aboutsummaryrefslogtreecommitdiff
diff options
context:
space:
mode:
-rw-r--r--Makefile15
-rw-r--r--Makefile.libretro164
-rw-r--r--blackberry_qnx/.cproject142
-rw-r--r--blackberry_qnx/.project84
-rw-r--r--frontend/3ds/3ds_utils.h66
-rw-r--r--frontend/3ds/pthread.h56
-rw-r--r--frontend/3ds/sys/mman.h107
-rw-r--r--frontend/3ds/zconf.h511
-rw-r--r--frontend/3ds/zlib.h1768
-rw-r--r--frontend/libretro.c481
-rw-r--r--frontend/main.c17
-rw-r--r--frontend/menu.c4
-rw-r--r--frontend/plugin.c51
-rw-r--r--frontend/plugin_lib.c13
-rw-r--r--frontend/plugin_lib.h10
-rw-r--r--frontend/vita/pthread.h308
-rw-r--r--frontend/vita/retro_inline.h39
-rw-r--r--frontend/vita/sys/mman.h69
-rw-r--r--include/psemu_plugin_defs.h14
-rw-r--r--jni/Android.mk3
-rw-r--r--libpcsxcore/cdriso.c6
-rw-r--r--libpcsxcore/new_dynarec/emu_if.c2
-rw-r--r--libpcsxcore/new_dynarec/emu_if.h2
-rw-r--r--libpcsxcore/plugins.c519
-rw-r--r--libpcsxcore/psxbios.c11
-rw-r--r--libpcsxcore/sio.c14
-rw-r--r--libpcsxcore/socket.c17
-rw-r--r--plugins/cdrcimg/cdrcimg.c4
-rw-r--r--plugins/dfinput/main.c7
-rw-r--r--plugins/dfinput/pad.c2
-rw-r--r--plugins/dfxvideo/gpulib_if.c6
31 files changed, 4077 insertions, 435 deletions
diff --git a/Makefile b/Makefile
index 0a3b1fe..29f02fd 100644
--- a/Makefile
+++ b/Makefile
@@ -2,8 +2,10 @@
# default stuff goes here, so that config can override
TARGET ?= pcsx
-CFLAGS += -Wall -ggdb -Iinclude -ffast-math
-ifndef DEBUG
+CFLAGS += -Wall -Iinclude -ffast-math
+ifeq ($(DEBUG), 1)
+CFLAGS += -O0 -ggdb
+else
CFLAGS += -O2 -DNDEBUG
endif
CXXFLAGS += $(CFLAGS)
@@ -194,6 +196,7 @@ endif
ifeq "$(PLATFORM)" "libretro"
OBJS += frontend/libretro.o
CFLAGS += -DFRONTEND_SUPPORTS_RGB565
+CFLAGS += -DHAVE_LIBRETRO
ifeq ($(MMAP_WIN32),1)
OBJS += libpcsxcore/memmap_win32.o
@@ -246,11 +249,19 @@ frontend/revision.h: FORCE
%.o: %.S
$(CC_AS) $(CFLAGS) -c $^ -o $@
+%.o: %.cpp
+ $(CXX) $(CXXFLAGS) -c -o $@ $<
+
+
target_: $(TARGET)
$(TARGET): $(OBJS)
+ifeq ($(STATIC_LINKING), 1)
+ $(AR) rcs $@ $(OBJS)
+else
$(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS)
+endif
clean: $(PLAT_CLEAN) clean_plugins
$(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h
diff --git a/Makefile.libretro b/Makefile.libretro
index 223ba9f..0f6608d 100644
--- a/Makefile.libretro
+++ b/Makefile.libretro
@@ -1,5 +1,7 @@
# Makefile for PCSX ReARMed (libretro)
+DEBUG=0
+
ifeq ($(platform),)
platform = unix
ifeq ($(shell uname -a),)
@@ -20,35 +22,45 @@ CC_AS ?= $(CC)
CFLAGS ?=
TARGET_NAME := pcsx_rearmed
-
+LIBZ := -lz
+LIBPTHREAD := -lpthread
+LIBDL := -ldl
MMAP_WIN32=0
+EXTRA_LDFLAGS =
# Unix
ifeq ($(platform), unix)
TARGET := $(TARGET_NAME)_libretro.so
fpic := -fPIC
- SHARED := -shared -Wl,--version-script=libretro/link.T
+
+else ifeq ($(platform), linux-portable)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC -nostdlib
+ EXTRA_LDFLAGS += -fPIC -nostdlib
+ LIBZ :=
+ LIBPTHREAD :=
+ LIBDL :=
+ NO_UNDEF_CHECK = 1
# OS X
else ifeq ($(platform), osx)
TARGET := $(TARGET_NAME)_libretro.dylib
fpic := -fPIC
- SHARED := -dynamiclib
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- fpic += -mmacosx-version-min=10.5
- endif
+ fpic += -mmacosx-version-min=10.1
# iOS
-else ifeq ($(platform), ios)
+else ifneq (,$(findstring ios,$(platform)))
ARCH := arm
+ USE_DYNAREC ?= 1
TARGET := $(TARGET_NAME)_libretro_ios.dylib
+ifeq ($(USE_DYNAREC),0)
+ # Override
+ TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib
+endif
fpic := -fPIC
- SHARED := -dynamiclib
ifeq ($(IOSSDK),)
- IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path)
+ IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path)
endif
CC = clang -arch armv7 -isysroot $(IOSSDK)
@@ -58,16 +70,18 @@ else ifeq ($(platform), ios)
ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
HAVE_NEON = 1
BUILTIN_GPU = neon
- USE_DYNAREC = 1
CFLAGS += -DIOS
- OSXVER = `sw_vers -productVersion | cut -d. -f 2`
- OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"`
- ifeq ($(OSX_LT_MAVERICKS),"YES")
- CC += -miphoneos-version-min=5.0
- CXX += -miphoneos-version-min=5.0
- CC_AS += -miphoneos-version-min=5.0
- CFLAGS += -miphoneos-version-min=5.0
- endif
+ifeq ($(platform),ios9)
+ CC += -miphoneos-version-min=8.0
+ CXX += -miphoneos-version-min=8.0
+ CC_AS += -miphoneos-version-min=8.0
+ CFLAGS += -miphoneos-version-min=8.0
+else
+ CC += -miphoneos-version-min=5.0
+ CXX += -miphoneos-version-min=5.0
+ CC_AS += -miphoneos-version-min=5.0
+ CFLAGS += -miphoneos-version-min=5.0
+endif
# PS3
else ifeq ($(platform), ps3)
@@ -97,6 +111,48 @@ else ifeq ($(platform), psp1)
AR = psp-ar$(EXE_EXT)
CFLAGS += -DPSP -G0
+# Vita
+else ifeq ($(platform), vita)
+ TARGET := $(TARGET_NAME)_libretro_vita.a
+ CC = arm-vita-eabi-gcc$(EXE_EXT)
+ AR = arm-vita-eabi-ar$(EXE_EXT)
+ CFLAGS += -DVITA
+ CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm
+ CFLAGS += -I$(VITASDK)/include -Ifrontend/vita
+ CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB
+ ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon
+
+# CFLAGS += -U__ARM_NEON__
+ HAVE_NEON = 1
+ BUILTIN_GPU = neon
+
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 0
+
+ ARCH = arm
+ STATIC_LINKING = 1
+
+# CTR(3DS)
+else ifeq ($(platform), ctr)
+ TARGET := $(TARGET_NAME)_libretro_ctr.a
+ CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT)
+ CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT)
+ AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT)
+ CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET
+ CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft
+ CFLAGS += -Wall -mword-relocations
+ CFLAGS += -fomit-frame-pointer -ffast-math
+ CFLAGS += -Ifrontend/3ds
+ CFLAGS += -Werror=implicit-function-declaration
+
+# CFLAGS += -DPCSX
+# BUILTIN_GPU = unai
+ USE_DYNAREC = 1
+ DRC_CACHE_BASE = 1
+ ARCH = arm
+
+ STATIC_LINKING = 1
+
# Xbox 360
else ifeq ($(platform), xenon)
TARGET := $(TARGET_NAME)_libretro_xenon360.a
@@ -121,6 +177,7 @@ else ifeq ($(platform), wii)
# QNX
else ifeq ($(platform), qnx)
TARGET := $(TARGET_NAME)_libretro_qnx.so
+ fpic := -fPIC
CC = qcc -Vgcc_ntoarmv7le
CC_AS = $(CC)
HAVE_NEON = 1
@@ -130,11 +187,36 @@ else ifeq ($(platform), qnx)
ARCH = arm
CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp
ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp
+ MAIN_LDLIBS += -lsocket
+ LIBPTHREAD :=
+ LIBDL :=
+
+#Raspberry Pi 2
+else ifeq ($(platform), rpi2)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
+
+#Raspberry Pi 3
+else ifeq ($(platform), rpi3)
+ TARGET := $(TARGET_NAME)_libretro.so
+ fpic := -fPIC
+ CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard
+ HAVE_NEON = 1
+ ARCH = arm
+ BUILTIN_GPU = neon
+ USE_DYNAREC = 1
# ARM
else ifneq (,$(findstring armv,$(platform)))
TARGET := $(TARGET_NAME)_libretro.so
- SHARED := -shared -Wl,--no-undefined
+ fpic := -fPIC
DRC_CACHE_BASE = 0
ifneq (,$(findstring cortexa8,$(platform)))
CFLAGS += -marm -mcpu=cortex-a8
@@ -163,24 +245,28 @@ else ifneq (,$(findstring armv,$(platform)))
# Windows
else
TARGET := $(TARGET_NAME)_libretro.dll
- CC = gcc
- fpic := -fPIC
- LD_FLAGS := -fPIC
- SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T
- CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__
+ MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s
+ CFLAGS += -D__WIN32__
MMAP_WIN32=1
-endif
-
-CFLAGS += -fPIC
-ifeq ($(platform),win)
MAIN_LDLIBS += -lws2_32
-else ifneq ($(platform),qnx)
- LDLIBS += -lpthread
- MAIN_LDLIBS += -ldl
+ LIBPTHREAD :=
+ LIBDL :=
endif
+
+CFLAGS += $(fpic)
MAIN_LDFLAGS += -shared
-MAIN_LDLIBS += -lm -lz
-EXTRA_LDFLAGS =
+MAIN_LDLIBS += $(LIBPTHREAD) $(LIBDL) $(LIBZ)
+
+# try to autodetect stuff for the lazy
+ifndef ARCH
+ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}')
+endif
+ifndef HAVE_NEON
+HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0)
+endif
+ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU)
+MAIN_LDFLAGS += -Wl,--no-undefined
+endif
# try to autodetect stuff for the lazy
ifndef ARCH
@@ -200,6 +286,14 @@ SOUND_DRIVERS = libretro
PLUGINS =
NO_CONFIG_MAK = yes
+libretro_all: all
+ifeq ($(platform),ios)
+ifeq ($(USE_DYNAREC),1)
+ make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean
+ make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform)
+endif
+endif
+
include Makefile
# no special AS needed for gpu_neon
diff --git a/blackberry_qnx/.cproject b/blackberry_qnx/.cproject
deleted file mode 100644
index 565f4a9..0000000
--- a/blackberry_qnx/.cproject
+++ /dev/null
@@ -1,142 +0,0 @@
-<?xml version="1.0" encoding="UTF-8" standalone="no"?>
-<?fileVersion 4.0.0?>
-
-<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage">
- <storageModule moduleId="org.eclipse.cdt.core.settings">
- <cconfiguration id="com.qnx.qcc.toolChain.1762498539">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1815033502">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- <cconfiguration id="com.qnx.qcc.toolChain.1271074456">
- <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug">
- <externalSettings/>
- <extensions>
- <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/>
- <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/>
- <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/>
- </extensions>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg">
- <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath="">
- <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain">
- <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/>
- <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/>
- <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/>
- <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/>
- <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/>
- <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/>
- <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler">
- <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/>
- <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath">
- <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/>
- <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/>
- </option>
- <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler">
- <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/>
- </tool>
- <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/>
- <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/>
- </toolChain>
- </folderInfo>
- </configuration>
- </storageModule>
- <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/>
- </cconfiguration>
- </storageModule>
- <storageModule moduleId="cdtBuildSystem" version="4.0.0">
- <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/>
- </storageModule>
- <storageModule moduleId="scannerConfiguration">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456">
- <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/>
- </scannerConfigBuildInfo>
- </storageModule>
- <storageModule moduleId="refreshScope" versionNumber="1">
- <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/>
- </storageModule>
-</cproject>
diff --git a/blackberry_qnx/.project b/blackberry_qnx/.project
deleted file mode 100644
index c8e1e20..0000000
--- a/blackberry_qnx/.project
+++ /dev/null
@@ -1,84 +0,0 @@
-<?xml version="1.0" encoding="UTF-8"?>
-<projectDescription>
- <name>pcsx_rearmed</name>
- <comment></comment>
- <projects>
- </projects>
- <buildSpec>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name>
- <triggers>clean,full,incremental,</triggers>
- <arguments>
- <dictionary>
- <key>?name?</key>
- <value></value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.append_environment</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.autoBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildArguments</key>
- <value>-C .. -f Makefile.libretro platform=qnx</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.buildCommand</key>
- <value>make</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.cleanBuildTarget</key>
- <value>clean</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.contents</key>
- <value>org.eclipse.cdt.make.core.activeConfigSettings</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableAutoBuild</key>
- <value>false</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableCleanBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.enableFullBuild</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.fullBuildTarget</key>
- <value>all</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.stopOnError</key>
- <value>true</value>
- </dictionary>
- <dictionary>
- <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key>
- <value>false</value>
- </dictionary>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name>
- <triggers>full,incremental,</triggers>
- <arguments>
- </arguments>
- </buildCommand>
- <buildCommand>
- <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name>
- <arguments>
- </arguments>
- </buildCommand>
- </buildSpec>
- <natures>
- <nature>org.eclipse.cdt.core.cnature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature>
- <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature>
- <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature>
- </natures>
-</projectDescription>
diff --git a/frontend/3ds/3ds_utils.h b/frontend/3ds/3ds_utils.h
new file mode 100644
index 0000000..3d50a66
--- /dev/null
+++ b/frontend/3ds/3ds_utils.h
@@ -0,0 +1,66 @@
+#ifndef _3DS_UTILS_H
+#define _3DS_UTILS_H
+
+#include <stdio.h>
+
+#define MEMOP_PROT 6
+#define MEMOP_MAP 4
+#define MEMOP_UNMAP 5
+
+void* linearMemAlign(size_t size, size_t alignment);
+void linearFree(void* mem);
+
+int32_t svcDuplicateHandle(uint32_t* out, uint32_t original);
+int32_t svcCloseHandle(uint32_t handle);
+int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm);
+
+int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id);
+int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds);
+void svcExitThread(void) __attribute__((noreturn));
+
+int32_t svcBackdoor(int32_t (*callback)(void));
+
+#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0)
+
+void wait_for_input(void);
+
+extern __attribute__((weak)) int __ctr_svchax;
+
+typedef int32_t (*ctr_callback_type)(void);
+
+static inline void ctr_invalidate_ICache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c5, 0\n\t");
+}
+
+static inline void ctr_flush_DCache_kernel(void)
+{
+ __asm__ volatile(
+ "cpsid aif\n\t"
+ "mov r0, #0\n\t"
+ "mcr p15, 0, r0, c7, c10, 0\n\t");
+}
+
+static inline void ctr_invalidate_ICache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel);
+}
+
+static inline void ctr_flush_DCache(void)
+{
+ svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel);
+}
+
+
+static inline void ctr_flush_invalidate_cache(void)
+{
+ ctr_flush_DCache();
+ ctr_invalidate_ICache();
+}
+
+
+#endif // _3DS_UTILS_H
diff --git a/frontend/3ds/pthread.h b/frontend/3ds/pthread.h
new file mode 100644
index 0000000..2c2bf6b
--- /dev/null
+++ b/frontend/3ds/pthread.h
@@ -0,0 +1,56 @@
+
+#ifndef _3DS_PTHREAD_WRAP__
+#define _3DS_PTHREAD_WRAP__
+
+#include <stdlib.h>
+#include <string.h>
+#include <stdio.h>
+
+#include "3ds_utils.h"
+
+#define CTR_PTHREAD_STACK_SIZE 0x10000
+
+typedef struct
+{
+ int32_t handle;
+ uint32_t* stack;
+}pthread_t;
+typedef int pthread_attr_t;
+
+static inline int pthread_create(pthread_t *thread,
+ const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg)
+{
+
+ thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8);
+
+ svcCreateThread(&thread->handle, start_routine, arg,
+ (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE),
+ 0x25, 1);
+
+ return 1;
+}
+
+
+static inline int pthread_join(pthread_t thread, void **retval)
+{
+ (void)retval;
+
+ if(svcWaitSynchronization(thread.handle, INT64_MAX))
+ return -1;
+
+ linearFree(thread.stack);
+
+ return 0;
+}
+
+
+static inline void pthread_exit(void *retval)
+{
+ (void)retval;
+
+ svcExitThread();
+}
+
+
+#endif //_3DS_PTHREAD_WRAP__
+
diff --git a/frontend/3ds/sys/mman.h b/frontend/3ds/sys/mman.h
new file mode 100644
index 0000000..e295b89
--- /dev/null
+++ b/frontend/3ds/sys/mman.h
@@ -0,0 +1,107 @@
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include <stdlib.h>
+#include <stdio.h>
+#include <stdint.h>
+#include <malloc.h>
+
+#include "3ds_utils.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_FIXED 0x10
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static void* dynarec_cache = NULL;
+static void* dynarec_cache_mapping = NULL;
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)fd;
+ (void)offset;
+
+ void* addr_out;
+
+ if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) &&
+ (flags == (MAP_FIXED | MAP_PRIVATE | MAP_ANONYMOUS)))
+ {
+ if(__ctr_svchax)
+ {
+ /* this hack works only for pcsx_rearmed */
+ uint32_t currentHandle;
+
+ if(!dynarec_cache)
+ dynarec_cache = memalign(0x1000, len);
+
+ svcDuplicateHandle(&currentHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, dynarec_cache,
+ len, MEMOP_MAP, prot);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = addr;
+ return addr;
+ }
+ else
+ {
+ printf("tried to mmap RWX pages without svcControlProcessMemory access !\n");
+ return MAP_FAILED;
+ }
+
+ }
+
+ addr_out = malloc(len);
+ if(!addr_out)
+ return MAP_FAILED;
+
+ return addr_out;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ if(__ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(&currentHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle, addr, NULL,
+ len, MEMOP_PROT, prot);
+ svcCloseHandle(currentHandle);
+ return 0;
+ }
+
+ printf("mprotect called without svcControlProcessMemory access !\n");
+ return -1;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ if((addr == dynarec_cache_mapping) && __ctr_svchax)
+ {
+ uint32_t currentHandle;
+ svcDuplicateHandle(&currentHandle, 0xFFFF8001);
+ svcControlProcessMemory(currentHandle,
+ dynarec_cache, dynarec_cache_mapping,
+ len, MEMOP_UNMAP, 0b111);
+ svcCloseHandle(currentHandle);
+ dynarec_cache_mapping = NULL;
+
+ }
+ else
+ free(addr);
+
+ return 0;
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
+
diff --git a/frontend/3ds/zconf.h b/frontend/3ds/zconf.h
new file mode 100644
index 0000000..996fff2
--- /dev/null
+++ b/frontend/3ds/zconf.h
@@ -0,0 +1,511 @@
+/* zconf.h -- configuration of the zlib compression library
+ * Copyright (C) 1995-2013 Jean-loup Gailly.
