diff options
84 files changed, 5042 insertions, 3769 deletions
diff --git a/.gitmodules b/.gitmodules deleted file mode 100644 index f93599e..0000000 --- a/.gitmodules +++ /dev/null @@ -1,6 +0,0 @@ -[submodule "libpicofe"] - path = frontend/libpicofe - url = git://notaz.gp2x.de/~notaz/libpicofe.git -[submodule "warm"] - path = frontend/warm - url = git://notaz.gp2x.de/~notaz/warm.git @@ -2,10 +2,16 @@ # default stuff goes here, so that config can override TARGET ?= pcsx -CFLAGS += -Wall -ggdb -Iinclude -ffast-math -ifndef DEBUG +CFLAGS += -Wall -Iinclude -ffast-math +ifeq ($(DEBUG), 1) +CFLAGS += -O0 -ggdb +else +ifeq ($(platform), vita) +CFLAGS += -O3 -DNDEBUG +else CFLAGS += -O2 -DNDEBUG endif +endif CXXFLAGS += $(CFLAGS) #DRC_DBG = 1 #PCNT = 1 @@ -56,21 +62,23 @@ libpcsxcore/psxbios.o: CFLAGS += -Wno-nonnull # dynarec ifeq "$(USE_DYNAREC)" "1" -OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/linkage_arm.o -OBJS += libpcsxcore/new_dynarec/pcsxmem.o +OBJS += libpcsxcore/new_dynarec/new_dynarec.o libpcsxcore/new_dynarec/arm/linkage_arm.o +OBJS += libpcsxcore/new_dynarec/backends/psx/pcsxmem.o else -libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -DDRC_DISABLE +libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -DDRC_DISABLE frontend/libretro.o: CFLAGS += -DDRC_DISABLE endif -OBJS += libpcsxcore/new_dynarec/emu_if.o -libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/assem_arm.c \ - libpcsxcore/new_dynarec/pcsxmem_inline.c +OBJS += libpcsxcore/new_dynarec/backends/psx/emu_if.o +libpcsxcore/new_dynarec/new_dynarec.o: libpcsxcore/new_dynarec/arm/assem_arm.c \ + libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c ifdef DRC_DBG -libpcsxcore/new_dynarec/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64 +libpcsxcore/new_dynarec/backends/psx/emu_if.o: CFLAGS += -D_FILE_OFFSET_BITS=64 CFLAGS += -DDRC_DBG endif ifeq "$(DRC_CACHE_BASE)" "1" libpcsxcore/new_dynarec/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 +libpcsxcore/new_dynarec/backends/psx/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 +libpcsxcore/new_dynarec/arm/%.o: CFLAGS += -DBASE_ADDR_FIXED=1 endif # spu @@ -194,6 +202,7 @@ endif ifeq "$(PLATFORM)" "libretro" OBJS += frontend/libretro.o CFLAGS += -DFRONTEND_SUPPORTS_RGB565 +CFLAGS += -DHAVE_LIBRETRO ifeq ($(MMAP_WIN32),1) OBJS += libpcsxcore/memmap_win32.o @@ -246,11 +255,19 @@ frontend/revision.h: FORCE %.o: %.S $(CC_AS) $(CFLAGS) -c $^ -o $@ +%.o: %.cpp + $(CXX) $(CXXFLAGS) -c -o $@ $< + + target_: $(TARGET) $(TARGET): $(OBJS) +ifeq ($(STATIC_LINKING), 1) + $(AR) rcs $@ $(OBJS) +else $(CC_LINK) -o $@ $^ $(LDFLAGS) $(LDLIBS) $(EXTRA_LDFLAGS) +endif clean: $(PLAT_CLEAN) clean_plugins $(RM) $(TARGET) $(OBJS) $(TARGET).map frontend/revision.h diff --git a/Makefile.libretro b/Makefile.libretro index 223ba9f..88a48f4 100644 --- a/Makefile.libretro +++ b/Makefile.libretro @@ -1,5 +1,7 @@ # Makefile for PCSX ReARMed (libretro) +DEBUG=0 + ifeq ($(platform),) platform = unix ifeq ($(shell uname -a),) @@ -20,35 +22,49 @@ CC_AS ?= $(CC) CFLAGS ?= TARGET_NAME := pcsx_rearmed - +GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)" +ifneq ($(GIT_VERSION)," unknown") + CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\" +endif +LIBZ := -lz +LIBPTHREAD := -lpthread +LIBDL := -ldl MMAP_WIN32=0 +EXTRA_LDFLAGS = # Unix ifeq ($(platform), unix) TARGET := $(TARGET_NAME)_libretro.so fpic := -fPIC - SHARED := -shared -Wl,--version-script=libretro/link.T + +else ifeq ($(platform), linux-portable) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC -nostdlib + EXTRA_LDFLAGS += -fPIC -nostdlib + LIBZ := + LIBPTHREAD := + LIBDL := + NO_UNDEF_CHECK = 1 # OS X else ifeq ($(platform), osx) TARGET := $(TARGET_NAME)_libretro.dylib fpic := -fPIC - SHARED := -dynamiclib - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - fpic += -mmacosx-version-min=10.5 - endif + fpic += -mmacosx-version-min=10.1 # iOS -else ifeq ($(platform), ios) +else ifneq (,$(findstring ios,$(platform))) ARCH := arm + USE_DYNAREC ?= 1 TARGET := $(TARGET_NAME)_libretro_ios.dylib +ifeq ($(USE_DYNAREC),0) + # Override + TARGET := $(TARGET_NAME)_interpreter_libretro_ios.dylib +endif fpic := -fPIC - SHARED := -dynamiclib ifeq ($(IOSSDK),) - IOSSDK := $(shell xcrun -sdk iphoneos -show-sdk-path) + IOSSDK := $(shell xcodebuild -version -sdk iphoneos Path) endif CC = clang -arch armv7 -isysroot $(IOSSDK) @@ -58,16 +74,18 @@ else ifeq ($(platform), ios) ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon HAVE_NEON = 1 BUILTIN_GPU = neon - USE_DYNAREC = 1 CFLAGS += -DIOS - OSXVER = `sw_vers -productVersion | cut -d. -f 2` - OSX_LT_MAVERICKS = `(( $(OSXVER) <= 9)) && echo "YES"` - ifeq ($(OSX_LT_MAVERICKS),"YES") - CC += -miphoneos-version-min=5.0 - CXX += -miphoneos-version-min=5.0 - CC_AS += -miphoneos-version-min=5.0 - CFLAGS += -miphoneos-version-min=5.0 - endif +ifeq ($(platform),ios9) + CC += -miphoneos-version-min=8.0 + CXX += -miphoneos-version-min=8.0 + CC_AS += -miphoneos-version-min=8.0 + CFLAGS += -miphoneos-version-min=8.0 +else + CC += -miphoneos-version-min=5.0 + CXX += -miphoneos-version-min=5.0 + CC_AS += -miphoneos-version-min=5.0 + CFLAGS += -miphoneos-version-min=5.0 +endif # PS3 else ifeq ($(platform), ps3) @@ -97,6 +115,52 @@ else ifeq ($(platform), psp1) AR = psp-ar$(EXE_EXT) CFLAGS += -DPSP -G0 +# Vita +else ifeq ($(platform), vita) + TARGET := $(TARGET_NAME)_libretro_vita.a + CC = arm-vita-eabi-gcc$(EXE_EXT) + AR = arm-vita-eabi-ar$(EXE_EXT) + CFLAGS += -DVITA + CFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon -marm + CFLAGS += -fsingle-precision-constant -mword-relocations -fno-unwind-tables + CFLAGS += -fno-asynchronous-unwind-tables -ftree-vectorize -funroll-loops + CFLAGS += -fno-optimize-sibling-calls + CFLAGS += -I$(VITASDK)/include -Ifrontend/vita + CFLAGS += -DNO_SOCKET -DNO_OS -DNO_DYLIB + ASFLAGS += -mcpu=cortex-a8 -mtune=cortex-a8 -mfpu=neon + +# CFLAGS += -U__ARM_NEON__ + HAVE_NEON = 1 + BUILTIN_GPU = neon + + USE_DYNAREC = 1 + DRC_CACHE_BASE = 0 + + ARCH = arm + STATIC_LINKING = 1 + +# CTR(3DS) +else ifeq ($(platform), ctr) + TARGET := $(TARGET_NAME)_libretro_ctr.a + CC = $(DEVKITARM)/bin/arm-none-eabi-gcc$(EXE_EXT) + CXX = $(DEVKITARM)/bin/arm-none-eabi-g++$(EXE_EXT) + AR = $(DEVKITARM)/bin/arm-none-eabi-ar$(EXE_EXT) + CFLAGS += -DARM11 -D_3DS -DNO_OS -DNO_DYLIB -DNO_SOCKET + CFLAGS += -march=armv6k -mtune=mpcore -mfloat-abi=hard -marm -mfpu=vfp -mtp=soft + CFLAGS += -Wall -mword-relocations + CFLAGS += -fomit-frame-pointer -ffast-math + CFLAGS += -Ifrontend/3ds + CFLAGS += -Werror=implicit-function-declaration + +# CFLAGS += -DPCSX +# BUILTIN_GPU = unai + USE_DYNAREC = 1 + DRC_CACHE_BASE = 1 + ARCH = arm + HAVE_NEON = 0 + + STATIC_LINKING = 1 + # Xbox 360 else ifeq ($(platform), xenon) TARGET := $(TARGET_NAME)_libretro_xenon360.a @@ -121,6 +185,7 @@ else ifeq ($(platform), wii) # QNX else ifeq ($(platform), qnx) TARGET := $(TARGET_NAME)_libretro_qnx.so + fpic := -fPIC CC = qcc -Vgcc_ntoarmv7le CC_AS = $(CC) HAVE_NEON = 1 @@ -130,11 +195,36 @@ else ifeq ($(platform), qnx) ARCH = arm CFLAGS += -D__BLACKBERRY_QNX__ -marm -mcpu=cortex-a9 -mtune=cortex-a9 -mfpu=neon -mfloat-abi=softfp ASFLAGS += -mcpu=cortex-a9 -mfpu=neon -mfloat-abi=softfp + MAIN_LDLIBS += -lsocket + LIBPTHREAD := + LIBDL := + +#Raspberry Pi 2 +else ifeq ($(platform), rpi2) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a7 -mfpu=neon-vfpv4 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 + +#Raspberry Pi 3 +else ifeq ($(platform), rpi3) + TARGET := $(TARGET_NAME)_libretro.so + fpic := -fPIC + CFLAGS += -marm -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + ASFLAGS += -mcpu=cortex-a53 -mfpu=neon-fp-armv8 -mfloat-abi=hard + HAVE_NEON = 1 + ARCH = arm + BUILTIN_GPU = neon + USE_DYNAREC = 1 # ARM else ifneq (,$(findstring armv,$(platform))) TARGET := $(TARGET_NAME)_libretro.so - SHARED := -shared -Wl,--no-undefined + fpic := -fPIC DRC_CACHE_BASE = 0 ifneq (,$(findstring cortexa8,$(platform))) CFLAGS += -marm -mcpu=cortex-a8 @@ -163,24 +253,28 @@ else ifneq (,$(findstring armv,$(platform))) # Windows else TARGET := $(TARGET_NAME)_libretro.dll - CC = gcc - fpic := -fPIC - LD_FLAGS := -fPIC - SHARED := -shared -static-libgcc -static-libstdc++ -s -Wl,--version-script=libretro/link.T - CFLAGS += -D__WIN32__ -D__WIN32_LIBRETRO__ + MAIN_LDFLAGS += -static-libgcc -static-libstdc++ -s + CFLAGS += -D__WIN32__ MMAP_WIN32=1 -endif - -CFLAGS += -fPIC -ifeq ($(platform),win) MAIN_LDLIBS += -lws2_32 -else ifneq ($(platform),qnx) - LDLIBS += -lpthread - MAIN_LDLIBS += -ldl + LIBPTHREAD := + LIBDL := endif + +CFLAGS += $(fpic) MAIN_LDFLAGS += -shared -MAIN_LDLIBS += -lm -lz -EXTRA_LDFLAGS = +MAIN_LDLIBS += $(LIBPTHREAD) $(LIBDL) $(LIBZ) + +# try to autodetect stuff for the lazy +ifndef ARCH +ARCH = $(shell $(CC) -dumpmachine | awk -F- '{print $$1}') +endif +ifndef HAVE_NEON +HAVE_NEON = $(shell $(CC) -E -dD - < /dev/null 2> /dev/null | grep -q __ARM_NEON__ && echo 1 || echo 0) +endif +ifeq ($(NO_UNDEF_CHECK)$(shell ld -v 2> /dev/null | awk '{print $$1}'),GNU) +MAIN_LDFLAGS += -Wl,--no-undefined +endif # try to autodetect stuff for the lazy ifndef ARCH @@ -200,6 +294,14 @@ SOUND_DRIVERS = libretro PLUGINS = NO_CONFIG_MAK = yes +libretro_all: all +ifeq ($(platform),ios) +ifeq ($(USE_DYNAREC),1) + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) clean + make -f Makefile.libretro USE_DYNAREC=0 platform=$(platform) +endif +endif + include Makefile # no special AS needed for gpu_neon diff --git a/blackberry_qnx/.cproject b/blackberry_qnx/.cproject deleted file mode 100644 index 565f4a9..0000000 --- a/blackberry_qnx/.cproject +++ /dev/null @@ -1,142 +0,0 @@ -<?xml version="1.0" encoding="UTF-8" standalone="no"?> -<?fileVersion 4.0.0?> - -<cproject storage_type_id="org.eclipse.cdt.core.XmlProjectDescriptionStorage"> - <storageModule moduleId="org.eclipse.cdt.core.settings"> - <cconfiguration id="com.qnx.qcc.toolChain.1762498539"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1762498539" moduleId="org.eclipse.cdt.core.settings" name="Device-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1762498539" name="Device-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1762498539.1561488424" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.682312592" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.1720929524" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.2107899725" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.596535986" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.742171011" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.982231418" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder arguments="-C .. -f Makefile.libretro platform=qnx" command="make" id="com.qnx.qcc.toolChain.1762498539.480897078" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.267897021" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1293751119" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.365274483" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.116424583" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1307903249" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1838739065" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1852803277" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1682937256" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1815033502"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1815033502" moduleId="org.eclipse.cdt.core.settings" name="Device-Release"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1815033502" name="Device-Release" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1815033502.1093640979" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.1811843468" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.66936807" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.1884625209" name="Target