diff options
31 files changed, 4077 insertions, 435 deletions
@@ -2,8 +2,10 @@ # default stuff goes here, so that config can override TARGET ?= pcsx -CFLAGS += -Wall -ggdb -Iinclude -ffast-math -ifndef DEBUG +CFLAGS += -Wall -Iinclude -ffast-math +ifeq ($(DEBUG), 1) +CFLAGS += -O0 -ggdb +else CFLAGS += -O2 -DNDEBUG endif CXXFLAGS += $(CFLAGS) @@ -194,6 +196,7 @@ endif ifeq "$(PLATFORM)" "libretro" OBJS += frontend/libretro.o CFLAGS += -DFRONTEND_SUPPORTS_RGB565 +CFLAGS += -DHAVE_LIBRETRO ifeq ($(MMAP_WIN32),1) OBJS += libpcsxcore/memmap_win32.o @@ -246,11 +249,19 @@ frontend/revision.h: FORCE %.o: %.S $(CC_AS) $(CFLAGS) -c $^ -o $@ +%.o: %.cpp + $(CXX) $(CXXFLAGS) -c -o $@ $< + + target_: $(TARGET) $(TARGET): $(OBJS) +ifeq ($(STATIC_LINKING), 1) + $(AR) rcs $@ $(OBJS) +else $(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS) +endif clean: $(PLAT_CLEAN) clean_plugins $(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h diff --git a/Makefile.libretro b/Makefile.libretro index 223ba9f..0f6608d 100644 --- a/Makefile.libretro +++ b/Makefile.libretro @@ -1,5 +1,7 @@ # Makefile for PCSX ReARMed (libretro) +DEBUG=0 + ifeq ($(platform),) platform = unix ifeq ($(shell uname -a),) @@ -20,35 +22,45 @@ CC_AS ?= $(CC) CFLAGS ?= TARGET_NAME := pcsx_rearmed - +LIBZ := -lz +LIBPTHREAD := -lpthread +LIBDL := -ldl MMAP_WIN32=0 +EXTRA_LDFLAGS = # Unix ifeq ($(platform), unix) TARGET := $(TARGET_NAME)_libretro.so fpic := -fPIC - SHARED := -shared -Wl,--version-script=libretro/link.T + +else ifeq ($(platform), linux-portable) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC -nostdlib + EXTRA_LDFLAGS += -fPIC -nostdlib + LIBZ := + LIBPTHREAD := + LIBDL := + NO_UNDEF_CHECK = 1 # OS X else ifeq ($(platform), osx) TARGET := $(TARGET_NAME)_libretro.dylib fpic := -fPIC - SHARED := -dynamiclib - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - fpic += -mmacosx-version-min=10.5 - endif + fpic += -mmacosx-version-min=10.1 # iOS -else ifeq ($(platform), ios) +else ifneq (,$(findstring ios,$(platform))) ARCH := arm + USE_DYNAREC ?= 1 TARGET := $(TARGET_NAME)_libretro_ios.dylib +ifeq ($(USE_DYNAREC),0) + # Override + TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib +endif fpic := -fPIC - SHARED := -dynamiclib ifeq ($(IOSSDK),) - IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path) + IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path) endif CC = clang -arch armv7 -isysroot $(IOSSDK) @@ -58,16 +70,18 @@ else ifeq ($(platform), ios) ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon HAVE_NEON = 1 BUILTIN_GPU = neon - USE_DYNAREC = 1 CFLAGS += -DIOS - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - CC += -miphoneos-version-min=5.0 - CXX += -miphoneos-version-min=5.0 - CC_AS += -miphoneos-version-min=5.0 - CFLAGS += -miphoneos-version-min=5.0 - endif +ifeq ($(platform),ios9) + CC += -miphoneos-version-min=8.0 + CXX += -miphoneos-version-min=8.0 + CC_AS += -miphoneos-version-min=8.0 + CFLAGS += -miphoneos-version-min=8.0 +else + CC += -miphoneos-version-min=5.0 + CXX += -miphoneos-version-min=5.0 + CC_AS += -miphoneos-version-min=5.0 + CFLAGS += -miphoneos-version-min=5.0 +endif # PS3 else ifeq ($(platform), ps3) @@ -97,6 +111,48 @@ else ifeq ($(platform), psp1) AR = psp-ar$(EXE_EXT) CFLAGS += -DPSP -G0 +# Vita +else ifeq ($(platform), vita) + TARGET := $(TARGET_NAME)_libretro_vita.a + CC = arm-vita-eabi-gcc$(EXE_EXT) + AR = arm-vita-eabi-ar$(EXE_EXT) + CFLAGS += -DVITA + CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm + CFLAGS += -I$(VITASDK)/include -Ifrontend/vita + CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB + ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon + +# CFLAGS += -U__ARM_NEON__ + HAVE_NEON = 1 + BUILTIN_GPU = neon + + USE_DYNAREC = 1 + DRC_CACHE_BASE = 0 + + ARCH = arm + STATIC_LINKING = 1 + +# CTR(3DS) +else ifeq ($(platform), ctr) + TARGET := $(TARGET_NAME)_libretro_ctr.a + CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT) + CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT) + AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT) + CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET + CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft + CFLAGS += -Wall -mword-relocations + CFLAGS += -fomit-frame-pointer -ffast-math + CFLAGS += -Ifrontend/3ds + CFLAGS += -Werror=implicit-function-declaration + +# CFLAGS += -DPCSX +# BUILTIN_GPU = unai + USE_DYNAREC = 1 + DRC_CACHE_BASE = 1 + ARCH = arm + + STATIC_LINKING = 1 + # Xbox 360 else ifeq ($(platform), xenon) TARGET := $(TARGET_NAME)_libretro_xenon360.a @@ -121,6 +177,7 @@ else ifeq ($(platform), wii) # QNX else ifeq ($(platform), qnx) TARGET := $(TARGET_NAME)_libretro_qnx.so + fpic := -fPIC CC = qcc -Vgcc_ntoarmv7le CC_AS = $(CC) HAVE_NEON = 1 @@ -130,11 +187,36 @@ else ifeq ($(platform), qnx) ARCH = arm CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp + MAIN_LDLIBS += -lsocket + LIBPTHREAD := + LIBDL := + +#Raspberry Pi 2 +else ifeq ($(platform), rpi2) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 + +#Raspberry Pi 3 +else ifeq ($(platform), rpi3) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 # ARM else ifneq (,$(findstring armv,$(platform))) TARGET := $(TARGET_NAME)_libretro.so - SHARED := -shared -Wl,--no-undefined + fpic := -fPIC DRC_CACHE_BASE = 0 ifneq (,$(findstring cortexa8,$(platform))) CFLAGS += -marm -mcpu=cortex-a8 @@ -163,24 +245,28 @@ else ifneq (,$(findstring armv,$(platform))) # Windows else TARGET := $(TARGET_NAME)_libretro.dll - CC = gcc - fpic := -fPIC - LD_FLAGS := -fPIC - SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T - CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__ + MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s + CFLAGS += -D__WIN32__ MMAP_WIN32=1 -endif - -CFLAGS += -fPIC -ifeq ($(platform),win) MAIN_LDLIBS += -lws2_32 -else ifneq ($(platform),qnx) - LDLIBS += -lpthread - MAIN_LDLIBS += -ldl + LIBPTHREAD := + LIBDL := endif + +CFLAGS += $(fpic) MAIN_LDFLAGS += -shared -MAIN_LDLIBS += -lm -lz -EXTRA_LDFLAGS = +MAIN_LDLIBS += $(LIBPTHREAD) $(LIBDL) $(LIBZ) + +# try to autodetect stuff for the lazy +ifndef ARCH +ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}') +endif +ifndef HAVE_NEON +HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0) +endif +ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU) +MAIN_LDFLAGS += -Wl,--no-undefined +endif # try to autodetect stuff for the lazy ifndef ARCH @@ -200,6 +286,14 @@ SOUND_DRIVERS = libretro PLUGINS = NO_CONFIG_MAK = yes +libretro_all: all +ifeq ($(platform),ios) +ifeq ($(USE_DYNAREC),1) + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) +endif +endif + include Makefile # no special AS needed for gpu_neon diff --git a/blackberry_qnx/.cproject b/blackberry_qnx/.cproject deleted file mode 100644 index 565f4a9..0000000 --- a/blackberry_qnx/.cproject +++ /dev/null @@ -1,142 +0,0 @@ -<?xml version="1.0" encoding="UTF-8" standalone="no"?> -<?fileVersion 4.0.0?> - -<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage"> - <storageModule moduleId="org.eclipse.cdt.core.settings"> - <cconfiguration id="com.qnx.qcc.toolChain.1762498539"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1815033502"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1271074456"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/> - <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/> - </storageModule> - <storageModule moduleId="scannerConfiguration"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - </storageModule> - <storageModule moduleId="refreshScope" versionNumber="1"> - <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/> - </storageModule> -</cproject> diff --git a/blackberry_qnx/.project b/blackberry_qnx/.project deleted file mode 100644 index c8e1e20..0000000 --- a/blackberry_qnx/.project +++ /dev/null @@ -1,84 +0,0 @@ -<?xml version="1.0" encoding="UTF-8"?> -<projectDescription> - <name>pcsx_rearmed</name> - <comment></comment> - <projects> - </projects> - <buildSpec> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name> - <triggers>clean,full,incremental,</triggers> - <arguments> - <dictionary> - <key>?name?</key> - <value></value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.append_environment</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.autoBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildArguments</key> - <value>-C .. -f Makefile.libretro platform=qnx</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildCommand</key> - <value>make</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.cleanBuildTarget</key> - <value>clean</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.contents</key> - <value>org.eclipse.cdt.make.core.activeConfigSettings</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableAutoBuild</key> - <value>false</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableCleanBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableFullBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.fullBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.stopOnError</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key> - <value>false</value> - </dictionary> - </arguments> - </buildCommand> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name> - <triggers>full,incremental,</triggers> - <arguments> - </arguments> - </buildCommand> - <buildCommand> - <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name> - <arguments> - </arguments> - </buildCommand> - </buildSpec> - <natures> - <nature>org.eclipse.cdt.core.cnature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature> - <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature> - </natures> -</projectDescription> diff --git a/frontend/3ds/3ds_utils.h b/frontend/3ds/3ds_utils.h new file mode 100644 index 0000000..3d50a66 --- /dev/null +++ b/frontend/3ds/3ds_utils.h @@ -0,0 +1,66 @@ +#ifndef _3DS_UTILS_H +#define _3DS_UTILS_H + +#include <stdio.h> + +#define MEMOP_PROT 6 +#define MEMOP_MAP 4 +#define MEMOP_UNMAP 5 + +void* linearMemAlign(size_t size, size_t alignment); +void linearFree(void* mem); + +int32_t svcDuplicateHandle(uint32_t* out, uint32_t original); +int32_t svcCloseHandle(uint32_t handle); +int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); +int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); + +int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id); +int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds); +void svcExitThread(void) __attribute__((noreturn)); + +int32_t svcBackdoor(int32_t (*callback)(void)); + +#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0) + +void wait_for_input(void); + +extern __attribute__((weak)) int __ctr_svchax; + +typedef int32_t (*ctr_callback_type)(void); + +static inline void ctr_invalidate_ICache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c5, 0\n\t"); +} + +static inline void ctr_flush_DCache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c10, 0\n\t"); +} + +static inline void ctr_invalidate_ICache(void) +{ + svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel); +} + +static inline void ctr_flush_DCache(void) +{ + svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel); +} + + +static inline void ctr_flush_invalidate_cache(void) +{ + ctr_flush_DCache(); + ctr_invalidate_ICache(); +} + + +#endif // _3DS_UTILS_H diff --git a/frontend/3ds/pthread.h b/frontend/3ds/pthread.h new file mode 100644 index 0000000..2c2bf6b --- /dev/null +++ b/frontend/3ds/pthread.h @@ -0,0 +1,56 @@ + +#ifndef _3DS_PTHREAD_WRAP__ +#define _3DS_PTHREAD_WRAP__ + +#include <stdlib.h> +#include <string.h> +#include <stdio.h> + +#include "3ds_utils.h" + +#define CTR_PTHREAD_STACK_SIZE 0x10000 + +typedef struct +{ + int32_t handle; + uint32_t* stack; +}pthread_t; +typedef int pthread_attr_t; + +static inline int pthread_create(pthread_t *thread, + const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg) +{ + + thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8); + + svcCreateThread(&thread->handle, start_routine, arg, + (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE), + 0x25, 1); + + return 1; +} + + +static inline int pthread_join(pthread_t thread, void **retval) +{ + (void)retval; + + if(svcWaitSynchronization(thread.handle, INT64_MAX)) + return -1; + + linearFree(thread.stack); + + return 0; +} + + +static inline void pthread_exit(void *retval) +{ + (void)retval; + + svcExitThread(); +} + + +#endif //_3DS_PTHREAD_WRAP__ + diff --git a/frontend/3ds/sys/mman.h b/frontend/3ds/sys/mman.h new file mode 100644 index 0000000..e295b89 --- /dev/null +++ b/frontend/3ds/sys/mman.h @@ -0,0 +1,107 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdlib.h> +#include <stdio.h> +#include <stdint.h> +#include <malloc.h> + +#include "3ds_utils.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_FIXED 0x10 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static void* dynarec_cache = NULL; +static void* dynarec_cache_mapping = NULL; + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)fd; + (void)offset; + + void* addr_out; + + if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) && + (flags == (MAP_FIXED | MAP_PRIVATE | MAP_ANONYMOUS))) + { + if(__ctr_svchax) + { + /* this hack works only for pcsx_rearmed */ + uint32_t currentHandle; + + if(!dynarec_cache) + dynarec_cache = memalign(0x1000, len); + + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, dynarec_cache, + len, MEMOP_MAP, prot); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = addr; + return addr; + } + else + { + printf("tried to mmap RWX pages without svcControlProcessMemory access !\n"); + return MAP_FAILED; + } + + } + + addr_out = malloc(len); + if(!addr_out) + return MAP_FAILED; + + return addr_out; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + if(__ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, NULL, + len, MEMOP_PROT, prot); + svcCloseHandle(currentHandle); + return 0; + } + + printf("mprotect called without svcControlProcessMemory access !\n"); + return -1; +} + +static inline int munmap(void *addr, size_t len) +{ + if((addr == dynarec_cache_mapping) && __ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, + dynarec_cache, dynarec_cache_mapping, + len, MEMOP_UNMAP, 0b111); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = NULL; + + } + else + free(addr); + + return 0; +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H + diff --git a/frontend/3ds/zconf.h b/frontend/3ds/zconf.h new file mode 100644 index 0000000..996fff2 --- /dev/null +++ b/frontend/3ds/zconf.h @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/frontend/3ds/zlib.h b/frontend/3ds/zlib.h new file mode 100644 index 0000000..3e0c767 --- /dev/null +++ b/frontend/3ds/zlib.h @@ -0,0 +1,1768 @@ +/* zlib.h -- interface of the 'zlib' general purpose compression library + version 1.2.8, April 28th, 2013 + + Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + + + The data format used by the zlib library is described by RFCs (Request for + Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950 + (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format). +*/ + +#ifndef ZLIB_H +#define ZLIB_H + +#include "zconf.