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+/* @(#) $Id$ */
+
+#ifndef ZCONF_H
+#define ZCONF_H
+
+/*
+ * If you *really* need a unique prefix for all types and library functions,
+ * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it.
+ * Even better than compiling with -DZ_PREFIX would be to use configure to set
+ * this permanently in zconf.h using "./configure --zprefix".
+ */
+#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */
+# define Z_PREFIX_SET
+
+/* all linked symbols */
+# define _dist_code z__dist_code
+# define _length_code z__length_code
+# define _tr_align z__tr_align
+# define _tr_flush_bits z__tr_flush_bits
+# define _tr_flush_block z__tr_flush_block
+# define _tr_init z__tr_init
+# define _tr_stored_block z__tr_stored_block
+# define _tr_tally z__tr_tally
+# define adler32 z_adler32
+# define adler32_combine z_adler32_combine
+# define adler32_combine64 z_adler32_combine64
+# ifndef Z_SOLO
+# define compress z_compress
+# define compress2 z_compress2
+# define compressBound z_compressBound
+# endif
+# define crc32 z_crc32
+# define crc32_combine z_crc32_combine
+# define crc32_combine64 z_crc32_combine64
+# define deflate z_deflate
+# define deflateBound z_deflateBound
+# define deflateCopy z_deflateCopy
+# define deflateEnd z_deflateEnd
+# define deflateInit2_ z_deflateInit2_
+# define deflateInit_ z_deflateInit_
+# define deflateParams z_deflateParams
+# define deflatePending z_deflatePending
+# define deflatePrime z_deflatePrime
+# define deflateReset z_deflateReset
+# define deflateResetKeep z_deflateResetKeep
+# define deflateSetDictionary z_deflateSetDictionary
+# define deflateSetHeader z_deflateSetHeader
+# define deflateTune z_deflateTune
+# define deflate_copyright z_deflate_copyright
+# define get_crc_table z_get_crc_table
+# ifndef Z_SOLO
+# define gz_error z_gz_error
+# define gz_intmax z_gz_intmax
+# define gz_strwinerror z_gz_strwinerror
+# define gzbuffer z_gzbuffer
+# define gzclearerr z_gzclearerr
+# define gzclose z_gzclose
+# define gzclose_r z_gzclose_r
+# define gzclose_w z_gzclose_w
+# define gzdirect z_gzdirect
+# define gzdopen z_gzdopen
+# define gzeof z_gzeof
+# define gzerror z_gzerror
+# define gzflush z_gzflush
+# define gzgetc z_gzgetc
+# define gzgetc_ z_gzgetc_
+# define gzgets z_gzgets
+# define gzoffset z_gzoffset
+# define gzoffset64 z_gzoffset64
+# define gzopen z_gzopen
+# define gzopen64 z_gzopen64
+# ifdef _WIN32
+# define gzopen_w z_gzopen_w
+# endif
+# define gzprintf z_gzprintf
+# define gzvprintf z_gzvprintf
+# define gzputc z_gzputc
+# define gzputs z_gzputs
+# define gzread z_gzread
+# define gzrewind z_gzrewind
+# define gzseek z_gzseek
+# define gzseek64 z_gzseek64
+# define gzsetparams z_gzsetparams
+# define gztell z_gztell
+# define gztell64 z_gztell64
+# define gzungetc z_gzungetc
+# define gzwrite z_gzwrite
+# endif
+# define inflate z_inflate
+# define inflateBack z_inflateBack
+# define inflateBackEnd z_inflateBackEnd
+# define inflateBackInit_ z_inflateBackInit_
+# define inflateCopy z_inflateCopy
+# define inflateEnd z_inflateEnd
+# define inflateGetHeader z_inflateGetHeader
+# define inflateInit2_ z_inflateInit2_
+# define inflateInit_ z_inflateInit_
+# define inflateMark z_inflateMark
+# define inflatePrime z_inflatePrime
+# define inflateReset z_inflateReset
+# define inflateReset2 z_inflateReset2
+# define inflateSetDictionary z_inflateSetDictionary
+# define inflateGetDictionary z_inflateGetDictionary
+# define inflateSync z_inflateSync
+# define inflateSyncPoint z_inflateSyncPoint
+# define inflateUndermine z_inflateUndermine
+# define inflateResetKeep z_inflateResetKeep
+# define inflate_copyright z_inflate_copyright
+# define inflate_fast z_inflate_fast
+# define inflate_table z_inflate_table
+# ifndef Z_SOLO
+# define uncompress z_uncompress
+# endif
+# define zError z_zError
+# ifndef Z_SOLO
+# define zcalloc z_zcalloc
+# define zcfree z_zcfree
+# endif
+# define zlibCompileFlags z_zlibCompileFlags
+# define zlibVersion z_zlibVersion
+
+/* all zlib typedefs in zlib.h and zconf.h */
+# define Byte z_Byte
+# define Bytef z_Bytef
+# define alloc_func z_alloc_func
+# define charf z_charf
+# define free_func z_free_func
+# ifndef Z_SOLO
+# define gzFile z_gzFile
+# endif
+# define gz_header z_gz_header
+# define gz_headerp z_gz_headerp
+# define in_func z_in_func
+# define intf z_intf
+# define out_func z_out_func
+# define uInt z_uInt
+# define uIntf z_uIntf
+# define uLong z_uLong
+# define uLongf z_uLongf
+# define voidp z_voidp
+# define voidpc z_voidpc
+# define voidpf z_voidpf
+
+/* all zlib structs in zlib.h and zconf.h */
+# define gz_header_s z_gz_header_s
+# define internal_state z_internal_state
+
+#endif
+
+#if defined(__MSDOS__) && !defined(MSDOS)
+# define MSDOS
+#endif
+#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2)
+# define OS2
+#endif
+#if defined(_WINDOWS) && !defined(WINDOWS)
+# define WINDOWS
+#endif
+#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__)
+# ifndef WIN32
+# define WIN32
+# endif
+#endif
+#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32)
+# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__)
+# ifndef SYS16BIT
+# define SYS16BIT
+# endif
+# endif
+#endif
+
+/*
+ * Compile with -DMAXSEG_64K if the alloc function cannot allocate more
+ * than 64k bytes at a time (needed on systems with 16-bit int).
+ */
+#ifdef SYS16BIT
+# define MAXSEG_64K
+#endif
+#ifdef MSDOS
+# define UNALIGNED_OK
+#endif
+
+#ifdef __STDC_VERSION__
+# ifndef STDC
+# define STDC
+# endif
+# if __STDC_VERSION__ >= 199901L
+# ifndef STDC99
+# define STDC99
+# endif
+# endif
+#endif
+#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32))
+# define STDC
+#endif
+#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__))
+# define STDC
+#endif
+
+#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */
+# define STDC
+#endif
+
+#ifndef STDC
+# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */
+# define const /* note: need a more gentle solution here */
+# endif
+#endif
+
+#if defined(ZLIB_CONST) && !defined(z_const)
+# define z_const const
+#else
+# define z_const
+#endif
+
+/* Some Mac compilers merge all .h files incorrectly: */
+#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__)
+# define NO_DUMMY_DECL
+#endif
+
+/* Maximum value for memLevel in deflateInit2 */
+#ifndef MAX_MEM_LEVEL
+# ifdef MAXSEG_64K
+# define MAX_MEM_LEVEL 8
+# else
+# define MAX_MEM_LEVEL 9
+# endif
+#endif
+
+/* Maximum value for windowBits in deflateInit2 and inflateInit2.
+ * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files
+ * created by gzip. (Files created by minigzip can still be extracted by
+ * gzip.)
+ */
+#ifndef MAX_WBITS
+# define MAX_WBITS 15 /* 32K LZ77 window */
+#endif
+
+/* The memory requirements for deflate are (in bytes):
+ (1 << (windowBits+2)) + (1 << (memLevel+9))
+ that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values)
+ plus a few kilobytes for small objects. For example, if you want to reduce
+ the default memory requirements from 256K to 128K, compile with
+ make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7"
+ Of course this will generally degrade compression (there's no free lunch).
+
+ The memory requirements for inflate are (in bytes) 1 << windowBits
+ that is, 32K for windowBits=15 (default value) plus a few kilobytes
+ for small objects.
+*/
+
+ /* Type declarations */
+
+#ifndef OF /* function prototypes */
+# ifdef STDC
+# define OF(args) args
+# else
+# define OF(args) ()
+# endif
+#endif
+
+#ifndef Z_ARG /* function prototypes for stdarg */
+# if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# define Z_ARG(args) args
+# else
+# define Z_ARG(args) ()
+# endif
+#endif
+
+/* The following definitions for FAR are needed only for MSDOS mixed
+ * model programming (small or medium model with some far allocations).
+ * This was tested only with MSC; for other MSDOS compilers you may have
+ * to define NO_MEMCPY in zutil.h. If you don't need the mixed model,
+ * just define FAR to be empty.
+ */
+#ifdef SYS16BIT
+# if defined(M_I86SM) || defined(M_I86MM)
+ /* MSC small or medium model */
+# define SMALL_MEDIUM
+# ifdef _MSC_VER
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+# if (defined(__SMALL__) || defined(__MEDIUM__))
+ /* Turbo C small or medium model */
+# define SMALL_MEDIUM
+# ifdef __BORLANDC__
+# define FAR _far
+# else
+# define FAR far
+# endif
+# endif
+#endif
+
+#if defined(WINDOWS) || defined(WIN32)
+ /* If building or using zlib as a DLL, define ZLIB_DLL.
+ * This is not mandatory, but it offers a little performance increase.
+ */
+# ifdef ZLIB_DLL
+# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500))
+# ifdef ZLIB_INTERNAL
+# define ZEXTERN extern __declspec(dllexport)
+# else
+# define ZEXTERN extern __declspec(dllimport)
+# endif
+# endif
+# endif /* ZLIB_DLL */
+ /* If building or using zlib with the WINAPI/WINAPIV calling convention,
+ * define ZLIB_WINAPI.
+ * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI.
+ */
+# ifdef ZLIB_WINAPI
+# ifdef FAR
+# undef FAR
+# endif
+# include <windows.h>
+ /* No need for _export, use ZLIB.DEF instead. */
+ /* For complete Windows compatibility, use WINAPI, not __stdcall. */
+# define ZEXPORT WINAPI
+# ifdef WIN32
+# define ZEXPORTVA WINAPIV
+# else
+# define ZEXPORTVA FAR CDECL
+# endif
+# endif
+#endif
+
+#if defined (__BEOS__)
+# ifdef ZLIB_DLL
+# ifdef ZLIB_INTERNAL
+# define ZEXPORT __declspec(dllexport)
+# define ZEXPORTVA __declspec(dllexport)
+# else
+# define ZEXPORT __declspec(dllimport)
+# define ZEXPORTVA __declspec(dllimport)
+# endif
+# endif
+#endif
+
+#ifndef ZEXTERN
+# define ZEXTERN extern
+#endif
+#ifndef ZEXPORT
+# define ZEXPORT
+#endif
+#ifndef ZEXPORTVA
+# define ZEXPORTVA
+#endif
+
+#ifndef FAR
+# define FAR
+#endif
+
+#if !defined(__MACTYPES__)
+typedef unsigned char Byte; /* 8 bits */
+#endif
+typedef unsigned int uInt; /* 16 bits or more */
+typedef unsigned long uLong; /* 32 bits or more */
+
+#ifdef SMALL_MEDIUM
+ /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */
+# define Bytef Byte FAR
+#else
+ typedef Byte FAR Bytef;
+#endif
+typedef char FAR charf;
+typedef int FAR intf;
+typedef uInt FAR uIntf;
+typedef uLong FAR uLongf;
+
+#ifdef STDC
+ typedef void const *voidpc;
+ typedef void FAR *voidpf;
+ typedef void *voidp;
+#else
+ typedef Byte const *voidpc;
+ typedef Byte FAR *voidpf;
+ typedef Byte *voidp;
+#endif
+
+#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC)
+# include <limits.h>
+# if (UINT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned
+# elif (ULONG_MAX == 0xffffffffUL)
+# define Z_U4 unsigned long
+# elif (USHRT_MAX == 0xffffffffUL)
+# define Z_U4 unsigned short
+# endif
+#endif
+
+#ifdef Z_U4
+ typedef Z_U4 z_crc_t;
+#else
+ typedef unsigned long z_crc_t;
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_UNISTD_H
+#endif
+
+#if 1 /* was set to #if 1 by ./configure */
+# define Z_HAVE_STDARG_H
+#endif
+
+#ifdef STDC
+# ifndef Z_SOLO
+# include <sys/types.h> /* for off_t */
+# endif
+#endif
+
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+# include <stdarg.h> /* for va_list */
+# endif
+#endif
+
+#ifdef _WIN32
+# ifndef Z_SOLO
+# include <stddef.h> /* for wchar_t */
+# endif
+#endif
+
+/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and
+ * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even
+ * though the former does not conform to the LFS document), but considering
+ * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as
+ * equivalently requesting no 64-bit operations
+ */
+#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1
+# undef _LARGEFILE64_SOURCE
+#endif
+
+#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H)
+# define Z_HAVE_UNISTD_H
+#endif
+#ifndef Z_SOLO
+# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE)
+# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */
+# ifdef VMS
+# include <unixio.h> /* for off_t */
+# endif
+# ifndef z_off_t
+# define z_off_t off_t
+# endif
+# endif
+#endif
+
+#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0
+# define Z_LFS64
+#endif
+
+#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64)
+# define Z_LARGE64
+#endif
+
+#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64)
+# define Z_WANT64
+#endif
+
+#if !defined(SEEK_SET) && !defined(Z_SOLO)
+# define SEEK_SET 0 /* Seek from beginning of file. */
+# define SEEK_CUR 1 /* Seek from current position. */
+# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */
+#endif
+
+#ifndef z_off_t
+# define z_off_t long
+#endif
+
+#if !defined(_WIN32) && defined(Z_LARGE64)
+# define z_off64_t off64_t
+#else
+# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO)
+# define z_off64_t __int64
+# else
+# define z_off64_t z_off_t
+# endif
+#endif
+
+/* MVS linker does not support external names larger than 8 bytes */
+#if defined(__MVS__)
+ #pragma map(deflateInit_,"DEIN")
+ #pragma map(deflateInit2_,"DEIN2")
+ #pragma map(deflateEnd,"DEEND")
+ #pragma map(deflateBound,"DEBND")
+ #pragma map(inflateInit_,"ININ")
+ #pragma map(inflateInit2_,"ININ2")
+ #pragma map(inflateEnd,"INEND")
+ #pragma map(inflateSync,"INSY")
+ #pragma map(inflateSetDictionary,"INSEDI")
+ #pragma map(compressBound,"CMBND")
+ #pragma map(inflate_table,"INTABL")
+ #pragma map(inflate_fast,"INFA")
+ #pragma map(inflate_copyright,"INCOPY")
+#endif
+
+#endif /* ZCONF_H */
diff --git a/frontend/3ds/zlib.h b/frontend/3ds/zlib.h
new file mode 100644
index 0000000..3e0c767
--- /dev/null
+++ b/frontend/3ds/zlib.h
@@ -0,0 +1,1768 @@
+/* zlib.h -- interface of the 'zlib' general purpose compression library
+ version 1.2.8, April 28th, 2013
+
+ Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler
+
+ This software is provided 'as-is', without any express or implied
+ warranty. In no event will the authors be held liable for any damages
+ arising from the use of this software.
+
+ Permission is granted to anyone to use this software for any purpose,
+ including commercial applications, and to alter it and redistribute it
+ freely, subject to the following restrictions:
+
+ 1. The origin of this software must not be misrepresented; you must not
+ claim that you wrote the original software. If you use this software
+ in a product, an acknowledgment in the product documentation would be
+ appreciated but is not required.
+ 2. Altered source versions must be plainly marked as such, and must not be
+ misrepresented as being the original software.
+ 3. This notice may not be removed or altered from any source distribution.
+
+ Jean-loup Gailly Mark Adler
+ jloup@gzip.org madler@alumni.caltech.edu
+
+
+ The data format used by the zlib library is described by RFCs (Request for
+ Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950
+ (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format).
+*/
+
+#ifndef ZLIB_H
+#define ZLIB_H
+
+#include "zconf.h"
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#define ZLIB_VERSION "1.2.8"
+#define ZLIB_VERNUM 0x1280
+#define ZLIB_VER_MAJOR 1
+#define ZLIB_VER_MINOR 2
+#define ZLIB_VER_REVISION 8
+#define ZLIB_VER_SUBREVISION 0
+
+/*
+ The 'zlib' compression library provides in-memory compression and
+ decompression functions, including integrity checks of the uncompressed data.
+ This version of the library supports only one compression method (deflation)
+ but other algorithms will be added later and will have the same stream
+ interface.
+
+ Compression can be done in a single step if the buffers are large enough,
+ or can be done by repeated calls of the compression function. In the latter
+ case, the application must provide more input and/or consume the output
+ (providing more output space) before each call.
+
+ The compressed data format used by default by the in-memory functions is
+ the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped
+ around a deflate stream, which is itself documented in RFC 1951.
+
+ The library also supports reading and writing files in gzip (.gz) format
+ with an interface similar to that of stdio using the functions that start
+ with "gz". The gzip format is different from the zlib format. gzip is a
+ gzip wrapper, documented in RFC 1952, wrapped around a deflate stream.
+
+ This library can optionally read and write gzip streams in memory as well.
+
+ The zlib format was designed to be compact and fast for use in memory
+ and on communications channels. The gzip format was designed for single-
+ file compression on file systems, has a larger header than zlib to maintain
+ directory information, and uses a different, slower check method than zlib.
+
+ The library does not install any signal handler. The decoder checks
+ the consistency of the compressed data, so the library should never crash
+ even in case of corrupted input.
+*/
+
+typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size));
+typedef void (*free_func) OF((voidpf opaque, voidpf address));
+
+struct internal_state;
+
+typedef struct z_stream_s {
+ z_const Bytef *next_in; /* next input byte */
+ uInt avail_in; /* number of bytes available at next_in */
+ uLong total_in; /* total number of input bytes read so far */
+
+ Bytef *next_out; /* next output byte should be put there */
+ uInt avail_out; /* remaining free space at next_out */
+ uLong total_out; /* total number of bytes output so far */
+
+ z_const char *msg; /* last error message, NULL if no error */
+ struct internal_state FAR *state; /* not visible by applications */
+
+ alloc_func zalloc; /* used to allocate the internal state */
+ free_func zfree; /* used to free the internal state */
+ voidpf opaque; /* private data object passed to zalloc and zfree */
+
+ int data_type; /* best guess about the data type: binary or text */
+ uLong adler; /* adler32 value of the uncompressed data */
+ uLong reserved; /* reserved for future use */
+} z_stream;
+
+typedef z_stream FAR *z_streamp;
+
+/*
+ gzip header information passed to and from zlib routines. See RFC 1952
+ for more details on the meanings of these fields.