CPU:" superClass="com.qnx.qcc.option.cpu" value="com.qnx.qcc.option.gen.cpu.armle-v7" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.903071639" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.901433789" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.1169345860" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1815033502.1831895405" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.401658009" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.20820451" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.2022402746" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1180700251" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1403530230" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.1360707586" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.577346665" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.637344581" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - <cconfiguration id="com.qnx.qcc.toolChain.1271074456"> - <storageModule buildSystemId="org.eclipse.cdt.managedbuilder.core.configurationDataProvider" id="com.qnx.qcc.toolChain.1271074456" moduleId="org.eclipse.cdt.core.settings" name="Simulator-Debug"> - <externalSettings/> - <extensions> - <extension id="com.qnx.tools.ide.qde.core.QDEBynaryParser" point="org.eclipse.cdt.core.BinaryParser"/> - <extension id="org.eclipse.cdt.core.GmakeErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.CWDLocator" point="org.eclipse.cdt.core.ErrorParser"/> - <extension id="org.eclipse.cdt.core.GCCErrorParser" point="org.eclipse.cdt.core.ErrorParser"/> - </extensions> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <configuration artifactName="${ProjName}" buildProperties="" description="" id="com.qnx.qcc.toolChain.1271074456" name="Simulator-Debug" parent="org.eclipse.cdt.build.core.emptycfg"> - <folderInfo id="com.qnx.qcc.toolChain.1271074456.2095507025" name="/" resourcePath=""> - <toolChain id="com.qnx.qcc.toolChain.563285451" name="com.qnx.qcc.toolChain" superClass="com.qnx.qcc.toolChain"> - <option id="com.qnx.qcc.option.os.2028959839" name="Target OS:" superClass="com.qnx.qcc.option.os"/> - <option id="com.qnx.qcc.option.cpu.460119393" name="Target CPU:" superClass="com.qnx.qcc.option.cpu"/> - <option id="com.qnx.qcc.option.compiler.318948553" name="Compiler:" superClass="com.qnx.qcc.option.compiler"/> - <option id="com.qnx.qcc.option.runtime.1244314155" name="Runtime:" superClass="com.qnx.qcc.option.runtime"/> - <targetPlatform archList="all" binaryParser="com.qnx.tools.ide.qde.core.QDEBynaryParser" id="com.qnx.qcc.targetPlatform.2005367550" osList="all" superClass="com.qnx.qcc.targetPlatform"/> - <builder id="com.qnx.qcc.toolChain.1271074456.325666051" keepEnvironmentInBuildfile="false" managedBuildOn="false" name="Gnu Make Builder" superClass="org.eclipse.cdt.build.core.settings.default.builder"/> - <tool id="com.qnx.qcc.tool.compiler.821983732" name="QCC Compiler" superClass="com.qnx.qcc.tool.compiler"> - <option id="com.qnx.qcc.option.compiler.optlevel.1701209030" name="Optimization Level" superClass="com.qnx.qcc.option.compiler.optlevel" value="com.qnx.qcc.option.compiler.optlevel.0" valueType="enumerated"/> - <option id="com.qnx.qcc.option.compiler.includePath.1616908655" name="Include Directories (-I)" superClass="com.qnx.qcc.option.compiler.includePath" valueType="includePath"> - <listOptionValue builtIn="false" value="${QNX_TARGET}/usr/include/freetype2"/> - <listOptionValue builtIn="false" value="${QNX_TARGET}/../target-override/usr/include"/> - </option> - <inputType id="com.qnx.qcc.inputType.compiler.1059435667" superClass="com.qnx.qcc.inputType.compiler"/> - </tool> - <tool id="com.qnx.qcc.tool.assembler.1920350417" name="QCC Assembler" superClass="com.qnx.qcc.tool.assembler"> - <inputType id="com.qnx.qcc.inputType.assembler.618235584" superClass="com.qnx.qcc.inputType.assembler"/> - </tool> - <tool id="com.qnx.qcc.tool.linker.1321150712" name="QCC Linker" superClass="com.qnx.qcc.tool.linker"/> - <tool id="com.qnx.qcc.tool.archiver.1860233844" name="QCC Archiver" superClass="com.qnx.qcc.tool.archiver"/> - </toolChain> - </folderInfo> - </configuration> - </storageModule> - <storageModule moduleId="org.eclipse.cdt.core.externalSettings"/> - </cconfiguration> - </storageModule> - <storageModule moduleId="cdtBuildSystem" version="4.0.0"> - <project id="pcsx_rearmed.null.446260429" name="pcsx_rearmed"/> - </storageModule> - <storageModule moduleId="scannerConfiguration"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1815033502"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1762498539"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - <scannerConfigBuildInfo instanceId="com.qnx.qcc.toolChain.1271074456"> - <autodiscovery enabled="true" problemReportingEnabled="true" selectedProfileId="com.qnx.tools.ide.qde.managedbuilder.core.qccScannerInfo"/> - </scannerConfigBuildInfo> - </storageModule> - <storageModule moduleId="refreshScope" versionNumber="1"> - <resource resourceType="PROJECT" workspacePath="/pcsx_rearmed"/> - </storageModule> -</cproject> diff --git a/blackberry_qnx/.project b/blackberry_qnx/.project deleted file mode 100644 index c8e1e20..0000000 --- a/blackberry_qnx/.project +++ /dev/null @@ -1,84 +0,0 @@ -<?xml version="1.0" encoding="UTF-8"?> -<projectDescription> - <name>pcsx_rearmed</name> - <comment></comment> - <projects> - </projects> - <buildSpec> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.genmakebuilder</name> - <triggers>clean,full,incremental,</triggers> - <arguments> - <dictionary> - <key>?name?</key> - <value></value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.append_environment</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.autoBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildArguments</key> - <value>-C .. -f Makefile.libretro platform=qnx</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.buildCommand</key> - <value>make</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.cleanBuildTarget</key> - <value>clean</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.contents</key> - <value>org.eclipse.cdt.make.core.activeConfigSettings</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableAutoBuild</key> - <value>false</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableCleanBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.enableFullBuild</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.fullBuildTarget</key> - <value>all</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.stopOnError</key> - <value>true</value> - </dictionary> - <dictionary> - <key>org.eclipse.cdt.make.core.useDefaultBuildCmd</key> - <value>false</value> - </dictionary> - </arguments> - </buildCommand> - <buildCommand> - <name>org.eclipse.cdt.managedbuilder.core.ScannerConfigBuilder</name> - <triggers>full,incremental,</triggers> - <arguments> - </arguments> - </buildCommand> - <buildCommand> - <name>com.qnx.tools.bbt.xml.core.bbtXMLValidationBuilder</name> - <arguments> - </arguments> - </buildCommand> - </buildSpec> - <natures> - <nature>org.eclipse.cdt.core.cnature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.managedBuildNature</nature> - <nature>org.eclipse.cdt.managedbuilder.core.ScannerConfigNature</nature> - <nature>com.qnx.tools.ide.bbt.core.bbtnature</nature> - </natures> -</projectDescription> diff --git a/debian_maemo/buildpkg b/debian_maemo/buildpkg deleted file mode 100644 index 4c34f94..0000000 --- a/debian_maemo/buildpkg +++ /dev/null @@ -1,13 +0,0 @@ -#!/bin/bash -e - -NAME=`head debian/changelog -n1 | sed -n 's/^\(.*\) (\(.*\)) .*/\1-\2/p'` -[[ -z $NAME ]] && { echo "Could not extract package name and version from debian/changelog" 2>&1; exit 1; } - -rm -rf ../$NAME -cp -r ../`basename $PWD` ../$NAME -cd ../$NAME -rm -rf .git* -find . -depth -name .svn -type d -exec rm -r {} \; -find . -name '*~' -exec rm {} \; - -LD_LIBRARY_PATH=/usr/lib dpkg-buildpackage -rfakeroot $* diff --git a/debian_maemo/changelog b/debian_maemo/changelog deleted file mode 100644 index e3395de..0000000 --- a/debian_maemo/changelog +++ /dev/null @@ -1,112 +0,0 @@ -pcsxrearmed (0.4.0.14.13) unstable; urgency=low - - * Updated source to notaz git version - - -- sakya <sakya_tg@yahoo.it> Fri, 15 Feb 2013 12:50:28 +0200 - -pcsxrearmed (0.4.0.14.12) unstable; urgency=low - - * Fixed a problem with controller and vibration (Gran Turismo 2, Wipeout 3) - * Added dependency to libts - - -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 17:09:33 +0200 - -pcsxrearmed (0.4.0.14.11) unstable; urgency=low - - * Added option -guncon and -gunnotrigger to activate guncon controller type - - -- sakya <sakya_tg@yahoo.it> Wed, 16 May 2012 09:37:12 +0200 - -pcsxrearmed (0.4.0.14.10) unstable; urgency=low - - * Added option -corners to set action to execute when clicking on display corners - * Fixed problem with notification using gles plugin - * Fixed controller problem with game "Heart Of Darkness" (maybe others?) - - -- sakya <sakya_tg@yahoo.it> Fri, 11 May 2012 16:38:29 +0200 - -pcsxrearmed (0.4.0.14.9) unstable; urgency=low - - * Added support to .mdf extension - * Added option -vibration to activate vibration - - -- sakya <sakya_tg@yahoo.it> Tue, 1 May 2012 12:19:49 +0200 - -pcsxrearmed (0.4.0.14.8) unstable; urgency=low - - * Added option -disc to set the initial disc in multi discs images (used when loading a savestate with -load) - * Added option -autosave - * Fixed disc change for multi discs images (PBP) - * Merged commits from Notaz git - * drc: inv: fix ram ofset and mirror handling - * support emulated RAM mapped at offset - - -- sakya <sakya_tg@yahoo.it> Fri, 20 Apr 2012 20:27:19 +0200 - -pcsxrearmed (0.4.0.14.7) unstable; urgency=low - - * Fixed -displayon - - -- sakya <sakya_tg@yahoo.it> Sun, 15 Apr 2012 17:22:08 +0200 - -pcsxrearmed (0.4.0.14.6) unstable; urgency=low - - * Added option -keys to set the keys config file - * Fixed L1/L2/R1/R2 - * Added autopause on incoming call - - -- sakya <sakya_tg@yahoo.it> Wed, 13 Apr 2012 12:51:35 +0200 - -pcsxrearmed (0.4.0.14.5) unstable; urgency=low - - * Fixed accelerometer using gles - * Added -analog option to use the accelerometer as the analog pad - * Added options to set accelerometer sens, max value, y_def - * Added -displayon option to keep the display on (useful when playing using the accelerometer) - - -- sakya <sakya_tg@yahoo.it> Tue, 10 Apr 2012 15:34:11 +0200 - -pcsxrearmed (0.4.0.14.4) unstable; urgency=low - - * Fixed -load option - * Added disc change (configured a new key) - - -- sakya <sakya_tg@yahoo.it> Fri, 06 Apr 2012 13:54:56 +0200 - -pcsxrearmed (0.4.0.14.3) unstable; urgency=low - - * Added options to set various gles settings - * Fixed save state slot selection - * Added notification on save state slot change - - -- sakya <sakya_tg@yahoo.it> Wed, 04 Apr 2012 10:20:18 +0200 - -pcsxrearmed (0.4.0.14.2) unstable; urgency=low - - * Fixed fullscreen using gpu-gles - * Fixed crash when saving savestate using gpu-gles - * Added options to set spu reverb and interpolation (disabled by default) - - -- sakya <sakya_tg@yahoo.it> Sun, 01 Apr 2012 11:42:20 +0200 - -pcsxrearmed (0.4.0.14.1) unstable; urgency=low - - * Added option to set psx region (NTSC/PAL/Auto) - * Use PulseAudio (better audio) - - -- sakya <sakya_tg@yahoo.it> Wed, 30 Mar 2012 09:44:51 +0200 - -pcsxrearmed (0.4.0.14) unstable; urgency=low - - * Updated to r14 - * Added --help - * PCSX4All - - -- sakya <sakya_tg@yahoo.it> Sun, 27 Dec 2011 00:02:27 +0200 - -pcsxrearmed (0.4.0.12.2) unstable; urgency=low - - * gpu-gles - - - -- Bonapart <bonapart@programist.ru> Sun, 27 Dec 2011 00:02:27 +0200 diff --git a/debian_maemo/compat b/debian_maemo/compat deleted file mode 100644 index 7ed6ff8..0000000 --- a/debian_maemo/compat +++ /dev/null @@ -1 +0,0 @@ -5 diff --git a/debian_maemo/control b/debian_maemo/control deleted file mode 100644 index 4469ed8..0000000 --- a/debian_maemo/control +++ /dev/null @@ -1,115 +0,0 @@ -Source: pcsxrearmed -Section: user/games -Priority: extra -Maintainer: Bonapart <bonapart@programist.ru> -Build-Depends: debhelper (>= 5), zlib1g-dev, libhildon1-dev, libpulse-dev, libasound2-dev, libbz2-dev, libgles1-sgx-img-dev, opengles-sgx-img-common-dev, libosso-dev, libdbus-1-dev, libhildonfm2-dev, libts-dev -Standards-Version: 3.7.3 - -Package: pcsxrearmed -Architecture: armel -Depends: ${shlibs:Depends}, libts-0.0-0 -Description: Sony PlayStation emulator -XSBC-Homepage: http://notaz.gp2x.de/pcsx_rearmed.php -XSBC-Bugtracker: http://notaz.gp2x.de/pcsx_rearmed.php -XB-Maemo-Display-Name: PCSX-ReArmed -XB-Maemo-Icon-26: - iVBORw0KGgoAAAANSUhEUgAAADAAAAAwCAYAAABXAvmHAAAAAXNSR0IArs4c - 6QAAEStJREFUaN7Fmn+wXVV1xz9r733uufe+e9+DJIRESEICEQghAUQBI8Uo - ik7jrxm1o+3ooB2RkWrtONqZlhn7Y8bRUVudqVZsoTjFH2CrSKsVEFIQIr8C - JARC0CDkBwkkIcl7L7n3nLP36h97n3Pvo07/7c2cOfeenB9rr/Vd3/Vd6zxh - 7DM52b9isj+5YcGC+a9bunTpOVNTU91WK5Msy1ECIgYRMGKxzmGtQQBrHSZ9 - R8C5DOcc1hiMtTjrsM4hAtZYWq1W/H9nyZzDZVk6x9LKWmSteH2rlZNlLhw/ - fnzXszt3fmHjxo13bH74oReBwbbtO6r0ODht5UpnfXXdytOXX+mswVcl1hqc - swjgQ0BV8T7gfSCEQFBQFFQJqqhquptpHCJiMGIQKxhjsdZircMai8kczibj - XUaWZdi0d1lGlrVwmdN2nsvypUtZvmwpw7LY8dSTT37yX264/sGgOrNl67ZS - AFavPudTF5y76u9fOniQZ3/7PLPHjuG9Z8wSJO7QeAABVIW0DFAFBEVANF0j - AGh9XBWV9L3eRFAx6dr6XFDiMWMNy049VS9Yu4o/et+7xBj78u5duz78lS9/ - 8U6UoZx59lnZ2StXbMP7lT+7cyNFUWCsbQwmyLhTo1EiydvpSFogIpiIMQST - zhOMMSAmnmcMIhYxgogFYxBjEYnnYOIWn2OjA4IiRjhj+TL98uc/K5X3W7Zs - 2fKBf/72Pz5tZmdmz5jodJZtfeppyqqK+LQx3EYtpm0wRChYazBWMCYaasRg - TFwAUu/TsgyIiecytkAxBjG1sTZuzfe4GIwDk4GxqMmQLAdx7PjNs/KNG75H - 3srWLFmy5E3P79rj7Omnr7is08o+8Otnn6MYFtGIErQCyZXsqxW6B3S3gQqw - /I6PNgEZwSPmQAMVYxERVCSSQTI8et4iYtF6MckhcXECJuWSGPbvf1EvumCN - nDA1taIoypuNr6pFg6JgMEjGe2Ch0vpmSXdnQeuqQPeeivZtBbI6oIWiKJqS - WLU2vM6POh2SIZjEXpIMtglGdSTib9IxEsSoFy9mBFtjmTleyJ33bMIYOevQ - oUMnuLIs5w+LkuCr+HAP+dcqWu8PFD8SZAEwA9kGxawuOXZeBjMGXJ0BNMk4 - gpIZYbr2ZvJ6hJBrftcLEGPTfVJ+EBcfUo6pgohQhMCBgwdB4fDhw5MG6JdV - RQgKQZAO2IuVMIDB+xzhcWF4lWP4FUPYZJATf1dCp0ROxps69LXR1mGsTZtD - TNrbWE/i9/jbmFEiRx6oCSCRRHJZURTMzMx0nUK7LD2KIgZ0CPoM2KWQf8tj - TlPkZGX4GRdNdiTvzzW+Nrg2voaIqb1uHUYsYm2KRNxURnBSTfdB4k5r6q0x - qogIIShFWVKWZWa8962y8g0eRGH4GYd/Usg/GsjerHQ2VnRuK7GvC6iXhjpH - xo+MyPOcdruNsTZyughiXFxI42mHuAyswzgLNrGRNWANYg1gUCOoMQ2DYUZ5 - JgKqahxI5n0Y4cJBeMxw7LwM+6ZA62880o454C4rmb1U4AkLrXHjY6UNqpx6 - ymKm+n2qEBgUFUemZzk8PYsPinMxIsa6xDAR71rXjFj/CJo8WdNDXeQTY4iA - tZHVnKo61VBfCW3FXqzoUCl/bnB/ECj+0uGurGj/bcBdESifcBGLKQIN5oFu - p8OCBfPpdDp0u13yvI1X5fnd+9jx210cOjJDnmUY4yLOE9xACEmamHoRQZtF - aar0oBgxOJfFBYgxTjXxeGVgnqdzd4nuh9mLshizFkieHDKcyzam5nNjICjt - djS81+sxMTHB5OQkvV6P89euoZXn3Pfgo9y16RGKMiDWRu8bQVTQEEAiPQsh - KoAwqjApDBgjZM5F54mIa5IwA31OKL5kMYthYkeJe2ege39Bfm3Ab4fqJy7i - PVjEW/AGCel3sHTb0fh+v8/k5CQ+KEemZ+h0u8yfN48PvvddXPvpq5ma6qMK - 1goGk2qdIKYmZlMrLiBE+ISAAkaELMswxohx1mZSaxgBnFD8hePYBx3V92PW - hEeFwecyjr+lA7stsgDMUkWWhLidGpBXBWRxQPvKZH+yWcA9v9rMN2+8mWd2 - Pk+/36fX6/G615zHtZ++GucsqpIkR6obgJFXVPfa+QliYgwuy7DW4sQYGdFg - UsMC1fct1Q8c+ZdKqq9lhBds1D3WYt8zwP3JMNFc/RTBiPLcXdtZ9/LFdHtd - +v0+/ck+Yi0vHXyZXq9Ht9ul3W5z2bqLeNsb13HrHffQytvUVdSIRPyPVfna - +HpJxiSpL4LTEDAxHFFC12IssUz51y2oBNOSVPqF8MMu1X90QWykR7EY46iq - ite89VImzp6Ixvf7tLIW1rbodDtMTEzQ6XTI85w8z7nowvP54U/vJs9Hyanq - myKpKKIpAppEsWqCXhRlTlUxSbvXJTtSlYyS1tTcnKrt0CKFbSqqcZHnfeVY - 0DupMb7X65HlOVhD3mo33s/znCzLWLl8Ka08IxBtUA1NUBVFJeoukdg0ee+Z - mZllMBwgCM45cSGEEPHX0OzcRqaWv4y+R/GVqmqSCJJ6iM5Ep2GeXq9H1soR - sWSt1hzjsyxj3oknMJG3KGqmqTsmiaCvo1BWnmJYUJRDKu9HjZIqzhijseSb - RlXW+zoqkSJMoyZreWDHKms8Bt1urzG+1+vhsgwjllaWkef5qB+2lsoHfEj8 - PoZ3QQjeU5QFRVFSlRUh+Oa8qIK1gVAwxozEWLpN3Tr6oIhRjIJY0yhHsbEB - qQWaMRapPN1uh36/z8TEBN1ul8xliAHrsjnGG2PY88I+Zo4dZ6I3EVnHB4qy - ZDgYUpYVGkJqbUO0SAEJqAYq72MEAG+SFtc6DwREU6+bIhCA4AMWgzhpEnek - c2KE6iJWV+I4jbA4Z2vubqK96aHHokQuo5eHRYEGT0hDBG0wLU0VltRi+qqK - CxARX+uKV+J/1HhHcRXVo+C9EvB4FWwAYwLz5p+IwZC1crrdLp1Oh3a7jRhD - 5QODwSAZBoPhkLvv/RXfuP4mPIbS+5iA49t4m9QcjwUt+EBRFrV0I4y8ImOV - Q5qOKiZzrUINKlBVnrzlWLFsCWefdQbr113CLx94BCNCp9Oh0+nQarWoqujZ - m370U3bs3MWik+Zx5OhRfnHPJnrdLsOyZPr4MarKY63BGtMYKnXhIsKmXogP - nqIogajuGwjVTKQyd+yROnQCUJYVJ05NsWb1Kt74hks4c+XpnPKqxfT7fZ58 - 5lmyVqsxPsuilsqtsPrMM7jktWs5/bRl9HtdrvnYh7HWMhgMefHAQR7c/Dg/ - u3Mjj27djnEWI6aJQNJ0zcd7T1EMI4RUtaqTamxWMoJOUoo+KKcsWsglF13I - 773hEk6av4B+vzcnYV8+fKQpUs45nHMcPTrNT757Heede04zwfhfcAXeuv5S - Pvepj3PHXffw2c9/kWd378Vg0DAXRqrgK89gMCSEMJbEafxBrVoZNS55nnP5 - G9dx+frLmgJVU+TR6Vnu+O/7+Pdb/4vHt2zjfe/ZEKdsaTRTVSWLTl6Ic5ay - qjg2e4ytTz3NDf96C4889jjHBkP+/E+v5sMfeC/tPOcdb38LU/0+7//jT3J0 - enpsXDDKCx88xTAtQKFsIKRjA6t6WqZw9qvP4PL1lzE5OcnExATtdocHHn6M - +x/azP0PPkorb7P23HO4MG8nre6oqdmK4cCBg+zavYc77v4lP7/rHrZse4oz - Vqxg7bnn8o4r1vPmy9Y1zATw4oGDBO/RkPJRx1pKjRAaDCMpOIGqSWIZTdqU - URIfPjpNnrdHnncZe/e/xAknnMDVH/0Q6y+9hFVnvZp/+s73CaqM15V+v8s1 - n72W5/fsY3Z2lt9/y3o+9fErOX/NOSxfthTnRoOmF/bt58bv3sz1N93CzOzs - qJGRxEAoSCB4z3A4yoFiVAdovB6naQYV4bnd+/jCV7/BuzdcwaVvuJjTly/i - z675GO12m06n00gDl2WNWhyfXBw9Ms2nr7qSd2+4gkUnL6Tdzkd5oPCrBx/m - m9d/h433PcjR6RmGRTXWTupcFKnifcWwzgERKWMEatYZCdjxAe2uF/bxtW/d - yNe/fSNrV69i1dmvZvHCRbSyDLGW/fv38/O77uX1//CVOcl5+MhRbv/xTSw6 - eWGjX7z3TE9P88Nbf8oNN93MY1ufjHoqiUljYncW6sSlrgFRRnhfMSzqHFAt - jJFGsMXRRuR+bSZjMULORSmxdfuveXzbMzFlxiYS5XDI3n37eenAQebPOzFC - CeLMCXjpwEGe3P4Mt/zoNv7z9l/w/J59KYKt6NwxxlFlrIAx+h0ghEAxLOIC - gmpRj/5C7XV5xfiiRkRiVWcdtOq5T2z9xBjaeYu/+uLf8YN/u5ULzlvNhisu - ZzAcsOnBh9m9dy+3/+JeNm95giNHZ8haGZNT/cjxGtvGKB9CQkpACQRCwkBI - 8jouoCxLvPfqNIRBnQOicY6TXBvlrMaGew60dCT8JIUcBWMNBw4d5t5ND3Pf - A4/wvVt+wuzsMbZt/zXT09MMyxJjLZ1Op1GUUmuexsPjsoH4m7lsFEKgrLXQ - KInndIdzJs9xRhPHHLFKayrtBiQZks4REWxm0QAHXz4MCoNiCBiyzKVnNJiI - 9wmRYXTMeG2eERKca4qJLBRqNaqqRZ7nWOua1q2REPWKAs1UTALxfVkawMYb - +9F8RxQNZvz9B6iMTbLjTUMIc7yu9Z4wFoUR89T72ODXL0oEZ4yUcQFWVcbZ - TZtmRhtRFXm4rtIRXqnZVghGRzYzPmtPhKraDK8aVtG52J/LOjp6hUVI3lVE - RK2NswsHlK34llCa7BeNuKd2uU0tTkA1hiJG1qNqmh6C1F01EJyzklFyJspJ - JBNSDigStDlWGz96AZGco4qNr31qOS1F1spod9ujKXP9Uq5OgWa0B0ZHN2s8 - Qz3XTBBibpvYxLSBgI4aljpx0Yb3m1eHiaHGtZ8I5O0cUMqy9KaqyuPe+4OL - Fy4kc07rmzH2kDjqCOnBPr4F0YCGufuAJwSPBo+G6hVbOlc9IV2j9bWEdN8k - F9SPYEZgjH5oOdHFCxcwHBb7q6oqzNGj00cOHjz05No1q1lw4qSoD801UlfC - Bn5a3yfOMTUWn7gF8CkR/4+NEFknfq/vXz9z9LwRtBI0gxK8Z+H8E2XtmtXs - 3bv38enp6VlzbHb25W3bnnhANQzeseFtKBWVL0bYk9jU61jySTP1Do2XGsrT - MOa5sU1HXZXq+LFRtyK11yXMmciB4qsCoeRd73w7RVEc37x586YjR44ctsba - 7NChQ3m73T7ltRe+Zumac1ax9Yltenx6RsSmF26M6aRxlkpo1zQASEgevQTU - MRgSKTJomHMMJb7pb/7RRDbWBk91/DiTUxN6zVUfkWVLlnDvvffed//99/8Y - +I0VkWCtMc/s2DHw3i9at+71C996+Xrp9Sd01/O7ZHD8GASP+gpClfbxt097 - rY/7ilAlvPt4bHwLVUmo4n1COten65rzqmL0PXgmum3eueEK/ciH/lBOmJrU - 2267bevtt9/+XeBRYJ8Att3OT6oqf6b3/pJ58+a96ROf+MRFZ5115sTk5JTp - 93vSzttYF//OwaU/2siyLPatiSqNiXI8TjhoeoIRe0gjr4MGqjI6oKoqyqKk - KAqGxRBf+TQIGFKWJbMzszozOxt27tw5e9111z1w4MCBO4H7gKeBlwWg3c5b - 3of5VVWtUNVzgfMvvvji80477bQFS5Ys6VprTd301IaNG2iMaWBR9wKNwa/Y - 69j8sqoqQhpeeR8Nr+V22sKePXuO7969+6WHHnroseT1x4GdwCGgbFzU7XSy - wXDYDyGcDKwAlgOLgUmgzf/PZwgcAV4Ank2G7wemgRLgfwDIFWZCNtkwCgAA - AABJRU5ErkJggg== diff --git a/debian_maemo/copyright b/debian_maemo/copyright deleted file mode 100644 index 75a6b06..0000000 --- a/debian_maemo/copyright +++ /dev/null @@ -1,2 +0,0 @@ -this package was maemonized by Roman Deninberg <bonapart@programist.ru> -Mon, 10 Jan 2011 02:00:13 +0100 diff --git a/debian_maemo/dirs b/debian_maemo/dirs deleted file mode 100644 index 33359b8..0000000 --- a/debian_maemo/dirs +++ /dev/null @@ -1 +0,0 @@ -usr/games diff --git a/debian_maemo/docs b/debian_maemo/docs deleted file mode 100644 index e845566..0000000 --- a/debian_maemo/docs +++ /dev/null @@ -1 +0,0 @@ -README diff --git a/debian_maemo/files b/debian_maemo/files deleted file mode 100644 index 0cc57dd..0000000 --- a/debian_maemo/files +++ /dev/null @@ -1 +0,0 @@ -pcsxrearmed_0.4.0.14.13_armel.deb user/games extra diff --git a/debian_maemo/install b/debian_maemo/install deleted file mode 100644 index a260186..0000000 --- a/debian_maemo/install +++ /dev/null @@ -1,6 +0,0 @@ -pcsx opt/maemo/usr/games/ -plugins/spunull/spunull.so opt/maemo/usr/games/plugins -plugins/gpu_unai/gpu_unai.so opt/maemo/usr/games/plugins -#plugins/gpu_unai/gpuPCSX4ALL.so opt/maemo/usr/games/plugins -plugins/dfxvideo/gpu_peops.so opt/maemo/usr/games/plugins -plugins/gpu-gles/gpu_gles.so opt/maemo/usr/games/plugins diff --git a/debian_maemo/rules b/debian_maemo/rules deleted file mode 100644 index 5230bf7..0000000 --- a/debian_maemo/rules +++ /dev/null @@ -1,68 +0,0 @@ -#!/usr/bin/make -f -# -*- makefile -*- - -#export DH_VERBOSE=1 - -DEB_HOST_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_HOST_GNU_TYPE) -DEB_BUILD_GNU_TYPE ?= $(shell dpkg-architecture -qDEB_BUILD_GNU_TYPE) -DEB_HOST_ARCH ?= $(shell dpkg-architecture -qDEB_HOST_ARCH) - -#GAME_VERSION := $(shell head debian/changelog -n1 | sed -n 's/.* (\(.*\)) .*/\1/p') -CFLAGS = -Wall -g - -ifneq (,$(findstring noopt,$(DEB_BUILD_OPTIONS))) - CFLAGS += -O0 -else - CFLAGS += -O2 -endif - -build: build-stamp - -build-stamp: - dh_testdir - ./configure --platform=maemo --gpu=neon --sound-drivers=pulseaudio --enable-neon - $(MAKE) - strip pcsx - strip plugins/gpu_unai/gpu_unai.so - strip plugins/gpu-gles/gpu_gles.so - strip plugins/spunull/spunull.so - touch build-stamp - -clean: - dh_testdir - dh_testroot - rm -f build-stamp - dh_clean - $(MAKE) clean clean_plugins - -install: build - dh_testdir - dh_testroot - dh_installdirs - mkdir -p "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - chmod 777 "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - chown user "$(CURDIR)"/debian/pcsxrearmed/opt/maemo/usr/games/screenshots - dh_install - -binary-indep: build install - -binary-arch: build install - dh_testdir - dh_testroot - dh_installchangelogs - dh_installdocs - #dh_installmenu - dh_link - dh_strip - dh_compress - dh_fixperms - dh_installdeb - dh_makeshlibs - dh_shlibdeps - dh_gencontrol - #maemo-optify - dh_md5sums - dh_builddeb - -binary: binary-indep binary-arch -.PHONY: build clean binary-indep binary-arch binary install diff --git a/frontend/320240/caanoo.gpe b/frontend/320240/caanoo.gpe deleted file mode 100755 index 9d6154a..0000000 --- a/frontend/320240/caanoo.gpe +++ /dev/null @@ -1,23 +0,0 @@ -#!