index ed220a0..0000000 --- a/frontend/320240/pcsx26.png +++ /dev/null diff --git a/frontend/320240/pcsx_rearmed.ini b/frontend/320240/pcsx_rearmed.ini deleted file mode 100644 index b15497f..0000000 --- a/frontend/320240/pcsx_rearmed.ini +++ /dev/null @@ -1,6 +0,0 @@ -[info] -name="PCSX ReARMed" -icon="/pcsx_rearmed/pcsx26.png" -path="/pcsx_rearmed/pcsx.gpe" -title="/pcsx_rearmed/pcsxb.png" -group="GAMES" diff --git a/frontend/320240/pcsxb.png b/frontend/320240/pcsxb.png Binary files differdeleted file mode 100644 index ff5a48a..0000000 --- a/frontend/320240/pcsxb.png +++ /dev/null diff --git a/frontend/320240/pollux_set.c b/frontend/320240/pollux_set.c deleted file mode 100644 index f49e777..0000000 --- a/frontend/320240/pollux_set.c +++ /dev/null @@ -1,389 +0,0 @@ -/* - * quick tool to set various timings for Wiz - * - * Copyright (c) Gražvydas "notaz" Ignotas, 2009 - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * * Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * * Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * * Neither the name of the organization nor the - * names of its contributors may be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE - * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL - * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR - * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER - * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, - * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE - * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - * - * HTOTAL: X VTOTAL: 341 - * HSWIDTH: 1 VSWIDTH: 0 - * HASTART: 37 VASTART: 17 - * HAEND: 277 VAEND: 337 - * - * 120Hz - * pcd 8, 447: + 594us - * pcd 9, 397: + 36us - * pcd 10, 357: - 523us - * pcd 11, 325: +1153us - * - * 'lcd_timings=397,1,37,277,341,0,17,337;dpc_clkdiv0=9' - * 'ram_timings=2,9,4,1,1,1,1' - */ - -#include <stdio.h> -#include <stdlib.h> -#include <string.h> -//#include "pollux_set.h" -#define BINARY - -/* parse stuff */ -static int parse_lcd_timings(const char *str, void *data) -{ - int *lcd_timings = data; - const char *p = str; - int ret, c; - ret = sscanf(str, "%d,%d,%d,%d,%d,%d,%d,%d", - &lcd_timings[0], &lcd_timings[1], &lcd_timings[2], &lcd_timings[3], - &lcd_timings[4], &lcd_timings[5], &lcd_timings[6], &lcd_timings[7]); - if (ret != 8) - return -1; - /* skip seven commas */ - for (c = 0; c < 7 && *p != 0; p++) - if (*p == ',') - c++; - if (c != 7) - return -1; - /* skip last number */ - while ('0' <= *p && *p <= '9') - p++; - - return p - str; -} - -static int parse_ram_timings(const char *str, void *data) -{ - int *ram_timings = data; - const char *p = str; - int ret, c; - float cas; - - ret = sscanf(p, "%f,%d,%d,%d,%d,%d,%d", - &cas, &ram_timings[1], &ram_timings[2], &ram_timings[3], - &ram_timings[4], &ram_timings[5], &ram_timings[6]); - if (ret != 7) - return -1; - if (cas == 2) - ram_timings[0] = 1; - else if (cas == 2.5) - ram_timings[0] = 2; - else if (cas == 3) - ram_timings[0] = 3; - else - return -1; - for (c = 0; c < 6 && *p != 0; p++) - if (*p == ',') - c++; - if (c != 6) - return -1; - while ('0' <= *p && *p <= '9') - p++; - - return p - str; -} - -static int parse_decimal(const char *str, void *data) -{ - char *ep; - - *(int *)data = strtoul(str, &ep, 10); - if (ep == str) - return -1; - - return ep - str; -} - -/* validate and apply stuff */ -static int apply_lcd_timings(volatile unsigned short *memregs, void *data) -{ - int *lcd_timings = data; - int i; - - for (i = 0; i < 8; i++) { - if (lcd_timings[i] & ~0xffff) { - fprintf(stderr, "pollux_set: invalid lcd timing %d: %d\n", i, lcd_timings[i]); - return -1; - } - } - - for (i = 0; i < 8; i++) - memregs[(0x307c>>1) + i] = lcd_timings[i]; - - return 0; -} - -static const struct { - signed char adj; /* how to adjust value passed by user */ - signed short min; /* range of */ - signed short max; /* allowed values (inclusive) */ -} -ram_ranges[] = { - { 0, 1, 3 }, /* cas (cl) */ - { -2, 0, 15 }, /* trc */ - { -2, 0, 15 }, /* tras */ - { 0, 0, 15 }, /* twr */ - { 0, 0, 15 }, /* tmrd */ - { 0, 0, 15 }, /* trp */ - { 0, 0, 15 }, /* trcd */ -}; - -static int apply_ram_timings(volatile unsigned short *memregs, void *data) -{ - int *ram_timings = data; - int i, val; - - for (i = 0; i < 7; i++) - { - ram_timings[i] += ram_ranges[i].adj; - if (ram_timings[i] < ram_ranges[i].min || ram_timings[i] > ram_ranges[i].max) { - fprintf(stderr, "pollux_set: invalid RAM timing %d\n", i); - return -1; - } - } - - val = memregs[0x14802>>1] & 0x0f00; - val |= (ram_timings[4] << 12) | (ram_timings[5] << 4) | ram_timings[6]; - memregs[0x14802>>1] = val; - - val = memregs[0x14804>>1] & 0x4000; - val |= (ram_timings[0] << 12) | (ram_timings[1] << 8) | - (ram_timings[2] << 4) | ram_timings[3]; - val |= 0x8000; - memregs[0x14804>>1] = val; - - for (i = 0; i < 0x100000 && (memregs[0x14804>>1] & 0x8000); i++) - ; - - return 0; -} - -static int apply_dpc_clkdiv0(volatile unsigned short *memregs, void *data) -{ - int pcd = *(int *)data; - int tmp; - - if ((pcd - 1) & ~0x3f) { - fprintf(stderr, "pollux_set: invalid lcd clkdiv0: %d\n", pcd); - return -1; - } - - pcd = (pcd - 1) & 0x3f; - tmp = memregs[0x31c4>>1]; - memregs[0x31c4>>1] = (tmp & ~0x3f0) | (pcd << 4); - - return 0; -} - -static int apply_cpuclk(volatile unsigned short *memregs, void *data) -{ - volatile unsigned int *memregl = (volatile void *)memregs; - int mhz = *(int *)data; - int adiv, mdiv, pdiv, sdiv = 0; - int i, vf000, vf004; - - // m = MDIV, p = PDIV, s = SDIV - #define SYS_CLK_FREQ 27 - pdiv = 9; - mdiv = (mhz * pdiv) / SYS_CLK_FREQ; - if (mdiv & ~0x3ff) - return -1; - vf004 = (pdiv<<18) | (mdiv<<8) | sdiv; - - // attempt to keep AHB the divider close to 250, but not higher - for (adiv = 1; mhz / adiv > 250; adiv++) - ; - - vf000 = memregl[0xf000>>2]; - vf000 = (vf000 & ~0x3c0) | ((adiv - 1) << 6); - memregl[0xf000>>2] = vf000; - memregl[0xf004>>2] = vf004; - memregl[0xf07c>>2] |= 0x8000; - for (i = 0; (memregl[0xf07c>>2] & 0x8000) && i < 0x100000; i++) - ; - - printf("clock set to %dMHz, AHB set to %dMHz\n", mhz, mhz / adiv); - return 0; -} - -static int lcd_timings[8]; -static int ram_timings[7]; -static int dpc_clkdiv0; -static int cpuclk; - -static const char lcd_t_help[] = "htotal,hswidth,hastart,haend,vtotal,vswidth,vastart,vaend"; -static const char ram_t_help[] = "CAS,tRC,tRAS,tWR,tMRD,tRP,tRCD"; - -static const struct { - const char *name; - const char *help; - int (*parse)(const char *str, void *data); - int (*apply)(volatile unsigned short *memregs, void *data); - void *data; -} -all_params[] = { - { "lcd_timings", lcd_t_help, parse_lcd_timings, apply_lcd_timings, lcd_timings }, - { "ram_timings", ram_t_help, parse_ram_timings, apply_ram_timings, ram_timings }, - { "dpc_clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, - { "clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, /* alias */ - { "cpuclk", "MHZ", parse_decimal, apply_cpuclk, &cpuclk }, -}; -#define ALL_PARAM_COUNT (sizeof(all_params) / sizeof(all_params[0])) - -/* - * set timings based on preformated string - * returns 0 on success. - */ -int pollux_set(volatile unsigned short *memregs, const char *str) -{ - int parsed_params[ALL_PARAM_COUNT]; - int applied_params[ALL_PARAM_COUNT]; - int applied_something = 0; - const char *p, *po; - int i, ret; - - if (str == NULL) - return -1; - - memset(parsed_params, 0, sizeof(parsed_params)); - memset(applied_params, 0, sizeof(applied_params)); - - p = str; - while (1) - { -again: - while (*p == ';' || *p == ' ') - p++; - if (*p == 0) - break; - - for (i = 0; i < ALL_PARAM_COUNT; i++) - { - int param_len = strlen(all_params[i].name); - if (strncmp(p, all_params[i].name, param_len) == 0 && p[param_len] == '=') - { - p += param_len + 1; - ret = all_params[i].parse(p, all_params[i].data); - if (ret < 0) { - fprintf(stderr, "pollux_set parser: error at %-10s\n", p); - fprintf(stderr, " valid format is: <%s>\n", all_params[i].help); - return -1; - } - parsed_params[i] = 1; - p += ret; - goto again; - } - } - - /* Unknown param. Attempt to be forward compatible and ignore it. */ - for (po = p; *p != 0 && *p != ';'; p++) - ; - - fprintf(stderr, "unhandled param: "); - fwrite(po, 1, p - po, stderr); - fprintf(stderr, "\n"); - } - - /* validate and apply */ - for (i = 0; i < ALL_PARAM_COUNT; i++) - { - if (!parsed_params[i]) - continue; - - ret = all_params[i].apply(memregs, all_params[i].data); - if (ret < 0) { - fprintf(stderr, "pollux_set: failed to apply %s (bad value?)\n", - all_params[i].name); - continue; - } - - applied_something = 1; - applied_params[i] = 1; - } - - if (applied_something) - { - int c; - printf("applied: "); - for (i = c = 0; i < ALL_PARAM_COUNT; i++) - { - if (!applied_params[i]) - continue; - if (c != 0) - printf(", "); - printf("%s", all_params[i].name); - c++; - } - printf("\n"); - } - - return 0; -} - -#ifdef BINARY -#include <sys/types.h> -#include <sys/stat.h> -#include <fcntl.h> -#include <sys/mman.h> -#include <unistd.h> - -static void usage(const char *binary) -{ - int i; - printf("usage:\n%s <set_str[;set_str[;...]]>\n" - "set_str:\n", binary); - for (i = 0; i < ALL_PARAM_COUNT; i++) - printf(" %s=<%s>\n", all_params[i].name, all_params[i].help); -} - -int main(int argc, char *argv[]) -{ - volatile unsigned short *memregs; - int ret, memdev; - - if (argc != 2) { - usage(argv[0]); - return 1; - } - - memdev = open("/dev/mem", O_RDWR); - if (memdev == -1) - { - perror("open(/dev/mem) failed"); - return 1; - } - - memregs = mmap(0, 0x20000, PROT_READ|PROT_WRITE, MAP_SHARED, memdev, 0xc0000000); - if (memregs == MAP_FAILED) - { - perror("mmap(memregs) failed"); - close(memdev); - return 1; - } - - ret = pollux_set(memregs, argv[1]); - - munmap((void *)memregs, 0x20000); - close(memdev); - - return ret; -} -#endif diff --git a/frontend/320240/skin/background.png b/frontend/320240/skin/background.png Binary files differdeleted file mode 100644 index 0efdd18..0000000 --- a/frontend/320240/skin/background.png +++ /dev/null diff --git a/frontend/320240/skin/font.png b/frontend/320240/skin/font.png Binary files differdeleted file mode 100644 index c526a08..0000000 --- a/frontend/320240/skin/font.png +++ /dev/null diff --git a/frontend/320240/skin/readme.txt b/frontend/320240/skin/readme.txt deleted file mode 100644 index dd83963..0000000 --- a/frontend/320240/skin/readme.txt +++ /dev/null @@ -1,8 +0,0 @@ -The skin images can be customized, but there are several limitations:
-
-background.png - must be 320x240 image with 24bit RGB colors.
-font.png - must be 128x160 8bit grayscale image.
-selector.png - must be 8x10 8bit grayscale image.
-
-Font and selector colors can be changed by editing skin.txt.
-
diff --git a/frontend/320240/skin/selector.png b/frontend/320240/skin/selector.png Binary files differdeleted file mode 100644 index 5062cc2..0000000 --- a/frontend/320240/skin/selector.png +++ /dev/null diff --git a/frontend/320240/skin/skin.txt b/frontend/320240/skin/skin.txt deleted file mode 100644 index 1d6979f..0000000 --- a/frontend/320240/skin/skin.txt +++ /dev/null @@ -1,4 +0,0 @@ -// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.
-text_color=ffffc0
-selection_color=808010
-
diff --git a/frontend/320240/ui_gp2x.h b/frontend/320240/ui_gp2x.h deleted file mode 100644 index a9c4413..0000000 --- a/frontend/320240/ui_gp2x.h +++ /dev/null @@ -1,15 +0,0 @@ -#ifndef UI_FEATURES_H -#define UI_FEATURES_H - -#define MENU_BIOS_PATH "pcsx_rearmed/bios/" -#define MENU_SHOW_VARSCALER 0 -#define MENU_SHOW_VOUTMODE 0 -#define MENU_SHOW_SCALER2 1 -#define MENU_SHOW_NUBS_BTNS 0 -#define MENU_SHOW_VIBRATION 1 -#define MENU_SHOW_DEADZONE 1 -#define MENU_SHOW_MINIMIZE 0 -#define MENU_SHOW_FULLSCREEN 0 -#define MENU_SHOW_VOLUME 1 - -#endif // UI_FEATURES_H diff --git a/frontend/3ds/3ds_utils.h b/frontend/3ds/3ds_utils.h new file mode 100644 index 0000000..3d50a66 --- /dev/null +++ b/frontend/3ds/3ds_utils.h @@ -0,0 +1,66 @@ +#ifndef _3DS_UTILS_H +#define _3DS_UTILS_H + +#include <stdio.h> + +#define MEMOP_PROT 6 +#define MEMOP_MAP 4 +#define MEMOP_UNMAP 5 + +void* linearMemAlign(size_t size, size_t alignment); +void linearFree(void* mem); + +int32_t svcDuplicateHandle(uint32_t* out, uint32_t original); +int32_t svcCloseHandle(uint32_t handle); +int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); +int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); + +int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id); +int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds); +void svcExitThread(void) __attribute__((noreturn)); + +int32_t svcBackdoor(int32_t (*callback)(void)); + +#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0) + +void wait_for_input(void); + +extern __attribute__((weak)) int __ctr_svchax; + +typedef int32_t (*ctr_callback_type)(void); + +static inline void ctr_invalidate_ICache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c5, 0\n\t"); +} + +static inline void ctr_flush_DCache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c10, 0\n\t"); +} + +static inline void ctr_invalidate_ICache(void) +{ + svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel); +} + +static inline void ctr_flush_DCache(void) +{ + svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel); +} + + +static inline void ctr_flush_invalidate_cache(void) +{ + ctr_flush_DCache(); + ctr_invalidate_ICache(); +} + + +#endif // _3DS_UTILS_H diff --git a/frontend/3ds/pthread.h b/frontend/3ds/pthread.h new file mode 100644 index 0000000..2c2bf6b --- /dev/null +++ b/frontend/3ds/pthread.h @@ -0,0 +1,56 @@ + +#ifndef _3DS_PTHREAD_WRAP__ +#define _3DS_PTHREAD_WRAP__ + +#include <stdlib.h> +#include <string.h> +#include <stdio.h> + +#include "3ds_utils.h" + +#define CTR_PTHREAD_STACK_SIZE 0x10000 + +typedef struct +{ + int32_t handle; + uint32_t* stack; +}pthread_t; +typedef int pthread_attr_t; + +static inline int pthread_create(pthread_t *thread, + const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg) +{ + + thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8); + + svcCreateThread(&thread->handle, start_routine, arg, + (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE), + 0x25, 1); + + return 1; +} + + +static inline int pthread_join(pthread_t thread, void **retval) +{ + (void)retval; + + if(svcWaitSynchronization(thread.handle, INT64_MAX)) + return -1; + + linearFree(thread.stack); + + return 0; +} + + +static inline void pthread_exit(void *retval) +{ + (void)retval; + + svcExitThread(); +} + + +#endif //_3DS_PTHREAD_WRAP__ + diff --git a/frontend/3ds/sys/mman.h b/frontend/3ds/sys/mman.h new file mode 100644 index 0000000..61dde6c --- /dev/null +++ b/frontend/3ds/sys/mman.h @@ -0,0 +1,107 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdlib.h> +#include <stdio.h> +#include <stdint.h> +#include <malloc.h> + +#include "3ds_utils.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_FIXED 0x10 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static void* dynarec_cache = NULL; +static void* dynarec_cache_mapping = NULL; + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)fd; + (void)offset; + + void* addr_out; + + if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) && + (flags == (MAP_PRIVATE | MAP_ANONYMOUS))) + { + if(__ctr_svchax) + { + /* this hack works only for pcsx_rearmed */ + uint32_t currentHandle; + + if(!dynarec_cache) + dynarec_cache = memalign(0x1000, len); + + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, dynarec_cache, + len, MEMOP_MAP, prot); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = addr; + return addr; + } + else + { + printf("tried to mmap RWX pages without svcControlProcessMemory access !\n"); + return MAP_FAILED; + } + + } + + addr_out = malloc(len); + if(!addr_out) + return MAP_FAILED; + + return addr_out; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + if(__ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, NULL, + len, MEMOP_PROT, prot); + svcCloseHandle(currentHandle); + return 0; + } + + printf("mprotect called without svcControlProcessMemory access !\n"); + return -1; +} + +static inline int munmap(void *addr, size_t len) +{ + if((addr == dynarec_cache_mapping) && __ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, + dynarec_cache, dynarec_cache_mapping, + len, MEMOP_UNMAP, 0b111); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = NULL; + + } + else + free(addr); + + return 0; +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H + diff --git a/frontend/3ds/zconf.h b/frontend/3ds/zconf.h new file mode 100644 index 0000000..996fff2 --- /dev/null +++ b/frontend/3ds/zconf.h @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/frontend/3ds/zlib.h b/frontend/3ds/zlib.h new file mode 100644 index 0000000..3e0c767 --- /dev/null +++ b/frontend/3ds/zlib.h @@ -0,0 +1,1768 @@ +/* zlib.h -- interface of the 'zlib' general purpose compression library + version 1.2.8, April 28th, 2013 + + Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + + + The data format used by the zlib library is described by RFCs (Request for + Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950 + (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format). +*/ + +#ifndef ZLIB_H +#define ZLIB_H + +#include "zconf.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#define ZLIB_VERSION "1.2.8" +#define ZLIB_VERNUM 0x1280 +#define ZLIB_VER_MAJOR 1 +#define ZLIB_VER_MINOR 2 +#define ZLIB_VER_REVISION 8 +#define ZLIB_VER_SUBREVISION 0 + +/* + The 'zlib' compression library provides in-memory compression and + decompression functions, including integrity checks of the uncompressed data. + This version of the library supports only one compression method (deflation) + but other algorithms will be added later and will have the same stream + interface. + + Compression can be done in a single step if the buffers are large enough, + or can be done by repeated calls of the compression function. In the latter + case, the application must provide more input and/or consume the output + (providing more output space) before each call. + + The compressed data format used by default by the in-memory functions is + the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped + around a deflate stream, which is itself documented in RFC 1951. + + The library also supports reading and writing files in gzip (.gz) format + with an interface similar to that of stdio using the functions that start + with "gz". The gzip format is different from the zlib format. gzip is a + gzip wrapper, documented in RFC 1952, wrapped around a deflate stream. + + This library can optionally read and write gzip streams in memory as well. + + The zlib format was designed to be compact and fast for use in memory + and on communications channels. The gzip format was designed for single- + file compression on file systems, has a larger header than zlib to maintain + directory information, and uses a different, slower check method than zlib. + + The library does not install any signal handler. The decoder checks + the consistency of the compressed data, so the library should never crash + even in case of corrupted input. +*/ + +typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size)); +typedef void (*free_func) OF((voidpf opaque, voidpf address)); + +struct internal_state; + +typedef struct z_stream_s { + z_const Bytef *next_in; /* next input byte */ + uInt avail_in; /* number of bytes available at next_in */ + uLong total_in; /* total number of input bytes read so far */ + + Bytef *next_out; /* next output byte should be put there */ + uInt avail_out; /* remaining free space at next_out */ + uLong total_out; /* total number of bytes output so far */ + + z_const char *msg; /* last error message, NULL if no error */ + struct internal_state FAR *state; /* not visible by applications */ + + alloc_func zalloc; /* used to allocate the internal state */ + free_func zfree; /* used to free the internal state */ + voidpf opaque; /* private data object passed to zalloc and zfree */ + + int data_type; /* best guess about the data type: binary or text */ + uLong adler; /* adler32 value of the uncompressed data */ + uLong reserved; /* reserved for future use */ +} z_stream; + +typedef z_stream FAR *z_streamp; + +/* + gzip header information passed to and from zlib routines. See RFC 1952 + for more details on the meanings of these fields. +*/ +typedef struct gz_header_s { + int text; /* true if compressed data believed to be text */ + uLong time; /* modification time */ + int xflags; /* extra flags (not used when writing a gzip file) */ + int os; /* operating system */ + Bytef *extra; /* pointer to extra field or Z_NULL if none */ + uInt extra_len; /* extra field length (valid if extra != Z_NULL) */ + uInt extra_max; /* space at extra (only when reading header) */ + Bytef *name; /* pointer to zero-terminated file name or Z_NULL */ + uInt name_max; /* space at name (only when reading header) */ + Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */ + uInt comm_max; /* space at comment (only when reading header) */ + int hcrc; /* true if there was or will be a header crc */ + int done; /* true when done reading gzip header (not used + when writing a gzip file) */ +} gz_header; + +typedef gz_header FAR *gz_headerp; + +/* + The application must update next_in and avail_in when avail_in has dropped + to zero. It must update next_out and avail_out when avail_out has dropped + to zero. The application must initialize zalloc, zfree and opaque before + calling the init function. All other fields are set by the compression + library and must not be updated by the application. + + The opaque value provided by the application will be passed as the first + parameter for calls of zalloc and zfree. This can be useful for custom + memory management. The compression library attaches no meaning to the + opaque value. + + zalloc must return Z_NULL if there is not enough memory for the object. + If zlib is used in a multi-threaded application, zalloc and zfree must be + thread safe. + + On 16-bit systems, the functions zalloc and zfree must be able to allocate + exactly 65536 bytes, but will not be required to allocate more than this if + the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers + returned by zalloc for objects of exactly 65536 bytes *must* have their + offset normalized to zero. The default allocation function provided by this + library ensures this (see zutil.c). To reduce memory requirements and avoid + any allocation of 64K objects, at the expense of compression ratio, compile + the library with -DMAX_WBITS=14 (see zconf.h). + + The fields total_in and total_out can be used for statistics or progress + reports. After compression, total_in holds the total size of the + uncompressed data and may be saved for use in the decompressor (particularly + if the decompressor wants to decompress everything in a single step). +*/ + + /* constants */ + +#define Z_NO_FLUSH 0 +#define Z_PARTIAL_FLUSH 1 +#define Z_SYNC_FLUSH 2 +#define Z_FULL_FLUSH 3 +#define Z_FINISH 4 +#define Z_BLOCK 5 +#define Z_TREES 6 +/* Allowed flush values; see deflate() and inflate() below for details */ + +#define Z_OK 0 +#define Z_STREAM_END 1 +#define Z_NEED_DICT 2 +#define Z_ERRNO (-1) +#define Z_STREAM_ERROR (-2) +#define Z_DATA_ERROR (-3) +#define Z_MEM_ERROR (-4) +#define Z_BUF_ERROR (-5) +#define Z_VERSION_ERROR (-6) +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ + +#define Z_NO_COMPRESSION 0 +#define Z_BEST_SPEED 1 +#define Z_BEST_COMPRESSION 9 +#define Z_DEFAULT_COMPRESSION (-1) +/* compression levels */ + +#define Z_FILTERED 1 +#define Z_HUFFMAN_ONLY 2 +#define Z_RLE 3 +#define Z_FIXED 4 +#define Z_DEFAULT_STRATEGY 0 +/* compression strategy; see deflateInit2() below for details */ + +#define Z_BINARY 0 +#define Z_TEXT 1 +#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */ +#define Z_UNKNOWN 2 +/* Possible values of the data_type field (though see inflate()) */ + +#define Z_DEFLATED 8 +/* The deflate compression method (the only one supported in this version) */ + +#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */ + +#define zlib_version zlibVersion() +/* for compatibility with versions < 1.0.2 */ + + + /* basic functions */ + +ZEXTERN const char * ZEXPORT zlibVersion OF((void)); +/* The application can compare zlibVersion and ZLIB_VERSION for consistency. + If the first character differs, the library code actually used is not + compatible with the zlib.h header file used by the application. This check + is automatically made by deflateInit and inflateInit. + */ + +/* +ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level)); + + Initializes the internal stream state for compression. The fields + zalloc, zfree and opaque must be initialized before by the caller. If + zalloc and zfree are set to Z_NULL, deflateInit updates them to use default + allocation functions. + + The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9: + 1 gives best speed, 9 gives best compression, 0 gives no compression at all + (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION + requests a default compromise between speed and compression (currently + equivalent to level 6). + + deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if level is not a valid compression level, or + Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible + with the version assumed by the caller (ZLIB_VERSION). msg is set to null + if there is no error message. deflateInit does not perform any compression: + this will be done by deflate(). +*/ + + +ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush)); +/* + deflate compresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. deflate performs one or both of the + following actions: + + - Compress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in and avail_in are updated and + processing will resume at this point for the next call of deflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. This action is forced if the parameter flush is non zero. + Forcing flush frequently degrades the compression ratio, so this parameter + should be set only when necessary (in interactive applications). Some + output may be provided even if flush is not set. + + Before the call of deflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating avail_in or avail_out accordingly; avail_out should + never be zero before the call. The application can consume the compressed + output when it wants, for example when the output buffer is full (avail_out + == 0), or after each call of deflate(). If deflate returns Z_OK and with + zero avail_out, it must be called again after making room in the output + buffer because there might be more output pending. + + Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to + decide how much data to accumulate before producing output, in order to + maximize compression. + + If the parameter flush is set to Z_SYNC_FLUSH, all pending output is + flushed to the output buffer and the output is aligned on a byte boundary, so + that the decompressor can get all input data available so far. (In + particular avail_in is zero after the call if enough output space has been + provided before the call.) Flushing may degrade compression for some + compression algorithms and so it should be used only when necessary. This + completes the current deflate block and follows it with an empty stored block + that is three bits plus filler bits to the next byte, followed by four bytes + (00 00 ff ff). + + If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the + output buffer, but the output is not aligned to a byte boundary. All of the + input data so far will be available to the decompressor, as for Z_SYNC_FLUSH. + This completes the current deflate block and follows it with an empty fixed + codes block that is 10 bits long. This assures that enough bytes are output + in order for the decompressor to finish the block before the empty fixed code + block. + + If flush is set to Z_BLOCK, a deflate block is completed and emitted, as + for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to + seven bits of the current block are held to be written as the next byte after + the next deflate block is completed. In this case, the decompressor may not + be provided enough bits at this point in order to complete decompression of + the data provided so far to the compressor. It may need to wait for the next + block to be emitted. This is for advanced applications that need to control + the emission of deflate blocks. + + If flush is set to Z_FULL_FLUSH, all output is flushed as with + Z_SYNC_FLUSH, and the compression state is reset so that decompression can + restart from this point if previous compressed data has been damaged or if + random access is desired. Using Z_FULL_FLUSH too often can seriously degrade + compression. + + If deflate returns with avail_out == 0, this function must be called again + with the same value of the flush parameter and more output space (updated + avail_out), until the flush is complete (deflate returns with non-zero + avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that + avail_out is greater than six to avoid repeated flush markers due to + avail_out == 0 on return. + + If the parameter flush is set to Z_FINISH, pending input is processed, + pending output is flushed and deflate returns with Z_STREAM_END if there was + enough output space; if deflate returns with Z_OK, this function must be + called again with Z_FINISH and more output space (updated avail_out) but no + more input data, until it returns with Z_STREAM_END or an error. After + deflate has returned Z_STREAM_END, the only possible operations on the stream + are deflateReset or deflateEnd. + + Z_FINISH can be used immediately after deflateInit if all the compression + is to be done in a single step. In this case, avail_out must be at least the + value returned by deflateBound (see below). Then deflate is guaranteed to + return Z_STREAM_END. If not enough output space is provided, deflate will + not return Z_STREAM_END, and it must be called again as described above. + + deflate() sets strm->adler to the adler32 checksum of all input read + so far (that is, total_in bytes). + + deflate() may update strm->data_type if it can make a good guess about + the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered + binary. This field is only for information purposes and does not affect the + compression algorithm in any manner. + + deflate() returns Z_OK if some progress has been made (more input + processed or more output produced), Z_STREAM_END if all input has been + consumed and all output has been produced (only when flush is set to + Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example + if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible + (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not + fatal, and deflate() can be called again with more input and more output + space to continue compressing. +*/ + + +ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the + stream state was inconsistent, Z_DATA_ERROR if the stream was freed + prematurely (some input or output was discarded). In the error case, msg + may be set but then points to a static string (which must not be + deallocated). +*/ + + +/* +ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm)); + + Initializes the internal stream state for decompression. The fields + next_in, avail_in, zalloc, zfree and opaque must be initialized before by + the caller. If next_in is not Z_NULL and avail_in is large enough (the + exact value depends on the compression method), inflateInit determines the + compression method from the zlib header and allocates all data structures + accordingly; otherwise the allocation will be deferred to the first call of + inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to + use default allocation functions. + + inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit() does not process any header information -- that is deferred + until inflate() is called. +*/ + + +ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush)); +/* + inflate decompresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. inflate performs one or both of the + following actions: + + - Decompress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in is updated and processing will + resume at this point for the next call of inflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. inflate() provides as much output as possible, until there is + no more input data or no more space in the output buffer (see below about + the flush parameter). + + Before the call of inflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating the next_* and avail_* values accordingly. The + application can consume the uncompressed output when it wants, for example + when the output buffer is full (avail_out == 0), or after each call of + inflate(). If inflate returns Z_OK and with zero avail_out, it must be + called again after making room in the output buffer because there might be + more output pending. + + The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH, + Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much + output as possible to the output buffer. Z_BLOCK requests that inflate() + stop if and when it gets to the next deflate block boundary. When decoding + the zlib or gzip format, this will cause inflate() to return immediately + after the header and before the first block. When doing a raw inflate, + inflate() will go ahead and process the first block, and will return when it + gets to the end of that block, or when it runs out of data. + + The Z_BLOCK option assists in appending to or combining deflate streams. + Also to assist in this, on return inflate() will set strm->data_type to the + number of unused bits in the last byte taken from strm->next_in, plus 64 if + inflate() is currently decoding the last block in the deflate stream, plus + 128 if inflate() returned immediately after decoding an end-of-block code or + decoding the complete header up to just before the first byte of the deflate + stream. The end-of-block will not be indicated until all of the uncompressed + data from that block has been written to strm->next_out. The number of + unused bits may in general be greater than seven, except when bit 7 of + data_type is set, in which case the number of unused bits will be less than + eight. data_type is set as noted here every time inflate() returns for all + flush options, and so can be used to determine the amount of currently + consumed input in bits. + + The Z_TREES option behaves as Z_BLOCK does, but it also returns when the + end of each deflate block header is reached, before any actual data in that + block is decoded. This allows the caller to determine the length of the + deflate block header for later use in random access within a deflate block. + 256 is added to the value of strm->data_type when inflate() returns + immediately after reaching the end of the deflate block header. + + inflate() should normally be called until it returns Z_STREAM_END or an + error. However if all decompression is to be performed in a single step (a + single call of inflate), the parameter flush should be set to Z_FINISH. In + this case all pending input is processed and all pending output is flushed; + avail_out must be large enough to hold all of the uncompressed data for the + operation to complete. (The size of the uncompressed data may have been + saved by the compressor for this purpose.) The use of Z_FINISH is not + required to perform an inflation in one step. However it may be used to + inform inflate that a faster approach can be used for the single inflate() + call. Z_FINISH also informs inflate to not maintain a sliding window if the + stream completes, which reduces inflate's memory footprint. If the stream + does not complete, either because not all of the stream is provided or not + enough output space is provided, then a sliding window will be allocated and + inflate() can be called again to continue the operation as if Z_NO_FLUSH had + been used. + + In this implementation, inflate() always flushes as much output as + possible to the output buffer, and always uses the faster approach on the + first call. So the effects of the flush parameter in this implementation are + on the return value of inflate() as noted below, when inflate() returns early + when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of + memory for a sliding window when Z_FINISH is used. + + If a preset dictionary is needed after this call (see inflateSetDictionary + below), inflate sets strm->adler to the Adler-32 checksum of the dictionary + chosen by the compressor and returns Z_NEED_DICT; otherwise it sets + strm->adler to the Adler-32 checksum of all output produced so far (that is, + total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described + below. At the end of the stream, inflate() checks that its computed adler32 + checksum is equal to that saved by the compressor and returns Z_STREAM_END + only if the checksum is correct. + + inflate() can decompress and check either zlib-wrapped or gzip-wrapped + deflate data. The header type is detected automatically, if requested when + initializing with inflateInit2(). Any information contained in the gzip + header is not retained, so applications that need that information should + instead use raw inflate, see inflateInit2() below, or inflateBack() and + perform their own processing of the gzip header and trailer. When processing + gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output + producted so far. The CRC-32 is checked against the gzip trailer. + + inflate() returns Z_OK if some progress has been made (more input processed + or more output produced), Z_STREAM_END if the end of the compressed data has + been reached and all uncompressed output has been produced, Z_NEED_DICT if a + preset dictionary is needed at this point, Z_DATA_ERROR if the input data was + corrupted (input stream not conforming to the zlib format or incorrect check + value), Z_STREAM_ERROR if the stream structure was inconsistent (for example + next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory, + Z_BUF_ERROR if no progress is possible or if there was not enough room in the + output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and + inflate() can be called again with more input and more output space to + continue decompressing. If Z_DATA_ERROR is returned, the application may + then call inflateSync() to look for a good compression block if a partial + recovery of the data is desired. +*/ + + +ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state + was inconsistent. In the error case, msg may be set but then points to a + static string (which must not be deallocated). +*/ + + + /* Advanced functions */ + +/* + The following functions are needed only in some special applications. +*/ + +/* +ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm, + int level, + int method, + int windowBits, + int memLevel, + int strategy)); + + This is another version of deflateInit with more compression options. The + fields next_in, zalloc, zfree and opaque must be initialized before by the + caller. + + The method parameter is the compression method. It must be Z_DEFLATED in + this version of the library. + + The windowBits parameter is the base two logarithm of the window size + (the size of the history buffer). It should be in the range 8..15 for this + version of the library. Larger values of this parameter result in better + compression at the expense of memory usage. The default value is 15 if + deflateInit is used instead. + + windowBits can also be -8..-15 for raw deflate. In this case, -windowBits + determines the window size. deflate() will then generate raw deflate data + with no zlib header or trailer, and will not compute an adler32 check value. + + windowBits can also be greater than 15 for optional gzip encoding. Add + 16 to windowBits to write a simple gzip header and trailer around the + compressed data instead of a zlib wrapper. The gzip header will have no + file name, no extra data, no comment, no modification time (set to zero), no + header crc, and the operating system will be set to 255 (unknown). If a + gzip stream is being written, strm->adler is a crc32 instead of an adler32. + + The memLevel parameter specifies how much memory should be allocated + for the internal compression state. memLevel=1 uses minimum memory but is + slow and reduces compression ratio; memLevel=9 uses maximum memory for + optimal speed. The default value is 8. See zconf.h for total memory usage + as a function of windowBits and memLevel. + + The strategy parameter is used to tune the compression algorithm. Use the + value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a + filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no + string match), or Z_RLE to limit match distances to one (run-length + encoding). Filtered data consists mostly of small values with a somewhat + random distribution. In this case, the compression algorithm is tuned to + compress them better. The effect of Z_FILTERED is to force more Huffman + coding and less string matching; it is somewhat intermediate between + Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as + fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The + strategy parameter only affects the compression ratio but not the + correctness of the compressed output even if it is not set appropriately. + Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler + decoder for special applications. + + deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid + method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is + incompatible with the version assumed by the caller (ZLIB_VERSION). msg is + set to null if there is no error message. deflateInit2 does not perform any + compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the compression dictionary from the given byte sequence + without producing any compressed output. When using the zlib format, this + function must be called immediately after deflateInit, deflateInit2 or + deflateReset, and before any call of deflate. When doing raw deflate, this + function must be called either before any call of deflate, or immediately + after the completion of a deflate block, i.e. after all input has been + consumed and all output has been delivered when using any of the flush + options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The + compressor and decompressor must use exactly the same dictionary (see + inflateSetDictionary). + + The dictionary should consist of strings (byte sequences) that are likely + to be encountered later in the data to be compressed, with the most commonly + used strings preferably put towards the end of the dictionary. Using a + dictionary is most useful when the data to be compressed is short and can be + predicted with good accuracy; the data can then be compressed better than + with the default empty dictionary. + + Depending on the size of the compression data structures selected by + deflateInit or deflateInit2, a part of the dictionary may in effect be + discarded, for example if the dictionary is larger than the window size + provided in deflateInit or deflateInit2. Thus the strings most likely to be + useful should be put at the end of the dictionary, not at the front. In + addition, the current implementation of deflate will use at most the window + size minus 262 bytes of the provided dictionary. + + Upon return of this function, strm->adler is set to the adler32 value + of the dictionary; the decompressor may later use this value to determine + which dictionary has been used by the compressor. (The adler32 value + applies to the whole dictionary even if only a subset of the dictionary is + actually used by the compressor.) If a raw deflate was requested, then the + adler32 value is not computed and strm->adler is not set. + + deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent (for example if deflate has already been called for this stream + or if not at a block boundary for raw deflate). deflateSetDictionary does + not perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when several compression strategies will be + tried, for example when there are several ways of pre-processing the input + data with a filter. The streams that will be discarded should then be freed + by calling deflateEnd. Note that deflateCopy duplicates the internal + compression state which can be quite large, so this strategy is slow and can + consume lots of memory. + + deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm)); +/* + This function is equivalent to deflateEnd followed by deflateInit, + but does not free and reallocate all the internal compression state. The + stream will keep the same compression level and any other attributes that + may have been set by deflateInit2. + + deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm, + int level, + int strategy)); +/* + Dynamically update the compression level and compression strategy. The + interpretation of level and strategy is as in deflateInit2. This can be + used to switch between compression and straight copy of the input data, or + to switch to a different kind of input data requiring a different strategy. + If the compression level is changed, the input available so far is + compressed with the old level (and may be flushed); the new level will take + effect only at the next call of deflate(). + + Before the call of deflateParams, the stream state must be set as for + a call of deflate(), since the currently available input may have to be + compressed and flushed. In particular, strm->avail_out must be non-zero. + + deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source + stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if + strm->avail_out was zero. +*/ + +ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm, + int good_length, + int max_lazy, + int nice_length, + int max_chain)); +/* + Fine tune deflate's internal compression parameters. This should only be + used by someone who understands the algorithm used by zlib's deflate for + searching for the best matching string, and even then only by the most + fanatic optimizer trying to squeeze out the last compressed bit for their + specific input data. Read the deflate.c source code for the meaning of the + max_lazy, good_length, nice_length, and max_chain parameters. + + deflateTune() can be called after deflateInit() or deflateInit2(), and + returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream. + */ + +ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm, + uLong sourceLen)); +/* + deflateBound() returns an upper bound on the compressed size after + deflation of sourceLen bytes. It must be called after deflateInit() or + deflateInit2(), and after deflateSetHeader(), if used. This would be used + to allocate an output buffer for deflation in a single pass, and so would be + called before deflate(). If that first deflate() call is provided the + sourceLen input bytes, an output buffer allocated to the size returned by + deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed + to return Z_STREAM_END. Note that it is possible for the compressed size to + be larger than the value returned by deflateBound() if flush options other + than Z_FINISH or Z_NO_FLUSH are used. +*/ + +ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm, + unsigned *pending, + int *bits)); +/* + deflatePending() returns the number of bytes and bits of output that have + been generated, but not yet provided in the available output. The bytes not + provided would be due to the available output space having being consumed. + The number of bits of output not provided are between 0 and 7, where they + await more bits to join them in order to fill out a full byte. If pending + or bits are Z_NULL, then those values are not set. + + deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. + */ + +ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + deflatePrime() inserts bits in the deflate output stream. The intent + is that this function is used to start off the deflate output with the bits + leftover from a previous deflate stream when appending to it. As such, this + function can only be used for raw deflate, and must be used before the first + deflate() call after a deflateInit2() or deflateReset(). bits must be less + than or equal to 16, and that many of the least significant bits of value + will be inserted in the output. + + deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough + room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm, + gz_headerp head)); +/* + deflateSetHeader() provides gzip header information for when a gzip + stream is requested by deflateInit2(). deflateSetHeader() may be called + after deflateInit2() or deflateReset() and before the first call of + deflate(). The text, time, os, extra field, name, and comment information + in the provided gz_header structure are written to the gzip header (xflag is + ignored -- the extra flags are set according to the compression level). The + caller must assure that, if not Z_NULL, name and comment are terminated with + a zero byte, and that if extra is not Z_NULL, that extra_len bytes are + available there. If hcrc is true, a gzip header crc is included. Note that + the current versions of the command-line version of gzip (up through version + 1.3.x) do not support header crc's, and will report that it is a "multi-part + gzip file" and give up. + + If deflateSetHeader is not used, the default gzip header has text false, + the time set to zero, and os set to 255, with no extra, name, or comment + fields. The gzip header is returned to the default state by deflateReset(). + + deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm, + int windowBits)); + + This is another version of inflateInit with an extra parameter. The + fields next_in, avail_in, zalloc, zfree and opaque must be initialized + before by the caller. + + The windowBits parameter is the base two logarithm of the maximum window + size (the size of the history buffer). It should be in the range 8..15 for + this version of the library. The default value is 15 if inflateInit is used + instead. windowBits must be greater than or equal to the windowBits value + provided to deflateInit2() while compressing, or it must be equal to 15 if + deflateInit2() was not used. If a compressed stream with a larger window + size is given as input, inflate() will return with the error code + Z_DATA_ERROR instead of trying to allocate a larger window. + + windowBits can also be zero to request that inflate use the window size in + the zlib header of the compressed stream. + + windowBits can also be -8..