+*/
+typedef struct gz_header_s {
+ int text; /* true if compressed data believed to be text */
+ uLong time; /* modification time */
+ int xflags; /* extra flags (not used when writing a gzip file) */
+ int os; /* operating system */
+ Bytef *extra; /* pointer to extra field or Z_NULL if none */
+ uInt extra_len; /* extra field length (valid if extra != Z_NULL) */
+ uInt extra_max; /* space at extra (only when reading header) */
+ Bytef *name; /* pointer to zero-terminated file name or Z_NULL */
+ uInt name_max; /* space at name (only when reading header) */
+ Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */
+ uInt comm_max; /* space at comment (only when reading header) */
+ int hcrc; /* true if there was or will be a header crc */
+ int done; /* true when done reading gzip header (not used
+ when writing a gzip file) */
+} gz_header;
+
+typedef gz_header FAR *gz_headerp;
+
+/*
+ The application must update next_in and avail_in when avail_in has dropped
+ to zero. It must update next_out and avail_out when avail_out has dropped
+ to zero. The application must initialize zalloc, zfree and opaque before
+ calling the init function. All other fields are set by the compression
+ library and must not be updated by the application.
+
+ The opaque value provided by the application will be passed as the first
+ parameter for calls of zalloc and zfree. This can be useful for custom
+ memory management. The compression library attaches no meaning to the
+ opaque value.
+
+ zalloc must return Z_NULL if there is not enough memory for the object.
+ If zlib is used in a multi-threaded application, zalloc and zfree must be
+ thread safe.
+
+ On 16-bit systems, the functions zalloc and zfree must be able to allocate
+ exactly 65536 bytes, but will not be required to allocate more than this if
+ the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers
+ returned by zalloc for objects of exactly 65536 bytes *must* have their
+ offset normalized to zero. The default allocation function provided by this
+ library ensures this (see zutil.c). To reduce memory requirements and avoid
+ any allocation of 64K objects, at the expense of compression ratio, compile
+ the library with -DMAX_WBITS=14 (see zconf.h).
+
+ The fields total_in and total_out can be used for statistics or progress
+ reports. After compression, total_in holds the total size of the
+ uncompressed data and may be saved for use in the decompressor (particularly
+ if the decompressor wants to decompress everything in a single step).
+*/
+
+ /* constants */
+
+#define Z_NO_FLUSH 0
+#define Z_PARTIAL_FLUSH 1
+#define Z_SYNC_FLUSH 2
+#define Z_FULL_FLUSH 3
+#define Z_FINISH 4
+#define Z_BLOCK 5
+#define Z_TREES 6
+/* Allowed flush values; see deflate() and inflate() below for details */
+
+#define Z_OK 0
+#define Z_STREAM_END 1
+#define Z_NEED_DICT 2
+#define Z_ERRNO (-1)
+#define Z_STREAM_ERROR (-2)
+#define Z_DATA_ERROR (-3)
+#define Z_MEM_ERROR (-4)
+#define Z_BUF_ERROR (-5)
+#define Z_VERSION_ERROR (-6)
+/* Return codes for the compression/decompression functions. Negative values
+ * are errors, positive values are used for special but normal events.
+ */
+
+#define Z_NO_COMPRESSION 0
+#define Z_BEST_SPEED 1
+#define Z_BEST_COMPRESSION 9
+#define Z_DEFAULT_COMPRESSION (-1)
+/* compression levels */
+
+#define Z_FILTERED 1
+#define Z_HUFFMAN_ONLY 2
+#define Z_RLE 3
+#define Z_FIXED 4
+#define Z_DEFAULT_STRATEGY 0
+/* compression strategy; see deflateInit2() below for details */
+
+#define Z_BINARY 0
+#define Z_TEXT 1
+#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */
+#define Z_UNKNOWN 2
+/* Possible values of the data_type field (though see inflate()) */
+
+#define Z_DEFLATED 8
+/* The deflate compression method (the only one supported in this version) */
+
+#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */
+
+#define zlib_version zlibVersion()
+/* for compatibility with versions < 1.0.2 */
+
+
+ /* basic functions */
+
+ZEXTERN const char * ZEXPORT zlibVersion OF((void));
+/* The application can compare zlibVersion and ZLIB_VERSION for consistency.
+ If the first character differs, the library code actually used is not
+ compatible with the zlib.h header file used by the application. This check
+ is automatically made by deflateInit and inflateInit.
+ */
+
+/*
+ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level));
+
+ Initializes the internal stream state for compression. The fields
+ zalloc, zfree and opaque must be initialized before by the caller. If
+ zalloc and zfree are set to Z_NULL, deflateInit updates them to use default
+ allocation functions.
+
+ The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9:
+ 1 gives best speed, 9 gives best compression, 0 gives no compression at all
+ (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION
+ requests a default compromise between speed and compression (currently
+ equivalent to level 6).
+
+ deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if level is not a valid compression level, or
+ Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible
+ with the version assumed by the caller (ZLIB_VERSION). msg is set to null
+ if there is no error message. deflateInit does not perform any compression:
+ this will be done by deflate().
+*/
+
+
+ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush));
+/*
+ deflate compresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. deflate performs one or both of the
+ following actions:
+
+ - Compress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in and avail_in are updated and
+ processing will resume at this point for the next call of deflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. This action is forced if the parameter flush is non zero.
+ Forcing flush frequently degrades the compression ratio, so this parameter
+ should be set only when necessary (in interactive applications). Some
+ output may be provided even if flush is not set.
+
+ Before the call of deflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating avail_in or avail_out accordingly; avail_out should
+ never be zero before the call. The application can consume the compressed
+ output when it wants, for example when the output buffer is full (avail_out
+ == 0), or after each call of deflate(). If deflate returns Z_OK and with
+ zero avail_out, it must be called again after making room in the output
+ buffer because there might be more output pending.
+
+ Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to
+ decide how much data to accumulate before producing output, in order to
+ maximize compression.
+
+ If the parameter flush is set to Z_SYNC_FLUSH, all pending output is
+ flushed to the output buffer and the output is aligned on a byte boundary, so
+ that the decompressor can get all input data available so far. (In
+ particular avail_in is zero after the call if enough output space has been
+ provided before the call.) Flushing may degrade compression for some
+ compression algorithms and so it should be used only when necessary. This
+ completes the current deflate block and follows it with an empty stored block
+ that is three bits plus filler bits to the next byte, followed by four bytes
+ (00 00 ff ff).
+
+ If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the
+ output buffer, but the output is not aligned to a byte boundary. All of the
+ input data so far will be available to the decompressor, as for Z_SYNC_FLUSH.
+ This completes the current deflate block and follows it with an empty fixed
+ codes block that is 10 bits long. This assures that enough bytes are output
+ in order for the decompressor to finish the block before the empty fixed code
+ block.
+
+ If flush is set to Z_BLOCK, a deflate block is completed and emitted, as
+ for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to
+ seven bits of the current block are held to be written as the next byte after
+ the next deflate block is completed. In this case, the decompressor may not
+ be provided enough bits at this point in order to complete decompression of
+ the data provided so far to the compressor. It may need to wait for the next
+ block to be emitted. This is for advanced applications that need to control
+ the emission of deflate blocks.
+
+ If flush is set to Z_FULL_FLUSH, all output is flushed as with
+ Z_SYNC_FLUSH, and the compression state is reset so that decompression can
+ restart from this point if previous compressed data has been damaged or if
+ random access is desired. Using Z_FULL_FLUSH too often can seriously degrade
+ compression.
+
+ If deflate returns with avail_out == 0, this function must be called again
+ with the same value of the flush parameter and more output space (updated
+ avail_out), until the flush is complete (deflate returns with non-zero
+ avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that
+ avail_out is greater than six to avoid repeated flush markers due to
+ avail_out == 0 on return.
+
+ If the parameter flush is set to Z_FINISH, pending input is processed,
+ pending output is flushed and deflate returns with Z_STREAM_END if there was
+ enough output space; if deflate returns with Z_OK, this function must be
+ called again with Z_FINISH and more output space (updated avail_out) but no
+ more input data, until it returns with Z_STREAM_END or an error. After
+ deflate has returned Z_STREAM_END, the only possible operations on the stream
+ are deflateReset or deflateEnd.
+
+ Z_FINISH can be used immediately after deflateInit if all the compression
+ is to be done in a single step. In this case, avail_out must be at least the
+ value returned by deflateBound (see below). Then deflate is guaranteed to
+ return Z_STREAM_END. If not enough output space is provided, deflate will
+ not return Z_STREAM_END, and it must be called again as described above.
+
+ deflate() sets strm->adler to the adler32 checksum of all input read
+ so far (that is, total_in bytes).
+
+ deflate() may update strm->data_type if it can make a good guess about
+ the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered
+ binary. This field is only for information purposes and does not affect the
+ compression algorithm in any manner.
+
+ deflate() returns Z_OK if some progress has been made (more input
+ processed or more output produced), Z_STREAM_END if all input has been
+ consumed and all output has been produced (only when flush is set to
+ Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example
+ if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible
+ (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not
+ fatal, and deflate() can be called again with more input and more output
+ space to continue compressing.
+*/
+
+
+ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the
+ stream state was inconsistent, Z_DATA_ERROR if the stream was freed
+ prematurely (some input or output was discarded). In the error case, msg
+ may be set but then points to a static string (which must not be
+ deallocated).
+*/
+
+
+/*
+ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm));
+
+ Initializes the internal stream state for decompression. The fields
+ next_in, avail_in, zalloc, zfree and opaque must be initialized before by
+ the caller. If next_in is not Z_NULL and avail_in is large enough (the
+ exact value depends on the compression method), inflateInit determines the
+ compression method from the zlib header and allocates all data structures
+ accordingly; otherwise the allocation will be deferred to the first call of
+ inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to
+ use default allocation functions.
+
+ inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit() does not process any header information -- that is deferred
+ until inflate() is called.
+*/
+
+
+ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush));
+/*
+ inflate decompresses as much data as possible, and stops when the input
+ buffer becomes empty or the output buffer becomes full. It may introduce
+ some output latency (reading input without producing any output) except when
+ forced to flush.
+
+ The detailed semantics are as follows. inflate performs one or both of the
+ following actions:
+
+ - Decompress more input starting at next_in and update next_in and avail_in
+ accordingly. If not all input can be processed (because there is not
+ enough room in the output buffer), next_in is updated and processing will
+ resume at this point for the next call of inflate().
+
+ - Provide more output starting at next_out and update next_out and avail_out
+ accordingly. inflate() provides as much output as possible, until there is
+ no more input data or no more space in the output buffer (see below about
+ the flush parameter).
+
+ Before the call of inflate(), the application should ensure that at least
+ one of the actions is possible, by providing more input and/or consuming more
+ output, and updating the next_* and avail_* values accordingly. The
+ application can consume the uncompressed output when it wants, for example
+ when the output buffer is full (avail_out == 0), or after each call of
+ inflate(). If inflate returns Z_OK and with zero avail_out, it must be
+ called again after making room in the output buffer because there might be
+ more output pending.
+
+ The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH,
+ Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much
+ output as possible to the output buffer. Z_BLOCK requests that inflate()
+ stop if and when it gets to the next deflate block boundary. When decoding
+ the zlib or gzip format, this will cause inflate() to return immediately
+ after the header and before the first block. When doing a raw inflate,
+ inflate() will go ahead and process the first block, and will return when it
+ gets to the end of that block, or when it runs out of data.
+
+ The Z_BLOCK option assists in appending to or combining deflate streams.
+ Also to assist in this, on return inflate() will set strm->data_type to the
+ number of unused bits in the last byte taken from strm->next_in, plus 64 if
+ inflate() is currently decoding the last block in the deflate stream, plus
+ 128 if inflate() returned immediately after decoding an end-of-block code or
+ decoding the complete header up to just before the first byte of the deflate
+ stream. The end-of-block will not be indicated until all of the uncompressed
+ data from that block has been written to strm->next_out. The number of
+ unused bits may in general be greater than seven, except when bit 7 of
+ data_type is set, in which case the number of unused bits will be less than
+ eight. data_type is set as noted here every time inflate() returns for all
+ flush options, and so can be used to determine the amount of currently
+ consumed input in bits.
+
+ The Z_TREES option behaves as Z_BLOCK does, but it also returns when the
+ end of each deflate block header is reached, before any actual data in that
+ block is decoded. This allows the caller to determine the length of the
+ deflate block header for later use in random access within a deflate block.
+ 256 is added to the value of strm->data_type when inflate() returns
+ immediately after reaching the end of the deflate block header.
+
+ inflate() should normally be called until it returns Z_STREAM_END or an
+ error. However if all decompression is to be performed in a single step (a
+ single call of inflate), the parameter flush should be set to Z_FINISH. In
+ this case all pending input is processed and all pending output is flushed;
+ avail_out must be large enough to hold all of the uncompressed data for the
+ operation to complete. (The size of the uncompressed data may have been
+ saved by the compressor for this purpose.) The use of Z_FINISH is not
+ required to perform an inflation in one step. However it may be used to
+ inform inflate that a faster approach can be used for the single inflate()
+ call. Z_FINISH also informs inflate to not maintain a sliding window if the
+ stream completes, which reduces inflate's memory footprint. If the stream
+ does not complete, either because not all of the stream is provided or not
+ enough output space is provided, then a sliding window will be allocated and
+ inflate() can be called again to continue the operation as if Z_NO_FLUSH had
+ been used.
+
+ In this implementation, inflate() always flushes as much output as
+ possible to the output buffer, and always uses the faster approach on the
+ first call. So the effects of the flush parameter in this implementation are
+ on the return value of inflate() as noted below, when inflate() returns early
+ when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of
+ memory for a sliding window when Z_FINISH is used.
+
+ If a preset dictionary is needed after this call (see inflateSetDictionary
+ below), inflate sets strm->adler to the Adler-32 checksum of the dictionary
+ chosen by the compressor and returns Z_NEED_DICT; otherwise it sets
+ strm->adler to the Adler-32 checksum of all output produced so far (that is,
+ total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described
+ below. At the end of the stream, inflate() checks that its computed adler32
+ checksum is equal to that saved by the compressor and returns Z_STREAM_END
+ only if the checksum is correct.
+
+ inflate() can decompress and check either zlib-wrapped or gzip-wrapped
+ deflate data. The header type is detected automatically, if requested when
+ initializing with inflateInit2(). Any information contained in the gzip
+ header is not retained, so applications that need that information should
+ instead use raw inflate, see inflateInit2() below, or inflateBack() and
+ perform their own processing of the gzip header and trailer. When processing
+ gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output
+ producted so far. The CRC-32 is checked against the gzip trailer.
+
+ inflate() returns Z_OK if some progress has been made (more input processed
+ or more output produced), Z_STREAM_END if the end of the compressed data has
+ been reached and all uncompressed output has been produced, Z_NEED_DICT if a
+ preset dictionary is needed at this point, Z_DATA_ERROR if the input data was
+ corrupted (input stream not conforming to the zlib format or incorrect check
+ value), Z_STREAM_ERROR if the stream structure was inconsistent (for example
+ next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory,
+ Z_BUF_ERROR if no progress is possible or if there was not enough room in the
+ output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and
+ inflate() can be called again with more input and more output space to
+ continue decompressing. If Z_DATA_ERROR is returned, the application may
+ then call inflateSync() to look for a good compression block if a partial
+ recovery of the data is desired.
+*/
+
+
+ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm));
+/*
+ All dynamically allocated data structures for this stream are freed.
+ This function discards any unprocessed input and does not flush any pending
+ output.
+
+ inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state
+ was inconsistent. In the error case, msg may be set but then points to a
+ static string (which must not be deallocated).
+*/
+
+
+ /* Advanced functions */
+
+/*
+ The following functions are needed only in some special applications.
+*/
+
+/*
+ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm,
+ int level,
+ int method,
+ int windowBits,
+ int memLevel,
+ int strategy));
+
+ This is another version of deflateInit with more compression options. The
+ fields next_in, zalloc, zfree and opaque must be initialized before by the
+ caller.
+
+ The method parameter is the compression method. It must be Z_DEFLATED in
+ this version of the library.
+
+ The windowBits parameter is the base two logarithm of the window size
+ (the size of the history buffer). It should be in the range 8..15 for this
+ version of the library. Larger values of this parameter result in better
+ compression at the expense of memory usage. The default value is 15 if
+ deflateInit is used instead.
+
+ windowBits can also be -8..-15 for raw deflate. In this case, -windowBits
+ determines the window size. deflate() will then generate raw deflate data
+ with no zlib header or trailer, and will not compute an adler32 check value.
+
+ windowBits can also be greater than 15 for optional gzip encoding. Add
+ 16 to windowBits to write a simple gzip header and trailer around the
+ compressed data instead of a zlib wrapper. The gzip header will have no
+ file name, no extra data, no comment, no modification time (set to zero), no
+ header crc, and the operating system will be set to 255 (unknown). If a
+ gzip stream is being written, strm->adler is a crc32 instead of an adler32.
+
+ The memLevel parameter specifies how much memory should be allocated
+ for the internal compression state. memLevel=1 uses minimum memory but is
+ slow and reduces compression ratio; memLevel=9 uses maximum memory for
+ optimal speed. The default value is 8. See zconf.h for total memory usage
+ as a function of windowBits and memLevel.
+
+ The strategy parameter is used to tune the compression algorithm. Use the
+ value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a
+ filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no
+ string match), or Z_RLE to limit match distances to one (run-length
+ encoding). Filtered data consists mostly of small values with a somewhat
+ random distribution. In this case, the compression algorithm is tuned to
+ compress them better. The effect of Z_FILTERED is to force more Huffman
+ coding and less string matching; it is somewhat intermediate between
+ Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as
+ fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The
+ strategy parameter only affects the compression ratio but not the
+ correctness of the compressed output even if it is not set appropriately.
+ Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler
+ decoder for special applications.
+
+ deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid
+ method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is
+ incompatible with the version assumed by the caller (ZLIB_VERSION). msg is
+ set to null if there is no error message. deflateInit2 does not perform any
+ compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the compression dictionary from the given byte sequence
+ without producing any compressed output. When using the zlib format, this
+ function must be called immediately after deflateInit, deflateInit2 or
+ deflateReset, and before any call of deflate. When doing raw deflate, this
+ function must be called either before any call of deflate, or immediately
+ after the completion of a deflate block, i.e. after all input has been
+ consumed and all output has been delivered when using any of the flush
+ options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The
+ compressor and decompressor must use exactly the same dictionary (see
+ inflateSetDictionary).
+
+ The dictionary should consist of strings (byte sequences) that are likely
+ to be encountered later in the data to be compressed, with the most commonly
+ used strings preferably put towards the end of the dictionary. Using a
+ dictionary is most useful when the data to be compressed is short and can be
+ predicted with good accuracy; the data can then be compressed better than
+ with the default empty dictionary.