/bin/sh - -# Wiz's timings are already good, apply this for Caanoo -if [ -e /dev/accel ]; then - ./pollux_set "ram_timings=3,9,4,1,1,1,1" -fi - -# the sync mount causes problems when writing saves, -# probably due to many write calls, so have to get rid of it -if grep mmcblk /proc/mounts | grep -q '\<sync\>'; then - oldmount=`grep mmcblk /proc/mounts | grep '\<sync\>' | awk '{print $4}'` - mount /dev/mmcblk0p1 /mnt/sd/ -o remount,dirsync,noatime -fi - -./pcsx "$@" -sync - -if [ -n "$oldmount" ]; then - mount /dev/mmcblk0p1 /mnt/sd/ -o remount,$oldmount -fi - -cd /usr/gp2x -exec ./gp2xmenu diff --git a/frontend/320240/haptic_s.cfg b/frontend/320240/haptic_s.cfg deleted file mode 100644 index 624056d..0000000 --- a/frontend/320240/haptic_s.cfg +++ /dev/null @@ -1,3 +0,0 @@ -0 126 -100 -126 -115 0 diff --git a/frontend/320240/haptic_w.cfg b/frontend/320240/haptic_w.cfg deleted file mode 100644 index 3585a71..0000000 --- a/frontend/320240/haptic_w.cfg +++ /dev/null @@ -1,3 +0,0 @@ -0 54 -100 -126 -105 0 diff --git a/frontend/320240/pcsx26.png b/frontend/320240/pcsx26.png Binary files differdeleted file mode 100644 index ed220a0..0000000 --- a/frontend/320240/pcsx26.png +++ /dev/null diff --git a/frontend/320240/pcsx_rearmed.ini b/frontend/320240/pcsx_rearmed.ini deleted file mode 100644 index b15497f..0000000 --- a/frontend/320240/pcsx_rearmed.ini +++ /dev/null @@ -1,6 +0,0 @@ -[info] -name="PCSX ReARMed" -icon="/pcsx_rearmed/pcsx26.png" -path="/pcsx_rearmed/pcsx.gpe" -title="/pcsx_rearmed/pcsxb.png" -group="GAMES" diff --git a/frontend/320240/pcsxb.png b/frontend/320240/pcsxb.png Binary files differdeleted file mode 100644 index ff5a48a..0000000 --- a/frontend/320240/pcsxb.png +++ /dev/null diff --git a/frontend/320240/pollux_set.c b/frontend/320240/pollux_set.c deleted file mode 100644 index f49e777..0000000 --- a/frontend/320240/pollux_set.c +++ /dev/null @@ -1,389 +0,0 @@ -/* - * quick tool to set various timings for Wiz - * - * Copyright (c) Gražvydas "notaz" Ignotas, 2009 - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * * Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * * Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * * Neither the name of the organization nor the - * names of its contributors may be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE - * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL - * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR - * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER - * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, - * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE - * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - * - * HTOTAL: X VTOTAL: 341 - * HSWIDTH: 1 VSWIDTH: 0 - * HASTART: 37 VASTART: 17 - * HAEND: 277 VAEND: 337 - * - * 120Hz - * pcd 8, 447: + 594us - * pcd 9, 397: + 36us - * pcd 10, 357: - 523us - * pcd 11, 325: +1153us - * - * 'lcd_timings=397,1,37,277,341,0,17,337;dpc_clkdiv0=9' - * 'ram_timings=2,9,4,1,1,1,1' - */ - -#include <stdio.h> -#include <stdlib.h> -#include <string.h> -//#include "pollux_set.h" -#define BINARY - -/* parse stuff */ -static int parse_lcd_timings(const char *str, void *data) -{ - int *lcd_timings = data; - const char *p = str; - int ret, c; - ret = sscanf(str, "%d,%d,%d,%d,%d,%d,%d,%d", - &lcd_timings[0], &lcd_timings[1], &lcd_timings[2], &lcd_timings[3], - &lcd_timings[4], &lcd_timings[5], &lcd_timings[6], &lcd_timings[7]); - if (ret != 8) - return -1; - /* skip seven commas */ - for (c = 0; c < 7 && *p != 0; p++) - if (*p == ',') - c++; - if (c != 7) - return -1; - /* skip last number */ - while ('0' <= *p && *p <= '9') - p++; - - return p - str; -} - -static int parse_ram_timings(const char *str, void *data) -{ - int *ram_timings = data; - const char *p = str; - int ret, c; - float cas; - - ret = sscanf(p, "%f,%d,%d,%d,%d,%d,%d", - &cas, &ram_timings[1], &ram_timings[2], &ram_timings[3], - &ram_timings[4], &ram_timings[5], &ram_timings[6]); - if (ret != 7) - return -1; - if (cas == 2) - ram_timings[0] = 1; - else if (cas == 2.5) - ram_timings[0] = 2; - else if (cas == 3) - ram_timings[0] = 3; - else - return -1; - for (c = 0; c < 6 && *p != 0; p++) - if (*p == ',') - c++; - if (c != 6) - return -1; - while ('0' <= *p && *p <= '9') - p++; - - return p - str; -} - -static int parse_decimal(const char *str, void *data) -{ - char *ep; - - *(int *)data = strtoul(str, &ep, 10); - if (ep == str) - return -1; - - return ep - str; -} - -/* validate and apply stuff */ -static int apply_lcd_timings(volatile unsigned short *memregs, void *data) -{ - int *lcd_timings = data; - int i; - - for (i = 0; i < 8; i++) { - if (lcd_timings[i] & ~0xffff) { - fprintf(stderr, "pollux_set: invalid lcd timing %d: %d\n", i, lcd_timings[i]); - return -1; - } - } - - for (i = 0; i < 8; i++) - memregs[(0x307c>>1) + i] = lcd_timings[i]; - - return 0; -} - -static const struct { - signed char adj; /* how to adjust value passed by user */ - signed short min; /* range of */ - signed short max; /* allowed values (inclusive) */ -} -ram_ranges[] = { - { 0, 1, 3 }, /* cas (cl) */ - { -2, 0, 15 }, /* trc */ - { -2, 0, 15 }, /* tras */ - { 0, 0, 15 }, /* twr */ - { 0, 0, 15 }, /* tmrd */ - { 0, 0, 15 }, /* trp */ - { 0, 0, 15 }, /* trcd */ -}; - -static int apply_ram_timings(volatile unsigned short *memregs, void *data) -{ - int *ram_timings = data; - int i, val; - - for (i = 0; i < 7; i++) - { - ram_timings[i] += ram_ranges[i].adj; - if (ram_timings[i] < ram_ranges[i].min || ram_timings[i] > ram_ranges[i].max) { - fprintf(stderr, "pollux_set: invalid RAM timing %d\n", i); - return -1; - } - } - - val = memregs[0x14802>>1] & 0x0f00; - val |= (ram_timings[4] << 12) | (ram_timings[5] << 4) | ram_timings[6]; - memregs[0x14802>>1] = val; - - val = memregs[0x14804>>1] & 0x4000; - val |= (ram_timings[0] << 12) | (ram_timings[1] << 8) | - (ram_timings[2] << 4) | ram_timings[3]; - val |= 0x8000; - memregs[0x14804>>1] = val; - - for (i = 0; i < 0x100000 && (memregs[0x14804>>1] & 0x8000); i++) - ; - - return 0; -} - -static int apply_dpc_clkdiv0(volatile unsigned short *memregs, void *data) -{ - int pcd = *(int *)data; - int tmp; - - if ((pcd - 1) & ~0x3f) { - fprintf(stderr, "pollux_set: invalid lcd clkdiv0: %d\n", pcd); - return -1; - } - - pcd = (pcd - 1) & 0x3f; - tmp = memregs[0x31c4>>1]; - memregs[0x31c4>>1] = (tmp & ~0x3f0) | (pcd << 4); - - return 0; -} - -static int apply_cpuclk(volatile unsigned short *memregs, void *data) -{ - volatile unsigned int *memregl = (volatile void *)memregs; - int mhz = *(int *)data; - int adiv, mdiv, pdiv, sdiv = 0; - int i, vf000, vf004; - - // m = MDIV, p = PDIV, s = SDIV - #define SYS_CLK_FREQ 27 - pdiv = 9; - mdiv = (mhz * pdiv) / SYS_CLK_FREQ; - if (mdiv & ~0x3ff) - return -1; - vf004 = (pdiv<<18) | (mdiv<<8) | sdiv; - - // attempt to keep AHB the divider close to 250, but not higher - for (adiv = 1; mhz / adiv > 250; adiv++) - ; - - vf000 = memregl[0xf000>>2]; - vf000 = (vf000 & ~0x3c0) | ((adiv - 1) << 6); - memregl[0xf000>>2] = vf000; - memregl[0xf004>>2] = vf004; - memregl[0xf07c>>2] |= 0x8000; - for (i = 0; (memregl[0xf07c>>2] & 0x8000) && i < 0x100000; i++) - ; - - printf("clock set to %dMHz, AHB set to %dMHz\n", mhz, mhz / adiv); - return 0; -} - -static int lcd_timings[8]; -static int ram_timings[7]; -static int dpc_clkdiv0; -static int cpuclk; - -static const char lcd_t_help[] = "htotal,hswidth,hastart,haend,vtotal,vswidth,vastart,vaend"; -static const char ram_t_help[] = "CAS,tRC,tRAS,tWR,tMRD,tRP,tRCD"; - -static const struct { - const char *name; - const char *help; - int (*parse)(const char *str, void *data); - int (*apply)(volatile unsigned short *memregs, void *data); - void *data; -} -all_params[] = { - { "lcd_timings", lcd_t_help, parse_lcd_timings, apply_lcd_timings, lcd_timings }, - { "ram_timings", ram_t_help, parse_ram_timings, apply_ram_timings, ram_timings }, - { "dpc_clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, - { "clkdiv0", "divider", parse_decimal, apply_dpc_clkdiv0, &dpc_clkdiv0 }, /* alias */ - { "cpuclk", "MHZ", parse_decimal, apply_cpuclk, &cpuclk }, -}; -#define ALL_PARAM_COUNT (sizeof(all_params) / sizeof(all_params[0])) - -/* - * set timings based on preformated string - * returns 0 on success. - */ -int pollux_set(volatile unsigned short *memregs, const char *str) -{ - int parsed_params[ALL_PARAM_COUNT]; - int applied_params[ALL_PARAM_COUNT]; - int applied_something = 0; - const char *p, *po; - int i, ret; - - if (str == NULL) - return -1; - - memset(parsed_params, 0, sizeof(parsed_params)); - memset(applied_params, 0, sizeof(applied_params)); - - p = str; - while (1) - { -again: - while (*p == ';' || *p == ' ') - p++; - if (*p == 0) - break; - - for (i = 0; i < ALL_PARAM_COUNT; i++) - { - int param_len = strlen(all_params[i].name); - if (strncmp(p, all_params[i].name, param_len) == 0 && p[param_len] == '=') - { - p += param_len + 1; - ret = all_params[i].parse(p, all_params[i].data); - if (ret < 0) { - fprintf(stderr, "pollux_set parser: error at %-10s\n", p); - fprintf(stderr, " valid format is: <%s>\n", all_params[i].help); - return -1; - } - parsed_params[i] = 1; - p += ret; - goto again; - } - } - - /* Unknown param. Attempt to be forward compatible and ignore it. */ - for (po = p; *p != 0 && *p != ';'; p++) - ; - - fprintf(stderr, "unhandled param: "); - fwrite(po, 1, p - po, stderr); - fprintf(stderr, "\n"); - } - - /* validate and apply */ - for (i = 0; i < ALL_PARAM_COUNT; i++) - { - if (!parsed_params[i]) - continue; - - ret = all_params[i].apply(memregs, all_params[i].data); - if (ret < 0) { - fprintf(stderr, "pollux_set: failed to apply %s (bad value?)\n", - all_params[i].name); - continue; - } - - applied_something = 1; - applied_params[i] = 1; - } - - if (applied_something) - { - int c; - printf("applied: "); - for (i = c = 0; i < ALL_PARAM_COUNT; i++) - { - if (!applied_params[i]) - continue; - if (c != 0) - printf(", "); - printf("%s", all_params[i].name); - c++; - } - printf("\n"); - } - - return 0; -} - -#ifdef BINARY -#include <sys/types.h> -#include <sys/stat.h> -#include <fcntl.h> -#include <sys/mman.h> -#include <unistd.h> - -static void usage(const char *binary) -{ - int i; - printf("usage:\n%s <set_str[;set_str[;...]]>\n" - "set_str:\n", binary); - for (i = 0; i < ALL_PARAM_COUNT; i++) - printf(" %s=<%s>\n", all_params[i].name, all_params[i].help); -} - -int main(int argc, char *argv[]) -{ - volatile unsigned short *memregs; - int ret, memdev; - - if (argc != 2) { - usage(argv[0]); - return 1; - } - - memdev = open("/dev/mem", O_RDWR); - if (memdev == -1) - { - perror("open(/dev/mem) failed"); - return 1; - } - - memregs = mmap(0, 0x20000, PROT_READ|PROT_WRITE, MAP_SHARED, memdev, 0xc0000000); - if (memregs == MAP_FAILED) - { - perror("mmap(memregs) failed"); - close(memdev); - return 1; - } - - ret = pollux_set(memregs, argv[1]); - - munmap((void *)memregs, 0x20000); - close(memdev); - - return ret; -} -#endif diff --git a/frontend/320240/skin/background.png b/frontend/320240/skin/background.png Binary files differdeleted file mode 100644 index 0efdd18..0000000 --- a/frontend/320240/skin/background.png +++ /dev/null diff --git a/frontend/320240/skin/font.png b/frontend/320240/skin/font.png Binary files differdeleted file mode 100644 index c526a08..0000000 --- a/frontend/320240/skin/font.png +++ /dev/null diff --git a/frontend/320240/skin/readme.txt b/frontend/320240/skin/readme.txt deleted file mode 100644 index dd83963..0000000 --- a/frontend/320240/skin/readme.txt +++ /dev/null @@ -1,8 +0,0 @@ -The skin images can be customized, but there are several limitations:
-
-background.png - must be 320x240 image with 24bit RGB colors.
-font.png - must be 128x160 8bit grayscale image.
-selector.png - must be 8x10 8bit grayscale image.
-
-Font and selector colors can be changed by editing skin.txt.
-
diff --git a/frontend/320240/skin/selector.png b/frontend/320240/skin/selector.png Binary files differdeleted file mode 100644 index 5062cc2..0000000 --- a/frontend/320240/skin/selector.png +++ /dev/null diff --git a/frontend/320240/skin/skin.txt b/frontend/320240/skin/skin.txt deleted file mode 100644 index 1d6979f..0000000 --- a/frontend/320240/skin/skin.txt +++ /dev/null @@ -1,4 +0,0 @@ -// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.