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#define ZLIB_VERSION "1.2.8" +#define ZLIB_VERNUM 0x1280 +#define ZLIB_VER_MAJOR 1 +#define ZLIB_VER_MINOR 2 +#define ZLIB_VER_REVISION 8 +#define ZLIB_VER_SUBREVISION 0 + +/* + The 'zlib' compression library provides in-memory compression and + decompression functions, including integrity checks of the uncompressed data. + This version of the library supports only one compression method (deflation) + but other algorithms will be added later and will have the same stream + interface. + + Compression can be done in a single step if the buffers are large enough, + or can be done by repeated calls of the compression function. In the latter + case, the application must provide more input and/or consume the output + (providing more output space) before each call. + + The compressed data format used by default by the in-memory functions is + the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped + around a deflate stream, which is itself documented in RFC 1951. + + The library also supports reading and writing files in gzip (.gz) format + with an interface similar to that of stdio using the functions that start + with "gz". The gzip format is different from the zlib format. gzip is a + gzip wrapper, documented in RFC 1952, wrapped around a deflate stream. + + This library can optionally read and write gzip streams in memory as well. + + The zlib format was designed to be compact and fast for use in memory + and on communications channels. The gzip format was designed for single- + file compression on file systems, has a larger header than zlib to maintain + directory information, and uses a different, slower check method than zlib. + + The library does not install any signal handler. The decoder checks + the consistency of the compressed data, so the library should never crash + even in case of corrupted input. +*/ + +typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size)); +typedef void (*free_func) OF((voidpf opaque, voidpf address)); + +struct internal_state; + +typedef struct z_stream_s { + z_const Bytef *next_in; /* next input byte */ + uInt avail_in; /* number of bytes available at next_in */ + uLong total_in; /* total number of input bytes read so far */ + + Bytef *next_out; /* next output byte should be put there */ + uInt avail_out; /* remaining free space at next_out */ + uLong total_out; /* total number of bytes output so far */ + + z_const char *msg; /* last error message, NULL if no error */ + struct internal_state FAR *state; /* not visible by applications */ + + alloc_func zalloc; /* used to allocate the internal state */ + free_func zfree; /* used to free the internal state */ + voidpf opaque; /* private data object passed to zalloc and zfree */ + + int data_type; /* best guess about the data type: binary or text */ + uLong adler; /* adler32 value of the uncompressed data */ + uLong reserved; /* reserved for future use */ +} z_stream; + +typedef z_stream FAR *z_streamp; + +/* + gzip header information passed to and from zlib routines. See RFC 1952 + for more details on the meanings of these fields. +*/ +typedef struct gz_header_s { + int text; /* true if compressed data believed to be text */ + uLong time; /* modification time */ + int xflags; /* extra flags (not used when writing a gzip file) */ + int os; /* operating system */ + Bytef *extra; /* pointer to extra field or Z_NULL if none */ + uInt extra_len; /* extra field length (valid if extra != Z_NULL) */ + uInt extra_max; /* space at extra (only when reading header) */ + Bytef *name; /* pointer to zero-terminated file name or Z_NULL */ + uInt name_max; /* space at name (only when reading header) */ + Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */ + uInt comm_max; /* space at comment (only when reading header) */ + int hcrc; /* true if there was or will be a header crc */ + int done; /* true when done reading gzip header (not used + when writing a gzip file) */ +} gz_header; + +typedef gz_header FAR *gz_headerp; + +/* + The application must update next_in and avail_in when avail_in has dropped + to zero. It must update next_out and avail_out when avail_out has dropped + to zero. The application must initialize zalloc, zfree and opaque before + calling the init function. All other fields are set by the compression + library and must not be updated by the application. + + The opaque value provided by the application will be passed as the first + parameter for calls of zalloc and zfree. This can be useful for custom + memory management. The compression library attaches no meaning to the + opaque value. + + zalloc must return Z_NULL if there is not enough memory for the object. + If zlib is used in a multi-threaded application, zalloc and zfree must be + thread safe. + + On 16-bit systems, the functions zalloc and zfree must be able to allocate + exactly 65536 bytes, but will not be required to allocate more than this if + the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers + returned by zalloc for objects of exactly 65536 bytes *must* have their + offset normalized to zero. The default allocation function provided by this + library ensures this (see zutil.c). To reduce memory requirements and avoid + any allocation of 64K objects, at the expense of compression ratio, compile + the library with -DMAX_WBITS=14 (see zconf.h). + + The fields total_in and total_out can be used for statistics or progress + reports. After compression, total_in holds the total size of the + uncompressed data and may be saved for use in the decompressor (particularly + if the decompressor wants to decompress everything in a single step). +*/ + + /* constants */ + +#define Z_NO_FLUSH 0 +#define Z_PARTIAL_FLUSH 1 +#define Z_SYNC_FLUSH 2 +#define Z_FULL_FLUSH 3 +#define Z_FINISH 4 +#define Z_BLOCK 5 +#define Z_TREES 6 +/* Allowed flush values; see deflate() and inflate() below for details */ + +#define Z_OK 0 +#define Z_STREAM_END 1 +#define Z_NEED_DICT 2 +#define Z_ERRNO (-1) +#define Z_STREAM_ERROR (-2) +#define Z_DATA_ERROR (-3) +#define Z_MEM_ERROR (-4) +#define Z_BUF_ERROR (-5) +#define Z_VERSION_ERROR (-6) +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ + +#define Z_NO_COMPRESSION 0 +#define Z_BEST_SPEED 1 +#define Z_BEST_COMPRESSION 9 +#define Z_DEFAULT_COMPRESSION (-1) +/* compression levels */ + +#define Z_FILTERED 1 +#define Z_HUFFMAN_ONLY 2 +#define Z_RLE 3 +#define Z_FIXED 4 +#define Z_DEFAULT_STRATEGY 0 +/* compression strategy; see deflateInit2() below for details */ + +#define Z_BINARY 0 +#define Z_TEXT 1 +#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */ +#define Z_UNKNOWN 2 +/* Possible values of the data_type field (though see inflate()) */ + +#define Z_DEFLATED 8 +/* The deflate compression method (the only one supported in this version) */ + +#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */ + +#define zlib_version zlibVersion() +/* for compatibility with versions < 1.0.2 */ + + + /* basic functions */ + +ZEXTERN const char * ZEXPORT zlibVersion OF((void)); +/* The application can compare zlibVersion and ZLIB_VERSION for consistency. + If the first character differs, the library code actually used is not + compatible with the zlib.h header file used by the application. This check + is automatically made by deflateInit and inflateInit. + */ + +/* +ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level)); + + Initializes the internal stream state for compression. The fields + zalloc, zfree and opaque must be initialized before by the caller. If + zalloc and zfree are set to Z_NULL, deflateInit updates them to use default + allocation functions. + + The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9: + 1 gives best speed, 9 gives best compression, 0 gives no compression at all + (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION + requests a default compromise between speed and compression (currently + equivalent to level 6). + + deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if level is not a valid compression level, or + Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible + with the version assumed by the caller (ZLIB_VERSION). msg is set to null + if there is no error message. deflateInit does not perform any compression: + this will be done by deflate(). +*/ + + +ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush)); +/* + deflate compresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. deflate performs one or both of the + following actions: + + - Compress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in and avail_in are updated and + processing will resume at this point for the next call of deflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. This action is forced if the parameter flush is non zero. + Forcing flush frequently degrades the compression ratio, so this parameter + should be set only when necessary (in interactive applications). Some + output may be provided even if flush is not set. + + Before the call of deflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating avail_in or avail_out accordingly; avail_out should + never be zero before the call. The application can consume the compressed + output when it wants, for example when the output buffer is full (avail_out + == 0), or after each call of deflate(). If deflate returns Z_OK and with + zero avail_out, it must be called again after making room in the output + buffer because there might be more output pending. + + Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to + decide how much data to accumulate before producing output, in order to + maximize compression. + + If the parameter flush is set to Z_SYNC_FLUSH, all pending output is + flushed to the output buffer and the output is aligned on a byte boundary, so + that the decompressor can get all input data available so far. (In + particular avail_in is zero after the call if enough output space has been + provided before the call.) Flushing may degrade compression for some + compression algorithms and so it should be used only when necessary. This + completes the current deflate block and follows it with an empty stored block + that is three bits plus filler bits to the next byte, followed by four bytes + (00 00 ff ff). + + If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the + output buffer, but the output is not aligned to a byte boundary. All of the + input data so far will be available to the decompressor, as for Z_SYNC_FLUSH. + This completes the current deflate block and follows it with an empty fixed + codes block that is 10 bits long. This assures that enough bytes are output + in order for the decompressor to finish the block before the empty fixed code + block. + + If flush is set to Z_BLOCK, a deflate block is completed and emitted, as + for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to + seven bits of the current block are held to be written as the next byte after + the next deflate block is completed. In this case, the decompressor may not + be provided enough bits at this point in order to complete decompression of + the data provided so far to the compressor. It may need to wait for the next + block to be emitted. This is for advanced applications that need to control + the emission of deflate blocks. + + If flush is set to Z_FULL_FLUSH, all output is flushed as with + Z_SYNC_FLUSH, and the compression state is reset so that decompression can + restart from this point if previous compressed data has been damaged or if + random access is desired. Using Z_FULL_FLUSH too often can seriously degrade + compression. + + If deflate returns with avail_out == 0, this function must be called again + with the same value of the flush parameter and more output space (updated + avail_out), until the flush is complete (deflate returns with non-zero + avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that + avail_out is greater than six to avoid repeated flush markers due to + avail_out == 0 on return. + + If the parameter flush is set to Z_FINISH, pending input is processed, + pending output is flushed and deflate returns with Z_STREAM_END if there was + enough output space; if deflate returns with Z_OK, this function must be + called again with Z_FINISH and more output space (updated avail_out) but no + more input data, until it returns with Z_STREAM_END or an error. After + deflate has returned Z_STREAM_END, the only possible operations on the stream + are deflateReset or deflateEnd. + + Z_FINISH can be used immediately after deflateInit if all the compression + is to be done in a single step. In this case, avail_out must be at least the + value returned by deflateBound (see below). Then deflate is guaranteed to + return Z_STREAM_END. If not enough output space is provided, deflate will + not return Z_STREAM_END, and it must be called again as described above. + + deflate() sets strm->adler to the adler32 checksum of all input read + so far (that is, total_in bytes). + + deflate() may update strm->data_type if it can make a good guess about + the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered + binary. This field is only for information purposes and does not affect the + compression algorithm in any manner. + + deflate() returns Z_OK if some progress has been made (more input + processed or more output produced), Z_STREAM_END if all input has been + consumed and all output has been produced (only when flush is set to + Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example + if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible + (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not + fatal, and deflate() can be called again with more input and more output + space to continue compressing. +*/ + + +ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the + stream state was inconsistent, Z_DATA_ERROR if the stream was freed + prematurely (some input or output was discarded). In the error case, msg + may be set but then points to a static string (which must not be + deallocated). +*/ + + +/* +ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm)); + + Initializes the internal stream state for decompression. The fields + next_in, avail_in, zalloc, zfree and opaque must be initialized before by + the caller. If next_in is not Z_NULL and avail_in is large enough (the + exact value depends on the compression method), inflateInit determines the + compression method from the zlib header and allocates all data structures + accordingly; otherwise the allocation will be deferred to the first call of + inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to + use default allocation functions. + + inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit() does not process any header information -- that is deferred + until inflate() is called. +*/ + + +ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush)); +/* + inflate decompresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. inflate performs one or both of the + following actions: + + - Decompress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in is updated and processing will + resume at this point for the next call of inflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. inflate() provides as much output as possible, until there is + no more input data or no more space in the output buffer (see below about + the flush parameter). + + Before the call of inflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating the next_* and avail_* values accordingly. The + application can consume the uncompressed output when it wants, for example + when the output buffer is full (avail_out == 0), or after each call of + inflate(). If inflate returns Z_OK and with zero avail_out, it must be + called again after making room in the output buffer because there might be + more output pending. + + The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH, + Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much + output as possible to the output buffer. Z_BLOCK requests that inflate() + stop if and when it gets to the next deflate block boundary. When decoding + the zlib or gzip format, this will cause inflate() to return immediately + after the header and before the first block. When doing a raw inflate, + inflate() will go ahead and process the first block, and will return when it + gets to the end of that block, or when it runs out of data. + + The Z_BLOCK option assists in appending to or combining deflate streams. + Also to assist in this, on return inflate() will set strm->data_type to the + number of unused bits in the last byte taken from strm->next_in, plus 64 if + inflate() is currently decoding the last block in the deflate stream, plus + 128 if inflate() returned immediately after decoding an end-of-block code or + decoding the complete header up to just before the first byte of the deflate + stream. The end-of-block will not be indicated until all of the uncompressed + data from that block has been written to strm->next_out. The number of + unused bits may in general be greater than seven, except when bit 7 of + data_type is set, in which case the number of unused bits will be less than + eight. data_type is set as noted here every time inflate() returns for all + flush options, and so can be used to determine the amount of currently + consumed input in bits. + + The Z_TREES option behaves as Z_BLOCK does, but it also returns when the + end of each deflate block header is reached, before any actual data in that + block is decoded. This allows the caller to determine the length of the + deflate block header for later use in random access within a deflate block. + 256 is added to the value of strm->data_type when inflate() returns + immediately after reaching the end of the deflate block header. + + inflate() should normally be called until it returns Z_STREAM_END or an + error. However if all decompression is to be performed in a single step (a + single call of inflate), the parameter flush should be set to Z_FINISH. In + this case all pending input is processed and all pending output is flushed; + avail_out must be large enough to hold all of the uncompressed data for the + operation to complete. (The size of the uncompressed data may have been + saved by the compressor for this purpose.) The use of Z_FINISH is not + required to perform an inflation in one step. However it may be used to + inform inflate that a faster approach can be used for the single inflate() + call. Z_FINISH also informs inflate to not maintain a sliding window if the + stream completes, which reduces inflate's memory footprint. If the stream + does not complete, either because not all of the stream is provided or not + enough output space is provided, then a sliding window will be allocated and + inflate() can be called again to continue the operation as if Z_NO_FLUSH