+
+ Depending on the size of the compression data structures selected by
+ deflateInit or deflateInit2, a part of the dictionary may in effect be
+ discarded, for example if the dictionary is larger than the window size
+ provided in deflateInit or deflateInit2. Thus the strings most likely to be
+ useful should be put at the end of the dictionary, not at the front. In
+ addition, the current implementation of deflate will use at most the window
+ size minus 262 bytes of the provided dictionary.
+
+ Upon return of this function, strm->adler is set to the adler32 value
+ of the dictionary; the decompressor may later use this value to determine
+ which dictionary has been used by the compressor. (The adler32 value
+ applies to the whole dictionary even if only a subset of the dictionary is
+ actually used by the compressor.) If a raw deflate was requested, then the
+ adler32 value is not computed and strm->adler is not set.
+
+ deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent (for example if deflate has already been called for this stream
+ or if not at a block boundary for raw deflate). deflateSetDictionary does
+ not perform any compression: this will be done by deflate().
+*/
+
+ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when several compression strategies will be
+ tried, for example when there are several ways of pre-processing the input
+ data with a filter. The streams that will be discarded should then be freed
+ by calling deflateEnd. Note that deflateCopy duplicates the internal
+ compression state which can be quite large, so this strategy is slow and can
+ consume lots of memory.
+
+ deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to deflateEnd followed by deflateInit,
+ but does not free and reallocate all the internal compression state. The
+ stream will keep the same compression level and any other attributes that
+ may have been set by deflateInit2.
+
+ deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm,
+ int level,
+ int strategy));
+/*
+ Dynamically update the compression level and compression strategy. The
+ interpretation of level and strategy is as in deflateInit2. This can be
+ used to switch between compression and straight copy of the input data, or
+ to switch to a different kind of input data requiring a different strategy.
+ If the compression level is changed, the input available so far is
+ compressed with the old level (and may be flushed); the new level will take
+ effect only at the next call of deflate().
+
+ Before the call of deflateParams, the stream state must be set as for
+ a call of deflate(), since the currently available input may have to be
+ compressed and flushed. In particular, strm->avail_out must be non-zero.
+
+ deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source
+ stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if
+ strm->avail_out was zero.
+*/
+
+ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm,
+ int good_length,
+ int max_lazy,
+ int nice_length,
+ int max_chain));
+/*
+ Fine tune deflate's internal compression parameters. This should only be
+ used by someone who understands the algorithm used by zlib's deflate for
+ searching for the best matching string, and even then only by the most
+ fanatic optimizer trying to squeeze out the last compressed bit for their
+ specific input data. Read the deflate.c source code for the meaning of the
+ max_lazy, good_length, nice_length, and max_chain parameters.
+
+ deflateTune() can be called after deflateInit() or deflateInit2(), and
+ returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream.
+ */
+
+ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm,
+ uLong sourceLen));
+/*
+ deflateBound() returns an upper bound on the compressed size after
+ deflation of sourceLen bytes. It must be called after deflateInit() or
+ deflateInit2(), and after deflateSetHeader(), if used. This would be used
+ to allocate an output buffer for deflation in a single pass, and so would be
+ called before deflate(). If that first deflate() call is provided the
+ sourceLen input bytes, an output buffer allocated to the size returned by
+ deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed
+ to return Z_STREAM_END. Note that it is possible for the compressed size to
+ be larger than the value returned by deflateBound() if flush options other
+ than Z_FINISH or Z_NO_FLUSH are used.
+*/
+
+ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm,
+ unsigned *pending,
+ int *bits));
+/*
+ deflatePending() returns the number of bytes and bits of output that have
+ been generated, but not yet provided in the available output. The bytes not
+ provided would be due to the available output space having being consumed.
+ The number of bits of output not provided are between 0 and 7, where they
+ await more bits to join them in order to fill out a full byte. If pending
+ or bits are Z_NULL, then those values are not set.
+
+ deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+ */
+
+ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ deflatePrime() inserts bits in the deflate output stream. The intent
+ is that this function is used to start off the deflate output with the bits
+ leftover from a previous deflate stream when appending to it. As such, this
+ function can only be used for raw deflate, and must be used before the first
+ deflate() call after a deflateInit2() or deflateReset(). bits must be less
+ than or equal to 16, and that many of the least significant bits of value
+ will be inserted in the output.
+
+ deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough
+ room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ deflateSetHeader() provides gzip header information for when a gzip
+ stream is requested by deflateInit2(). deflateSetHeader() may be called
+ after deflateInit2() or deflateReset() and before the first call of
+ deflate(). The text, time, os, extra field, name, and comment information
+ in the provided gz_header structure are written to the gzip header (xflag is
+ ignored -- the extra flags are set according to the compression level). The
+ caller must assure that, if not Z_NULL, name and comment are terminated with
+ a zero byte, and that if extra is not Z_NULL, that extra_len bytes are
+ available there. If hcrc is true, a gzip header crc is included. Note that
+ the current versions of the command-line version of gzip (up through version
+ 1.3.x) do not support header crc's, and will report that it is a "multi-part
+ gzip file" and give up.
+
+ If deflateSetHeader is not used, the default gzip header has text false,
+ the time set to zero, and os set to 255, with no extra, name, or comment
+ fields. The gzip header is returned to the default state by deflateReset().
+
+ deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm,
+ int windowBits));
+
+ This is another version of inflateInit with an extra parameter. The
+ fields next_in, avail_in, zalloc, zfree and opaque must be initialized
+ before by the caller.
+
+ The windowBits parameter is the base two logarithm of the maximum window
+ size (the size of the history buffer). It should be in the range 8..15 for
+ this version of the library. The default value is 15 if inflateInit is used
+ instead. windowBits must be greater than or equal to the windowBits value
+ provided to deflateInit2() while compressing, or it must be equal to 15 if
+ deflateInit2() was not used. If a compressed stream with a larger window
+ size is given as input, inflate() will return with the error code
+ Z_DATA_ERROR instead of trying to allocate a larger window.
+
+ windowBits can also be zero to request that inflate use the window size in
+ the zlib header of the compressed stream.
+
+ windowBits can also be -8..-15 for raw inflate. In this case, -windowBits
+ determines the window size. inflate() will then process raw deflate data,
+ not looking for a zlib or gzip header, not generating a check value, and not
+ looking for any check values for comparison at the end of the stream. This
+ is for use with other formats that use the deflate compressed data format
+ such as zip. Those formats provide their own check values. If a custom
+ format is developed using the raw deflate format for compressed data, it is
+ recommended that a check value such as an adler32 or a crc32 be applied to
+ the uncompressed data as is done in the zlib, gzip, and zip formats. For
+ most applications, the zlib format should be used as is. Note that comments
+ above on the use in deflateInit2() applies to the magnitude of windowBits.
+
+ windowBits can also be greater than 15 for optional gzip decoding. Add
+ 32 to windowBits to enable zlib and gzip decoding with automatic header
+ detection, or add 16 to decode only the gzip format (the zlib format will
+ return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a
+ crc32 instead of an adler32.
+
+ inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_VERSION_ERROR if the zlib library version is incompatible with the
+ version assumed by the caller, or Z_STREAM_ERROR if the parameters are
+ invalid, such as a null pointer to the structure. msg is set to null if
+ there is no error message. inflateInit2 does not perform any decompression
+ apart from possibly reading the zlib header if present: actual decompression
+ will be done by inflate(). (So next_in and avail_in may be modified, but
+ next_out and avail_out are unused and unchanged.) The current implementation
+ of inflateInit2() does not process any header information -- that is
+ deferred until inflate() is called.
+*/
+
+ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm,
+ const Bytef *dictionary,
+ uInt dictLength));
+/*
+ Initializes the decompression dictionary from the given uncompressed byte
+ sequence. This function must be called immediately after a call of inflate,
+ if that call returned Z_NEED_DICT. The dictionary chosen by the compressor
+ can be determined from the adler32 value returned by that call of inflate.
+ The compressor and decompressor must use exactly the same dictionary (see
+ deflateSetDictionary). For raw inflate, this function can be called at any
+ time to set the dictionary. If the provided dictionary is smaller than the
+ window and there is already data in the window, then the provided dictionary
+ will amend what's there. The application must insure that the dictionary
+ that was used for compression is provided.
+
+ inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a
+ parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is
+ inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the
+ expected one (incorrect adler32 value). inflateSetDictionary does not
+ perform any decompression: this will be done by subsequent calls of
+ inflate().
+*/
+
+ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm,
+ Bytef *dictionary,
+ uInt *dictLength));
+/*
+ Returns the sliding dictionary being maintained by inflate. dictLength is
+ set to the number of bytes in the dictionary, and that many bytes are copied
+ to dictionary. dictionary must have enough space, where 32768 bytes is
+ always enough. If inflateGetDictionary() is called with dictionary equal to
+ Z_NULL, then only the dictionary length is returned, and nothing is copied.
+ Similary, if dictLength is Z_NULL, then it is not set.
+
+ inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the
+ stream state is inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm));
+/*
+ Skips invalid compressed data until a possible full flush point (see above
+ for the description of deflate with Z_FULL_FLUSH) can be found, or until all
+ available input is skipped. No output is provided.
+
+ inflateSync searches for a 00 00 FF FF pattern in the compressed data.
+ All full flush points have this pattern, but not all occurrences of this
+ pattern are full flush points.
+
+ inflateSync returns Z_OK if a possible full flush point has been found,
+ Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point
+ has been found, or Z_STREAM_ERROR if the stream structure was inconsistent.
+ In the success case, the application may save the current current value of
+ total_in which indicates where valid compressed data was found. In the
+ error case, the application may repeatedly call inflateSync, providing more
+ input each time, until success or end of the input data.
+*/
+
+ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest,
+ z_streamp source));
+/*
+ Sets the destination stream as a complete copy of the source stream.
+
+ This function can be useful when randomly accessing a large stream. The
+ first pass through the stream can periodically record the inflate state,
+ allowing restarting inflate at those points when randomly accessing the
+ stream.
+
+ inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_STREAM_ERROR if the source stream state was inconsistent
+ (such as zalloc being Z_NULL). msg is left unchanged in both source and
+ destination.
+*/
+
+ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm));
+/*
+ This function is equivalent to inflateEnd followed by inflateInit,
+ but does not free and reallocate all the internal decompression state. The
+ stream will keep attributes that may have been set by inflateInit2.
+
+ inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL).
+*/
+
+ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm,
+ int windowBits));
+/*
+ This function is the same as inflateReset, but it also permits changing
+ the wrap and window size requests. The windowBits parameter is interpreted
+ the same as it is for inflateInit2.
+
+ inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent (such as zalloc or state being Z_NULL), or if
+ the windowBits parameter is invalid.
+*/
+
+ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm,
+ int bits,
+ int value));
+/*
+ This function inserts bits in the inflate input stream. The intent is
+ that this function is used to start inflating at a bit position in the
+ middle of a byte. The provided bits will be used before any bytes are used
+ from next_in. This function should only be used with raw inflate, and
+ should be used before the first inflate() call after inflateInit2() or
+ inflateReset(). bits must be less than or equal to 16, and that many of the
+ least significant bits of value will be inserted in the input.
+
+ If bits is negative, then the input stream bit buffer is emptied. Then
+ inflatePrime() can be called again to put bits in the buffer. This is used
+ to clear out bits leftover after feeding inflate a block description prior
+ to feeding inflate codes.
+
+ inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm));
+/*
+ This function returns two values, one in the lower 16 bits of the return
+ value, and the other in the remaining upper bits, obtained by shifting the
+ return value down 16 bits. If the upper value is -1 and the lower value is
+ zero, then inflate() is currently decoding information outside of a block.
+ If the upper value is -1 and the lower value is non-zero, then inflate is in
+ the middle of a stored block, with the lower value equaling the number of
+ bytes from the input remaining to copy. If the upper value is not -1, then
+ it is the number of bits back from the current bit position in the input of
+ the code (literal or length/distance pair) currently being processed. In
+ that case the lower value is the number of bytes already emitted for that
+ code.
+
+ A code is being processed if inflate is waiting for more input to complete
+ decoding of the code, or if it has completed decoding but is waiting for
+ more output space to write the literal or match data.
+
+ inflateMark() is used to mark locations in the input data for random
+ access, which may be at bit positions, and to note those cases where the
+ output of a code may span boundaries of random access blocks. The current
+ location in the input stream can be determined from avail_in and data_type
+ as noted in the description for the Z_BLOCK flush parameter for inflate.
+
+ inflateMark returns the value noted above or -1 << 16 if the provided
+ source stream state was inconsistent.
+*/
+
+ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm,
+ gz_headerp head));
+/*
+ inflateGetHeader() requests that gzip header information be stored in the
+ provided gz_header structure. inflateGetHeader() may be called after
+ inflateInit2() or inflateReset(), and before the first call of inflate().
+ As inflate() processes the gzip stream, head->done is zero until the header
+ is completed, at which time head->done is set to one. If a zlib stream is
+ being decoded, then head->done is set to -1 to indicate that there will be
+ no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be
+ used to force inflate() to return immediately after header processing is
+ complete and before any actual data is decompressed.
+
+ The text, time, xflags, and os fields are filled in with the gzip header
+ contents. hcrc is set to true if there is a header CRC. (The header CRC
+ was valid if done is set to one.) If extra is not Z_NULL, then extra_max
+ contains the maximum number of bytes to write to extra. Once done is true,
+ extra_len contains the actual extra field length, and extra contains the
+ extra field, or that field truncated if extra_max is less than extra_len.
+ If name is not Z_NULL, then up to name_max characters are written there,
+ terminated with a zero unless the length is greater than name_max. If
+ comment is not Z_NULL, then up to comm_max characters are written there,
+ terminated with a zero unless the length is greater than comm_max. When any
+ of extra, name, or comment are not Z_NULL and the respective field is not
+ present in the header, then that field is set to Z_NULL to signal its
+ absence. This allows the use of deflateSetHeader() with the returned
+ structure to duplicate the header. However if those fields are set to
+ allocated memory, then the application will need to save those pointers
+ elsewhere so that they can be eventually freed.
+
+ If inflateGetHeader is not used, then the header information is simply
+ discarded. The header is always checked for validity, including the header
+ CRC if present. inflateReset() will reset the process to discard the header
+ information. The application would need to call inflateGetHeader() again to
+ retrieve the header from the next gzip stream.
+
+ inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source
+ stream state was inconsistent.
+*/
+
+/*
+ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window));
+
+ Initialize the internal stream state for decompression using inflateBack()
+ calls. The fields zalloc, zfree and opaque in strm must be initialized
+ before the call. If zalloc and zfree are Z_NULL, then the default library-
+ derived memory allocation routines are used. windowBits is the base two
+ logarithm of the window size, in the range 8..15. window is a caller
+ supplied buffer of that size. Except for special applications where it is
+ assured that deflate was used with small window sizes, windowBits must be 15
+ and a 32K byte window must be supplied to be able to decompress general
+ deflate streams.
+
+ See inflateBack() for the usage of these routines.
+
+ inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of
+ the parameters are invalid, Z_MEM_ERROR if the internal state could not be
+ allocated, or Z_VERSION_ERROR if the version of the library does not match
+ the version of the header file.
+*/
+
+typedef unsigned (*in_func) OF((void FAR *,
+ z_const unsigned char FAR * FAR *));
+typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned));
+
+ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm,
+ in_func in, void FAR *in_desc,
+ out_func out, void FAR *out_desc));
+/*
+ inflateBack() does a raw inflate with a single call using a call-back
+ interface for input and output. This is potentially more efficient than
+ inflate() for file i/o applications, in that it avoids copying between the
+ output and the sliding window by simply making the window itself the output
+ buffer. inflate() can be faster on modern CPUs when used with large
+ buffers. inflateBack() trusts the application to not change the output
+ buffer passed by the output function, at least until inflateBack() returns.
+
+ inflateBackInit() must be called first to allocate the internal state
+ and to initialize the state with the user-provided window buffer.
+ inflateBack() may then be used multiple times to inflate a complete, raw
+ deflate stream with each call. inflateBackEnd() is then called to free the
+ allocated state.
+
+ A raw deflate stream is one with no zlib or gzip header or trailer.
+ This routine would normally be used in a utility that reads zip or gzip
+ files and writes out uncompressed files. The utility would decode the
+ header and process the trailer on its own, hence this routine expects only
+ the raw deflate stream to decompress. This is different from the normal
+ behavior of inflate(), which expects either a zlib or gzip header and
+ trailer around the deflate stream.
+
+ inflateBack() uses two subroutines supplied by the caller that are then
+ called by inflateBack() for input and output. inflateBack() calls those
+ routines until it reads a complete deflate stream and writes out all of the
+ uncompressed data, or until it encounters an error. The function's
+ parameters and return types are defined above in the in_func and out_func
+ typedefs. inflateBack() will call in(in_desc, &buf) which should return the
+ number of bytes of provided input, and a pointer to that input in buf. If
+ there is no input available, in() must return zero--buf is ignored in that
+ case--and inflateBack() will return a buffer error. inflateBack() will call
+ out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out()
+ should return zero on success, or non-zero on failure. If out() returns
+ non-zero, inflateBack() will return with an error. Neither in() nor out()
+ are permitted to change the contents of the window provided to
+ inflateBackInit(), which is also the buffer that out() uses to write from.
+ The length written by out() will be at most the window size. Any non-zero
+ amount of input may be provided by in().
+
+ For convenience, inflateBack() can be provided input on the first call by
+ setting strm->next_in and strm->avail_in. If that input is exhausted, then
+ in() will be called. Therefore strm->next_in must be initialized before
+ calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called
+ immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in
+ must also be initialized, and then if strm->avail_in is not zero, input will
+ initially be taken from strm->next_in[0 .. strm->avail_in - 1].
+
+ The in_desc and out_desc parameters of inflateBack() is passed as the
+ first parameter of in() and out() respectively when they are called. These
+ descriptors can be optionally used to pass any information that the caller-
+ supplied in() and out() functions need to do their job.
+
+ On return, inflateBack() will set strm->next_in and strm->avail_in to
+ pass back any unused input that was provided by the last in() call. The
+ return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR
+ if in() or out() returned an error, Z_DATA_ERROR if there was a format error
+ in the deflate stream (in which case strm->msg is set to indicate the nature
+ of the error), or Z_STREAM_ERROR if the stream was not properly initialized.
+ In the case of Z_BUF_ERROR, an input or output error can be distinguished
+ using strm->next_in which will be Z_NULL only if in() returned an error. If
+ strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning
+ non-zero. (in() will always be called before out(), so strm->next_in is
+ assured to be defined if out() returns non-zero.) Note that inflateBack()
+ cannot return Z_OK.
+*/
+
+ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm));
+/*
+ All memory allocated by inflateBackInit() is freed.
+
+ inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream
+ state was inconsistent.
+*/
+
+ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void));
+/* Return flags indicating compile-time options.