-15 for raw inflate. In this case, -windowBits + determines the window size. inflate() will then process raw deflate data, + not looking for a zlib or gzip header, not generating a check value, and not + looking for any check values for comparison at the end of the stream. This + is for use with other formats that use the deflate compressed data format + such as zip. Those formats provide their own check values. If a custom + format is developed using the raw deflate format for compressed data, it is + recommended that a check value such as an adler32 or a crc32 be applied to + the uncompressed data as is done in the zlib, gzip, and zip formats. For + most applications, the zlib format should be used as is. Note that comments + above on the use in deflateInit2() applies to the magnitude of windowBits. + + windowBits can also be greater than 15 for optional gzip decoding. Add + 32 to windowBits to enable zlib and gzip decoding with automatic header + detection, or add 16 to decode only the gzip format (the zlib format will + return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a + crc32 instead of an adler32. + + inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit2 does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit2() does not process any header information -- that is + deferred until inflate() is called. +*/ + +ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the decompression dictionary from the given uncompressed byte + sequence. This function must be called immediately after a call of inflate, + if that call returned Z_NEED_DICT. The dictionary chosen by the compressor + can be determined from the adler32 value returned by that call of inflate. + The compressor and decompressor must use exactly the same dictionary (see + deflateSetDictionary). For raw inflate, this function can be called at any + time to set the dictionary. If the provided dictionary is smaller than the + window and there is already data in the window, then the provided dictionary + will amend what's there. The application must insure that the dictionary + that was used for compression is provided. + + inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the + expected one (incorrect adler32 value). inflateSetDictionary does not + perform any decompression: this will be done by subsequent calls of + inflate(). +*/ + +ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm, + Bytef *dictionary, + uInt *dictLength)); +/* + Returns the sliding dictionary being maintained by inflate. dictLength is + set to the number of bytes in the dictionary, and that many bytes are copied + to dictionary. dictionary must have enough space, where 32768 bytes is + always enough. If inflateGetDictionary() is called with dictionary equal to + Z_NULL, then only the dictionary length is returned, and nothing is copied. + Similary, if dictLength is Z_NULL, then it is not set. + + inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the + stream state is inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm)); +/* + Skips invalid compressed data until a possible full flush point (see above + for the description of deflate with Z_FULL_FLUSH) can be found, or until all + available input is skipped. No output is provided. + + inflateSync searches for a 00 00 FF FF pattern in the compressed data. + All full flush points have this pattern, but not all occurrences of this + pattern are full flush points. + + inflateSync returns Z_OK if a possible full flush point has been found, + Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point + has been found, or Z_STREAM_ERROR if the stream structure was inconsistent. + In the success case, the application may save the current current value of + total_in which indicates where valid compressed data was found. In the + error case, the application may repeatedly call inflateSync, providing more + input each time, until success or end of the input data. +*/ + +ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when randomly accessing a large stream. The + first pass through the stream can periodically record the inflate state, + allowing restarting inflate at those points when randomly accessing the + stream. + + inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm)); +/* + This function is equivalent to inflateEnd followed by inflateInit, + but does not free and reallocate all the internal decompression state. The + stream will keep attributes that may have been set by inflateInit2. + + inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm, + int windowBits)); +/* + This function is the same as inflateReset, but it also permits changing + the wrap and window size requests. The windowBits parameter is interpreted + the same as it is for inflateInit2. + + inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL), or if + the windowBits parameter is invalid. +*/ + +ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + This function inserts bits in the inflate input stream. The intent is + that this function is used to start inflating at a bit position in the + middle of a byte. The provided bits will be used before any bytes are used + from next_in. This function should only be used with raw inflate, and + should be used before the first inflate() call after inflateInit2() or + inflateReset(). bits must be less than or equal to 16, and that many of the + least significant bits of value will be inserted in the input. + + If bits is negative, then the input stream bit buffer is emptied. Then + inflatePrime() can be called again to put bits in the buffer. This is used + to clear out bits leftover after feeding inflate a block description prior + to feeding inflate codes. + + inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm)); +/* + This function returns two values, one in the lower 16 bits of the return + value, and the other in the remaining upper bits, obtained by shifting the + return value down 16 bits. If the upper value is -1 and the lower value is + zero, then inflate() is currently decoding information outside of a block. + If the upper value is -1 and the lower value is non-zero, then inflate is in + the middle of a stored block, with the lower value equaling the number of + bytes from the input remaining to copy. If the upper value is not -1, then + it is the number of bits back from the current bit position in the input of + the code (literal or length/distance pair) currently being processed. In + that case the lower value is the number of bytes already emitted for that + code. + + A code is being processed if inflate is waiting for more input to complete + decoding of the code, or if it has completed decoding but is waiting for + more output space to write the literal or match data. + + inflateMark() is used to mark locations in the input data for random + access, which may be at bit positions, and to note those cases where the + output of a code may span boundaries of random access blocks. The current + location in the input stream can be determined from avail_in and data_type + as noted in the description for the Z_BLOCK flush parameter for inflate. + + inflateMark returns the value noted above or -1 << 16 if the provided + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm, + gz_headerp head)); +/* + inflateGetHeader() requests that gzip header information be stored in the + provided gz_header structure. inflateGetHeader() may be called after + inflateInit2() or inflateReset(), and before the first call of inflate(). + As inflate() processes the gzip stream, head->done is zero until the header + is completed, at which time head->done is set to one. If a zlib stream is + being decoded, then head->done is set to -1 to indicate that there will be + no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be + used to force inflate() to return immediately after header processing is + complete and before any actual data is decompressed. + + The text, time, xflags, and os fields are filled in with the gzip header + contents. hcrc is set to true if there is a header CRC. (The header CRC + was valid if done is set to one.) If extra is not Z_NULL, then extra_max + contains the maximum number of bytes to write to extra. Once done is true, + extra_len contains the actual extra field length, and extra contains the + extra field, or that field truncated if extra_max is less than extra_len. + If name is not Z_NULL, then up to name_max characters are written there, + terminated with a zero unless the length is greater than name_max. If + comment is not Z_NULL, then up to comm_max characters are written there, + terminated with a zero unless the length is greater than comm_max. When any + of extra, name, or comment are not Z_NULL and the respective field is not + present in the header, then that field is set to Z_NULL to signal its + absence. This allows the use of deflateSetHeader() with the returned + structure to duplicate the header. However if those fields are set to + allocated memory, then the application will need to save those pointers + elsewhere so that they can be eventually freed. + + If inflateGetHeader is not used, then the header information is simply + discarded. The header is always checked for validity, including the header + CRC if present. inflateReset() will reset the process to discard the header + information. The application would need to call inflateGetHeader() again to + retrieve the header from the next gzip stream. + + inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits, + unsigned char FAR *window)); + + Initialize the internal stream state for decompression using inflateBack() + calls. The fields zalloc, zfree and opaque in strm must be initialized + before the call. If zalloc and zfree are Z_NULL, then the default library- + derived memory allocation routines are used. windowBits is the base two + logarithm of the window size, in the range 8..15. window is a caller + supplied buffer of that size. Except for special applications where it is + assured that deflate was used with small window sizes, windowBits must be 15 + and a 32K byte window must be supplied to be able to decompress general + deflate streams. + + See inflateBack() for the usage of these routines. + + inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of + the parameters are invalid, Z_MEM_ERROR if the internal state could not be + allocated, or Z_VERSION_ERROR if the version of the library does not match + the version of the header file. +*/ + +typedef unsigned (*in_func) OF((void FAR *, + z_const unsigned char FAR * FAR *)); +typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned)); + +ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm, + in_func in, void FAR *in_desc, + out_func out, void FAR *out_desc)); +/* + inflateBack() does a raw inflate with a single call using a call-back + interface for input and output. This is potentially more efficient than + inflate() for file i/o applications, in that it avoids copying between the + output and the sliding window by simply making the window itself the output + buffer. inflate() can be faster on modern CPUs when used with large + buffers. inflateBack() trusts the application to not change the output + buffer passed by the output function, at least until inflateBack() returns. + + inflateBackInit() must be called first to allocate the internal state + and to initialize the state with the user-provided window buffer. + inflateBack() may then be used multiple times to inflate a complete, raw + deflate stream with each call. inflateBackEnd() is then called to free the + allocated state. + + A raw deflate stream is one with no zlib or gzip header or trailer. + This routine would normally be used in a utility that reads zip or gzip + files and writes out uncompressed files. The utility would decode the + header and process the trailer on its own, hence this routine expects only + the raw deflate stream to decompress. This is different from the normal + behavior of inflate(), which expects either a zlib or gzip header and + trailer around the deflate stream. + + inflateBack() uses two subroutines supplied by the caller that are then + called by inflateBack() for input and output. inflateBack() calls those + routines until it reads a complete deflate stream and writes out all of the + uncompressed data, or until it encounters an error. The function's + parameters and return types are defined above in the in_func and out_func + typedefs. inflateBack() will call in(in_desc, &buf) which should return the + number of bytes of provided input, and a pointer to that input in buf. If + there is no input available, in() must return zero--buf is ignored in that + case--and inflateBack() will return a buffer error. inflateBack() will call + out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out() + should return zero on success, or non-zero on failure. If out() returns + non-zero, inflateBack() will return with an error. Neither in() nor out() + are permitted to change the contents of the window provided to + inflateBackInit(), which is also the buffer that out() uses to write from. + The length written by out() will be at most the window size. Any non-zero + amount of input may be provided by in(). + + For convenience, inflateBack() can be provided input on the first call by + setting strm->next_in and strm->avail_in. If that input is exhausted, then + in() will be called. Therefore strm->next_in must be initialized before + calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called + immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in + must also be initialized, and then if strm->avail_in is not zero, input will + initially be taken from strm->next_in[0 .. strm->avail_in - 1]. + + The in_desc and out_desc parameters of inflateBack() is passed as the + first parameter of in() and out() respectively when they are called. These + descriptors can be optionally used to pass any information that the caller- + supplied in() and out() functions need to do their job. + + On return, inflateBack() will set strm->next_in and strm->avail_in to + pass back any unused input that was provided by the last in() call. The + return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR + if in() or out() returned an error, Z_DATA_ERROR if there was a format error + in the deflate stream (in which case strm->msg is set to indicate the nature + of the error), or Z_STREAM_ERROR if the stream was not properly initialized. + In the case of Z_BUF_ERROR, an input or output error can be distinguished + using strm->next_in which will be Z_NULL only if in() returned an error. If + strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning + non-zero. (in() will always be called before out(), so strm->next_in is + assured to be defined if out() returns non-zero.) Note that inflateBack() + cannot return Z_OK. +*/ + +ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm)); +/* + All memory allocated by inflateBackInit() is freed. + + inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream + state was inconsistent. +*/ + +ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void)); +/* Return flags indicating compile-time options. + + Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other: + 1.0: size of uInt + 3.2: size of uLong + 5.4: size of voidpf (pointer) + 7.6: size of z_off_t + + Compiler, assembler, and debug options: + 8: DEBUG + 9: ASMV or ASMINF -- use ASM code + 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention + 11: 0 (reserved) + + One-time table building (smaller code, but not thread-safe if true): + 12: BUILDFIXED -- build static block decoding tables when needed + 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed + 14,15: 0 (reserved) + + Library content (indicates missing functionality): + 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking + deflate code when not needed) + 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect + and decode gzip streams (to avoid linking crc code) + 18-19: 0 (reserved) + + Operation variations (changes in library functionality): + 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate + 21: FASTEST -- deflate algorithm with only one, lowest compression level + 22,23: 0 (reserved) + + The sprintf variant used by gzprintf (zero is best): + 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format + 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure! + 26: 0 = returns value, 1 = void -- 1 means inferred string length returned + + Remainder: + 27-31: 0 (reserved) + */ + +#ifndef Z_SOLO + + /* utility functions */ + +/* + The following utility functions are implemented on top of the basic + stream-oriented functions. To simplify the interface, some default options + are assumed (compression level and memory usage, standard memory allocation + functions). The source code of these utility functions can be modified if + you need special options. +*/ + +ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Compresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer. +*/ + +ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen, + int level)); +/* + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. +*/ + +ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen)); +/* + compressBound() returns an upper bound on the compressed size after + compress() or compress2() on sourceLen bytes. It would be used before a + compress() or compress2() call to allocate the destination buffer. +*/ + +ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be large enough to hold the entire + uncompressed data. (The size of the uncompressed data must have been saved + previously by the compressor and transmitted to the decompressor by some + mechanism outside the scope of this compression library.) Upon exit, destLen + is the actual size of the uncompressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In + the case where there is not enough room, uncompress() will fill the output + buffer with the uncompressed data up to that point. +*/ + + /* gzip file access functions */ + +/* + This library supports reading and writing files in gzip (.gz) format with + an interface similar to that of stdio, using the functions that start with + "gz". The gzip format is different from the zlib format. gzip is a gzip + wrapper, documented in RFC 1952, wrapped around a deflate stream. +*/ + +typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */ + +/* +ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode)); + + Opens a gzip (.gz) file for reading or writing. The mode parameter is as + in fopen ("rb" or "wb") but can also include a compression level ("wb9") or + a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only + compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F' + for fixed code compression as in "wb9F". (See the description of + deflateInit2 for more information about the strategy parameter.) 'T' will + request transparent writing or appending with no compression and not using + the gzip format. + + "a" can be used instead of "w" to request that the gzip stream that will + be written be appended to the file. "+" will result in an error, since + reading and writing to the same gzip file is not supported. The addition of + "x" when writing will create the file exclusively, which fails if the file + already exists. On systems that support it, the addition of "e" when + reading or writing will set the flag to close the file on an execve() call. + + These functions, as well as gzip, will read and decode a sequence of gzip + streams in a file. The append function of gzopen() can be used to create + such a file. (Also see gzflush() for another way to do this.) When + appending, gzopen does not test whether the file begins with a gzip stream, + nor does it look for the end of the gzip streams to begin appending. gzopen + will simply append a gzip stream to the existing file. + + gzopen can be used to read a file which is not in gzip format; in this + case gzread will directly read from the file without decompression. When + reading, this will be detected automatically by looking for the magic two- + byte gzip header. + + gzopen returns NULL if the file could not be opened, if there was + insufficient memory to allocate the gzFile state, or if an invalid mode was + specified (an 'r', 'w', or 'a' was not provided, or '+' was provided). + errno can be checked to determine if the reason gzopen failed was that the + file could not be opened. +*/ + +ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode)); +/* + gzdopen associates a gzFile with the file descriptor fd. File descriptors + are obtained from calls like open, dup, creat, pipe or fileno (if the file + has been previously opened with fopen). The mode parameter is as in gzopen. + + The next call of gzclose on the returned gzFile will also close the file + descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor + fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd, + mode);. The duplicated descriptor should be saved to avoid a leak, since + gzdopen does not close fd if it fails. If you are using fileno() to get the + file descriptor from a FILE *, then you will have to use dup() to avoid + double-close()ing the file descriptor. Both gzclose() and fclose() will + close the associated file descriptor, so they need to have different file + descriptors. + + gzdopen returns NULL if there was insufficient memory to allocate the + gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not + provided, or '+' was provided), or if fd is -1. The file descriptor is not + used until the next gz* read, write, seek, or close operation, so gzdopen + will not detect if fd is invalid (unless fd is -1). +*/ + +ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size)); +/* + Set the internal buffer size used by this library's functions. The + default buffer size is 8192 bytes. This function must be called after + gzopen() or gzdopen(), and before any other calls that read or write the + file. The buffer memory allocation is always deferred to the first read or + write. Two buffers are allocated, either both of the specified size when + writing, or one of the specified size and the other twice that size when + reading. A larger buffer size of, for example, 64K or 128K bytes will + noticeably increase the speed of decompression (reading). + + The new buffer size also affects the maximum length for gzprintf(). + + gzbuffer() returns 0 on success, or -1 on failure, such as being called + too late. +*/ + +ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy)); +/* + Dynamically update the compression level or strategy. See the description + of deflateInit2 for the meaning of these parameters. + + gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not + opened for writing. +*/ + +ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len)); +/* + Reads the given number of uncompressed bytes from the compressed file. If + the input file is not in gzip format, gzread copies the given number of + bytes into the buffer directly from the file. + + After reaching the end of a gzip stream in the input, gzread will continue + to read, looking for another gzip stream. Any number of gzip streams may be + concatenated in the input file, and will all be decompressed by gzread(). + If something other than a gzip stream is encountered after a gzip stream, + that remaining trailing garbage is ignored (and no error is returned). + + gzread can be used to read a gzip file that is being concurrently written. + Upon reaching the end of the input, gzread will return with the available + data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then + gzclearerr can be used to clear the end of file indicator in order to permit + gzread to be tried again. Z_OK indicates that a gzip stream was completed + on the last gzread. Z_BUF_ERROR indicates that the input file ended in the + middle of a gzip stream. Note that gzread does not return -1 in the event + of an incomplete gzip stream. This error is deferred until gzclose(), which + will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip + stream. Alternatively, gzerror can be used before gzclose to detect this + case. + + gzread returns the number of uncompressed bytes actually read, less than + len for end of file, or -1 for error. +*/ + +ZEXTERN int ZEXPORT gzwrite OF((gzFile file, + voidpc buf, unsigned len)); +/* + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of uncompressed bytes written or 0 in case of + error. +*/ + +ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...)); +/* + Converts, formats, and writes the arguments to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written, or 0 in case of error. The number of + uncompressed bytes written is limited to 8191, or one less than the buffer + size given to gzbuffer(). The caller should assure that this limit is not + exceeded. If it is exceeded, then gzprintf() will return an error (0) with + nothing written. In this case, there may also be a buffer overflow with + unpredictable consequences, which is possible only if zlib was compiled with + the insecure functions sprintf() or vsprintf() because the secure snprintf() + or vsnprintf() functions were not available. This can be determined using + zlibCompileFlags(). +*/ + +ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s)); +/* + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + + gzputs returns the number of characters written, or -1 in case of error. +*/ + +ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len)); +/* + Reads bytes from the compressed file until len-1 characters are read, or a + newline character is read and transferred to buf, or an end-of-file + condition is encountered. If any characters are read or if len == 1, the + string is terminated with a null character. If no characters are read due + to an end-of-file or len < 1, then the buffer is left untouched. + + gzgets returns buf which is a null-terminated string, or it returns NULL + for end-of-file or in case of error. If there was an error, the contents at + buf are indeterminate. +*/ + +ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c)); +/* + Writes c, converted to an unsigned char, into the compressed file. gzputc + returns the value that was written, or -1 in case of error. +*/ + +ZEXTERN int ZEXPORT gzgetc OF((gzFile file)); +/* + Reads one byte from the compressed file. gzgetc returns this byte or -1 + in case of end of file or error. This is implemented as a macro for speed. + As such, it does not do all of the checking the other functions do. I.e. + it does not check to see if file is NULL, nor whether the structure file + points to has been clobbered or not. +*/ + +ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file)); +/* + Push one character back onto the stream to be read as the first character + on the next read. At least one character of push-back is allowed. + gzungetc() returns the character pushed, or -1 on failure. gzungetc() will + fail if c is -1, and may fail if a character has been pushed but not read + yet. If gzungetc is used immediately after gzopen or gzdopen, at least the + output buffer size of pushed characters is allowed. (See gzbuffer above.) + The pushed character will be discarded if the stream is repositioned with + gzseek() or gzrewind(). +*/ + +ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush)); +/* + Flushes all pending output into the compressed file. The parameter flush + is as in the deflate() function. The return value is the zlib error number + (see function gzerror below). gzflush is only permitted when writing. + + If the flush parameter is Z_FINISH, the remaining data is written and the + gzip stream is completed in the output. If gzwrite() is called again, a new + gzip stream will be started in the output. gzread() is able to read such + concatented gzip streams. + + gzflush should be called only when strictly necessary because it will + degrade compression if called too often. +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file, + z_off_t offset, int whence)); + + Sets the starting position for the next gzread or gzwrite on the given + compressed file. The offset represents a number of bytes in the + uncompressed data stream. The whence parameter is defined as in lseek(2); + the value SEEK_END is not supported. + + If the file is opened for reading, this function is emulated but can be + extremely slow. If the file is opened for writing, only forward seeks are + supported; gzseek then compresses a sequence of zeroes up to the new + starting position. + + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error, in + particular if the file is opened for writing and the new starting position + would be before the current position. +*/ + +ZEXTERN int ZEXPORT gzrewind OF((gzFile file)); +/* + Rewinds the given file. This function is supported only for reading. + + gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file)); + + Returns the starting position for the next gzread or gzwrite on the given + compressed file. This position represents a number of bytes in the + uncompressed data stream, and is zero when starting, even if appending or + reading a gzip stream from the middle of a file using gzdopen(). + + gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file)); + + Returns the current offset in the file being read or written. This offset + includes the count of bytes that precede the gzip stream, for example when + appending or when using gzdopen() for reading. When reading, the offset + does not include as yet unused buffered input. This information can be used + for a progress indicator. On error, gzoffset() returns -1. +*/ + +ZEXTERN int ZEXPORT gzeof OF((gzFile file)); +/* + Returns true (1) if the end-of-file indicator has been set while reading, + false (0) otherwise. Note that the end-of-file indicator is set only if the + read tried to go past the end of the input, but came up short. Therefore, + just like feof(), gzeof() may return false even if there is no more data to + read, in the event that the last read request was for the exact number of + bytes remaining in the input file. This will happen if the input file size + is an exact multiple of the buffer size. + + If gzeof() returns true, then the read functions will return no more data, + unless the end-of-file indicator is reset by gzclearerr() and the input file + has grown since the previous end of file was detected. +*/ + +ZEXTERN int ZEXPORT gzdirect OF((gzFile file)); +/* + Returns true (1) if file is being copied directly while reading, or false + (0) if file is a gzip stream being decompressed. + + If the input file is empty, gzdirect() will return true, since the input + does not contain a gzip stream. + + If gzdirect() is used immediately after gzopen() or gzdopen() it will + cause buffers to be allocated to allow reading the file to determine if it + is a gzip file. Therefore if gzbuffer() is used, it should be called before + gzdirect(). + + When writing, gzdirect() returns true (1) if transparent writing was + requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note: + gzdirect() is not needed when writing. Transparent writing must be + explicitly requested, so the application already knows the answer. When + linking statically, using gzdirect() will include all of the zlib code for + gzip file reading and decompression, which may not be desired.) +*/ + +ZEXTERN int ZEXPORT gzclose OF((gzFile file)); +/* + Flushes all pending output if necessary, closes the compressed file and + deallocates the (de)compression state. Note that once file is closed, you + cannot call gzerror with file, since its structures have been deallocated. + gzclose must not be called more than once on the same file, just as free + must not be called more than once on the same allocation. + + gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a + file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the + last read ended in the middle of a gzip stream, or Z_OK on success. +*/ + +ZEXTERN int ZEXPORT gzclose_r OF((gzFile file)); +ZEXTERN int ZEXPORT gzclose_w OF((gzFile file)); +/* + Same as gzclose(), but gzclose_r() is only for use when reading, and + gzclose_w() is only for use when writing or appending. The advantage to + using these instead of gzclose() is that they avoid linking in zlib + compression or decompression code that is not used when only reading or only + writing respectively. If gzclose() is used, then both compression and + decompression code will be included the application when linking to a static + zlib library. +*/ + +ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum)); +/* + Returns the error message for the last error which occurred on the given + compressed file. errnum is set to zlib error number. If an error occurred + in the file system and not in the compression library, errnum is set to + Z_ERRNO and the application may consult errno to get the exact error code. + + The application must not modify the returned string. Future calls to + this function may invalidate the previously returned string. If file is + closed, then the string previously returned by gzerror will no longer be + available. + + gzerror() should be used to distinguish errors from end-of-file for those + functions above that do not distinguish those cases in their return values. +*/ + +ZEXTERN void ZEXPORT gzclearerr OF((gzFile file)); +/* + Clears the error and end-of-file flags for file. This is analogous to the + clearerr() function in stdio. This is useful for continuing to read a gzip + file that is being written concurrently. +*/ + +#endif /* !Z_SOLO */ + + /* checksum functions */ + +/* + These functions are not related to compression but are exported + anyway because they might be useful in applications using the compression + library. +*/ + +ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len)); +/* + Update a running Adler-32 checksum with the bytes buf[0..len-1] and + return the updated checksum. If buf is Z_NULL, this function returns the + required initial value for the checksum. + + An Adler-32 checksum is almost as reliable as a CRC32 but can be computed + much faster. + + Usage example: + + uLong adler = adler32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + adler = adler32(adler, buffer, length); + } + if (adler != original_adler) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2, + z_off_t len2)); + + Combine two Adler-32 checksums into one. For two sequences of bytes, seq1 + and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for + each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of + seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note + that the z_off_t type (like off_t) is a signed integer. If len2 is + negative, the result has no meaning or utility. +*/ + +ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len)); +/* + Update a running CRC-32 with the bytes buf[0..len-1] and return the + updated CRC-32. If buf is Z_NULL, this function returns the required + initial value for the crc. Pre- and post-conditioning (one's complement) is + performed within this function so it shouldn't be done by the application. + + Usage example: + + uLong crc = crc32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + crc = crc32(crc, buffer, length); + } + if (crc != original_crc) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2)); + + Combine two CRC-32 check values into one. For two sequences of bytes, + seq1 and seq2 with lengths len1 and len2, CRC-32 check values were + calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32 + check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and + len2. +*/ + + + /* various hacks, don't look :) */ + +/* deflateInit and inflateInit are macros to allow checking the zlib version + * and the compiler's view of z_stream: + */ +ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method, + int windowBits, int memLevel, + int strategy, const char *version, + int stream_size)); +ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits, + unsigned char FAR *window, + const char *version, + int stream_size)); +#define deflateInit(strm, level) \ + deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit(strm) \ + inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream)) +#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \ + deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\ + (strategy), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit2(strm, windowBits) \ + inflateInit2_((strm), (windowBits), ZLIB_VERSION, \ + (int)sizeof(z_stream)) +#define inflateBackInit(strm, windowBits, window) \ + inflateBackInit_((strm), (windowBits), (window), \ + ZLIB_VERSION, (int)sizeof(z_stream)) + +#ifndef Z_SOLO + +/* gzgetc() macro and its supporting function and exposed data structure. Note + * that the real internal state is much larger than the exposed structure. + * This abbreviated structure exposes just enough for the gzgetc() macro. The + * user should not mess with these exposed elements, since their names or + * behavior could change in the future, perhaps even capriciously. They can + * only be used by the gzgetc() macro. You have been warned. + */ +struct gzFile_s { + unsigned have; + unsigned char *next; + z_off64_t pos; +}; +ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +# define z_gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#else +# define gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#endif + +/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or + * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if + * both are true, the application gets the *64 functions, and the regular + * functions are changed to 64 bits) -- in case these are set on systems + * without large file support, _LFS64_LARGEFILE must also be true + */ +#ifdef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int)); + ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t)); +#endif + +#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64) +# ifdef Z_PREFIX_SET +# define z_gzopen z_gzopen64 +# define z_gzseek z_gzseek64 +# define z_gztell z_gztell64 +# define z_gzoffset z_gzoffset64 +# define z_adler32_combine z_adler32_combine64 +# define z_crc32_combine z_crc32_combine64 +# else +# define gzopen gzopen64 +# define gzseek gzseek64 +# define gztell gztell64 +# define gzoffset gzoffset64 +# define adler32_combine adler32_combine64 +# define crc32_combine crc32_combine64 +# endif +# ifndef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +# endif +#else + ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); +#endif + +#else /* Z_SOLO */ + + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); + +#endif /* !Z_SOLO */ + +/* hack for buggy compilers */ +#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL) + struct internal_state {int dummy;}; +#endif + +/* undocumented functions */ +ZEXTERN const char * ZEXPORT zError OF((int)); +ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp)); +ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void)); +ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int)); +ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp)); +ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp)); +#if defined(_WIN32) && !defined(Z_SOLO) +ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path, + const char *mode)); +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file, + const char *format, + va_list va)); +# endif +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* ZLIB_H */ diff --git a/frontend/cspace.c b/frontend/cspace.c index 33a981d..55d4ac6 100644 --- a/frontend/cspace.c +++ b/frontend/cspace.c @@ -34,24 +34,46 @@ void bgr555_to_rgb565(void *dst_, const void *src_, int bytes) #endif +#ifdef __arm64__ + +void bgr888_to_rgb565(void *dst_, const void *src_, int bytes) +{ + const unsigned char *src = src_; + unsigned int *dst = dst_; + unsigned int r1, g1, b1, r2, g2, b2; + + for (; bytes >= 6; bytes -= 6, src += 6, dst++) { + r1 = src[0] & 0xf8; + g1 = src[1] & 0xfc; + b1 = src[2] & 0xf8; + r2 = src[3] & 0xf8; + g2 = src[4] & 0xfc; + b2 = src[5] & 0xf8; + *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) | + (r1 << 8) | (g1 << 3) | (b1 >> 3); + } +} + +#endif + #ifndef __ARM_NEON__ void bgr888_to_rgb565(void *dst_, const void *src_, int bytes) { - const unsigned char *src = src_; - unsigned int *dst = dst_; - unsigned int r1, g1, b1, r2, g2, b2; - - for (; bytes >= 6; bytes -= 6, src += 6, dst++) { - r1 = src[0] & 0xf8; - g1 = src[1] & 0xfc; - b1 = src[2] & 0xf8; - r2 = src[3] & 0xf8; - g2 = src[4] & 0xfc; - b2 = src[5] & 0xf8; - *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) | - (r1 << 8) | (g1 << 3) | (b1 >> 3); - } + const unsigned char *src = src_; + unsigned int *dst = dst_; + unsigned int r1, g1, b1, r2, g2, b2; + + for (; bytes >= 6; bytes -= 6, src += 6, dst++) { + r1 = src[0] & 0xf8; + g1 = src[1] & 0xfc; + b1 = src[2] & 0xf8; + r2 = src[3] & 0xf8; + g2 = src[4] & 0xfc; + b2 = src[5] & 0xf8; + *dst = (r2 << 24) | (g2 << 19) | (b2 << 13) | + (r1 << 8) | (g1 << 3) | (b1 >> 3); + } } // TODO? diff --git a/frontend/libpicofe b/frontend/libpicofe deleted file mode 160000 -Subproject 21604a047941b8fe81d381ede0371c75da964af diff --git a/frontend/libretro.c b/frontend/libretro.c index 940ff05..7fa63cb 100644 --- a/frontend/libretro.c +++ b/frontend/libretro.c @@ -33,36 +33,94 @@ #include "revision.h" #include "libretro.h" +#ifdef _3DS +#include "3ds/3ds_utils.h" +#endif + +#define PORTS_NUMBER 8 + +#ifndef MIN +#define MIN(a, b) ((a) < (b) ? (a) : (b)) +#endif + +#ifndef MAX +#define MAX(a, b) ((a) > (b) ? (a) : (b)) +#endif + +#define ISHEXDEC ((buf[cursor]>='0') && (buf[cursor]<='9')) || ((buf[cursor]>='a') && (buf[cursor]<='f')) || ((buf[cursor]>='A') && (buf[cursor]<='F')) + +//hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key +static int rebootemu = 0; + static retro_video_refresh_t video_cb; static retro_input_poll_t input_poll_cb; static retro_input_state_t input_state_cb; static retro_environment_t environ_cb; static retro_audio_sample_batch_t audio_batch_cb; static struct retro_rumble_interface rumble; +static struct retro_log_callback logging; +static retro_log_printf_t log_cb; static void *vout_buf; +static void * vout_buf_ptr; static int vout_width, vout_height; static int vout_doffs_old, vout_fb_dirty; static bool vout_can_dupe; static bool duping_enable; +static bool found_bios; static int plugins_opened; static int is_pal_mode; /* memory card data */ extern char Mcd1Data[MCD_SIZE]; +extern char Mcd2Data[MCD_SIZE]; extern char McdDisable[2]; /* PCSX ReARMed core calls and stuff */ -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; -int in_keystate; +int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE }; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +unsigned short in_keystate[PORTS_NUMBER]; +int multitap1 = 0; +int multitap2 = 0; int in_enable_vibration = 1; +// NegCon adjustment parameters +// > The NegCon 'twist' action is somewhat awkward when mapped +// to a standard analog stick -> user should be able to tweak +// response/deadzone for comfort +// > When response is linear, 'additional' deadzone (set here) +// may be left at zero, since this is normally handled via in-game +// options menus +// > When response is non-linear, deadzone should be set to match the +// controller being used (otherwise precision may be lost) +// > negcon_linearity: +// - 1: Response is linear - recommended when using racing wheel +// peripherals, not recommended for standard gamepads +// - 2: Response is quadratic - optimal setting for gamepads +// - 3: Response is cubic - enables precise fine control, but +// difficult to use... +#define NEGCON_RANGE 0x7FFF +static int negcon_deadzone = 0; +static int negcon_linearity = 1; + /* PSX max resolution is 640x512, but with enhancement it's 1024x512 */ #define VOUT_MAX_WIDTH 1024 #define VOUT_MAX_HEIGHT 512 +//Dummy functions +bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info){return false;} +void retro_unload_game(void){} +static int vout_open(void){return 0;} +static void vout_close(void){} +static int snd_init(void){return 0;} +static void snd_finish(void){} +static int snd_busy(void){return 0;} + static void init_memcard(char *mcd_data) { unsigned off = 0; @@ -96,15 +154,26 @@ static void init_memcard(char *mcd_data) } } -static int vout_open(void) +static void set_vout_fb() { - return 0; + struct retro_framebuffer fb = {0}; + + fb.width = vout_width; + fb.height = vout_height; + fb.access_flags = RETRO_MEMORY_ACCESS_WRITE; + + if (environ_cb(RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER, &fb) && fb.format == RETRO_PIXEL_FORMAT_RGB565) + vout_buf_ptr = (uint16_t*)fb.data; + else + vout_buf_ptr = vout_buf; } static void vout_set_mode(int w, int h, int raw_w, int raw_h, int bpp) { - vout_width = w; - vout_height = h; + vout_width = w; + vout_height = h; + + set_vout_fb(); } #ifndef FRONTEND_SUPPORTS_RGB565 @@ -121,14 +190,14 @@ static void convert(void *buf, size_t bytes) static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) { - unsigned short *dest = vout_buf; + unsigned short *dest = vout_buf_ptr; const unsigned short *src = vram; int dstride = vout_width, h1 = h; int doffs; if (vram == NULL) { // blanking - memset(vout_buf, 0, dstride * h * 2); + memset(vout_buf_ptr, 0, dstride * h * 2); goto out; } @@ -136,7 +205,7 @@ static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) doffs += (dstride - w) / 2 & ~1; if (doffs != vout_doffs_old) { // clear borders - memset(vout_buf, 0, dstride * h * 2); + memset(vout_buf_ptr, 0, dstride * h * 2); vout_doffs_old = doffs; } dest += doffs; @@ -159,16 +228,173 @@ static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) out: #ifndef FRONTEND_SUPPORTS_RGB565 - convert(vout_buf, vout_width * vout_height * 2); + convert(vout_buf_ptr, vout_width * vout_height * 2); #endif vout_fb_dirty = 1; pl_rearmed_cbs.flip_cnt++; } -static void vout_close(void) +#ifdef _3DS +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +psx_map_t custom_psx_maps[] = { + {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) { + (void)is_fixed; + (void)addr; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + uint32_t ptr_aligned, tmp; + + custom_map->buffer = malloc(size + 0x1000); + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0) + { + SysPrintf("could not map memory @0x%08X\n", custom_map->target_map); + exit(1); + } + + return (void*)custom_map->target_map; + } + } + } + + return malloc(size); } +void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag) +{ + (void)tag; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->target_map == (uint32_t)ptr)) + { + uint32_t ptr_aligned, tmp; + + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3); + + free(custom_map->buffer); + custom_map->buffer = NULL; + return; + } + } + } + + free(ptr); +} +#endif + +#ifdef VITA +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +void* addr = NULL; + +psx_map_t custom_psx_maps[] = { + {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +int init_vita_mmap(){ + int n; + void * tmpaddr; + addr = malloc(64*1024*1024); + if(addr==NULL) + return -1; + tmpaddr = ((u32)(addr+0xFFFFFF))&~0xFFFFFF; + custom_psx_maps[0].buffer=tmpaddr+0x2000000; + custom_psx_maps[1].buffer=tmpaddr+0x1800000; + custom_psx_maps[2].buffer=tmpaddr+0x1c00000; + custom_psx_maps[3].buffer=tmpaddr+0x0000000; + custom_psx_maps[4].buffer=tmpaddr+0x1000000; +#if 0 + for(n = 0; n < 5; n++){ + sceClibPrintf("addr reserved %x\n",custom_psx_maps[n].buffer); + } +#endif + return 0; +} + +void deinit_vita_mmap(){ + free(addr); +} + +void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) +{ + (void)is_fixed; + (void)addr; + + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + return custom_map->buffer; + } + } + + + return malloc(size); +} + +void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag) +{ + (void)tag; + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->buffer == ptr)) + { + return; + } + } + + free(ptr); +} +#endif + static void *pl_mmap(unsigned int size) { return psxMap(0, size, 0, MAP_TAG_VRAM); @@ -204,8 +430,11 @@ void pl_timing_prepare(int is_pal) void plat_trigger_vibrate(int pad, int low, int high) { - rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8); - rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0); + if(in_enable_vibration) + { + rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8); + rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0); + } } void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in) @@ -213,20 +442,6 @@ void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in) } /* sound calls */ -static int snd_init(void) -{ - return 0; -} - -static void snd_finish(void) -{ -} - -static int snd_busy(void) -{ - return 0; -} - static void snd_feed(void *buf, int bytes) { if (audio_batch_cb != NULL) @@ -247,9 +462,22 @@ void retro_set_environment(retro_environment_t cb) { static const struct retro_variable vars[] = { { "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" }, - { "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" }, - { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" }, - { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" }, + { "pcsx_rearmed_region", "Region; auto|NTSC|PAL" }, + { "pcsx_rearmed_memcard2", "Enable second memory card; disabled|enabled" }, + { "pcsx_rearmed_pad1type", "Pad 1 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad2type", "Pad 2 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad3type", "Pad 3 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad4type", "Pad 4 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad5type", "Pad 5 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad6type", "Pad 6 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad7type", "Pad 7 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_pad8type", "Pad 8 Type; default|none|standard|analog|dualshock|negcon" }, + { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" }, + { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" }, + { "pcsx_rearmed_negcon_deadzone", "NegCon Twist Deadzone (percent); 0|5|10|15|20|25|30" }, + { "pcsx_rearmed_negcon_response", "NegCon Twist Response; linear|quadratic|cubic" }, + { "pcsx_rearmed_vibration", "Enable Vibration; enabled|disabled" }, + { "pcsx_rearmed_dithering", "Enable Dithering; enabled|disabled" }, #ifndef DRC_DISABLE { "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" }, #endif @@ -258,12 +486,18 @@ void retro_set_environment(retro_environment_t cb) { "pcsx_rearmed_neon_enhancement_enable", "Enhanced resolution (slow); disabled|enabled" }, { "pcsx_rearmed_neon_enhancement_no_main", "Enhanced resolution speed hack; disabled|enabled" }, #endif - { "pcsx_rearmed_duping_enable", "Frame duping; on|off" }, - { "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" }, + { "pcsx_rearmed_duping_enable", "Frame duping; enabled|disabled" }, + { "pcsx_rearmed_show_bios_bootlogo", "Show Bios Bootlogo(Breaks some games); disabled|enabled" }, + { "pcsx_rearmed_spu_reverb", "Sound: Reverb; enabled|disabled" }, { "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" }, + { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" }, + { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" }, { NULL, NULL }, }; + if (cb(RETRO_ENVIRONMENT_GET_LOG_INTERFACE, &logging)) + log_cb = logging.log; + environ_cb = cb; cb(RETRO_ENVIRONMENT_SET_VARIABLES, (void*)vars); @@ -280,15 +514,172 @@ unsigned retro_api_version(void) return RETRO_API_VERSION; } +static int controller_port_variable(unsigned port, struct retro_variable *var) +{ + if (port >= PORTS_NUMBER) + return 0; + + if (!environ_cb) + return 0; + + var->value = NULL; + switch (port) { + case 0: + var->key = "pcsx_rearmed_pad1type"; + break; + case 1: + var->key = "pcsx_rearmed_pad2type"; + break; + case 2: + var->key = "pcsx_rearmed_pad3type"; + break; + case 3: + var->key = "pcsx_rearmed_pad4type"; + break; + case 4: + var->key = "pcsx_rearmed_pad5type"; + break; + case 5: + var->key = "pcsx_rearmed_pad6type"; + break; + case 6: + var->key = "pcsx_rearmed_pad7type"; + break; + case 7: + var->key = "pcsx_rearmed_pad8type"; + break; + } + + return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value; +} + +static void update_controller_port_variable(unsigned port) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (controller_port_variable(port, &var)) + { + if (strcmp(var.value, "standard") == 0) + in_type[port] = PSE_PAD_TYPE_STANDARD; + else if (strcmp(var.value, "analog") == 0) + in_type[port] = PSE_PAD_TYPE_ANALOGJOY; + else if (strcmp(var.value, "dualshock") == 0) + in_type[port] = PSE_PAD_TYPE_ANALOGPAD; + else if (strcmp(var.value, "negcon") == 0) + in_type[port] = PSE_PAD_TYPE_NEGCON; + else if (strcmp(var.value, "none") == 0) + in_type[port] = PSE_PAD_TYPE_NONE; + // else 'default' case, do nothing + } +} + +static void update_controller_port_device(unsigned port, unsigned device) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (!controller_port_variable(port, &var)) + return; + + if (strcmp(var.value, "default") != 0) + return; + + switch (device) + { + case RETRO_DEVICE_JOYPAD: + in_type[port] = PSE_PAD_TYPE_STANDARD; + break; + case RETRO_DEVICE_ANALOG: + in_type[port] = PSE_PAD_TYPE_ANALOGPAD; + break; + case RETRO_DEVICE_MOUSE: + in_type[port] = PSE_PAD_TYPE_MOUSE; + break; + case RETRO_DEVICE_LIGHTGUN: + in_type[port] = PSE_PAD_TYPE_GUN; + break; + case RETRO_DEVICE_NONE: + default: + in_type[port] = PSE_PAD_TYPE_NONE; + } +} + +static void update_multitap() +{ + struct retro_variable var; + int auto_case, port; + + var.value = NULL; + var.key = "pcsx_rearmed_multitap1"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap1 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap1 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 2, we need a first multitap. + multitap1 = 0; + for (port = 2; port < PORTS_NUMBER; port++) + multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE; + } + + var.value = NULL; + var.key = "pcsx_rearmed_multitap2"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap2 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap2 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 4, we need a second multitap. + multitap2 = 0; + for (port = 4; port < PORTS_NUMBER; port++) + multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE; + } +} + void retro_set_controller_port_device(unsigned port, unsigned device) { + SysPrintf("port %u device %u",port,device); + + if (port >= PORTS_NUMBER) + return; + + update_controller_port_device(port, device); + update_multitap(); } void retro_get_system_info(struct retro_system_info *info) { memset(info, 0, sizeof(*info)); info->library_name = "PCSX-ReARMed"; - info->library_version = "r22"; +#ifndef GIT_VERSION +#define GIT_VERSION "" +#endif + info->library_version = "r22" GIT_VERSION; info->valid_extensions = "bin|cue|img|mdf|pbp|toc|cbn|m3u"; info->need_fullpath = true; } @@ -306,8 +697,8 @@ void retro_get_system_av_info(struct retro_system_av_info *info) } /* savestates */ -size_t retro_serialize_size(void) -{ +size_t retro_serialize_size(void) +{ // it's currently 4380651-4397047 bytes, // but have some reserved for future return 0x440000; @@ -393,7 +784,7 @@ static void save_close(void *file) } bool retro_serialize(void *data, size_t size) -{ +{ int ret = SaveState(data); return ret == 0 ? true : false; } @@ -418,6 +809,21 @@ void retro_cheat_set(unsigned index, bool enabled, const char *code) // cheat funcs are destructive, need a copy.. strncpy(buf, code, sizeof(buf)); buf[sizeof(buf) - 1] = 0; + + //Prepare buffered cheat for PCSX's AddCheat fucntion. + int cursor=0; + int nonhexdec=0; + while (buf[cursor]){ + if (!