had + been used. + + In this implementation, inflate() always flushes as much output as + possible to the output buffer, and always uses the faster approach on the + first call. So the effects of the flush parameter in this implementation are + on the return value of inflate() as noted below, when inflate() returns early + when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of + memory for a sliding window when Z_FINISH is used. + + If a preset dictionary is needed after this call (see inflateSetDictionary + below), inflate sets strm->adler to the Adler-32 checksum of the dictionary + chosen by the compressor and returns Z_NEED_DICT; otherwise it sets + strm->adler to the Adler-32 checksum of all output produced so far (that is, + total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described + below. At the end of the stream, inflate() checks that its computed adler32 + checksum is equal to that saved by the compressor and returns Z_STREAM_END + only if the checksum is correct. + + inflate() can decompress and check either zlib-wrapped or gzip-wrapped + deflate data. The header type is detected automatically, if requested when + initializing with inflateInit2(). Any information contained in the gzip + header is not retained, so applications that need that information should + instead use raw inflate, see inflateInit2() below, or inflateBack() and + perform their own processing of the gzip header and trailer. When processing + gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output + producted so far. The CRC-32 is checked against the gzip trailer. + + inflate() returns Z_OK if some progress has been made (more input processed + or more output produced), Z_STREAM_END if the end of the compressed data has + been reached and all uncompressed output has been produced, Z_NEED_DICT if a + preset dictionary is needed at this point, Z_DATA_ERROR if the input data was + corrupted (input stream not conforming to the zlib format or incorrect check + value), Z_STREAM_ERROR if the stream structure was inconsistent (for example + next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory, + Z_BUF_ERROR if no progress is possible or if there was not enough room in the + output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and + inflate() can be called again with more input and more output space to + continue decompressing. If Z_DATA_ERROR is returned, the application may + then call inflateSync() to look for a good compression block if a partial + recovery of the data is desired. +*/ + + +ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state + was inconsistent. In the error case, msg may be set but then points to a + static string (which must not be deallocated). +*/ + + + /* Advanced functions */ + +/* + The following functions are needed only in some special applications. +*/ + +/* +ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm, + int level, + int method, + int windowBits, + int memLevel, + int strategy)); + + This is another version of deflateInit with more compression options. The + fields next_in, zalloc, zfree and opaque must be initialized before by the + caller. + + The method parameter is the compression method. It must be Z_DEFLATED in + this version of the library. + + The windowBits parameter is the base two logarithm of the window size + (the size of the history buffer). It should be in the range 8..15 for this + version of the library. Larger values of this parameter result in better + compression at the expense of memory usage. The default value is 15 if + deflateInit is used instead. + + windowBits can also be -8..-15 for raw deflate. In this case, -windowBits + determines the window size. deflate() will then generate raw deflate data + with no zlib header or trailer, and will not compute an adler32 check value. + + windowBits can also be greater than 15 for optional gzip encoding. Add + 16 to windowBits to write a simple gzip header and trailer around the + compressed data instead of a zlib wrapper. The gzip header will have no + file name, no extra data, no comment, no modification time (set to zero), no + header crc, and the operating system will be set to 255 (unknown). If a + gzip stream is being written, strm->adler is a crc32 instead of an adler32. + + The memLevel parameter specifies how much memory should be allocated + for the internal compression state. memLevel=1 uses minimum memory but is + slow and reduces compression ratio; memLevel=9 uses maximum memory for + optimal speed. The default value is 8. See zconf.h for total memory usage + as a function of windowBits and memLevel. + + The strategy parameter is used to tune the compression algorithm. Use the + value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a + filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no + string match), or Z_RLE to limit match distances to one (run-length + encoding). Filtered data consists mostly of small values with a somewhat + random distribution. In this case, the compression algorithm is tuned to + compress them better. The effect of Z_FILTERED is to force more Huffman + coding and less string matching; it is somewhat intermediate between + Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as + fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The + strategy parameter only affects the compression ratio but not the + correctness of the compressed output even if it is not set appropriately. + Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler + decoder for special applications. + + deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid + method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is + incompatible with the version assumed by the caller (ZLIB_VERSION). msg is + set to null if there is no error message. deflateInit2 does not perform any + compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the compression dictionary from the given byte sequence + without producing any compressed output. When using the zlib format, this + function must be called immediately after deflateInit, deflateInit2 or + deflateReset, and before any call of deflate. When doing raw deflate, this + function must be called either before any call of deflate, or immediately + after the completion of a deflate block, i.e. after all input has been + consumed and all output has been delivered when using any of the flush + options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The + compressor and decompressor must use exactly the same dictionary (see + inflateSetDictionary). + + The dictionary should consist of strings (byte sequences) that are likely + to be encountered later in the data to be compressed, with the most commonly + used strings preferably put towards the end of the dictionary. Using a + dictionary is most useful when the data to be compressed is short and can be + predicted with good accuracy; the data can then be compressed better than + with the default empty dictionary. + + Depending on the size of the compression data structures selected by + deflateInit or deflateInit2, a part of the dictionary may in effect be + discarded, for example if the dictionary is larger than the window size + provided in deflateInit or deflateInit2. Thus the strings most likely to be + useful should be put at the end of the dictionary, not at the front. In + addition, the current implementation of deflate will use at most the window + size minus 262 bytes of the provided dictionary. + + Upon return of this function, strm->adler is set to the adler32 value + of the dictionary; the decompressor may later use this value to determine + which dictionary has been used by the compressor. (The adler32 value + applies to the whole dictionary even if only a subset of the dictionary is + actually used by the compressor.) If a raw deflate was requested, then the + adler32 value is not computed and strm->adler is not set. + + deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent (for example if deflate has already been called for this stream + or if not at a block boundary for raw deflate). deflateSetDictionary does + not perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when several compression strategies will be + tried, for example when there are several ways of pre-processing the input + data with a filter. The streams that will be discarded should then be freed + by calling deflateEnd. Note that deflateCopy duplicates the internal + compression state which can be quite large, so this strategy is slow and can + consume lots of memory. + + deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm)); +/* + This function is equivalent to deflateEnd followed by deflateInit, + but does not free and reallocate all the internal compression state. The + stream will keep the same compression level and any other attributes that + may have been set by deflateInit2. + + deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm, + int level, + int strategy)); +/* + Dynamically update the compression level and compression strategy. The + interpretation of level and strategy is as in deflateInit2. This can be + used to switch between compression and straight copy of the input data, or + to switch to a different kind of input data requiring a different strategy. + If the compression level is changed, the input available so far is + compressed with the old level (and may be flushed); the new level will take + effect only at the next call of deflate(). + + Before the call of deflateParams, the stream state must be set as for + a call of deflate(), since the currently available input may have to be + compressed and flushed. In particular, strm->avail_out must be non-zero. + + deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source + stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if + strm->avail_out was zero. +*/ + +ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm, + int good_length, + int max_lazy, + int nice_length, + int max_chain)); +/* + Fine tune deflate's internal compression parameters. This should only be + used by someone who understands the algorithm used by zlib's deflate for + searching for the best matching string, and even then only by the most + fanatic optimizer trying to squeeze out the last compressed bit for their + specific input data. Read the deflate.c source code for the meaning of the + max_lazy, good_length, nice_length, and max_chain parameters. + + deflateTune() can be called after deflateInit() or deflateInit2(), and + returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream. + */ + +ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm, + uLong sourceLen)); +/* + deflateBound() returns an upper bound on the compressed size after + deflation of sourceLen bytes. It must be called after deflateInit() or + deflateInit2(), and after deflateSetHeader(), if used. This would be used + to allocate an output buffer for deflation in a single pass, and so would be + called before deflate(). If that first deflate() call is provided the + sourceLen input bytes, an output buffer allocated to the size returned by + deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed + to return Z_STREAM_END. Note that it is possible for the compressed size to + be larger than the value returned by deflateBound() if flush options other + than Z_FINISH or Z_NO_FLUSH are used. +*/ + +ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm, + unsigned *pending, + int *bits)); +/* + deflatePending() returns the number of bytes and bits of output that have + been generated, but not yet provided in the available output. The bytes not + provided would be due to the available output space having being consumed. + The number of bits of output not provided are between 0 and 7, where they + await more bits to join them in order to fill out a full byte. If pending + or bits are Z_NULL, then those values are not set. + + deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. + */ + +ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + deflatePrime() inserts bits in the deflate output stream. The intent + is that this function is used to start off the deflate output with the bits + leftover from a previous deflate stream when appending to it. As such, this + function can only be used for raw deflate, and must be used before the first + deflate() call after a deflateInit2() or deflateReset(). bits must be less + than or equal to 16, and that many of the least significant bits of value + will be inserted in the output. + + deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough + room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm, + gz_headerp head)); +/* + deflateSetHeader() provides gzip header information for when a gzip + stream is requested by deflateInit2(). deflateSetHeader() may be called + after deflateInit2() or deflateReset() and before the first call of + deflate(). The text, time, os, extra field, name, and comment information + in the provided gz_header structure are written to the gzip header (xflag is + ignored -- the extra flags are set according to the compression level). The + caller must assure that, if not Z_NULL, name and comment are terminated with + a zero byte, and that if extra is not Z_NULL, that extra_len bytes are + available there. If hcrc is true, a gzip header crc is included. Note that + the current versions of the command-line version of gzip (up through version + 1.3.x) do not support header crc's, and will report that it is a "multi-part + gzip file" and give up. + + If deflateSetHeader is not used, the default gzip header has text false, + the time set to zero, and os set to 255, with no extra, name, or comment + fields. The gzip header is returned to the default state by deflateReset(). + + deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm, + int windowBits)); + + This is another version of inflateInit with an extra parameter. The + fields next_in, avail_in, zalloc, zfree and opaque must be initialized + before by the caller. + + The windowBits parameter is the base two logarithm of the maximum window + size (the size of the history buffer). It should be in the range 8..15 for + this version of the library. The default value is 15 if inflateInit is used + instead. windowBits must be greater than or equal to the windowBits value + provided to deflateInit2() while compressing, or it must be equal to 15 if + deflateInit2() was not used. If a compressed stream with a larger window + size is given as input, inflate() will return with the error code + Z_DATA_ERROR instead of trying to allocate a larger window. + + windowBits can also be zero to request that inflate use the window size in + the zlib header of the compressed stream. + + windowBits can also be -8..