+
+ Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other:
+ 1.0: size of uInt
+ 3.2: size of uLong
+ 5.4: size of voidpf (pointer)
+ 7.6: size of z_off_t
+
+ Compiler, assembler, and debug options:
+ 8: DEBUG
+ 9: ASMV or ASMINF -- use ASM code
+ 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention
+ 11: 0 (reserved)
+
+ One-time table building (smaller code, but not thread-safe if true):
+ 12: BUILDFIXED -- build static block decoding tables when needed
+ 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed
+ 14,15: 0 (reserved)
+
+ Library content (indicates missing functionality):
+ 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking
+ deflate code when not needed)
+ 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect
+ and decode gzip streams (to avoid linking crc code)
+ 18-19: 0 (reserved)
+
+ Operation variations (changes in library functionality):
+ 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate
+ 21: FASTEST -- deflate algorithm with only one, lowest compression level
+ 22,23: 0 (reserved)
+
+ The sprintf variant used by gzprintf (zero is best):
+ 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format
+ 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure!
+ 26: 0 = returns value, 1 = void -- 1 means inferred string length returned
+
+ Remainder:
+ 27-31: 0 (reserved)
+ */
+
+#ifndef Z_SOLO
+
+ /* utility functions */
+
+/*
+ The following utility functions are implemented on top of the basic
+ stream-oriented functions. To simplify the interface, some default options
+ are assumed (compression level and memory usage, standard memory allocation
+ functions). The source code of these utility functions can be modified if
+ you need special options.
+*/
+
+ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Compresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer.
+*/
+
+ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen,
+ int level));
+/*
+ Compresses the source buffer into the destination buffer. The level
+ parameter has the same meaning as in deflateInit. sourceLen is the byte
+ length of the source buffer. Upon entry, destLen is the total size of the
+ destination buffer, which must be at least the value returned by
+ compressBound(sourceLen). Upon exit, destLen is the actual size of the
+ compressed buffer.
+
+ compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough
+ memory, Z_BUF_ERROR if there was not enough room in the output buffer,
+ Z_STREAM_ERROR if the level parameter is invalid.
+*/
+
+ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen));
+/*
+ compressBound() returns an upper bound on the compressed size after
+ compress() or compress2() on sourceLen bytes. It would be used before a
+ compress() or compress2() call to allocate the destination buffer.
+*/
+
+ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen,
+ const Bytef *source, uLong sourceLen));
+/*
+ Decompresses the source buffer into the destination buffer. sourceLen is
+ the byte length of the source buffer. Upon entry, destLen is the total size
+ of the destination buffer, which must be large enough to hold the entire
+ uncompressed data. (The size of the uncompressed data must have been saved
+ previously by the compressor and transmitted to the decompressor by some
+ mechanism outside the scope of this compression library.) Upon exit, destLen
+ is the actual size of the uncompressed buffer.
+
+ uncompress returns Z_OK if success, Z_MEM_ERROR if there was not
+ enough memory, Z_BUF_ERROR if there was not enough room in the output
+ buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In
+ the case where there is not enough room, uncompress() will fill the output
+ buffer with the uncompressed data up to that point.
+*/
+
+ /* gzip file access functions */
+
+/*
+ This library supports reading and writing files in gzip (.gz) format with
+ an interface similar to that of stdio, using the functions that start with
+ "gz". The gzip format is different from the zlib format. gzip is a gzip
+ wrapper, documented in RFC 1952, wrapped around a deflate stream.
+*/
+
+typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */
+
+/*
+ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode));
+
+ Opens a gzip (.gz) file for reading or writing. The mode parameter is as
+ in fopen ("rb" or "wb") but can also include a compression level ("wb9") or
+ a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only
+ compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F'
+ for fixed code compression as in "wb9F". (See the description of
+ deflateInit2 for more information about the strategy parameter.) 'T' will
+ request transparent writing or appending with no compression and not using
+ the gzip format.
+
+ "a" can be used instead of "w" to request that the gzip stream that will
+ be written be appended to the file. "+" will result in an error, since
+ reading and writing to the same gzip file is not supported. The addition of
+ "x" when writing will create the file exclusively, which fails if the file
+ already exists. On systems that support it, the addition of "e" when
+ reading or writing will set the flag to close the file on an execve() call.
+
+ These functions, as well as gzip, will read and decode a sequence of gzip
+ streams in a file. The append function of gzopen() can be used to create
+ such a file. (Also see gzflush() for another way to do this.) When
+ appending, gzopen does not test whether the file begins with a gzip stream,
+ nor does it look for the end of the gzip streams to begin appending. gzopen
+ will simply append a gzip stream to the existing file.
+
+ gzopen can be used to read a file which is not in gzip format; in this
+ case gzread will directly read from the file without decompression. When
+ reading, this will be detected automatically by looking for the magic two-
+ byte gzip header.
+
+ gzopen returns NULL if the file could not be opened, if there was
+ insufficient memory to allocate the gzFile state, or if an invalid mode was
+ specified (an 'r', 'w', or 'a' was not provided, or '+' was provided).
+ errno can be checked to determine if the reason gzopen failed was that the
+ file could not be opened.
+*/
+
+ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode));
+/*
+ gzdopen associates a gzFile with the file descriptor fd. File descriptors
+ are obtained from calls like open, dup, creat, pipe or fileno (if the file
+ has been previously opened with fopen). The mode parameter is as in gzopen.
+
+ The next call of gzclose on the returned gzFile will also close the file
+ descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor
+ fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd,
+ mode);. The duplicated descriptor should be saved to avoid a leak, since
+ gzdopen does not close fd if it fails. If you are using fileno() to get the
+ file descriptor from a FILE *, then you will have to use dup() to avoid
+ double-close()ing the file descriptor. Both gzclose() and fclose() will
+ close the associated file descriptor, so they need to have different file
+ descriptors.
+
+ gzdopen returns NULL if there was insufficient memory to allocate the
+ gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not
+ provided, or '+' was provided), or if fd is -1. The file descriptor is not
+ used until the next gz* read, write, seek, or close operation, so gzdopen
+ will not detect if fd is invalid (unless fd is -1).
+*/
+
+ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size));
+/*
+ Set the internal buffer size used by this library's functions. The
+ default buffer size is 8192 bytes. This function must be called after
+ gzopen() or gzdopen(), and before any other calls that read or write the
+ file. The buffer memory allocation is always deferred to the first read or
+ write. Two buffers are allocated, either both of the specified size when
+ writing, or one of the specified size and the other twice that size when
+ reading. A larger buffer size of, for example, 64K or 128K bytes will
+ noticeably increase the speed of decompression (reading).
+
+ The new buffer size also affects the maximum length for gzprintf().
+
+ gzbuffer() returns 0 on success, or -1 on failure, such as being called
+ too late.
+*/
+
+ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy));
+/*
+ Dynamically update the compression level or strategy. See the description
+ of deflateInit2 for the meaning of these parameters.
+
+ gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not
+ opened for writing.
+*/
+
+ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len));
+/*
+ Reads the given number of uncompressed bytes from the compressed file. If
+ the input file is not in gzip format, gzread copies the given number of
+ bytes into the buffer directly from the file.
+
+ After reaching the end of a gzip stream in the input, gzread will continue
+ to read, looking for another gzip stream. Any number of gzip streams may be
+ concatenated in the input file, and will all be decompressed by gzread().
+ If something other than a gzip stream is encountered after a gzip stream,
+ that remaining trailing garbage is ignored (and no error is returned).
+
+ gzread can be used to read a gzip file that is being concurrently written.
+ Upon reaching the end of the input, gzread will return with the available
+ data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then
+ gzclearerr can be used to clear the end of file indicator in order to permit
+ gzread to be tried again. Z_OK indicates that a gzip stream was completed
+ on the last gzread. Z_BUF_ERROR indicates that the input file ended in the
+ middle of a gzip stream. Note that gzread does not return -1 in the event
+ of an incomplete gzip stream. This error is deferred until gzclose(), which
+ will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip
+ stream. Alternatively, gzerror can be used before gzclose to detect this
+ case.
+
+ gzread returns the number of uncompressed bytes actually read, less than
+ len for end of file, or -1 for error.
+*/
+
+ZEXTERN int ZEXPORT gzwrite OF((gzFile file,
+ voidpc buf, unsigned len));
+/*
+ Writes the given number of uncompressed bytes into the compressed file.
+ gzwrite returns the number of uncompressed bytes written or 0 in case of
+ error.
+*/
+
+ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...));
+/*
+ Converts, formats, and writes the arguments to the compressed file under
+ control of the format string, as in fprintf. gzprintf returns the number of
+ uncompressed bytes actually written, or 0 in case of error. The number of
+ uncompressed bytes written is limited to 8191, or one less than the buffer
+ size given to gzbuffer(). The caller should assure that this limit is not
+ exceeded. If it is exceeded, then gzprintf() will return an error (0) with
+ nothing written. In this case, there may also be a buffer overflow with
+ unpredictable consequences, which is possible only if zlib was compiled with
+ the insecure functions sprintf() or vsprintf() because the secure snprintf()
+ or vsnprintf() functions were not available. This can be determined using
+ zlibCompileFlags().
+*/
+
+ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s));
+/*
+ Writes the given null-terminated string to the compressed file, excluding
+ the terminating null character.
+
+ gzputs returns the number of characters written, or -1 in case of error.
+*/
+
+ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len));
+/*
+ Reads bytes from the compressed file until len-1 characters are read, or a
+ newline character is read and transferred to buf, or an end-of-file
+ condition is encountered. If any characters are read or if len == 1, the
+ string is terminated with a null character. If no characters are read due
+ to an end-of-file or len < 1, then the buffer is left untouched.
+
+ gzgets returns buf which is a null-terminated string, or it returns NULL
+ for end-of-file or in case of error. If there was an error, the contents at
+ buf are indeterminate.
+*/
+
+ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c));
+/*
+ Writes c, converted to an unsigned char, into the compressed file. gzputc
+ returns the value that was written, or -1 in case of error.
+*/
+
+ZEXTERN int ZEXPORT gzgetc OF((gzFile file));
+/*
+ Reads one byte from the compressed file. gzgetc returns this byte or -1
+ in case of end of file or error. This is implemented as a macro for speed.
+ As such, it does not do all of the checking the other functions do. I.e.
+ it does not check to see if file is NULL, nor whether the structure file
+ points to has been clobbered or not.
+*/
+
+ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file));
+/*
+ Push one character back onto the stream to be read as the first character
+ on the next read. At least one character of push-back is allowed.
+ gzungetc() returns the character pushed, or -1 on failure. gzungetc() will
+ fail if c is -1, and may fail if a character has been pushed but not read
+ yet. If gzungetc is used immediately after gzopen or gzdopen, at least the
+ output buffer size of pushed characters is allowed. (See gzbuffer above.)
+ The pushed character will be discarded if the stream is repositioned with
+ gzseek() or gzrewind().
+*/
+
+ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush));
+/*
+ Flushes all pending output into the compressed file. The parameter flush
+ is as in the deflate() function. The return value is the zlib error number
+ (see function gzerror below). gzflush is only permitted when writing.
+
+ If the flush parameter is Z_FINISH, the remaining data is written and the
+ gzip stream is completed in the output. If gzwrite() is called again, a new
+ gzip stream will be started in the output. gzread() is able to read such
+ concatented gzip streams.
+
+ gzflush should be called only when strictly necessary because it will
+ degrade compression if called too often.
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file,
+ z_off_t offset, int whence));
+
+ Sets the starting position for the next gzread or gzwrite on the given
+ compressed file. The offset represents a number of bytes in the
+ uncompressed data stream. The whence parameter is defined as in lseek(2);
+ the value SEEK_END is not supported.
+
+ If the file is opened for reading, this function is emulated but can be
+ extremely slow. If the file is opened for writing, only forward seeks are
+ supported; gzseek then compresses a sequence of zeroes up to the new
+ starting position.
+
+ gzseek returns the resulting offset location as measured in bytes from
+ the beginning of the uncompressed stream, or -1 in case of error, in
+ particular if the file is opened for writing and the new starting position
+ would be before the current position.
+*/
+
+ZEXTERN int ZEXPORT gzrewind OF((gzFile file));
+/*
+ Rewinds the given file. This function is supported only for reading.
+
+ gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file));
+
+ Returns the starting position for the next gzread or gzwrite on the given
+ compressed file. This position represents a number of bytes in the
+ uncompressed data stream, and is zero when starting, even if appending or
+ reading a gzip stream from the middle of a file using gzdopen().
+
+ gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR)
+*/
+
+/*
+ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file));
+
+ Returns the current offset in the file being read or written. This offset
+ includes the count of bytes that precede the gzip stream, for example when
+ appending or when using gzdopen() for reading. When reading, the offset
+ does not include as yet unused buffered input. This information can be used
+ for a progress indicator. On error, gzoffset() returns -1.
+*/
+
+ZEXTERN int ZEXPORT gzeof OF((gzFile file));
+/*
+ Returns true (1) if the end-of-file indicator has been set while reading,
+ false (0) otherwise. Note that the end-of-file indicator is set only if the
+ read tried to go past the end of the input, but came up short. Therefore,
+ just like feof(), gzeof() may return false even if there is no more data to
+ read, in the event that the last read request was for the exact number of
+ bytes remaining in the input file. This will happen if the input file size
+ is an exact multiple of the buffer size.
+
+ If gzeof() returns true, then the read functions will return no more data,
+ unless the end-of-file indicator is reset by gzclearerr() and the input file
+ has grown since the previous end of file was detected.
+*/
+
+ZEXTERN int ZEXPORT gzdirect OF((gzFile file));
+/*
+ Returns true (1) if file is being copied directly while reading, or false
+ (0) if file is a gzip stream being decompressed.
+
+ If the input file is empty, gzdirect() will return true, since the input
+ does not contain a gzip stream.
+
+ If gzdirect() is used immediately after gzopen() or gzdopen() it will
+ cause buffers to be allocated to allow reading the file to determine if it
+ is a gzip file. Therefore if gzbuffer() is used, it should be called before
+ gzdirect().
+
+ When writing, gzdirect() returns true (1) if transparent writing was
+ requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note:
+ gzdirect() is not needed when writing. Transparent writing must be
+ explicitly requested, so the application already knows the answer. When
+ linking statically, using gzdirect() will include all of the zlib code for
+ gzip file reading and decompression, which may not be desired.)
+*/
+
+ZEXTERN int ZEXPORT gzclose OF((gzFile file));
+/*
+ Flushes all pending output if necessary, closes the compressed file and
+ deallocates the (de)compression state. Note that once file is closed, you
+ cannot call gzerror with file, since its structures have been deallocated.
+ gzclose must not be called more than once on the same file, just as free
+ must not be called more than once on the same allocation.
+
+ gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a
+ file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the
+ last read ended in the middle of a gzip stream, or Z_OK on success.
+*/
+
+ZEXTERN int ZEXPORT gzclose_r OF((gzFile file));
+ZEXTERN int ZEXPORT gzclose_w OF((gzFile file));
+/*
+ Same as gzclose(), but gzclose_r() is only for use when reading, and
+ gzclose_w() is only for use when writing or appending. The advantage to
+ using these instead of gzclose() is that they avoid linking in zlib
+ compression or decompression code that is not used when only reading or only
+ writing respectively. If gzclose() is used, then both compression and
+ decompression code will be included the application when linking to a static
+ zlib library.
+*/
+
+ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum));
+/*
+ Returns the error message for the last error which occurred on the given
+ compressed file. errnum is set to zlib error number. If an error occurred
+ in the file system and not in the compression library, errnum is set to
+ Z_ERRNO and the application may consult errno to get the exact error code.
+
+ The application must not modify the returned string. Future calls to
+ this function may invalidate the previously returned string. If file is
+ closed, then the string previously returned by gzerror will no longer be
+ available.
+
+ gzerror() should be used to distinguish errors from end-of-file for those
+ functions above that do not distinguish those cases in their return values.
+*/
+
+ZEXTERN void ZEXPORT gzclearerr OF((gzFile file));
+/*
+ Clears the error and end-of-file flags for file. This is analogous to the
+ clearerr() function in stdio. This is useful for continuing to read a gzip
+ file that is being written concurrently.
+*/
+
+#endif /* !Z_SOLO */
+
+ /* checksum functions */
+
+/*
+ These functions are not related to compression but are exported
+ anyway because they might be useful in applications using the compression
+ library.
+*/
+
+ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len));
+/*
+ Update a running Adler-32 checksum with the bytes buf[0..len-1] and
+ return the updated checksum. If buf is Z_NULL, this function returns the
+ required initial value for the checksum.
+
+ An Adler-32 checksum is almost as reliable as a CRC32 but can be computed
+ much faster.
+
+ Usage example:
+
+ uLong adler = adler32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ adler = adler32(adler, buffer, length);
+ }
+ if (adler != original_adler) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2,
+ z_off_t len2));
+
+ Combine two Adler-32 checksums into one. For two sequences of bytes, seq1
+ and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for
+ each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of
+ seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note
+ that the z_off_t type (like off_t) is a signed integer. If len2 is
+ negative, the result has no meaning or utility.
+*/
+
+ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len));
+/*
+ Update a running CRC-32 with the bytes buf[0..len-1] and return the
+ updated CRC-32. If buf is Z_NULL, this function returns the required
+ initial value for the crc. Pre- and post-conditioning (one's complement) is
+ performed within this function so it shouldn't be done by the application.
+
+ Usage example:
+
+ uLong crc = crc32(0L, Z_NULL, 0);
+
+ while (read_buffer(buffer, length) != EOF) {
+ crc = crc32(crc, buffer, length);
+ }
+ if (crc != original_crc) error();
+*/
+
+/*
+ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2));
+
+ Combine two CRC-32 check values into one. For two sequences of bytes,
+ seq1 and seq2 with lengths len1 and len2, CRC-32 check values were
+ calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32
+ check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and
+ len2.
+*/
+
+
+ /* various hacks, don't look :) */
+
+/* deflateInit and inflateInit are macros to allow checking the zlib version
+ * and the compiler's view of z_stream:
+ */
+ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method,
+ int windowBits, int memLevel,
+ int strategy, const char *version,
+ int stream_size));
+ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits,
+ const char *version, int stream_size));
+ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits,
+ unsigned char FAR *window,
+ const char *version,
+ int stream_size));
+#define deflateInit(strm, level) \
+ deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit(strm) \
+ inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream))
+#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \
+ deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\
+ (strategy), ZLIB_VERSION, (int)sizeof(z_stream))
+#define inflateInit2(strm, windowBits) \
+ inflateInit2_((strm), (windowBits), ZLIB_VERSION, \
+ (int)sizeof(z_stream))
+#define inflateBackInit(strm, windowBits, window) \
+ inflateBackInit_((strm), (windowBits), (window), \
+ ZLIB_VERSION, (int)sizeof(z_stream))
+
+#ifndef Z_SOLO
+
+/* gzgetc() macro and its supporting function and exposed data structure. Note
+ * that the real internal state is much larger than the exposed structure.
+ * This abbreviated structure exposes just enough for the gzgetc() macro. The
+ * user should not mess with these exposed elements, since their names or
+ * behavior could change in the future, perhaps even capriciously. They can
+ * only be used by the gzgetc() macro. You have been warned.