-text_color=ffffc0
-selection_color=808010
-
diff --git a/frontend/320240/ui_gp2x.h b/frontend/320240/ui_gp2x.h deleted file mode 100644 index a9c4413..0000000 --- a/frontend/320240/ui_gp2x.h +++ /dev/null @@ -1,15 +0,0 @@ -#ifndef UI_FEATURES_H -#define UI_FEATURES_H - -#define MENU_BIOS_PATH "pcsx_rearmed/bios/" -#define MENU_SHOW_VARSCALER 0 -#define MENU_SHOW_VOUTMODE 0 -#define MENU_SHOW_SCALER2 1 -#define MENU_SHOW_NUBS_BTNS 0 -#define MENU_SHOW_VIBRATION 1 -#define MENU_SHOW_DEADZONE 1 -#define MENU_SHOW_MINIMIZE 0 -#define MENU_SHOW_FULLSCREEN 0 -#define MENU_SHOW_VOLUME 1 - -#endif // UI_FEATURES_H diff --git a/frontend/3ds/3ds_utils.h b/frontend/3ds/3ds_utils.h new file mode 100644 index 0000000..3d50a66 --- /dev/null +++ b/frontend/3ds/3ds_utils.h @@ -0,0 +1,66 @@ +#ifndef _3DS_UTILS_H +#define _3DS_UTILS_H + +#include <stdio.h> + +#define MEMOP_PROT 6 +#define MEMOP_MAP 4 +#define MEMOP_UNMAP 5 + +void* linearMemAlign(size_t size, size_t alignment); +void linearFree(void* mem); + +int32_t svcDuplicateHandle(uint32_t* out, uint32_t original); +int32_t svcCloseHandle(uint32_t handle); +int32_t svcControlMemory(void* addr_out, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); +int32_t svcControlProcessMemory(uint32_t process, void* addr0, void* addr1, uint32_t size, uint32_t op, uint32_t perm); + +int32_t svcCreateThread(int32_t* thread, void *(*entrypoint)(void*), void* arg, void* stack_top, int32_t thread_priority, int32_t processor_id); +int32_t svcWaitSynchronization(int32_t handle, int64_t nanoseconds); +void svcExitThread(void) __attribute__((noreturn)); + +int32_t svcBackdoor(int32_t (*callback)(void)); + +#define DEBUG_HOLD() do{printf("%s@%s:%d.\n",__FUNCTION__, __FILE__, __LINE__);fflush(stdout);wait_for_input();}while(0) + +void wait_for_input(void); + +extern __attribute__((weak)) int __ctr_svchax; + +typedef int32_t (*ctr_callback_type)(void); + +static inline void ctr_invalidate_ICache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c5, 0\n\t"); +} + +static inline void ctr_flush_DCache_kernel(void) +{ + __asm__ volatile( + "cpsid aif\n\t" + "mov r0, #0\n\t" + "mcr p15, 0, r0, c7, c10, 0\n\t"); +} + +static inline void ctr_invalidate_ICache(void) +{ + svcBackdoor((ctr_callback_type)ctr_invalidate_ICache_kernel); +} + +static inline void ctr_flush_DCache(void) +{ + svcBackdoor((ctr_callback_type)ctr_flush_DCache_kernel); +} + + +static inline void ctr_flush_invalidate_cache(void) +{ + ctr_flush_DCache(); + ctr_invalidate_ICache(); +} + + +#endif // _3DS_UTILS_H diff --git a/frontend/3ds/pthread.h b/frontend/3ds/pthread.h new file mode 100644 index 0000000..2c2bf6b --- /dev/null +++ b/frontend/3ds/pthread.h @@ -0,0 +1,56 @@ + +#ifndef _3DS_PTHREAD_WRAP__ +#define _3DS_PTHREAD_WRAP__ + +#include <stdlib.h> +#include <string.h> +#include <stdio.h> + +#include "3ds_utils.h" + +#define CTR_PTHREAD_STACK_SIZE 0x10000 + +typedef struct +{ + int32_t handle; + uint32_t* stack; +}pthread_t; +typedef int pthread_attr_t; + +static inline int pthread_create(pthread_t *thread, + const pthread_attr_t *attr, void *(*start_routine)(void*), void *arg) +{ + + thread->stack = linearMemAlign(CTR_PTHREAD_STACK_SIZE, 8); + + svcCreateThread(&thread->handle, start_routine, arg, + (uint32_t*)((uint32_t)thread->stack + CTR_PTHREAD_STACK_SIZE), + 0x25, 1); + + return 1; +} + + +static inline int pthread_join(pthread_t thread, void **retval) +{ + (void)retval; + + if(svcWaitSynchronization(thread.handle, INT64_MAX)) + return -1; + + linearFree(thread.stack); + + return 0; +} + + +static inline void pthread_exit(void *retval) +{ + (void)retval; + + svcExitThread(); +} + + +#endif //_3DS_PTHREAD_WRAP__ + diff --git a/frontend/3ds/sys/mman.h b/frontend/3ds/sys/mman.h new file mode 100644 index 0000000..61dde6c --- /dev/null +++ b/frontend/3ds/sys/mman.h @@ -0,0 +1,107 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include <stdlib.h> +#include <stdio.h> +#include <stdint.h> +#include <malloc.h> + +#include "3ds_utils.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_FIXED 0x10 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static void* dynarec_cache = NULL; +static void* dynarec_cache_mapping = NULL; + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)fd; + (void)offset; + + void* addr_out; + + if((prot == (PROT_READ | PROT_WRITE | PROT_EXEC)) && + (flags == (MAP_PRIVATE | MAP_ANONYMOUS))) + { + if(__ctr_svchax) + { + /* this hack works only for pcsx_rearmed */ + uint32_t currentHandle; + + if(!dynarec_cache) + dynarec_cache = memalign(0x1000, len); + + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, dynarec_cache, + len, MEMOP_MAP, prot); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = addr; + return addr; + } + else + { + printf("tried to mmap RWX pages without svcControlProcessMemory access !\n"); + return MAP_FAILED; + } + + } + + addr_out = malloc(len); + if(!addr_out) + return MAP_FAILED; + + return addr_out; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + if(__ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, addr, NULL, + len, MEMOP_PROT, prot); + svcCloseHandle(currentHandle); + return 0; + } + + printf("mprotect called without svcControlProcessMemory access !\n"); + return -1; +} + +static inline int munmap(void *addr, size_t len) +{ + if((addr == dynarec_cache_mapping) && __ctr_svchax) + { + uint32_t currentHandle; + svcDuplicateHandle(¤tHandle, 0xFFFF8001); + svcControlProcessMemory(currentHandle, + dynarec_cache, dynarec_cache_mapping, + len, MEMOP_UNMAP, 0b111); + svcCloseHandle(currentHandle); + dynarec_cache_mapping = NULL; + + } + else + free(addr); + + return 0; +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H + diff --git a/frontend/3ds/zconf.h b/frontend/3ds/zconf.h new file mode 100644 index 0000000..996fff2 --- /dev/null +++ b/frontend/3ds/zconf.h @@ -0,0 +1,511 @@ +/* zconf.h -- configuration of the zlib compression library + * Copyright (C) 1995-2013 Jean-loup Gailly. + * For conditions of distribution and use, see copyright notice in zlib.h + */ + +/* @(#) $Id$ */ + +#ifndef ZCONF_H +#define ZCONF_H + +/* + * If you *really* need a unique prefix for all types and library functions, + * compile with -DZ_PREFIX. The "standard" zlib should be compiled without it. + * Even better than compiling with -DZ_PREFIX would be to use configure to set + * this permanently in zconf.h using "./configure --zprefix". + */ +#ifdef Z_PREFIX /* may be set to #if 1 by ./configure */ +# define Z_PREFIX_SET + +/* all linked symbols */ +# define _dist_code z__dist_code +# define _length_code z__length_code +# define _tr_align z__tr_align +# define _tr_flush_bits z__tr_flush_bits +# define _tr_flush_block z__tr_flush_block +# define _tr_init z__tr_init +# define _tr_stored_block z__tr_stored_block +# define _tr_tally z__tr_tally +# define adler32 z_adler32 +# define adler32_combine z_adler32_combine +# define adler32_combine64 z_adler32_combine64 +# ifndef Z_SOLO +# define compress z_compress +# define compress2 z_compress2 +# define compressBound z_compressBound +# endif +# define crc32 z_crc32 +# define crc32_combine z_crc32_combine +# define crc32_combine64 z_crc32_combine64 +# define deflate z_deflate +# define deflateBound z_deflateBound +# define deflateCopy z_deflateCopy +# define deflateEnd z_deflateEnd +# define deflateInit2_ z_deflateInit2_ +# define deflateInit_ z_deflateInit_ +# define deflateParams z_deflateParams +# define deflatePending z_deflatePending +# define deflatePrime z_deflatePrime +# define deflateReset z_deflateReset +# define deflateResetKeep z_deflateResetKeep +# define deflateSetDictionary z_deflateSetDictionary +# define deflateSetHeader z_deflateSetHeader +# define deflateTune z_deflateTune +# define deflate_copyright z_deflate_copyright +# define get_crc_table z_get_crc_table +# ifndef Z_SOLO +# define gz_error z_gz_error +# define gz_intmax z_gz_intmax +# define gz_strwinerror z_gz_strwinerror +# define gzbuffer z_gzbuffer +# define gzclearerr z_gzclearerr +# define gzclose z_gzclose +# define gzclose_r z_gzclose_r +# define gzclose_w z_gzclose_w +# define gzdirect z_gzdirect +# define gzdopen z_gzdopen +# define gzeof z_gzeof +# define gzerror z_gzerror +# define gzflush z_gzflush +# define gzgetc z_gzgetc +# define gzgetc_ z_gzgetc_ +# define gzgets z_gzgets +# define gzoffset z_gzoffset +# define gzoffset64 z_gzoffset64 +# define gzopen z_gzopen +# define gzopen64 z_gzopen64 +# ifdef _WIN32 +# define gzopen_w z_gzopen_w +# endif +# define gzprintf z_gzprintf +# define gzvprintf z_gzvprintf +# define gzputc z_gzputc +# define gzputs z_gzputs +# define gzread z_gzread +# define gzrewind z_gzrewind +# define gzseek z_gzseek +# define gzseek64 z_gzseek64 +# define gzsetparams z_gzsetparams +# define gztell z_gztell +# define gztell64 z_gztell64 +# define gzungetc z_gzungetc +# define gzwrite z_gzwrite +# endif +# define inflate z_inflate +# define inflateBack z_inflateBack +# define inflateBackEnd z_inflateBackEnd +# define inflateBackInit_ z_inflateBackInit_ +# define inflateCopy z_inflateCopy +# define inflateEnd z_inflateEnd +# define inflateGetHeader z_inflateGetHeader +# define inflateInit2_ z_inflateInit2_ +# define inflateInit_ z_inflateInit_ +# define inflateMark z_inflateMark +# define inflatePrime z_inflatePrime +# define inflateReset z_inflateReset +# define inflateReset2 z_inflateReset2 +# define inflateSetDictionary z_inflateSetDictionary +# define inflateGetDictionary z_inflateGetDictionary +# define inflateSync z_inflateSync +# define inflateSyncPoint z_inflateSyncPoint +# define inflateUndermine z_inflateUndermine +# define inflateResetKeep z_inflateResetKeep +# define inflate_copyright z_inflate_copyright +# define inflate_fast z_inflate_fast +# define inflate_table z_inflate_table +# ifndef Z_SOLO +# define uncompress z_uncompress +# endif +# define zError z_zError +# ifndef Z_SOLO +# define zcalloc z_zcalloc +# define zcfree z_zcfree +# endif +# define zlibCompileFlags z_zlibCompileFlags +# define zlibVersion z_zlibVersion + +/* all zlib typedefs in zlib.h and zconf.h */ +# define Byte z_Byte +# define Bytef z_Bytef +# define alloc_func z_alloc_func +# define charf z_charf +# define free_func z_free_func +# ifndef Z_SOLO +# define gzFile z_gzFile +# endif +# define gz_header z_gz_header +# define gz_headerp z_gz_headerp +# define in_func z_in_func +# define intf z_intf +# define out_func z_out_func +# define uInt z_uInt +# define uIntf z_uIntf +# define uLong z_uLong +# define uLongf z_uLongf +# define voidp z_voidp +# define voidpc z_voidpc +# define voidpf z_voidpf + +/* all zlib structs in zlib.h and zconf.h */ +# define gz_header_s z_gz_header_s +# define internal_state z_internal_state + +#endif + +#if defined(__MSDOS__) && !defined(MSDOS) +# define MSDOS +#endif +#if (defined(OS_2) || defined(__OS2__)) && !defined(OS2) +# define OS2 +#endif +#if defined(_WINDOWS) && !defined(WINDOWS) +# define WINDOWS +#endif +#if defined(_WIN32) || defined(_WIN32_WCE) || defined(__WIN32__) +# ifndef WIN32 +# define WIN32 +# endif +#endif +#if (defined(MSDOS) || defined(OS2) || defined(WINDOWS)) && !defined(WIN32) +# if !defined(__GNUC__) && !defined(__FLAT__) && !defined(__386__) +# ifndef SYS16BIT +# define SYS16BIT +# endif +# endif +#endif + +/* + * Compile with -DMAXSEG_64K if the alloc function cannot allocate more + * than 64k bytes at a time (needed on systems with 16-bit int). + */ +#ifdef SYS16BIT +# define MAXSEG_64K +#endif +#ifdef MSDOS +# define UNALIGNED_OK +#endif + +#ifdef __STDC_VERSION__ +# ifndef STDC +# define STDC +# endif +# if __STDC_VERSION__ >= 199901L +# ifndef STDC99 +# define STDC99 +# endif +# endif +#endif +#if !defined(STDC) && (defined(__STDC__) || defined(__cplusplus)) +# define STDC +#endif +#if !defined(STDC) && (defined(__GNUC__) || defined(__BORLANDC__)) +# define STDC +#endif +#if !defined(STDC) && (defined(MSDOS) || defined(WINDOWS) || defined(WIN32)) +# define STDC +#endif +#if !defined(STDC) && (defined(OS2) || defined(__HOS_AIX__)) +# define STDC +#endif + +#if defined(__OS400__) && !defined(STDC) /* iSeries (formerly AS/400). */ +# define STDC +#endif + +#ifndef STDC +# ifndef const /* cannot use !defined(STDC) && !defined(const) on Mac */ +# define const /* note: need a more gentle solution here */ +# endif +#endif + +#if defined(ZLIB_CONST) && !defined(z_const) +# define z_const const +#else +# define z_const +#endif + +/* Some Mac compilers merge all .h files incorrectly: */ +#if defined(__MWERKS__)||defined(applec)||defined(THINK_C)||defined(__SC__) +# define NO_DUMMY_DECL +#endif + +/* Maximum value for memLevel in deflateInit2 */ +#ifndef MAX_MEM_LEVEL +# ifdef MAXSEG_64K +# define MAX_MEM_LEVEL 8 +# else +# define MAX_MEM_LEVEL 9 +# endif +#endif + +/* Maximum value for windowBits in deflateInit2 and inflateInit2. + * WARNING: reducing MAX_WBITS makes minigzip unable to extract .gz files + * created by gzip. (Files created by minigzip can still be extracted by + * gzip.) + */ +#ifndef MAX_WBITS +# define MAX_WBITS 15 /* 32K LZ77 window */ +#endif + +/* The memory requirements for deflate are (in bytes): + (1 << (windowBits+2)) + (1 << (memLevel+9)) + that is: 128K for windowBits=15 + 128K for memLevel = 8 (default values) + plus a few kilobytes for small objects. For example, if you want to reduce + the default memory requirements from 256K to 128K, compile with + make CFLAGS="-O -DMAX_WBITS=14 -DMAX_MEM_LEVEL=7" + Of course this will generally degrade compression (there's no free lunch). + + The memory requirements for inflate are (in bytes) 1 << windowBits + that is, 32K for windowBits=15 (default value) plus a few kilobytes + for small objects. +*/ + + /* Type declarations */ + +#ifndef OF /* function prototypes */ +# ifdef STDC +# define OF(args) args +# else +# define OF(args) () +# endif +#endif + +#ifndef Z_ARG /* function prototypes for stdarg */ +# if defined(STDC) || defined(Z_HAVE_STDARG_H) +# define Z_ARG(args) args +# else +# define Z_ARG(args) () +# endif +#endif + +/* The following definitions for FAR are needed only for MSDOS mixed + * model programming (small or medium model with some far allocations). + * This was tested only with MSC; for other MSDOS compilers you may have + * to define NO_MEMCPY in zutil.h. If you don't need the mixed model, + * just define FAR to be empty. + */ +#ifdef SYS16BIT +# if defined(M_I86SM) || defined(M_I86MM) + /* MSC small or medium model */ +# define SMALL_MEDIUM +# ifdef _MSC_VER +# define FAR _far +# else +# define FAR far +# endif +# endif +# if (defined(__SMALL__) || defined(__MEDIUM__)) + /* Turbo C small or medium model */ +# define SMALL_MEDIUM +# ifdef __BORLANDC__ +# define FAR _far +# else +# define FAR far +# endif +# endif +#endif + +#if defined(WINDOWS) || defined(WIN32) + /* If building or using zlib as a DLL, define ZLIB_DLL. + * This is not mandatory, but it offers a little performance increase. + */ +# ifdef ZLIB_DLL +# if defined(WIN32) && (!defined(__BORLANDC__) || (__BORLANDC__ >= 0x500)) +# ifdef ZLIB_INTERNAL +# define ZEXTERN extern __declspec(dllexport) +# else +# define ZEXTERN extern __declspec(dllimport) +# endif +# endif +# endif /* ZLIB_DLL */ + /* If building or using zlib with the WINAPI/WINAPIV calling convention, + * define ZLIB_WINAPI. + * Caution: the standard ZLIB1.DLL is NOT compiled using ZLIB_WINAPI. + */ +# ifdef ZLIB_WINAPI +# ifdef FAR +# undef FAR +# endif +# include <windows.h> + /* No need for _export, use ZLIB.DEF instead. */ + /* For complete Windows compatibility, use WINAPI, not __stdcall. */ +# define ZEXPORT WINAPI +# ifdef WIN32 +# define ZEXPORTVA WINAPIV +# else +# define ZEXPORTVA FAR CDECL +# endif +# endif +#endif + +#if defined (__BEOS__) +# ifdef ZLIB_DLL +# ifdef ZLIB_INTERNAL +# define ZEXPORT __declspec(dllexport) +# define ZEXPORTVA __declspec(dllexport) +# else +# define ZEXPORT __declspec(dllimport) +# define ZEXPORTVA __declspec(dllimport) +# endif +# endif +#endif + +#ifndef ZEXTERN +# define ZEXTERN extern +#endif +#ifndef ZEXPORT +# define ZEXPORT +#endif +#ifndef ZEXPORTVA +# define ZEXPORTVA +#endif + +#ifndef FAR +# define FAR +#endif + +#if !defined(__MACTYPES__) +typedef unsigned char Byte; /* 8 bits */ +#endif +typedef unsigned int uInt; /* 16 bits or more */ +typedef unsigned long uLong; /* 32 bits or more */ + +#ifdef SMALL_MEDIUM + /* Borland C/C++ and some old MSC versions ignore FAR inside typedef */ +# define Bytef Byte FAR +#else + typedef Byte FAR Bytef; +#endif +typedef char FAR charf; +typedef int FAR intf; +typedef uInt FAR uIntf; +typedef uLong FAR uLongf; + +#ifdef STDC + typedef void const *voidpc; + typedef void FAR *voidpf; + typedef void *voidp; +#else + typedef Byte const *voidpc; + typedef Byte FAR *voidpf; + typedef Byte *voidp; +#endif + +#if !defined(Z_U4) && !defined(Z_SOLO) && defined(STDC) +# include <limits.h> +# if (UINT_MAX == 0xffffffffUL) +# define Z_U4 unsigned +# elif (ULONG_MAX == 0xffffffffUL) +# define Z_U4 unsigned long +# elif (USHRT_MAX == 0xffffffffUL) +# define Z_U4 unsigned short +# endif +#endif + +#ifdef Z_U4 + typedef Z_U4 z_crc_t; +#else + typedef unsigned long z_crc_t; +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_UNISTD_H +#endif + +#if 1 /* was set to #if 1 by ./configure */ +# define Z_HAVE_STDARG_H +#endif + +#ifdef STDC +# ifndef Z_SOLO +# include <sys/types.h> /* for off_t */ +# endif +#endif + +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +# include <stdarg.h> /* for va_list */ +# endif +#endif + +#ifdef _WIN32 +# ifndef Z_SOLO +# include <stddef.h> /* for wchar_t */ +# endif +#endif + +/* a little trick to accommodate both "#define _LARGEFILE64_SOURCE" and + * "#define _LARGEFILE64_SOURCE 1" as requesting 64-bit operations, (even + * though the former does not conform to the LFS document), but considering + * both "#undef _LARGEFILE64_SOURCE" and "#define _LARGEFILE64_SOURCE 0" as + * equivalently requesting no 64-bit operations + */ +#if defined(_LARGEFILE64_SOURCE) && -_LARGEFILE64_SOURCE - -1 == 1 +# undef _LARGEFILE64_SOURCE +#endif + +#if defined(__WATCOMC__) && !defined(Z_HAVE_UNISTD_H) +# define Z_HAVE_UNISTD_H +#endif +#ifndef Z_SOLO +# if defined(Z_HAVE_UNISTD_H) || defined(_LARGEFILE64_SOURCE) +# include <unistd.h> /* for SEEK_*, off_t, and _LFS64_LARGEFILE */ +# ifdef VMS +# include <unixio.h> /* for off_t */ +# endif +# ifndef z_off_t +# define z_off_t off_t +# endif +# endif +#endif + +#if defined(_LFS64_LARGEFILE) && _LFS64_LARGEFILE-0 +# define Z_LFS64 +#endif + +#if defined(_LARGEFILE64_SOURCE) && defined(Z_LFS64) +# define Z_LARGE64 +#endif + +#if