(ISHEXDEC)){ + if (++nonhexdec%2){ + buf[cursor]=' '; + } else { + buf[cursor]='\n'; + } + } + cursor++; + } + if (index < NumCheats) ret = EditCheat(index, "", buf); @@ -557,6 +963,10 @@ static struct retro_disk_control_callback disk_control = { #define SLASH '/' #endif +#ifndef PATH_MAX +#define PATH_MAX 4096 +#endif + static char base_dir[PATH_MAX]; static bool read_m3u(const char *file) @@ -761,7 +1171,7 @@ bool retro_load_game(const struct retro_game_info *info) { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -782,7 +1192,7 @@ bool retro_load_game(const struct retro_game_info *info) { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -803,7 +1213,7 @@ bool retro_load_game(const struct retro_game_info *info) { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -844,7 +1254,7 @@ bool retro_load_game(const struct retro_game_info *info) if (is_m3u) { if (!read_m3u(info->path)) { - SysPrintf("failed to read m3u file\n"); + log_cb(RETRO_LOG_INFO, "failed to read m3u file\n"); return false; } } else { @@ -856,7 +1266,7 @@ bool retro_load_game(const struct retro_game_info *info) /* have to reload after set_cd_image for correct cdr plugin */ if (LoadPlugins() == -1) { - SysPrintf("failed to load plugins\n"); + log_cb(RETRO_LOG_INFO, "failed to load plugins\n"); return false; } @@ -864,23 +1274,22 @@ bool retro_load_game(const struct retro_game_info *info) NetOpened = 0; if (OpenPlugins() == -1) { - SysPrintf("failed to open plugins\n"); + log_cb(RETRO_LOG_INFO, "failed to open plugins\n"); return false; } plugin_call_rearmed_cbs(); dfinput_activate(); - Config.PsxAuto = 1; if (CheckCdrom() == -1) { - SysPrintf("unsupported/invalid CD image: %s\n", info->path); + log_cb(RETRO_LOG_INFO, "unsupported/invalid CD image: %s\n", info->path); return false; } SysReset(); if (LoadCdrom() == -1) { - SysPrintf("could not load CD-ROM!\n"); + log_cb(RETRO_LOG_INFO, "could not load CD\n"); return false; } emu_on_new_cd(0); @@ -897,15 +1306,6 @@ bool retro_load_game(const struct retro_game_info *info) return true; } -bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info) -{ - return false; -} - -void retro_unload_game(void) -{ -} - unsigned retro_get_region(void) { return is_pal_mode ? RETRO_REGION_PAL : RETRO_REGION_NTSC; @@ -929,7 +1329,9 @@ size_t retro_get_memory_size(unsigned id) void retro_reset(void) { - SysReset(); + //hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key + rebootemu = 1; + //SysReset(); } static const unsigned short retro_psx_map[] = { @@ -955,20 +1357,19 @@ static const unsigned short retro_psx_map[] = { static void update_variables(bool in_flight) { struct retro_variable var; - + int i; + var.value = NULL; var.key = "pcsx_rearmed_frameskip"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) pl_rearmed_cbs.frameskip = atoi(var.value); var.value = NULL; var.key = "pcsx_rearmed_region"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { Config.PsxAuto = 0; - if (strcmp(var.value, "Automatic") == 0) + if (strcmp(var.value, "auto") == 0) Config.PsxAuto = 1; else if (strcmp(var.value, "NTSC") == 0) Config.PsxType = 0; @@ -976,24 +1377,61 @@ static void update_variables(bool in_flight) Config.PsxType = 1; } + for (i = 0; i < PORTS_NUMBER; i++) + update_controller_port_variable(i); + + update_multitap(); + + var.value = NULL; + var.key = "pcsx_rearmed_negcon_deadzone"; + negcon_deadzone = 0; + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + negcon_deadzone = (int)(atoi(var.value) * 0.01f * NEGCON_RANGE); + } + + var.value = NULL; + var.key = "pcsx_rearmed_negcon_response"; + negcon_linearity = 1; + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "quadratic") == 0){ + negcon_linearity = 2; + } else if (strcmp(var.value, "cubic") == 0){ + negcon_linearity = 3; + } + } + var.value = NULL; - var.key = "pcsx_rearmed_pad1type"; + var.key = "pcsx_rearmed_vibration"; if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - in_type1 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type1 = PSE_PAD_TYPE_ANALOGPAD; + if (strcmp(var.value, "disabled") == 0) + in_enable_vibration = 0; + else if (strcmp(var.value, "enabled") == 0) + in_enable_vibration = 1; } var.value = NULL; - var.key = "pcsx_rearmed_pad2type"; + var.key = "pcsx_rearmed_dithering"; if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - in_type2 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type2 = PSE_PAD_TYPE_ANALOGPAD; + if (strcmp(var.value, "disabled") == 0) { + pl_rearmed_cbs.gpu_peops.iUseDither = 0; + pl_rearmed_cbs.gpu_peopsgl.bDrawDither = 0; +#ifdef __ARM_NEON__ + pl_rearmed_cbs.gpu_neon.allow_dithering = 0; +#endif + } + else if (strcmp(var.value, "enabled") == 0) { + pl_rearmed_cbs.gpu_peops.iUseDither = 1; + pl_rearmed_cbs.gpu_peopsgl.bDrawDither = 1; +#ifdef __ARM_NEON__ + pl_rearmed_cbs.gpu_neon.allow_dithering = 1; +#endif + } } #ifdef __ARM_NEON__ @@ -1036,9 +1474,9 @@ static void update_variables(bool in_flight) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - if (strcmp(var.value, "off") == 0) + if (strcmp(var.value, "disabled") == 0) duping_enable = false; - else if (strcmp(var.value, "on") == 0) + else if (strcmp(var.value, "enabled") == 0) duping_enable = true; } @@ -1050,6 +1488,11 @@ static void update_variables(bool in_flight) { R3000Acpu *prev_cpu = psxCpu; +#ifdef _3DS + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; + else +#endif if (strcmp(var.value, "disabled") == 0) Config.Cpu = CPU_INTERPRETER; else if (strcmp(var.value, "enabled") == 0) @@ -1069,9 +1512,9 @@ static void update_variables(bool in_flight) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - if (strcmp(var.value, "off") == 0) + if (strcmp(var.value, "disabled") == 0) spu_config.iUseReverb = false; - else if (strcmp(var.value, "on") == 0) + else if (strcmp(var.value, "enabled") == 0) spu_config.iUseReverb = true; } @@ -1090,6 +1533,28 @@ static void update_variables(bool in_flight) spu_config.iUseInterpolation = 0; } + var.value = "NULL"; + var.key = "pcsx_rearmed_pe2_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.RCntFix = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.RCntFix = 1; + } + + var.value = "NULL"; + var.key = "pcsx_rearmed_inuyasha_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.VSyncWA = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.VSyncWA = 1; + } + if (in_flight) { // inform core things about possible config changes plugin_call_rearmed_cbs(); @@ -1101,11 +1566,62 @@ static void update_variables(bool in_flight) dfinput_activate(); } + else{ + //not yet running + + //bootlogo display hack + if (found_bios) { + var.value = "NULL"; + var.key = "pcsx_rearmed_show_bios_bootlogo"; + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "enabled") == 0) + rebootemu = 1; + } + } + } } -void retro_run(void) +// Taken from beetle-psx-libretro +static uint16_t get_analog_button(retro_input_state_t input_state_cb, int player_index, int id) { - int i; + uint16_t button; + + // NOTE: Analog buttons were added Nov 2017. Not all front-ends support this + // feature (or pre-date it) so we need to handle this in a graceful way. + + // First, try and get an analog value using the new libretro API constant + button = input_state_cb(player_index, + RETRO_DEVICE_ANALOG, + RETRO_DEVICE_INDEX_ANALOG_BUTTON, + id); + button = MIN(button / 128, 255); + + if (button == 0) + { + // If we got exactly zero, we're either not pressing the button, or the front-end + // is not reporting analog values. We need to do a second check using the classic + // digital API method, to at least get some response - better than nothing. + + // NOTE: If we're really just not holding the button, we're still going to get zero. + + button = input_state_cb(player_index, + RETRO_DEVICE_JOYPAD, + 0, + id) ? 255 : 0; + } + + return button; +} + +void retro_run(void) +{ + int i; + //SysReset must be run while core is running,Not in menu (Locks up Retroarch) + if(rebootemu != 0){ + rebootemu = 0; + SysReset(); + } input_poll_cb(); @@ -1113,29 +1629,161 @@ void retro_run(void) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated) update_variables(true); - in_keystate = 0; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; - in_keystate <<= 16; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; + // reset all keystate, query libretro for keystate + int j; + int lsx; + int rsy; + float negcon_twist_amplitude; + int negcon_i_rs; + int negcon_ii_rs; + for(i = 0; i < PORTS_NUMBER; i++) { + in_keystate[i] = 0; + + if (in_type[i] == PSE_PAD_TYPE_NONE) + continue; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) - { - in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; - in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; + if (in_type[i] == PSE_PAD_TYPE_NEGCON) + { + // Query digital inputs + // + // > Pad-Up + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_UP)){ + in_keystate[i] |= (1 << DKEY_UP); + } + // > Pad-Right + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_RIGHT)){ + in_keystate[i] |= (1 << DKEY_RIGHT); + } + // > Pad-Down + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_DOWN)){ + in_keystate[i] |= (1 << DKEY_DOWN); + } + // > Pad-Left + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_LEFT)){ + in_keystate[i] |= (1 << DKEY_LEFT); + } + // > Start + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START)){ + in_keystate[i] |= (1 << DKEY_START); + } + // > neGcon A + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_A)){ + in_keystate[i] |= (1 << DKEY_CIRCLE); + } + // > neGcon B + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_X)){ + in_keystate[i] |= (1 << DKEY_TRIANGLE); + } + // > neGcon R shoulder (digital) + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R)){ + in_keystate[i] |= (1 << DKEY_R1); + } + // Query analog inputs + // + // From studying 'libpcsxcore/plugins.c' and 'frontend/plugin.c': + // >> pad->leftJoyX == in_analog_left[i][0] == NeGcon II + // >> pad->leftJoyY == in_analog_left[i][1] == NeGcon L + // >> pad->rightJoyX == in_analog_right[i][0] == NeGcon twist + // >> pad->rightJoyY == in_analog_right[i][1] == NeGcon I + // So we just have to map in_analog_left/right to more + // appropriate inputs... + // + // > NeGcon twist + // >> Get raw analog stick value and account for deadzone + lsx = input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X); + if (lsx > negcon_deadzone){ + lsx = lsx - negcon_deadzone; + } else if (lsx < -negcon_deadzone){ + lsx = lsx + negcon_deadzone; + } else { + lsx = 0; + } + // >> Convert to an 'amplitude' [-1.0,1.0] and adjust response + negcon_twist_amplitude = (float)lsx / (float)(NEGCON_RANGE - negcon_deadzone); + if (negcon_linearity == 2){ + if (negcon_twist_amplitude < 0.0){ + negcon_twist_amplitude = -(negcon_twist_amplitude * negcon_twist_amplitude); + } else { + negcon_twist_amplitude = negcon_twist_amplitude * negcon_twist_amplitude; + } + } else if (negcon_linearity == 3){ + negcon_twist_amplitude = negcon_twist_amplitude * negcon_twist_amplitude * negcon_twist_amplitude; + } + // >> Convert to final 'in_analog' integer value [0,255] + in_analog_right[i][0] = MAX(MIN((int)(negcon_twist_amplitude * 128.0f) + 128, 255), 0); + // > NeGcon I + II + // >> Handle right analog stick vertical axis mapping... + // - Up (-Y) == accelerate == neGcon I + // - Down (+Y) == brake == neGcon II + negcon_i_rs = 0; + negcon_ii_rs = 0; + rsy = input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y); + if (rsy >= 0){ + // Account for deadzone + // (Note: have never encountered a gamepad with significant differences + // in deadzone between left/right analog sticks, so use the regular 'twist' + // deadzone here) + if (rsy > negcon_deadzone){ + rsy = rsy - negcon_deadzone; + } else { + rsy = 0; + } + // Convert to 'in_analog' integer value [0,255] + negcon_ii_rs = MIN((int)(((float)rsy / (float)(NEGCON_RANGE - negcon_deadzone)) * 255.0f), 255); + } else { + if (rsy < -negcon_deadzone){ + rsy = -1 * (rsy + negcon_deadzone); + } else { + rsy = 0; + } + negcon_i_rs = MIN((int)(((float)rsy / (float)(NEGCON_RANGE - negcon_deadzone)) * 255.0f), 255); + } + // >> NeGcon I + in_analog_right[i][1] = MAX( + MAX( + get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_R2), + get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_B) + ), + negcon_i_rs + ); + // >> NeGcon II + in_analog_left[i][0] = MAX( + MAX( + get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_L2), + get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_Y) + ), + negcon_ii_rs + ); + // > NeGcon L + in_analog_left[i][1] = get_analog_button(input_state_cb, i, RETRO_DEVICE_ID_JOYPAD_L); + } + else + { + // Query digital inputs + for (j = 0; j < RETRO_PSX_MAP_LEN; j++){ + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j)){ + in_keystate[i] |= retro_psx_map[j]; + } + } + // Query analog inputs + if (in_type[i] == PSE_PAD_TYPE_ANALOGJOY || in_type[i] == PSE_PAD_TYPE_ANALOGPAD) + { + in_analog_left[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255); + in_analog_left[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255); + in_analog_right[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255); + in_analog_right[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255); + } + } } stop = 0; psxCpu->Execute(); - video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf : NULL, + video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf_ptr : NULL, vout_width, vout_height, vout_width * 2); vout_fb_dirty = 0; + + set_vout_fb(); } static bool try_use_bios(const char *path) @@ -1162,7 +1810,7 @@ static bool try_use_bios(const char *path) return true; } -#if 1 +#ifndef VITA #include <sys/types.h> #include <dirent.h> @@ -1180,7 +1828,7 @@ static bool find_any_bios(const char *dirpath, char *path, size_t path_size) if (strncasecmp(ent->d_name, "scph", 4) != 0) continue; - snprintf(path, path_size, "%s/%s", dirpath, ent->d_name); + snprintf(path, path_size, "%s%c%s", dirpath, SLASH, ent->d_name); ret = try_use_bios(path); if (ret) break; @@ -1198,38 +1846,98 @@ static void check_system_specs(void) environ_cb(RETRO_ENVIRONMENT_SET_PERFORMANCE_LEVEL, &level); } +static int init_memcards(void) +{ + int ret = 0; + const char *dir; + struct retro_variable var = { .key="pcsx_rearmed_memcard2", .value=NULL }; + static const char CARD2_FILE[] = "pcsx-card2.mcd"; + + McdDisable[0] = 0; + // Disable memcard 2 by default + McdDisable[1] = 1; + init_memcard(Mcd1Data); + // Memcard 2 is managed by the emulator on the filesystem, + // There is no need to initialize Mcd2Data like Mcd1Data. + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) && var.value) { + SysPrintf("Memcard 2: %s\n", var.value); + if (memcmp(var.value, "enabled", 7) == 0) { + if (environ_cb(RETRO_ENVIRONMENT_GET_SAVE_DIRECTORY, &dir) && dir) { + if (strlen(dir) + strlen(CARD2_FILE) + 2 > sizeof(Config.Mcd2)) { + SysPrintf("Path '%s' is too long. Cannot use memcard 2. Use a shorter path.\n", dir); + ret = -1; + } else { + McdDisable[1] = 0; + snprintf(Config.Mcd2, sizeof(Config.Mcd2), "%s/%s", dir, CARD2_FILE); + SysPrintf("Use memcard 2: %s\n", Config.Mcd2); + } + } else { + SysPrintf("Could not get save directory! Could not create memcard 2."); + ret = -1; + } + } + } + return ret; +} + void retro_init(void) { - const char *bios[] = { "scph1001", "scph5501", "scph7001" }; + const char *bios[] = { + "SCPH101", "SCPH7001", "SCPH5501", "SCPH1001", + "scph101", "scph7001", "scph5501", "scph1001" + }; const char *dir; char path[256]; int i, ret; - bool found_bios = false; + + found_bios = false; #ifdef __MACH__ // magic sauce to make the dynarec work on iOS syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0); #endif +#ifdef _3DS + psxMapHook = pl_3ds_mmap; + psxUnmapHook = pl_3ds_munmap; +#endif +#ifdef VITA + if(init_vita_mmap()<0) + abort(); + psxMapHook = pl_vita_mmap; + psxUnmapHook = pl_vita_munmap; +#endif ret = emu_core_preinit(); +#ifdef _3DS + /* emu_core_preinit sets the cpu to dynarec */ + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; +#endif + ret |= init_memcards(); + ret |= emu_core_init(); if (ret != 0) { SysPrintf("PCSX init failed.\n"); exit(1); } -#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) +#ifdef _3DS + vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80); +#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA) posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); #else vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); #endif - + + vout_buf_ptr = vout_buf; + if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir) { - snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir); + snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir); for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) { - snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]); + snprintf(path, sizeof(path), "%s%c%s.bin", dir, SLASH, bios[i]); found_bios = try_use_bios(path); if (found_bios) break; @@ -1244,9 +1952,9 @@ void retro_init(void) else { SysPrintf("no BIOS files found.\n"); - struct retro_message msg = + struct retro_message msg = { - "no BIOS found, expect bugs!", + "No PlayStation BIOS file found - add for better compatibility", 180 }; environ_cb(RETRO_ENVIRONMENT_SET_MESSAGE, (void*)&msg); @@ -1266,10 +1974,6 @@ void retro_init(void) pl_rearmed_cbs.gpu_peops.iUseDither = 1; spu_config.iUseFixedUpdates = 1; - McdDisable[0] = 0; - McdDisable[1] = 1; - init_memcard(Mcd1Data); - SaveFuncs.open = save_open; SaveFuncs.read = save_read; SaveFuncs.write = save_write; @@ -1283,6 +1987,22 @@ void retro_init(void) void retro_deinit(void) { SysClose(); +#ifdef _3DS + linearFree(vout_buf); +#else free(vout_buf); +#endif vout_buf = NULL; + +#ifdef VITA + deinit_vita_mmap(); +#endif } + +#ifdef VITA +#include <psp2/kernel/threadmgr.h> +int usleep (unsigned long us) +{ + sceKernelDelayThread(us); +} +#endif diff --git a/frontend/libretro.h b/frontend/libretro.h index 16c274a..8456415 100755 --- a/frontend/libretro.h +++ b/frontend/libretro.h @@ -1,4 +1,4 @@ -/* Copyright (C) 2010-2014 The RetroArch team +/* Copyright (C) 2010-2016 The RetroArch team * * --------------------------------------------------------------------------------------- * The following license statement only applies to this libretro API header (libretro.h). @@ -43,6 +43,40 @@ extern "C" { #endif #endif +#ifndef RETRO_CALLCONV +# if defined(__GNUC__) && defined(__i386__) && !defined(__x86_64__) +# define RETRO_CALLCONV __attribute__((cdecl)) +# elif defined(_MSC_VER) && defined(_M_X86) && !defined(_M_X64) +# define RETRO_CALLCONV __cdecl +# else +# define RETRO_CALLCONV /* all other platforms only have one calling convention each */ +# endif +#endif + +#ifndef RETRO_API +# if defined(_WIN32) || defined(__CYGWIN__) || defined(__MINGW32__) +# ifdef RETRO_IMPORT_SYMBOLS +# ifdef __GNUC__ +# define RETRO_API RETRO_CALLCONV __attribute__((__dllimport__)) +# else +# define RETRO_API RETRO_CALLCONV __declspec(dllimport) +# endif +# else +# ifdef __GNUC__ +# define RETRO_API RETRO_CALLCONV __attribute__((__dllexport__)) +# else +# define RETRO_API RETRO_CALLCONV __declspec(dllexport) +# endif +# endif +# else +# if defined(__GNUC__) && __GNUC__ >= 4 && !defined(__CELLOS_LV2__) +# define RETRO_API RETRO_CALLCONV __attribute__((__visibility__("default"))) +# else +# define RETRO_API RETRO_CALLCONV +# endif +# endif +#endif + /* Used for checking API/ABI mismatches that can break libretro * implementations. * It is not incremented for compatible changes to the API. @@ -161,17 +195,20 @@ extern "C" { /* Index / Id values for ANALOG device. */ #define RETRO_DEVICE_INDEX_ANALOG_LEFT 0 #define RETRO_DEVICE_INDEX_ANALOG_RIGHT 1 +#define RETRO_DEVICE_INDEX_ANALOG_BUTTON 2 #define RETRO_DEVICE_ID_ANALOG_X 0 #define RETRO_DEVICE_ID_ANALOG_Y 1 /* Id values for MOUSE. */ -#define RETRO_DEVICE_ID_MOUSE_X 0 -#define RETRO_DEVICE_ID_MOUSE_Y 1 -#define RETRO_DEVICE_ID_MOUSE_LEFT 2 -#define RETRO_DEVICE_ID_MOUSE_RIGHT 3 -#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4 -#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5 -#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6 +#define RETRO_DEVICE_ID_MOUSE_X 0 +#define RETRO_DEVICE_ID_MOUSE_Y 1 +#define RETRO_DEVICE_ID_MOUSE_LEFT 2 +#define RETRO_DEVICE_ID_MOUSE_RIGHT 3 +#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4 +#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5 +#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6 +#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELUP 7 +#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELDOWN 8 /* Id values for LIGHTGUN types. */ #define RETRO_DEVICE_ID_LIGHTGUN_X 0 @@ -206,6 +243,8 @@ enum retro_language RETRO_LANGUAGE_KOREAN = 9, RETRO_LANGUAGE_CHINESE_TRADITIONAL = 10, RETRO_LANGUAGE_CHINESE_SIMPLIFIED = 11, + RETRO_LANGUAGE_ESPERANTO = 12, + RETRO_LANGUAGE_POLISH = 13, RETRO_LANGUAGE_LAST, /* Ensure sizeof(enum) == sizeof(int) */ @@ -693,9 +732,10 @@ enum retro_mod * location-based information from the host device, * such as current latitude / longitude. */ -#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 +#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 /* Old name, kept for compatibility. */ +#define RETRO_ENVIRONMENT_GET_CORE_ASSETS_DIRECTORY 30 /* const char ** -- - * Returns the "content" directory of the frontend. + * Returns the "core assets" directory of the frontend. * This directory can be used to store specific assets that the * core relies upon, such as art assets, * input data, etc etc. @@ -851,6 +891,61 @@ enum retro_mod * Returns the specified language of the frontend, if specified by the user. * It can be used by the core for localization purposes. */ +#define RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER (40 | RETRO_ENVIRONMENT_EXPERIMENTAL) + /* struct retro_framebuffer * -- + * Returns a preallocated framebuffer which the core can use for rendering + * the frame into when not using SET_HW_RENDER. + * The framebuffer returned from this call must not be used + * after the current call to retro_run() returns. + * + * The goal of this call is to allow zero-copy behavior where a core + * can render directly into video memory, avoiding extra bandwidth cost by copying + * memory from core to video memory. + * + * If this call succeeds and the core renders into it, + * the framebuffer pointer and pitch can be passed to retro_video_refresh_t. + * If the buffer from GET_CURRENT_SOFTWARE_FRAMEBUFFER is to be used, + * the core must pass the exact + * same pointer as returned by GET_CURRENT_SOFTWARE_FRAMEBUFFER; + * i.e. passing a pointer which is offset from the + * buffer is undefined. The width, height and pitch parameters + * must also match exactly to the values obtained from GET_CURRENT_SOFTWARE_FRAMEBUFFER. + * + * It is possible for a frontend to return a different pixel format + * than the one used in SET_PIXEL_FORMAT. This can happen if the frontend + * needs to perform conversion. + * + * It is still valid for a core to render to a different buffer + * even if GET_CURRENT_SOFTWARE_FRAMEBUFFER succeeds. + * + * A frontend must make sure that the pointer obtained from this function is + * writeable (and readable). + */ + +enum retro_hw_render_interface_type +{ + RETRO_HW_RENDER_INTERFACE_VULKAN = 0, + RETRO_HW_RENDER_INTERFACE_DUMMY = INT_MAX +}; + +/* Base struct. All retro_hw_render_interface_* types + * contain at least these fields. */ +struct retro_hw_render_interface +{ + enum retro_hw_render_interface_type interface_type; + unsigned interface_version; +}; +#define RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE (41 | RETRO_ENVIRONMENT_EXPERIMENTAL) + /* const struct retro_hw_render_interface ** -- + * Returns an API specific rendering interface for accessing API specific data. + * Not all HW rendering APIs support or need this. + * The contents of the returned pointer is specific to the rendering API + * being used. See the various headers like libretro_vulkan.h, etc. + * + * GET_HW_RENDER_INTERFACE cannot be called before context_reset has been called. + * Similarly, after context_destroyed callback returns, + * the contents of the HW_RENDER_INTERFACE are invalidated. + */ #define RETRO_MEMDESC_CONST (1 << 0) /* The frontend will never change this memory area once retro_load_game has returned. */ #define RETRO_MEMDESC_BIGENDIAN (1 << 1) /* The memory area contains big endian data. Default is little endian. */ @@ -1125,6 +1220,10 @@ struct retro_log_callback #define RETRO_SIMD_VFPU (1 << 13) #define RETRO_SIMD_PS (1 << 14) #define RETRO_SIMD_AES (1 << 15) +#define RETRO_SIMD_VFPV3 (1 << 16) +#define RETRO_SIMD_VFPV4 (1 << 17) +#define RETRO_SIMD_POPCNT (1 << 18) +#define RETRO_SIMD_MOVBE (1 << 19) typedef uint64_t retro_perf_tick_t; typedef int64_t retro_time_t; @@ -1464,6 +1563,9 @@ enum retro_hw_context_type * use the corresponding enums directly. */ RETRO_HW_CONTEXT_OPENGLES_VERSION = 5, + /* Vulkan, see RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE. */ + RETRO_HW_CONTEXT_VULKAN = 6, + RETRO_HW_CONTEXT_DUMMY = INT_MAX }; @@ -1486,23 +1588,28 @@ struct retro_hw_render_callback */ retro_hw_context_reset_t context_reset; - /* Set by frontend. */ + /* Set by frontend. + * TODO: This is rather obsolete. The frontend should not + * be providing preallocated framebuffers. */ retro_hw_get_current_framebuffer_t get_current_framebuffer; /* Set by frontend. */ retro_hw_get_proc_address_t get_proc_address; - /* Set if render buffers should have depth component attached. */ + /* Set if render buffers should have depth component attached. + * TODO: Obsolete. */ bool depth; - /* Set if stencil buffers should be attached. */ + /* Set if stencil buffers should be attached. + * TODO: Obsolete. */ bool stencil; /* If depth and stencil are true, a packed 24/8 buffer will be added. * Only attaching stencil is invalid and will be ignored. */ /* Use conventional bottom-left origin convention. If false, - * standard libretro top-left origin semantics are used. */ + * standard libretro top-left origin semantics are used. + * TODO: Move to GL specific interface. */ bool bottom_left_origin; /* Major version number for core GL context or GLES 3.1+. */ @@ -1513,6 +1620,7 @@ struct retro_hw_render_callback /* If this is true, the frontend will go very far to avoid * resetting context in scenarios like toggling fullscreen, etc. + * TODO: Obsolete? Maybe frontend should just always assume this ... */ bool cache_context; @@ -1779,6 +1887,36 @@ struct retro_game_info const char *meta; /* String of implementation specific meta-data. */ }; +#define RETRO_MEMORY_ACCESS_WRITE (1 << 0) + /* The core will write to the buffer provided by retro_framebuffer::data. */ +#define RETRO_MEMORY_ACCESS_READ (1 << 1) + /* The core will read from retro_framebuffer::data. */ +#define RETRO_MEMORY_TYPE_CACHED (1 << 0) + /* The memory in data is cached. + * If not cached, random writes and/or reading from the buffer is expected to be very slow. */ +struct retro_framebuffer +{ + void *data; /* The framebuffer which the core can render into. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. + The initial contents of data are unspecified. */ + unsigned width; /* The framebuffer width used by the core. Set by core. */ + unsigned height; /* The framebuffer height used by the core. Set by core. */ + size_t pitch; /* The number of bytes between the beginning of a scanline, + and beginning of the next scanline. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ + enum retro_pixel_format format; /* The pixel format the core must use to render into data. + This format could differ from the format used in + SET_PIXEL_FORMAT. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ + + unsigned access_flags; /* How the core will access the memory in the framebuffer. + RETRO_MEMORY_ACCESS_* flags. + Set by core. */ + unsigned memory_flags; /* Flags telling core how the memory has been mapped. + RETRO_MEMORY_TYPE_* flags. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ +}; + /* Callbacks */ /* Environment callback. Gives implementations a way of performing @@ -1832,25 +1970,25 @@ typedef int16_t (*retro_input_state_t)(unsigned port, unsigned device, * * The rest of the set_* functions are guaranteed to have been called * before the first call to retro_run() is made. */ -void retro_set_environment(retro_environment_t); -void retro_set_video_refresh(retro_video_refresh_t); -void retro_set_audio_sample(retro_audio_sample_t); -void retro_set_audio_sample_batch(retro_audio_sample_batch_t); -void retro_set_input_poll(retro_input_poll_t); -void retro_set_input_state(retro_input_state_t); +RETRO_API void retro_set_environment(retro_environment_t); +RETRO_API void retro_set_video_refresh(retro_video_refresh_t); +RETRO_API void retro_set_audio_sample(retro_audio_sample_t); +RETRO_API void retro_set_audio_sample_batch(retro_audio_sample_batch_t); +RETRO_API void retro_set_input_poll(retro_input_poll_t); +RETRO_API void retro_set_input_state(retro_input_state_t); /* Library global initialization/deinitialization. */ -void retro_init(void); -void retro_deinit(void); +RETRO_API void retro_init(void); +RETRO_API void retro_deinit(void); /* Must return RETRO_API_VERSION. Used to validate ABI compatibility * when the API is revised. */ -unsigned retro_api_version(void); +RETRO_API unsigned retro_api_version(void); /* Gets statically known system info. Pointers provided in *info * must be statically allocated. * Can be called at any time, even before retro_init(). */ -void retro_get_system_info(struct retro_system_info *info); +RETRO_API void retro_get_system_info(struct retro_system_info *info); /* Gets information about system audio/video timings and geometry. * Can be called only after retro_load_game() has successfully completed. @@ -1858,7 +1996,7 @@ void retro_get_system_info(struct retro_system_info *info); * variable if needed. * E.g. geom.aspect_ratio might not be initialized if core doesn't * desire a particular aspect ratio. */ -void retro_get_system_av_info(struct retro_system_av_info *info); +RETRO_API void retro_get_system_av_info(struct retro_system_av_info *info); /* Sets device to be used for player 'port'. * By default, RETRO_DEVICE_JOYPAD is assumed to be plugged into all @@ -1868,10 +2006,10 @@ void retro_get_system_av_info(struct retro_system_av_info *info); * hint to the libretro core when a core cannot automatically detect the * appropriate input device type on its own. It is also relevant when a * core can change its behavior depending on device type. */ -void retro_set_controller_port_device(unsigned port, unsigned device); +RETRO_API void retro_set_controller_port_device(unsigned port, unsigned device); /* Resets the current game. */ -void retro_reset(void); +RETRO_API void retro_reset(void); /* Runs the game for one video frame. * During retro_run(), input_poll callback must be called at least once. @@ -1881,7 +2019,7 @@ void retro_reset(void); * a frame if GET_CAN_DUPE returns true. * In this case, the video callback can take a NULL argument for data. */ -void retro_run(void); +RETRO_API void retro_run(void); /* Returns the amount of data the implementation requires to serialize * internal state (save states). @@ -1889,35 +2027,35 @@ void retro_run(void); * returned size is never allowed to be larger than a previous returned * value, to ensure that the frontend can allocate a save state buffer once. */ -size_t retro_serialize_size(void); +RETRO_API size_t retro_serialize_size(void); /* Serializes internal state. If failed, or size is lower than * retro_serialize_size(), it should return false, true otherwise. */ -bool retro_serialize(void *data, size_t size); -bool retro_unserialize(const void *data, size_t size); +RETRO_API bool retro_serialize(void *data, size_t size); +RETRO_API bool retro_unserialize(const void *data, size_t size); -void retro_cheat_reset(void); -void retro_cheat_set(unsigned index, bool enabled, const char *code); +RETRO_API void retro_cheat_reset(void); +RETRO_API void retro_cheat_set(unsigned index, bool enabled, const char *code); /* Loads a game. */ -bool retro_load_game(const struct retro_game_info *game); +RETRO_API bool retro_load_game(const struct retro_game_info *game); /* Loads a "special" kind of game. Should not be used, * except in extreme cases. */ -bool retro_load_game_special( +RETRO_API bool retro_load_game_special( unsigned game_type, const struct retro_game_info *info, size_t num_info ); /* Unloads a currently loaded game. */ -void retro_unload_game(void); +RETRO_API void retro_unload_game(void); /* Gets region of game. */ -unsigned retro_get_region(void); +RETRO_API unsigned retro_get_region(void); /* Gets region of memory. */ -void *retro_get_memory_data(unsigned id); -size_t retro_get_memory_size(unsigned id); +RETRO_API void *retro_get_memory_data(unsigned id); +RETRO_API size_t retro_get_memory_size(unsigned id); #ifdef __cplusplus } diff --git a/frontend/link.T b/frontend/link.T new file mode 100644 index 0000000..b0c262d --- /dev/null +++ b/frontend/link.T @@ -0,0 +1,5 @@ +{ + global: retro_*; + local: *; +}; + diff --git a/frontend/main.c b/frontend/main.c index a824fdc..2d438aa 100644 --- a/frontend/main.c +++ b/frontend/main.c @@ -11,7 +11,7 @@ #include <unistd.h> #include <signal.h> #include <time.h> -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) #include <dlfcn.h> #endif @@ -151,8 +151,8 @@ void emu_set_default_config(void) new_dynarec_hacks = 0; cycle_multiplier = 200; - in_type1 = PSE_PAD_TYPE_STANDARD; - in_type2 = PSE_PAD_TYPE_STANDARD; + in_type[0] = PSE_PAD_TYPE_STANDARD; + in_type[1] = PSE_PAD_TYPE_STANDARD; } void do_emu_action(void) @@ -721,10 +721,10 @@ void SysReset() { // reset can run code, timing must be set pl_timing_prepare(Config.PsxType); - EmuReset(); - - // hmh core forgets this + // hmh core forgets this CDR_stop(); + + EmuReset(); GPU_updateLace = real_lace; g_emu_resetting = 0; @@ -772,7 +772,7 @@ int emu_save_state(int slot) return ret; ret = SaveState(fname); -#ifdef HAVE_PRE_ARMV7 /* XXX GPH hack */ +#if defined(HAVE_PRE_ARMV7) && !defined(_3DS) /* XXX GPH hack */ sync(); #endif SysPrintf("* %s \"%s\" [%d]\n", @@ -986,7 +986,7 @@ void *SysLoadLibrary(const char *lib) { return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]); } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) ret = dlopen(lib, RTLD_NOW); if (ret == NULL) SysMessage("dlopen: %s", dlerror()); @@ -1003,7 +1003,7 @@ void *SysLoadSym(void *lib, const char *sym) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return plugin_link(plugid - PLUGIN_DL_BASE, sym); -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) return dlsym(lib, sym); #else return NULL; @@ -1011,7 +1011,9 @@ void *SysLoadSym(void *lib, const char *sym) { } const char *SysLibError() { -#ifndef _WIN32 +#if defined(NO_DYLIB) + return NULL; +#elif !defined(_WIN32) return dlerror(); #else return "not supported"; @@ -1024,8 +1026,7 @@ void SysCloseLibrary(void *lib) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return; -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) dlclose(lib); #endif } - diff --git a/frontend/menu.c b/frontend/menu.c index cf9382a..0f59910 100644 --- a/frontend/menu.c +++ b/frontend/menu.c @@ -101,13 +101,10 @@ int scanlines, scanline_level = 20; int soft_scaling, analog_deadzone; // for Caanoo int soft_filter; -#ifndef HAVE_PRE_ARMV7 -#define DEFAULT_PSX_CLOCK 57 -#define DEFAULT_PSX_CLOCK_S "57" -#else -#define DEFAULT_PSX_CLOCK 50 -#define DEFAULT_PSX_CLOCK_S "50" -#endif +// Default to 100% CPU speed as most hardware can handle it nowadays using the dynamic recompiler. +// If not, the option is in the advanced speed hacks menu, so in a logical place. +#define DEFAULT_PSX_CLOCK 100 +#define DEFAULT_PSX_CLOCK_S "100" static const char *bioses[24]; static const char *gpu_plugins[16]; @@ -309,12 +306,12 @@ static void menu_sync_config(void) switch (in_type_sel1) { case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break; default: in_type1 = PSE_PAD_TYPE_STANDARD; } switch (in_type_sel2) { case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break; default: in_type2 = PSE_PAD_TYPE_STANDARD; } if (in_evdev_allow_abs_only != allow_abs_only_old) { diff --git a/frontend/pandora/pcsx.png b/frontend/pandora/pcsx.png Binary files differdeleted file mode 100644 index 71f36d0..0000000 --- a/frontend/pandora/pcsx.png +++ /dev/null diff --git a/frontend/pandora/pcsx.pxml.templ b/frontend/pandora/pcsx.pxml.templ deleted file mode 100644 index f748065..0000000 --- a/frontend/pandora/pcsx.pxml.templ +++ /dev/null @@ -1,42 +0,0 @@ -<?xml version="1.0" encoding="UTF-8"?> -<PXML xmlns="http://openpandora.org/namespaces/PXML" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="PXML_schema.xsd"> -<package id="package.pcsx_rearmed.notaz"> - <titles> - <title lang="en_US">PCSX ReARMed</title> - </titles> - <version major="1" minor="9" release="93" build="%PR%"/> - <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/> -</package> -<application id="pcsx_rearmed.notaz.%PR%" appdata="pcsx_rearmed"> - <titles> - <title lang="en_US">PCSX ReARMed %PR%</title> - </titles> - <title lang="en_US">PCSX ReARMed %PR%</title> - - <descriptions> - <description lang="en_US">PCSX ReARMed is heavily optimized PlayStation Emulator. It's a PCSX fork based on the PCSX-Reloaded project, which itself contains code from PCSX, PCSX-df and PCSX-Revolution. - -The emulator features MIPS->ARM recompiler by Ari64 and ARM NEON GPU by Exophase, that in many cases produces pixel perfect graphics at very high performance. There is also NEON-optimized GTE code, optimized P.E.Op.S. (Pete's) SPU; PCSX4ALL and traditional P.E.Op.S. GPUs are also available.</description> - </descriptions> - - <exec command="pcsx.sh"/> - - <icon src="pcsx.png"/> - - <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/> - - <version major="1" minor="9" release="93" build="%PR%"/> - - <licenses> - <license name="GPLv2+" url="http://www.gnu.org/licenses/gpl-2.0.html" sourcecodeurl="http://notaz.gp2x.de/cgi-bin/gitweb.cgi?p=pcsx_rearmed.git"/> - </licenses> - - <info name="PCSX ReARMed %PR% readme" type="text/plain" src="readme.txt"/> - - <categories> - <category name="Game"> - <subcategory name="Emulator"/> - </category> - </categories> -</application> -</PXML> diff --git a/frontend/pandora/pcsx.sh b/frontend/pandora/pcsx.sh deleted file mode 100755 index 710f641..0000000 --- a/frontend/pandora/pcsx.sh +++ /dev/null @@ -1,24 +0,0 @@ -#!/bin/sh - -# stupid nub mode thing -nub0mode=`cat /proc/pandora/nub0/mode` -nub1mode=`cat /proc/pandora/nub1/mode` -/usr/pandora/scripts/op_nubchange.sh absolute absolute - -# 4MB for RAM (2+align) + 2MB for vram (1+overdraw) -# + 10MB for gpu_neon (8+overdraw) + 8MB LUTs -# no big deal if this fails, only performance loss -sudo -n /usr/pandora/scripts/op_hugetlb.sh 24 - -# C64x DSP for SPU -sudo -n /usr/pandora/scripts/op_dsp_c64.sh - -./pcsx "$@" - -# restore stuff if pcsx crashes -./picorestore -sudo -n /usr/pandora/scripts/op_lcdrate.sh 60 -sudo -n /usr/pandora/scripts/op_gamma.sh 0 -sudo -n /usr/pandora/scripts/op_hugetlb.sh 0 - -/usr/pandora/scripts/op_nubchange.sh $nub0mode $nub1mode diff --git a/frontend/pandora/picorestore.c b/frontend/pandora/picorestore.c deleted file mode 100644 index 77f5720..0000000 --- a/frontend/pandora/picorestore.c +++ /dev/null @@ -1,109 +0,0 @@ -/* - * picorestore - clean up after an omapfb program crash - * - * Copyright (c) Gražvydas "notaz" Ignotas, 2010 - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * * Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * * Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * * Neither the name of the organization nor the - * names of its contributors may be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE - * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL - * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR - * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER - * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, - * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE - * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - */ - -#include <stdio.h> -#include <sys/types.h> -#include <sys/stat.h> -#include <fcntl.h> -#include <unistd.h> -#include <sys/ioctl.h> -#include <linux/fb.h> -#include <linux/omapfb.h> -#include <linux/kd.h> - -int main() -{ - struct fb_var_screeninfo fbvar; - struct omapfb_plane_info pi; - struct omapfb_mem_info mi; - int ret, fbdev, kbdfd; - - fbdev = open("/dev/fb0", O_RDWR); - if (fbdev == -1) { - perror("open fb0"); - goto end_fb0; - } - - ret = ioctl(fbdev, FBIOGET_VSCREENINFO, &fbvar); - if (ret == -1) { - perror("FBIOGET_VSCREENINFO ioctl"); - goto end_fb0; - } - - if (fbvar.yoffset != 0) { - printf("fixing yoffset.. "); - fbvar.yoffset = 0; - ret = ioctl(fbdev, FBIOPAN_DISPLAY, &fbvar); - if (ret < 0) - perror("ioctl FBIOPAN_DISPLAY"); - else - printf("ok\n"); - } - -end_fb0: - if (fbdev >= 0) - close(fbdev); - - fbdev = open("/dev/fb1", O_RDWR); - if (fbdev == -1) { - perror("open fb1"); - goto end_fb1; - } - - ret = ioctl(fbdev, OMAPFB_QUERY_PLANE, &pi); - ret |= ioctl(fbdev, OMAPFB_QUERY_MEM, &mi); - if (ret != 0) - perror("QUERY_*"); - - pi.enabled = 0; - ret = ioctl(fbdev, OMAPFB_SETUP_PLANE, &pi); - if (ret != 0) - perror("SETUP_PLANE"); - - mi.size = 0; - ret = ioctl(fbdev, OMAPFB_SETUP_MEM, &mi); - if (ret != 0) - perror("SETUP_MEM"); - -end_fb1: - if (fbdev >= 0) - close(fbdev); - - kbdfd = open("/dev/tty", O_RDWR); - if (kbdfd == -1) { - perror("open /dev/tty"); - return 1; - } - - if (ioctl(kbdfd, KDSETMODE, KD_TEXT) == -1) - perror("KDSETMODE KD_TEXT"); - - close(kbdfd); - - return 0; -} diff --git a/frontend/pandora/skin/background.png b/frontend/pandora/skin/background.png Binary files differdeleted file mode 100644 index f4b4523..0000000 --- a/frontend/pandora/skin/background.png +++ /dev/null diff --git a/frontend/pandora/skin/font.png b/frontend/pandora/skin/font.png Binary files differdeleted file mode 100644 index 707a5b4..0000000 --- a/frontend/pandora/skin/font.png +++ /dev/null diff --git a/frontend/pandora/skin/readme.txt b/frontend/pandora/skin/readme.txt deleted file mode 100644 index dd83963..0000000 --- a/frontend/pandora/skin/readme.txt +++ /dev/null @@ -1,8 +0,0 @@ -The skin images can be customized, but there are several limitations:
-
-background.png - must be 320x240 image with 24bit RGB colors.