+ */
+struct gzFile_s {
+ unsigned have;
+ unsigned char *next;
+ z_off64_t pos;
+};
+ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */
+#ifdef Z_PREFIX_SET
+# undef z_gzgetc
+# define z_gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#else
+# define gzgetc(g) \
+ ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g))
+#endif
+
+/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or
+ * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if
+ * both are true, the application gets the *64 functions, and the regular
+ * functions are changed to 64 bits) -- in case these are set on systems
+ * without large file support, _LFS64_LARGEFILE must also be true
+ */
+#ifdef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int));
+ ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t));
+#endif
+
+#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64)
+# ifdef Z_PREFIX_SET
+# define z_gzopen z_gzopen64
+# define z_gzseek z_gzseek64
+# define z_gztell z_gztell64
+# define z_gzoffset z_gzoffset64
+# define z_adler32_combine z_adler32_combine64
+# define z_crc32_combine z_crc32_combine64
+# else
+# define gzopen gzopen64
+# define gzseek gzseek64
+# define gztell gztell64
+# define gzoffset gzoffset64
+# define adler32_combine adler32_combine64
+# define crc32_combine crc32_combine64
+# endif
+# ifndef Z_LARGE64
+ ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t));
+# endif
+#else
+ ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *));
+ ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int));
+ ZEXTERN z_off_t ZEXPORT gztell OF((gzFile));
+ ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile));
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+#endif
+
+#else /* Z_SOLO */
+
+ ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t));
+ ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t));
+
+#endif /* !Z_SOLO */
+
+/* hack for buggy compilers */
+#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL)
+ struct internal_state {int dummy;};
+#endif
+
+/* undocumented functions */
+ZEXTERN const char * ZEXPORT zError OF((int));
+ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp));
+ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void));
+ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int));
+ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp));
+ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp));
+#if defined(_WIN32) && !defined(Z_SOLO)
+ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path,
+ const char *mode));
+#endif
+#if defined(STDC) || defined(Z_HAVE_STDARG_H)
+# ifndef Z_SOLO
+ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file,
+ const char *format,
+ va_list va));
+# endif
+#endif
+
+#ifdef __cplusplus
+}
+#endif
+
+#endif /* ZLIB_H */
diff --git a/frontend/libretro.c b/frontend/libretro.c
index 940ff05..1e86509 100644
--- a/frontend/libretro.c
+++ b/frontend/libretro.c
@@ -33,6 +33,12 @@
#include "revision.h"
#include "libretro.h"
+#ifdef _3DS
+#include "3ds/3ds_utils.h"
+#endif
+
+#define PORTS_NUMBER 8
+
static retro_video_refresh_t video_cb;
static retro_input_poll_t input_poll_cb;
static retro_input_state_t input_state_cb;
@@ -54,9 +60,15 @@ extern char Mcd1Data[MCD_SIZE];
extern char McdDisable[2];
/* PCSX ReARMed core calls and stuff */
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
-int in_keystate;
+int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE,
+ PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE };
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+unsigned short in_keystate[PORTS_NUMBER];
+int multitap1 = 0;
+int multitap2 = 0;
int in_enable_vibration = 1;
/* PSX max resolution is 640x512, but with enhancement it's 1024x512 */
@@ -169,6 +181,164 @@ static void vout_close(void)
{
}
+#ifdef _3DS
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ custom_map->buffer = malloc(size + 0x1000);
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0)
+ {
+ SysPrintf("could not map memory @0x%08X\n", custom_map->target_map);
+ exit(1);
+ }
+
+ return (void*)custom_map->target_map;
+ }
+ }
+ }
+
+ return malloc(size);
+}
+
+void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag)
+{
+ (void)tag;
+
+ if (__ctr_svchax)
+ {
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->target_map == (uint32_t)ptr))
+ {
+ uint32_t ptr_aligned, tmp;
+
+ ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+
+ svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3);
+
+ free(custom_map->buffer);
+ custom_map->buffer = NULL;
+ return;
+ }
+ }
+ }
+
+ free(ptr);
+}
+#endif
+
+#ifdef VITA
+typedef struct
+{
+ void* buffer;
+ uint32_t target_map;
+ size_t size;
+ enum psxMapTag tag;
+}psx_map_t;
+
+psx_map_t custom_psx_maps[] = {
+ {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000
+ {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000
+ {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000
+ {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000
+ {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000
+};
+
+void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed,
+ enum psxMapTag tag)
+{
+ (void)is_fixed;
+ (void)addr;
+
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->size == size) && (custom_map->tag == tag))
+ {
+ int block, ret;
+ char blockname[32];
+ sprintf(blockname, "CODE 0x%08X",tag);
+
+ block = sceKernelAllocMemBlock(blockname, size + 0x1000);
+ if(block<=0){
+ sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, tag);
+ exit(1);
+ }
+
+ // get base address
+ ret = sceKernelGetMemBlockBase(block, &custom_map->buffer);
+ if (ret < 0)
+ {
+ sceClibPrintf("could get address @0x%08X 0x%08X 0x%08X \n", block, ret, tag);
+ exit(1);
+ }
+ custom_map->buffer = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF;
+ custom_map->target_map = block;
+
+ return custom_map->buffer;
+ }
+ }
+
+
+ return malloc(size);
+}
+
+void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag)
+{
+ (void)tag;
+
+ psx_map_t* custom_map = custom_psx_maps;
+
+ for (; custom_map->size; custom_map++)
+ {
+ if ((custom_map->buffer == ptr))
+ {
+ sceKernelFreeMemBlock(custom_map->target_map);
+ custom_map->buffer = NULL;
+ custom_map->target_map = NULL;
+ return;
+ }
+ }
+
+ free(ptr);
+}
+#endif
+
static void *pl_mmap(unsigned int size)
{
return psxMap(0, size, 0, MAP_TAG_VRAM);
@@ -248,8 +418,16 @@ void retro_set_environment(retro_environment_t cb)
static const struct retro_variable vars[] = {
{ "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" },
{ "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" },
- { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" },
- { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" },
+ { "pcsx_rearmed_pad1type", "Pad 1 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad2type", "Pad 2 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad3type", "Pad 3 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad4type", "Pad 4 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad5type", "Pad 5 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad6type", "Pad 6 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad7type", "Pad 7 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_pad8type", "Pad 8 Type; default|none|standard|analog|negcon" },
+ { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" },
+ { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" },
#ifndef DRC_DISABLE
{ "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" },
#endif
@@ -261,6 +439,8 @@ void retro_set_environment(retro_environment_t cb)
{ "pcsx_rearmed_duping_enable", "Frame duping; on|off" },
{ "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" },
{ "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" },
+ { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" },
+ { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" },
{ NULL, NULL },
};
@@ -280,8 +460,160 @@ unsigned retro_api_version(void)
return RETRO_API_VERSION;
}
+static int controller_port_variable(unsigned port, struct retro_variable *var)
+{
+ if (port >= PORTS_NUMBER)
+ return 0;
+
+ if (!environ_cb)
+ return 0;
+
+ var->value = NULL;
+ switch (port) {
+ case 0:
+ var->key = "pcsx_rearmed_pad1type";
+ break;
+ case 1:
+ var->key = "pcsx_rearmed_pad2type";
+ break;
+ case 2:
+ var->key = "pcsx_rearmed_pad3type";
+ break;
+ case 3:
+ var->key = "pcsx_rearmed_pad4type";
+ break;
+ case 4:
+ var->key = "pcsx_rearmed_pad5type";
+ break;
+ case 5:
+ var->key = "pcsx_rearmed_pad6type";
+ break;
+ case 6:
+ var->key = "pcsx_rearmed_pad7type";
+ break;
+ case 7:
+ var->key = "pcsx_rearmed_pad8type";
+ break;
+ }
+
+ return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value;
+}
+
+static void update_controller_port_variable(unsigned port)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (controller_port_variable(port, &var))
+ {
+ if (strcmp(var.value, "standard") == 0)
+ in_type[0] = PSE_PAD_TYPE_STANDARD;
+ else if (strcmp(var.value, "analog") == 0)
+ in_type[0] = PSE_PAD_TYPE_ANALOGPAD;
+ else if (strcmp(var.value, "negcon") == 0)
+ in_type[0] = PSE_PAD_TYPE_NEGCON;
+ else if (strcmp(var.value, "none") == 0)
+ in_type[0] = PSE_PAD_TYPE_NONE;
+ // else 'default' case, do nothing
+ }
+}
+
+static void update_controller_port_device(unsigned port, unsigned device)
+{
+ if (port >= PORTS_NUMBER)
+ return;
+
+ struct retro_variable var;
+
+ if (!controller_port_variable(port, &var))
+ return;
+
+ if (strcmp(var.value, "default") != 0)
+ return;
+
+ switch (device)
+ {
+ case RETRO_DEVICE_JOYPAD:
+ in_type[port] = PSE_PAD_TYPE_STANDARD;
+ break;
+ case RETRO_DEVICE_ANALOG:
+ in_type[port] = PSE_PAD_TYPE_ANALOGPAD;
+ break;
+ case RETRO_DEVICE_MOUSE:
+ in_type[port] = PSE_PAD_TYPE_MOUSE;
+ break;
+ case RETRO_DEVICE_LIGHTGUN:
+ in_type[port] = PSE_PAD_TYPE_GUN;
+ break;
+ case RETRO_DEVICE_NONE:
+ default:
+ in_type[port] = PSE_PAD_TYPE_NONE;
+ }
+}
+
+static void update_multitap()
+{
+ struct retro_variable var;
+ int auto_case, port;
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap1";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap1 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap1 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 2, we need a first multitap.
+ multitap1 = 0;
+ for (port = 2; port < PORTS_NUMBER; port++)
+ multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+
+ var.value = NULL;
+ var.key = "pcsx_rearmed_multitap2";
+ auto_case = 0;
+ if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value))
+ {
+ if (strcmp(var.value, "enabled") == 0)
+ multitap2 = 1;
+ else if (strcmp(var.value, "disabled") == 0)
+ multitap2 = 0;
+ else // 'auto' case
+ auto_case = 1;
+ }
+ else
+ auto_case = 1;
+
+ if (auto_case)
+ {
+ // If a gamepad is plugged after port 4, we need a second multitap.
+ multitap2 = 0;
+ for (port = 4; port < PORTS_NUMBER; port++)
+ multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE;
+ }
+}
+
void retro_set_controller_port_device(unsigned port, unsigned device)
{
+ SysPrintf("port %u device %u",port,device);
+
+ if (port >= PORTS_NUMBER)
+ return;
+
+ update_controller_port_device(port, device);
+ update_multitap();
}
void retro_get_system_info(struct retro_system_info *info)
@@ -306,8 +638,8 @@ void retro_get_system_av_info(struct retro_system_av_info *info)
}
/* savestates */
-size_t retro_serialize_size(void)
-{
+size_t retro_serialize_size(void)
+{
// it's currently 4380651-4397047 bytes,
// but have some reserved for future
return 0x440000;
@@ -393,7 +725,7 @@ static void save_close(void *file)
}
bool retro_serialize(void *data, size_t size)
-{
+{
int ret = SaveState(data);
return ret == 0 ? true : false;
}
@@ -761,7 +1093,7 @@ bool retro_load_game(const struct retro_game_info *info)
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
@@ -782,7 +1114,7 @@ bool retro_load_game(const struct retro_game_info *info)
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
@@ -803,7 +1135,7 @@ bool retro_load_game(const struct retro_game_info *info)
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" },
{ 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" },
- { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
+ { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" },
{ 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" },
@@ -902,7 +1234,7 @@ bool retro_load_game_special(unsigned game_type, const struct retro_game_info *i
return false;
}
-void retro_unload_game(void)
+void retro_unload_game(void)
{
}
@@ -955,16 +1287,15 @@ static const unsigned short retro_psx_map[] = {
static void update_variables(bool in_flight)
{
struct retro_variable var;
-
+ int i;
+
var.value = NULL;
var.key = "pcsx_rearmed_frameskip";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
pl_rearmed_cbs.frameskip = atoi(var.value);
var.value = NULL;
var.key = "pcsx_rearmed_region";
-
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
{
Config.PsxAuto = 0;
@@ -976,25 +1307,10 @@ static void update_variables(bool in_flight)
Config.PsxType = 1;
}
- var.value = NULL;
- var.key = "pcsx_rearmed_pad1type";
+ for (i = 0; i < PORTS_NUMBER; i++)
+ update_controller_port_variable(i);
- if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
- {
- in_type1 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type1 = PSE_PAD_TYPE_ANALOGPAD;
- }
-
- var.value = NULL;
- var.key = "pcsx_rearmed_pad2type";
-
- if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
- {
- in_type2 = PSE_PAD_TYPE_STANDARD;
- if (strcmp(var.value, "analog") == 0)
- in_type2 = PSE_PAD_TYPE_ANALOGPAD;
- }
+ update_multitap();
#ifdef __ARM_NEON__
var.value = "NULL";
@@ -1050,6 +1366,11 @@ static void update_variables(bool in_flight)
{
R3000Acpu *prev_cpu = psxCpu;
+#ifdef _3DS
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+ else
+#endif
if (strcmp(var.value, "disabled") == 0)
Config.Cpu = CPU_INTERPRETER;
else if (strcmp(var.value, "enabled") == 0)
@@ -1090,6 +1411,28 @@ static void update_variables(bool in_flight)
spu_config.iUseInterpolation = 0;
}
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_pe2_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.RCntFix = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.RCntFix = 1;
+ }
+
+ var.value = "NULL";
+ var.key = "pcsx_rearmed_inuyasha_fix";
+
+ if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)
+ {
+ if (strcmp(var.value, "disabled") == 0)
+ Config.VSyncWA = 0;
+ else if (strcmp(var.value, "enabled") == 0)
+ Config.VSyncWA = 1;
+ }
+
if (in_flight) {
// inform core things about possible config changes
plugin_call_rearmed_cbs();
@@ -1103,9 +1446,9 @@ static void update_variables(bool in_flight)
}
}
-void retro_run(void)
+void retro_run(void)
{
- int i;
+ int i;
input_poll_cb();
@@ -1113,21 +1456,26 @@ void retro_run(void)
if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated)
update_variables(true);
- in_keystate = 0;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
- in_keystate <<= 16;
- for (i = 0; i < RETRO_PSX_MAP_LEN; i++)
- if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i))
- in_keystate |= retro_psx_map[i];
+ // reset all keystate, query libretro for keystate
+ int j;
+ for(i = 0; i < PORTS_NUMBER; i++) {
+ in_keystate[i] = 0;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
- {
- in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
- in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
- in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
+ if (in_type[i] == PSE_PAD_TYPE_NONE)
+ continue;
+
+ // query libretro for keystate
+ for (j = 0; j < RETRO_PSX_MAP_LEN; j++)
+ if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j))
+ in_keystate[i] |= retro_psx_map[j];
+
+ if (in_type[i] == PSE_PAD_TYPE_ANALOGPAD)
+ {
+ in_analog_left[i][0] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
+ in_analog_left[i][1] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
+ in_analog_right[i][0] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128;
+ in_analog_right[i][1] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128;
+ }
}
stop = 0;
@@ -1162,7 +1510,7 @@ static bool try_use_bios(const char *path)
return true;
}
-#if 1
+#ifndef VITA
#include <sys/types.h>
#include <dirent.h>
@@ -1211,14 +1559,29 @@ void retro_init(void)
syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0);
#endif
+#ifdef _3DS
+ psxMapHook = pl_3ds_mmap;
+ psxUnmapHook = pl_3ds_munmap;
+#endif
+#ifdef VITA
+ psxMapHook = pl_vita_mmap;
+ psxUnmapHook = pl_vita_munmap;
+#endif
ret = emu_core_preinit();
+#ifdef _3DS
+ /* emu_core_preinit sets the cpu to dynarec */
+ if(!__ctr_svchax)
+ Config.Cpu = CPU_INTERPRETER;
+#endif
ret |= emu_core_init();
if (ret != 0) {
SysPrintf("PCSX init failed.\n");
exit(1);
}
-#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L)
+#ifdef _3DS
+ vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80);
+#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA)
posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
#else
vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2);
@@ -1226,7 +1589,7 @@ void retro_init(void)
if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir)
{
- snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir);
+ snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir);
for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) {
snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]);
@@ -1244,7 +1607,7 @@ void retro_init(void)
else
{
SysPrintf("no BIOS files found.\n");
- struct retro_message msg =
+ struct retro_message msg =
{
"no BIOS found, expect bugs!",
180
@@ -1283,6 +1646,18 @@ void retro_init(void)
void retro_deinit(void)
{
SysClose();
+#ifdef _3DS
+ linearFree(vout_buf);
+#else
free(vout_buf);
+#endif
vout_buf = NULL;
}
+
+#ifdef VITA
+#include <psp2/kernel/threadmgr.h>
+int usleep (unsigned long us)
+{
+ sceKernelDelayThread(us);
+}
+#endif
diff --git a/frontend/main.c b/frontend/main.c
index a824fdc..89e96e4 100644
--- a/frontend/main.c
+++ b/frontend/main.c
@@ -11,7 +11,7 @@
#include <unistd.h>
#include <signal.h>
#include <time.h>
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
#include <dlfcn.h>
#endif
@@ -151,8 +151,8 @@ void emu_set_default_config(void)
new_dynarec_hacks = 0;
cycle_multiplier = 200;
- in_type1 = PSE_PAD_TYPE_STANDARD;
- in_type2 = PSE_PAD_TYPE_STANDARD;
+ in_type[0] = PSE_PAD_TYPE_STANDARD;
+ in_type[1] = PSE_PAD_TYPE_STANDARD;
}
void do_emu_action(void)
@@ -986,7 +986,7 @@ void *SysLoadLibrary(const char *lib) {
return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]);
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
ret = dlopen(lib, RTLD_NOW);
if (ret == NULL)
SysMessage("dlopen: %s", dlerror());
@@ -1003,7 +1003,7 @@ void *SysLoadSym(void *lib, const char *sym) {
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return plugin_link(plugid - PLUGIN_DL_BASE, sym);
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
return dlsym(lib, sym);
#else
return NULL;
@@ -1011,7 +1011,9 @@ void *SysLoadSym(void *lib, const char *sym) {
}
const char *SysLibError() {
-#ifndef _WIN32
+#if defined(NO_DYLIB)
+ return NULL;
+#elif !defined(_WIN32)
return dlerror();
#else
return "not supported";
@@ -1024,8 +1026,7 @@ void SysCloseLibrary(void *lib) {
if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins))
return;
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
dlclose(lib);
#endif
}
-
diff --git a/frontend/menu.c b/frontend/menu.c
index cf9382a..7e1fdd1 100644
--- a/frontend/menu.c
+++ b/frontend/menu.c
@@ -309,12 +309,12 @@ static void menu_sync_config(void)
switch (in_type_sel1) {
case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break;
default: in_type1 = PSE_PAD_TYPE_STANDARD;
}
switch (in_type_sel2) {
case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break;
- case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break;
+ case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break;
default: in_type2 = PSE_PAD_TYPE_STANDARD;
}
if (in_evdev_allow_abs_only != allow_abs_only_old) {
diff --git a/frontend/plugin.c b/frontend/plugin.c
index d9eb04a..8914519 100644
--- a/frontend/plugin.c
+++ b/frontend/plugin.c
@@ -49,24 +49,43 @@ extern void CALLBACK SPUasync(unsigned int, unsigned int);
extern int CALLBACK SPUplayCDDAchannel(short *, int);
/* PAD */
-static long PADreadPort1(PadDataS *pad)
-{
- pad->controllerType = in_type1;
- pad->buttonStatus = ~in_keystate;
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) {
- pad->leftJoyX = in_a1[0];
- pad->leftJoyY = in_a1[1];
- pad->rightJoyX = in_a2[0];
- pad->rightJoyY = in_a2[1];
- }
- return 0;
+static long PADreadPort1(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap1 == 1)
+ pad->portMultitap = 1;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
-static long PADreadPort2(PadDataS *pad)
-{
- pad->controllerType = in_type2;
- pad->buttonStatus = ~in_keystate >> 16;
- return 0;
+static long PADreadPort2(PadDataS *pad) {
+ int pad_index = pad->requestPadIndex;
+
+ pad->controllerType = in_type[pad_index];
+ pad->buttonStatus = ~in_keystate[pad_index];
+ if (multitap2 ==1 )
+ pad->portMultitap = 2;
+ else
+ pad->portMultitap = 0;
+
+ if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON)
+ {
+ pad->leftJoyX = in_analog_left[pad_index][0];
+ pad->leftJoyY = in_analog_left[pad_index][1];
+ pad->rightJoyX = in_analog_right[pad_index][0];
+ pad->rightJoyY = in_analog_right[pad_index][1];
+ }
+ return 0;
}
/* GPU */
diff --git a/frontend/plugin_lib.c b/frontend/plugin_lib.c
index ab4d415..ad2f49b 100644
--- a/frontend/plugin_lib.c
+++ b/frontend/plugin_lib.c
@@ -36,8 +36,11 @@
#define HUD_HEIGHT 10
-int in_type1, in_type2;
-int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 };
+int in_type[8];
+int multitap1;
+int multitap2;
+int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
+int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }};
int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }};
int in_adev_is_nublike[2];
int in_keystate, in_state_gun;
@@ -560,7 +563,7 @@ static void update_analog_nub_adjust(int *x_, int *y_)
static void update_analogs(void)
{
- int *nubp[2] = { in_a1, in_a2 };
+ int *nubp[2] = { in_analog_left[0], in_analog_right[0] };
int vals[2];
int i, a, v, ret;
@@ -597,7 +600,7 @@ static void update_input(void)
unsigned int emu_act;
in_update(actions);
- if (in_type1 == PSE_PAD_TYPE_ANALOGPAD)
+ if (in_type[0] == PSE_PAD_TYPE_ANALOGPAD)
update_analogs();
emu_act = actions[IN_BINDTYPE_EMU];
in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER;
@@ -611,7 +614,7 @@ static void update_input(void)
}
emu_set_action(emu_act);
- in_keystate = actions[IN_BINDTYPE_PLAYER12];
+ in_keystate[0] = actions[IN_BINDTYPE_PLAYER12];
}
#else /* MAEMO */
extern void update_input(void);
diff --git a/frontend/plugin_lib.h b/frontend/plugin_lib.h
index 4a11002..ad27fc2 100644
--- a/frontend/plugin_lib.h
+++ b/frontend/plugin_lib.h
@@ -17,8 +17,14 @@ enum {
DKEY_CROSS,
DKEY_SQUARE,
};
-extern int in_type1, in_type2;
-extern int in_keystate, in_state_gun, in_a1[2], in_a2[2];
+extern int in_state_gun;
+extern int in_type[8];
+extern int multitap1;
+extern int multitap2;
+extern int in_analog_left[8][2];
+extern int in_analog_right[8][2];
+unsigned short in_keystate[8];
+
extern int in_adev[2], in_adev_axis[2][2];
extern int in_adev_is_nublike[2];
extern int in_enable_vibration;
diff --git a/frontend/vita/pthread.h b/frontend/vita/pthread.h
new file mode 100644
index 0000000..e1afdc5
--- /dev/null
+++ b/frontend/vita/pthread.h
@@ -0,0 +1,308 @@
+/* Copyright (C) 2010-2016 The RetroArch team
+ *
+ * ---------------------------------------------------------------------------------------
+ * The following license statement only applies to this file (psp_pthread.h).