-15 for raw inflate. In this case, -windowBits + determines the window size. inflate() will then process raw deflate data, + not looking for a zlib or gzip header, not generating a check value, and not + looking for any check values for comparison at the end of the stream. This + is for use with other formats that use the deflate compressed data format + such as zip. Those formats provide their own check values. If a custom + format is developed using the raw deflate format for compressed data, it is + recommended that a check value such as an adler32 or a crc32 be applied to + the uncompressed data as is done in the zlib, gzip, and zip formats. For + most applications, the zlib format should be used as is. Note that comments + above on the use in deflateInit2() applies to the magnitude of windowBits. + + windowBits can also be greater than 15 for optional gzip decoding. Add + 32 to windowBits to enable zlib and gzip decoding with automatic header + detection, or add 16 to decode only the gzip format (the zlib format will + return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a + crc32 instead of an adler32. + + inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit2 does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit2() does not process any header information -- that is + deferred until inflate() is called. +*/ + +ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the decompression dictionary from the given uncompressed byte + sequence. This function must be called immediately after a call of inflate, + if that call returned Z_NEED_DICT. The dictionary chosen by the compressor + can be determined from the adler32 value returned by that call of inflate. + The compressor and decompressor must use exactly the same dictionary (see + deflateSetDictionary). For raw inflate, this function can be called at any + time to set the dictionary. If the provided dictionary is smaller than the + window and there is already data in the window, then the provided dictionary + will amend what's there. The application must insure that the dictionary + that was used for compression is provided. + + inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the + expected one (incorrect adler32 value). inflateSetDictionary does not + perform any decompression: this will be done by subsequent calls of + inflate(). +*/ + +ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm, + Bytef *dictionary, + uInt *dictLength)); +/* + Returns the sliding dictionary being maintained by inflate. dictLength is + set to the number of bytes in the dictionary, and that many bytes are copied + to dictionary. dictionary must have enough space, where 32768 bytes is + always enough. If inflateGetDictionary() is called with dictionary equal to + Z_NULL, then only the dictionary length is returned, and nothing is copied. + Similary, if dictLength is Z_NULL, then it is not set. + + inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the + stream state is inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm)); +/* + Skips invalid compressed data until a possible full flush point (see above + for the description of deflate with Z_FULL_FLUSH) can be found, or until all + available input is skipped. No output is provided. + + inflateSync searches for a 00 00 FF FF pattern in the compressed data. + All full flush points have this pattern, but not all occurrences of this + pattern are full flush points. + + inflateSync returns Z_OK if a possible full flush point has been found, + Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point + has been found, or Z_STREAM_ERROR if the stream structure was inconsistent. + In the success case, the application may save the current current value of + total_in which indicates where valid compressed data was found. In the + error case, the application may repeatedly call inflateSync, providing more + input each time, until success or end of the input data. +*/ + +ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when randomly accessing a large stream. The + first pass through the stream can periodically record the inflate state, + allowing restarting inflate at those points when randomly accessing the + stream. + + inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm)); +/* + This function is equivalent to inflateEnd followed by inflateInit, + but does not free and reallocate all the internal decompression state. The + stream will keep attributes that may have been set by inflateInit2. + + inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm, + int windowBits)); +/* + This function is the same as inflateReset, but it also permits changing + the wrap and window size requests. The windowBits parameter is interpreted + the same as it is for inflateInit2. + + inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL), or if + the windowBits parameter is invalid. +*/ + +ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + This function inserts bits in the inflate input stream. The intent is + that this function is used to start inflating at a bit position in the + middle of a byte. The provided bits will be used before any bytes are used + from next_in. This function should only be used with raw inflate, and + should be used before the first inflate() call after inflateInit2() or + inflateReset(). bits must be less than or equal to 16, and that many of the + least significant bits of value will be inserted in the input. + + If bits is negative, then the input stream bit buffer is emptied. Then + inflatePrime() can be called again to put bits in the buffer. This is used + to clear out bits leftover after feeding inflate a block description prior + to feeding inflate codes. + + inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm)); +/* + This function returns two values, one in the lower 16 bits of the return + value, and the other in the remaining upper bits, obtained by shifting the + return value down 16 bits. If the upper value is -1 and the lower value is + zero, then inflate() is currently decoding information outside of a block. + If the upper value is -1 and the lower value is non-zero, then inflate is in + the middle of a stored block, with the lower value equaling the number of + bytes from the input remaining to copy. If the upper value is not -1, then + it is the number of bits back from the current bit position in the input of + the code (literal or length/distance pair) currently being processed. In + that case the lower value is the number of bytes already emitted for that + code. + + A code is being processed if inflate is waiting for more input to complete + decoding of the code, or if it has completed decoding but is waiting for + more output space to write the literal or match data. + + inflateMark() is used to mark locations in the input data for random + access, which may be at bit positions, and to note those cases where the + output of a code may span boundaries of random access blocks. The current + location in the input stream can be determined from avail_in and data_type + as noted in the description for the Z_BLOCK flush parameter for inflate. + + inflateMark returns the value noted above or -1 << 16 if the provided + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm, + gz_headerp head)); +/* + inflateGetHeader() requests that gzip header information be stored in the + provided gz_header structure. inflateGetHeader() may be called after + inflateInit2() or inflateReset(), and before the first call of inflate(). + As inflate() processes the gzip stream, head->done is zero until the header + is completed, at which time head->done is set to one. If a zlib stream is + being decoded, then head->done is set to -1 to indicate that there will be + no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be + used to force inflate() to return immediately after header processing is + complete and before any actual data is decompressed. + + The text, time, xflags, and os fields are filled in with the gzip header + contents. hcrc is set to true if there is a header CRC. (The header CRC + was valid if done is set to one.) If extra is not Z_NULL, then extra_max + contains the maximum number of bytes to write to extra. Once done is true, + extra_len contains the actual extra field length, and extra contains the + extra field, or that field truncated if extra_max is less than extra_len. + If name is not Z_NULL, then up to name_max characters are written there, + terminated with a zero unless the length is greater than name_max. If + comment is not Z_NULL, then up to comm_max characters are written there, + terminated with a zero unless the length is greater than comm_max. When any + of extra, name, or comment are not Z_NULL and the respective field is not + present in the header, then that field is set to Z_NULL to signal its + absence. This allows the use of deflateSetHeader() with the returned + structure to duplicate the header. However if those fields are set to + allocated memory, then the application will need to save those pointers + elsewhere so that they can be eventually freed. + + If inflateGetHeader is not used, then the header information is simply + discarded. The header is always checked for validity, including the header + CRC if present. inflateReset() will reset the process to discard the header + information. The application would need to call inflateGetHeader() again to + retrieve the header from the next gzip stream. + + inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits, + unsigned char FAR *window)); + + Initialize the internal stream state for decompression using inflateBack() + calls. The fields zalloc, zfree and opaque in strm must be initialized + before the call. If zalloc and zfree are Z_NULL, then the default library- + derived memory allocation routines are used. windowBits is the base two + logarithm of the window size, in the range 8..15. window is a caller + supplied buffer of that size. Except for special applications where it is + assured that deflate was used with small window sizes, windowBits must be 15 + and a 32K byte window must be supplied to be able to decompress general + deflate streams. + + See inflateBack() for the usage of these routines. + + inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of + the parameters are invalid, Z_MEM_ERROR if the internal state could not be + allocated, or Z_VERSION_ERROR if the version of the library does not match + the version of the header file. +*/ + +typedef unsigned (*in_func) OF((void FAR *, + z_const unsigned char FAR * FAR *)); +typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned)); + +ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm, + in_func in, void FAR *in_desc, + out_func out, void FAR *out_desc)); +/* + inflateBack() does a raw inflate with a single call using a call-back + interface for input and output. This is potentially more efficient than + inflate() for file i/o applications, in that it avoids copying between the + output and the sliding window by simply making the window itself the output + buffer. inflate() can be faster on modern CPUs when used with large + buffers. inflateBack() trusts the application to not change the output + buffer passed by the output function, at least until inflateBack() returns. + + inflateBackInit() must be called first to allocate the internal state + and to initialize the state with the user-provided window buffer. + inflateBack() may then be used multiple times to inflate a complete, raw + deflate stream with each call. inflateBackEnd() is then called to free the + allocated state. + + A raw deflate stream is one with no zlib or gzip header or trailer. + This routine would normally be used in a utility that reads zip or gzip + files and writes out uncompressed files. The utility would decode the + header and process the trailer on its own, hence this routine expects only + the raw deflate stream to decompress. This is different from the normal + behavior of inflate(), which expects either a zlib or gzip header and + trailer around the deflate stream. + + inflateBack() uses two subroutines supplied by the caller that are then + called by inflateBack() for input and output. inflateBack() calls those + routines until it reads a complete deflate stream and writes out all of the + uncompressed data, or until it encounters an error. The function's + parameters and return types are defined above in the in_func and out_func + typedefs. inflateBack() will call in(in_desc, &buf) which should return the + number of bytes of provided input, and a pointer to that input in buf. If + there is no input available, in() must return zero--buf is ignored in that + case--and inflateBack() will return a buffer error. inflateBack() will call + out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out() + should return zero on success, or non-zero on failure. If out() returns + non-zero, inflateBack() will return with an error. Neither in() nor out() + are permitted to change the contents of the window provided to + inflateBackInit(), which is also the buffer that out() uses to write from. + The length written by out() will be at most the window size. Any non-zero + amount of input may be provided by in(). + + For convenience, inflateBack() can be provided input on the first call by + setting strm->next_in and strm->avail_in. If that input is exhausted, then + in() will be called. Therefore strm->next_in must be initialized before + calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called + immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in + must also be initialized, and then if strm->avail_in is not zero, input will + initially be taken from strm->next_in[0 .. strm->avail_in - 1]. + + The in_desc and out_desc parameters of inflateBack() is passed as the + first parameter of in() and out() respectively when they are called. These + descriptors can be optionally used to pass any information that the caller- + supplied in() and out() functions need to do their job. + + On return, inflateBack() will set strm->next_in and strm->avail_in to + pass back any unused input that was provided by the last in() call. The + return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR + if in() or out() returned an error, Z_DATA_ERROR if there was a format error + in the deflate stream (in which case strm->msg is set to indicate the nature + of the error), or Z_STREAM_ERROR if the stream was not properly initialized. + In the case of Z_BUF_ERROR, an input or output error can be distinguished + using strm->next_in which will be Z_NULL only if in() returned an error. If + strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning + non-zero. (in() will always be called before out(), so strm->next_in is + assured to be defined if out() returns non-zero.) Note that inflateBack() + cannot return Z_OK. +*/ + +ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm)); +/* + All memory allocated by inflateBackInit() is freed. + + inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream + state was inconsistent. +*/ + +ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void)); +/* Return flags indicating compile-time options. + + Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other: + 1.0: size of uInt + 3.2: size of uLong + 5.4: size of voidpf (pointer) + 7.6: size of z_off_t + + Compiler, assembler, and debug options: + 8: DEBUG + 9: ASMV or ASMINF -- use ASM code + 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention + 11: 0 (reserved) + + One-time table building (smaller code, but not thread-safe if true): + 12: BUILDFIXED -- build static block decoding tables when needed + 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed + 14,15: 0 (reserved) + + Library content (indicates missing functionality): + 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking + deflate code when not needed) + 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect + and decode gzip streams (to avoid linking crc code) + 18-19: 0 (reserved) + + Operation variations (changes in library functionality): + 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate + 21: FASTEST -- deflate algorithm with only one, lowest compression level + 22,23: 0 (reserved) + + The sprintf variant used by gzprintf (zero is best): + 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format + 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure! + 26: 0 = returns value, 1 = void -- 1 means inferred string length returned + + Remainder: + 27-31: 0 (reserved) + */ + +#ifndef Z_SOLO + + /* utility functions */ + +/* + The following utility functions are implemented on top of the basic + stream-oriented functions. To simplify the interface, some default options + are assumed (compression level and memory usage, standard memory allocation + functions). The source code of these utility functions can be modified if + you need special options. +*/ + +ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Compresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer. +*/ + +ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen, + int level)); +/* + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. +*/ + +ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen)); +/* + compressBound() returns an upper bound on the compressed size after + compress() or compress2() on sourceLen bytes. It would be used before a + compress() or compress2() call to allocate the destination buffer. +*/ + +ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be large enough to hold the entire + uncompressed data. (The size of the uncompressed data must have been saved + previously by the compressor and transmitted to the decompressor by some + mechanism outside the scope of this compression library.) Upon exit, destLen + is the actual size of the uncompressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In + the case where there is not enough room, uncompress() will fill the output + buffer with the uncompressed data up to that point. +*/ + + /* gzip file access functions */ + +/* + This library supports reading and writing files in gzip (.gz) format with + an interface similar to that of stdio, using the functions that start with + "gz". The gzip format is different from the zlib format. gzip is a gzip + wrapper, documented in RFC 1952, wrapped around a deflate stream. +*/ + +typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */ + +/* +ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode)); + + Opens a gzip (.gz) file for reading or writing. The mode parameter is as + in fopen ("rb" or "wb") but can also include a compression level ("wb9") or + a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only + compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F' + for fixed code compression as in "wb9F". (See the description of + deflateInit2 for more information about the strategy parameter.) 