defined(_FILE_OFFSET_BITS) && _FILE_OFFSET_BITS-0 == 64 && defined(Z_LFS64) +# define Z_WANT64 +#endif + +#if !defined(SEEK_SET) && !defined(Z_SOLO) +# define SEEK_SET 0 /* Seek from beginning of file. */ +# define SEEK_CUR 1 /* Seek from current position. */ +# define SEEK_END 2 /* Set file pointer to EOF plus "offset" */ +#endif + +#ifndef z_off_t +# define z_off_t long +#endif + +#if !defined(_WIN32) && defined(Z_LARGE64) +# define z_off64_t off64_t +#else +# if defined(_WIN32) && !defined(__GNUC__) && !defined(Z_SOLO) +# define z_off64_t __int64 +# else +# define z_off64_t z_off_t +# endif +#endif + +/* MVS linker does not support external names larger than 8 bytes */ +#if defined(__MVS__) + #pragma map(deflateInit_,"DEIN") + #pragma map(deflateInit2_,"DEIN2") + #pragma map(deflateEnd,"DEEND") + #pragma map(deflateBound,"DEBND") + #pragma map(inflateInit_,"ININ") + #pragma map(inflateInit2_,"ININ2") + #pragma map(inflateEnd,"INEND") + #pragma map(inflateSync,"INSY") + #pragma map(inflateSetDictionary,"INSEDI") + #pragma map(compressBound,"CMBND") + #pragma map(inflate_table,"INTABL") + #pragma map(inflate_fast,"INFA") + #pragma map(inflate_copyright,"INCOPY") +#endif + +#endif /* ZCONF_H */ diff --git a/frontend/3ds/zlib.h b/frontend/3ds/zlib.h new file mode 100644 index 0000000..3e0c767 --- /dev/null +++ b/frontend/3ds/zlib.h @@ -0,0 +1,1768 @@ +/* zlib.h -- interface of the 'zlib' general purpose compression library + version 1.2.8, April 28th, 2013 + + Copyright (C) 1995-2013 Jean-loup Gailly and Mark Adler + + This software is provided 'as-is', without any express or implied + warranty. In no event will the authors be held liable for any damages + arising from the use of this software. + + Permission is granted to anyone to use this software for any purpose, + including commercial applications, and to alter it and redistribute it + freely, subject to the following restrictions: + + 1. The origin of this software must not be misrepresented; you must not + claim that you wrote the original software. If you use this software + in a product, an acknowledgment in the product documentation would be + appreciated but is not required. + 2. Altered source versions must be plainly marked as such, and must not be + misrepresented as being the original software. + 3. This notice may not be removed or altered from any source distribution. + + Jean-loup Gailly Mark Adler + jloup@gzip.org madler@alumni.caltech.edu + + + The data format used by the zlib library is described by RFCs (Request for + Comments) 1950 to 1952 in the files http://tools.ietf.org/html/rfc1950 + (zlib format), rfc1951 (deflate format) and rfc1952 (gzip format). +*/ + +#ifndef ZLIB_H +#define ZLIB_H + +#include "zconf.h" + +#ifdef __cplusplus +extern "C" { +#endif + +#define ZLIB_VERSION "1.2.8" +#define ZLIB_VERNUM 0x1280 +#define ZLIB_VER_MAJOR 1 +#define ZLIB_VER_MINOR 2 +#define ZLIB_VER_REVISION 8 +#define ZLIB_VER_SUBREVISION 0 + +/* + The 'zlib' compression library provides in-memory compression and + decompression functions, including integrity checks of the uncompressed data. + This version of the library supports only one compression method (deflation) + but other algorithms will be added later and will have the same stream + interface. + + Compression can be done in a single step if the buffers are large enough, + or can be done by repeated calls of the compression function. In the latter + case, the application must provide more input and/or consume the output + (providing more output space) before each call. + + The compressed data format used by default by the in-memory functions is + the zlib format, which is a zlib wrapper documented in RFC 1950, wrapped + around a deflate stream, which is itself documented in RFC 1951. + + The library also supports reading and writing files in gzip (.gz) format + with an interface similar to that of stdio using the functions that start + with "gz". The gzip format is different from the zlib format. gzip is a + gzip wrapper, documented in RFC 1952, wrapped around a deflate stream. + + This library can optionally read and write gzip streams in memory as well. + + The zlib format was designed to be compact and fast for use in memory + and on communications channels. The gzip format was designed for single- + file compression on file systems, has a larger header than zlib to maintain + directory information, and uses a different, slower check method than zlib. + + The library does not install any signal handler. The decoder checks + the consistency of the compressed data, so the library should never crash + even in case of corrupted input. +*/ + +typedef voidpf (*alloc_func) OF((voidpf opaque, uInt items, uInt size)); +typedef void (*free_func) OF((voidpf opaque, voidpf address)); + +struct internal_state; + +typedef struct z_stream_s { + z_const Bytef *next_in; /* next input byte */ + uInt avail_in; /* number of bytes available at next_in */ + uLong total_in; /* total number of input bytes read so far */ + + Bytef *next_out; /* next output byte should be put there */ + uInt avail_out; /* remaining free space at next_out */ + uLong total_out; /* total number of bytes output so far */ + + z_const char *msg; /* last error message, NULL if no error */ + struct internal_state FAR *state; /* not visible by applications */ + + alloc_func zalloc; /* used to allocate the internal state */ + free_func zfree; /* used to free the internal state */ + voidpf opaque; /* private data object passed to zalloc and zfree */ + + int data_type; /* best guess about the data type: binary or text */ + uLong adler; /* adler32 value of the uncompressed data */ + uLong reserved; /* reserved for future use */ +} z_stream; + +typedef z_stream FAR *z_streamp; + +/* + gzip header information passed to and from zlib routines. See RFC 1952 + for more details on the meanings of these fields. +*/ +typedef struct gz_header_s { + int text; /* true if compressed data believed to be text */ + uLong time; /* modification time */ + int xflags; /* extra flags (not used when writing a gzip file) */ + int os; /* operating system */ + Bytef *extra; /* pointer to extra field or Z_NULL if none */ + uInt extra_len; /* extra field length (valid if extra != Z_NULL) */ + uInt extra_max; /* space at extra (only when reading header) */ + Bytef *name; /* pointer to zero-terminated file name or Z_NULL */ + uInt name_max; /* space at name (only when reading header) */ + Bytef *comment; /* pointer to zero-terminated comment or Z_NULL */ + uInt comm_max; /* space at comment (only when reading header) */ + int hcrc; /* true if there was or will be a header crc */ + int done; /* true when done reading gzip header (not used + when writing a gzip file) */ +} gz_header; + +typedef gz_header FAR *gz_headerp; + +/* + The application must update next_in and avail_in when avail_in has dropped + to zero. It must update next_out and avail_out when avail_out has dropped + to zero. The application must initialize zalloc, zfree and opaque before + calling the init function. All other fields are set by the compression + library and must not be updated by the application. + + The opaque value provided by the application will be passed as the first + parameter for calls of zalloc and zfree. This can be useful for custom + memory management. The compression library attaches no meaning to the + opaque value. + + zalloc must return Z_NULL if there is not enough memory for the object. + If zlib is used in a multi-threaded application, zalloc and zfree must be + thread safe. + + On 16-bit systems, the functions zalloc and zfree must be able to allocate + exactly 65536 bytes, but will not be required to allocate more than this if + the symbol MAXSEG_64K is defined (see zconf.h). WARNING: On MSDOS, pointers + returned by zalloc for objects of exactly 65536 bytes *must* have their + offset normalized to zero. The default allocation function provided by this + library ensures this (see zutil.c). To reduce memory requirements and avoid + any allocation of 64K objects, at the expense of compression ratio, compile + the library with -DMAX_WBITS=14 (see zconf.h). + + The fields total_in and total_out can be used for statistics or progress + reports. After compression, total_in holds the total size of the + uncompressed data and may be saved for use in the decompressor (particularly + if the decompressor wants to decompress everything in a single step). +*/ + + /* constants */ + +#define Z_NO_FLUSH 0 +#define Z_PARTIAL_FLUSH 1 +#define Z_SYNC_FLUSH 2 +#define Z_FULL_FLUSH 3 +#define Z_FINISH 4 +#define Z_BLOCK 5 +#define Z_TREES 6 +/* Allowed flush values; see deflate() and inflate() below for details */ + +#define Z_OK 0 +#define Z_STREAM_END 1 +#define Z_NEED_DICT 2 +#define Z_ERRNO (-1) +#define Z_STREAM_ERROR (-2) +#define Z_DATA_ERROR (-3) +#define Z_MEM_ERROR (-4) +#define Z_BUF_ERROR (-5) +#define Z_VERSION_ERROR (-6) +/* Return codes for the compression/decompression functions. Negative values + * are errors, positive values are used for special but normal events. + */ + +#define Z_NO_COMPRESSION 0 +#define Z_BEST_SPEED 1 +#define Z_BEST_COMPRESSION 9 +#define Z_DEFAULT_COMPRESSION (-1) +/* compression levels */ + +#define Z_FILTERED 1 +#define Z_HUFFMAN_ONLY 2 +#define Z_RLE 3 +#define Z_FIXED 4 +#define Z_DEFAULT_STRATEGY 0 +/* compression strategy; see deflateInit2() below for details */ + +#define Z_BINARY 0 +#define Z_TEXT 1 +#define Z_ASCII Z_TEXT /* for compatibility with 1.2.2 and earlier */ +#define Z_UNKNOWN 2 +/* Possible values of the data_type field (though see inflate()) */ + +#define Z_DEFLATED 8 +/* The deflate compression method (the only one supported in this version) */ + +#define Z_NULL 0 /* for initializing zalloc, zfree, opaque */ + +#define zlib_version zlibVersion() +/* for compatibility with versions < 1.0.2 */ + + + /* basic functions */ + +ZEXTERN const char * ZEXPORT zlibVersion OF((void)); +/* The application can compare zlibVersion and ZLIB_VERSION for consistency. + If the first character differs, the library code actually used is not + compatible with the zlib.h header file used by the application. This check + is automatically made by deflateInit and inflateInit. + */ + +/* +ZEXTERN int ZEXPORT deflateInit OF((z_streamp strm, int level)); + + Initializes the internal stream state for compression. The fields + zalloc, zfree and opaque must be initialized before by the caller. If + zalloc and zfree are set to Z_NULL, deflateInit updates them to use default + allocation functions. + + The compression level must be Z_DEFAULT_COMPRESSION, or between 0 and 9: + 1 gives best speed, 9 gives best compression, 0 gives no compression at all + (the input data is simply copied a block at a time). Z_DEFAULT_COMPRESSION + requests a default compromise between speed and compression (currently + equivalent to level 6). + + deflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if level is not a valid compression level, or + Z_VERSION_ERROR if the zlib library version (zlib_version) is incompatible + with the version assumed by the caller (ZLIB_VERSION). msg is set to null + if there is no error message. deflateInit does not perform any compression: + this will be done by deflate(). +*/ + + +ZEXTERN int ZEXPORT deflate OF((z_streamp strm, int flush)); +/* + deflate compresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. deflate performs one or both of the + following actions: + + - Compress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in and avail_in are updated and + processing will resume at this point for the next call of deflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. This action is forced if the parameter flush is non zero. + Forcing flush frequently degrades the compression ratio, so this parameter + should be set only when necessary (in interactive applications). Some + output may be provided even if flush is not set. + + Before the call of deflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating avail_in or avail_out accordingly; avail_out should + never be zero before the call. The application can consume the compressed + output when it wants, for example when the output buffer is full (avail_out + == 0), or after each call of deflate(). If deflate returns Z_OK and with + zero avail_out, it must be called again after making room in the output + buffer because there might be more output pending. + + Normally the parameter flush is set to Z_NO_FLUSH, which allows deflate to + decide how much data to accumulate before producing output, in order to + maximize compression. + + If the parameter flush is set to Z_SYNC_FLUSH, all pending output is + flushed to the output buffer and the output is aligned on a byte boundary, so + that the decompressor can get all input data available so far. (In + particular avail_in is zero after the call if enough output space has been + provided before the call.) Flushing may degrade compression for some + compression algorithms and so it should be used only when necessary. This + completes the current deflate block and follows it with an empty stored block + that is three bits plus filler bits to the next byte, followed by four bytes + (00 00 ff ff). + + If flush is set to Z_PARTIAL_FLUSH, all pending output is flushed to the + output buffer, but the output is not aligned to a byte boundary. All of the + input data so far will be available to the decompressor, as for Z_SYNC_FLUSH. + This completes the current deflate block and follows it with an empty fixed + codes block that is 10 bits long. This assures that enough bytes are output + in order for the decompressor to finish the block before the empty fixed code + block. + + If flush is set to Z_BLOCK, a deflate block is completed and emitted, as + for Z_SYNC_FLUSH, but the output is not aligned on a byte boundary, and up to + seven bits of the current block are held to be written as the next byte after + the next deflate block is completed. In this case, the decompressor may not + be provided enough bits at this point in order to complete decompression of + the data provided so far to the compressor. It may need to wait for the next + block to be emitted. This is for advanced applications that need to control + the emission of deflate blocks. + + If flush is set to Z_FULL_FLUSH, all output is flushed as with + Z_SYNC_FLUSH, and the compression state is reset so that decompression can + restart from this point if previous compressed data has been damaged or if + random access is desired. Using Z_FULL_FLUSH too often can seriously degrade + compression. + + If deflate returns with avail_out == 0, this function must be called again + with the same value of the flush parameter and more output space (updated + avail_out), until the flush is complete (deflate returns with non-zero + avail_out). In the case of a Z_FULL_FLUSH or Z_SYNC_FLUSH, make sure that + avail_out is greater than six to avoid repeated flush markers due to + avail_out == 0 on return. + + If the parameter flush is set to Z_FINISH, pending input is processed, + pending output is flushed and deflate returns with Z_STREAM_END if there was + enough output space; if deflate returns with Z_OK, this function must be + called again with Z_FINISH and more output space (updated avail_out) but no + more input data, until it returns with Z_STREAM_END or an error. After + deflate has returned Z_STREAM_END, the only possible operations on the stream + are deflateReset or deflateEnd. + + Z_FINISH can be used immediately after deflateInit if all the compression + is to be done in a single step. In this case, avail_out must be at least the + value returned by deflateBound (see below). Then deflate is guaranteed to + return Z_STREAM_END. If not enough output space is provided, deflate will + not return Z_STREAM_END, and it must be called again as described above. + + deflate() sets strm->adler to the adler32 checksum of all input read + so far (that is, total_in bytes). + + deflate() may update strm->data_type if it can make a good guess about + the input data type (Z_BINARY or Z_TEXT). In doubt, the data is considered + binary. This field is only for information purposes and does not affect the + compression algorithm in any manner. + + deflate() returns Z_OK if some progress has been made (more input + processed or more output produced), Z_STREAM_END if all input has been + consumed and all output has been produced (only when flush is set to + Z_FINISH), Z_STREAM_ERROR if the stream state was inconsistent (for example + if next_in or next_out was Z_NULL), Z_BUF_ERROR if no progress is possible + (for example avail_in or avail_out was zero). Note that Z_BUF_ERROR is not + fatal, and deflate() can be called again with more input and more output + space to continue compressing. +*/ + + +ZEXTERN int ZEXPORT deflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + deflateEnd returns Z_OK if success, Z_STREAM_ERROR if the + stream state was inconsistent, Z_DATA_ERROR if the stream was freed + prematurely (some input or output was discarded). In the error case, msg + may be set but then points to a static string (which must not be + deallocated). +*/ + + +/* +ZEXTERN int ZEXPORT inflateInit OF((z_streamp strm)); + + Initializes the internal stream state for decompression. The fields + next_in, avail_in, zalloc, zfree and opaque must be initialized before by + the caller. If next_in is not Z_NULL and avail_in is large enough (the + exact value depends on the compression method), inflateInit determines the + compression method from the zlib header and allocates all data structures + accordingly; otherwise the allocation will be deferred to the first call of + inflate. If zalloc and zfree are set to Z_NULL, inflateInit updates them to + use default allocation functions. + + inflateInit returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit() does not process any header information -- that is deferred + until inflate() is called. +*/ + + +ZEXTERN int ZEXPORT inflate OF((z_streamp strm, int flush)); +/* + inflate decompresses as much data as possible, and stops when the input + buffer becomes empty or the output buffer becomes full. It may introduce + some output latency (reading input without producing any output) except when + forced to flush. + + The detailed semantics are as follows. inflate performs one or both of the + following actions: + + - Decompress more input starting at next_in and update next_in and avail_in + accordingly. If not all input can be processed (because there is not + enough room in the output buffer), next_in