+ * ---------------------------------------------------------------------------------------
+ *
+ * Permission is hereby granted, free of charge,
+ * to any person obtaining a copy of this software and associated documentation files (the "Software"),
+ * to deal in the Software without restriction, including without limitation the rights to
+ * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software,
+ * and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+ * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+ * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+/* FIXME: unfinished on PSP, mutexes and condition variables basically a stub. */
+#ifndef _PSP_PTHREAD_WRAP__
+#define _PSP_PTHREAD_WRAP__
+
+#ifdef VITA
+#include <psp2/kernel/threadmgr.h>
+#include <sys/time.h>
+#else
+#include <pspkernel.h>
+#include <pspthreadman.h>
+#include <pspthreadman_kernel.h>
+#endif
+#include <stdio.h>
+#include <retro_inline.h>
+
+#define STACKSIZE (8 * 1024)
+
+typedef SceUID pthread_t;
+typedef SceUID pthread_mutex_t;
+typedef void* pthread_mutexattr_t;
+typedef int pthread_attr_t;
+
+typedef struct
+{
+ SceUID mutex;
+ SceUID sema;
+ int waiting;
+} pthread_cond_t;
+
+typedef SceUID pthread_condattr_t;
+
+/* Use pointer values to create unique names for threads/mutexes */
+char name_buffer[256];
+
+typedef void* (*sthreadEntry)(void *argp);
+
+typedef struct
+{
+ void* arg;
+ sthreadEntry start_routine;
+} sthread_args_struct;
+
+
+static int psp_thread_wrap(SceSize args, void *argp)
+{
+ sthread_args_struct* sthread_args = (sthread_args_struct*)argp;
+
+ return (int)sthread_args->start_routine(sthread_args->arg);
+}
+
+static INLINE int pthread_create(pthread_t *thread,
+ const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg)
+{
+ sprintf(name_buffer, "0x%08X", (unsigned int) thread);
+
+#ifdef VITA
+ *thread = sceKernelCreateThread(name_buffer, psp_thread_wrap,
+ 0x10000100, 0x10000, 0, 0, NULL);
+#else
+ *thread = sceKernelCreateThread(name_buffer,
+ psp_thread_wrap, 0x20, STACKSIZE, 0, NULL);
+#endif
+
+ sthread_args_struct sthread_args;
+ sthread_args.arg = arg;
+ sthread_args.start_routine = start_routine;
+
+ return sceKernelStartThread(*thread, sizeof(sthread_args), &sthread_args);
+}
+
+static INLINE int pthread_mutex_init(pthread_mutex_t *mutex,
+ const pthread_mutexattr_t *attr)
+{
+ sprintf(name_buffer, "0x%08X", (unsigned int) mutex);
+
+#ifdef VITA
+ *mutex = sceKernelCreateMutex(name_buffer, 0, 0, 0);
+ if(*mutex<0)
+ return *mutex;
+ return 0;
+#else
+ return *mutex = sceKernelCreateSema(name_buffer, 0, 1, 1, NULL);
+#endif
+}
+
+static INLINE int pthread_mutex_destroy(pthread_mutex_t *mutex)
+{
+#ifdef VITA
+ return sceKernelDeleteMutex(*mutex);
+#else
+ return sceKernelDeleteSema(*mutex);
+#endif
+}
+
+static INLINE int pthread_mutex_lock(pthread_mutex_t *mutex)
+{
+#ifdef VITA
+ int ret = sceKernelLockMutex(*mutex, 1, 0);
+ return ret;
+
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+static INLINE int pthread_mutex_unlock(pthread_mutex_t *mutex)
+{
+#ifdef VITA
+ int ret = sceKernelUnlockMutex(*mutex, 1);
+ return ret;
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+
+static INLINE int pthread_join(pthread_t thread, void **retval)
+{
+#ifdef VITA
+ int res = sceKernelWaitThreadEnd(thread, 0, 0);
+ if (res < 0)
+ return res;
+ return sceKernelDeleteThread(thread);
+#else
+ SceUInt timeout = (SceUInt)-1;
+ sceKernelWaitThreadEnd(thread, &timeout);
+ exit_status = sceKernelGetThreadExitStatus(thread);
+ sceKernelDeleteThread(thread);
+ return exit_status;
+#endif
+}
+
+static INLINE int pthread_mutex_trylock(pthread_mutex_t *mutex)
+{
+#ifdef VITA
+ return sceKernelTryLockMutex(*mutex, 1 /* not sure about this last param */);
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+static INLINE int pthread_cond_wait(pthread_cond_t *cond,
+ pthread_mutex_t *mutex)
+{
+#ifdef VITA
+ int ret = pthread_mutex_lock(&cond->mutex);
+ if (ret < 0)
+ return ret;
+ ++cond->waiting;
+ pthread_mutex_unlock(mutex);
+ pthread_mutex_unlock(&cond->mutex);
+
+ ret = sceKernelWaitSema(cond->sema, 1, 0);
+ if (ret < 0)
+ sceClibPrintf("Premature wakeup: %08X", ret);
+ pthread_mutex_lock(mutex);
+ return ret;
+#else
+ /* FIXME: stub */
+ sceKernelDelayThread(10000);
+ return 1;
+#endif
+}
+
+static INLINE int pthread_cond_timedwait(pthread_cond_t *cond,
+ pthread_mutex_t *mutex, const struct timespec *abstime)
+{
+#ifdef VITA
+ int ret = pthread_mutex_lock(&cond->mutex);
+ if (ret < 0)
+ return ret;
+ ++cond->waiting;
+ pthread_mutex_unlock(mutex);
+ pthread_mutex_unlock(&cond->mutex);
+
+ SceUInt timeout = 0;
+
+ timeout = abstime->tv_sec;
+ timeout += abstime->tv_nsec / 1.0e6;
+
+ ret = sceKernelWaitSema(cond->sema, 1, &timeout);
+ if (ret < 0)
+ sceClibPrintf("Premature wakeup: %08X", ret);
+ pthread_mutex_lock(mutex);
+ return ret;
+
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+static INLINE int pthread_cond_init(pthread_cond_t *cond,
+ const pthread_condattr_t *attr)
+{
+#ifdef VITA
+
+ pthread_mutex_init(&cond->mutex,NULL);
+ if(cond->mutex<0){
+ return cond->mutex;
+ }
+ sprintf(name_buffer, "0x%08X", (unsigned int) cond);
+ //cond->sema = sceKernelCreateCond(name_buffer, 0, cond->mutex, 0);
+ cond->sema = sceKernelCreateSema(name_buffer, 0, 0, 1, 0);
+ if(cond->sema<0){
+ pthread_mutex_destroy(&cond->mutex);
+ return cond->sema;
+ }
+
+ cond->waiting = 0;
+
+
+ return 0;
+
+
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+static INLINE int pthread_cond_signal(pthread_cond_t *cond)
+{
+#ifdef VITA
+ pthread_mutex_lock(&cond->mutex);
+ if (cond->waiting)
+ {
+ --cond->waiting;
+ sceKernelSignalSema(cond->sema, 1);
+ }
+ pthread_mutex_unlock(&cond->mutex);
+ return 0;
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+static INLINE int pthread_cond_broadcast(pthread_cond_t *cond)
+{
+ /* FIXME: stub */
+ return 1;
+}
+
+static INLINE int pthread_cond_destroy(pthread_cond_t *cond)
+{
+#ifdef VITA
+ int ret = sceKernelDeleteSema(cond->sema);
+ if(ret < 0)
+ return ret;
+
+ return sceKernelDeleteMutex(cond->mutex);
+#else
+ /* FIXME: stub */
+ return 1;
+#endif
+}
+
+
+static INLINE int pthread_detach(pthread_t thread)
+{
+ return 0;
+}
+
+static INLINE void pthread_exit(void *retval)
+{
+#ifdef VITA
+ sceKernelExitDeleteThread(sceKernelGetThreadId());
+#endif
+}
+
+static INLINE pthread_t pthread_self(void)
+{
+ /* zero 20-mar-2016: untested */
+ return sceKernelGetThreadId();
+}
+
+static INLINE int pthread_equal(pthread_t t1, pthread_t t2)
+{
+ return t1 == t2;
+}
+
+#endif //_PSP_PTHREAD_WRAP__
diff --git a/frontend/vita/retro_inline.h b/frontend/vita/retro_inline.h
new file mode 100644
index 0000000..8535d84
--- /dev/null
+++ b/frontend/vita/retro_inline.h
@@ -0,0 +1,39 @@
+/* Copyright (C) 2010-2015 The RetroArch team
+ *
+ * ---------------------------------------------------------------------------------------
+ * The following license statement only applies to this file (retro_inline.h).
+ * ---------------------------------------------------------------------------------------
+ *
+ * Permission is hereby granted, free of charge,
+ * to any person obtaining a copy of this software and associated documentation files (the "Software"),
+ * to deal in the Software without restriction, including without limitation the rights to
+ * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software,
+ * and to permit persons to whom the Software is furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+ * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+ * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+ * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+ */
+
+#ifndef __LIBRETRO_SDK_INLINE_H
+#define __LIBRETRO_SDK_INLINE_H
+
+#ifndef INLINE
+
+#if !defined(__cplusplus) && defined(_WIN32)
+#define INLINE _inline
+#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L
+#define INLINE inline
+#elif defined(__GNUC__)
+#define INLINE __inline__
+#else
+#define INLINE
+#endif
+
+#endif
+#endif
diff --git a/frontend/vita/sys/mman.h b/frontend/vita/sys/mman.h
new file mode 100644
index 0000000..89da513
--- /dev/null
+++ b/frontend/vita/sys/mman.h
@@ -0,0 +1,69 @@
+#ifndef MMAN_H
+#define MMAN_H
+
+#ifdef __cplusplus
+extern "C" {
+#endif
+
+#include "stdlib.h"
+#include "stdio.h"
+
+#define PROT_READ 0b001
+#define PROT_WRITE 0b010
+#define PROT_EXEC 0b100
+#define MAP_PRIVATE 2
+#define MAP_ANONYMOUS 0x20
+
+#define MAP_FAILED ((void *)-1)
+
+static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset)
+{
+ (void)prot;
+ (void)flags;
+ (void)fd;
+ (void)offset;
+
+ int block, ret;
+
+ block = sceKernelAllocMemBlockForVM("code", len);
+ if(block<=0){
+ sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len);
+ exit(1);
+ }
+
+ // get base address
+ ret = sceKernelGetMemBlockBase(block, &addr);
+ if (ret < 0)
+ {
+ sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr);
+ exit(1);
+ }
+
+
+ if(!addr)
+ return MAP_FAILED;
+
+ return addr;
+}
+
+static inline int mprotect(void *addr, size_t len, int prot)
+{
+ (void)addr;
+ (void)len;
+ (void)prot;
+ return 0;
+}
+
+static inline int munmap(void *addr, size_t len)
+{
+ int uid = sceKernelFindMemBlockByAddr(addr, len);
+
+ return sceKernelFreeMemBlock(uid);
+
+}
+
+#ifdef __cplusplus
+};
+#endif
+
+#endif // MMAN_H
diff --git a/include/psemu_plugin_defs.h b/include/psemu_plugin_defs.h
index 9986654..6fc59b7 100644
--- a/include/psemu_plugin_defs.h
+++ b/include/psemu_plugin_defs.h
@@ -153,6 +153,8 @@ typedef struct
+// No controller
+#define PSE_PAD_TYPE_NONE 0
// MOUSE SCPH-1030
#define PSE_PAD_TYPE_MOUSE 1
// NEGCON - 16 button analog controller SLPH-00001
@@ -191,9 +193,15 @@ typedef struct
typedef struct
{
- // controler type - fill it withe predefined values above
+ // controller type - fill it withe predefined values above
unsigned char controllerType;
+ //0 : no multitap between psx and pad
+ //1 : multitap between psx and pad on port 1
+ //2 : multitap between psx and pad on port 2
+ int portMultitap;
+ int requestPadIndex;
+
// status of buttons - every controller fills this field
unsigned short buttonStatus;
@@ -207,7 +215,9 @@ typedef struct
unsigned char Vib[2];
unsigned char VibF[2];
-
+
+ //configuration mode Request 0x43
+ int configMode;
unsigned char reserved[87];
} PadDataS;
diff --git a/jni/Android.mk b/jni/Android.mk
index 72c6738..36b0c93 100644
--- a/jni/Android.mk
+++ b/jni/Android.mk
@@ -4,6 +4,9 @@ include $(CLEAR_VARS)
APP_DIR := ../../src
+#fix stupid change in ndk r11 that breaks compiling even when the exe would run fine
+LOCAL_DISABLE_FATAL_LINKER_WARNINGS := true
+
ifneq ($(TARGET_ARCH_ABI),armeabi-v7a)
NO_NEON_BUILD := 1
else
diff --git a/libpcsxcore/cdriso.c b/libpcsxcore/cdriso.c
index 515370f..d2c904c 100644
--- a/libpcsxcore/cdriso.c
+++ b/libpcsxcore/cdriso.c
@@ -30,7 +30,7 @@
#include <process.h>
#include <windows.h>
#define strcasecmp _stricmp
-#define usleep(x) Sleep((x) / 1000)
+#define usleep(x) (Sleep((x) / 1000))
#else
#include <pthread.h>
#include <sys/time.h>
@@ -225,7 +225,9 @@ static void *playthread(void *param)
do {
ret = SPU_playCDDAchannel((short *)sndbuffer, s);
if (ret == 0x7761)
+ {
usleep(6 * 1000);
+ }
} while (ret == 0x7761 && playing); // rearmed_wait
}
@@ -236,7 +238,9 @@ static void *playthread(void *param)
// HACK: stop feeding data while emu is paused
extern int stop;
while (stop && playing)
+ {
usleep(10000);
+ }
now = GetTickCount();
osleep = t - now;
diff --git a/libpcsxcore/new_dynarec/emu_if.c b/libpcsxcore/new_dynarec/emu_if.c
index 22db5d1..8aebd64 100644
--- a/libpcsxcore/new_dynarec/emu_if.c
+++ b/libpcsxcore/new_dynarec/emu_if.c
@@ -431,7 +431,7 @@ void do_insn_cmp() {}
#ifdef DRC_DISABLE
unsigned int address;
int pending_exception, stop;
-unsigned int next_interupt;
+u32 next_interupt;
int new_dynarec_did_compile;
int cycle_multiplier;
int new_dynarec_hacks;
diff --git a/libpcsxcore/new_dynarec/emu_if.h b/libpcsxcore/new_dynarec/emu_if.h
index 3980490..73f842b 100644
--- a/libpcsxcore/new_dynarec/emu_if.h
+++ b/libpcsxcore/new_dynarec/emu_if.h
@@ -89,7 +89,7 @@ extern void *scratch_buf_ptr;
extern u32 inv_code_start, inv_code_end;
/* cycles/irqs */
-extern unsigned int next_interupt;
+extern u32 next_interupt;
extern int pending_exception;
/* called by drc */
diff --git a/libpcsxcore/plugins.c b/libpcsxcore/plugins.c
index e6d8a11..007b61e 100644
--- a/libpcsxcore/plugins.c
+++ b/libpcsxcore/plugins.c
@@ -205,7 +205,7 @@ void CALLBACK GPU__vBlank(int val) {}
#define LoadGpuSym1(dest, name) \
LoadSym(GPU_##dest, GPU##dest, name, TRUE);
-
+
#define LoadGpuSym0(dest, name) \
LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
@@ -368,93 +368,419 @@ static int LoadSPUplugin(const char *SPUdll) {
void *hPAD1Driver = NULL;
void *hPAD2Driver = NULL;
-static unsigned char buf[256];
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-
-static int bufcount, bufc;
-
-PadDataS padd1, padd2;
-
-unsigned char _PADstartPoll(PadDataS *pad) {
- bufc = 0;
-
+static int multitap1 = -1;
+static int multitap2 = -1;
+//Pad information, keystate, mode, config mode, vibration
+static PadDataS pad[8];
+
+static int reqPos, respSize, req;
+static int ledStateReq44[8];
+
+static unsigned char buf[256];
+static unsigned char bufMulti[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+unsigned char multitappar[34] = { 0x80, 0x5a,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+//response for request 44, 45, 46, 47, 4C, 4D
+static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00};
+static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A};
+static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14};
+static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00};
+static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00};
+static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00};
+static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF};
+
+//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F
+static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+
+// Resquest of psx core
+enum {
+ // REQUEST
+ // first call of this request for the pad, the pad is configured as an digital pad.
+ // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00
+ // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D)
+ // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad
+ // Y if 0 : psx request a pad key state
+ // ZZ rumble small motor 00-> OFF, 01 -> ON
+ // AA rumble large motor speed 0x00 -> 0xFF
+ // RESPONSE
+ // header 3 Bytes
+ // 0x00
+ // PadId -> 0x41 for digital pas, 0x73 for analog pad
+ // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch
+ // 6 Bytes for keystates
+ CMD_READ_DATA_AND_VIBRATE = 0x42,
+
+ // REQUEST
+ // Header
+ // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // XX = 00 -> Normal mode : Seconde bytes of response = padId
+ // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3
+ // RESPONSE
+ // enter in config mode example :
+ // req : 01 43 00 01 00 00 00 00 00 00
+ // res : 00 41 5A buttons state, analog states
+ // exit config mode :
+ // req : 01 43 00 00 00 00 00 00 00 00
+ // res : 00 F3 5A buttons state, analog states
+ CMD_CONFIG_MODE = 0x43,
+
+ // Set led State
+ // REQUEST
+ // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00
+ // If sel = 2 then
+ // VAL = 00 -> OFF
+ // VAL = 01 -> ON
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ CMD_SET_MODE_AND_LOCK = 0x44,
+
+ // Get Analog Led state
+ // REQUEST
+ // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00
+ // VAL = 00 Led OFF
+ // VAL = 01 Led ON
+ CMD_QUERY_MODEL_AND_MODE = 0x45,
+
+ //Get Variable A
+ // REQUEST
+ // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX=00
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A
+ // XX=01
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14
+ CMD_QUERY_ACT = 0x46,
+
+ // REQUEST
+ // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00
+ CMD_QUERY_COMB = 0x47,
+
+ // REQUEST
+ // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00
+ // RESPONSE
+ // XX = 0
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00
+ // XX = 1
+ // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00
+ CMD_QUERY_MODE = 0x4C,
+
+ // REQUEST
+ // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF
+ // RESPONSE
+ // 0x00, 0xF3, 0x5A, old value or
+ // AA = 01 unlock large motor (and swap VAL1 and VAL2)
+ // BB = 01 unlock large motor (default)
+ // CC, DD, EE, FF = all FF -> unlock small motor
+ //
+ // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF
+ //
+ CMD_VIBRATION_TOGGLE = 0x4D,
+ REQ40 = 0x40,
+ REQ41 = 0x41,
+ REQ49 = 0x49,
+ REQ4A = 0x4A,
+ REQ4B = 0x4B,
+ REQ4E = 0x4E,
+ REQ4F = 0x4F
+};
+
+
+
+
+//NO MULTITAP
+
+void initBufForRequest(int padIndex, char value){
+ switch (value){
+ //Pad keystate already in buffer
+ //case CMD_READ_DATA_AND_VIBRATE :
+ // break;
+ case CMD_CONFIG_MODE :
+ if(pad[padIndex].configMode == 1){
+ memcpy(buf, resp43, 8);
+ break;
+ }
+ //else, not in config mode, pad keystate return (already in the buffer)
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ memcpy(buf, resp44, 8);
+ break;
+ case CMD_QUERY_MODEL_AND_MODE :
+ memcpy(buf, resp45, 8);
+ break;
+ case CMD_QUERY_ACT :
+ memcpy(buf, resp46_00, 8);
+ break;
+ case CMD_QUERY_COMB :
+ memcpy(buf, resp47, 8);
+ break;
+ case CMD_QUERY_MODE :
+ memcpy(buf, resp4C_00, 8);
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ memcpy(buf, resp4D, 8);
+ break;
+ case REQ40 :
+ memcpy(buf, resp40, 8);
+ break;
+ case REQ41 :
+ memcpy(buf, resp41, 8);
+ break;
+ case REQ49 :
+ memcpy(buf, resp49, 8);
+ break;
+ case REQ4A :
+ memcpy(buf, resp4A, 8);
+ break;
+ case REQ4B :
+ memcpy(buf, resp4B, 8);
+ break;
+ case REQ4E :
+ memcpy(buf, resp4E, 8);
+ break;
+ case REQ4F :
+ memcpy(buf, resp4F, 8);
+ break;
+ }
+}
+
+
+
+
+void reqIndex2Treatment(int padIndex, char value){
+ switch (req){
+ case CMD_CONFIG_MODE :
+ //0x43
+ if(value == 0){
+ pad[padIndex].configMode = 0;
+ }else{
+ pad[padIndex].configMode = 1;
+ }
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ //0x44 store the led state for change mode if the next value = 0x02
+ //0x01 analog ON
+ //0x00 analog OFF
+ ledStateReq44[padIndex] = value;
+ break;
+ case CMD_QUERY_ACT :
+ //0x46
+ if(value==1){
+ memcpy(buf, resp46_01, 8);
+ }
+ break;
+
+ case CMD_QUERY_MODE :
+ if(value==1){
+ memcpy(buf, resp4C_01, 8);
+ }
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ //0x4D
+ memcpy(buf, resp4D, 8);
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for small motor;
+ pad[padIndex].Vib[0] = value;
+ }
+}
+
+void vibrate(int padIndex){
+ if(pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]){
+ //value is different update Value and call libretro for vibration
+ pad[padIndex].VibF[0] = pad[padIndex].Vib[0];
+ pad[padIndex].VibF[1] = pad[padIndex].Vib[1];
+ plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]);
+ //printf("vibration pad %i", padIndex);
+ }
+}
+
+
+
+
+//Build response for 0x42 request Pad in port
+void _PADstartPoll(PadDataS *pad) {
switch (pad->controllerType) {
case PSE_PAD_TYPE_MOUSE:
- mousepar[3] = pad->buttonStatus & 0xff;
- mousepar[4] = pad->buttonStatus >> 8;
- mousepar[5] = pad->moveX;
- mousepar[6] = pad->moveY;
-
- memcpy(buf, mousepar, 7);
- bufcount = 6;
+ stdpar[0] = 0x12;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->moveX;
+ stdpar[5] = pad->moveY;
+ memcpy(buf, stdpar, 6);
+ respSize = 6;
break;
case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
- analogpar[1] = 0x23;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x23;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_ANALOGPAD: // scph1150
- analogpar[1] = 0x73;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x73;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_ANALOGJOY: // scph1110
- analogpar[1] = 0x53;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x53;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_STANDARD:
- default:
- stdpar[3] = pad->buttonStatus & 0xff;
- stdpar[4] = pad->buttonStatus >> 8;
-
- memcpy(buf, stdpar, 5);
- bufcount = 4;
+ default:
+ stdpar[0] = 0x41;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ //avoid analog value in multitap mode if change pad type in game.
+ stdpar[4] = 0xff;
+ stdpar[5] = 0xff;
+ stdpar[6] = 0xff;
+ stdpar[7] = 0xff;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
}
-
- return buf[bufc++];
}
-unsigned char _PADpoll(unsigned char value) {
- if (bufc > bufcount) return 0;
- return buf[bufc++];
-}
-
-unsigned char CALLBACK PAD1__startPoll(int pad) {
- PadDataS padd;
+
+//Build response for 0x42 request Multitap in port
+//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D)
+void _PADstartPollMultitap(PadDataS padd[4]) {
+ int i = 0;
+ int offset = 2;
+ PadDataS pad;
+ for(i = 0; i < 4; i++) {
+ offset = 2 + (i * 8);
+ pad = padd[i];
+ _PADstartPoll(&pad);
+ memcpy(multitappar+offset, stdpar, 8);
+ }
+ memcpy(bufMulti, multitappar, 34);
+ respSize = 34;
+}
- PAD1_readPort1(&padd);
- return _PADstartPoll(&padd);
+unsigned char _PADpoll(int port, unsigned char value) {
+ if(reqPos==0){
+ //mem the request number
+ req = value;
+ //copy the default value of request response in buffer instead of the keystate
+ initBufForRequest(port,value);
+ }
+
+ //if no new request the pad return 0xff, for signaling connected
+ if ( reqPos >= respSize) return 0xff;
+
+ switch(reqPos){
+ case 2:
+ reqIndex2Treatment(port, value);
+ break;
+ case 3:
+ switch(req) {
+ case CMD_SET_MODE_AND_LOCK :
+ //change mode on pad
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for Large motor;
+ pad[port].Vib[1] = value;
+ //vibration
+ vibrate(port);
+ break;
+
+ break;
+ }
+ }
+ return buf[reqPos++];
+}
+
+
+unsigned char _PADpollMultitap(int port, unsigned char value) {
+ if ( reqPos >= respSize) return 0xff;
+ return bufMulti[reqPos++];
+}
+
+
+// refresh the button state on port 1.
+// int pad is not needed.
+unsigned char CALLBACK PAD1__startPoll(int pad) {
+ reqPos = 0;
+ // first call the pad provide if a multitap is connected between the psx and himself
+ if(multitap1 == -1){
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ multitap1 = padd.portMultitap;
+ }
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap1 == 0){
+ PadDataS padd;
+ padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i=0;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) {
+ padd[i].requestPadIndex = i;
+ PAD1_readPort1(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 1 : ");
+ return 0x00;
}
-unsigned char CALLBACK PAD1__poll(unsigned char value) {
- return _PADpoll(value);
+unsigned char CALLBACK PAD1__poll(unsigned char value) {
+ char tmp;
+ if(multitap1 == 1){
+ tmp = _PADpollMultitap(0, value);
+ }else{
+ tmp = _PADpoll(0, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+
}
+
long CALLBACK PAD1__configure(void) { return 0; }
void CALLBACK PAD1__about(void) {}
long CALLBACK PAD1__test(void) { return 0; }
@@ -497,16 +823,57 @@ static int LoadPAD1plugin(const char *PAD1dll) {
return 0;
}
-unsigned char CALLBACK PAD2__startPoll(int pad) {
- PadDataS padd;
-
- PAD2_readPort2(&padd);
-
- return _PADstartPoll(&padd);
+unsigned char CALLBACK PAD2__startPoll(int pad) {
+ reqPos = 0;
+ int pad_index = 0;
+ if(multitap1 == 0 && multitap2 == 0){
+ pad_index += 1;
+ }else if(multitap1 == 1 && multitap2 == 0){
+ pad_index += 4;
+ }else if(multitap1 == 0 && multitap2 == 2){
+ pad_index += 1;
+ }else if(multitap1 == 1 && multitap2 == 2){
+ pad_index += 4;
+ }
+
+ //first call the pad provide if a multitap is connected between the psx and himself
+ if(multitap2 == -1){
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ multitap2 = padd.portMultitap;
+ }
+
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap2 == 0){
+ PadDataS padd;
+ padd.requestPadIndex = pad_index;
+ PAD2_readPort2(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ //a multitap is plugged : refresh all pad.
+ int i=0;
+ PadDataS padd[4];
+ for(i=0;i<4;i++){
+ padd[i].requestPadIndex = i+pad_index;
+ PAD2_readPort2(&padd[i]);
+ }
+ _PADstartPollMultitap(padd);
+ }
+ //printf("\npad 2 : ");
+ return 0x00;
}
unsigned char CALLBACK PAD2__poll(unsigned char value) {
- return _PADpoll(value);
+ char tmp;
+ if(multitap2 == 2){
+ tmp = _PADpollMultitap(1, value);
+ }else{
+ tmp = _PADpoll(1, value);
+ }
+ //printf("%2x:%2x, ",value,tmp);
+ return tmp;
}
long CALLBACK PAD2__configure(void) { return 0; }
diff --git a/libpcsxcore/psxbios.c b/libpcsxcore/psxbios.c
index 292d80d..d5ed725 100644
--- a/libpcsxcore/psxbios.c
+++ b/libpcsxcore/psxbios.c
@@ -2216,6 +2216,15 @@ void psxBios_ChangeClearPad() { // 5b
pc0 = ra;
}
+void psxBios__card_status() { // 5c
+#ifdef PSXBIOS_LOG
+ PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0);
+#endif
+
+ v0 = 1;
+ pc0 = ra;
+}
+
/* System calls C0 */
/*
@@ -2569,7 +2578,7 @@ void psxBiosInit() {
//biosB0[0x59] = psxBios_sys_b0_59;
//biosB0[0x5a] = psxBios_sys_b0_5a;
biosB0[0x5b] = psxBios_ChangeClearPad;
- //biosB0[0x5c] = psxBios__card_status;
+ biosB0[0x5c] = psxBios__card_status;
//biosB0[0x5d] = psxBios__card_wait;
//*******************C0 CALLS****************************
//biosC0[0x00] = psxBios_InitRCnt;
diff --git a/libpcsxcore/sio.c b/libpcsxcore/sio.c
index b3732d2..d251fa7 100644
--- a/libpcsxcore/sio.c
+++ b/libpcsxcore/sio.c
@@ -117,6 +117,20 @@ void sioWrite8(unsigned char value) {
break;
}
}
+ // NegCon - Wipeout 3
+ if( buf[parp] == 0x23 ) {
+ switch (value) {
+ // enter config mode
+ case 0x43:
+ buf[1] = 0x79;
+ break;
+
+ // get status
+ case 0x45:
+ buf[1] = 0xf3;
+ break;
+ }
+ }
}
else padst = 0;
return;
diff --git a/libpcsxcore/socket.c b/libpcsxcore/socket.c
index 31f82e2..c408bc3 100644
--- a/libpcsxcore/socket.c
+++ b/libpcsxcore/socket.c
@@ -15,6 +15,22 @@
* along with this program; if not, see <http://www.gnu.org/licenses>.
*/
+#ifdef NO_SOCKET
+
+int StartServer() { return 0;}
+void StopServer() {}
+void GetClient() {}
+void CloseClient() {}
+int HasClient() { return 0;}
+int ReadSocket(char * buffer, int len) { return 0;}
+int RawReadSocket(char * buffer, int len) { return 0;}
+void WriteSocket(char * buffer, int len) {}
+
+void SetsBlock() {}
+void SetsNonblock() {}
+
+#else // NO_SOCKET
+
#ifdef _WIN32
#include <winsock2.h>
#endif
@@ -252,3 +268,4 @@ void SetsNonblock() {
fcntl(server_socket, F_SETFL, flags | O_NONBLOCK);
#endif
}
+#endif // NO_SOCKET
diff --git a/plugins/cdrcimg/cdrcimg.c b/plugins/cdrcimg/cdrcimg.c
index 76cdfba..47371aa 100644
--- a/plugins/cdrcimg/cdrcimg.c
+++ b/plugins/cdrcimg/cdrcimg.c
@@ -14,7 +14,9 @@
#include <zlib.h>
#ifndef _WIN32
#define CALLBACK
+#ifndef NO_DYLIB
#include <dlfcn.h>
+#endif
#else
#define WIN32_LEAN_AND_MEAN
#include <windows.h>
@@ -285,7 +287,7 @@ static long CDRinit(void)
return -1;
}
}
-#ifndef _WIN32
+#if !defined(_WIN32) && !defined(NO_DYLIB)
if (pBZ2_bzBuffToBuffDecompress == NULL) {
void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY);
if (h == NULL)
diff --git a/plugins/dfinput/main.c b/plugins/dfinput/main.c
index 475ea07..4204b86 100644
--- a/plugins/dfinput/main.c
+++ b/plugins/dfinput/main.c
@@ -44,6 +44,7 @@ static int old_controller_type1 = -1, old_controller_type2 = -1;
PAD##n##_poll = PADpoll_guncon; \
guncon_init(); \
break; \
+ case PSE_PAD_TYPE_NEGCON: \
case PSE_PAD_TYPE_GUN: \
default: \
PAD##n##_startPoll = PAD##n##__startPoll; \
@@ -52,13 +53,19 @@ static int old_controller_type1 = -1, old_controller_type2 = -1;
} \
}
+
void dfinput_activate(void)
{
+ #ifndef HAVE_LIBRETRO
PadDataS pad;
+ pad.portMultitap = -1;
+ pad.requestPadIndex = 0;
PAD1_readPort1(&pad);
select_pad(1);
+ pad.requestPadIndex = 1;
PAD2_readPort2(&pad);
select_pad(2);
+ #endif
}
diff --git a/plugins/dfinput/pad.c b/plugins/dfinput/pad.c
index 7e00a11..853c8c8 100644
--- a/plugins/dfinput/pad.c
+++ b/plugins/dfinput/pad.c
@@ -254,6 +254,7 @@ unsigned char PADpoll(unsigned char value) {
#define PADpoll PADpoll_
#endif
+#ifndef HAVE_LIBRETRO
unsigned char PADpoll_pad(unsigned char value) {
if (CurByte == 0) {
CurCmd = value;
@@ -302,3 +303,4 @@ void pad_init(void)
padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD;
}
}
+#endif
diff --git a/plugins/dfxvideo/gpulib_if.c b/plugins/dfxvideo/gpulib_if.c
index 01b8dde..bb3ad56 100644
--- a/plugins/dfxvideo/gpulib_if.c
+++ b/plugins/dfxvideo/gpulib_if.c
@@ -309,11 +309,11 @@ void renderer_notify_res_change(void)
extern const unsigned char cmd_lengths[256];
-int do_cmd_list(unsigned int *list, int list_len, int *last_cmd)
+int do_cmd_list(uint32_t *list, int list_len, int *last_cmd)
{
unsigned int cmd = 0, len;
- unsigned int *list_start = list;
- unsigned int *list_end = list + list_len;
+ uint32_t *list_start = list;
+ uint32_t *list_end = list + list_len;
for (; list < list_end; list += 1 + len)
{