'T' will + request transparent writing or appending with no compression and not using + the gzip format. + + "a" can be used instead of "w" to request that the gzip stream that will + be written be appended to the file. "+" will result in an error, since + reading and writing to the same gzip file is not supported. The addition of + "x" when writing will create the file exclusively, which fails if the file + already exists. On systems that support it, the addition of "e" when + reading or writing will set the flag to close the file on an execve() call. + + These functions, as well as gzip, will read and decode a sequence of gzip + streams in a file. The append function of gzopen() can be used to create + such a file. (Also see gzflush() for another way to do this.) When + appending, gzopen does not test whether the file begins with a gzip stream, + nor does it look for the end of the gzip streams to begin appending. gzopen + will simply append a gzip stream to the existing file. + + gzopen can be used to read a file which is not in gzip format; in this + case gzread will directly read from the file without decompression. When + reading, this will be detected automatically by looking for the magic two- + byte gzip header. + + gzopen returns NULL if the file could not be opened, if there was + insufficient memory to allocate the gzFile state, or if an invalid mode was + specified (an 'r', 'w', or 'a' was not provided, or '+' was provided). + errno can be checked to determine if the reason gzopen failed was that the + file could not be opened. +*/ + +ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode)); +/* + gzdopen associates a gzFile with the file descriptor fd. File descriptors + are obtained from calls like open, dup, creat, pipe or fileno (if the file + has been previously opened with fopen). The mode parameter is as in gzopen. + + The next call of gzclose on the returned gzFile will also close the file + descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor + fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd, + mode);. The duplicated descriptor should be saved to avoid a leak, since + gzdopen does not close fd if it fails. If you are using fileno() to get the + file descriptor from a FILE *, then you will have to use dup() to avoid + double-close()ing the file descriptor. Both gzclose() and fclose() will + close the associated file descriptor, so they need to have different file + descriptors. + + gzdopen returns NULL if there was insufficient memory to allocate the + gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not + provided, or '+' was provided), or if fd is -1. The file descriptor is not + used until the next gz* read, write, seek, or close operation, so gzdopen + will not detect if fd is invalid (unless fd is -1). +*/ + +ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size)); +/* + Set the internal buffer size used by this library's functions. The + default buffer size is 8192 bytes. This function must be called after + gzopen() or gzdopen(), and before any other calls that read or write the + file. The buffer memory allocation is always deferred to the first read or + write. Two buffers are allocated, either both of the specified size when + writing, or one of the specified size and the other twice that size when + reading. A larger buffer size of, for example, 64K or 128K bytes will + noticeably increase the speed of decompression (reading). + + The new buffer size also affects the maximum length for gzprintf(). + + gzbuffer() returns 0 on success, or -1 on failure, such as being called + too late. +*/ + +ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy)); +/* + Dynamically update the compression level or strategy. See the description + of deflateInit2 for the meaning of these parameters. + + gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not + opened for writing. +*/ + +ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len)); +/* + Reads the given number of uncompressed bytes from the compressed file. If + the input file is not in gzip format, gzread copies the given number of + bytes into the buffer directly from the file. + + After reaching the end of a gzip stream in the input, gzread will continue + to read, looking for another gzip stream. Any number of gzip streams may be + concatenated in the input file, and will all be decompressed by gzread(). + If something other than a gzip stream is encountered after a gzip stream, + that remaining trailing garbage is ignored (and no error is returned). + + gzread can be used to read a gzip file that is being concurrently written. + Upon reaching the end of the input, gzread will return with the available + data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then + gzclearerr can be used to clear the end of file indicator in order to permit + gzread to be tried again. Z_OK indicates that a gzip stream was completed + on the last gzread. Z_BUF_ERROR indicates that the input file ended in the + middle of a gzip stream. Note that gzread does not return -1 in the event + of an incomplete gzip stream. This error is deferred until gzclose(), which + will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip + stream. Alternatively, gzerror can be used before gzclose to detect this + case. + + gzread returns the number of uncompressed bytes actually read, less than + len for end of file, or -1 for error. +*/ + +ZEXTERN int ZEXPORT gzwrite OF((gzFile file, + voidpc buf, unsigned len)); +/* + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of uncompressed bytes written or 0 in case of + error. +*/ + +ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...)); +/* + Converts, formats, and writes the arguments to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written, or 0 in case of error. The number of + uncompressed bytes written is limited to 8191, or one less than the buffer + size given to gzbuffer(). The caller should assure that this limit is not + exceeded. If it is exceeded, then gzprintf() will return an error (0) with + nothing written. In this case, there may also be a buffer overflow with + unpredictable consequences, which is possible only if zlib was compiled with + the insecure functions sprintf() or vsprintf() because the secure snprintf() + or vsnprintf() functions were not available. This can be determined using + zlibCompileFlags(). +*/ + +ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s)); +/* + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + + gzputs returns the number of characters written, or -1 in case of error. +*/ + +ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len)); +/* + Reads bytes from the compressed file until len-1 characters are read, or a + newline character is read and transferred to buf, or an end-of-file + condition is encountered. If any characters are read or if len == 1, the + string is terminated with a null character. If no characters are read due + to an end-of-file or len < 1, then the buffer is left untouched. + + gzgets returns buf which is a null-terminated string, or it returns NULL + for end-of-file or in case of error. If there was an error, the contents at + buf are indeterminate. +*/ + +ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c)); +/* + Writes c, converted to an unsigned char, into the compressed file. gzputc + returns the value that was written, or -1 in case of error. +*/ + +ZEXTERN int ZEXPORT gzgetc OF((gzFile file)); +/* + Reads one byte from the compressed file. gzgetc returns this byte or -1 + in case of end of file or error. This is implemented as a macro for speed. + As such, it does not do all of the checking the other functions do. I.e. + it does not check to see if file is NULL, nor whether the structure file + points to has been clobbered or not. +*/ + +ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file)); +/* + Push one character back onto the stream to be read as the first character + on the next read. At least one character of push-back is allowed. + gzungetc() returns the character pushed, or -1 on failure. gzungetc() will + fail if c is -1, and may fail if a character has been pushed but not read + yet. If gzungetc is used immediately after gzopen or gzdopen, at least the + output buffer size of pushed characters is allowed. (See gzbuffer above.) + The pushed character will be discarded if the stream is repositioned with + gzseek() or gzrewind(). +*/ + +ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush)); +/* + Flushes all pending output into the compressed file. The parameter flush + is as in the deflate() function. The return value is the zlib error number + (see function gzerror below). gzflush is only permitted when writing. + + If the flush parameter is Z_FINISH, the remaining data is written and the + gzip stream is completed in the output. If gzwrite() is called again, a new + gzip stream will be started in the output. gzread() is able to read such + concatented gzip streams. + + gzflush should be called only when strictly necessary because it will + degrade compression if called too often. +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file, + z_off_t offset, int whence)); + + Sets the starting position for the next gzread or gzwrite on the given + compressed file. The offset represents a number of bytes in the + uncompressed data stream. The whence parameter is defined as in lseek(2); + the value SEEK_END is not supported. + + If the file is opened for reading, this function is emulated but can be + extremely slow. If the file is opened for writing, only forward seeks are + supported; gzseek then compresses a sequence of zeroes up to the new + starting position. + + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error, in + particular if the file is opened for writing and the new starting position + would be before the current position. +*/ + +ZEXTERN int ZEXPORT gzrewind OF((gzFile file)); +/* + Rewinds the given file. This function is supported only for reading. + + gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file)); + + Returns the starting position for the next gzread or gzwrite on the given + compressed file. This position represents a number of bytes in the + uncompressed data stream, and is zero when starting, even if appending or + reading a gzip stream from the middle of a file using gzdopen(). + + gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file)); + + Returns the current offset in the file being read or written. This offset + includes the count of bytes that precede the gzip stream, for example when + appending or when using gzdopen() for reading. When reading, the offset + does not include as yet unused buffered input. This information can be used + for a progress indicator. On error, gzoffset() returns -1. +*/ + +ZEXTERN int ZEXPORT gzeof OF((gzFile file)); +/* + Returns true (1) if the end-of-file indicator has been set while reading, + false (0) otherwise. Note that the end-of-file indicator is set only if the + read tried to go past the end of the input, but came up short. Therefore, + just like feof(), gzeof() may return false even if there is no more data to + read, in the event that the last read request was for the exact number of + bytes remaining in the input file. This will happen if the input file size + is an exact multiple of the buffer size. + + If gzeof() returns true, then the read functions will return no more data, + unless the end-of-file indicator is reset by gzclearerr() and the input file + has grown since the previous end of file was detected. +*/ + +ZEXTERN int ZEXPORT gzdirect OF((gzFile file)); +/* + Returns true (1) if file is being copied directly while reading, or false + (0) if file is a gzip stream being decompressed. + + If the input file is empty, gzdirect() will return true, since the input + does not contain a gzip stream. + + If gzdirect() is used immediately after gzopen() or gzdopen() it will + cause buffers to be allocated to allow reading the file to determine if it + is a gzip file. Therefore if gzbuffer() is used, it should be called before + gzdirect(). + + When writing, gzdirect() returns true (1) if transparent writing was + requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note: + gzdirect() is not needed when writing. Transparent writing must be + explicitly requested, so the application already knows the answer. When + linking statically, using gzdirect() will include all of the zlib code for + gzip file reading and decompression, which may not be desired.) +*/ + +ZEXTERN int ZEXPORT gzclose OF((gzFile file)); +/* + Flushes all pending output if necessary, closes the compressed file and + deallocates the (de)compression state. Note that once file is closed, you + cannot call gzerror with file, since its structures have been deallocated. + gzclose must not be called more than once on the same file, just as free + must not be called more than once on the same allocation. + + gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a + file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the + last read ended in the middle of a gzip stream, or Z_OK on success. +*/ + +ZEXTERN int ZEXPORT gzclose_r OF((gzFile file)); +ZEXTERN int ZEXPORT gzclose_w OF((gzFile file)); +/* + Same as gzclose(), but gzclose_r() is only for use when reading, and + gzclose_w() is only for use when writing or appending. The advantage to + using these instead of gzclose() is that they avoid linking in zlib + compression or decompression code that is not used when only reading or only + writing respectively. If gzclose() is used, then both compression and + decompression code will be included the application when linking to a static + zlib library. +*/ + +ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum)); +/* + Returns the error message for the last error which occurred on the given + compressed file. errnum is set to zlib error number. If an error occurred + in the file system and not in the compression library, errnum is set to + Z_ERRNO and the application may consult errno to get the exact error code. + + The application must not modify the returned string. Future calls to + this function may invalidate the previously returned string. If file is + closed, then the string previously returned by gzerror will no longer be + available. + + gzerror() should be used to distinguish errors from end-of-file for those + functions above that do not distinguish those cases in their return values. +*/ + +ZEXTERN void ZEXPORT gzclearerr OF((gzFile file)); +/* + Clears the error and end-of-file flags for file. This is analogous to the + clearerr() function in stdio. This is useful for continuing to read a gzip + file that is being written concurrently. +*/ + +#endif /* !Z_SOLO */ + + /* checksum functions */ + +/* + These functions are not related to compression but are exported + anyway because they might be useful in applications using the compression + library. +*/ + +ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len)); +/* + Update a running Adler-32 checksum with the bytes buf[0..len-1] and + return the updated checksum. If buf is Z_NULL, this function returns the + required initial value for the checksum. + + An Adler-32 checksum is almost as reliable as a CRC32 but can be computed + much faster. + + Usage example: + + uLong adler = adler32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + adler = adler32(adler, buffer, length); + } + if (adler != original_adler) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2, + z_off_t len2)); + + Combine two Adler-32 checksums into one. For two sequences of bytes, seq1 + and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for + each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of + seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note + that the z_off_t type (like off_t) is a signed integer. If len2 is + negative, the result has no meaning or utility. +*/ + +ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len)); +/* + Update a running CRC-32 with the bytes buf[0..len-1] and return the + updated CRC-32. If buf is Z_NULL, this function returns the required + initial value for the crc. Pre- and post-conditioning (one's complement) is + performed within this function so it shouldn't be done by the application. + + Usage example: + + uLong crc = crc32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + crc = crc32(crc, buffer, length); + } + if (crc != original_crc) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2)); + + Combine two CRC-32 check values into one. For two sequences of bytes, + seq1 and seq2 with lengths len1 and len2, CRC-32 check values were + calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32 + check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and + len2. +*/ + + + /* various hacks, don't look :) */ + +/* deflateInit and inflateInit are macros to allow checking the zlib version + * and the compiler's view of z_stream: + */ +ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method, + int windowBits, int memLevel, + int strategy, const char *version, + int stream_size)); +ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits, + unsigned char FAR *window, + const char *version, + int stream_size)); +#define deflateInit(strm, level) \ + deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit(strm) \ + inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream)) +#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \ + deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\ + (strategy), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit2(strm, windowBits) \ + inflateInit2_((strm), (windowBits), ZLIB_VERSION, \ + (int)sizeof(z_stream)) +#define inflateBackInit(strm, windowBits, window) \ + inflateBackInit_((strm), (windowBits), (window), \ + ZLIB_VERSION, (int)sizeof(z_stream)) + +#ifndef Z_SOLO + +/* gzgetc() macro and its supporting function and exposed data structure. Note + * that the real internal state is much larger than the exposed structure. + * This abbreviated structure exposes just enough for the gzgetc() macro. The + * user should not mess with these exposed elements, since their names or + * behavior could change in the future, perhaps even capriciously. They can + * only be used by the gzgetc() macro. You have been warned. + */ +struct gzFile_s { + unsigned have; + unsigned char *next; + z_off64_t pos; +}; +ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +# define z_gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#else +# define gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#endif + +/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or + * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if + * both are true, the application gets the *64 functions, and the regular + * functions are changed to 64 bits) -- in case these are set on systems + * without large file support, _LFS64_LARGEFILE must also be true + */ +#ifdef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int)); + ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t)); +#endif + +#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64) +# ifdef Z_PREFIX_SET +# define z_gzopen z_gzopen64 +# define z_gzseek z_gzseek64 +# define z_gztell z_gztell64 +# define z_gzoffset z_gzoffset64 +# define z_adler32_combine z_adler32_combine64 +# define z_crc32_combine z_crc32_combine64 +# else +# define gzopen gzopen64 +# define gzseek gzseek64 +# define gztell gztell64 +# define gzoffset gzoffset64 +# define adler32_combine adler32_combine64 +# define crc32_combine crc32_combine64 +# endif +# ifndef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +# endif +#else + ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); +#endif + +#else /* Z_SOLO */ + + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); + +#endif /* !Z_SOLO */ + +/* hack for buggy compilers */ +#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL) + struct internal_state {int dummy;}; +#endif + +/* undocumented functions */ +ZEXTERN const char * ZEXPORT zError OF((int)); +ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp)); +ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void)); +ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int)); +ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp)); +ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp)); +#if defined(_WIN32) && !defined(Z_SOLO) +ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path, + const char *mode)); +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file, + const char *format, + va_list va)); +# endif +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* ZLIB_H */ diff --git a/frontend/libretro.c b/frontend/libretro.c index 940ff05..1e86509 100644 --- a/frontend/libretro.c +++ b/frontend/libretro.c @@ -33,6 +33,12 @@ #include "revision.h" #include "libretro.h" +#ifdef _3DS +#include "3ds/3ds_utils.h" +#endif + +#define PORTS_NUMBER 8 + static retro_video_refresh_t video_cb; static retro_input_poll_t input_poll_cb; static retro_input_state_t input_state_cb; @@ -54,9 +60,15 @@ extern char Mcd1Data[MCD_SIZE]; extern char McdDisable[2]; /* PCSX ReARMed core calls and stuff */ -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; -int in_keystate; +int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE }; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +unsigned short in_keystate[PORTS_NUMBER]; +int multitap1 = 0; +int multitap2 = 0; int in_enable_vibration = 1; /* PSX max resolution is 640x512, but with enhancement it's 1024x512 */ @@ -169,6 +181,164 @@ static void vout_close(void) { } +#ifdef _3DS +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +psx_map_t custom_psx_maps[] = { + {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) +{ + (void)is_fixed; + (void)addr; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + uint32_t ptr_aligned, tmp; + + custom_map->buffer = malloc(size + 0x1000); + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0) + { + SysPrintf("could not map memory @0x%08X\n", custom_map->target_map); + exit(1); + } + + return (void*)custom_map->target_map; + } + } + } + + return malloc(size); +} + +void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag) +{ + (void)tag; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->target_map == (uint32_t)ptr)) + { + uint32_t ptr_aligned, tmp; + + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3); + + free(custom_map->buffer); + custom_map->buffer = NULL; + return; + } + } + } + + free(ptr); +} +#endif + +#ifdef VITA +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +psx_map_t custom_psx_maps[] = { + {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) +{ + (void)is_fixed; + (void)addr; + + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + int block, ret; + char blockname[32]; + sprintf(blockname, "CODE 0x%08X",tag); + + block = sceKernelAllocMemBlock(blockname, size + 0x1000); + if(block<=0){ + sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, tag); + exit(1); + } + + // get base address + ret = sceKernelGetMemBlockBase(block, &custom_map->buffer); + if (ret < 0) + { + sceClibPrintf("could get address @0x%08X 0x%08X 0x%08X \n", block, ret, tag); + exit(1); + } + custom_map->buffer = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + custom_map->target_map = block; + + return custom_map->buffer; + } + } + + + return malloc(size); +} + +void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag) +{ + (void)tag; + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->buffer == ptr)) + { + sceKernelFreeMemBlock(custom_map->target_map); + custom_map->buffer = NULL; + custom_map->target_map = NULL; + return; + } + } + + free(ptr); +} +#endif + static void *pl_mmap(unsigned int size) { return psxMap(0, size, 0, MAP_TAG_VRAM); @@ -248,8 +418,16 @@ void retro_set_environment(retro_environment_t cb) static const struct retro_variable vars[] = { { "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" }, { "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" }, - { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" }, - { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" }, + { "pcsx_rearmed_pad1type", "Pad 1 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad2type", "Pad 2 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad3type", "Pad 3 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad4type", "Pad 4 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad5type", "Pad 5 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad6type", "Pad 6 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad7type", "Pad 7 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad8type", "Pad 8 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" }, + { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" }, #ifndef DRC_DISABLE { "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" }, #endif @@ -261,6 +439,8 @@ void retro_set_environment(retro_environment_t cb) { "pcsx_rearmed_duping_enable", "Frame duping; on|off" }, { "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" }, { "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" }, + { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" }, + { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" }, { NULL, NULL }, }; @@ -280,8 +460,160 @@ unsigned retro_api_version(void) return RETRO_API_VERSION; } +static int controller_port_variable(unsigned port, struct retro_variable *var) +{ + if (port >= PORTS_NUMBER) + return 0; + + if (!environ_cb) + return 0; + + var->value = NULL; + switch (port) { + case 0: + var->key = "pcsx_rearmed_pad1type"; + break; + case 1: + var->key = "pcsx_rearmed_pad2type"; + break; + case 2: + var->key = "pcsx_rearmed_pad3type"; + break; + case 3: + var->key = "pcsx_rearmed_pad4type"; + break; + case 4: + var->key = "pcsx_rearmed_pad5type"; + break; + case 5: + var->key = "pcsx_rearmed_pad6type"; + break; + case 6: + var->key = "pcsx_rearmed_pad7type"; + break; + case 7: + var->key = "pcsx_rearmed_pad8type"; + break; + } + + return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value; +} + +static void update_controller_port_variable(unsigned port) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (controller_port_variable(port, &var)) + { + if (strcmp(var.value, "standard") == 0) + in_type[0] = PSE_PAD_TYPE_STANDARD; + else if (strcmp(var.value, "analog") == 0) + in_type[0] = PSE_PAD_TYPE_ANALOGPAD; + else if (strcmp(var.value, "negcon") == 0) + in_type[0] = PSE_PAD_TYPE_NEGCON; + else if (strcmp(var.value, "none") == 0) + in_type[0] = PSE_PAD_TYPE_NONE; + // else 'default' case, do nothing + } +} + +static void update_controller_port_device(unsigned port, unsigned device) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (!controller_port_variable(port, &var)) + return; + + if (strcmp(var.value, "default") != 0) + return; + + switch (device) + { + case RETRO_DEVICE_JOYPAD: + in_type[port] = PSE_PAD_TYPE_STANDARD; + break; + case RETRO_DEVICE_ANALOG: + in_type[port] = PSE_PAD_TYPE_ANALOGPAD; + break; + case RETRO_DEVICE_MOUSE: + in_type[port] = PSE_PAD_TYPE_MOUSE; + break; + case RETRO_DEVICE_LIGHTGUN: + in_type[port] = PSE_PAD_TYPE_GUN; + break; + case RETRO_DEVICE_NONE: + default: + in_type[port] = PSE_PAD_TYPE_NONE; + } +} + +static void update_multitap() +{ + struct retro_variable var; + int auto_case, port; + + var.value = NULL; + var.key = "pcsx_rearmed_multitap1"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap1 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap1 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 2, we need a first multitap. + multitap1 = 0; + for (port = 2; port < PORTS_NUMBER; port++) + multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE; + } + + var.value = NULL; + var.key = "pcsx_rearmed_multitap2"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap2 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap2 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 4, we need a second multitap. + multitap2 = 0; + for (port = 4; port < PORTS_NUMBER; port++) + multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE; + } +} + void retro_set_controller_port_device(unsigned port, unsigned device) { + SysPrintf("port %u device %u",port,device); + + if (port >= PORTS_NUMBER) + return; + + update_controller_port_device(port, device); + update_multitap(); } void retro_get_system_info(struct retro_system_info *info) @@ -306,8 +638,8 @@ void retro_get_system_av_info(struct retro_system_av_info *info) } /* savestates */ -size_t retro_serialize_size(void) -{ +size_t retro_serialize_size(void) +{ // it's currently 4380651-4397047 bytes, // but have some reserved for future return 0x440000; @@ -393,7 +725,7 @@ static void save_close(void *file) } bool retro_serialize(void *data, size_t size) -{ +{ int ret = SaveState(data); return ret == 0 ? true : false; } @@ -761,7 +1093,7 @@ bool retro_load_game(const struct retro_game_info *info) { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -782,7 +1114,7 @@ bool retro_load_game(const struct retro_game_info *info) { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -803,7 +1135,7 @@ bool retro_load_game(const struct retro_game_info *info) { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -902,7 +1234,7 @@ bool retro_load_game_special(unsigned game_type, const struct retro_game_info *i return false; } -void retro_unload_game(void) +void retro_unload_game(void) { } @@ -955,16 +1287,15 @@ static const unsigned short retro_psx_map[] = { static void update_variables(bool in_flight) { struct retro_variable var; - + int i; + var.value = NULL; var.key = "pcsx_rearmed_frameskip"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) pl_rearmed_cbs.frameskip = atoi(var.value); var.value = NULL; var.key = "pcsx_rearmed_region"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { Config.PsxAuto = 0; @@ -976,25 +1307,10 @@ static void update_variables(bool in_flight) Config.PsxType = 1; } - var.value = NULL; - var.key = "pcsx_rearmed_pad1type"; + for (i = 0; i < PORTS_NUMBER; i++) + update_controller_port_variable(i); - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) - { - in_type1 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type1 = PSE_PAD_TYPE_ANALOGPAD; - } - - var.value = NULL; - var.key = "pcsx_rearmed_pad2type"; - - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) - { - in_type2 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type2 = PSE_PAD_TYPE_ANALOGPAD; - } + update_multitap(); #ifdef __ARM_NEON__ var.value = "NULL"; @@ -1050,6 +1366,11 @@ static void update_variables(bool in_flight) { R3000Acpu *prev_cpu = psxCpu; +#ifdef _3DS + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; + else +#endif if (strcmp(var.value, "disabled") == 0) Config.Cpu = CPU_INTERPRETER; else if (strcmp(var.value, "enabled") == 0) @@ -1090,6 +1411,28 @@ static void update_variables(bool in_flight) spu_config.iUseInterpolation = 0; } + var.value = "NULL"; + var.key = "pcsx_rearmed_pe2_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.RCntFix = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.RCntFix = 1; + } + + var.value = "NULL"; + var.key = "pcsx_rearmed_inuyasha_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.VSyncWA = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.VSyncWA = 1; + } + if (in_flight) { // inform core things about possible config changes plugin_call_rearmed_cbs(); @@ -1103,9 +1446,9 @@ static void update_variables(bool in_flight) } } -void retro_run(void) +void retro_run(void) { - int i; + int i; input_poll_cb(); @@ -1113,21 +1456,26 @@ void retro_run(void) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated) update_variables(true); - in_keystate = 0; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; - in_keystate <<= 16; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; + // reset all keystate, query libretro for keystate + int j; + for(i = 0; i < PORTS_NUMBER; i++) { + in_keystate[i] = 0; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) - { - in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; - in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; + if (in_type[i] == PSE_PAD_TYPE_NONE) + continue; + + // query libretro for keystate + for (j = 0; j < RETRO_PSX_MAP_LEN; j++) + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j)) + in_keystate[i] |= retro_psx_map[j]; + + if (in_type[i] == PSE_PAD_TYPE_ANALOGPAD) + { + in_analog_left[i][0] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; + in_analog_left[i][1] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; + in_analog_right[i][0] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; + in_analog_right[i][1] = (input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; + } } stop = 0; @@ -1162,7 +1510,7 @@ static bool try_use_bios(const char *path) return true; } -#if 1 +#ifndef VITA #include <sys/types.h> #include <dirent.h> @@ -1211,14 +1559,29 @@ void retro_init(void) syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0); #endif +#ifdef _3DS + psxMapHook = pl_3ds_mmap; + psxUnmapHook = pl_3ds_munmap; +#endif +#ifdef VITA + psxMapHook = pl_vita_mmap; + psxUnmapHook = pl_vita_munmap; +#endif ret = emu_core_preinit(); +#ifdef _3DS + /* emu_core_preinit sets the cpu to dynarec */ + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; +#endif ret |= emu_core_init(); if (ret != 0) { SysPrintf("PCSX init failed.\n"); exit(1); } -#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) +#ifdef _3DS + vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80); +#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA) posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); #else vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); @@ -1226,7 +1589,7 @@ void retro_init(void) if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir) { - snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir); + snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir); for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) { snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]); @@ -1244,7 +1607,7 @@ void retro_init(void) else { SysPrintf("no BIOS files found.