-font.png - must be 128x160 8bit grayscale image.
-selector.png - must be 8x10 8bit grayscale image.
-
-Font and selector colors can be changed by editing skin.txt.
-
diff --git a/frontend/pandora/skin/selector.png b/frontend/pandora/skin/selector.png Binary files differdeleted file mode 100644 index a439169..0000000 --- a/frontend/pandora/skin/selector.png +++ /dev/null diff --git a/frontend/pandora/skin/skin.txt b/frontend/pandora/skin/skin.txt deleted file mode 100644 index 1d6979f..0000000 --- a/frontend/pandora/skin/skin.txt +++ /dev/null @@ -1,4 +0,0 @@ -// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.
-text_color=ffffc0
-selection_color=808010
-
diff --git a/frontend/pandora/ui_feat.h b/frontend/pandora/ui_feat.h deleted file mode 100644 index 3bb808a..0000000 --- a/frontend/pandora/ui_feat.h +++ /dev/null @@ -1,16 +0,0 @@ -#ifndef UI_FEATURES_H -#define UI_FEATURES_H - -#define MENU_BIOS_PATH "<SD card>/pandora/appdata/pcsx_rearmed/bios/" -#define BOOT_MSG "Booting up... (press SPACE for menu)" -#define MENU_SHOW_VARSCALER 1 -#define MENU_SHOW_VOUTMODE 0 -#define MENU_SHOW_SCALER2 0 -#define MENU_SHOW_NUBS_BTNS 1 -#define MENU_SHOW_VIBRATION 0 -#define MENU_SHOW_DEADZONE 0 -#define MENU_SHOW_MINIMIZE 1 -#define MENU_SHOW_FULLSCREEN 0 -#define MENU_SHOW_VOLUME 0 - -#endif // UI_FEATURES_H diff --git a/frontend/plugin.c b/frontend/plugin.c index d9eb04a..1fcd7be 100644 --- a/frontend/plugin.c +++ b/frontend/plugin.c @@ -49,24 +49,43 @@ extern void CALLBACK SPUasync(unsigned int, unsigned int); extern int CALLBACK SPUplayCDDAchannel(short *, int); /* PAD */ -static long PADreadPort1(PadDataS *pad) -{ - pad->controllerType = in_type1; - pad->buttonStatus = ~in_keystate; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) { - pad->leftJoyX = in_a1[0]; - pad->leftJoyY = in_a1[1]; - pad->rightJoyX = in_a2[0]; - pad->rightJoyY = in_a2[1]; - } - return 0; +static long PADreadPort1(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap1 == 1) + pad->portMultitap = 1; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGJOY || in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } -static long PADreadPort2(PadDataS *pad) -{ - pad->controllerType = in_type2; - pad->buttonStatus = ~in_keystate >> 16; - return 0; +static long PADreadPort2(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap2 == 1) + pad->portMultitap = 2; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGJOY || in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } /* GPU */ diff --git a/frontend/plugin_lib.c b/frontend/plugin_lib.c index ab4d415..eee255b 100644 --- a/frontend/plugin_lib.c +++ b/frontend/plugin_lib.c @@ -36,11 +36,15 @@ #define HUD_HEIGHT 10 -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; +int in_type[8]; +int multitap1; +int multitap2; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }}; int in_adev_is_nublike[2]; -int in_keystate, in_state_gun; +unsigned short in_keystate[8]; +int in_state_gun; int in_enable_vibration; void *tsdev; void *pl_vout_buf; @@ -560,7 +564,7 @@ static void update_analog_nub_adjust(int *x_, int *y_) static void update_analogs(void) { - int *nubp[2] = { in_a1, in_a2 }; + int *nubp[2] = { in_analog_left[0], in_analog_right[0] }; int vals[2]; int i, a, v, ret; @@ -597,7 +601,7 @@ static void update_input(void) unsigned int emu_act; in_update(actions); - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) + if (in_type[0] == PSE_PAD_TYPE_ANALOGJOY || in_type[0] == PSE_PAD_TYPE_ANALOGPAD) update_analogs(); emu_act = actions[IN_BINDTYPE_EMU]; in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER; @@ -611,7 +615,7 @@ static void update_input(void) } emu_set_action(emu_act); - in_keystate = actions[IN_BINDTYPE_PLAYER12]; + in_keystate[0] = actions[IN_BINDTYPE_PLAYER12]; } #else /* MAEMO */ extern void update_input(void); diff --git a/frontend/plugin_lib.h b/frontend/plugin_lib.h index 4a11002..92e62e9 100644 --- a/frontend/plugin_lib.h +++ b/frontend/plugin_lib.h @@ -17,8 +17,14 @@ enum { DKEY_CROSS, DKEY_SQUARE, }; -extern int in_type1, in_type2; -extern int in_keystate, in_state_gun, in_a1[2], in_a2[2]; +extern int in_state_gun; +extern int in_type[8]; +extern int multitap1; +extern int multitap2; +extern int in_analog_left[8][2]; +extern int in_analog_right[8][2]; +extern unsigned short in_keystate[8]; + extern int in_adev[2], in_adev_axis[2][2]; extern int in_adev_is_nublike[2]; extern int in_enable_vibration; @@ -65,6 +71,7 @@ struct rearmed_cbs { int allow_interlace; // 0 off, 1 on, 2 guess int enhancement_enable; int enhancement_no_main; + int allow_dithering; } gpu_neon; struct { int iUseDither; diff --git a/frontend/vita/retro_inline.h b/frontend/vita/retro_inline.h new file mode 100644 index 0000000..8535d84 --- /dev/null +++ b/frontend/vita/retro_inline.h @@ -0,0 +1,39 @@ +/* Copyright (C) 2010-2015 The RetroArch team + * + * --------------------------------------------------------------------------------------- + * The following license statement only applies to this file (retro_inline.h). + * --------------------------------------------------------------------------------------- + * + * Permission is hereby granted, free of charge, + * to any person obtaining a copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation the rights to + * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, + * and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. + * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + +#ifndef __LIBRETRO_SDK_INLINE_H +#define __LIBRETRO_SDK_INLINE_H + +#ifndef INLINE + +#if !defined(__cplusplus) && defined(_WIN32) +#define INLINE _inline +#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L +#define INLINE inline +#elif defined(__GNUC__) +#define INLINE __inline__ +#else +#define INLINE +#endif + +#endif +#endif diff --git a/frontend/vita/sys/mman.h b/frontend/vita/sys/mman.h new file mode 100644 index 0000000..89da513 --- /dev/null +++ b/frontend/vita/sys/mman.h @@ -0,0 +1,69 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include "stdlib.h" +#include "stdio.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)prot; + (void)flags; + (void)fd; + (void)offset; + + int block, ret; + + block = sceKernelAllocMemBlockForVM("code", len); + if(block<=0){ + sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len); + exit(1); + } + + // get base address + ret = sceKernelGetMemBlockBase(block, &addr); + if (ret < 0) + { + sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr); + exit(1); + } + + + if(!addr) + return MAP_FAILED; + + return addr; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + (void)addr; + (void)len; + (void)prot; + return 0; +} + +static inline int munmap(void *addr, size_t len) +{ + int uid = sceKernelFindMemBlockByAddr(addr, len); + + return sceKernelFreeMemBlock(uid); + +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H diff --git a/frontend/warm b/frontend/warm deleted file mode 160000 -Subproject a6f015da3b10b82a476250793645c071340decb diff --git a/include/psemu_plugin_defs.h b/include/psemu_plugin_defs.h index 9986654..6fc59b7 100644 --- a/include/psemu_plugin_defs.h +++ b/include/psemu_plugin_defs.h @@ -153,6 +153,8 @@ typedef struct +// No controller +#define PSE_PAD_TYPE_NONE 0 // MOUSE SCPH-1030 #define PSE_PAD_TYPE_MOUSE 1 // NEGCON - 16 button analog controller SLPH-00001 @@ -191,9 +193,15 @@ typedef struct typedef struct { - // controler type - fill it withe predefined values above + // controller type - fill it withe predefined values above unsigned char controllerType; + //0 : no multitap between psx and pad + //1 : multitap between psx and pad on port 1 + //2 : multitap between psx and pad on port 2 + int portMultitap; + int requestPadIndex; + // status of buttons - every controller fills this field unsigned short buttonStatus; @@ -207,7 +215,9 @@ typedef struct unsigned char Vib[2]; unsigned char VibF[2]; - + + //configuration mode Request 0x43 + int configMode; unsigned char reserved[87]; } PadDataS; diff --git a/jni/Android.mk b/jni/Android.mk index 72c6738..1b24c0b 100644 --- a/jni/Android.mk +++ b/jni/Android.mk @@ -1,99 +1,122 @@ LOCAL_PATH := $(call my-dir) -include $(CLEAR_VARS) - -APP_DIR := ../../src - -ifneq ($(TARGET_ARCH_ABI),armeabi-v7a) - NO_NEON_BUILD := 1 -else - NO_NEON_BUILD := $(NO_NEON) -endif +$(shell cd "$(LOCAL_PATH)" && ((git describe || echo) | sed -e 's/.*/#define REV "\0"/' > ../frontend/revision.h_)) +$(shell cd "$(LOCAL_PATH)" && (diff -q ../frontend/revision.h_ ../frontend/revision.h > /dev/null 2>&1 || cp ../frontend/revision.h_ ../frontend/revision.h)) +$(shell cd "$(LOCAL_PATH)" && (rm ../frontend/revision.h_)) -ifeq ($(NO_NEON_BUILD)$(TARGET_ARCH_ABI),1armeabi-v7a) - LOCAL_MODULE := retro-noneon -else - LOCAL_MODULE := retro -endif +ROOT_DIR := $(LOCAL_PATH)/.. +CORE_DIR := $(ROOT_DIR)/libpcsxcore +SPU_DIR := $(ROOT_DIR)/plugins/dfsound +GPU_DIR := $(ROOT_DIR)/plugins/gpulib +CDR_DIR := $(ROOT_DIR)/plugins/cdrcimg +INPUT_DIR := $(ROOT_DIR)/plugins/dfinput +FRONTEND_DIR := $(ROOT_DIR)/frontend +NEON_DIR := $(ROOT_DIR)/plugins/gpu_neon +UNAI_DIR := $(ROOT_DIR)/plugins/gpu_unai +DYNAREC_DIR := $(ROOT_DIR)/libpcsxcore/new_dynarec + +# core +SOURCES_C := $(CORE_DIR)/cdriso.c \ + $(CORE_DIR)/cdrom.c \ + $(CORE_DIR)/cheat.c \ + $(CORE_DIR)/debug.c \ + $(CORE_DIR)/decode_xa.c \ + $(CORE_DIR)/disr3000a.c \ + $(CORE_DIR)/mdec.c \ + $(CORE_DIR)/misc.c \ + $(CORE_DIR)/plugins.c \ + $(CORE_DIR)/ppf.c \ + $(CORE_DIR)/psxbios.c \ + $(CORE_DIR)/psxcommon.c \ + $(CORE_DIR)/psxcounters.c \ + $(CORE_DIR)/psxdma.c \ + $(CORE_DIR)/psxhle.c \ + $(CORE_DIR)/psxhw.c \ + $(CORE_DIR)/psxinterpreter.c \ + $(CORE_DIR)/psxmem.c \ + $(CORE_DIR)/r3000a.c \ + $(CORE_DIR)/sio.c \ + $(CORE_DIR)/socket.c \ + $(CORE_DIR)/spu.c \ + $(CORE_DIR)/gte.c \ + $(CORE_DIR)/gte_nf.c \ + $(CORE_DIR)/gte_divider.c -ifeq ($(TARGET_ARCH),arm) - LOCAL_ARM_MODE := arm +# spu +SOURCES_C += $(SPU_DIR)/dma.c \ + $(SPU_DIR)/freeze.c \ + $(SPU_DIR)/registers.c \ + $(SPU_DIR)/spu.c \ + $(SPU_DIR)/out.c \ + $(SPU_DIR)/nullsnd.c - LOCAL_CFLAGS += -DANDROID_ARM +# gpu +SOURCES_C += $(GPU_DIR)/gpu.c \ + $(GPU_DIR)/vout_pl.c - LOCAL_SRC_FILES += ../libpcsxcore/gte_arm.S +# cdrcimg +SOURCES_C += $(CDR_DIR)/cdrcimg.c - # dynarec - LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/linkage_arm.S ../libpcsxcore/new_dynarec/emu_if.c ../libpcsxcore/new_dynarec/pcsxmem.c +# dfinput +SOURCES_C += $(INPUT_DIR)/main.c \ + $(INPUT_DIR)/pad.c \ + $(INPUT_DIR)/guncon.c - # spu - LOCAL_SRC_FILES += ../plugins/dfsound/arm_utils.S +# frontend +SOURCES_C += $(FRONTEND_DIR)/main.c \ + $(FRONTEND_DIR)/plugin.c \ + $(FRONTEND_DIR)/cspace.c \ + $(FRONTEND_DIR)/libretro.c - # misc +# dynarec +SOURCES_C += $(DYNAREC_DIR)/backends/psx/emu_if.c - ifeq ($(NO_NEON_BUILD),1) - # gpu - LOCAL_CFLAGS += -DREARMED - LOCAL_SRC_FILES += ../plugins/gpu_unai/gpulib_if.cpp ../plugins/gpu_unai/gpu_arm.s - LOCAL_SRC_FILES += ../frontend/cspace_arm.S - else - LOCAL_ARM_NEON := true - LOCAL_CFLAGS += -DNEON_BUILD -DTEXTURE_CACHE_4BPP -DTEXTURE_CACHE_8BPP - LOCAL_SRC_FILES += ../libpcsxcore/gte_neon.S ../frontend/cspace_neon.S +COREFLAGS := -ffast-math -funroll-loops -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 -DANDROID -DREARMED - # gpu - LOCAL_SRC_FILES += ../plugins/gpu_neon/psx_gpu_if.c ../plugins/gpu_neon/psx_gpu/psx_gpu_arm_neon.S - endif +ifeq ($(TARGET_ARCH),arm) + SOURCES_ASM := $(CORE_DIR)/gte_arm.S \ + $(SPU_DIR)/arm_utils.S \ + $(DYNAREC_DIR)/arm/linkage_arm.S + SOURCES_C += $(DYNAREC_DIR)/new_dynarec.c \ + $(DYNAREC_DIR)/backends/psx/pcsxmem.c +else + COREFLAGS += -DDRC_DISABLE + SOURCES_ASM := endif -ifeq ($(TARGET_ARCH),x86) - LOCAL_CFLAGS += -DANDROID_X86 +ifeq ($(TARGET_ARCH_ABI),armeabi-v7a) + COREFLAGS += -DNEON_BUILD -DTEXTURE_CACHE_4BPP -DTEXTURE_CACHE_8BPP + SOURCES_ASM += $(CORE_DIR)/gte_neon.S \ + $(NEON_DIR)/psx_gpu/psx_gpu_arm_neon.S \ + $(FRONTEND_DIR)/cspace_neon.S + SOURCES_C += $(NEON_DIR)/psx_gpu_if.c +else ifeq ($(TARGET_ARCH_ABI),armeabi) + SOURCES_ASM += $(UNAI_DIR)/gpu_arm.s \ + $(FRONTEND_DIR)/cspace_arm.S + SOURCES_C += $(UNAI_DIR)/gpulib_if.cpp +else + SOURCES_C += $(UNAI_DIR)/gpulib_if.cpp endif -ifeq ($(TARGET_ARCH),mips) - LOCAL_CFLAGS += -DANDROID_MIPS -D__mips__ -D__MIPSEL__ +GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)" +ifneq ($(GIT_VERSION)," unknown") + COREFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\" endif -ifneq ($(TARGET_ARCH),arm) - # gpu - LOCAL_CFLAGS += -DREARMED - LOCAL_SRC_FILES += ../plugins/gpu_unai/gpulib_if.cpp +include $(CLEAR_VARS) +LOCAL_MODULE := retro +LOCAL_SRC_FILES := $(SOURCES_C) $(SOURCES_ASM) +LOCAL_CFLAGS := $(COREFLAGS) +LOCAL_C_INCLUDES := $(ROOT_DIR)/include +LOCAL_LDFLAGS := -Wl,-version-script=$(FRONTEND_DIR)/link.T +LOCAL_LDLIBS := -lz -llog +LOCAL_ARM_MODE := arm + +ifeq ($(TARGET_ARCH_ABI),armeabi-v7a) + LOCAL_ARM_NEON := true +endif +ifeq ($(TARGET_ARCH),arm) + LOCAL_LDLIBS += -Wl,-no-warn-shared-textrel endif - -$(shell cd "$(LOCAL_PATH)" && ((git describe || echo) | sed -e 's/.*/#define REV "\0"/' > ../frontend/revision.h_)) -$(shell cd "$(LOCAL_PATH)" && (diff -q ../frontend/revision.h_ ../frontend/revision.h > /dev/null 2>&1 || cp ../frontend/revision.h_ ../frontend/revision.h)) -$(shell cd "$(LOCAL_PATH)" && (rm ../frontend/revision.h_)) - -LOCAL_SRC_FILES += ../libpcsxcore/cdriso.c ../libpcsxcore/cdrom.c ../libpcsxcore/cheat.c ../libpcsxcore/debug.c \ - ../libpcsxcore/decode_xa.c ../libpcsxcore/disr3000a.c ../libpcsxcore/mdec.c \ - ../libpcsxcore/misc.c ../libpcsxcore/plugins.c ../libpcsxcore/ppf.c ../libpcsxcore/psxbios.c \ - ../libpcsxcore/psxcommon.c ../libpcsxcore/psxcounters.c ../libpcsxcore/psxdma.c ../libpcsxcore/psxhle.c \ - ../libpcsxcore/psxhw.c ../libpcsxcore/psxinterpreter.c ../libpcsxcore/psxmem.c ../libpcsxcore/r3000a.c \ - ../libpcsxcore/sio.c ../libpcsxcore/socket.c ../libpcsxcore/spu.c -LOCAL_SRC_FILES += ../libpcsxcore/gte.c ../libpcsxcore/gte_nf.c ../libpcsxcore/gte_divider.c - -# spu -LOCAL_SRC_FILES += ../plugins/dfsound/dma.c ../plugins/dfsound/freeze.c \ - ../plugins/dfsound/registers.c ../plugins/dfsound/spu.c \ - ../plugins/dfsound/out.c ../plugins/dfsound/nullsnd.c - -# builtin gpu -LOCAL_SRC_FILES += ../plugins/gpulib/gpu.c ../plugins/gpulib/vout_pl.c - -# cdrcimg -LOCAL_SRC_FILES += ../plugins/cdrcimg/cdrcimg.c - -# dfinput -LOCAL_SRC_FILES += ../plugins/dfinput/main.c ../plugins/dfinput/pad.c ../plugins/dfinput/guncon.c - -# misc -LOCAL_SRC_FILES += ../frontend/main.c ../frontend/plugin.c ../frontend/cspace.c - -# libretro -LOCAL_SRC_FILES += ../frontend/libretro.c - -LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 -LOCAL_C_INCLUDES += $(LOCAL_PATH)/../include -LOCAL_LDLIBS := -lz -llog include $(BUILD_SHARED_LIBRARY) diff --git a/jni/Application.mk b/jni/Application.mk index f05229c..a252a72 100644 --- a/jni/Application.mk +++ b/jni/Application.mk @@ -1 +1 @@ -APP_ABI := armeabi armeabi-v7a +APP_ABI := all diff --git a/libpcsxcore/cdriso.c b/libpcsxcore/cdriso.c index 515370f..cf1a59e 100644 --- a/libpcsxcore/cdriso.c +++ b/libpcsxcore/cdriso.c @@ -25,19 +25,20 @@ #include "cdriso.h" #include "ppf.h" +#include <errno.h> +#include <zlib.h> + #ifdef _WIN32 #define WIN32_LEAN_AND_MEAN #include <process.h> #include <windows.h> #define strcasecmp _stricmp -#define usleep(x) Sleep((x) / 1000) +#define usleep(x) (Sleep((x) / 1000)) #else #include <pthread.h> #include <sys/time.h> #include <unistd.h> #endif -#include <errno.h> -#include <zlib.h> #define OFF_T_MSB ((off_t)1 << (sizeof(off_t) * 8 - 1)) @@ -225,7 +226,9 @@ static void *playthread(void *param) do { ret = SPU_playCDDAchannel((short *)sndbuffer, s); if (ret == 0x7761) + { usleep(6 * 1000); + } } while (ret == 0x7761 && playing); // rearmed_wait } @@ -236,7 +239,9 @@ static void *playthread(void *param) // HACK: stop feeding data while emu is paused extern int stop; while (stop && playing) + { usleep(10000); + } now = GetTickCount(); osleep = t - now; @@ -560,20 +565,15 @@ static int parsecue(const char *isofile) { if (t != 1) sscanf(linebuf, " FILE %255s", tmpb); - // absolute path? - ti[numtracks + 1].handle = fopen(tmpb, "rb"); - if (ti[numtracks + 1].handle == NULL) { - // relative to .cue? - tmp = strrchr(tmpb, '\\'); - if (tmp == NULL) - tmp = strrchr(tmpb, '/'); - if (tmp != NULL) - tmp++; - else - tmp = tmpb; - strncpy(incue_fname, tmp, incue_max_len); - ti[numtracks + 1].handle = fopen(filepath, "rb"); - } + tmp = strrchr(tmpb, '\\'); + if (tmp == NULL) + tmp = strrchr(tmpb, '/'); + if (tmp != NULL) + tmp++; + else + tmp = tmpb; + strncpy(incue_fname, tmp, incue_max_len); + ti[numtracks + 1].handle = fopen(filepath, "rb"); // update global offset if this is not first file in this .cue if (numtracks + 1 > 1) { @@ -1089,7 +1089,7 @@ static int cdread_sub_mixed(FILE *f, unsigned int base, void *dest, int sector) return ret; } -static int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size) +static int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size) { static z_stream z; int ret = 0; @@ -1169,7 +1169,7 @@ static int cdread_compressed(FILE *f, unsigned int base, void *dest, int sector) if (is_compressed) { cdbuffer_size_expect = sizeof(compr_img->buff_raw[0]) << compr_img->block_shift; cdbuffer_size = cdbuffer_size_expect; - ret = uncompress2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size); + ret = uncomp2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size); if (ret != 0) { SysPrintf("uncompress failed with %d for block %d, sector %d\n", ret, block, sector); diff --git a/libpcsxcore/gte_neon.S b/libpcsxcore/gte_neon.S index fe153e2..fbe0e59 100644 --- a/libpcsxcore/gte_neon.S +++ b/libpcsxcore/gte_neon.S @@ -6,7 +6,7 @@ */ #include "arm_features.h" -#include "new_dynarec/linkage_offsets.h" +#include "new_dynarec/arm/linkage_offsets.h" .syntax unified .text diff --git a/libpcsxcore/new_dynarec/assem_arm.c b/libpcsxcore/new_dynarec/arm/assem_arm.c index 21640f8..db1d2af 100644 --- a/libpcsxcore/new_dynarec/assem_arm.c +++ b/libpcsxcore/new_dynarec/arm/assem_arm.c @@ -19,12 +19,12 @@ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */ -#include "../gte.h" +#include "../../gte.h" #define FLAGLESS -#include "../gte.h" +#include "../../gte.h" #undef FLAGLESS -#include "../gte_arm.h" -#include "../gte_neon.h" +#include "../../gte_arm.h" +#include "../../gte_neon.h" #include "pcnt.h" #include "arm_features.h" @@ -2518,8 +2518,8 @@ static void mov_loadtype_adj(int type,int rs,int rt) } } -#include "pcsxmem.h" -#include "pcsxmem_inline.c" +#include "../backends/psx/pcsxmem.h" +#include "../backends/psx/pcsxmem_inline.c" static void do_readstub(int n) { diff --git a/libpcsxcore/new_dynarec/assem_arm.h b/libpcsxcore/new_dynarec/arm/assem_arm.h index bb6114c..bb6114c 100644 --- a/libpcsxcore/new_dynarec/assem_arm.h +++ b/libpcsxcore/new_dynarec/arm/assem_arm.h diff --git a/libpcsxcore/new_dynarec/linkage_arm.S b/libpcsxcore/new_dynarec/arm/linkage_arm.S index d32dc0b..269eb99 100644 --- a/libpcsxcore/new_dynarec/linkage_arm.S +++ b/libpcsxcore/new_dynarec/arm/linkage_arm.S @@ -20,7 +20,7 @@ * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */ #include "arm_features.h" -#include "new_dynarec_config.h" +#include "../new_dynarec_config.h" #include "linkage_offsets.h" diff --git a/libpcsxcore/new_dynarec/linkage_offsets.h b/libpcsxcore/new_dynarec/arm/linkage_offsets.h index f7e1911..f7e1911 100644 --- a/libpcsxcore/new_dynarec/linkage_offsets.h +++ b/libpcsxcore/new_dynarec/arm/linkage_offsets.h diff --git a/libpcsxcore/new_dynarec/emu_if.c b/libpcsxcore/new_dynarec/backends/psx/emu_if.c index 22db5d1..2a090a0 100644 --- a/libpcsxcore/new_dynarec/emu_if.c +++ b/libpcsxcore/new_dynarec/backends/psx/emu_if.c @@ -9,15 +9,19 @@ #include "emu_if.h" #include "pcsxmem.h" -#include "../psxhle.h" -#include "../r3000a.h" -#include "../cdrom.h" -#include "../psxdma.h" -#include "../mdec.h" -#include "../gte_arm.h" -#include "../gte_neon.h" +#include "../../../psxhle.h" +#include "../../../r3000a.h" +#include "../../../cdrom.h" +#include "../../../psxdma.h" +#include "../../../mdec.h" +#include "../../../gte_arm.h" +#include "../../../gte_neon.h" + +#include "../../../gte.h" + #define FLAGLESS -#include "../gte.h" +#include "../../../gte.h" +#undef FLAGLESS #define ARRAY_SIZE(x) (sizeof(x) / sizeof(x[0])) @@ -331,6 +335,7 @@ static int ari64_init() #ifdef DRC_DBG memcpy(gte_handlers_nf, gte_handlers, sizeof(gte_handlers_nf)); #endif + psxH_ptr = psxH; zeromem_ptr = zero_mem; scratch_buf_ptr = scratch_buf; @@ -431,7 +436,7 @@ void do_insn_cmp() {} #ifdef DRC_DISABLE unsigned int address; int pending_exception, stop; -unsigned int next_interupt; +u32 next_interupt; int new_dynarec_did_compile; int cycle_multiplier; int new_dynarec_hacks; diff --git a/libpcsxcore/new_dynarec/emu_if.h b/libpcsxcore/new_dynarec/backends/psx/emu_if.h index 3980490..d8c7990 100644 --- a/libpcsxcore/new_dynarec/emu_if.h +++ b/libpcsxcore/new_dynarec/backends/psx/emu_if.h @@ -1,5 +1,5 @@ -#include "new_dynarec.h" -#include "../r3000a.h" +#include "../../new_dynarec.h" +#include "../../../r3000a.h" extern char invalid_code[0x100000]; @@ -89,7 +89,7 @@ extern void *scratch_buf_ptr; extern u32 inv_code_start, inv_code_end; /* cycles/irqs */ -extern unsigned int next_interupt; +extern u32 next_interupt; extern int pending_exception; /* called by drc */ diff --git a/libpcsxcore/new_dynarec/pcsxmem.c b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.c index 9376ff4..647981e 100644 --- a/libpcsxcore/new_dynarec/pcsxmem.c +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.c @@ -6,11 +6,11 @@ */ #include <stdio.h> -#include "../psxhw.h" -#include "../cdrom.h" -#include "../mdec.h" -#include "../gpu.h" -#include "../psxmem_map.h" +#include "../../../psxhw.h" +#include "../../../cdrom.h" +#include "../../../mdec.h" +#include "../../../gpu.h" +#include "../../../psxmem_map.h" #include "emu_if.h" #include "pcsxmem.h" diff --git a/libpcsxcore/new_dynarec/pcsxmem.h b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.h index 72892a8..72892a8 100644 --- a/libpcsxcore/new_dynarec/pcsxmem.h +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.h diff --git a/libpcsxcore/new_dynarec/pcsxmem_inline.c b/libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c index 305931a..305931a 100644 --- a/libpcsxcore/new_dynarec/pcsxmem_inline.c +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c diff --git a/libpcsxcore/new_dynarec/new_dynarec.c b/libpcsxcore/new_dynarec/new_dynarec.c index cd63d2b..dfa17a7 100644 --- a/libpcsxcore/new_dynarec/new_dynarec.c +++ b/libpcsxcore/new_dynarec/new_dynarec.c @@ -32,10 +32,11 @@ #ifdef VITA #include <psp2/kernel/sysmem.h> static int sceBlock; +int getVMBlock(); #endif #include "new_dynarec_config.h" -#include "emu_if.h" //emulator interface +#include "backends/psx/emu_if.h" //emulator interface //#define DISASM //#define assem_debug printf @@ -44,13 +45,17 @@ static int sceBlock; #define inv_debug(...) #ifdef __i386__ -#include "assem_x86.h" +#include "x86/assem_x86.h" #endif #ifdef __x86_64__ -#include "assem_x64.h" +#include "x64/assem_x64.h" #endif #ifdef __arm__ -#include "assem_arm.h" +#include "arm/assem_arm.h" +#endif + +#ifdef VITA +int _newlib_vm_size_user = 1 << TARGET_SIZE_2; #endif #define MAXBLOCK 4096 @@ -361,14 +366,16 @@ static u_int get_vpage(u_int vaddr) // This is called from the recompiled JR/JALR instructions void *get_addr(u_int vaddr) { - u_int page=get_page(vaddr); - u_int vpage=get_vpage(vaddr); - struct ll_entry *head; + struct ll_entry *head = NULL; + u_int page = get_page(vaddr); + u_int vpage = get_vpage(vaddr); //printf("TRACE: count=%d next=%d (get_addr %x,page %d)\n",Count,next_interupt,vaddr,page); head=jump_in[page]; - while(head!=NULL) { - if(head->vaddr==vaddr) { - //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); + while(head!=NULL) + { + if(head->vaddr==vaddr) + { + //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; ht_bin[3]=ht_bin[1]; ht_bin[2]=ht_bin[0]; @@ -379,39 +386,47 @@ void *get_addr(u_int vaddr) head=head->next; } head=jump_dirty[vpage]; - while(head!=NULL) { - if(head->vaddr==vaddr) { + while(head!=NULL) + { + if(head->vaddr==vaddr) + { //printf("TRACE: count=%d next=%d (get_addr match dirty %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); // Don't restore blocks which are about to expire from the cache if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) - if(verify_dirty(head->addr)) { - //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]); - invalid_code[vaddr>>12]=0; - inv_code_start=inv_code_end=~0; - if(vpage<2048) { - restore_candidate[vpage>>3]|=1<<(vpage&7); - } - else restore_candidate[page>>3]|=1<<(page&7); - u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; - if(ht_bin[0]==vaddr) { - ht_bin[1]=(u_int)head->addr; // Replace existing entry - } - else + if(verify_dirty(head->addr)) { - ht_bin[3]=ht_bin[1]; - ht_bin[2]=ht_bin[0]; - ht_bin[1]=(int)head->addr; - ht_bin[0]=vaddr; + //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]); + invalid_code[vaddr>>12]=0; + inv_code_start=inv_code_end=~0; + if(vpage<2048) + { + restore_candidate[vpage>>3]|=1<<(vpage&7); + } + else + { + restore_candidate[page>>3]|=1<<(page&7); + } + u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; + + if(ht_bin[0]==vaddr) + ht_bin[1]=(u_int)head->addr; // Replace existing entry + else + { + ht_bin[3]=ht_bin[1]; + ht_bin[2]=ht_bin[0]; + ht_bin[1]=(int)head->addr; + ht_bin[0]=vaddr; + } + return head->addr; } - return head->addr; - } } head=head->next; } //printf("TRACE: count=%d next=%d (get_addr no-match %x)\n",Count,next_interupt,vaddr); int r=new_recompile_block(vaddr); - if(r==0) return get_addr(vaddr); - // Execute in unmapped page, generate pagefault execption + if(r==0) + return get_addr(vaddr); + // Execute in unmapped page, generate pagefault exception Status|=2; Cause=(vaddr<<31)|0x8; EPC=(vaddr&1)?vaddr-5:vaddr; @@ -420,6 +435,7 @@ void *get_addr(u_int vaddr) EntryHi=BadVAddr&0xFFFFE000; return get_addr_ht(0x80000000); } + // Look up address in hash table first void *get_addr_ht(u_int vaddr) { @@ -763,13 +779,13 @@ void alloc_all(struct regstat *cur,int i) } #ifdef __i386__ -#include "assem_x86.c" +#include "x86/assem_x86.c" #endif #ifdef __x86_64__ -#include "assem_x64.c" +#include "x64/assem_x64.c" #endif #ifdef __arm__ -#include "assem_arm.c" +#include "arm/assem_arm.c" #endif // Add virtual address mapping to linked list @@ -943,23 +959,26 @@ static void invalidate_block_range(u_int block, u_int first, u_int last) assert(first+5>page); // NB: this assumes MAXBLOCK<=4096 (4 pages) assert(last<page+5); // Invalidate the adjacent pages if a block crosses a 4K boundary - while(first<page) { + while(first<page) + { invalidate_page(first); first++; } - for(first=page+1;first<last;first++) { + for(first=page+1;first<last;first++) + { invalidate_page(first); } - #ifdef __arm__ - do_clear_cache(); - #endif + +#ifdef __arm__ + do_clear_cache(); +#endif // Don't trap writes invalid_code[block]=1; - #ifdef USE_MINI_HT +#ifdef USE_MINI_HT memset(mini_ht,-1,sizeof(mini_ht)); - #endif +#endif } void invalidate_block(u_int block) @@ -967,19 +986,22 @@ void invalidate_block(u_int block) u_int page=get_page(block<<12); u_int vpage=get_vpage(block<<12); inv_debug("INVALIDATE: %x (%d)\n",block<<12,page); - //inv_debug("invalid_code[block]=%d\n",invalid_code[block]); u_int first,last; first=last=page; struct ll_entry *head; head=jump_dirty[vpage]; //printf("page=%d vpage=%d\n",page,vpage); - while(head!=NULL) { + while(head!=NULL) + { u_int start,end; - if(vpage>2047||(head->vaddr>>12)==block) { // Ignore vaddr hash collision + if(vpage>2047||(head->vaddr>>12)==block) + { // Ignore vaddr hash collision get_bounds((int)head->addr,&start,&end); //printf("start: %x end: %x\n",start,end); - if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) { - if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) { + if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) + { + if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) + { if((((start-(u_int)rdram)>>12)&2047)<first) first=((start-(u_int)rdram)>>12)&2047; if((((end-1-(u_int)rdram)>>12)&2047)>last) last=((end-1-(u_int)rdram)>>12)&2047; } @@ -1050,19 +1072,23 @@ void invalidate_addr(u_int addr) // This is called when loading a save state. // Anything could have changed, so invalidate everything. -void invalidate_all_pages() +void invalidate_all_pages(void) { u_int page; for(page=0;page<4096;page++) invalidate_page(page); for(page=0;page<1048576;page++) - if(!invalid_code[page]) { + { + if(!invalid_code[page]) + { restore_candidate[(page&2047)>>3]|=1<<(page&7); restore_candidate[((page&2047)>>3)+256]|=1<<(page&7); } - #ifdef USE_MINI_HT + } + +#ifdef USE_MINI_HT memset(mini_ht,-1,sizeof(mini_ht)); - #endif +#endif } // Add an entry to jump_out after making a link @@ -1087,37 +1113,48 @@ void clean_blocks(u_int page) struct ll_entry *head; inv_debug("INV: clean_blocks page=%d\n",page); head=jump_dirty[page]; - while(head!=NULL) { - if(!invalid_code[head->vaddr>>12]) { + while(head!=NULL) + { + if(!invalid_code[head->vaddr>>12]) + { // Don't restore blocks which are about to expire from the cache - if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) { + if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) + { u_int start,end; - if(verify_dirty(head->addr)) { + if(verify_dirty(head->addr)) + { //printf("Possibly Restore %x (%x)\n",head->vaddr, (int)head->addr); u_int i; u_int inv=0; get_bounds((int)head->addr,&start,&end); - if(start-(u_int)rdram<RAM_SIZE) { - for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) { + if(start-(u_int)rdram<RAM_SIZE) + { + for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) + { inv|=invalid_code[i]; } } - else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) { + else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) + { inv=1; } - if(!inv) { + if(!inv) + { void * clean_addr=(void *)get_clean_addr((int)head->addr); - if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) { + if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) + { u_int ppage=page; inv_debug("INV: Restored %x (%x/%x)\n",head->vaddr, (int)head->addr, (int)clean_addr); //printf("page=%x, addr=%x\n",page,head->vaddr); //assert(head->vaddr>>12==(page|0x80000)); ll_add_flags(jump_in+ppage,head->vaddr,head->reg_sv_flags,clean_addr); u_int *ht_bin=hash_table[((head->vaddr>>16)^head->vaddr)&0xFFFF]; - if(ht_bin[0]==head->vaddr) { + if(ht_bin[0]==head->vaddr) + { ht_bin[1]=(u_int)clean_addr; // Replace existing entry } - if(ht_bin[2]==head->vaddr) { + if(ht_bin[2]==head->vaddr) + { ht_bin[3]=(u_int)clean_addr; // Replace existing entry } } @@ -1129,15 +1166,17 @@ void clean_blocks(u_int page) } } - -void mov_alloc(struct regstat *current,int i) +static void mov_alloc(struct regstat *current,int i) { // Note: Don't need to actually alloc the source registers - if((~current->is32>>rs1[i])&1) { + if((~current->is32>>rs1[i])&1) + { //alloc_reg64(current,i,rs1[i]); alloc_reg64(current,i,rt1[i]); current->is32&=~(1LL<<rt1[i]); - } else { + } + else + { //alloc_reg(current,i,rs1[i]); alloc_reg(current,i,rt1[i]); current->is32|=(1LL<<rt1[i]); @@ -1695,7 +1734,8 @@ void syscall_alloc(struct regstat *current,int i) void delayslot_alloc(struct regstat *current,int i) { - switch(itype[i]) { + switch(itype[i]) + { case UJUMP: case CJUMP: case SJUMP: @@ -1845,7 +1885,8 @@ void wb_register(signed char r,signed char regmap[],uint64_t dirty,uint64_t is32 } } -int mchecksum() +#if 0 +static int mchecksum(void) { //if(!tracedebug) return 0; int i; @@ -1858,7 +1899,8 @@ int mchecksum() } return sum; } -int rchecksum() + +static int rchecksum(void) { int i; int sum=0; @@ -1866,7 +1908,8 @@ int rchecksum() sum^=((u_int *)reg)[i]; return sum; } -void rlist() + +static void rlist(void) { int i; printf("TRACE: "); @@ -1875,12 +1918,12 @@ void rlist() printf("\n"); } -void enabletrace() +static void enabletrace(void) { tracedebug=1; } -void memdebug(int i) +static void memdebug(int i) { //printf("TRACE: count=%d next=%d (checksum %x) lo=%8x%8x\n",Count,next_interupt,mchecksum(),(int)(reg[LOREG]>>32),(int)reg[LOREG]); //printf("TRACE: count=%d next=%d (rchecksum %x)\n",Count,next_interupt,rchecksum()); @@ -1905,6 +1948,7 @@ void memdebug(int i) } //printf("TRACE: %x\n",(&i)[-1]); } +#endif void alu_assemble(int i,struct regstat *i_regs) { @@ -7016,7 +7060,7 @@ static int new_dynarec_test(void) // clear the state completely, instead of just marking // things invalid like invalidate_all_pages() does -void new_dynarec_clear_full() +void new_dynarec_clear_full(void) { int n; out=(u_char *)BASE_ADDR; @@ -7037,7 +7081,7 @@ void new_dynarec_clear_full() for(n=0;n<4096;n++) ll_clear(jump_dirty+n); } -void new_dynarec_init() +void new_dynarec_init(void) { SysPrintf("Init new dynarec\n"); @@ -7045,37 +7089,45 @@ void new_dynarec_init() // see assem_arm.h for some explanation #if defined(BASE_ADDR_FIXED) if (mmap (translation_cache, 1 << TARGET_SIZE_2, - PROT_READ | PROT_WRITE | PROT_EXEC, - MAP_PRIVATE | MAP_ANONYMOUS, - -1, 0) != translation_cache) { + PROT_READ | PROT_WRITE | PROT_EXEC, + MAP_PRIVATE | MAP_ANONYMOUS, + -1, 0) != translation_cache) + { SysPrintf("mmap() failed: %s\n", strerror(errno)); SysPrintf("disable BASE_ADDR_FIXED and recompile\n"); abort(); } #elif defined(BASE_ADDR_DYNAMIC) - #ifdef VITA - sceBlock = sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2); +#ifdef VITA + sceBlock = getVMBlock();//sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2); if (sceBlock < 0) SysPrintf("sceKernelAllocMemBlockForVM failed\n"); int ret = sceKernelGetMemBlockBase(sceBlock, (void **)&translation_cache); if (ret < 0) SysPrintf("sceKernelGetMemBlockBase failed\n"); - #else + + sceKernelOpenVMDomain(); + sceClibPrintf("translation_cache = 0x%08X \n ", translation_cache); +#elif defined(_MSC_VER) + base_addr = VirtualAlloc(NULL, 1<<TARGET_SIZE_2, MEM_COMMIT | MEM_RESERVE, + PAGE_EXECUTE_READWRITE); +#else translation_cache = mmap (NULL, 1 << TARGET_SIZE_2, - PROT_READ | PROT_WRITE | PROT_EXEC, - MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); + PROT_READ | PROT_WRITE | PROT_EXEC, + MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); if (translation_cache == MAP_FAILED) { SysPrintf("mmap() failed: %s\n", strerror(errno)); abort(); } - #endif +#endif #else - #ifndef NO_WRITE_EXEC +#ifndef NO_WRITE_EXEC // not all systems allow execute in data segment by default if (mprotect((void *)BASE_ADDR, 1<<TARGET_SIZE_2, PROT_READ | PROT_WRITE | PROT_EXEC) != 0) SysPrintf("mprotect() failed: %s\n", strerror(errno)); - #endif #endif +#endif + out=(u_char *)BASE_ADDR; cycle_multiplier=200; new_dynarec_clear_full(); @@ -7092,24 +7144,28 @@ void new_dynarec_init() SysPrintf("warning: RAM is not directly mapped, performance will suffer\n"); } -void new_dynarec_cleanup() +void new_dynarec_cleanup(void) { int n; #if defined(BASE_ADDR_FIXED) || defined(BASE_ADDR_DYNAMIC) - #ifdef VITA - sceKernelFreeMemBlock(sceBlock); - sceBlock = -1; - #else +#ifndef VITA +#if defined(_MSC_VER) + VirtualFree(base_addr, 0, MEM_RELEASE); +#else if (munmap ((void *)BASE_ADDR, 1<<TARGET_SIZE_2) < 0) SysPrintf("munmap() failed\n"); - #endif #endif - for(n=0;n<4096;n++) ll_clear(jump_in+n); - for(n=0;n<4096;n++) ll_clear(jump_out+n); - for(n=0;n<4096;n++) ll_clear(jump_dirty+n); - #ifdef ROM_COPY +#endif +#endif + for(n=0;n<4096;n++) + ll_clear(jump_in+n); + for(n=0;n<4096;n++) + ll_clear(jump_out+n); + for(n=0;n<4096;n++) + ll_clear(jump_dirty+n); +#ifdef ROM_COPY if (munmap (ROM_COPY, 67108864) < 0) {SysPrintf("munmap() failed\n");} - #endif +#endif } static u_int *get_source_start(u_int addr, u_int *limit) diff --git a/libpcsxcore/new_dynarec/new_dynarec.h b/libpcsxcore/new_dynarec/new_dynarec.h index ddc84a5..e7eb247 100644 --- a/libpcsxcore/new_dynarec/new_dynarec.h +++ b/libpcsxcore/new_dynarec/new_dynarec.h @@ -11,12 +11,12 @@ extern int cycle_multiplier; // 100 for 1.0 #define NDHACK_GTE_NO_FLAGS (1<<2) extern int new_dynarec_hacks; -void new_dynarec_init(); -void new_dynarec_cleanup(); -void new_dynarec_clear_full(); -void new_dyna_start(); +void new_dynarec_init(void); +void new_dynarec_cleanup(void); +void new_dynarec_clear_full(void); +void new_dyna_start(void); int new_dynarec_save_blocks(void *save, int size); void new_dynarec_load_blocks(const void *save, int size); -void invalidate_all_pages(); +void invalidate_all_pages(void); void invalidate_block(unsigned int block); diff --git a/libpcsxcore/new_dynarec/new_dynarec_config.h b/libpcsxcore/new_dynarec/new_dynarec_config.h index fbd08ac..d55f128 100644 --- a/libpcsxcore/new_dynarec/new_dynarec_config.h +++ b/libpcsxcore/new_dynarec/new_dynarec_config.h @@ -4,7 +4,7 @@ #define USE_MINI_HT 1 //#define REG_PREFETCH 1 -#if defined(__MACH__) || defined(VITA) +#if defined(__MACH__) #define NO_WRITE_EXEC 1 #endif #ifdef VITA diff --git a/libpcsxcore/plugins.c b/libpcsxcore/plugins.c index e6d8a11..afe3f3b 100644 --- a/libpcsxcore/plugins.c +++ b/libpcsxcore/plugins.c @@ -1,836 +1,1198 @@ -/***************************************************************************
- * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *
- * *
- * This program is free software; you can redistribute it and/or modify *
- * it under the terms of the GNU General Public License as published by *
- * the Free Software Foundation; either version 2 of the License, or *
- * (at your option) any later version. *
- * *
- * This program is distributed in the hope that it will be useful, *
- * but WITHOUT ANY WARRANTY; without even the implied warranty of *
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *
- * GNU General Public License for more details. *
- * *
- * You should have received a copy of the GNU General Public License *
- * along with this program; if not, write to the *
- * Free Software Foundation, Inc., *
- * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *
- ***************************************************************************/
-
-/*
-* Plugin library callback/access functions.