is updated and processing will + resume at this point for the next call of inflate(). + + - Provide more output starting at next_out and update next_out and avail_out + accordingly. inflate() provides as much output as possible, until there is + no more input data or no more space in the output buffer (see below about + the flush parameter). + + Before the call of inflate(), the application should ensure that at least + one of the actions is possible, by providing more input and/or consuming more + output, and updating the next_* and avail_* values accordingly. The + application can consume the uncompressed output when it wants, for example + when the output buffer is full (avail_out == 0), or after each call of + inflate(). If inflate returns Z_OK and with zero avail_out, it must be + called again after making room in the output buffer because there might be + more output pending. + + The flush parameter of inflate() can be Z_NO_FLUSH, Z_SYNC_FLUSH, Z_FINISH, + Z_BLOCK, or Z_TREES. Z_SYNC_FLUSH requests that inflate() flush as much + output as possible to the output buffer. Z_BLOCK requests that inflate() + stop if and when it gets to the next deflate block boundary. When decoding + the zlib or gzip format, this will cause inflate() to return immediately + after the header and before the first block. When doing a raw inflate, + inflate() will go ahead and process the first block, and will return when it + gets to the end of that block, or when it runs out of data. + + The Z_BLOCK option assists in appending to or combining deflate streams. + Also to assist in this, on return inflate() will set strm->data_type to the + number of unused bits in the last byte taken from strm->next_in, plus 64 if + inflate() is currently decoding the last block in the deflate stream, plus + 128 if inflate() returned immediately after decoding an end-of-block code or + decoding the complete header up to just before the first byte of the deflate + stream. The end-of-block will not be indicated until all of the uncompressed + data from that block has been written to strm->next_out. The number of + unused bits may in general be greater than seven, except when bit 7 of + data_type is set, in which case the number of unused bits will be less than + eight. data_type is set as noted here every time inflate() returns for all + flush options, and so can be used to determine the amount of currently + consumed input in bits. + + The Z_TREES option behaves as Z_BLOCK does, but it also returns when the + end of each deflate block header is reached, before any actual data in that + block is decoded. This allows the caller to determine the length of the + deflate block header for later use in random access within a deflate block. + 256 is added to the value of strm->data_type when inflate() returns + immediately after reaching the end of the deflate block header. + + inflate() should normally be called until it returns Z_STREAM_END or an + error. However if all decompression is to be performed in a single step (a + single call of inflate), the parameter flush should be set to Z_FINISH. In + this case all pending input is processed and all pending output is flushed; + avail_out must be large enough to hold all of the uncompressed data for the + operation to complete. (The size of the uncompressed data may have been + saved by the compressor for this purpose.) The use of Z_FINISH is not + required to perform an inflation in one step. However it may be used to + inform inflate that a faster approach can be used for the single inflate() + call. Z_FINISH also informs inflate to not maintain a sliding window if the + stream completes, which reduces inflate's memory footprint. If the stream + does not complete, either because not all of the stream is provided or not + enough output space is provided, then a sliding window will be allocated and + inflate() can be called again to continue the operation as if Z_NO_FLUSH had + been used. + + In this implementation, inflate() always flushes as much output as + possible to the output buffer, and always uses the faster approach on the + first call. So the effects of the flush parameter in this implementation are + on the return value of inflate() as noted below, when inflate() returns early + when Z_BLOCK or Z_TREES is used, and when inflate() avoids the allocation of + memory for a sliding window when Z_FINISH is used. + + If a preset dictionary is needed after this call (see inflateSetDictionary + below), inflate sets strm->adler to the Adler-32 checksum of the dictionary + chosen by the compressor and returns Z_NEED_DICT; otherwise it sets + strm->adler to the Adler-32 checksum of all output produced so far (that is, + total_out bytes) and returns Z_OK, Z_STREAM_END or an error code as described + below. At the end of the stream, inflate() checks that its computed adler32 + checksum is equal to that saved by the compressor and returns Z_STREAM_END + only if the checksum is correct. + + inflate() can decompress and check either zlib-wrapped or gzip-wrapped + deflate data. The header type is detected automatically, if requested when + initializing with inflateInit2(). Any information contained in the gzip + header is not retained, so applications that need that information should + instead use raw inflate, see inflateInit2() below, or inflateBack() and + perform their own processing of the gzip header and trailer. When processing + gzip-wrapped deflate data, strm->adler32 is set to the CRC-32 of the output + producted so far. The CRC-32 is checked against the gzip trailer. + + inflate() returns Z_OK if some progress has been made (more input processed + or more output produced), Z_STREAM_END if the end of the compressed data has + been reached and all uncompressed output has been produced, Z_NEED_DICT if a + preset dictionary is needed at this point, Z_DATA_ERROR if the input data was + corrupted (input stream not conforming to the zlib format or incorrect check + value), Z_STREAM_ERROR if the stream structure was inconsistent (for example + next_in or next_out was Z_NULL), Z_MEM_ERROR if there was not enough memory, + Z_BUF_ERROR if no progress is possible or if there was not enough room in the + output buffer when Z_FINISH is used. Note that Z_BUF_ERROR is not fatal, and + inflate() can be called again with more input and more output space to + continue decompressing. If Z_DATA_ERROR is returned, the application may + then call inflateSync() to look for a good compression block if a partial + recovery of the data is desired. +*/ + + +ZEXTERN int ZEXPORT inflateEnd OF((z_streamp strm)); +/* + All dynamically allocated data structures for this stream are freed. + This function discards any unprocessed input and does not flush any pending + output. + + inflateEnd returns Z_OK if success, Z_STREAM_ERROR if the stream state + was inconsistent. In the error case, msg may be set but then points to a + static string (which must not be deallocated). +*/ + + + /* Advanced functions */ + +/* + The following functions are needed only in some special applications. +*/ + +/* +ZEXTERN int ZEXPORT deflateInit2 OF((z_streamp strm, + int level, + int method, + int windowBits, + int memLevel, + int strategy)); + + This is another version of deflateInit with more compression options. The + fields next_in, zalloc, zfree and opaque must be initialized before by the + caller. + + The method parameter is the compression method. It must be Z_DEFLATED in + this version of the library. + + The windowBits parameter is the base two logarithm of the window size + (the size of the history buffer). It should be in the range 8..15 for this + version of the library. Larger values of this parameter result in better + compression at the expense of memory usage. The default value is 15 if + deflateInit is used instead. + + windowBits can also be -8..-15 for raw deflate. In this case, -windowBits + determines the window size. deflate() will then generate raw deflate data + with no zlib header or trailer, and will not compute an adler32 check value. + + windowBits can also be greater than 15 for optional gzip encoding. Add + 16 to windowBits to write a simple gzip header and trailer around the + compressed data instead of a zlib wrapper. The gzip header will have no + file name, no extra data, no comment, no modification time (set to zero), no + header crc, and the operating system will be set to 255 (unknown). If a + gzip stream is being written, strm->adler is a crc32 instead of an adler32. + + The memLevel parameter specifies how much memory should be allocated + for the internal compression state. memLevel=1 uses minimum memory but is + slow and reduces compression ratio; memLevel=9 uses maximum memory for + optimal speed. The default value is 8. See zconf.h for total memory usage + as a function of windowBits and memLevel. + + The strategy parameter is used to tune the compression algorithm. Use the + value Z_DEFAULT_STRATEGY for normal data, Z_FILTERED for data produced by a + filter (or predictor), Z_HUFFMAN_ONLY to force Huffman encoding only (no + string match), or Z_RLE to limit match distances to one (run-length + encoding). Filtered data consists mostly of small values with a somewhat + random distribution. In this case, the compression algorithm is tuned to + compress them better. The effect of Z_FILTERED is to force more Huffman + coding and less string matching; it is somewhat intermediate between + Z_DEFAULT_STRATEGY and Z_HUFFMAN_ONLY. Z_RLE is designed to be almost as + fast as Z_HUFFMAN_ONLY, but give better compression for PNG image data. The + strategy parameter only affects the compression ratio but not the + correctness of the compressed output even if it is not set appropriately. + Z_FIXED prevents the use of dynamic Huffman codes, allowing for a simpler + decoder for special applications. + + deflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_STREAM_ERROR if any parameter is invalid (such as an invalid + method), or Z_VERSION_ERROR if the zlib library version (zlib_version) is + incompatible with the version assumed by the caller (ZLIB_VERSION). msg is + set to null if there is no error message. deflateInit2 does not perform any + compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the compression dictionary from the given byte sequence + without producing any compressed output. When using the zlib format, this + function must be called immediately after deflateInit, deflateInit2 or + deflateReset, and before any call of deflate. When doing raw deflate, this + function must be called either before any call of deflate, or immediately + after the completion of a deflate block, i.e. after all input has been + consumed and all output has been delivered when using any of the flush + options Z_BLOCK, Z_PARTIAL_FLUSH, Z_SYNC_FLUSH, or Z_FULL_FLUSH. The + compressor and decompressor must use exactly the same dictionary (see + inflateSetDictionary). + + The dictionary should consist of strings (byte sequences) that are likely + to be encountered later in the data to be compressed, with the most commonly + used strings preferably put towards the end of the dictionary. Using a + dictionary is most useful when the data to be compressed is short and can be + predicted with good accuracy; the data can then be compressed better than + with the default empty dictionary. + + Depending on the size of the compression data structures selected by + deflateInit or deflateInit2, a part of the dictionary may in effect be + discarded, for example if the dictionary is larger than the window size + provided in deflateInit or deflateInit2. Thus the strings most likely to be + useful should be put at the end of the dictionary, not at the front. In + addition, the current implementation of deflate will use at most the window + size minus 262 bytes of the provided dictionary. + + Upon return of this function, strm->adler is set to the adler32 value + of the dictionary; the decompressor may later use this value to determine + which dictionary has been used by the compressor. (The adler32 value + applies to the whole dictionary even if only a subset of the dictionary is + actually used by the compressor.) If a raw deflate was requested, then the + adler32 value is not computed and strm->adler is not set. + + deflateSetDictionary returns Z_OK if success, or Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent (for example if deflate has already been called for this stream + or if not at a block boundary for raw deflate). deflateSetDictionary does + not perform any compression: this will be done by deflate(). +*/ + +ZEXTERN int ZEXPORT deflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when several compression strategies will be + tried, for example when there are several ways of pre-processing the input + data with a filter. The streams that will be discarded should then be freed + by calling deflateEnd. Note that deflateCopy duplicates the internal + compression state which can be quite large, so this strategy is slow and can + consume lots of memory. + + deflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT deflateReset OF((z_streamp strm)); +/* + This function is equivalent to deflateEnd followed by deflateInit, + but does not free and reallocate all the internal compression state. The + stream will keep the same compression level and any other attributes that + may have been set by deflateInit2. + + deflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT deflateParams OF((z_streamp strm, + int level, + int strategy)); +/* + Dynamically update the compression level and compression strategy. The + interpretation of level and strategy is as in deflateInit2. This can be + used to switch between compression and straight copy of the input data, or + to switch to a different kind of input data requiring a different strategy. + If the compression level is changed, the input available so far is + compressed with the old level (and may be flushed); the new level will take + effect only at the next call of deflate(). + + Before the call of deflateParams, the stream state must be set as for + a call of deflate(), since the currently available input may have to be + compressed and flushed. In particular, strm->avail_out must be non-zero. + + deflateParams returns Z_OK if success, Z_STREAM_ERROR if the source + stream state was inconsistent or if a parameter was invalid, Z_BUF_ERROR if + strm->avail_out was zero. +*/ + +ZEXTERN int ZEXPORT deflateTune OF((z_streamp strm, + int good_length, + int max_lazy, + int nice_length, + int max_chain)); +/* + Fine tune deflate's internal compression parameters. This should only be + used by someone who understands the algorithm used by zlib's deflate for + searching for the best matching string, and even then only by the most + fanatic optimizer trying to squeeze out the last compressed bit for their + specific input data. Read the deflate.c source code for the meaning of the + max_lazy, good_length, nice_length, and max_chain parameters. + + deflateTune() can be called after deflateInit() or deflateInit2(), and + returns Z_OK on success, or Z_STREAM_ERROR for an invalid deflate stream. + */ + +ZEXTERN uLong ZEXPORT deflateBound OF((z_streamp strm, + uLong sourceLen)); +/* + deflateBound() returns an upper bound on the compressed size after + deflation of sourceLen bytes. It must be called after deflateInit() or + deflateInit2(), and after deflateSetHeader(), if used. This would be used + to allocate an output buffer for deflation in a single pass, and so would be + called before deflate(). If that first deflate() call is provided the + sourceLen input bytes, an output buffer allocated to the size returned by + deflateBound(), and the flush value Z_FINISH, then deflate() is guaranteed + to return Z_STREAM_END. Note that it is possible for the compressed size to + be larger than the value returned by deflateBound() if flush options other + than Z_FINISH or Z_NO_FLUSH are used. +*/ + +ZEXTERN int ZEXPORT deflatePending OF((z_streamp strm, + unsigned *pending, + int *bits)); +/* + deflatePending() returns the number of bytes and bits of output that have + been generated, but not yet provided in the available output. The bytes not + provided would be due to the available output space having being consumed. + The number of bits of output not provided are between 0 and 7, where they + await more bits to join them in order to fill out a full byte. If pending + or bits are Z_NULL, then those values are not set. + + deflatePending returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. + */ + +ZEXTERN int ZEXPORT deflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + deflatePrime() inserts bits in the deflate output stream. The intent + is that this function is used to start off the deflate output with the bits + leftover from a previous deflate stream when appending to it. As such, this + function can only be used for raw deflate, and must be used before the first + deflate() call after a deflateInit2() or deflateReset(). bits must be less + than or equal to 16, and that many of the least significant bits of value + will be inserted in the output. + + deflatePrime returns Z_OK if success, Z_BUF_ERROR if there was not enough + room in the internal buffer to insert the bits, or Z_STREAM_ERROR if the + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT deflateSetHeader OF((z_streamp strm, + gz_headerp head)); +/* + deflateSetHeader() provides gzip header information for when a gzip + stream is requested by deflateInit2(). deflateSetHeader() may be called + after deflateInit2() or deflateReset() and before the first call of + deflate(). The text, time, os, extra field, name, and comment information + in the provided gz_header structure are written to the gzip header (xflag is + ignored -- the extra flags are set according to the compression level). The + caller must assure that, if not Z_NULL, name and comment are terminated with + a zero byte, and that if extra is not Z_NULL, that extra_len bytes are + available there. If hcrc is true, a gzip header crc is included. Note that + the current versions of the command-line version of gzip (up through version + 1.3.x) do not support header crc's, and will report that it is a "multi-part + gzip file" and give up. + + If deflateSetHeader is not used, the default gzip header has text false, + the time set to zero, and os set to 255, with no extra, name, or comment + fields. The gzip header is returned to the default state by deflateReset(). + + deflateSetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateInit2 OF((z_streamp strm, + int windowBits)); + + This is another version of inflateInit with an extra parameter. The + fields next_in, avail_in, zalloc, zfree and opaque must be initialized + before by the caller. + + The windowBits parameter is the base two logarithm of the maximum window + size (the size of the history buffer). It should be in the range 8..15 for + this version of the library. The default value is 15 if inflateInit is used + instead. windowBits must be greater than or equal to the windowBits value + provided to deflateInit2() while compressing, or it must be equal to 15 if + deflateInit2() was not used. If a compressed stream with a larger window + size is given as input, inflate() will return with the error code + Z_DATA_ERROR instead of trying to allocate a larger window. + + windowBits can also be zero to request that inflate use the window size in + the zlib header of the compressed stream. + + windowBits can also be -8..