\n"); - struct retro_message msg = + struct retro_message msg = { "no BIOS found, expect bugs!", 180 @@ -1283,6 +1646,18 @@ void retro_init(void) void retro_deinit(void) { SysClose(); +#ifdef _3DS + linearFree(vout_buf); +#else free(vout_buf); +#endif vout_buf = NULL; } + +#ifdef VITA +#include <psp2/kernel/threadmgr.h> +int usleep (unsigned long us) +{ + sceKernelDelayThread(us); +} +#endif diff --git a/frontend/main.c b/frontend/main.c index a824fdc..89e96e4 100644 --- a/frontend/main.c +++ b/frontend/main.c @@ -11,7 +11,7 @@ #include <unistd.h> #include <signal.h> #include <time.h> -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) #include <dlfcn.h> #endif @@ -151,8 +151,8 @@ void emu_set_default_config(void) new_dynarec_hacks = 0; cycle_multiplier = 200; - in_type1 = PSE_PAD_TYPE_STANDARD; - in_type2 = PSE_PAD_TYPE_STANDARD; + in_type[0] = PSE_PAD_TYPE_STANDARD; + in_type[1] = PSE_PAD_TYPE_STANDARD; } void do_emu_action(void) @@ -986,7 +986,7 @@ void *SysLoadLibrary(const char *lib) { return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]); } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) ret = dlopen(lib, RTLD_NOW); if (ret == NULL) SysMessage("dlopen: %s", dlerror()); @@ -1003,7 +1003,7 @@ void *SysLoadSym(void *lib, const char *sym) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return plugin_link(plugid - PLUGIN_DL_BASE, sym); -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) return dlsym(lib, sym); #else return NULL; @@ -1011,7 +1011,9 @@ void *SysLoadSym(void *lib, const char *sym) { } const char *SysLibError() { -#ifndef _WIN32 +#if defined(NO_DYLIB) + return NULL; +#elif !defined(_WIN32) return dlerror(); #else return "not supported"; @@ -1024,8 +1026,7 @@ void SysCloseLibrary(void *lib) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return; -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) dlclose(lib); #endif } - diff --git a/frontend/menu.c b/frontend/menu.c index cf9382a..7e1fdd1 100644 --- a/frontend/menu.c +++ b/frontend/menu.c @@ -309,12 +309,12 @@ static void menu_sync_config(void) switch (in_type_sel1) { case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break; default: in_type1 = PSE_PAD_TYPE_STANDARD; } switch (in_type_sel2) { case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break; default: in_type2 = PSE_PAD_TYPE_STANDARD; } if (in_evdev_allow_abs_only != allow_abs_only_old) { diff --git a/frontend/plugin.c b/frontend/plugin.c index d9eb04a..8914519 100644 --- a/frontend/plugin.c +++ b/frontend/plugin.c @@ -49,24 +49,43 @@ extern void CALLBACK SPUasync(unsigned int, unsigned int); extern int CALLBACK SPUplayCDDAchannel(short *, int); /* PAD */ -static long PADreadPort1(PadDataS *pad) -{ - pad->controllerType = in_type1; - pad->buttonStatus = ~in_keystate; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) { - pad->leftJoyX = in_a1[0]; - pad->leftJoyY = in_a1[1]; - pad->rightJoyX = in_a2[0]; - pad->rightJoyY = in_a2[1]; - } - return 0; +static long PADreadPort1(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap1 == 1) + pad->portMultitap = 1; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } -static long PADreadPort2(PadDataS *pad) -{ - pad->controllerType = in_type2; - pad->buttonStatus = ~in_keystate >> 16; - return 0; +static long PADreadPort2(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap2 ==1 ) + pad->portMultitap = 2; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } /* GPU */ diff --git a/frontend/plugin_lib.c b/frontend/plugin_lib.c index ab4d415..ad2f49b 100644 --- a/frontend/plugin_lib.c +++ b/frontend/plugin_lib.c @@ -36,8 +36,11 @@ #define HUD_HEIGHT 10 -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; +int in_type[8]; +int multitap1; +int multitap2; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }}; int in_adev_is_nublike[2]; int in_keystate, in_state_gun; @@ -560,7 +563,7 @@ static void update_analog_nub_adjust(int *x_, int *y_) static void update_analogs(void) { - int *nubp[2] = { in_a1, in_a2 }; + int *nubp[2] = { in_analog_left[0], in_analog_right[0] }; int vals[2]; int i, a, v, ret; @@ -597,7 +600,7 @@ static void update_input(void) unsigned int emu_act; in_update(actions); - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) + if (in_type[0] == PSE_PAD_TYPE_ANALOGPAD) update_analogs(); emu_act = actions[IN_BINDTYPE_EMU]; in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER; @@ -611,7 +614,7 @@ static void update_input(void) } emu_set_action(emu_act); - in_keystate = actions[IN_BINDTYPE_PLAYER12]; + in_keystate[0] = actions[IN_BINDTYPE_PLAYER12]; } #else /* MAEMO */ extern void update_input(void); diff --git a/frontend/plugin_lib.h b/frontend/plugin_lib.h index 4a11002..ad27fc2 100644 --- a/frontend/plugin_lib.h +++ b/frontend/plugin_lib.h @@ -17,8 +17,14 @@ enum { DKEY_CROSS, DKEY_SQUARE, }; -extern int in_type1, in_type2; -extern int in_keystate, in_state_gun, in_a1[2], in_a2[2]; +extern int in_state_gun; +extern int in_type[8]; +extern int multitap1; +extern int multitap2; +extern int in_analog_left[8][2]; +extern int in_analog_right[8][2]; +unsigned short in_keystate[8]; + extern int in_adev[2], in_adev_axis[2][2]; extern int in_adev_is_nublike[2]; extern int in_enable_vibration; diff --git a/frontend/vita/pthread.h b/frontend/vita/pthread.h new file mode 100644 index 0000000..e1afdc5 --- /dev/null +++ b/frontend/vita/pthread.h @@ -0,0 +1,308 @@ +/* Copyright (C) 2010-2016 The RetroArch team + * + * --------------------------------------------------------------------------------------- + * The following license statement only applies to this file (psp_pthread.h). + * --------------------------------------------------------------------------------------- + * + * Permission is hereby granted, free of charge, + * to any person obtaining a copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation the rights to + * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, + * and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. + * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + +/* FIXME: unfinished on PSP, mutexes and condition variables basically a stub. */ +#ifndef _PSP_PTHREAD_WRAP__ +#define _PSP_PTHREAD_WRAP__ + +#ifdef VITA +#include <psp2/kernel/threadmgr.h> +#include <sys/time.h> +#else +#include <pspkernel.h> +#include <pspthreadman.h> +#include <pspthreadman_kernel.h> +#endif +#include <stdio.h> +#include <retro_inline.h> + +#define STACKSIZE (8 * 1024) + +typedef SceUID pthread_t; +typedef SceUID pthread_mutex_t; +typedef void* pthread_mutexattr_t; +typedef int pthread_attr_t; + +typedef struct +{ + SceUID mutex; + SceUID sema; + int waiting; +} pthread_cond_t; + +typedef SceUID pthread_condattr_t; + +/* Use pointer values to create unique names for threads/mutexes */ +char name_buffer[256]; + +typedef void* (*sthreadEntry)(void *argp); + +typedef struct +{ + void* arg; + sthreadEntry start_routine; +} sthread_args_struct; + + +static int psp_thread_wrap(SceSize args, void *argp) +{ + sthread_args_struct* sthread_args = (sthread_args_struct*)argp; + + return (int)sthread_args->start_routine(sthread_args->arg); +} + +static INLINE int pthread_create(pthread_t *thread, + const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg) +{ + sprintf(name_buffer, "0x%08X", (unsigned int) thread); + +#ifdef VITA + *thread = sceKernelCreateThread(name_buffer, psp_thread_wrap, + 0x10000100, 0x10000, 0, 0, NULL); +#else + *thread = sceKernelCreateThread(name_buffer, + psp_thread_wrap, 0x20, STACKSIZE, 0, NULL); +#endif + + sthread_args_struct sthread_args; + sthread_args.arg = arg; + sthread_args.start_routine = start_routine; + + return sceKernelStartThread(*thread, sizeof(sthread_args), &sthread_args); +} + +static INLINE int pthread_mutex_init(pthread_mutex_t *mutex, + const pthread_mutexattr_t *attr) +{ + sprintf(name_buffer, "0x%08X", (unsigned int) mutex); + +#ifdef VITA + *mutex = sceKernelCreateMutex(name_buffer, 0, 0, 0); + if(*mutex<0) + return *mutex; + return 0; +#else + return *mutex = sceKernelCreateSema(name_buffer, 0, 1, 1, NULL); +#endif +} + +static INLINE int pthread_mutex_destroy(pthread_mutex_t *mutex) +{ +#ifdef VITA + return sceKernelDeleteMutex(*mutex); +#else + return sceKernelDeleteSema(*mutex); +#endif +} + +static INLINE int pthread_mutex_lock(pthread_mutex_t *mutex) +{ +#ifdef VITA + int ret = sceKernelLockMutex(*mutex, 1, 0); + return ret; + +#else + /* FIXME: stub */ + return 1; +#endif +} + +static INLINE int pthread_mutex_unlock(pthread_mutex_t *mutex) +{ +#ifdef VITA + int ret = sceKernelUnlockMutex(*mutex, 1); + return ret; +#else + /* FIXME: stub */ + return 1; +#endif +} + + +static INLINE int pthread_join(pthread_t thread, void **retval) +{ +#ifdef VITA + int res = sceKernelWaitThreadEnd(thread, 0, 0); + if (res < 0) + return res; + return sceKernelDeleteThread(thread); +#else + SceUInt timeout = (SceUInt)-1; + sceKernelWaitThreadEnd(thread, &timeout); + exit_status = sceKernelGetThreadExitStatus(thread); + sceKernelDeleteThread(thread); + return exit_status; +#endif +} + +static INLINE int pthread_mutex_trylock(pthread_mutex_t *mutex) +{ +#ifdef VITA + return sceKernelTryLockMutex(*mutex, 1 /* not sure about this last param */); +#else + /* FIXME: stub */ + return 1; +#endif +} + +static INLINE int pthread_cond_wait(pthread_cond_t *cond, + pthread_mutex_t *mutex) +{ +#ifdef VITA + int ret = pthread_mutex_lock(&cond->mutex); + if (ret < 0) + return ret; + ++cond->waiting; + pthread_mutex_unlock(mutex); + pthread_mutex_unlock(&cond->mutex); + + ret = sceKernelWaitSema(cond->sema, 1, 0); + if (ret < 0) + sceClibPrintf("Premature wakeup: %08X", ret); + pthread_mutex_lock(mutex); + return ret; +#else + /* FIXME: stub */ + sceKernelDelayThread(10000); + return 1; +#endif +} + +static INLINE int pthread_cond_timedwait(pthread_cond_t *cond, + pthread_mutex_t *mutex, const struct timespec *abstime) +{ +#ifdef VITA + int ret = pthread_mutex_lock(&cond->mutex); + if (ret < 0) + return ret; + ++cond->waiting; + pthread_mutex_unlock(mutex); + pthread_mutex_unlock(&cond->mutex); + + SceUInt timeout = 0; + + timeout = abstime->tv_sec; + timeout += abstime->tv_nsec / 1.0e6; + + ret = sceKernelWaitSema(cond->sema, 1, &timeout); + if (ret < 0) + sceClibPrintf("Premature wakeup: %08X", ret); + pthread_mutex_lock(mutex); + return ret; + +#else + /* FIXME: stub */ + return 1; +#endif +} + +static INLINE int pthread_cond_init(pthread_cond_t *cond, + const pthread_condattr_t *attr) +{ +#ifdef VITA + + pthread_mutex_init(&cond->mutex,NULL); + if(cond->mutex<0){ + return cond->mutex; + } + sprintf(name_buffer, "0x%08X", (unsigned int) cond); + //cond->sema = sceKernelCreateCond(name_buffer, 0, cond->mutex, 0); + cond->sema = sceKernelCreateSema(name_buffer, 0, 0, 1, 0); + if(cond->sema<0){ + pthread_mutex_destroy(&cond->mutex); + return cond->sema; + } + + cond->waiting = 0; + + + return 0; + + +#else + /* FIXME: stub */ + return 1; +#endif +} + +static INLINE int pthread_cond_signal(pthread_cond_t *cond) +{ +#ifdef VITA + pthread_mutex_lock(&cond->mutex); + if (cond->waiting) + { + --cond->waiting; + sceKernelSignalSema(cond->sema, 1); + } + pthread_mutex_unlock(&cond->mutex); + return 0; +#else + /* FIXME: stub */ + return 1; +#endif +} + +static INLINE int pthread_cond_broadcast(pthread_cond_t *cond) +{ + /* FIXME: stub */ + return 1; +} + +static INLINE int pthread_cond_destroy(pthread_cond_t *cond) +{ +#ifdef VITA + int ret = sceKernelDeleteSema(cond->sema); + if(ret < 0) + return ret; + + return sceKernelDeleteMutex(cond->mutex); +#else + /* FIXME: stub */ + return 1; +#endif +} + + +static INLINE int pthread_detach(pthread_t thread) +{ + return 0; +} + +static INLINE void pthread_exit(void *retval) +{ +#ifdef VITA + sceKernelExitDeleteThread(sceKernelGetThreadId()); +#endif +} + +static INLINE pthread_t pthread_self(void) +{ + /* zero 20-mar-2016: untested */ + return sceKernelGetThreadId(); +} + +static INLINE int pthread_equal(pthread_t t1, pthread_t t2) +{ + return t1 == t2; +} + +#endif //_PSP_PTHREAD_WRAP__ diff --git a/frontend/vita/retro_inline.h b/frontend/vita/retro_inline.h new file mode 100644 index 0000000..8535d84 --- /dev/null +++ b/frontend/vita/retro_inline.h @@ -0,0 +1,39 @@ +/* Copyright (C) 2010-2015 The RetroArch team + * + * --------------------------------------------------------------------------------------- + * The following license statement only applies to this file (retro_inline.h). + * --------------------------------------------------------------------------------------- + * + * Permission is hereby granted, free of charge, + * to any person obtaining a copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation the rights to + * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, + * and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. + * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + +#ifndef __LIBRETRO_SDK_INLINE_H +#define __LIBRETRO_SDK_INLINE_H + +#ifndef INLINE + +#if !defined(__cplusplus) && defined(_WIN32) +#define INLINE _inline +#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L +#define INLINE inline +#elif defined(__GNUC__) +#define INLINE __inline__ +#else +#define INLINE +#endif + +#endif +#endif diff --git a/frontend/vita/sys/mman.h b/frontend/vita/sys/mman.h new file mode 100644 index 0000000..89da513 --- /dev/null +++ b/frontend/vita/sys/mman.h @@ -0,0 +1,69 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include "stdlib.h" +#include "stdio.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)prot; + (void)flags; + (void)fd; + (void)offset; + + int block, ret; + + block = sceKernelAllocMemBlockForVM("code", len); + if(block<=0){ + sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len); + exit(1); + } + + // get base address + ret = sceKernelGetMemBlockBase(block, &addr); + if (ret < 0) + { + sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr); + exit(1); + } + + + if(!addr) + return MAP_FAILED; + + return addr; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + (void)addr; + (void)len; + (void)prot; + return 0; +} + +static inline int munmap(void *addr, size_t len) +{ + int uid = sceKernelFindMemBlockByAddr(addr, len); + + return sceKernelFreeMemBlock(uid); + +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H diff --git a/include/psemu_plugin_defs.h b/include/psemu_plugin_defs.h index 9986654..6fc59b7 100644 --- a/include/psemu_plugin_defs.h +++ b/include/psemu_plugin_defs.h @@ -153,6 +153,8 @@ typedef struct +// No controller +#define PSE_PAD_TYPE_NONE 0 // MOUSE SCPH-1030 #define PSE_PAD_TYPE_MOUSE 1 // NEGCON - 16 button analog controller SLPH-00001 @@ -191,9 +193,15 @@ typedef struct typedef struct { - // controler type - fill it withe predefined values above + // controller type - fill it withe predefined values above unsigned char controllerType; + //0 : no multitap between psx and pad + //1 : multitap between psx and pad on port 1 + //2 : multitap between psx and pad on port 2 + int portMultitap; + int requestPadIndex; + // status of buttons - every controller fills this field unsigned short buttonStatus; @@ -207,7 +215,9 @@ typedef struct unsigned char Vib[2]; unsigned char VibF[2]; - + + //configuration mode Request 0x43 + int configMode; unsigned char reserved[87]; } PadDataS; diff --git a/jni/Android.mk b/jni/Android.mk index 72c6738..36b0c93 100644 --- a/jni/Android.mk +++ b/jni/Android.mk @@ -4,6 +4,9 @@ include $(CLEAR_VARS) APP_DIR := ../../src +#fix stupid change in ndk r11 that breaks compiling even when the exe would run fine +LOCAL_DISABLE_FATAL_LINKER_WARNINGS := true + ifneq ($(TARGET_ARCH_ABI),armeabi-v7a) NO_NEON_BUILD := 1 else diff --git a/libpcsxcore/cdriso.c b/libpcsxcore/cdriso.c index 515370f..d2c904c 100644 --- a/libpcsxcore/cdriso.c +++ b/libpcsxcore/cdriso.c @@ -30,7 +30,7 @@ #include <process.h> #include <windows.h> #define strcasecmp _stricmp -#define usleep(x) Sleep((x) / 1000) +#define usleep(x) (Sleep((x) / 1000)) #else #include <pthread.h> #include <sys/time.h> @@ -225,7 +225,9 @@ static void *playthread(void *param) do { ret = SPU_playCDDAchannel((short *)sndbuffer, s); if (ret == 0x7761) + { usleep(6 * 1000); + } } while (ret == 0x7761 && playing); // rearmed_wait } @@ -236,7 +238,9 @@ static void *playthread(void *param) // HACK: stop feeding data while emu is paused extern int stop; while (stop && playing) + { usleep(10000); + } now = GetTickCount(); osleep = t - now; diff --git a/libpcsxcore/new_dynarec/emu_if.c b/libpcsxcore/new_dynarec/emu_if.c index 22db5d1..8aebd64 100644 --- a/libpcsxcore/new_dynarec/emu_if.c +++ b/libpcsxcore/new_dynarec/emu_if.c @@ -431,7 +431,7 @@ void do_insn_cmp() {} #ifdef DRC_DISABLE unsigned int address; int pending_exception, stop; -unsigned int next_interupt; +u32 next_interupt; int new_dynarec_did_compile; int cycle_multiplier; int new_dynarec_hacks; diff --git a/libpcsxcore/new_dynarec/emu_if.h b/libpcsxcore/new_dynarec/emu_if.h index 3980490..73f842b 100644 --- a/libpcsxcore/new_dynarec/emu_if.h +++ b/libpcsxcore/new_dynarec/emu_if.h @@ -89,7 +89,7 @@ extern void *scratch_buf_ptr; extern u32 inv_code_start, inv_code_end; /* cycles/irqs */ -extern unsigned int next_interupt; +extern u32 next_interupt; extern int pending_exception; /* called by drc */ diff --git a/libpcsxcore/plugins.c b/libpcsxcore/plugins.c index e6d8a11..007b61e 100644 --- a/libpcsxcore/plugins.c +++ b/libpcsxcore/plugins.c @@ -205,7 +205,7 @@ void CALLBACK GPU__vBlank(int val) {} #define LoadGpuSym1(dest, name) \