-*/
-
-#include "plugins.h"
-#include "cdriso.h"
-
-static char IsoFile[MAXPATHLEN] = "";
-static s64 cdOpenCaseTime = 0;
-
-GPUupdateLace GPU_updateLace;
-GPUinit GPU_init;
-GPUshutdown GPU_shutdown;
-GPUconfigure GPU_configure;
-GPUtest GPU_test;
-GPUabout GPU_about;
-GPUopen GPU_open;
-GPUclose GPU_close;
-GPUreadStatus GPU_readStatus;
-GPUreadData GPU_readData;
-GPUreadDataMem GPU_readDataMem;
-GPUwriteStatus GPU_writeStatus;
-GPUwriteData GPU_writeData;
-GPUwriteDataMem GPU_writeDataMem;
-GPUdmaChain GPU_dmaChain;
-GPUkeypressed GPU_keypressed;
-GPUdisplayText GPU_displayText;
-GPUmakeSnapshot GPU_makeSnapshot;
-GPUfreeze GPU_freeze;
-GPUgetScreenPic GPU_getScreenPic;
-GPUshowScreenPic GPU_showScreenPic;
-GPUclearDynarec GPU_clearDynarec;
-GPUvBlank GPU_vBlank;
-
-CDRinit CDR_init;
-CDRshutdown CDR_shutdown;
-CDRopen CDR_open;
-CDRclose CDR_close;
-CDRtest CDR_test;
-CDRgetTN CDR_getTN;
-CDRgetTD CDR_getTD;
-CDRreadTrack CDR_readTrack;
-CDRgetBuffer CDR_getBuffer;
-CDRplay CDR_play;
-CDRstop CDR_stop;
-CDRgetStatus CDR_getStatus;
-CDRgetDriveLetter CDR_getDriveLetter;
-CDRgetBufferSub CDR_getBufferSub;
-CDRconfigure CDR_configure;
-CDRabout CDR_about;
-CDRsetfilename CDR_setfilename;
-CDRreadCDDA CDR_readCDDA;
-CDRgetTE CDR_getTE;
-
-SPUconfigure SPU_configure;
-SPUabout SPU_about;
-SPUinit SPU_init;
-SPUshutdown SPU_shutdown;
-SPUtest SPU_test;
-SPUopen SPU_open;
-SPUclose SPU_close;
-SPUplaySample SPU_playSample;
-SPUwriteRegister SPU_writeRegister;
-SPUreadRegister SPU_readRegister;
-SPUwriteDMA SPU_writeDMA;
-SPUreadDMA SPU_readDMA;
-SPUwriteDMAMem SPU_writeDMAMem;
-SPUreadDMAMem SPU_readDMAMem;
-SPUplayADPCMchannel SPU_playADPCMchannel;
-SPUfreeze SPU_freeze;
-SPUregisterCallback SPU_registerCallback;
-SPUregisterScheduleCb SPU_registerScheduleCb;
-SPUasync SPU_async;
-SPUplayCDDAchannel SPU_playCDDAchannel;
-
-PADconfigure PAD1_configure;
-PADabout PAD1_about;
-PADinit PAD1_init;
-PADshutdown PAD1_shutdown;
-PADtest PAD1_test;
-PADopen PAD1_open;
-PADclose PAD1_close;
-PADquery PAD1_query;
-PADreadPort1 PAD1_readPort1;
-PADkeypressed PAD1_keypressed;
-PADstartPoll PAD1_startPoll;
-PADpoll PAD1_poll;
-PADsetSensitive PAD1_setSensitive;
-
-PADconfigure PAD2_configure;
-PADabout PAD2_about;
-PADinit PAD2_init;
-PADshutdown PAD2_shutdown;
-PADtest PAD2_test;
-PADopen PAD2_open;
-PADclose PAD2_close;
-PADquery PAD2_query;
-PADreadPort2 PAD2_readPort2;
-PADkeypressed PAD2_keypressed;
-PADstartPoll PAD2_startPoll;
-PADpoll PAD2_poll;
-PADsetSensitive PAD2_setSensitive;
-
-NETinit NET_init;
-NETshutdown NET_shutdown;
-NETopen NET_open;
-NETclose NET_close;
-NETtest NET_test;
-NETconfigure NET_configure;
-NETabout NET_about;
-NETpause NET_pause;
-NETresume NET_resume;
-NETqueryPlayer NET_queryPlayer;
-NETsendData NET_sendData;
-NETrecvData NET_recvData;
-NETsendPadData NET_sendPadData;
-NETrecvPadData NET_recvPadData;
-NETsetInfo NET_setInfo;
-NETkeypressed NET_keypressed;
-
-#ifdef ENABLE_SIO1API
-
-SIO1init SIO1_init;
-SIO1shutdown SIO1_shutdown;
-SIO1open SIO1_open;
-SIO1close SIO1_close;
-SIO1test SIO1_test;
-SIO1configure SIO1_configure;
-SIO1about SIO1_about;
-SIO1pause SIO1_pause;
-SIO1resume SIO1_resume;
-SIO1keypressed SIO1_keypressed;
-SIO1writeData8 SIO1_writeData8;
-SIO1writeData16 SIO1_writeData16;
-SIO1writeData32 SIO1_writeData32;
-SIO1writeStat16 SIO1_writeStat16;
-SIO1writeStat32 SIO1_writeStat32;
-SIO1writeMode16 SIO1_writeMode16;
-SIO1writeMode32 SIO1_writeMode32;
-SIO1writeCtrl16 SIO1_writeCtrl16;
-SIO1writeCtrl32 SIO1_writeCtrl32;
-SIO1writeBaud16 SIO1_writeBaud16;
-SIO1writeBaud32 SIO1_writeBaud32;
-SIO1readData8 SIO1_readData8;
-SIO1readData16 SIO1_readData16;
-SIO1readData32 SIO1_readData32;
-SIO1readStat16 SIO1_readStat16;
-SIO1readStat32 SIO1_readStat32;
-SIO1readMode16 SIO1_readMode16;
-SIO1readMode32 SIO1_readMode32;
-SIO1readCtrl16 SIO1_readCtrl16;
-SIO1readCtrl32 SIO1_readCtrl32;
-SIO1readBaud16 SIO1_readBaud16;
-SIO1readBaud32 SIO1_readBaud32;
-SIO1registerCallback SIO1_registerCallback;
-
-#endif
-
-static const char *err;
-
-#define CheckErr(func) { \
- err = SysLibError(); \
- if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \
-}
-
-#define LoadSym(dest, src, name, checkerr) { \
- dest = (src)SysLoadSym(drv, name); \
- if (checkerr) { CheckErr(name); } else SysLibError(); \
-}
-
-void *hGPUDriver = NULL;
-
-void CALLBACK GPU__displayText(char *pText) {
- SysPrintf("%s\n", pText);
-}
-
-long CALLBACK GPU__configure(void) { return 0; }
-long CALLBACK GPU__test(void) { return 0; }
-void CALLBACK GPU__about(void) {}
-void CALLBACK GPU__makeSnapshot(void) {}
-void CALLBACK GPU__keypressed(int key) {}
-long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }
-long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }
-void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}
-void CALLBACK GPU__vBlank(int val) {}
-
-#define LoadGpuSym1(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, TRUE);
-
-#define LoadGpuSym0(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
- if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
-
-#define LoadGpuSymN(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, FALSE);
-
-static int LoadGPUplugin(const char *GPUdll) {
- void *drv;
-
- hGPUDriver = SysLoadLibrary(GPUdll);
- if (hGPUDriver == NULL) {
- GPU_configure = NULL;
- SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1;
- }
- drv = hGPUDriver;
- LoadGpuSym1(init, "GPUinit");
- LoadGpuSym1(shutdown, "GPUshutdown");
- LoadGpuSym1(open, "GPUopen");
- LoadGpuSym1(close, "GPUclose");
- LoadGpuSym1(readData, "GPUreadData");
- LoadGpuSym1(readDataMem, "GPUreadDataMem");
- LoadGpuSym1(readStatus, "GPUreadStatus");
- LoadGpuSym1(writeData, "GPUwriteData");
- LoadGpuSym1(writeDataMem, "GPUwriteDataMem");
- LoadGpuSym1(writeStatus, "GPUwriteStatus");
- LoadGpuSym1(dmaChain, "GPUdmaChain");
- LoadGpuSym1(updateLace, "GPUupdateLace");
- LoadGpuSym0(keypressed, "GPUkeypressed");
- LoadGpuSym0(displayText, "GPUdisplayText");
- LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");
- LoadGpuSym1(freeze, "GPUfreeze");
- LoadGpuSym0(getScreenPic, "GPUgetScreenPic");
- LoadGpuSym0(showScreenPic, "GPUshowScreenPic");
- LoadGpuSym0(clearDynarec, "GPUclearDynarec");
- LoadGpuSym0(vBlank, "GPUvBlank");
- LoadGpuSym0(configure, "GPUconfigure");
- LoadGpuSym0(test, "GPUtest");
- LoadGpuSym0(about, "GPUabout");
-
- return 0;
-}
-
-void *hCDRDriver = NULL;
-
-long CALLBACK CDR__play(unsigned char *sector) { return 0; }
-long CALLBACK CDR__stop(void) { return 0; }
-
-long CALLBACK CDR__getStatus(struct CdrStat *stat) {
- if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))
- stat->Status = 0x10;
- else
- stat->Status = 0;
-
- return 0;
-}
-
-char* CALLBACK CDR__getDriveLetter(void) { return NULL; }
-long CALLBACK CDR__configure(void) { return 0; }
-long CALLBACK CDR__test(void) { return 0; }
-void CALLBACK CDR__about(void) {}
-long CALLBACK CDR__setfilename(char*filename) { return 0; }
-
-#define LoadCdrSym1(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, TRUE);
-
-#define LoadCdrSym0(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, FALSE); \
- if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;
-
-#define LoadCdrSymN(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, FALSE);
-
-static int LoadCDRplugin(const char *CDRdll) {
- void *drv;
-
- if (CDRdll == NULL) {
- cdrIsoInit();
- return 0;
- }
-
- hCDRDriver = SysLoadLibrary(CDRdll);
- if (hCDRDriver == NULL) {
- CDR_configure = NULL;
- SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;
- }
- drv = hCDRDriver;
- LoadCdrSym1(init, "CDRinit");
- LoadCdrSym1(shutdown, "CDRshutdown");
- LoadCdrSym1(open, "CDRopen");
- LoadCdrSym1(close, "CDRclose");
- LoadCdrSym1(getTN, "CDRgetTN");
- LoadCdrSym1(getTD, "CDRgetTD");
- LoadCdrSym1(readTrack, "CDRreadTrack");
- LoadCdrSym1(getBuffer, "CDRgetBuffer");
- LoadCdrSym1(getBufferSub, "CDRgetBufferSub");
- LoadCdrSym0(play, "CDRplay");
- LoadCdrSym0(stop, "CDRstop");
- LoadCdrSym0(getStatus, "CDRgetStatus");
- LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");
- LoadCdrSym0(configure, "CDRconfigure");
- LoadCdrSym0(test, "CDRtest");
- LoadCdrSym0(about, "CDRabout");
- LoadCdrSym0(setfilename, "CDRsetfilename");
- LoadCdrSymN(readCDDA, "CDRreadCDDA");
- LoadCdrSymN(getTE, "CDRgetTE");
-
- return 0;
-}
-
-void *hSPUDriver = NULL;
-
-long CALLBACK SPU__configure(void) { return 0; }
-void CALLBACK SPU__about(void) {}
-long CALLBACK SPU__test(void) { return 0; }
-void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}
-
-#define LoadSpuSym1(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, TRUE);
-
-#define LoadSpuSym0(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, FALSE); \
- if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;
-
-#define LoadSpuSymN(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, FALSE);
-
-static int LoadSPUplugin(const char *SPUdll) {
- void *drv;
-
- hSPUDriver = SysLoadLibrary(SPUdll);
- if (hSPUDriver == NULL) {
- SPU_configure = NULL;
- SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;
- }
- drv = hSPUDriver;
- LoadSpuSym1(init, "SPUinit");
- LoadSpuSym1(shutdown, "SPUshutdown");
- LoadSpuSym1(open, "SPUopen");
- LoadSpuSym1(close, "SPUclose");
- LoadSpuSym0(configure, "SPUconfigure");
- LoadSpuSym0(about, "SPUabout");
- LoadSpuSym0(test, "SPUtest");
- LoadSpuSym1(writeRegister, "SPUwriteRegister");
- LoadSpuSym1(readRegister, "SPUreadRegister");
- LoadSpuSym1(writeDMA, "SPUwriteDMA");
- LoadSpuSym1(readDMA, "SPUreadDMA");
- LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");
- LoadSpuSym1(readDMAMem, "SPUreadDMAMem");
- LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");
- LoadSpuSym1(freeze, "SPUfreeze");
- LoadSpuSym1(registerCallback, "SPUregisterCallback");
- LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");
- LoadSpuSymN(async, "SPUasync");
- LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");
-
- return 0;
-}
-
-void *hPAD1Driver = NULL;
-void *hPAD2Driver = NULL;
-
-static unsigned char buf[256];
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-
-static int bufcount, bufc;
-
-PadDataS padd1, padd2;
-
-unsigned char _PADstartPoll(PadDataS *pad) {
- bufc = 0;
-
- switch (pad->controllerType) {
- case PSE_PAD_TYPE_MOUSE:
- mousepar[3] = pad->buttonStatus & 0xff;
- mousepar[4] = pad->buttonStatus >> 8;
- mousepar[5] = pad->moveX;
- mousepar[6] = pad->moveY;
-
- memcpy(buf, mousepar, 7);
- bufcount = 6;
- break;
- case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
- analogpar[1] = 0x23;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_ANALOGPAD: // scph1150
- analogpar[1] = 0x73;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_ANALOGJOY: // scph1110
- analogpar[1] = 0x53;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_STANDARD:
- default:
- stdpar[3] = pad->buttonStatus & 0xff;
- stdpar[4] = pad->buttonStatus >> 8;
-
- memcpy(buf, stdpar, 5);
- bufcount = 4;
- }
-
- return buf[bufc++];
-}
-
-unsigned char _PADpoll(unsigned char value) {
- if (bufc > bufcount) return 0;
- return buf[bufc++];
-}
-
-unsigned char CALLBACK PAD1__startPoll(int pad) {
- PadDataS padd;
-
- PAD1_readPort1(&padd);
-
- return _PADstartPoll(&padd);
-}
-
-unsigned char CALLBACK PAD1__poll(unsigned char value) {
- return _PADpoll(value);
-}
-
-long CALLBACK PAD1__configure(void) { return 0; }
-void CALLBACK PAD1__about(void) {}
-long CALLBACK PAD1__test(void) { return 0; }
-long CALLBACK PAD1__query(void) { return 3; }
-long CALLBACK PAD1__keypressed() { return 0; }
-
-#define LoadPad1Sym1(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, TRUE);
-
-#define LoadPad1SymN(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE);
-
-#define LoadPad1Sym0(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \
- if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;
-
-static int LoadPAD1plugin(const char *PAD1dll) {
- void *drv;
-
- hPAD1Driver = SysLoadLibrary(PAD1dll);
- if (hPAD1Driver == NULL) {
- PAD1_configure = NULL;
- SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;
- }
- drv = hPAD1Driver;
- LoadPad1Sym1(init, "PADinit");
- LoadPad1Sym1(shutdown, "PADshutdown");
- LoadPad1Sym1(open, "PADopen");
- LoadPad1Sym1(close, "PADclose");
- LoadPad1Sym0(query, "PADquery");
- LoadPad1Sym1(readPort1, "PADreadPort1");
- LoadPad1Sym0(configure, "PADconfigure");
- LoadPad1Sym0(test, "PADtest");
- LoadPad1Sym0(about, "PADabout");
- LoadPad1Sym0(keypressed, "PADkeypressed");
- LoadPad1Sym0(startPoll, "PADstartPoll");
- LoadPad1Sym0(poll, "PADpoll");
- LoadPad1SymN(setSensitive, "PADsetSensitive");
-
- return 0;
-}
-
-unsigned char CALLBACK PAD2__startPoll(int pad) {
- PadDataS padd;
-
- PAD2_readPort2(&padd);
-
- return _PADstartPoll(&padd);
-}
-
-unsigned char CALLBACK PAD2__poll(unsigned char value) {
- return _PADpoll(value);
-}
-
-long CALLBACK PAD2__configure(void) { return 0; }
-void CALLBACK PAD2__about(void) {}
-long CALLBACK PAD2__test(void) { return 0; }
-long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }
-long CALLBACK PAD2__keypressed() { return 0; }
-
-#define LoadPad2Sym1(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, TRUE);
-
-#define LoadPad2Sym0(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \
- if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;
-
-#define LoadPad2SymN(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE);
-
-static int LoadPAD2plugin(const char *PAD2dll) {
- void *drv;
-
- hPAD2Driver = SysLoadLibrary(PAD2dll);
- if (hPAD2Driver == NULL) {
- PAD2_configure = NULL;
- SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;
- }
- drv = hPAD2Driver;
- LoadPad2Sym1(init, "PADinit");
- LoadPad2Sym1(shutdown, "PADshutdown");
- LoadPad2Sym1(open, "PADopen");
- LoadPad2Sym1(close, "PADclose");
- LoadPad2Sym0(query, "PADquery");
- LoadPad2Sym1(readPort2, "PADreadPort2");
- LoadPad2Sym0(configure, "PADconfigure");
- LoadPad2Sym0(test, "PADtest");
- LoadPad2Sym0(about, "PADabout");
- LoadPad2Sym0(keypressed, "PADkeypressed");
- LoadPad2Sym0(startPoll, "PADstartPoll");
- LoadPad2Sym0(poll, "PADpoll");
- LoadPad2SymN(setSensitive, "PADsetSensitive");
-
- return 0;
-}
-
-void *hNETDriver = NULL;
-
-void CALLBACK NET__setInfo(netInfo *info) {}
-void CALLBACK NET__keypressed(int key) {}
-long CALLBACK NET__configure(void) { return 0; }
-long CALLBACK NET__test(void) { return 0; }
-void CALLBACK NET__about(void) {}
-
-#define LoadNetSym1(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, TRUE);
-
-#define LoadNetSymN(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, FALSE);
-
-#define LoadNetSym0(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, FALSE); \
- if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;
-
-static int LoadNETplugin(const char *NETdll) {
- void *drv;
-
- hNETDriver = SysLoadLibrary(NETdll);
- if (hNETDriver == NULL) {
- SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;
- }
- drv = hNETDriver;
- LoadNetSym1(init, "NETinit");
- LoadNetSym1(shutdown, "NETshutdown");
- LoadNetSym1(open, "NETopen");
- LoadNetSym1(close, "NETclose");
- LoadNetSymN(sendData, "NETsendData");
- LoadNetSymN(recvData, "NETrecvData");
- LoadNetSym1(sendPadData, "NETsendPadData");
- LoadNetSym1(recvPadData, "NETrecvPadData");
- LoadNetSym1(queryPlayer, "NETqueryPlayer");
- LoadNetSym1(pause, "NETpause");
- LoadNetSym1(resume, "NETresume");
- LoadNetSym0(setInfo, "NETsetInfo");
- LoadNetSym0(keypressed, "NETkeypressed");
- LoadNetSym0(configure, "NETconfigure");
- LoadNetSym0(test, "NETtest");
- LoadNetSym0(about, "NETabout");
-
- return 0;
-}
-
-#ifdef ENABLE_SIO1API
-
-void *hSIO1Driver = NULL;
-
-long CALLBACK SIO1__init(void) { return 0; }
-long CALLBACK SIO1__shutdown(void) { return 0; }
-long CALLBACK SIO1__open(void) { return 0; }
-long CALLBACK SIO1__close(void) { return 0; }
-long CALLBACK SIO1__configure(void) { return 0; }
-long CALLBACK SIO1__test(void) { return 0; }
-void CALLBACK SIO1__about(void) {}
-void CALLBACK SIO1__pause(void) {}
-void CALLBACK SIO1__resume(void) {}
-long CALLBACK SIO1__keypressed(int key) { return 0; }
-void CALLBACK SIO1__writeData8(unsigned char val) {}
-void CALLBACK SIO1__writeData16(unsigned short val) {}
-void CALLBACK SIO1__writeData32(unsigned long val) {}
-void CALLBACK SIO1__writeStat16(unsigned short val) {}
-void CALLBACK SIO1__writeStat32(unsigned long val) {}
-void CALLBACK SIO1__writeMode16(unsigned short val) {}
-void CALLBACK SIO1__writeMode32(unsigned long val) {}
-void CALLBACK SIO1__writeCtrl16(unsigned short val) {}
-void CALLBACK SIO1__writeCtrl32(unsigned long val) {}
-void CALLBACK SIO1__writeBaud16(unsigned short val) {}
-void CALLBACK SIO1__writeBaud32(unsigned long val) {}
-unsigned char CALLBACK SIO1__readData8(void) { return 0; }
-unsigned short CALLBACK SIO1__readData16(void) { return 0; }
-unsigned long CALLBACK SIO1__readData32(void) { return 0; }
-unsigned short CALLBACK SIO1__readStat16(void) { return 0; }
-unsigned long CALLBACK SIO1__readStat32(void) { return 0; }
-unsigned short CALLBACK SIO1__readMode16(void) { return 0; }
-unsigned long CALLBACK SIO1__readMode32(void) { return 0; }
-unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }
-unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }
-unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }
-unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }
-void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};
-
-void CALLBACK SIO1irq(void) {
- psxHu32ref(0x1070) |= SWAPu32(0x100);
-}
-
-#define LoadSio1Sym1(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);
-
-#define LoadSio1SymN(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);
-
-#define LoadSio1Sym0(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \
- if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;
-
-static int LoadSIO1plugin(const char *SIO1dll) {
- void *drv;
-
- hSIO1Driver = SysLoadLibrary(SIO1dll);
- if (hSIO1Driver == NULL) {
- SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;
- }
- drv = hSIO1Driver;
-
- LoadSio1Sym0(init, "SIO1init");
- LoadSio1Sym0(shutdown, "SIO1shutdown");
- LoadSio1Sym0(open, "SIO1open");
- LoadSio1Sym0(close, "SIO1close");
- LoadSio1Sym0(pause, "SIO1pause");
- LoadSio1Sym0(resume, "SIO1resume");
- LoadSio1Sym0(keypressed, "SIO1keypressed");
- LoadSio1Sym0(configure, "SIO1configure");
- LoadSio1Sym0(test, "SIO1test");
- LoadSio1Sym0(about, "SIO1about");
- LoadSio1Sym0(writeData8, "SIO1writeData8");
- LoadSio1Sym0(writeData16, "SIO1writeData16");
- LoadSio1Sym0(writeData32, "SIO1writeData32");
- LoadSio1Sym0(writeStat16, "SIO1writeStat16");
- LoadSio1Sym0(writeStat32, "SIO1writeStat32");
- LoadSio1Sym0(writeMode16, "SIO1writeMode16");
- LoadSio1Sym0(writeMode32, "SIO1writeMode32");
- LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");
- LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");
- LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");
- LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");
- LoadSio1Sym0(readData16, "SIO1readData16");
- LoadSio1Sym0(readData32, "SIO1readData32");
- LoadSio1Sym0(readStat16, "SIO1readStat16");
- LoadSio1Sym0(readStat32, "SIO1readStat32");
- LoadSio1Sym0(readMode16, "SIO1readMode16");
- LoadSio1Sym0(readMode32, "SIO1readMode32");
- LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");
- LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");
- LoadSio1Sym0(readBaud16, "SIO1readBaud16");
- LoadSio1Sym0(readBaud32, "SIO1readBaud32");
- LoadSio1Sym0(registerCallback, "SIO1registerCallback");
-
- return 0;
-}
-
-#endif
-
-void CALLBACK clearDynarec(void) {
- psxCpu->Reset();
-}
-
-int LoadPlugins() {
- int ret;
- char Plugin[MAXPATHLEN];
-
- ReleasePlugins();
- SysLibError();
-
- if (UsingIso()) {
- LoadCDRplugin(NULL);
- } else {
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
- if (LoadCDRplugin(Plugin) == -1) return -1;
- }
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);
- if (LoadGPUplugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);
- if (LoadSPUplugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);
- if (LoadPAD1plugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);
- if (LoadPAD2plugin(Plugin) == -1) return -1;
-
- if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)
- Config.UseNet = FALSE;
- else {
- Config.UseNet = TRUE;
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);
- if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;
- }
-
-#ifdef ENABLE_SIO1API
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);
- if (LoadSIO1plugin(Plugin) == -1) return -1;
-#endif
-
- ret = CDR_init();
- if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }
- ret = GPU_init();
- if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }
- ret = SPU_init();
- if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }
- ret = PAD1_init(1);
- if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }
- ret = PAD2_init(2);
- if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }
-
- if (Config.UseNet) {
- ret = NET_init();
- if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }
- }
-
-#ifdef ENABLE_SIO1API
- ret = SIO1_init();
- if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }
-#endif
-
- SysPrintf(_("Plugins loaded.\n"));
- return 0;
-}
-
-void ReleasePlugins() {
- if (Config.UseNet) {
- int ret = NET_close();
- if (ret < 0) Config.UseNet = FALSE;
- }
- NetOpened = FALSE;
-
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
- if (hGPUDriver != NULL) GPU_shutdown();
- if (hSPUDriver != NULL) SPU_shutdown();
- if (hPAD1Driver != NULL) PAD1_shutdown();
- if (hPAD2Driver != NULL) PAD2_shutdown();
-
- if (Config.UseNet && hNETDriver != NULL) NET_shutdown();
-
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
- if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;
- if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;
- if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;
- if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;
-
- if (Config.UseNet && hNETDriver != NULL) {
- SysCloseLibrary(hNETDriver); hNETDriver = NULL;
- }
-
-#ifdef ENABLE_SIO1API
- if (hSIO1Driver != NULL) {
- SIO1_shutdown();
- SysCloseLibrary(hSIO1Driver);
- hSIO1Driver = NULL;
- }
-#endif
-}
-
-// for CD swap
-int ReloadCdromPlugin()
-{
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
-
- if (UsingIso()) {
- LoadCDRplugin(NULL);
- } else {
- char Plugin[MAXPATHLEN];
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
- if (LoadCDRplugin(Plugin) == -1) return -1;
- }
-
- return CDR_init();
-}
-
-void SetIsoFile(const char *filename) {
- if (filename == NULL) {
- IsoFile[0] = '\0';
- return;
- }
- strncpy(IsoFile, filename, MAXPATHLEN);
-}
-
-const char *GetIsoFile(void) {
- return IsoFile;
-}
-
-boolean UsingIso(void) {
- return (IsoFile[0] != '\0');
-}
-
-void SetCdOpenCaseTime(s64 time) {
- cdOpenCaseTime = time;
-}
+/*************************************************************************** + * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team * + * * + * This program is free software; you can redistribute it and/or modify * + * it under the terms of the GNU General Public License as published by * + * the Free Software Foundation; either version 2 of the License, or * + * (at your option) any later version. * + * * + * This program is distributed in the hope that it will be useful, * + * but WITHOUT ANY WARRANTY; without even the implied warranty of * + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * + * GNU General Public License for more details. * + * * + * You should have received a copy of the GNU General Public License * + * along with this program; if not, write to the * + * Free Software Foundation, Inc., * + * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. * + ***************************************************************************/ + +/* +* Plugin library callback/access functions. +*/ + +#include "plugins.h" +#include "cdriso.h" +#include "../plugins/dfinput/externals.h" + +static char IsoFile[MAXPATHLEN] = ""; +static s64 cdOpenCaseTime = 0; + +GPUupdateLace GPU_updateLace; +GPUinit GPU_init; +GPUshutdown GPU_shutdown; +GPUconfigure GPU_configure; +GPUtest GPU_test; +GPUabout GPU_about; +GPUopen GPU_open; +GPUclose GPU_close; +GPUreadStatus GPU_readStatus; +GPUreadData GPU_readData; +GPUreadDataMem GPU_readDataMem; +GPUwriteStatus GPU_writeStatus; +GPUwriteData GPU_writeData; +GPUwriteDataMem GPU_writeDataMem; +GPUdmaChain GPU_dmaChain; +GPUkeypressed GPU_keypressed; +GPUdisplayText GPU_displayText; +GPUmakeSnapshot GPU_makeSnapshot; +GPUfreeze GPU_freeze; +GPUgetScreenPic GPU_getScreenPic; +GPUshowScreenPic GPU_showScreenPic; +GPUclearDynarec GPU_clearDynarec; +GPUvBlank GPU_vBlank; + +CDRinit CDR_init; +CDRshutdown CDR_shutdown; +CDRopen CDR_open; +CDRclose CDR_close; +CDRtest CDR_test; +CDRgetTN CDR_getTN; +CDRgetTD CDR_getTD; +CDRreadTrack CDR_readTrack; +CDRgetBuffer CDR_getBuffer; +CDRplay CDR_play; +CDRstop CDR_stop; +CDRgetStatus CDR_getStatus; +CDRgetDriveLetter CDR_getDriveLetter; +CDRgetBufferSub CDR_getBufferSub; +CDRconfigure CDR_configure; +CDRabout CDR_about; +CDRsetfilename CDR_setfilename; +CDRreadCDDA CDR_readCDDA; +CDRgetTE CDR_getTE; + +SPUconfigure SPU_configure; +SPUabout SPU_about; +SPUinit SPU_init; +SPUshutdown SPU_shutdown; +SPUtest SPU_test; +SPUopen SPU_open; +SPUclose SPU_close; +SPUplaySample SPU_playSample; +SPUwriteRegister SPU_writeRegister; +SPUreadRegister SPU_readRegister; +SPUwriteDMA SPU_writeDMA; +SPUreadDMA SPU_readDMA; +SPUwriteDMAMem SPU_writeDMAMem; +SPUreadDMAMem SPU_readDMAMem; +SPUplayADPCMchannel SPU_playADPCMchannel; +SPUfreeze SPU_freeze; +SPUregisterCallback SPU_registerCallback; +SPUregisterScheduleCb SPU_registerScheduleCb; +SPUasync SPU_async; +SPUplayCDDAchannel SPU_playCDDAchannel; + +PADconfigure PAD1_configure; +PADabout PAD1_about; +PADinit PAD1_init; +PADshutdown PAD1_shutdown; +PADtest PAD1_test; +PADopen PAD1_open; +PADclose PAD1_close; +PADquery PAD1_query; +PADreadPort1 PAD1_readPort1; +PADkeypressed PAD1_keypressed; +PADstartPoll PAD1_startPoll; +PADpoll PAD1_poll; +PADsetSensitive PAD1_setSensitive; + +PADconfigure PAD2_configure; +PADabout PAD2_about; +PADinit PAD2_init; +PADshutdown PAD2_shutdown; +PADtest PAD2_test; +PADopen PAD2_open; +PADclose PAD2_close; +PADquery PAD2_query; +PADreadPort2 PAD2_readPort2; +PADkeypressed PAD2_keypressed; +PADstartPoll PAD2_startPoll; +PADpoll PAD2_poll; +PADsetSensitive PAD2_setSensitive; + +NETinit NET_init; +NETshutdown NET_shutdown; +NETopen NET_open; +NETclose NET_close; +NETtest NET_test; +NETconfigure NET_configure; +NETabout NET_about; +NETpause NET_pause; +NETresume NET_resume; +NETqueryPlayer NET_queryPlayer; +NETsendData NET_sendData; +NETrecvData NET_recvData; +NETsendPadData NET_sendPadData; +NETrecvPadData NET_recvPadData; +NETsetInfo NET_setInfo; +NETkeypressed NET_keypressed; + +#ifdef ENABLE_SIO1API + +SIO1init SIO1_init; +SIO1shutdown SIO1_shutdown; +SIO1open SIO1_open; +SIO1close SIO1_close; +SIO1test SIO1_test; +SIO1configure SIO1_configure; +SIO1about SIO1_about; +SIO1pause SIO1_pause; +SIO1resume SIO1_resume; +SIO1keypressed SIO1_keypressed; +SIO1writeData8 SIO1_writeData8; +SIO1writeData16 SIO1_writeData16; +SIO1writeData32 SIO1_writeData32; +SIO1writeStat16 SIO1_writeStat16; +SIO1writeStat32 SIO1_writeStat32; +SIO1writeMode16 SIO1_writeMode16; +SIO1writeMode32 SIO1_writeMode32; +SIO1writeCtrl16 SIO1_writeCtrl16; +SIO1writeCtrl32 SIO1_writeCtrl32; +SIO1writeBaud16 SIO1_writeBaud16; +SIO1writeBaud32 SIO1_writeBaud32; +SIO1readData8 SIO1_readData8; +SIO1readData16 SIO1_readData16; +SIO1readData32 SIO1_readData32; +SIO1readStat16 SIO1_readStat16; +SIO1readStat32 SIO1_readStat32; +SIO1readMode16 SIO1_readMode16; +SIO1readMode32 SIO1_readMode32; +SIO1readCtrl16 SIO1_readCtrl16; +SIO1readCtrl32 SIO1_readCtrl32; +SIO1readBaud16 SIO1_readBaud16; +SIO1readBaud32 SIO1_readBaud32; +SIO1registerCallback SIO1_registerCallback; + +#endif + +static const char *err; + +#define CheckErr(func) { \ + err = SysLibError(); \ + if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \ +} + +#define LoadSym(dest, src, name, checkerr) { \ + dest = (src)SysLoadSym(drv, name); \ + if (checkerr) { CheckErr(name); } else SysLibError(); \ +} + +void *hGPUDriver = NULL; + +void CALLBACK GPU__displayText(char *pText) { + SysPrintf("%s\n", pText); +} + +long CALLBACK GPU__configure(void) { return 0; } +long CALLBACK GPU__test(void) { return 0; } +void CALLBACK GPU__about(void) {} +void CALLBACK GPU__makeSnapshot(void) {} +void CALLBACK GPU__keypressed(int key) {} +long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; } +long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; } +void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {} +void CALLBACK GPU__vBlank(int val) {} + +#define LoadGpuSym1(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, TRUE); + +#define LoadGpuSym0(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, FALSE); \ + if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest; + +#define LoadGpuSymN(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, FALSE); + +static int LoadGPUplugin(const char *GPUdll) { + void *drv; + + hGPUDriver = SysLoadLibrary(GPUdll); + if (hGPUDriver == NULL) { + GPU_configure = NULL; + SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1; + } + drv = hGPUDriver; + LoadGpuSym1(init, "GPUinit"); + LoadGpuSym1(shutdown, "GPUshutdown"); + LoadGpuSym1(open, "GPUopen"); + LoadGpuSym1(close, "GPUclose"); + LoadGpuSym1(readData, "GPUreadData"); + LoadGpuSym1(readDataMem, "GPUreadDataMem"); + LoadGpuSym1(readStatus, "GPUreadStatus"); + LoadGpuSym1(writeData, "GPUwriteData"); + LoadGpuSym1(writeDataMem, "GPUwriteDataMem"); + LoadGpuSym1(writeStatus, "GPUwriteStatus"); + LoadGpuSym1(dmaChain, "GPUdmaChain"); + LoadGpuSym1(updateLace, "GPUupdateLace"); + LoadGpuSym0(keypressed, "GPUkeypressed"); + LoadGpuSym0(displayText, "GPUdisplayText"); + LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot"); + LoadGpuSym1(freeze, "GPUfreeze"); + LoadGpuSym0(getScreenPic, "GPUgetScreenPic"); + LoadGpuSym0(showScreenPic, "GPUshowScreenPic"); + LoadGpuSym0(clearDynarec, "GPUclearDynarec"); + LoadGpuSym0(vBlank, "GPUvBlank"); + LoadGpuSym0(configure, "GPUconfigure"); + LoadGpuSym0(test, "GPUtest"); + LoadGpuSym0(about, "GPUabout"); + + return 0; +} + +void *hCDRDriver = NULL; + +long CALLBACK CDR__play(unsigned char *sector) { return 0; } +long CALLBACK CDR__stop(void) { return 0; } + +long CALLBACK CDR__getStatus(struct CdrStat *stat) { + if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL)) + stat->Status = 0x10; + else + stat->Status = 0; + + return 0; +} + +char* CALLBACK CDR__getDriveLetter(void) { return NULL; } +long CALLBACK CDR__configure(void) { return 0; } +long CALLBACK CDR__test(void) { return 0; } +void CALLBACK CDR__about(void) {} +long CALLBACK CDR__setfilename(char*filename) { return 0; } + +#define LoadCdrSym1(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, TRUE); + +#define LoadCdrSym0(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, FALSE); \ + if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest; + +#define LoadCdrSymN(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, FALSE); + +static int LoadCDRplugin(const char *CDRdll) { + void *drv; + + if (CDRdll == NULL) { + cdrIsoInit(); + return 0; + } + + hCDRDriver = SysLoadLibrary(CDRdll); + if (hCDRDriver == NULL) { + CDR_configure = NULL; + SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1; + } + drv = hCDRDriver; + LoadCdrSym1(init, "CDRinit"); + LoadCdrSym1(shutdown, "CDRshutdown"); + LoadCdrSym1(open, "CDRopen"); + LoadCdrSym1(close, "CDRclose"); + LoadCdrSym1(getTN, "CDRgetTN"); + LoadCdrSym1(getTD, "CDRgetTD"); + LoadCdrSym1(readTrack, "CDRreadTrack"); + LoadCdrSym1(getBuffer, "CDRgetBuffer"); + LoadCdrSym1(getBufferSub, "CDRgetBufferSub"); + LoadCdrSym0(play, "CDRplay"); + LoadCdrSym0(stop, "CDRstop"); + LoadCdrSym0(getStatus, "CDRgetStatus"); + LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter"); + LoadCdrSym0(configure, "CDRconfigure"); + LoadCdrSym0(test, "CDRtest"); + LoadCdrSym0(about, "CDRabout"); + LoadCdrSym0(setfilename, "CDRsetfilename"); + LoadCdrSymN(readCDDA, "CDRreadCDDA"); + LoadCdrSymN(getTE, "CDRgetTE"); + + return 0; +} + +void *hSPUDriver = NULL; + +long CALLBACK SPU__configure(void) { return 0; } +void CALLBACK SPU__about(void) {} +long CALLBACK SPU__test(void) { return 0; } +void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {} + +#define LoadSpuSym1(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, TRUE); + +#define LoadSpuSym0(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, FALSE); \ + if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest; + +#define LoadSpuSymN(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, FALSE); + +static int LoadSPUplugin(const char *SPUdll) { + void *drv; + + hSPUDriver = SysLoadLibrary(SPUdll); + if (hSPUDriver == NULL) { + SPU_configure = NULL; + SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1; + } + drv = hSPUDriver; + LoadSpuSym1(init, "SPUinit"); + LoadSpuSym1(shutdown, "SPUshutdown"); + LoadSpuSym1(open, "SPUopen"); + LoadSpuSym1(close, "SPUclose"); + LoadSpuSym0(configure, "SPUconfigure"); + LoadSpuSym0(about, "SPUabout"); + LoadSpuSym0(test, "SPUtest"); + LoadSpuSym1(writeRegister, "SPUwriteRegister"); + LoadSpuSym1(readRegister, "SPUreadRegister"); + LoadSpuSym1(writeDMA, "SPUwriteDMA"); + LoadSpuSym1(readDMA, "SPUreadDMA"); + LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem"); + LoadSpuSym1(readDMAMem, "SPUreadDMAMem"); + LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel"); + LoadSpuSym1(freeze, "SPUfreeze"); + LoadSpuSym1(registerCallback, "SPUregisterCallback"); + LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb"); + LoadSpuSymN(async, "SPUasync"); + LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel"); + + return 0; +} + +void *hPAD1Driver = NULL; +void *hPAD2Driver = NULL; + +static int multitap1 = -1; +static int multitap2 = -1; +//Pad information, keystate, mode, config mode, vibration +static PadDataS pad[8]; + +static int reqPos, respSize, req; +static int ledStateReq44[8]; + +static unsigned char buf[256]; +static unsigned char bufMulti[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; + +unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; +unsigned char multitappar[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; + +//response for request 44, 45, 46, 47, 4C, 4D +static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00}; +static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A}; +static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14}; +static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00}; +static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00}; +static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00}; +static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF}; + +//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F +static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; + +// Resquest of psx core +enum { + // REQUEST + // first call of this request for the pad, the pad is configured as an digital pad. + // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00 + // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D) + // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad + // Y if 0 : psx request a pad key state + // ZZ rumble small motor 00-> OFF, 01 -> ON + // AA rumble large motor speed 0x00 -> 0xFF + // RESPONSE + // header 3 Bytes + // 0x00 + // PadId -> 0x41 for digital pas, 0x73 for analog pad + // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch + // 6 Bytes for keystates + CMD_READ_DATA_AND_VIBRATE = 0x42, + + // REQUEST + // Header + // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // XX = 00 -> Normal mode : Seconde bytes of response = padId + // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3 + // RESPONSE + // enter in config mode example : + // req : 01 43 00 01 00 00 00 00 00 00 + // res : 00 41 5A buttons state, analog states + // exit config mode : + // req : 01 43 00 00 00 00 00 00 00 00 + // res : 00 F3 5A buttons state, analog states + CMD_CONFIG_MODE = 0x43, + + // Set led State + // REQUEST + // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00 + // If sel = 2 then + // VAL = 00 -> OFF + // VAL = 01 -> ON + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + CMD_SET_MODE_AND_LOCK = 0x44, + + // Get Analog Led state + // REQUEST + // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00 + // VAL = 00 Led OFF + // VAL = 01 Led ON + CMD_QUERY_MODEL_AND_MODE = 0x45, + + //Get Variable A + // REQUEST + // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX=00 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A + // XX=01 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14 + CMD_QUERY_ACT = 0x46, + + // REQUEST + // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00 + CMD_QUERY_COMB = 0x47, + + // REQUEST + // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX = 0 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00 + // XX = 1 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00 + CMD_QUERY_MODE = 0x4C, + + // REQUEST + // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF + // RESPONSE + // 0x00, 0xF3, 0x5A, old value or + // AA = 01 unlock large motor (and swap VAL1 and VAL2) + // BB = 01 unlock large motor (default) + // CC, DD, EE, FF = all FF -> unlock small motor + // + // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF + // + CMD_VIBRATION_TOGGLE = 0x4D, + REQ40 = 0x40, + REQ41 = 0x41, + REQ49 = 0x49, + REQ4A = 0x4A, + REQ4B = 0x4B, + REQ4E = 0x4E, + REQ4F = 0x4F +}; + + + + +//NO MULTITAP + +void initBufForRequest(int padIndex, char value){ + switch (value){ + //Pad keystate already in buffer + //case CMD_READ_DATA_AND_VIBRATE : + // break; + case CMD_CONFIG_MODE : + if (pad[padIndex].configMode == 1) { + memcpy(buf, resp43, 8); + break; + } + //else, not in config mode, pad keystate return (already in the buffer) + break; + case CMD_SET_MODE_AND_LOCK : + memcpy(buf, resp44, 8); + break; + case CMD_QUERY_MODEL_AND_MODE : + memcpy(buf, resp45, 8); + break; + case CMD_QUERY_ACT : + memcpy(buf, resp46_00, 8); + break; + case CMD_QUERY_COMB : + memcpy(buf, resp47, 8); + break; + case CMD_QUERY_MODE : + memcpy(buf, resp4C_00, 8); + break; + case CMD_VIBRATION_TOGGLE : + memcpy(buf, resp4D, 8); + break; + case REQ40 : + memcpy(buf, resp40, 8); + break; + case REQ41 : + memcpy(buf, resp41, 8); + break; + case REQ49 : + memcpy(buf, resp49, 8); + break; + case REQ4A : + memcpy(buf, resp4A, 8); + break; + case REQ4B : + memcpy(buf, resp4B, 8); + break; + case REQ4E : + memcpy(buf, resp4E, 8); + break; + case REQ4F : + memcpy(buf, resp4F, 8); + break; + } +} + + + + +void reqIndex2Treatment(int padIndex, char value){ + switch (req){ + case CMD_CONFIG_MODE : + //0x43 + if (value == 0) { + pad[padIndex].configMode = 0; + } else { + pad[padIndex].configMode = 1; + } + break; + case CMD_SET_MODE_AND_LOCK : + //0x44 store the led state for change mode if the next value = 0x02 + //0x01 analog ON + //0x00 analog OFF + ledStateReq44[padIndex] = value; + break; + case CMD_QUERY_ACT : + //0x46 + if (value == 1) { + memcpy(buf, resp46_01, 8); + } + break; + case CMD_QUERY_MODE : + if (value == 1) { + memcpy(buf, resp4C_01, 8); + } + break; + case CMD_VIBRATION_TOGGLE : + //0x4D + memcpy(buf, resp4D, 8); + break; + case CMD_READ_DATA_AND_VIBRATE: + //mem the vibration value for small motor; + pad[padIndex].Vib[0] = value; + break; + } +} + +void vibrate(int padIndex){ + if (pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]) { + //value is different update Value and call libretro for vibration + pad[padIndex].VibF[0] = pad[padIndex].Vib[0]; + pad[padIndex].VibF[1] = pad[padIndex].Vib[1]; + plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]); + //printf("vibration pad %i", padIndex); + } +} + + + + +//Build response for 0x42 request Pad in port +void _PADstartPoll(PadDataS *pad) { + switch (pad->controllerType) { + case PSE_PAD_TYPE_MOUSE: + stdpar[0] = 0x12; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->moveX; + stdpar[5] = pad->moveY; + memcpy(buf, stdpar, 6); + respSize = 6; + break; + case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069) + stdpar[0] = 0x23; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_ANALOGPAD: // scph1150 + stdpar[0] = 0x73; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_ANALOGJOY: // scph1110 + stdpar[0] = 0x53; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_STANDARD: + default: + stdpar[0] = 0x41; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + //avoid analog value in multitap mode if change pad type in game. + stdpar[4] = 0xff; + stdpar[5] = 0xff; + stdpar[6] = 0xff; + stdpar[7] = 0xff; + memcpy(buf, stdpar, 8); + respSize = 8; + } +} + + +//Build response for 0x42 request Multitap in port +//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D) +void _PADstartPollMultitap(PadDataS* padd) { + int i, offset; + for(i = 0; i < 4; i++) { + offset = 2 + (i * 8); + _PADstartPoll(&padd[i]); + memcpy(multitappar+offset, stdpar, 8); + } + memcpy(bufMulti, multitappar, 34); + respSize = 34; +} + + +unsigned char _PADpoll(int port, unsigned char value) { + if (reqPos == 0) { + //mem the request number + req = value; + //copy the default value of request response in buffer instead of the keystate + initBufForRequest(port, value); + } + + //if no new request the pad return 0xff, for signaling connected + if (reqPos >= respSize) return 0xff; + + switch(reqPos){ + case 2: + reqIndex2Treatment(port, value); + break; + case 3: + switch(req) { + case CMD_SET_MODE_AND_LOCK : + //change mode on pad + break; + case CMD_READ_DATA_AND_VIBRATE: + //mem the vibration value for Large motor; + pad[port].Vib[1] = value; + //vibration + vibrate(port); + break; + } + break; + } + return buf[reqPos++]; +} + + +unsigned char _PADpollMultitap(int port, unsigned char value) { + if (reqPos >= respSize) return 0xff; + return bufMulti[reqPos++]; +} + + +// refresh the button state on port 1. +// int pad is not needed. +unsigned char CALLBACK PAD1__startPoll(int pad) { + reqPos = 0; + // first call the pad provide if a multitap is connected between the psx and himself + if (multitap1 == -1) { + PadDataS padd; + padd.requestPadIndex = 0; + PAD1_readPort1(&padd); + multitap1 = padd.portMultitap; + } + // just one pad is on port 1 : NO MULTITAP + if (multitap1 == 0) { + PadDataS padd; + padd.requestPadIndex = 0; + PAD1_readPort1(&padd); + _PADstartPoll(&padd); + } else { + // a multitap is plugged : refresh all pad. + int i; + PadDataS padd[4]; + for(i = 0; i < 4; i++) { + padd[i].requestPadIndex = i; + PAD1_readPort1(&padd[i]); + } + _PADstartPollMultitap(padd); + } + //printf("\npad 1 : "); + return 0x00; +} + +unsigned char CALLBACK PAD1__poll(unsigned char value) { + char tmp; + if (multitap1 == 1) { + tmp = _PADpollMultitap(0, value); + } else { + tmp = _PADpoll(0, value); + } + //printf("%2x:%2x, ",value,tmp); + return tmp; + +} + + +long CALLBACK PAD1__configure(void) { return 0; } +void CALLBACK PAD1__about(void) {} +long CALLBACK PAD1__test(void) { return 0; } +long CALLBACK PAD1__query(void) { return 3; } +long CALLBACK PAD1__keypressed() { return 0; } + +#define LoadPad1Sym1(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, TRUE); + +#define LoadPad1SymN(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, FALSE); + +#define LoadPad1Sym0(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \ + if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest; + +static int LoadPAD1plugin(const char *PAD1dll) { + void *drv; + + hPAD1Driver = SysLoadLibrary(PAD1dll); + if (hPAD1Driver == NULL) { + PAD1_configure = NULL; + SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1; + } + drv = hPAD1Driver; + LoadPad1Sym1(init, "PADinit"); + LoadPad1Sym1(shutdown, "PADshutdown"); + LoadPad1Sym1(open, "PADopen"); + LoadPad1Sym1(close, "PADclose"); + LoadPad1Sym0(query, "PADquery"); + LoadPad1Sym1(readPort1, "PADreadPort1"); + LoadPad1Sym0(configure, "PADconfigure"); + LoadPad1Sym0(test, "PADtest"); + LoadPad1Sym0(about, "PADabout"); + LoadPad1Sym0(keypressed, "PADkeypressed"); + LoadPad1Sym0(startPoll, "PADstartPoll"); + LoadPad1Sym0(poll, "PADpoll"); + LoadPad1SymN(setSensitive, "PADsetSensitive"); + + return 0; +} + +unsigned char CALLBACK PAD2__startPoll(int pad) { + int pad_index; + + reqPos = 0; + if (multitap1 == 0 && (multitap2 == 0 || multitap2 == 2)) { + pad_index = 1; + } else if(multitap1 == 1 && (multitap2 == 0 || multitap2 == 2)) { + pad_index = 4; + } else { + pad_index = 0; + } + + //first call the pad provide if a multitap is connected between the psx and himself + if (multitap2 == -1) { + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd); + multitap2 = padd.portMultitap; + } + + // just one pad is on port 1 : NO MULTITAP + if (multitap2 == 0) { + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd); + _PADstartPoll(&padd); + } else { + // a multitap is plugged : refresh all pad. + int i; + PadDataS padd[4]; + for(i = 0; i < 4; i++) { + padd[i].requestPadIndex = i+pad_index; + PAD2_readPort2(&padd[i]); + } + _PADstartPollMultitap(padd); + } + //printf("\npad 2 : "); + return 0x00; +} + +unsigned char CALLBACK PAD2__poll(unsigned char value) { + char tmp; + if (multitap2 == 2) { + tmp = _PADpollMultitap(1, value); + } else { + tmp = _PADpoll(1, value); + } + //printf("%2x:%2x, ",value,tmp); + return tmp; +} + +long CALLBACK PAD2__configure(void) { return 0; } +void CALLBACK PAD2__about(void) {} +long CALLBACK PAD2__test(void) { return 0; } +long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; } +long CALLBACK PAD2__keypressed() { return 0; } + +#define LoadPad2Sym1(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, TRUE); + +#define LoadPad2Sym0(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \ + if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest; + +#define LoadPad2SymN(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, FALSE); + +static int LoadPAD2plugin(const char *PAD2dll) { + void *drv; + + hPAD2Driver = SysLoadLibrary(PAD2dll); + if (hPAD2Driver == NULL) { + PAD2_configure = NULL; + SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1; + } + drv = hPAD2Driver; + LoadPad2Sym1(init, "PADinit"); + LoadPad2Sym1(shutdown, "PADshutdown"); + LoadPad2Sym1(open, "PADopen"); + LoadPad2Sym1(close, "PADclose"); + LoadPad2Sym0(query, "PADquery"); + LoadPad2Sym1(readPort2, "PADreadPort2"); + LoadPad2Sym0(configure, "PADconfigure"); + LoadPad2Sym0(test, "PADtest"); + LoadPad2Sym0(about, "PADabout"); + LoadPad2Sym0(keypressed, "PADkeypressed"); + LoadPad2Sym0(startPoll, "PADstartPoll"); + LoadPad2Sym0(poll, "PADpoll"); + LoadPad2SymN(setSensitive, "PADsetSensitive"); + + return 0; +} + +void *hNETDriver = NULL; + +void CALLBACK NET__setInfo(netInfo *info) {} +void CALLBACK NET__keypressed(int key) {} +long CALLBACK NET__configure(void) { return 0; } +long CALLBACK NET__test(void) { return 0; } +void CALLBACK NET__about(void) {} + +#define LoadNetSym1(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, TRUE); + +#define LoadNetSymN(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, FALSE); + +#define LoadNetSym0(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, FALSE); \ + if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest; + +static int LoadNETplugin(const char *NETdll) { + void *drv; + + hNETDriver = SysLoadLibrary(NETdll); + if (hNETDriver == NULL) { + SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1; + } + drv = hNETDriver; + LoadNetSym1(init, "NETinit"); + LoadNetSym1(shutdown, "NETshutdown"); + LoadNetSym1(open, "NETopen"); + LoadNetSym1(close, "NETclose"); + LoadNetSymN(sendData, "NETsendData"); + LoadNetSymN(recvData, "NETrecvData"); + LoadNetSym1(sendPadData, "NETsendPadData"); + LoadNetSym1(recvPadData, "NETrecvPadData"); + LoadNetSym1(queryPlayer, "NETqueryPlayer"); + LoadNetSym1(pause, "NETpause"); + LoadNetSym1(resume, "NETresume"); + LoadNetSym0(setInfo, "NETsetInfo"); + LoadNetSym0(keypressed, "NETkeypressed"); + LoadNetSym0(configure, "NETconfigure"); + LoadNetSym0(test, "NETtest"); + LoadNetSym0(about, "NETabout"); + + return 0; +} + +#ifdef ENABLE_SIO1API + +void *hSIO1Driver = NULL; + +long CALLBACK SIO1__init(void) { return 0; } +long CALLBACK SIO1__shutdown(void) { return 0; } +long CALLBACK SIO1__open(void) { return 0; } +long CALLBACK SIO1__close(void) { return 0; } +long CALLBACK SIO1__configure(void) { return 0; } +long CALLBACK SIO1__test(void) { return 0; } +void CALLBACK SIO1__about(void) {} +void CALLBACK SIO1__pause(void) {} +void CALLBACK SIO1__resume(void) {} +long CALLBACK SIO1__keypressed(int key) { return 0; } +void CALLBACK SIO1__writeData8(unsigned char val) {} +void CALLBACK SIO1__writeData16(unsigned short val) {} +void CALLBACK SIO1__writeData32(unsigned long val) {} +void CALLBACK SIO1__writeStat16(unsigned short val) {} +void CALLBACK SIO1__writeStat32(unsigned long val) {} +void CALLBACK SIO1__writeMode16(unsigned short val) {} +void CALLBACK SIO1__writeMode32(unsigned long val) {} +void CALLBACK SIO1__writeCtrl16(unsigned short val) {} +void CALLBACK SIO1__writeCtrl32(unsigned long val) {} +void CALLBACK SIO1__writeBaud16(unsigned short val) {} +void CALLBACK SIO1__writeBaud32(unsigned long val) {} +unsigned char CALLBACK SIO1__readData8(void) { return 0; } +unsigned short CALLBACK SIO1__readData16(void) { return 0; } +unsigned long CALLBACK SIO1__readData32(void) { return 0; } +unsigned short CALLBACK SIO1__readStat16(void) { return 0; } +unsigned long CALLBACK SIO1__readStat32(void) { return 0; } +unsigned short CALLBACK SIO1__readMode16(void) { return 0; } +unsigned long CALLBACK SIO1__readMode32(void) { return 0; } +unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; } +unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; } +unsigned short CALLBACK SIO1__readBaud16(void) { return 0; } +unsigned long CALLBACK SIO1__readBaud32(void) { return 0; } +void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {}; + +void CALLBACK SIO1irq(void) { + psxHu32ref(0x1070) |= SWAPu32(0x100); +} + +#define LoadSio1Sym1(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, TRUE); + +#define LoadSio1SymN(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); + +#define LoadSio1Sym0(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \ + if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest; + +static int LoadSIO1plugin(const char *SIO1dll) { + void *drv; + + hSIO1Driver = SysLoadLibrary(SIO1dll); + if (hSIO1Driver == NULL) { + SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1; + } + drv = hSIO1Driver; + + LoadSio1Sym0(init, "SIO1init"); + LoadSio1Sym0(shutdown, "SIO1shutdown"); + LoadSio1Sym0(open, "SIO1open"); + LoadSio1Sym0(close, "SIO1close"); + LoadSio1Sym0(pause, "SIO1pause"); + LoadSio1Sym0(resume, "SIO1resume"); + LoadSio1Sym0(keypressed, "SIO1keypressed"); + LoadSio1Sym0(configure, "SIO1configure"); + LoadSio1Sym0(test, "SIO1test"); + LoadSio1Sym0(about, "SIO1about"); + LoadSio1Sym0(writeData8, "SIO1writeData8"); + LoadSio1Sym0(writeData16, "SIO1writeData16"); + LoadSio1Sym0(writeData32, "SIO1writeData32"); + LoadSio1Sym0(writeStat16, "SIO1writeStat16"); + LoadSio1Sym0(writeStat32, "SIO1writeStat32"); + LoadSio1Sym0(writeMode16, "SIO1writeMode16"); + LoadSio1Sym0(writeMode32, "SIO1writeMode32"); + LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16"); + LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32"); + LoadSio1Sym0(writeBaud16, "SIO1writeBaud16"); + LoadSio1Sym0(writeBaud32, "SIO1writeBaud32"); + LoadSio1Sym0(readData16, "SIO1readData16"); + LoadSio1Sym0(readData32, "SIO1readData32"); + LoadSio1Sym0(readStat16, "SIO1readStat16"); + LoadSio1Sym0(readStat32, "SIO1readStat32"); + LoadSio1Sym0(readMode16, "SIO1readMode16"); + LoadSio1Sym0(readMode32, "SIO1readMode32"); + LoadSio1Sym0(readCtrl16, "SIO1readCtrl16"); + LoadSio1Sym0(readCtrl32, "SIO1readCtrl32"); + LoadSio1Sym0(readBaud16, "SIO1readBaud16"); + LoadSio1Sym0(readBaud32, "SIO1readBaud32"); + LoadSio1Sym0(registerCallback, "SIO1registerCallback"); + + return 0; +} + +#endif + +void CALLBACK clearDynarec(void) { + psxCpu->Reset(); +} + +int LoadPlugins() { + int ret; + char Plugin[MAXPATHLEN]; + + ReleasePlugins(); + SysLibError(); + + if (UsingIso()) { + LoadCDRplugin(NULL); + } else { + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr); + if (LoadCDRplugin(Plugin) == -1) return -1; + } + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu); + if (LoadGPUplugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu); + if (LoadSPUplugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1); + if (LoadPAD1plugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2); + if (LoadPAD2plugin(Plugin) == -1) return -1; + + if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0) + Config.UseNet = FALSE; + else { + Config.UseNet = TRUE; + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net); + if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE; + } + +#ifdef ENABLE_SIO1API + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1); + if (LoadSIO1plugin(Plugin) == -1) return -1; +#endif + + ret = CDR_init(); + if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; } + ret = GPU_init(); + if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; } + ret = SPU_init(); + if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; } + ret = PAD1_init(1); + if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; } + ret = PAD2_init(2); + if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; } + + if (Config.UseNet) { + ret = NET_init(); + if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; } + } + +#ifdef ENABLE_SIO1API + ret = SIO1_init(); + if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; } +#endif + + SysPrintf(_("Plugins loaded.\n")); + return 0; +} + +void ReleasePlugins() { + if (Config.UseNet) { + int ret = NET_close(); + if (ret < 0) Config.UseNet = FALSE; + } + NetOpened = FALSE; + + if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown(); + if (hGPUDriver != NULL) GPU_shutdown(); + if (hSPUDriver != NULL) SPU_shutdown(); + if (hPAD1Driver != NULL) PAD1_shutdown(); + if (hPAD2Driver != NULL) PAD2_shutdown(); + + if (Config.UseNet && hNETDriver != NULL) NET_shutdown(); + + if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL; + if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL; + if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL; + if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL; + if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL; + + if (Config.UseNet && hNETDriver != NULL) { + SysCloseLibrary(hNETDriver); hNETDriver = NULL; + } + +#ifdef ENABLE_SIO1API + if (hSIO1Driver != NULL) { + SIO1_shutdown(); + SysCloseLibrary(hSIO1Driver); + hSIO1Driver = NULL; + } +#endif +} + +// for CD swap +int ReloadCdromPlugin() +{ + if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown(); + if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL; + + if (UsingIso()) { + LoadCDRplugin(NULL); + } else { + char Plugin[MAXPATHLEN]; + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr); + if (LoadCDRplugin(Plugin) == -1) return -1; + } + + return CDR_init(); +} + +void SetIsoFile(const char *filename) { + if (filename == NULL) { + IsoFile[0] = '\0'; + return; + } + strncpy(IsoFile, filename, MAXPATHLEN); +} + +const char *GetIsoFile(void) { + return IsoFile; +} + +boolean UsingIso(void) { + return (IsoFile[0] != '\0'); +} + +void SetCdOpenCaseTime(s64 time) { + cdOpenCaseTime = time; +} diff --git a/libpcsxcore/psxbios.c b/libpcsxcore/psxbios.c index 292d80d..d5ed725 100644 --- a/libpcsxcore/psxbios.c +++ b/libpcsxcore/psxbios.c @@ -2216,6 +2216,15 @@ void psxBios_ChangeClearPad() { // 5b pc0 = ra; } +void psxBios__card_status() { // 5c +#ifdef PSXBIOS_LOG + PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0); +#endif + + v0 = 1; + pc0 = ra; +} + /* System calls C0 */ /* @@ -2569,7 +2578,7 @@ void psxBiosInit() { //biosB0[0x59] = psxBios_sys_b0_59; //biosB0[0x5a] = psxBios_sys_b0_5a; biosB0[0x5b] = psxBios_ChangeClearPad; - //biosB0[0x5c] = psxBios__card_status; + biosB0[0x5c] = psxBios__card_status; //biosB0[0x5d] = psxBios__card_wait; //*******************C0 CALLS**************************** //biosC0[0x00] = psxBios_InitRCnt; diff --git a/libpcsxcore/r3000a.c b/libpcsxcore/r3000a.c index 82eb885..22341c5 100644 --- a/libpcsxcore/r3000a.c +++ b/libpcsxcore/r3000a.c @@ -50,7 +50,7 @@ int psxInit() { void psxReset() { psxMemReset(); - memset(&psxRegs, 0, sizeof(psxRegs)); + memset(&psxRegs, 0x00, sizeof(psxRegs)); psxRegs.pc = 0xbfc00000; // Start in bootstrap diff --git a/libpcsxcore/sio.c b/libpcsxcore/sio.c index b3732d2..d251fa7 100644 --- a/libpcsxcore/sio.c +++ b/libpcsxcore/sio.c @@ -117,6 +117,20 @@ void sioWrite8(unsigned char value) { break; } } + // NegCon - Wipeout 3 + if( buf[parp] == 0x23 ) { + switch (value) { + // enter config mode + case 0x43: + buf[1] = 0x79; + break; + + // get status + case 0x45: + buf[1] = 0xf3; + break; + } + } } else padst = 0; return; diff --git a/libpcsxcore/socket.c b/libpcsxcore/socket.c index 31f82e2..c408bc3 100644 --- a/libpcsxcore/socket.c +++ b/libpcsxcore/socket.c @@ -15,6 +15,22 @@ * along with this program; if not, see <http://www.gnu.org/licenses>. */ +#ifdef NO_SOCKET + +int StartServer() { return 0;} +void StopServer() {} +void GetClient() {} +void CloseClient() {} +int HasClient() { return 0;} +int ReadSocket(char * buffer, int len) { return 0;} +int RawReadSocket(char * buffer, int len) { return 0;} +void WriteSocket(char * buffer, int len) {} + +void SetsBlock() {} +void SetsNonblock() {} + +#else // NO_SOCKET + #ifdef _WIN32 #include <winsock2.h> #endif @@ -252,3 +268,4 @@ void SetsNonblock() { fcntl(server_socket, F_SETFL, flags | O_NONBLOCK); #endif } +#endif // NO_SOCKET diff --git a/maemo/hildon.c b/maemo/hildon.c deleted file mode 100644 index 7e9cd9f..0000000 --- a/maemo/hildon.c +++ /dev/null @@ -1,843 +0,0 @@ -#include <gtk/gtk.h> -#include <glib.h> -#include <stdlib.h> -#include <stdint.h> -#include <unistd.h> -#include <hildon/hildon.h> -#include <string.h> -#include <pthread.h> - -#include "../frontend/plugin_lib.h" -#include "../frontend/main.h" -#include "../libpcsxcore/misc.h" -#include "../include/psemu_plugin_defs.h" -#include "../libpcsxcore/cdrom.h" -#include "../libpcsxcore/cdriso.h" -#include "../plugins/dfinput/main.h" -#include "../frontend/libpicofe/readpng.h" -#include "maemo_common.h" -#include <libosso.h> -#include <dbus/dbus.h> - -#define X_RES 800 -#define Y_RES 480 -#define D_WIDTH 640 -#define D_HEIGHT 480 - -#define CALL_SIGNAL_IF "com.nokia.csd.Call" -#define CALL_SIGNAL_PATH "/com/nokia/csd/call" -#define CALL_INCOMING_SIG "Coming" - -#define DBUS_RULE_CALL_INCOMING "type='signal',interface='" CALL_SIGNAL_IF \ - "',path='" CALL_SIGNAL_PATH \ - "',member='" CALL_INCOMING_SIG "'" - -osso_context_t* osso = NULL; -int bRunning = TRUE; -extern int bKeepDisplayOn; -extern int bAutosaveOnExit; -extern int cornerActions[4]; -extern char keys_config_file[MAXPATHLEN]; -static pthread_t display_thread = (pthread_t)0; -int g_layer_x = (X_RES - D_WIDTH) / 2; -int g_layer_y = (Y_RES - D_HEIGHT) / 2; -int g_layer_w = D_WIDTH, g_layer_h = D_HEIGHT; - -static GdkImage *image; -static HildonAnimationActor *actor; -static GtkWidget *window, *drawing = NULL; - -static int pl_buf_w, pl_buf_h; -int keymap[65536]; -int direction_keys[4]; - -// map psx4m compatible keymap to PSX keys -static const unsigned char keymap2[14] = { - DKEY_LEFT, // 0 - DKEY_RIGHT, - DKEY_UP, - DKEY_DOWN, - DKEY_CIRCLE, - DKEY_CROSS, // 5 - DKEY_TRIANGLE, - DKEY_SQUARE, - DKEY_SELECT, - DKEY_START, - DKEY_L1, // 10 - DKEY_R1, - DKEY_L2, - DKEY_R2, -}; - -void hildon_quit() -{ - maemo_finish(); - gtk_main_quit(); - exit(0); -} - -gdouble press_x = -1; -gdouble press_y = -1; - -int maemo_x11_update_keys(); -void show_notification(char* text); - -void change_slot(int delta) -{ - state_slot += delta; - if (state_slot > 9) - state_slot = 0; - else if (state_slot < 0) - state_slot = 9; - char message[50]; - sprintf(message,"Savestate slot: %i",state_slot + 1); - show_notification(message); -} - -void save(int state_slot) -{ - emu_save_state(state_slot); - char buf[MAXPATHLEN]; - if (image && image->mem){ - sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,state_slot); - writepng(buf, image->mem, pl_buf_w,pl_buf_h); - } - char message[50]; - sprintf(message,"Saved savestate slot: %i",state_slot + 1); - show_notification(message); -} - -void quit() -{ - if (bAutosaveOnExit){ - show_notification("Autosaving"); - emu_save_state(99); - char buf[MAXPATHLEN]; - if (image && image->mem){ - sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,99); - writepng(buf, image->mem, pl_buf_w,pl_buf_h); - } - } - hildon_quit(); -} - -int show_confirmbox(char* text) -{ - if (!window) - return TRUE; - - GtkWidget *dialog; - dialog = gtk_message_dialog_new (GTK_WINDOW(window), - GTK_DIALOG_DESTROY_WITH_PARENT, - GTK_MESSAGE_QUESTION, - GTK_BUTTONS_YES_NO, - text); - gint result = gtk_dialog_run (GTK_DIALOG (dialog)); - gtk_widget_destroy (dialog); - if (result == GTK_RESPONSE_YES) - return TRUE; - return FALSE; -} - -static void -window_button_proxy(GtkWidget *widget, - GdkEventButton *event, - gpointer user_data) -{ - int corner = -1; - int sens = 100; - - switch (event->type){ - case GDK_BUTTON_PRESS: - //printf("GDK_BUTTON_PRESS: x=%f y=%f\n", event->x, event->y); - press_x = event->x; - press_y = event->y; - break; - case GDK_BUTTON_RELEASE: - //printf("GDK_BUTTON_RELEASE: x=%f y=%f\n", event->x, event->y); - if (press_x < sens && press_y < sens && event->x < sens && event->y < sens) - corner = 0; - else if (press_x > 800 - sens && press_y < sens && event->x > 800 - sens && event->y < sens) - corner = 1; - else if (press_x > 800 - sens && press_y > 480 - sens && event->x > 800 - sens && event->y > 480 - sens) - corner = 2; - else if (press_x < sens && press_y > 480 - sens && event->x < sens && event->y > 480 - sens) - corner = 3; - - press_x = -1; - press_y = -1; - break; - default: - break; - } - - if (corner >= 0){ - switch (cornerActions[corner]){ - case 1: - if (show_confirmbox("Save savestate?")) - save(state_slot); - break; - case 2: - if (show_confirmbox("Load savestate?")) - emu_load_state(state_slot); - break; - case 3: - change_slot(1); - break; - case 4: - change_slot(-1); - break; - case 5: - if (show_confirmbox("Quit?")) - quit(); - break; - } - } -} - -static void *displayThread(void *arg) -{ - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - DBusMessage* msg = dbus_message_new_method_call("com.nokia.mce", - "/com/nokia/mce/request", - "com.nokia.mce.request", - "req_display_blanking_pause"); - if (msg && system_bus) { - bRunning = TRUE; - while (bRunning) { - dbus_connection_send(system_bus, msg, NULL); - dbus_connection_flush(system_bus); - int i = 0; - for (i=0; i<8; i++){ - usleep(500000); - if (!bRunning) - break; - } - } - dbus_message_unref(msg); - } - - pthread_exit(0); - return NULL; -} - -void show_notification(char* text) -{ - if (window){ - GtkWidget* banner = hildon_banner_show_information(GTK_WIDGET(window), NULL, text); - hildon_banner_set_timeout(HILDON_BANNER(banner), 3000); - }else{ - DBusConnection* session_bus = (DBusConnection*)osso_get_dbus_connection(osso); - DBusMessageIter args; - DBusMessage*msg = dbus_message_new_method_call("org.freedesktop.Notifications", - "/org/freedesktop/Notifications", - "org.freedesktop.Notifications", - "SystemNoteInfoprint"); - if (msg) { - dbus_message_iter_init_append(msg, &args); - char* param = text; - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_STRING, ¶m)) { - dbus_connection_send(session_bus, msg, NULL); - dbus_connection_flush(session_bus); - } - dbus_message_unref(msg); - } - } -} - -void show_messagebox(char* text) -{ - if (!window) - return; - - GtkWidget *dialog; - dialog = gtk_message_dialog_new (GTK_WINDOW(window), - GTK_DIALOG_DESTROY_WITH_PARENT, - GTK_MESSAGE_INFO, - GTK_BUTTONS_OK, - text); - gtk_dialog_run (GTK_DIALOG (dialog)); - gtk_widget_destroy (dialog); -} - -#include <hildon/hildon-file-chooser-dialog.h> -void change_disc() -{ - GtkWidget *dialog; - dialog = hildon_file_chooser_dialog_new (GTK_WINDOW(window), GTK_FILE_CHOOSER_ACTION_OPEN); - gtk_window_set_title (GTK_WINDOW (dialog), "Change disc"); - - char currentFile[MAXPATHLEN]; - strcpy(currentFile, GetIsoFile()); - if (strlen(currentFile)) - gtk_file_chooser_set_filename (GTK_FILE_CHOOSER(dialog), currentFile); - else - gtk_file_chooser_set_current_folder (GTK_FILE_CHOOSER(dialog), "/home/user/MyDocs/"); - - GtkFileFilter *filter=gtk_file_filter_new(); - gtk_file_filter_add_pattern (filter,"*.bin"); - gtk_file_filter_add_pattern (filter,"*.BIN"); - gtk_file_filter_add_pattern (filter,"*.iso"); - gtk_file_filter_add_pattern (filter,"*.ISO"); - gtk_file_filter_add_pattern (filter,"*.img"); - gtk_file_filter_add_pattern (filter,"*.IMG"); - gtk_file_filter_add_pattern (filter,"*.z"); - gtk_file_filter_add_pattern (filter,"*.Z"); - gtk_file_filter_add_pattern (filter,"*.znx"); - gtk_file_filter_add_pattern (filter,"*.ZNX"); - gtk_file_filter_add_pattern (filter,"*.pbp"); - gtk_file_filter_add_pattern (filter,"*.PBP"); - gtk_file_filter_add_pattern (filter,"*.mdf"); - gtk_file_filter_add_pattern (filter,"*.MDF"); - gtk_file_chooser_set_filter (GTK_FILE_CHOOSER (dialog),filter); - - if (gtk_dialog_run (GTK_DIALOG (dialog)) == GTK_RESPONSE_OK) { - char *filename = gtk_file_chooser_get_filename (GTK_FILE_CHOOSER (dialog)); - - //if (strcmp(filename, currentFile)) { - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - set_cd_image(filename); - if (ReloadCdromPlugin() < 0) - printf("Failed to load cdr plugin\n"); - - if (CDR_open() < 0) - printf("Failed to open cdr plugin\n"); - - strcpy(file_name, strrchr(filename,'/')); - - SetCdOpenCaseTime(time(NULL) + 3); - LidInterrupt(); - //} - g_free (filename); - } - - gtk_widget_destroy (dialog); -} - -void change_multi_disc() -{ - HildonDialog* window = HILDON_DIALOG(hildon_dialog_new()); - gtk_window_set_title (GTK_WINDOW (window), "Change disc"); - gtk_window_set_default_size(GTK_WINDOW (window), 480, 300); - - GtkWidget* sw = hildon_pannable_area_new (); - gtk_box_pack_start (GTK_BOX(GTK_DIALOG(window)->vbox), sw, TRUE, TRUE, 0); - - GtkWidget* tree_view = hildon_gtk_tree_view_new (HILDON_UI_MODE_EDIT); - gtk_widget_set_name (tree_view, "fremantle-widget"); - - gtk_tree_view_set_rules_hint (GTK_TREE_VIEW (tree_view), TRUE); - - int i; - GtkListStore *store = gtk_list_store_new (1, G_TYPE_STRING); - for (i = 0; i < cdrIsoMultidiskCount; i++) { - gchar *str; - - str = g_strdup_printf ("Disc %d", i+1); - gtk_list_store_insert_with_values (store, NULL, i, 0, str, -1); - g_free (str); - } - GtkTreeModel* model = GTK_TREE_MODEL (store); - - gtk_tree_view_set_model (GTK_TREE_VIEW (tree_view), model); - g_object_unref (model); - - GtkTreeSelection* selection = gtk_tree_view_get_selection (GTK_TREE_VIEW (tree_view)); - gtk_tree_selection_set_mode (selection, GTK_SELECTION_SINGLE); - - GtkCellRenderer* renderer = gtk_cell_renderer_text_new (); - g_object_set (renderer, - "xalign", 0.5, - "weight", PANGO_WEIGHT_NORMAL, - NULL); - - gtk_tree_view_insert_column_with_attributes (GTK_TREE_VIEW (tree_view), - 0, "Column 0", - renderer, - "text", 0, - NULL); - - char current[5]; - sprintf(current, "%i", cdrIsoMultidiskSelect); - GtkTreePath* path = gtk_tree_path_new_from_string(current); - gtk_tree_selection_select_path (selection, path); - gtk_tree_path_free(path); - - gtk_widget_set_size_request (tree_view, 480, 800); - gtk_container_add (GTK_CONTAINER (sw), tree_view); - - hildon_dialog_add_button (HILDON_DIALOG(window), GTK_STOCK_OK, GTK_RESPONSE_ACCEPT); - - gtk_widget_show_all (GTK_WIDGET(window)); - gint result = gtk_dialog_run (GTK_DIALOG (window)); - if (result == GTK_RESPONSE_ACCEPT) { - GtkTreeModel* model; - GtkTreeIter iter; - GtkTreeSelection* selection = gtk_tree_view_get_selection(GTK_TREE_VIEW(tree_view)); - if (gtk_tree_selection_get_selected(selection, &model, &iter)){ - GtkTreePath* path = gtk_tree_model_get_path(model , &iter); - int* i = gtk_tree_path_get_indices(path) ; - - cdrIsoMultidiskSelect = *i; - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - CDR_close(); - if (CDR_open() < 0) { - printf("Failed to load cdr plugin\n"); - return; - } - - SetCdOpenCaseTime(time(NULL) + 3); - LidInterrupt(); - } - } - gtk_widget_destroy(GTK_WIDGET(window)); -} - -static DBusHandlerResult on_msg_recieved(DBusConnection* connection G_GNUC_UNUSED, DBusMessage* message, void* data) -{ - const char* path = dbus_message_get_path(message); - if (path && g_str_equal(path, CALL_SIGNAL_PATH)){ - const char* mbr = dbus_message_get_member(message); - if (mbr && g_str_equal(mbr, CALL_INCOMING_SIG)) - show_messagebox("Paused"); - } - - return DBUS_HANDLER_RESULT_NOT_YET_HANDLED; -} - -static void -window_key_proxy(GtkWidget *widget, - GdkEventKey *event, - gpointer user_data) -{ - key_press_event(event->hardware_keycode, event->type == GDK_KEY_PRESS ? 