LoadSym(GPU_##dest, GPU##dest, name, TRUE);
-
+ #define LoadGpuSym0(dest, name) \
LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
@@ -368,93 +368,419 @@ static int LoadSPUplugin(const char *SPUdll) { void *hPAD1Driver = NULL;
void *hPAD2Driver = NULL;
-static unsigned char buf[256];
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-
-static int bufcount, bufc;
-
-PadDataS padd1, padd2;
-
-unsigned char _PADstartPoll(PadDataS *pad) {
- bufc = 0;
-
+static int multitap1 = -1;
+static int multitap2 = -1;
+//Pad information, keystate, mode, config mode, vibration
+static PadDataS pad[8]; + +static int reqPos, respSize, req; +static int ledStateReq44[8]; +
+static unsigned char buf[256]; +static unsigned char bufMulti[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; +
+unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+unsigned char multitappar[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff,
+ 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff};
+
+//response for request 44, 45, 46, 47, 4C, 4D
+static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00};
+static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A};
+static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14};
+static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00};
+static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00};
+static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00};
+static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF};
+ +//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F +static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00};
+static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; + +// Resquest of psx core +enum { + // REQUEST + // first call of this request for the pad, the pad is configured as an digital pad. + // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00 + // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D) + // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad + // Y if 0 : psx request a pad key state + // ZZ rumble small motor 00-> OFF, 01 -> ON + // AA rumble large motor speed 0x00 -> 0xFF + // RESPONSE + // header 3 Bytes + // 0x00 + // PadId -> 0x41 for digital pas, 0x73 for analog pad + // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch + // 6 Bytes for keystates + CMD_READ_DATA_AND_VIBRATE = 0x42, + + // REQUEST + // Header + // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // XX = 00 -> Normal mode : Seconde bytes of response = padId + // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3 + // RESPONSE + // enter in config mode example : + // req : 01 43 00 01 00 00 00 00 00 00 + // res : 00 41 5A buttons state, analog states + // exit config mode : + // req : 01 43 00 00 00 00 00 00 00 00 + // res : 00 F3 5A buttons state, analog states + CMD_CONFIG_MODE = 0x43, + + // Set led State + // REQUEST + // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00 + // If sel = 2 then + // VAL = 00 -> OFF + // VAL = 01 -> ON + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + CMD_SET_MODE_AND_LOCK = 0x44, + + // Get Analog Led state + // REQUEST + // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00 + // VAL = 00 Led OFF + // VAL = 01 Led ON + CMD_QUERY_MODEL_AND_MODE = 0x45, + + //Get Variable A + // REQUEST + // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX=00 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A + // XX=01 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14 + CMD_QUERY_ACT = 0x46, + + // REQUEST + // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00 + CMD_QUERY_COMB = 0x47, + + // REQUEST + // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX = 0 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00 + // XX = 1 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00 + CMD_QUERY_MODE = 0x4C, + + // REQUEST + // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF + // RESPONSE + // 0x00, 0xF3, 0x5A, old value or + // AA = 01 unlock large motor (and swap VAL1 and VAL2) + // BB = 01 unlock large motor (default) + // CC, DD, EE, FF = all FF -> unlock small motor + // + // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF + // + CMD_VIBRATION_TOGGLE = 0x4D, + REQ40 = 0x40, + REQ41 = 0x41, + REQ49 = 0x49, + REQ4A = 0x4A, + REQ4B = 0x4B, + REQ4E = 0x4E, + REQ4F = 0x4F +}; + + + + +//NO MULTITAP + +void initBufForRequest(int padIndex, char value){ + switch (value){
+ //Pad keystate already in buffer
+ //case CMD_READ_DATA_AND_VIBRATE :
+ // break;
+ case CMD_CONFIG_MODE :
+ if(pad[padIndex].configMode == 1){
+ memcpy(buf, resp43, 8);
+ break;
+ }
+ //else, not in config mode, pad keystate return (already in the buffer)
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ memcpy(buf, resp44, 8);
+ break;
+ case CMD_QUERY_MODEL_AND_MODE :
+ memcpy(buf, resp45, 8);
+ break;
+ case CMD_QUERY_ACT :
+ memcpy(buf, resp46_00, 8);
+ break;
+ case CMD_QUERY_COMB :
+ memcpy(buf, resp47, 8);
+ break;
+ case CMD_QUERY_MODE :
+ memcpy(buf, resp4C_00, 8);
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ memcpy(buf, resp4D, 8);
+ break;
+ case REQ40 :
+ memcpy(buf, resp40, 8);
+ break;
+ case REQ41 :
+ memcpy(buf, resp41, 8);
+ break;
+ case REQ49 :
+ memcpy(buf, resp49, 8);
+ break;
+ case REQ4A :
+ memcpy(buf, resp4A, 8);
+ break;
+ case REQ4B :
+ memcpy(buf, resp4B, 8);
+ break;
+ case REQ4E :
+ memcpy(buf, resp4E, 8);
+ break;
+ case REQ4F :
+ memcpy(buf, resp4F, 8);
+ break;
+ } +} + + +
+
+void reqIndex2Treatment(int padIndex, char value){
+ switch (req){
+ case CMD_CONFIG_MODE :
+ //0x43
+ if(value == 0){
+ pad[padIndex].configMode = 0;
+ }else{
+ pad[padIndex].configMode = 1;
+ }
+ break;
+ case CMD_SET_MODE_AND_LOCK :
+ //0x44 store the led state for change mode if the next value = 0x02
+ //0x01 analog ON
+ //0x00 analog OFF
+ ledStateReq44[padIndex] = value;
+ break;
+ case CMD_QUERY_ACT :
+ //0x46
+ if(value==1){
+ memcpy(buf, resp46_01, 8);
+ }
+ break;
+
+ case CMD_QUERY_MODE :
+ if(value==1){
+ memcpy(buf, resp4C_01, 8);
+ }
+ break;
+ case CMD_VIBRATION_TOGGLE :
+ //0x4D
+ memcpy(buf, resp4D, 8);
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for small motor;
+ pad[padIndex].Vib[0] = value; + }
+}
+ +void vibrate(int padIndex){ + if(pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]){ + //value is different update Value and call libretro for vibration + pad[padIndex].VibF[0] = pad[padIndex].Vib[0]; + pad[padIndex].VibF[1] = pad[padIndex].Vib[1]; + plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]); + //printf("vibration pad %i", padIndex); + } +} + + + + +//Build response for 0x42 request Pad in port
+void _PADstartPoll(PadDataS *pad) {
switch (pad->controllerType) {
case PSE_PAD_TYPE_MOUSE:
- mousepar[3] = pad->buttonStatus & 0xff;
- mousepar[4] = pad->buttonStatus >> 8;
- mousepar[5] = pad->moveX;
- mousepar[6] = pad->moveY;
-
- memcpy(buf, mousepar, 7);
- bufcount = 6;
+ stdpar[0] = 0x12;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->moveX;
+ stdpar[5] = pad->moveY;
+ memcpy(buf, stdpar, 6);
+ respSize = 6;
break;
case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
- analogpar[1] = 0x23;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x23;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_ANALOGPAD: // scph1150
- analogpar[1] = 0x73;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x73;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_ANALOGJOY: // scph1110
- analogpar[1] = 0x53;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
+ stdpar[0] = 0x53;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8;
+ stdpar[4] = pad->rightJoyX;
+ stdpar[5] = pad->rightJoyY;
+ stdpar[6] = pad->leftJoyX;
+ stdpar[7] = pad->leftJoyY;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
break;
case PSE_PAD_TYPE_STANDARD:
- default:
- stdpar[3] = pad->buttonStatus & 0xff;
- stdpar[4] = pad->buttonStatus >> 8;
-
- memcpy(buf, stdpar, 5);
- bufcount = 4;
+ default: + stdpar[0] = 0x41;
+ stdpar[2] = pad->buttonStatus & 0xff;
+ stdpar[3] = pad->buttonStatus >> 8; + //avoid analog value in multitap mode if change pad type in game. + stdpar[4] = 0xff; + stdpar[5] = 0xff; + stdpar[6] = 0xff; + stdpar[7] = 0xff;
+ memcpy(buf, stdpar, 8);
+ respSize = 8;
}
-
- return buf[bufc++];
}
-unsigned char _PADpoll(unsigned char value) {
- if (bufc > bufcount) return 0;
- return buf[bufc++];
-}
-
-unsigned char CALLBACK PAD1__startPoll(int pad) {
- PadDataS padd;
+ +//Build response for 0x42 request Multitap in port +//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D)
+void _PADstartPollMultitap(PadDataS padd[4]) {
+ int i = 0;
+ int offset = 2;
+ PadDataS pad;
+ for(i = 0; i < 4; i++) {
+ offset = 2 + (i * 8);
+ pad = padd[i];
+ _PADstartPoll(&pad); + memcpy(multitappar+offset, stdpar, 8);
+ }
+ memcpy(bufMulti, multitappar, 34);
+ respSize = 34;
+} - PAD1_readPort1(&padd);
- return _PADstartPoll(&padd);
+unsigned char _PADpoll(int port, unsigned char value) { + if(reqPos==0){ + //mem the request number + req = value;
+ //copy the default value of request response in buffer instead of the keystate
+ initBufForRequest(port,value); + }
+
+ //if no new request the pad return 0xff, for signaling connected
+ if ( reqPos >= respSize) return 0xff;
+
+ switch(reqPos){
+ case 2:
+ reqIndex2Treatment(port, value);
+ break;
+ case 3:
+ switch(req) {
+ case CMD_SET_MODE_AND_LOCK :
+ //change mode on pad
+ break;
+ case CMD_READ_DATA_AND_VIBRATE:
+ //mem the vibration value for Large motor;
+ pad[port].Vib[1] = value;
+ //vibration + vibrate(port);
+ break;
+
+ break;
+ }
+ }
+ return buf[reqPos++];
+} + + +unsigned char _PADpollMultitap(int port, unsigned char value) { + if ( reqPos >= respSize) return 0xff;
+ return bufMulti[reqPos++];
+} +
+
+// refresh the button state on port 1.
+// int pad is not needed.
+unsigned char CALLBACK PAD1__startPoll(int pad) { + reqPos = 0;
+ // first call the pad provide if a multitap is connected between the psx and himself
+ if(multitap1 == -1){
+ PadDataS padd; + padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ multitap1 = padd.portMultitap;
+ }
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap1 == 0){
+ PadDataS padd; + padd.requestPadIndex = 0;
+ PAD1_readPort1(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ int i=0;
+ PadDataS padd[4];
+ for(i = 0; i < 4; i++) { + padd[i].requestPadIndex = i;
+ PAD1_readPort1(&padd[i]);
+ } + _PADstartPollMultitap(padd);
+ } + //printf("\npad 1 : "); + return 0x00;
}
-unsigned char CALLBACK PAD1__poll(unsigned char value) {
- return _PADpoll(value);
+unsigned char CALLBACK PAD1__poll(unsigned char value) { + char tmp; + if(multitap1 == 1){ + tmp = _PADpollMultitap(0, value); + }else{ + tmp = _PADpoll(0, value); + } + //printf("%2x:%2x, ",value,tmp);
+ return tmp;
+
}
+
long CALLBACK PAD1__configure(void) { return 0; }
void CALLBACK PAD1__about(void) {}
long CALLBACK PAD1__test(void) { return 0; }
@@ -497,16 +823,57 @@ static int LoadPAD1plugin(const char *PAD1dll) { return 0;
}
-unsigned char CALLBACK PAD2__startPoll(int pad) {
- PadDataS padd;
-
- PAD2_readPort2(&padd);
-
- return _PADstartPoll(&padd);
+unsigned char CALLBACK PAD2__startPoll(int pad) { + reqPos = 0;
+ int pad_index = 0; + if(multitap1 == 0 && multitap2 == 0){ + pad_index += 1; + }else if(multitap1 == 1 && multitap2 == 0){ + pad_index += 4; + }else if(multitap1 == 0 && multitap2 == 2){ + pad_index += 1; + }else if(multitap1 == 1 && multitap2 == 2){ + pad_index += 4; + } + + //first call the pad provide if a multitap is connected between the psx and himself + if(multitap2 == -1){ + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd); + multitap2 = padd.portMultitap; + } +
+ // just one pad is on port 1 : NO MULTITAP
+ if (multitap2 == 0){ + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd);
+ _PADstartPoll(&padd);
+ } else {
+ // a multitap is plugged : refresh all pad.
+ //a multitap is plugged : refresh all pad. + int i=0; + PadDataS padd[4]; + for(i=0;i<4;i++){ + padd[i].requestPadIndex = i+pad_index; + PAD2_readPort2(&padd[i]); + } + _PADstartPollMultitap(padd);
+ } + //printf("\npad 2 : "); + return 0x00;
}
unsigned char CALLBACK PAD2__poll(unsigned char value) {
- return _PADpoll(value);
+ char tmp; + if(multitap2 == 2){ + tmp = _PADpollMultitap(1, value); + }else{ + tmp = _PADpoll(1, value); + } + //printf("%2x:%2x, ",value,tmp);
+ return tmp;
}
long CALLBACK PAD2__configure(void) { return 0; }
diff --git a/libpcsxcore/psxbios.c b/libpcsxcore/psxbios.c index 292d80d..d5ed725 100644 --- a/libpcsxcore/psxbios.c +++ b/libpcsxcore/psxbios.c @@ -2216,6 +2216,15 @@ void psxBios_ChangeClearPad() { // 5b pc0 = ra; } +void psxBios__card_status() { // 5c +#ifdef PSXBIOS_LOG + PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0); +#endif + + v0 = 1; + pc0 = ra; +} + /* System calls C0 */ /* @@ -2569,7 +2578,7 @@ void psxBiosInit() { //biosB0[0x59] = psxBios_sys_b0_59; //biosB0[0x5a] = psxBios_sys_b0_5a; biosB0[0x5b] = psxBios_ChangeClearPad; - //biosB0[0x5c] = psxBios__card_status; + biosB0[0x5c] = psxBios__card_status; //biosB0[0x5d] = psxBios__card_wait; //*******************C0 CALLS**************************** //biosC0[0x00] = psxBios_InitRCnt; diff --git a/libpcsxcore/sio.c b/libpcsxcore/sio.c index b3732d2..d251fa7 100644 --- a/libpcsxcore/sio.c +++ b/libpcsxcore/sio.c @@ -117,6 +117,20 @@ void sioWrite8(unsigned char value) { break; } } + // NegCon - Wipeout 3 + if( buf[parp] == 0x23 ) { + switch (value) { + // enter config mode + case 0x43: + buf[1] = 0x79; + break; + + // get status + case 0x45: + buf[1] = 0xf3; + break; + } + } } else padst = 0; return; diff --git a/libpcsxcore/socket.c b/libpcsxcore/socket.c index 31f82e2..c408bc3 100644 --- a/libpcsxcore/socket.c +++ b/libpcsxcore/socket.c @@ -15,6 +15,22 @@ * along with this program; if not, see <http://www.gnu.org/licenses>. */ +#ifdef NO_SOCKET + +int StartServer() { return 0;} +void StopServer() {} +void GetClient() {} +void CloseClient() {} +int HasClient() { return 0;} +int ReadSocket(char * buffer, int len) { return 0;} +int RawReadSocket(char * buffer, int len) { return 0;} +void WriteSocket(char * buffer, int len) {} + +void SetsBlock() {} +void SetsNonblock() {} + +#else // NO_SOCKET + #ifdef _WIN32 #include <winsock2.h> #endif @@ -252,3 +268,4 @@ void SetsNonblock() { fcntl(server_socket, F_SETFL, flags | O_NONBLOCK); #endif } +#endif // NO_SOCKET diff --git a/plugins/cdrcimg/cdrcimg.c b/plugins/cdrcimg/cdrcimg.c index 76cdfba..47371aa 100644 --- a/plugins/cdrcimg/cdrcimg.c +++ b/plugins/cdrcimg/cdrcimg.c @@ -14,7 +14,9 @@ #include <zlib.h> #ifndef _WIN32 #define CALLBACK +#ifndef NO_DYLIB #include <dlfcn.h> +#endif #else #define WIN32_LEAN_AND_MEAN #include <windows.h> @@ -285,7 +287,7 @@ static long CDRinit(void) return -1; } } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) if (pBZ2_bzBuffToBuffDecompress == NULL) { void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY); if (h == NULL) diff --git a/plugins/dfinput/main.c b/plugins/dfinput/main.c index 475ea07..4204b86 100644 --- a/plugins/dfinput/main.c +++ b/plugins/dfinput/main.c @@ -44,6 +44,7 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; PAD##n##_poll = PADpoll_guncon; \ guncon_init(); \ break; \ + case PSE_PAD_TYPE_NEGCON: \ case PSE_PAD_TYPE_GUN: \ default: \ PAD##n##_startPoll = PAD##n##__startPoll; \ @@ -52,13 +53,19 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; } \ } + void dfinput_activate(void) { + #ifndef HAVE_LIBRETRO PadDataS pad; + pad.portMultitap = -1; + pad.requestPadIndex = 0; PAD1_readPort1(&pad); select_pad(1); + pad.requestPadIndex = 1; PAD2_readPort2(&pad); select_pad(2); + #endif } diff --git a/plugins/dfinput/pad.c b/plugins/dfinput/pad.c index 7e00a11..853c8c8 100644 --- a/plugins/dfinput/pad.c +++ b/plugins/dfinput/pad.c @@ -254,6 +254,7 @@ unsigned char PADpoll(unsigned char value) { #define PADpoll PADpoll_ #endif +#ifndef HAVE_LIBRETRO unsigned char PADpoll_pad(unsigned char value) { if (CurByte == 0) { CurCmd = value; @@ -302,3 +303,4 @@ void pad_init(void) padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD; } } +#endif diff --git a/plugins/dfxvideo/gpulib_if.c b/plugins/dfxvideo/gpulib_if.c index 01b8dde..bb3ad56 100644 --- a/plugins/dfxvideo/gpulib_if.c +++ b/plugins/dfxvideo/gpulib_if.c @@ -309,11 +309,11 @@ void renderer_notify_res_change(void) extern const unsigned char cmd_lengths[256]; -int do_cmd_list(unsigned int *list, int list_len, int *last_cmd) +int do_cmd_list(uint32_t *list, int list_len, int *last_cmd) { unsigned int cmd = 0, len; - unsigned int *list_start = list; - unsigned int *list_end = list + list_len; + uint32_t *list_start = list; + uint32_t *list_end = list + list_len; for (; list < list_end; list += 1 + len) { |