1 : (event->type == GDK_KEY_RELEASE ? 2 : 0) ); -} - -int last_key_pressed = 0; -inline void key_press_event(int key2,int type) -{ - int psxkey1 = -1, psxkey2 = -1; - int key=keymap[key2]; - - if (key < 0) - return; - - if (type == 1 && key2 == last_key_pressed) - return; - last_key_pressed = type == 1 ? key2 : 0; - - //printf("Key: %i %s\n", key2, type == 1 ? "Pressed" : (type == 2 ? "Released" : "Unknown")); - if (key < ARRAY_SIZE(keymap2)){ - psxkey1 = keymap2[key]; - }else switch (key) { - case 14: - quit(); - break; - case 15: - psxkey1 = DKEY_UP; - psxkey2 = DKEY_LEFT; - break; - case 16: - psxkey1 = DKEY_UP; - psxkey2 = DKEY_RIGHT; - break; - case 17: - psxkey1 = DKEY_DOWN; - psxkey2 = DKEY_LEFT; - break; - case 18: - psxkey1 = DKEY_DOWN; - psxkey2 = DKEY_RIGHT; - break; - case 19: - if (type == 1) - save(state_slot); - return; - case 20: - if (type == 1) - emu_load_state(state_slot); - return; - case 21: - if (type == 1) - change_slot(1); - return; - case 22: - if (type == 1) - change_slot(-1); - return; - case 23: - if (type == 1){ - if (cdrIsoMultidiskCount > 1) - change_multi_disc(); - else - change_disc(); - } - return; - } - - if (in_type1 == PSE_PAD_TYPE_GUNCON){ - if (type == 1) { - switch (psxkey1){ - case DKEY_CROSS: - in_state_gun |= SACTION_GUN_A; - break; - case DKEY_CIRCLE: - in_state_gun |= SACTION_GUN_B; - break; - case DKEY_TRIANGLE: - in_state_gun |= SACTION_GUN_TRIGGER2; - break; - case DKEY_SQUARE: - in_state_gun |= SACTION_GUN_TRIGGER; - break; - } - }else if (type == 2) { - switch (psxkey1){ - case DKEY_CROSS: - in_state_gun &= ~SACTION_GUN_A; - break; - case DKEY_CIRCLE: - in_state_gun &= ~SACTION_GUN_B; - break; - case DKEY_TRIANGLE: - in_state_gun &= ~SACTION_GUN_TRIGGER2; - break; - case DKEY_SQUARE: - in_state_gun &= ~SACTION_GUN_TRIGGER; - break; - } - } - }else{ - if (type == 1) { - if (psxkey1 >= 0) - in_keystate |= 1 << psxkey1; - if (psxkey2 >= 0) - in_keystate |= 1 << psxkey2; - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - switch(psxkey1){ - case DKEY_LEFT: - in_a1[0] = 0; - break; - case DKEY_RIGHT: - in_a1[0] = 255; - break; - case DKEY_UP: - in_a1[1] = 0; - break; - case DKEY_DOWN: - in_a1[1] = 255; - break; - } - } - } - else if (type == 2) { - if (psxkey1 >= 0) - in_keystate &= ~(1 << psxkey1); - if (psxkey2 >= 0) - in_keystate &= ~(1 << psxkey2); - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - switch(psxkey1){ - case DKEY_LEFT: - case DKEY_RIGHT: - in_a1[0] = 127; - break; - case DKEY_UP: - case DKEY_DOWN: - in_a1[1] = 127; - break; - } - } - emu_set_action(SACTION_NONE); - } - } -} - -void plat_finish() -{ - hildon_quit(); -} - -void set_accel_multipliers() -{ - accelOptions.xMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0); - accelOptions.yMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0); -} - -#include <gdk/gdkx.h> -int maemo_init(int *argc, char ***argv) -{ - osso = osso_initialize("pcsxrearmed", PACKAGE_VERSION, FALSE, NULL); - - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - dbus_bus_add_match(system_bus, DBUS_RULE_CALL_INCOMING, NULL); - dbus_connection_add_filter(system_bus, on_msg_recieved, NULL, NULL); - - FILE* pFile; - pFile = fopen(keys_config_file, "r"); - if (pFile == NULL){ - fprintf(stderr, "Error opening keys config file %s\n", keys_config_file); - return 1; - } - printf("Keys config read from %s\n", keys_config_file); - - int ch; - int i=0; - for (i=0;i<65536;i++) - keymap[i]=-1; - if (NULL != pFile) { - for(i=0;i<24;i++){ - fscanf(pFile, "%i",&ch); - keymap[ch]=i; - if (i < 4) - direction_keys[i] = ch; - } - fclose(pFile); - } - - switch (in_type1){ - case PSE_PAD_TYPE_GUNCON: - memset(cornerActions, 0, sizeof(cornerActions)); - printf("Controller set to GUNCON (SLPH-00034)\n"); - break; - case PSE_PAD_TYPE_STANDARD: - printf("Controller set to standard (SCPH-1080)\n"); - break; - case PSE_PAD_TYPE_ANALOGPAD: - printf("Controller set to analog (SCPH-1150)\n"); - break; - } - - if (in_enable_vibration) - printf("Vibration enabled\n"); - - if (!(g_maemo_opts&8)){ - gtk_init (argc, argv); - - window = hildon_stackable_window_new (); - gtk_widget_realize (window); - gtk_window_fullscreen (GTK_WINDOW(window)); - - if (cornerActions[0] + cornerActions[1] + cornerActions[2] + cornerActions[3] > 0){ - g_signal_connect (G_OBJECT (window), "button_release_event", - G_CALLBACK (window_button_proxy), NULL); - g_signal_connect (G_OBJECT (window), "button_press_event", - G_CALLBACK (window_button_proxy), NULL); - } - - g_signal_connect (G_OBJECT (window), "key-press-event", - G_CALLBACK (window_key_proxy), NULL); - g_signal_connect (G_OBJECT (window), "key-release-event", - G_CALLBACK (window_key_proxy), NULL); - g_signal_connect (G_OBJECT (window), "delete_event", - G_CALLBACK (hildon_quit), NULL); - gtk_widget_add_events (window, - GDK_BUTTON_PRESS_MASK | GDK_BUTTON_RELEASE_MASK); - - actor = HILDON_ANIMATION_ACTOR (hildon_animation_actor_new()); - if (g_maemo_opts & 2) - hildon_animation_actor_set_position (actor, 0, 0 ); - else - hildon_animation_actor_set_position (actor, (X_RES - D_WIDTH)/2, (Y_RES - D_HEIGHT)/2 ); - hildon_animation_actor_set_parent (actor, GTK_WINDOW (window)); - - drawing = gtk_image_new (); - - gtk_container_add (GTK_CONTAINER (actor), drawing); - - gtk_widget_show_all (GTK_WIDGET (actor)); - gtk_widget_show_all (GTK_WIDGET (window)); - }else{ - gtk_init (argc, argv); - /*GdkScreen* scr = gdk_screen_get_default(); - window = GTK_WIDGET(gdk_screen_get_root_window(scr)); - if (!window) - window = GTK_WIDGET(gdk_get_default_root_window());*/ - } - - set_accel_multipliers(); - - if (bKeepDisplayOn){ - if (pthread_create(&display_thread, NULL, displayThread, NULL)) - printf("Failed to create display thread.\n"); - } - - pl_rearmed_cbs.only_16bpp = 1; - return 0; -} - -void maemo_finish() -{ - if (display_thread > 0){ - bRunning = FALSE; - pthread_join(display_thread, NULL); - } - - if (osso){ - osso_deinitialize(osso); - osso = NULL; - } - printf("Exiting\n"); -} - -void menu_loop(void) -{ -} - -void *plat_gvideo_set_mode(int *w_, int *h_, int *bpp_) -{ - int w = *w_, h = *h_; - - if (g_maemo_opts&8) return pl_vout_buf; - //printf("Setting video mode %ix%i\n", w, h); - - if (w <= 0 || h <= 0) - return pl_vout_buf; - - if (image) gdk_image_destroy(image); - image = gdk_image_new( GDK_IMAGE_FASTEST, gdk_visual_get_system(), w, h ); - - pl_vout_buf = (void *) image->mem; - - gtk_image_set_from_image (GTK_IMAGE(drawing), image, NULL); - - gtk_window_resize (GTK_WINDOW (actor), w, h); - if (g_maemo_opts & 2) - hildon_animation_actor_set_scale (actor, - (gdouble)800 / (gdouble)w, - (gdouble)480 / (gdouble)h - ); - else - hildon_animation_actor_set_scale (actor, - (gdouble)D_WIDTH / (gdouble)w, - (gdouble)D_HEIGHT / (gdouble)h - ); - pl_buf_w=w;pl_buf_h=h; - return pl_vout_buf; -} - -void *plat_gvideo_flip(void) -{ - if (!(g_maemo_opts&8)) - gtk_widget_queue_draw(drawing); - - // process accelometer - if (g_maemo_opts & 4) { - float x, y, z; - FILE* f = fopen( "/sys/class/i2c-adapter/i2c-3/3-001d/coord", "r" ); - if( !f ) {printf ("err in accel"); exit(1);} - fscanf( f, "%f %f %f", &x, &y, &z ); - fclose( f ); - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - if (x > accelOptions.maxValue) x = accelOptions.maxValue; - else if (x < -accelOptions.maxValue) x = -accelOptions.maxValue; - - const int maxValue = accelOptions.maxValue - accelOptions.sens; - if(x > accelOptions.sens){ - x -= accelOptions.sens; - in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier; - }else if (x < -accelOptions.sens){ - x += accelOptions.sens; - in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier; - }else in_a1[0] = 127; - - y += accelOptions.y_def; - if (y > accelOptions.maxValue) y = accelOptions.maxValue; - else if (y < -accelOptions.maxValue) y = -accelOptions.maxValue; - - if(y > accelOptions.sens){ - y -= accelOptions.sens; - in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier; - }else if (y < -accelOptions.sens){ - y += accelOptions.sens; - in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier; - }else in_a1[1] = 127; - - //printf("x: %i y: %i\n", in_a1[0], in_a1[1]); - }else{ - if( x > accelOptions.sens ) in_keystate |= 1 << DKEY_LEFT; - else if( x < -accelOptions.sens ) in_keystate |= 1 << DKEY_RIGHT; - else {in_keystate &= ~(1 << DKEY_LEFT);in_keystate &= ~(1 << DKEY_RIGHT);} - - y += accelOptions.y_def; - if( y > accelOptions.sens )in_keystate |= 1 << DKEY_UP; - else if( y < -accelOptions.sens ) in_keystate |= 1 << DKEY_DOWN; - else {in_keystate &= ~(1 << DKEY_DOWN);in_keystate &= ~(1 << DKEY_UP);} - } - } - - return pl_vout_buf; -} - -// for frontend/plugin_lib.c -void update_input(void) -{ - if (g_maemo_opts & 8) - maemo_x11_update_keys(); - else { - /* process GTK+ events */ - while (gtk_events_pending()) - gtk_main_iteration(); - } -} - -int omap_enable_layer(int enabled) -{ - return 0; -} - -void menu_notify_mode_change(int w, int h, int bpp) -{ -} - -void *plat_prepare_screenshot(int *w, int *h, int *bpp) -{ - return NULL; -} - -void plat_step_volume(int is_up) -{ -} - -void plat_trigger_vibrate(int pad, int low, int high) -{ - const int vDuration = 10; - - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - DBusMessageIter args; - DBusMessage*msg = dbus_message_new_method_call("com.nokia.mce", - "/com/nokia/mce/request", - "com.nokia.mce.request", - "req_start_manual_vibration"); - if (msg) { - dbus_message_iter_init_append(msg, &args); - // FIXME: somebody with hardware should tune this - int speed = high; // is_strong ? 200 : 150; - int duration = vDuration; - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &speed)) { - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &duration)) { - dbus_connection_send(system_bus, msg, NULL); - //dbus_connection_flush(system_bus); - } - } - dbus_message_unref(msg); - } -} - -void plat_minimize(void) -{ -} - -void plat_gvideo_close(void) -{ -} - -void plat_gvideo_open(int is_pal) -{ -} diff --git a/maemo/maemo_common.h b/maemo/maemo_common.h deleted file mode 100644 index ace0bfd..0000000 --- a/maemo/maemo_common.h +++ /dev/null @@ -1,18 +0,0 @@ -int maemo_init(int *argc, char ***argv); -void maemo_finish(); - -extern char file_name[MAXPATHLEN]; -extern int g_maemo_opts; - -extern inline void key_press_event(int key,int type); - -typedef struct -{ - int sens; - int y_def; - float maxValue; - float xMultiplier; - float yMultiplier; -} accel_option; - -extern accel_option accelOptions; diff --git a/maemo/maemo_xkb.c b/maemo/maemo_xkb.c deleted file mode 100644 index 52af2ca..0000000 --- a/maemo/maemo_xkb.c +++ /dev/null @@ -1,88 +0,0 @@ -/* - * Copyright (c) 2009, Wei Mingzhi <whistler@openoffice.org>. - * All Rights Reserved. - * - * This program is free software; you can redistribute it and/or modify - * it under the terms of the GNU General Public License as published by - * the Free Software Foundation; either version 2 of the License, or - * (at your option) any later version. - * - * This program is distributed in the hope that it will be useful, - * but WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - * GNU General Public License for more details. - * - * You should have received a copy of the GNU General Public License - * along with this program; if not, see <http://www.gnu.org/licenses>. - */ - -#include <stdio.h> -#include <stdlib.h> -#include <stdint.h> -#include <X11/Xlib.h> -#include <X11/Xutil.h> -#include <X11/keysym.h> -#include <X11/XKBlib.h> - -#include "../frontend/main.h" -#include "../frontend/plugin_lib.h" - -static Atom wmprotocols, wmdelwindow; -static int initialized; - - - -static void InitKeyboard(void) { - Display *disp = (Display *)gpuDisp; - if (disp){ - wmprotocols = XInternAtom(disp, "WM_PROTOCOLS", 0); - wmdelwindow = XInternAtom(disp, "WM_DELETE_WINDOW", 0); - XkbSetDetectableAutoRepeat(disp, 1, NULL); - } -} - -static void DestroyKeyboard(void) { - Display *disp = (Display *)gpuDisp; - if (disp) - XkbSetDetectableAutoRepeat(disp, 0, NULL); -} -#include "maemo_common.h" - -int maemo_x11_update_keys() { - - XEvent evt; - XClientMessageEvent *xce; - int leave = 0; - Display *disp = (Display *)gpuDisp; - - if (!disp) - return 0; - - if (!initialized) { - initialized++; - InitKeyboard(); - } - - while (XPending(disp)>0) { - XNextEvent(disp, &evt); - switch (evt.type) { - case KeyPress: - case KeyRelease: - key_press_event(evt.xkey.keycode, evt.type==KeyPress ? 1 : (evt.type==KeyRelease ? 2 : 0) ); - break; - - case ClientMessage: - xce = (XClientMessageEvent *)&evt; - if (xce->message_type == wmprotocols && (Atom)xce->data.l[0] == wmdelwindow) - leave = 1; - break; - } - } - - if (leave) { - DestroyKeyboard(); - exit(1); - } - - return 0; -} diff --git a/maemo/main.c b/maemo/main.c deleted file mode 100644 index 85db400..0000000 --- a/maemo/main.c +++ /dev/null @@ -1,418 +0,0 @@ -/* - * (C) notaz, 2010-2011 - * - * This work is licensed under the terms of the GNU GPLv2 or later. - * See the COPYING file in the top-level directory. - */ - -#include <stdio.h> -#include <string.h> -#include <stdint.h> -#include <unistd.h> - -#include "../frontend/main.h" -#include "../frontend/menu.h" -#include "../frontend/plugin.h" -#include "../frontend/plugin_lib.h" -#include "../libpcsxcore/misc.h" -#include "../libpcsxcore/cdriso.h" -#include "../libpcsxcore/new_dynarec/new_dynarec.h" -#include "../plugins/dfinput/main.h" -#include "../plugins/dfsound/spu_config.h" -#include "maemo_common.h" - -extern int in_enable_vibration; -extern int cycle_multiplier; -extern int in_type1, in_type2; - -accel_option accelOptions; -int ready_to_go, g_emu_want_quit, g_emu_resetting; -int g_menuscreen_w, g_menuscreen_h; -int g_scaler, soft_filter; -int g_opts = 0; -int g_maemo_opts; -int cornerActions[4] = {0,0,0,0}; -int bKeepDisplayOn = FALSE; -int bAutosaveOnExit = FALSE; -char file_name[MAXPATHLEN]; -char keys_config_file[MAXPATHLEN] = "/opt/psx4m/keys"; - -enum sched_action emu_action; -void do_emu_action(void); - -static void ChangeWorkingDirectory(char *exe) -{ - char exepath[1024]; - char *s; - snprintf(exepath, sizeof(exepath), "%s", exe); - s = strrchr(exepath, '/'); - if (s != NULL) { - *s = '\0'; - chdir(exepath); - } -} - -void PrintHelp() -{ - printf("PCSX-ReARMed version %s for Maemo\n\n", PACKAGE_VERSION); - - printf("Usage:\n"); - printf(" pcsx [options] -cdfile FILE\n\n"); - - printf("Options:\n"); - printf(" -help : This help\n"); - printf(" -disc VALUE : Disc number for multi discs images\n"); - printf(" -fullscreen : Run fullscreen\n"); - printf(" -frameskip : Frameskip\n"); - printf(" -1=Auto (Default)\n"); - printf(" 0=Disabled\n"); - printf(" 1=Set to 1\n"); - printf(" ...\n"); - printf(" -autosave : Enable auto save on exit\n"); - printf(" -accel : Enable accelerometer\n"); - printf(" -analog : Use analog pad for accel\n"); - printf(" -vibration : Activate vibration\n"); - printf(" -sens VALUE : Set accelerometer sens [0-1000]\n"); - printf(" (Default 150)\n"); - printf(" -ydef VALUE : Set accelerometer y zero [0-1000]\n"); - printf(" (Default 500)\n"); - printf(" -max VALUE : Set accelerometer max value[0-1000]\n"); - printf(" (Default 500)\n"); - printf(" -nosound : No sound output\n"); - printf(" -bdir PATH : Set the bios path\n"); - printf(" -pdir PATH : Set the plugins path\n"); - printf(" -bios : Set the bios\n"); - printf(" -cdda : Disable CD Audio for a performance boost\n"); - printf(" -xa : Disables XA sound, which can sometimes\n"); - printf(" improve performance\n"); - printf(" -sio : SIO IRQ Always Enabled\n"); - printf(" -spuirq : SPU IRQ Always Enabled\n"); - printf(" -fps : Show fps\n"); - printf(" -cpu : Show CPU load\n"); - printf(" -spu : Show SPU channels\n"); - printf(" -nofl : Disable Frame Limiter\n"); - printf(" -mcd1 FILE : Set memory card 1 file\n"); - printf(" -mcd2 FILE : Set memory card 2 file\n"); - printf(" -region VALUE : Set PSX region\n"); - printf(" -1=Auto (Default)\n"); - printf(" 0=NTSC\n"); - printf(" 1=PAL\n"); - printf(" -cpuclock VALUE: PSX CPU clock %% [1-500]\n"); - printf(" (Default 50)\n"); - printf(" -displayon : Prevent display from blanking\n"); - printf(" (Default disabled)\n"); - printf(" -keys FILE : File with keys configuration\n"); - printf(" (Default /opt/psx4m/keys)\n"); - printf(" -corners VALUE : Define actions for click on the\n"); - printf(" display corners\n"); - printf(" VALUE is a four digit number, each number\n"); - printf(" represent a corner (topleft, topright,\n"); - printf(" bottomright and bottomleft\n"); - printf(" Actions:\n"); - printf(" 0=No action\n"); - printf(" 1=Save\n"); - printf(" 2=Load\n"); - printf(" 3=Change slot (+1)\n"); - printf(" 4=Change slot (-1)\n"); - printf(" 5=Quit\n"); - printf(" -guncon : Set the controller to guncon\n"); - printf(" -gunnotrigger : Don't trigger (shoot) when touching screen\n"); - printf(" 0=Auto (Default)\n"); - printf(" 1=On\n"); - printf(" 2=Off\n"); - - - printf("\nGPU Options:\n"); - printf(" -gles : Use the GLES plugin (gpu_gles.so)\n"); - printf(" -oldgpu : Use the peops plugin (gpu_peops.so)\n"); - printf(" -unai : Use the unai plugin (gpu_unai.so)\n"); - - printf("\nSound Options:\n"); - printf(" -spu_reverb VALUE : Enable/disable reverb [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -spu_interpolation VALUE : Set interpolation mode\n"); - printf(" 0=None (Default)\n"); - printf(" 1=Simple\n"); - printf(" 2=Gaussian\n"); - printf(" 3=Cubic\n"); - - printf("\nNeon Options (default GPU):\n"); - printf(" -enhance : Enable graphic enhancement\n"); - - printf("\nGles Options:\n"); - printf(" -gles_dithering VALUE : Enable/disable dithering [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_mask VALUE : Enable/disable mask detect [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_filtering VALUE : Texture Filtering\n"); - printf(" 0=None (Default)\n"); - printf(" 1=Standard\n"); - printf(" 2=Extended\n"); - printf(" 3=Standard-sprites\n"); - printf(" 4=Extended-sprites\n"); - printf(" 5=Standard+sprites\n"); - printf(" 6=Extended+sprites\n"); - printf(" -gles_fbtex VALUE : Framebuffer Textures\n"); - printf(" 0=Emulated VRam (Default)\n"); - printf(" 1=Black\n"); - printf(" 2=Card\n"); - printf(" 3=Card+soft\n"); - printf(" -gles_vram VALUE : Texture RAM size in MB [4-128]\n"); - printf(" (Default 64)\n"); - printf(" -gles_fastmdec VALUE : Enable/disable Fast Mdec [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_advblend VALUE : Enable/disable Adv. Blend [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_opaque VALUE : Enable/disable Opaque Pass [0/1]\n"); - printf(" (Default disabled)\n"); -} - -int main(int argc, char **argv) -{ - if (argc == 1 || (argc == 2 && (!strcmp(argv[1], "--help") || !strcmp(argv[1], "-help") || !strcmp(argv[1], "-h")))) { - PrintHelp(); - return 0; - } - - emu_core_preinit(); - ChangeWorkingDirectory("c"); - char file[MAXPATHLEN] = ""; - char path[MAXPATHLEN]; - const char *cdfile = NULL; - int loadst = 0; - int i; - int getst = -1; - int discNumber = 0; - - g_menuscreen_w = 800; - g_menuscreen_h = 480; - - strcpy(Config.Gpu, "builtin_gpu"); - strcpy(Config.Spu, "builtin_spu"); - strcpy(Config.BiosDir, "/home/user/MyDocs"); - strcpy(Config.PluginsDir, "/opt/maemo/usr/games/plugins"); - snprintf(Config.PatchesDir, sizeof(Config.PatchesDir), "/opt/maemo/usr/games" PATCHES_DIR); - Config.PsxAuto = 1; - pl_rearmed_cbs.frameskip = -1; - strcpy(Config.Bios, "HLE"); - spu_config.iUseReverb = 1; - spu_config.iUseInterpolation = 1; - - in_type1 = PSE_PAD_TYPE_STANDARD; - in_type2 = PSE_PAD_TYPE_STANDARD; - - accelOptions.sens = 150; - accelOptions.y_def = 500; - accelOptions.maxValue = 500.0; - - // read command line options - for (i = 1; i < argc; i++) { - if (!strcmp(argv[i], "-psxout")) Config.PsxOut = 1; - else if (!strcmp(argv[i], "-load")) loadst = atol(argv[++i]); - else if (!strcmp(argv[i], "-cdfile")) { - char isofilename[MAXPATHLEN]; - if (i+1 >= argc) break; - strncpy(isofilename, argv[++i], MAXPATHLEN); - if (isofilename[0] != '/') { - getcwd(path, MAXPATHLEN); - if (strlen(path) + strlen(isofilename) + 1 < MAXPATHLEN) { - strcat(path, "/"); - strcat(path, isofilename); - strcpy(isofilename, path); - } else - isofilename[0] = 0; - } - cdfile = isofilename; - } - else if (!strcmp(argv[i],"-frameskip")) { - int tv_reg = atol(argv[++i]); - if (tv_reg < -1) - pl_rearmed_cbs.frameskip = -1; - else - pl_rearmed_cbs.frameskip = tv_reg; - } - else if (!strcmp(argv[i],"-region")) { - int psx_reg = atol(argv[++i]); - if (psx_reg == 0 || psx_reg == 1){ - Config.PsxAuto = 0; - Config.PsxType = psx_reg; - } - } - - else if (!strcmp(argv[i],"-get_sstatename")) getst = atol(argv[++i]); - - else if (!strcmp(argv[i], "-fullscreen")) g_maemo_opts |= 2; - else if (!strcmp(argv[i], "-accel")) g_maemo_opts |= 4; - else if (!strcmp(argv[i], "-nosound")) strcpy(Config.Spu, "spunull.so"); - else if (!strcmp(argv[i], "-bdir")) sprintf(Config.BiosDir, "%s", argv[++i]); - else if (!strcmp(argv[i], "-pdir")) sprintf(Config.PluginsDir, "%s", argv[++i]); - else if (!strcmp(argv[i], "-bios")) sprintf(Config.Bios, "%s", argv[++i]); - else if (!strcmp(argv[i], "-gles")) { strcpy(Config.Gpu, "gpu_gles.so"); g_maemo_opts |= 8 ;} - else if (!strcmp(argv[i], "-oldgpu")) strcpy(Config.Gpu, "gpu_peops.so"); - else if (!strcmp(argv[i], "-unai")) strcpy(Config.Gpu, "gpu_unai.so"); - else if (!strcmp(argv[i], "-cdda")) Config.Cdda = 1; - else if (!strcmp(argv[i], "-xa")) Config.Xa = 1; - else if (!strcmp(argv[i], "-rcnt")) Config.RCntFix = 1 ; - else if (!strcmp(argv[i], "-sio")) Config.Sio = 1; - else if (!strcmp(argv[i], "-spuirq")) Config.SpuIrq = 1; - else if (!strcmp(argv[i], "-vsync")) Config.VSyncWA = 1; - else if (!strcmp(argv[i], "-fps")) g_opts |=OPT_SHOWFPS; - else if (!strcmp(argv[i], "-cpu")) g_opts |=OPT_SHOWCPU; - else if (!strcmp(argv[i], "-spu")) g_opts |=OPT_SHOWSPU; - else if (!strcmp(argv[i], "-nofl")) g_opts |=OPT_NO_FRAMELIM; - else if (!strcmp(argv[i], "-mcd1")) sprintf(Config.Mcd1, "%s", argv[++i]); - else if (!strcmp(argv[i], "-mcd2")) sprintf(Config.Mcd2, "%s", argv[++i]); - - else if (!strcmp(argv[i], "-cpuclock")) cycle_multiplier = 10000 / atol(argv[++i]); - else if (!strcmp(argv[i], "-guncon")) in_type1 = PSE_PAD_TYPE_GUNCON; - else if (!strcmp(argv[i], "-gunnotrigger")) g_opts |= OPT_TSGUN_NOTRIGGER; - else if (!strcmp(argv[i], "-analog")) in_type1 = PSE_PAD_TYPE_ANALOGPAD; - else if (!strcmp(argv[i], "-vibration")) { in_type1 = PSE_PAD_TYPE_ANALOGPAD; in_enable_vibration = 1; } - else if (!strcmp(argv[i], "-sens")) accelOptions.sens = atol(argv[++i]); - else if (!strcmp(argv[i], "-ydef")) accelOptions.y_def = atol(argv[++i]); - else if (!strcmp(argv[i], "-max")) accelOptions.maxValue = atol(argv[++i]); - else if (!strcmp(argv[i], "-displayon")) bKeepDisplayOn = TRUE; - else if (!strcmp(argv[i], "-keys")) sprintf(keys_config_file, "%s", argv[++i]); - else if (!strcmp(argv[i], "-autosave")) bAutosaveOnExit = TRUE; - else if (!strcmp(argv[i], "-disc")) discNumber = atol(argv[++i]); - else if (!strcmp(argv[i], "-corners")){ - int j = 0; - i++; - char num[2]; - for (j=0; j<strlen(argv[i]); j++){ - strncpy(num, argv[i] + j, 1); - cornerActions[j] = atoi(num); - } - } - - else if (!strcmp(argv[i], "-spu_reverb")) spu_config.iUseReverb = atol(argv[++i]); - else if (!strcmp(argv[i], "-spu_interpolation")) spu_config.iUseInterpolation = atol(argv[++i]); - - else if (!strcmp(argv[i], "-enhance")) pl_rearmed_cbs.gpu_neon.enhancement_enable = 1; - else if (!strcmp(argv[i], "-enhancehack")) pl_rearmed_cbs.gpu_neon.enhancement_no_main = 1; - - else if (!strcmp(argv[i], "-gles_dithering")) pl_rearmed_cbs.gpu_peopsgl.bDrawDither = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_mask")) pl_rearmed_cbs.gpu_peopsgl.iUseMask = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_filtering")) pl_rearmed_cbs.gpu_peopsgl.iFilterType = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_fbtex")) pl_rearmed_cbs.gpu_peopsgl.iFrameTexType = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_vram")) pl_rearmed_cbs.gpu_peopsgl.iVRamSize = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_fastmdec")) pl_rearmed_cbs.gpu_peopsgl.bUseFastMdec = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_advblend")) pl_rearmed_cbs.gpu_peopsgl.bAdvancedBlend = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_opaque")) pl_rearmed_cbs.gpu_peopsgl.bOpaquePass = atol(argv[++i]); - - else { - fprintf(stderr, "Unknown option: %s\n", argv[i]); - return 1; - } - } - - pl_init(); - if (emu_core_init() == -1) - return 1; - - if (cdfile) { - set_cd_image(cdfile); - strcpy(file_name, strrchr(cdfile,'/')); - } - - if (LoadPlugins() == -1) { - SysMessage("Failed loading plugins!"); - return 1; - } - - if (discNumber > 0) - cdrIsoMultidiskSelect = discNumber - 1; - - if (OpenPlugins() == -1) { - return 1; - } - plugin_call_rearmed_cbs(); - - CheckCdrom(); - - if (getst >= 0){ - char fname[MAXPATHLEN]; - - get_state_filename(fname, sizeof(fname), getst); - printf("SAVESTATE: %s\n", fname); - if (cdrIsoMultidiskCount > 1){ - int i = 0; - for (i=1; i<cdrIsoMultidiskCount; i++){ - cdrIsoMultidiskSelect = i; - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - CDR_close(); - if (CDR_open() == 0){ - CheckCdrom(); - get_state_filename(fname, sizeof(fname), getst); - printf("SAVESTATE: %s\n", fname); - } - } - } - return 0; - } - - SysReset(); - - if (file[0] != '\0') { - if (Load(file) != -1) - ready_to_go = 1; - } else { - if (cdfile) { - if (LoadCdrom() == -1) { - ClosePlugins(); - printf(_("Could not load CD-ROM!\n")); - return -1; - } - emu_on_new_cd(0); - ready_to_go = 1; - } - } - - if (!ready_to_go) { - printf ("something goes wrong, maybe you forgot -cdfile ? \n"); - return 1; - } - - if (cdrIsoMultidiskCount > 1) - printf ("Loaded a multidisc image: %i discs.\n", cdrIsoMultidiskCount); - - // If a state has been specified, then load that - if (loadst) { - int ret = emu_load_state(loadst - 1); - printf("%s state %d\n", ret ? "Failed to load" : "Loaded", loadst); - state_slot = loadst - 1; - } - - if (maemo_init(&argc, &argv)) - return 1; - - if (GPU_open != NULL) { - int ret = GPU_open(&gpuDisp, "PCSX", NULL); - if (ret){ - fprintf(stderr, "Warning: GPU_open returned %d\n", ret); - gpuDisp=ret; - } - } - - if (Config.HLE) - printf("Note: running without BIOS, expect compatibility problems\n"); - - dfinput_activate(); - pl_timing_prepare(Config.PsxType); - - while (1) - { - stop = 0; - emu_action = SACTION_NONE; - - psxCpu->Execute(); - if (emu_action != SACTION_NONE) - do_emu_action(); - } - - maemo_finish(); - return 0; -} - diff --git a/plugins/cdrcimg/cdrcimg.c b/plugins/cdrcimg/cdrcimg.c index 76cdfba..45016bb 100644 --- a/plugins/cdrcimg/cdrcimg.c +++ b/plugins/cdrcimg/cdrcimg.c @@ -14,7 +14,9 @@ #include <zlib.h> #ifndef _WIN32 #define CALLBACK +#ifndef NO_DYLIB #include <dlfcn.h> +#endif #else #define WIN32_LEAN_AND_MEAN #include <windows.h> @@ -98,7 +100,7 @@ static long CDRgetTD(unsigned char track, unsigned char *buffer) return 0; } -int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size) +int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size) { static z_stream z; int ret = 0; @@ -199,7 +201,7 @@ static long CDRreadTrack(unsigned char *time) ret = uncompress(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); break; case CDRC_ZLIB2: - ret = uncompress2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); + ret = uncomp2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); break; case CDRC_BZ: ret = pBZ2_bzBuffToBuffDecompress((char *)cdbuffer->raw, (unsigned int *)&cdbuffer_size, @@ -285,7 +287,7 @@ static long CDRinit(void) return -1; } } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) if (pBZ2_bzBuffToBuffDecompress == NULL) { void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY); if (h == NULL) diff --git a/plugins/dfinput/main.c b/plugins/dfinput/main.c index 475ea07..4204b86 100644 --- a/plugins/dfinput/main.c +++ b/plugins/dfinput/main.c @@ -44,6 +44,7 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; PAD##n##_poll = PADpoll_guncon; \ guncon_init(); \ break; \ + case PSE_PAD_TYPE_NEGCON: \ case PSE_PAD_TYPE_GUN: \ default: \ PAD##n##_startPoll = PAD##n##__startPoll; \ @@ -52,13 +53,19 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; } \ } + void dfinput_activate(void) { + #ifndef HAVE_LIBRETRO PadDataS pad; + pad.portMultitap = -1; + pad.requestPadIndex = 0; PAD1_readPort1(&pad); select_pad(1); + pad.requestPadIndex = 1; PAD2_readPort2(&pad); select_pad(2); + #endif } diff --git a/plugins/dfinput/pad.c b/plugins/dfinput/pad.c index 7e00a11..853c8c8 100644 --- a/plugins/dfinput/pad.c +++ b/plugins/dfinput/pad.c @@ -254,6 +254,7 @@ unsigned char PADpoll(unsigned char value) { #define PADpoll PADpoll_ #endif +#ifndef HAVE_LIBRETRO unsigned char PADpoll_pad(unsigned char value) { if (CurByte == 0) { CurCmd = value; @@ -302,3 +303,4 @@ void pad_init(void) padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD; } } +#endif diff --git a/plugins/dfsound/gauss_i.h b/plugins/dfsound/gauss_i.h index 4405e57..012cf70 100644 --- a/plugins/dfsound/gauss_i.h +++ b/plugins/dfsound/gauss_i.h @@ -5,6 +5,7 @@ copyright : (C) 2003 by Chris Moeller, eh, whatever
email : chris@kode54.tk
***************************************************************************/
+
/***************************************************************************
* *
* This program is free software; you can redistribute it and/or modify *
@@ -15,136 +16,296 @@ * *
***************************************************************************/
+//*************************************************************************//
+// History of changes:
+//
+// 2003/02/08 - kode54
+// - generated by interleaving table from gauss.h from the libopenspc
+// project; a gaussian bell curve table logged from the SPC-700,
+// though Neill says he logged the same curve from a PSX SPU. Also
+// says that interleaving the coefficients together runs faster. Meh.
+//
+//*************************************************************************//
+
#ifndef GAUSS_H
#define GAUSS_H
-static const short gauss[]={
- 0x172, 0x519, 0x176, 0x000, 0x16E, 0x519, 0x17A, 0x000,
- 0x16A, 0x518, 0x17D, 0x000, 0x166, 0x518, 0x181, 0x000,
- 0x162, 0x518, 0x185, 0x000, 0x15F, 0x518, 0x189, 0x000,
- 0x15B, 0x518, 0x18D, 0x000, 0x157, 0x517, 0x191, 0x000,
- 0x153, 0x517, 0x195, 0x000, 0x150, 0x517, 0x19A, 0x000,
- 0x14C, 0x516, 0x19E, 0x000, 0x148, 0x516, 0x1A2, 0x000,
- 0x145, 0x515, 0x1A6, 0x000, 0x141, 0x514, 0x1AA, 0x000,
- 0x13E, 0x514, 0x1AE, 0x000, 0x13A, 0x513, 0x1B2, 0x000,
- 0x137, 0x512, 0x1B7, 0x001, 0x133, 0x511, 0x1BB, 0x001,
- 0x130, 0x511, 0x1BF, 0x001, 0x12C, 0x510, 0x1C3, 0x001,
- 0x129, 0x50F, 0x1C8, 0x001, 0x125, 0x50E, 0x1CC, 0x001,
- 0x122, 0x50D, 0x1D0, 0x001, 0x11E, 0x50C, 0x1D5, 0x001,
- 0x11B, 0x50B, 0x1D9, 0x001, 0x118, 0x50A, 0x1DD, 0x001,
- 0x114, 0x508, 0x1E2, 0x001, 0x111, 0x507, 0x1E6, 0x002,
- 0x10E, 0x506, 0x1EB, 0x002, 0x10B, 0x504, 0x1EF, 0x002,
- 0x107, 0x503, 0x1F3, 0x002, 0x104, 0x502, 0x1F8, 0x002,
- 0x101, 0x500, 0x1FC, 0x002, 0x0FE, 0x4FF, 0x201, 0x002,
- 0x0FB, 0x4FD, 0x205, 0x003, 0x0F8, 0x4FB, 0x20A, 0x003,
- 0x0F5, 0x4FA, 0x20F, 0x003, 0x0F2, 0x4F8, 0x213, 0x003,
- 0x0EF, 0x4F6, 0x218, 0x003, 0x0EC, 0x4F5, 0x21C, 0x004,
- 0x0E9, 0x4F3, 0x221, 0x004, 0x0E6, 0x4F1, 0x226, 0x004,
- 0x0E3, 0x4EF, 0x22A, 0x004, 0x0E0, 0x4ED, 0x22F, 0x004,
- 0x0DD, 0x4EB, 0x233, 0x005, 0x0DA, 0x4E9, 0x238, 0x005,
- 0x0D7, 0x4E7, 0x23D, 0x005, 0x0D4, 0x4E5, 0x241, 0x005,
- 0x0D2, 0x4E3, 0x246, 0x006, 0x0CF, 0x4E0, 0x24B, 0x006,
- 0x0CC, 0x4DE, 0x250, 0x006, 0x0C9, 0x4DC, 0x254, 0x006,
- 0x0C7, 0x4D9, 0x259, 0x007, 0x0C4, 0x4D7, 0x25E, 0x007,
- 0x0C1, 0x4D5, 0x263, 0x007, 0x0BF, 0x4D2, 0x267, 0x008,
- 0x0BC, 0x4D0, 0x26C, 0x008, 0x0BA, 0x4CD, 0x271, 0x008,
- 0x0B7, 0x4CB, 0x276, 0x009, 0x0B4, 0x4C8, 0x27B, 0x009,
- 0x0B2, 0x4C5, 0x280, 0x009, 0x0AF, 0x4C3, 0x284, 0x00A,
- 0x0AD, 0x4C0, 0x289, 0x00A, 0x0AB, 0x4BD, 0x28E, 0x00A,
- 0x0A8, 0x4BA, 0x293, 0x00B, 0x0A6, 0x4B7, 0x298, 0x00B,
- 0x0A3, 0x4B5, 0x29D, 0x00B, 0x0A1, 0x4B2, 0x2A2, 0x00C,
- 0x09F, 0x4AF, 0x2A6, 0x00C, 0x09C, 0x4AC, 0x2AB, 0x00D,
- 0x09A, 0x4A9, 0x2B0, 0x00D, 0x098, 0x4A6, 0x2B5, 0x00E,
- 0x096, 0x4A2, 0x2BA, 0x00E, 0x093, 0x49F, 0x2BF, 0x00F,
- 0x091, 0x49C, 0x2C4, 0x00F, 0x08F, 0x499, 0x2C9, 0x00F,
- 0x08D, 0x496, 0x2CE, 0x010, 0x08B, 0x492, 0x2D3, 0x010,
- 0x089, 0x48F, 0x2D8, 0x011, 0x086, 0x48C, 0x2DC, 0x011,
- 0x084, 0x488, 0x2E1, 0x012, 0x082, 0x485, 0x2E6, 0x013,
- 0x080, 0x481, 0x2EB, 0x013, 0x07E, 0x47E, 0x2F0, 0x014,
- 0x07C, 0x47A, 0x2F5, 0x014, 0x07A, 0x477, 0x2FA, 0x015,
- 0x078, 0x473, 0x2FF, 0x015, 0x076, 0x470, 0x304, 0x016,
- 0x075, 0x46C, 0x309, 0x017, 0x073, 0x468, 0x30E, 0x017,
- 0x071, 0x465, 0x313, 0x018, 0x06F, 0x461, 0x318, 0x018,
- 0x06D, 0x45D, 0x31D, 0x019, 0x06B, 0x459, 0x322, 0x01A,
- 0x06A, 0x455, 0x326, 0x01B, 0x068, 0x452, 0x32B, 0x01B,
- 0x066, 0x44E, 0x330, 0x01C, 0x064, 0x44A, 0x335, 0x01D,
- 0x063, 0x446, 0x33A, 0x01D, 0x061, 0x442, 0x33F, 0x01E,
- 0x05F, 0x43E, 0x344, 0x01F, 0x05E, 0x43A, 0x349, 0x020,
- 0x05C, 0x436, 0x34E, 0x020, 0x05A, 0x432, 0x353, 0x021,
- 0x059, 0x42E, 0x357, 0x022, 0x057, 0x42A, 0x35C, 0x023,
- 0x056, 0x425, 0x361, 0x024, 0x054, 0x421, 0x366, 0x024,
- 0x053, 0x41D, 0x36B, 0x025, 0x051, 0x419, 0x370, 0x026,
- 0x050, 0x415, 0x374, 0x027, 0x04E, 0x410, 0x379, 0x028,
- 0x04D, 0x40C, 0x37E, 0x029, 0x04C, 0x408, 0x383, 0x02A,
- 0x04A, 0x403, 0x388, 0x02B, 0x049, 0x3FF, 0x38C, 0x02C,
- 0x047, 0x3FB, 0x391, 0x02D, 0x046, 0x3F6, 0x396, 0x02E,
- 0x045, 0x3F2, 0x39B, 0x02F, 0x043, 0x3ED, 0x39F, 0x030,
- 0x042, 0x3E9, 0x3A4, 0x031, 0x041, 0x3E5, 0x3A9, 0x032,
- 0x040, 0x3E0, 0x3AD, 0x033, 0x03E, 0x3DC, 0x3B2, 0x034,
- 0x03D, 0x3D7, 0x3B7, 0x035, 0x03C, 0x3D2, 0x3BB, 0x036,
- 0x03B, 0x3CE, 0x3C0, 0x037, 0x03A, 0x3C9, 0x3C5, 0x038,
- 0x038, 0x3C5, 0x3C9, 0x03A, 0x037, 0x3C0, 0x3CE, 0x03B,
- 0x036, 0x3BB, 0x3D2, 0x03C, 0x035, 0x3B7, 0x3D7, 0x03D,
- 0x034, 0x3B2, 0x3DC, 0x03E, 0x033, 0x3AD, 0x3E0, 0x040,
- 0x032, 0x3A9, 0x3E5, 0x041, 0x031, 0x3A4, 0x3E9, 0x042,
- 0x030, 0x39F, 0x3ED, 0x043, 0x02F, 0x39B, 0x3F2, 0x045,
- 0x02E, 0x396, 0x3F6, 0x046, 0x02D, 0x391, 0x3FB, 0x047,
- 0x02C, 0x38C, 0x3FF, 0x049, 0x02B, 0x388, 0x403, 0x04A,
- 0x02A, 0x383, 0x408, 0x04C, 0x029, 0x37E, 0x40C, 0x04D,
- 0x028, 0x379, 0x410, 0x04E, 0x027, 0x374, 0x415, 0x050,
- 0x026, 0x370, 0x419, 0x051, 0x025, 0x36B, 0x41D, 0x053,
- 0x024, 0x366, 0x421, 0x054, 0x024, 0x361, 0x425, 0x056,
- 0x023, 0x35C, 0x42A, 0x057, 0x022, 0x357, 0x42E, 0x059,
- 0x021, 0x353, 0x432, 0x05A, 0x020, 0x34E, 0x436, 0x05C,
- 0x020, 0x349, 0x43A, 0x05E, 0x01F, 0x344, 0x43E, 0x05F,
- 0x01E, 0x33F, 0x442, 0x061, 0x01D, 0x33A, 0x446, 0x063,
- 0x01D, 0x335, 0x44A, 0x064, 0x01C, 0x330, 0x44E, 0x066,
- 0x01B, 0x32B, 0x452, 0x068, 0x01B, 0x326, 0x455, 0x06A,
- 0x01A, 0x322, 0x459, 0x06B, 0x019, 0x31D, 0x45D, 0x06D,
- 0x018, 0x318, 0x461, 0x06F, 0x018, 0x313, 0x465, 0x071,
- 0x017, 0x30E, 0x468, 0x073, 0x017, 0x309, 0x46C, 0x075,
- 0x016, 0x304, 0x470, 0x076, 0x015, 0x2FF, 0x473, 0x078,
- 0x015, 0x2FA, 0x477, 0x07A, 0x014, 0x2F5, 0x47A, 0x07C,
- 0x014, 0x2F0, 0x47E, 0x07E, 0x013, 0x2EB, 0x481, 0x080,
- 0x013, 0x2E6, 0x485, 0x082, 0x012, 0x2E1, 0x488, 0x084,
- 0x011, 0x2DC, 0x48C, 0x086, 0x011, 0x2D8, 0x48F, 0x089,
- 0x010, 0x2D3, 0x492, 0x08B, 0x010, 0x2CE, 0x496, 0x08D,
- 0x00F, 0x2C9, 0x499, 0x08F, 0x00F, 0x2C4, 0x49C, 0x091,
- 0x00F, 0x2BF, 0x49F, 0x093, 0x00E, 0x2BA, 0x4A2, 0x096,
- 0x00E, 0x2B5, 0x4A6, 0x098, 0x00D, 0x2B0, 0x4A9, 0x09A,
- 0x00D, 0x2AB, 0x4AC, 0x09C, 0x00C, 0x2A6, 0x4AF, 0x09F,
- 0x00C, 0x2A2, 0x4B2, 0x0A1, 0x00B, 0x29D, 0x4B5, 0x0A3,
- 0x00B, 0x298, 0x4B7, 0x0A6, 0x00B, 0x293, 0x4BA, 0x0A8,
- 0x00A, 0x28E, 0x4BD, 0x0AB, 0x00A, 0x289, 0x4C0, 0x0AD,
- 0x00A, 0x284, 0x4C3, 0x0AF, 0x009, 0x280, 0x4C5, 0x0B2,
- 0x009, 0x27B, 0x4C8, 0x0B4, 0x009, 0x276, 0x4CB, 0x0B7,
- 0x008, 0x271, 0x4CD, 0x0BA, 0x008, 0x26C, 0x4D0, 0x0BC,
- 0x008, 0x267, 0x4D2, 0x0BF, 0x007, 0x263, 0x4D5, 0x0C1,
- 0x007, 0x25E, 0x4D7, 0x0C4, 0x007, 0x259, 0x4D9, 0x0C7,
- 0x006, 0x254, 0x4DC, 0x0C9, 0x006, 0x250, 0x4DE, 0x0CC,
- 0x006, 0x24B, 0x4E0, 0x0CF, 0x006, 0x246, 0x4E3, 0x0D2,
- 0x005, 0x241, 0x4E5, 0x0D4, 0x005, 0x23D, 0x4E7, 0x0D7,
- 0x005, 0x238, 0x4E9, 0x0DA, 0x005, 0x233, 0x4EB, 0x0DD,
- 0x004, 0x22F, 0x4ED, 0x0E0, 0x004, 0x22A, 0x4EF, 0x0E3,
- 0x004, 0x226, 0x4F1, 0x0E6, 0x004, 0x221, 0x4F3, 0x0E9,
- 0x004, 0x21C, 0x4F5, 0x0EC, 0x003, 0x218, 0x4F6, 0x0EF,
- 0x003, 0x213, 0x4F8, 0x0F2, 0x003, 0x20F, 0x4FA, 0x0F5,
- 0x003, 0x20A, 0x4FB, 0x0F8, 0x003, 0x205, 0x4FD, 0x0FB,
- 0x002, 0x201, 0x4FF, 0x0FE, 0x002, 0x1FC, 0x500, 0x101,
- 0x002, 0x1F8, 0x502, 0x104, 0x002, 0x1F3, 0x503, 0x107,
- 0x002, 0x1EF, 0x504, 0x10B, 0x002, 0x1EB, 0x506, 0x10E,
- 0x002, 0x1E6, 0x507, 0x111, 0x001, 0x1E2, 0x508, 0x114,
- 0x001, 0x1DD, 0x50A, 0x118, 0x001, 0x1D9, 0x50B, 0x11B,
- 0x001, 0x1D5, 0x50C, 0x11E, 0x001, 0x1D0, 0x50D, 0x122,
- 0x001, 0x1CC, 0x50E, 0x125, 0x001, 0x1C8, 0x50F, 0x129,
- 0x001, 0x1C3, 0x510, 0x12C, 0x001, 0x1BF, 0x511, 0x130,
- 0x001, 0x1BB, 0x511, 0x133, 0x001, 0x1B7, 0x512, 0x137,
- 0x000, 0x1B2, 0x513, 0x13A, 0x000, 0x1AE, 0x514, 0x13E,
- 0x000, 0x1AA, 0x514, 0x141, 0x000, 0x1A6, 0x515, 0x145,
- 0x000, 0x1A2, 0x516, 0x148, 0x000, 0x19E, 0x516, 0x14C,
- 0x000, 0x19A, 0x517, 0x150, 0x000, 0x195, 0x517, 0x153,
- 0x000, 0x191, 0x517, 0x157, 0x000, 0x18D, 0x518, 0x15B,
- 0x000, 0x189, 0x518, 0x15F, 0x000, 0x185, 0x518, 0x162,
- 0x000, 0x181, 0x518, 0x166, 0x000, 0x17D, 0x518, 0x16A,
- 0x000, 0x17A, 0x519, 0x16E, 0x000, 0x176, 0x519, 0x172};
-#endif
+
+/*
+128 * 4 table
+- 0 = past #3
+- 1 = past #2
+- 2 = past #1
+- 3 = past #0
+
+
+offset 0
+for(0) + for(256) + rev(256) + rev(0)
+*/
+
+
+// NOTE: Dr. Hell
+// - Excel NORMDIST($A6,2,0.567,FALSE) [0-4] = 98%
+
+
+// Mednafen's table (PSX) 99-100%
+const int gauss[]={
+ 0x12c7, 0x59b3, 0x1307, 0xffffffff,
+ 0x1288, 0x59b2, 0x1347, 0xffffffff,
+ 0x1249, 0x59b0, 0x1388, 0xffffffff,
+ 0x120b, 0x59ad, 0x13c9, 0xffffffff,
+ 0x11cd, 0x59a9, 0x140b, 0xffffffff,
+ 0x118f, 0x59a4, 0x144d, 0xffffffff,
+ 0x1153, 0x599e, 0x1490, 0xffffffff,
+ 0x1116, 0x5997, 0x14d4, 0xffffffff,
+ 0x10db, 0x598f, 0x1517, 0xffffffff,
+ 0x109f, 0x5986, 0x155c, 0xffffffff,
+ 0x1065, 0x597c, 0x15a0, 0xffffffff,
+ 0x102a, 0x5971, 0x15e6, 0xffffffff,
+ 0x0ff1, 0x5965, 0x162c, 0xffffffff,
+ 0x0fb7, 0x5958, 0x1672, 0xffffffff,
+ 0x0f7f, 0x5949, 0x16b9, 0xffffffff,
+ 0x0f46, 0x593a, 0x1700, 0xffffffff,
+ 0x0f0f, 0x592a, 0x1747, 0x0000,
+ 0x0ed7, 0x5919, 0x1790, 0x0000,
+ 0x0ea1, 0x5907, 0x17d8, 0x0000,
+ 0x0e6b, 0x58f4, 0x1821, 0x0000,
+ 0x0e35, 0x58e0, 0x186b, 0x0000,
+ 0x0e00, 0x58cb, 0x18b5, 0x0000,
+ 0x0dcb, 0x58b5, 0x1900, 0x0000,
+ 0x0d97, 0x589e, 0x194b, 0x0001,
+ 0x0d63, 0x5886, 0x1996, 0x0001,
+ 0x0d30, 0x586d, 0x19e2, 0x0001,
+ 0x0cfd, 0x5853, 0x1a2e, 0x0001,
+ 0x0ccb, 0x5838, 0x1a7b, 0x0002,
+ 0x0c99, 0x581c, 0x1ac8, 0x0002,
+ 0x0c68, 0x57ff, 0x1b16, 0x0002,
+ 0x0c38, 0x57e2, 0x1b64, 0x0003,
+ 0x0c07, 0x57c3, 0x1bb3, 0x0003,
+ 0x0bd8, 0x57a3, 0x1c02, 0x0003,
+ 0x0ba9, 0x5782, 0x1c51, 0x0004,
+ 0x0b7a, 0x5761, 0x1ca1, 0x0004,
+ 0x0b4c, 0x573e, 0x1cf1, 0x0005,
+ 0x0b1e, 0x571b, 0x1d42, 0x0005,
+ 0x0af1, 0x56f6, 0x1d93, 0x0006,
+ 0x0ac4, 0x56d1, 0x1de5, 0x0007,
+ 0x0a98, 0x56ab, 0x1e37, 0x0007,
+ 0x0a6c, 0x5684, 0x1e89, 0x0008,
+ 0x0a40, 0x565b, 0x1edc, 0x0009,
+ 0x0a16, 0x5632, 0x1f2f, 0x0009,
+ 0x09eb, 0x5609, 0x1f82, 0x000a,
+ 0x09c1, 0x55de, 0x1fd6, 0x000b,
+ 0x0998, 0x55b2, 0x202a, 0x000c,
+ 0x096f, 0x5585, 0x207f, 0x000d,
+ 0x0946, 0x5558, 0x20d4, 0x000e,
+ 0x091e, 0x5529, 0x2129, 0x000f,
+ 0x08f7, 0x54fa, 0x217f, 0x0010,
+ 0x08d0, 0x54ca, 0x21d5, 0x0011,
+ 0x08a9, 0x5499, 0x222c, 0x0012,
+ 0x0883, 0x5467, 0x2282, 0x0013,
+ 0x085d, 0x5434, 0x22da, 0x0015,
+ 0x0838, 0x5401, 0x2331, 0x0016,
+ 0x0813, 0x53cc, 0x2389, 0x0018,
+ 0x07ef, 0x5397, 0x23e1, 0x0019,
+ 0x07cb, 0x5361, 0x2439, 0x001b,
+ 0x07a7, 0x532a, 0x2492, 0x001c,
+ 0x0784, 0x52f3, 0x24eb, 0x001e,
+ 0x0762, 0x52ba, 0x2545, 0x0020,
+ 0x0740, 0x5281, 0x259e, 0x0021,
+ 0x071e, 0x5247, 0x25f8, 0x0023,
+ 0x06fd, 0x520c, 0x2653, 0x0025,
+ 0x06dc, 0x51d0, 0x26ad, 0x0027,
+ 0x06bb, 0x5194, 0x2708, 0x0029,
+ 0x069b, 0x5156, 0x2763, 0x002c,
+ 0x067c, 0x5118, 0x27be, 0x002e,
+ 0x065c, 0x50da, 0x281a, 0x0030,
+ 0x063e, 0x509a, 0x2876, 0x0033,
+ 0x061f, 0x505a, 0x28d2, 0x0035,
+ 0x0601, 0x5019, 0x292e, 0x0038,
+ 0x05e4, 0x4fd7, 0x298b, 0x003a,
+ 0x05c7, 0x4f95, 0x29e7, 0x003d,
+ 0x05aa, 0x4f52, 0x2a44, 0x0040,
+ 0x058e, 0x4f0e, 0x2aa1, 0x0043,
+ 0x0572, 0x4ec9, 0x2aff, 0x0046,
+ 0x0556, 0x4e84, 0x2b5c, 0x0049,
+ 0x053b, 0x4e3e, 0x2bba, 0x004d,
+ 0x0520, 0x4df7, 0x2c18, 0x0050,
+ 0x0506, 0x4db0, 0x2c76, 0x0054,
+ 0x04ec, 0x4d68, 0x2cd4, 0x0057,
+ 0x04d2, 0x4d20, 0x2d33, 0x005b,
+ 0x04b9, 0x4cd7, 0x2d91, 0x005f,
+ 0x04a0, 0x4c8d, 0x2df0, 0x0063,
+ 0x0488, 0x4c42, 0x2e4f, 0x0067,
+ 0x0470, 0x4bf7, 0x2eae, 0x006b,
+ 0x0458, 0x4bac, 0x2f0d, 0x006f,
+ 0x0441, 0x4b5f, 0x2f6c, 0x0074,
+ 0x042a, 0x4b13, 0x2fcc, 0x0078,
+ 0x0413, 0x4ac5, 0x302b, 0x007d,
+ 0x03fc, 0x4a77, 0x308b, 0x0082,
+ 0x03e7, 0x4a29, 0x30ea, 0x0087,
+ 0x03d1, 0x49d9, 0x314a, 0x008c,
+ 0x03bc, 0x498a, 0x31aa, 0x0091,
+ 0x03a7, 0x493a, 0x3209, 0x0096,
+ 0x0392, 0x48e9, 0x3269, 0x009c,
+ 0x037e, 0x4898, 0x32c9, 0x00a1,
+ 0x036a, 0x4846, 0x3329, 0x00a7,
+ 0x0356, 0x47f4, 0x3389, 0x00ad,
+ 0x0343, 0x47a1, 0x33e9, 0x00b3,
+ 0x0330, 0x474e, 0x3449, 0x00ba,
+ 0x031d, 0x46fa, 0x34a9, 0x00c0,
+ 0x030b, 0x46a6, 0x3509, 0x00c7,
+ 0x02f9, 0x4651, 0x3569, 0x00cd,
+ 0x02e7, 0x45fc, 0x35c9, 0x00d4,
+ 0x02d6, 0x45a6, 0x3629, 0x00db,
+ 0x02c4, 0x4550, 0x3689, 0x00e3,
+ 0x02b4, 0x44fa, 0x36e8, 0x00ea,
+ 0x02a3, 0x44a3, 0x3748, 0x00f2,
+ 0x0293, 0x444c, 0x37a8, 0x00fa,
+ 0x0283, 0x43f4, 0x3807, 0x0101,
+ 0x0273, 0x439c, 0x3867, 0x010a,
+ 0x0264, 0x4344, 0x38c6, 0x0112,
+ 0x0255, 0x42eb, 0x3926, 0x011b,
+ 0x0246, 0x4292, 0x3985, 0x0123,
+ 0x0237, 0x4239, 0x39e4, 0x012c,
+ 0x0229, 0x41df, 0x3a43, 0x0135,
+ 0x021b, 0x4185, 0x3aa2, 0x013f,
+ 0x020d, 0x412a, 0x3b00, 0x0148,
+ 0x0200, 0x40d0, 0x3b5f, 0x0152,
+ 0x01f2, 0x4074, 0x3bbd, 0x015c,
+ 0x01e5, 0x4019, 0x3c1b, 0x0166,
+ 0x01d9, 0x3fbd, 0x3c79, 0x0171,
+ 0x01cc, 0x3f62, 0x3cd7, 0x017b,
+ 0x01c0, 0x3f05, 0x3d35, 0x0186,
+ 0x01b4, 0x3ea9, 0x3d92, 0x0191,
+ 0x01a8, 0x3e4c, 0x3def, 0x019c,
+ 0x019c, 0x3def, 0x3e4c, 0x01a8,
+ 0x0191, 0x3d92, 0x3ea9, 0x01b4,
+ 0x0186, 0x3d35, 0x3f05, 0x01c0,
+ 0x017b, 0x3cd7, 0x3f62, 0x01cc,
+ 0x0171, 0x3c79, 0x3fbd, 0x01d9,
+ 0x0166, 0x3c1b, 0x4019, 0x01e5,
+ 0x015c, 0x3bbd, 0x4074, 0x01f2,
+ 0x0152, 0x3b5f, 0x40d0, 0x0200,
+ 0x0148, 0x3b00, 0x412a, 0x020d,
+ 0x013f, 0x3aa2, 0x4185, 0x021b,
+ 0x0135, 0x3a43, 0x41df, 0x0229,
+ 0x012c, 0x39e4, 0x4239, 0x0237,
+ 0x0123, 0x3985, 0x4292, 0x0246,
+ 0x011b, 0x3926, 0x42eb, 0x0255,
+ 0x0112, 0x38c6, 0x4344, 0x0264,
+ 0x010a, 0x3867, 0x439c, 0x0273,
+ 0x0101, 0x3807, 0x43f4, 0x0283,
+ 0x00fa, 0x37a8, 0x444c, 0x0293,
+ 0x00f2, 0x3748, 0x44a3, 0x02a3,
+ 0x00ea, 0x36e8, 0x44fa, 0x02b4,
+ 0x00e3, 0x3689, 0x4550, 0x02c4,
+ 0x00db, 0x3629, 0x45a6, 0x02d6,
+ 0x00d4, 0x35c9, 0x45fc, 0x02e7,
+ 0x00cd, 0x3569, 0x4651, 0x02f9,
+ 0x00c7, 0x3509, 0x46a6, 0x030b,
+ 0x00c0, 0x34a9, 0x46fa, 0x031d,
+ 0x00ba, 0x3449, 0x474e, 0x0330,
+ 0x00b3, 0x33e9, 0x47a1, 0x0343,
+ 0x00ad, 0x3389, 0x47f4, 0x0356,
+ 0x00a7, 0x3329, 0x4846, 0x036a,
+ 0x00a1, 0x32c9, 0x4898, 0x037e,
+ 0x009c, 0x3269, 0x48e9, 0x0392,
+ 0x0096, 0x3209, 0x493a, 0x03a7,
+ 0x0091, 0x31aa, 0x498a, 0x03bc,
+ 0x008c, 0x314a, 0x49d9, 0x03d1,
+ 0x0087, 0x30ea, 0x4a29, 0x03e7,
+ 0x0082, 0x308b, 0x4a77, 0x03fc,
+ 0x007d, 0x302b, 0x4ac5, 0x0413,
+ 0x0078, 0x2fcc, 0x4b13, 0x042a,
+ 0x0074, 0x2f6c, 0x4b5f, 0x0441,
+ 0x006f, 0x2f0d, 0x4bac, 0x0458,
+ 0x006b, 0x2eae, 0x4bf7, 0x0470,
+ 0x0067, 0x2e4f, 0x4c42, 0x0488,
+ 0x0063, 0x2df0, 0x4c8d, 0x04a0,
+ 0x005f, 0x2d91, 0x4cd7, 0x04b9,
+ 0x005b, 0x2d33, 0x4d20, 0x04d2,
+ 0x0057, 0x2cd4, 0x4d68, 0x04ec,
+ 0x0054, 0x2c76, 0x4db0, 0x0506,
+ 0x0050, 0x2c18, 0x4df7, 0x0520,
+ 0x004d, 0x2bba, 0x4e3e, 0x053b,
+ 0x0049, 0x2b5c, 0x4e84, 0x0556,
+ 0x0046, 0x2aff, 0x4ec9, 0x0572,
+ 0x0043, 0x2aa1, 0x4f0e, 0x058e,
+ 0x0040, 0x2a44, 0x4f52, 0x05aa,
+ 0x003d, 0x29e7, 0x4f95, 0x05c7,
+ 0x003a, 0x298b, 0x4fd7, 0x05e4,
+ 0x0038, 0x292e, 0x5019, 0x0601,
+ 0x0035, 0x28d2, 0x505a, 0x061f,
+ 0x0033, 0x2876, 0x509a, 0x063e,
+ 0x0030, 0x281a, 0x50da, 0x065c,
+ 0x002e, 0x27be, 0x5118, 0x067c,
+ 0x002c, 0x2763, 0x5156, 0x069b,
+ 0x0029, 0x2708, 0x5194, 0x06bb,
+ 0x0027, 0x26ad, 0x51d0, 0x06dc,
+ 0x0025, 0x2653, 0x520c, 0x06fd,
+ 0x0023, 0x25f8, 0x5247, 0x071e,
+ 0x0021, 0x259e, 0x5281, 0x0740,
+ 0x0020, 0x2545, 0x52ba, 0x0762,
+ 0x001e, 0x24eb, 0x52f3, 0x0784,
+ 0x001c, 0x2492, 0x532a, 0x07a7,
+ 0x001b, 0x2439, 0x5361, 0x07cb,
+ 0x0019, 0x23e1, 0x5397, 0x07ef,
+ 0x0018, 0x2389, 0x53cc, 0x0813,
+ 0x0016, 0x2331, 0x5401, 0x0838,
+ 0x0015, 0x22da, 0x5434, 0x085d,
+ 0x0013, 0x2282, 0x5467, 0x0883,
+ 0x0012, 0x222c, 0x5499, 0x08a9,
+ 0x0011, 0x21d5, 0x54ca, 0x08d0,
+ 0x0010, 0x217f, 0x54fa, 0x08f7,
+ 0x000f, 0x2129, 0x5529, 0x091e,
+ 0x000e, 0x20d4, 0x5558, 0x0946,
+ 0x000d, 0x207f, 0x5585, 0x096f,
+ 0x000c, 0x202a, 0x55b2, 0x0998,
+ 0x000b, 0x1fd6, 0x55de, 0x09c1,
+ 0x000a, 0x1f82, 0x5609, 0x09eb,
+ 0x0009, 0x1f2f, 0x5632, 0x0a16,
+ 0x0009, 0x1edc, 0x565b, 0x0a40,
+ 0x0008, 0x1e89, 0x5684, 0x0a6c,
+ 0x0007, 0x1e37, 0x56ab, 0x0a98,
+ 0x0007, 0x1de5, 0x56d1, 0x0ac4,
+ 0x0006, 0x1d93, 0x56f6, 0x0af1,
+ 0x0005, 0x1d42, 0x571b, 0x0b1e,
+ 0x0005, 0x1cf1, 0x573e, 0x0b4c,
+ 0x0004, 0x1ca1, 0x5761, 0x0b7a,
+ 0x0004, 0x1c51, 0x5782, 0x0ba9,
+ 0x0003, 0x1c02, 0x57a3, 0x0bd8,
+ 0x0003, 0x1bb3, 0x57c3, 0x0c07,
+ 0x0003, 0x1b64, 0x57e2, 0x0c38,
+ 0x0002, 0x1b16, 0x57ff, 0x0c68,
+ 0x0002, 0x1ac8, 0x581c, 0x0c99,
+ 0x0002, 0x1a7b, 0x5838, 0x0ccb,
+ 0x0001, 0x1a2e, 0x5853, 0x0cfd,
+ 0x0001, 0x19e2, 0x586d, 0x0d30,
+ 0x0001, 0x1996, 0x5886, 0x0d63,
+ 0x0001, 0x194b, 0x589e, 0x0d97,
+ 0x0000, 0x1900, 0x58b5, 0x0dcb,
+ 0x0000, 0x18b5, 0x58cb, 0x0e00,
+ 0x0000, 0x186b, 0x58e0, 0x0e35,
+ 0x0000, 0x1821, 0x58f4, 0x0e6b,
+ 0x0000, 0x17d8, 0x5907, 0x0ea1,
+ 0x0000, 0x1790, 0x5919, 0x0ed7,
+ 0x0000, 0x1747, 0x592a, 0x0f0f,
+ 0xffffffff, 0x1700, 0x593a, 0x0f46,
+ 0xffffffff, 0x16b9, 0x5949, 0x0f7f,
+ 0xffffffff, 0x1672, 0x5958, 0x0fb7,
+ 0xffffffff, 0x162c, 0x5965, 0x0ff1,
+ 0xffffffff, 0x15e6, 0x5971, 0x102a,
+ 0xffffffff, 0x15a0, 0x597c, 0x1065,
+ 0xffffffff, 0x155c, 0x5986, 0x109f,
+ 0xffffffff, 0x1517, 0x598f, 0x10db,
+ 0xffffffff, 0x14d4, 0x5997, 0x1116,
+ 0xffffffff, 0x1490, 0x599e, 0x1153,
+ 0xffffffff, 0x144d, 0x59a4, 0x118f,
+ 0xffffffff, 0x140b, 0x59a9, 0x11cd,
+ 0xffffffff, 0x13c9, 0x59ad, 0x120b,
+ 0xffffffff, 0x1388, 0x59b0, 0x1249,
+ 0xffffffff, 0x1347, 0x59b2, 0x1288,
+ 0xffffffff, 0x1307, 0x59b3, 0x12c7,
+};
+
+#endif
\ No newline at end of file diff --git a/plugins/dfsound/spu.c b/plugins/dfsound/spu.c index 0058ad2..a64927e 100644 --- a/plugins/dfsound/spu.c +++ b/plugins/dfsound/spu.c @@ -345,11 +345,11 @@ INLINE int iGetInterpolationVal(int *SB, int sinc, int spos, int fmod_freq) int vl, vr;int gpos; vl = (spos >> 6) & ~3; gpos = SB[28]; - vr=(gauss[vl]*(int)gval0)&~2047; - vr+=(gauss[vl+1]*gval(1))&~2047; - vr+=(gauss[vl+2]*gval(2))&~2047; - vr+=(gauss[vl+3]*gval(3))&~2047; - fa = vr>>11; + vr=(gauss[vl]*(int)gval0) >> 15; + vr+=(gauss[vl+1]*gval(1)) >> 15; + vr+=(gauss[vl+2]*gval(2)) >> 15; + vr+=(gauss[vl+3]*gval(3)) >> 15; + fa = vr; } break; //--------------------------------------------------// case 1: // simple interpolation diff --git a/plugins/dfsound/xa.c b/plugins/dfsound/xa.c index ad7e824..bfebe3e 100644 --- a/plugins/dfsound/xa.c +++ b/plugins/dfsound/xa.c @@ -189,16 +189,16 @@ INLINE void FeedXA(xa_decode_t *xap) spos -= 0x10000L; } vl = (spos >> 6) & ~3; - vr=(gauss[vl]*gvall0)&~2047; - vr+=(gauss[vl+1]*gvall(1))&~2047; - vr+=(gauss[vl+2]*gvall(2))&~2047; - vr+=(gauss[vl+3]*gvall(3))&~2047; - l= (vr >> 11) & 0xffff; - vr=(gauss[vl]*gvalr0)&~2047; - vr+=(gauss[vl+1]*gvalr(1))&~2047; - vr+=(gauss[vl+2]*gvalr(2))&~2047; - vr+=(gauss[vl+3]*gvalr(3))&~2047; - l |= vr << 5; + vr=(gauss[vl]*gvall0) >> 15; + vr+=(gauss[vl+1]*gvall(1)) >> 15; + vr+=(gauss[vl+2]*gvall(2)) >> 15; + vr+=(gauss[vl+3]*gvall(3)) >> 15; + l= vr & 0xffff; + vr=(gauss[vl]*gvalr0) >> 15; + vr+=(gauss[vl+1]*gvalr(1)) >> 15; + vr+=(gauss[vl+2]*gvalr(2)) >> 15; + vr+=(gauss[vl+3]*gvalr(3)) >> 15; + l |= vr << 16; } else { @@ -246,16 +246,16 @@ INLINE void FeedXA(xa_decode_t *xap) spos -= 0x10000L; } vl = (spos >> 6) & ~3; - vr=(gauss[vl]*gvall0)&~2047; - vr+=(gauss[vl+1]*gvall(1))&~2047; - vr+=(gauss[vl+2]*gvall(2))&~2047; - vr+=(gauss[vl+3]*gvall(3))&~2047; - l= (vr >> 11) & 0xffff; - vr=(gauss[vl]*gvalr0)&~2047; - vr+=(gauss[vl+1]*gvalr(1))&~2047; - vr+=(gauss[vl+2]*gvalr(2))&~2047; - vr+=(gauss[vl+3]*gvalr(3))&~2047; - l |= vr << 5; + vr=(gauss[vl]*gvall0) >> 15; + vr+=(gauss[vl+1]*gvall(1)) >> 15; + vr+=(gauss[vl+2]*gvall(2)) >> 15; + vr+=(gauss[vl+3]*gvall(3)) >> 15; + l= vr & 0xffff; + vr=(gauss[vl]*gvalr0) >> 15; + vr+=(gauss[vl+1]*gvalr(1)) >> 15; + vr+=(gauss[vl+2]*gvalr(2)) >> 15; + vr+=(gauss[vl+3]*gvalr(3)) >> 15; + l |= vr << 16; } else { @@ -298,11 +298,11 @@ INLINE void FeedXA(xa_decode_t *xap) spos -= 0x10000L; } vl = (spos >> 6) & ~3; - vr=(gauss[vl]*gvall0)&~2047; - vr+=(gauss[vl+1]*gvall(1))&~2047; - vr+=(gauss[vl+2]*gvall(2))&~2047; - vr+=(gauss[vl+3]*gvall(3))&~2047; - l1=s= vr >> 11; + vr=(gauss[vl]*gvall0) >> 15; + vr+=(gauss[vl+1]*gvall(1)) >> 15; + vr+=(gauss[vl+2]*gvall(2)) >> 15; + vr+=(gauss[vl+3]*gvall(3)) >> 15; + l1=s= vr; l1 &= 0xffff; } else @@ -343,11 +343,11 @@ INLINE void FeedXA(xa_decode_t *xap) spos -= 0x10000L; } vl = (spos >> 6) & ~3; - vr=(gauss[vl]*gvall0)&~2047; - vr+=(gauss[vl+1]*gvall(1))&~2047; - vr+=(gauss[vl+2]*gvall(2))&~2047; - vr+=(gauss[vl+3]*gvall(3))&~2047; - l=s= vr >> 11; + vr=(gauss[vl]*gvall0) >> 15; + vr+=(gauss[vl+1]*gvall(1)) >> 15; + vr+=(gauss[vl+2]*gvall(2)) >> 15; + vr+=(gauss[vl+3]*gvall(3)) >> 15; + l=s= vr; } else { diff --git a/plugins/dfxvideo/gpulib_if.c b/plugins/dfxvideo/gpulib_if.c index 01b8dde..bb3ad56 100644 --- a/plugins/dfxvideo/gpulib_if.c +++ b/plugins/dfxvideo/gpulib_if.c @@ -309,11 +309,11 @@ void renderer_notify_res_change(void) extern const unsigned char cmd_lengths[256]; -int do_cmd_list(unsigned int *list, int list_len, int *last_cmd) +int do_cmd_list(uint32_t *list, int list_len, int *last_cmd) { unsigned int cmd = 0, len; - unsigned int *list_start = list; - unsigned int *list_end = list + list_len; + uint32_t *list_start = list; + uint32_t *list_end = list + list_len; for (; list < list_end; list += 1 + len) { diff --git a/plugins/gpu_neon/psx_gpu/psx_gpu.h b/plugins/gpu_neon/psx_gpu/psx_gpu.h index 1eaa99a..1fa6b98 100644 --- a/plugins/gpu_neon/psx_gpu/psx_gpu.h +++ b/plugins/gpu_neon/psx_gpu/psx_gpu.h @@ -207,6 +207,7 @@ typedef struct u8 texture_4bpp_cache[32][256 * 256]; u8 texture_8bpp_even_cache[16][256 * 256]; u8 texture_8bpp_odd_cache[16][256 * 256]; + int use_dithering; } psx_gpu_struct; typedef struct __attribute__((aligned(16))) diff --git a/plugins/gpu_neon/psx_gpu_if.c b/plugins/gpu_neon/psx_gpu_if.c index ad01761..788e3b4 100644 --- a/plugins/gpu_neon/psx_gpu_if.c +++ b/plugins/gpu_neon/psx_gpu_if.c @@ -184,4 +184,18 @@ void renderer_set_config(const struct rearmed_cbs *cbs) map_enhancement_buffer(); if (cbs->pl_set_gpu_caps) cbs->pl_set_gpu_caps(GPU_CAP_SUPPORTS_2X); + + egpu.use_dithering = cbs->gpu_neon.allow_dithering; + if(!egpu.use_dithering) { + egpu.dither_table[0] = dither_table_row(0, 0, 0, 0); + egpu.dither_table[1] = dither_table_row(0, 0, 0, 0); + egpu.dither_table[2] = dither_table_row(0, 0, 0, 0); + egpu.dither_table[3] = dither_table_row(0, 0, 0, 0); + } else { + egpu.dither_table[0] = dither_table_row(-4, 0, -3, 1); + egpu.dither_table[1] = dither_table_row(2, -2, 3, -1); + egpu.dither_table[2] = dither_table_row(-3, 1, -4, 0); + egpu.dither_table[3] = dither_table_row(3, -1, 2, -2); + } + } diff --git a/plugins/gpulib/gpu.c b/plugins/gpulib/gpu.c index 125bd89..9fc5f43 100644 --- a/plugins/gpulib/gpu.c +++ b/plugins/gpulib/gpu.c @@ -726,6 +726,7 @@ void GPUrearmedCallbacks(const struct rearmed_cbs *cbs) gpu.state.allow_interlace = cbs->gpu_neon.allow_interlace; gpu.state.enhancement_enable = cbs->gpu_neon.enhancement_enable; + gpu.useDithering = cbs->gpu_neon.allow_dithering; gpu.mmap = cbs->mmap; gpu.munmap = cbs->munmap; diff --git a/plugins/gpulib/gpu.h b/plugins/gpulib/gpu.h index d11f991..7e1d18b 100644 --- a/plugins/gpulib/gpu.h +++ b/plugins/gpulib/gpu.h @@ -88,6 +88,7 @@ struct psx_gpu { uint32_t last_flip_frame; uint32_t pending_fill[3]; } frameskip; + int useDithering:1; /* 0 - off , 1 - on */ uint16_t *(*get_enhancement_bufer) (int *x, int *y, int *w, int *h, int *vram_h); void *(*mmap)(unsigned int size); |