-15 for raw inflate. In this case, -windowBits + determines the window size. inflate() will then process raw deflate data, + not looking for a zlib or gzip header, not generating a check value, and not + looking for any check values for comparison at the end of the stream. This + is for use with other formats that use the deflate compressed data format + such as zip. Those formats provide their own check values. If a custom + format is developed using the raw deflate format for compressed data, it is + recommended that a check value such as an adler32 or a crc32 be applied to + the uncompressed data as is done in the zlib, gzip, and zip formats. For + most applications, the zlib format should be used as is. Note that comments + above on the use in deflateInit2() applies to the magnitude of windowBits. + + windowBits can also be greater than 15 for optional gzip decoding. Add + 32 to windowBits to enable zlib and gzip decoding with automatic header + detection, or add 16 to decode only the gzip format (the zlib format will + return a Z_DATA_ERROR). If a gzip stream is being decoded, strm->adler is a + crc32 instead of an adler32. + + inflateInit2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_VERSION_ERROR if the zlib library version is incompatible with the + version assumed by the caller, or Z_STREAM_ERROR if the parameters are + invalid, such as a null pointer to the structure. msg is set to null if + there is no error message. inflateInit2 does not perform any decompression + apart from possibly reading the zlib header if present: actual decompression + will be done by inflate(). (So next_in and avail_in may be modified, but + next_out and avail_out are unused and unchanged.) The current implementation + of inflateInit2() does not process any header information -- that is + deferred until inflate() is called. +*/ + +ZEXTERN int ZEXPORT inflateSetDictionary OF((z_streamp strm, + const Bytef *dictionary, + uInt dictLength)); +/* + Initializes the decompression dictionary from the given uncompressed byte + sequence. This function must be called immediately after a call of inflate, + if that call returned Z_NEED_DICT. The dictionary chosen by the compressor + can be determined from the adler32 value returned by that call of inflate. + The compressor and decompressor must use exactly the same dictionary (see + deflateSetDictionary). For raw inflate, this function can be called at any + time to set the dictionary. If the provided dictionary is smaller than the + window and there is already data in the window, then the provided dictionary + will amend what's there. The application must insure that the dictionary + that was used for compression is provided. + + inflateSetDictionary returns Z_OK if success, Z_STREAM_ERROR if a + parameter is invalid (e.g. dictionary being Z_NULL) or the stream state is + inconsistent, Z_DATA_ERROR if the given dictionary doesn't match the + expected one (incorrect adler32 value). inflateSetDictionary does not + perform any decompression: this will be done by subsequent calls of + inflate(). +*/ + +ZEXTERN int ZEXPORT inflateGetDictionary OF((z_streamp strm, + Bytef *dictionary, + uInt *dictLength)); +/* + Returns the sliding dictionary being maintained by inflate. dictLength is + set to the number of bytes in the dictionary, and that many bytes are copied + to dictionary. dictionary must have enough space, where 32768 bytes is + always enough. If inflateGetDictionary() is called with dictionary equal to + Z_NULL, then only the dictionary length is returned, and nothing is copied. + Similary, if dictLength is Z_NULL, then it is not set. + + inflateGetDictionary returns Z_OK on success, or Z_STREAM_ERROR if the + stream state is inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateSync OF((z_streamp strm)); +/* + Skips invalid compressed data until a possible full flush point (see above + for the description of deflate with Z_FULL_FLUSH) can be found, or until all + available input is skipped. No output is provided. + + inflateSync searches for a 00 00 FF FF pattern in the compressed data. + All full flush points have this pattern, but not all occurrences of this + pattern are full flush points. + + inflateSync returns Z_OK if a possible full flush point has been found, + Z_BUF_ERROR if no more input was provided, Z_DATA_ERROR if no flush point + has been found, or Z_STREAM_ERROR if the stream structure was inconsistent. + In the success case, the application may save the current current value of + total_in which indicates where valid compressed data was found. In the + error case, the application may repeatedly call inflateSync, providing more + input each time, until success or end of the input data. +*/ + +ZEXTERN int ZEXPORT inflateCopy OF((z_streamp dest, + z_streamp source)); +/* + Sets the destination stream as a complete copy of the source stream. + + This function can be useful when randomly accessing a large stream. The + first pass through the stream can periodically record the inflate state, + allowing restarting inflate at those points when randomly accessing the + stream. + + inflateCopy returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_STREAM_ERROR if the source stream state was inconsistent + (such as zalloc being Z_NULL). msg is left unchanged in both source and + destination. +*/ + +ZEXTERN int ZEXPORT inflateReset OF((z_streamp strm)); +/* + This function is equivalent to inflateEnd followed by inflateInit, + but does not free and reallocate all the internal decompression state. The + stream will keep attributes that may have been set by inflateInit2. + + inflateReset returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL). +*/ + +ZEXTERN int ZEXPORT inflateReset2 OF((z_streamp strm, + int windowBits)); +/* + This function is the same as inflateReset, but it also permits changing + the wrap and window size requests. The windowBits parameter is interpreted + the same as it is for inflateInit2. + + inflateReset2 returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent (such as zalloc or state being Z_NULL), or if + the windowBits parameter is invalid. +*/ + +ZEXTERN int ZEXPORT inflatePrime OF((z_streamp strm, + int bits, + int value)); +/* + This function inserts bits in the inflate input stream. The intent is + that this function is used to start inflating at a bit position in the + middle of a byte. The provided bits will be used before any bytes are used + from next_in. This function should only be used with raw inflate, and + should be used before the first inflate() call after inflateInit2() or + inflateReset(). bits must be less than or equal to 16, and that many of the + least significant bits of value will be inserted in the input. + + If bits is negative, then the input stream bit buffer is emptied. Then + inflatePrime() can be called again to put bits in the buffer. This is used + to clear out bits leftover after feeding inflate a block description prior + to feeding inflate codes. + + inflatePrime returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +ZEXTERN long ZEXPORT inflateMark OF((z_streamp strm)); +/* + This function returns two values, one in the lower 16 bits of the return + value, and the other in the remaining upper bits, obtained by shifting the + return value down 16 bits. If the upper value is -1 and the lower value is + zero, then inflate() is currently decoding information outside of a block. + If the upper value is -1 and the lower value is non-zero, then inflate is in + the middle of a stored block, with the lower value equaling the number of + bytes from the input remaining to copy. If the upper value is not -1, then + it is the number of bits back from the current bit position in the input of + the code (literal or length/distance pair) currently being processed. In + that case the lower value is the number of bytes already emitted for that + code. + + A code is being processed if inflate is waiting for more input to complete + decoding of the code, or if it has completed decoding but is waiting for + more output space to write the literal or match data. + + inflateMark() is used to mark locations in the input data for random + access, which may be at bit positions, and to note those cases where the + output of a code may span boundaries of random access blocks. The current + location in the input stream can be determined from avail_in and data_type + as noted in the description for the Z_BLOCK flush parameter for inflate. + + inflateMark returns the value noted above or -1 << 16 if the provided + source stream state was inconsistent. +*/ + +ZEXTERN int ZEXPORT inflateGetHeader OF((z_streamp strm, + gz_headerp head)); +/* + inflateGetHeader() requests that gzip header information be stored in the + provided gz_header structure. inflateGetHeader() may be called after + inflateInit2() or inflateReset(), and before the first call of inflate(). + As inflate() processes the gzip stream, head->done is zero until the header + is completed, at which time head->done is set to one. If a zlib stream is + being decoded, then head->done is set to -1 to indicate that there will be + no gzip header information forthcoming. Note that Z_BLOCK or Z_TREES can be + used to force inflate() to return immediately after header processing is + complete and before any actual data is decompressed. + + The text, time, xflags, and os fields are filled in with the gzip header + contents. hcrc is set to true if there is a header CRC. (The header CRC + was valid if done is set to one.) If extra is not Z_NULL, then extra_max + contains the maximum number of bytes to write to extra. Once done is true, + extra_len contains the actual extra field length, and extra contains the + extra field, or that field truncated if extra_max is less than extra_len. + If name is not Z_NULL, then up to name_max characters are written there, + terminated with a zero unless the length is greater than name_max. If + comment is not Z_NULL, then up to comm_max characters are written there, + terminated with a zero unless the length is greater than comm_max. When any + of extra, name, or comment are not Z_NULL and the respective field is not + present in the header, then that field is set to Z_NULL to signal its + absence. This allows the use of deflateSetHeader() with the returned + structure to duplicate the header. However if those fields are set to + allocated memory, then the application will need to save those pointers + elsewhere so that they can be eventually freed. + + If inflateGetHeader is not used, then the header information is simply + discarded. The header is always checked for validity, including the header + CRC if present. inflateReset() will reset the process to discard the header + information. The application would need to call inflateGetHeader() again to + retrieve the header from the next gzip stream. + + inflateGetHeader returns Z_OK if success, or Z_STREAM_ERROR if the source + stream state was inconsistent. +*/ + +/* +ZEXTERN int ZEXPORT inflateBackInit OF((z_streamp strm, int windowBits, + unsigned char FAR *window)); + + Initialize the internal stream state for decompression using inflateBack() + calls. The fields zalloc, zfree and opaque in strm must be initialized + before the call. If zalloc and zfree are Z_NULL, then the default library- + derived memory allocation routines are used. windowBits is the base two + logarithm of the window size, in the range 8..15. window is a caller + supplied buffer of that size. Except for special applications where it is + assured that deflate was used with small window sizes, windowBits must be 15 + and a 32K byte window must be supplied to be able to decompress general + deflate streams. + + See inflateBack() for the usage of these routines. + + inflateBackInit will return Z_OK on success, Z_STREAM_ERROR if any of + the parameters are invalid, Z_MEM_ERROR if the internal state could not be + allocated, or Z_VERSION_ERROR if the version of the library does not match + the version of the header file. +*/ + +typedef unsigned (*in_func) OF((void FAR *, + z_const unsigned char FAR * FAR *)); +typedef int (*out_func) OF((void FAR *, unsigned char FAR *, unsigned)); + +ZEXTERN int ZEXPORT inflateBack OF((z_streamp strm, + in_func in, void FAR *in_desc, + out_func out, void FAR *out_desc)); +/* + inflateBack() does a raw inflate with a single call using a call-back + interface for input and output. This is potentially more efficient than + inflate() for file i/o applications, in that it avoids copying between the + output and the sliding window by simply making the window itself the output + buffer. inflate() can be faster on modern CPUs when used with large + buffers. inflateBack() trusts the application to not change the output + buffer passed by the output function, at least until inflateBack() returns. + + inflateBackInit() must be called first to allocate the internal state + and to initialize the state with the user-provided window buffer. + inflateBack() may then be used multiple times to inflate a complete, raw + deflate stream with each call. inflateBackEnd() is then called to free the + allocated state. + + A raw deflate stream is one with no zlib or gzip header or trailer. + This routine would normally be used in a utility that reads zip or gzip + files and writes out uncompressed files. The utility would decode the + header and process the trailer on its own, hence this routine expects only + the raw deflate stream to decompress. This is different from the normal + behavior of inflate(), which expects either a zlib or gzip header and + trailer around the deflate stream. + + inflateBack() uses two subroutines supplied by the caller that are then + called by inflateBack() for input and output. inflateBack() calls those + routines until it reads a complete deflate stream and writes out all of the + uncompressed data, or until it encounters an error. The function's + parameters and return types are defined above in the in_func and out_func + typedefs. inflateBack() will call in(in_desc, &buf) which should return the + number of bytes of provided input, and a pointer to that input in buf. If + there is no input available, in() must return zero--buf is ignored in that + case--and inflateBack() will return a buffer error. inflateBack() will call + out(out_desc, buf, len) to write the uncompressed data buf[0..len-1]. out() + should return zero on success, or non-zero on failure. If out() returns + non-zero, inflateBack() will return with an error. Neither in() nor out() + are permitted to change the contents of the window provided to + inflateBackInit(), which is also the buffer that out() uses to write from. + The length written by out() will be at most the window size. Any non-zero + amount of input may be provided by in(). + + For convenience, inflateBack() can be provided input on the first call by + setting strm->next_in and strm->avail_in. If that input is exhausted, then + in() will be called. Therefore strm->next_in must be initialized before + calling inflateBack(). If strm->next_in is Z_NULL, then in() will be called + immediately for input. If strm->next_in is not Z_NULL, then strm->avail_in + must also be initialized, and then if strm->avail_in is not zero, input will + initially be taken from strm->next_in[0 .. strm->avail_in - 1]. + + The in_desc and out_desc parameters of inflateBack() is passed as the + first parameter of in() and out() respectively when they are called. These + descriptors can be optionally used to pass any information that the caller- + supplied in() and out() functions need to do their job. + + On return, inflateBack() will set strm->next_in and strm->avail_in to + pass back any unused input that was provided by the last in() call. The + return values of inflateBack() can be Z_STREAM_END on success, Z_BUF_ERROR + if in() or out() returned an error, Z_DATA_ERROR if there was a format error + in the deflate stream (in which case strm->msg is set to indicate the nature + of the error), or Z_STREAM_ERROR if the stream was not properly initialized. + In the case of Z_BUF_ERROR, an input or output error can be distinguished + using strm->next_in which will be Z_NULL only if in() returned an error. If + strm->next_in is not Z_NULL, then the Z_BUF_ERROR was due to out() returning + non-zero. (in() will always be called before out(), so strm->next_in is + assured to be defined if out() returns non-zero.) Note that inflateBack() + cannot return Z_OK. +*/ + +ZEXTERN int ZEXPORT inflateBackEnd OF((z_streamp strm)); +/* + All memory allocated by inflateBackInit() is freed. + + inflateBackEnd() returns Z_OK on success, or Z_STREAM_ERROR if the stream + state was inconsistent. +*/ + +ZEXTERN uLong ZEXPORT zlibCompileFlags OF((void)); +/* Return flags indicating compile-time options. + + Type sizes, two bits each, 00 = 16 bits, 01 = 32, 10 = 64, 11 = other: + 1.0: size of uInt + 3.2: size of uLong + 5.4: size of voidpf (pointer) + 7.6: size of z_off_t + + Compiler, assembler, and debug options: + 8: DEBUG + 9: ASMV or ASMINF -- use ASM code + 10: ZLIB_WINAPI -- exported functions use the WINAPI calling convention + 11: 0 (reserved) + + One-time table building (smaller code, but not thread-safe if true): + 12: BUILDFIXED -- build static block decoding tables when needed + 13: DYNAMIC_CRC_TABLE -- build CRC calculation tables when needed + 14,15: 0 (reserved) + + Library content (indicates missing functionality): + 16: NO_GZCOMPRESS -- gz* functions cannot compress (to avoid linking + deflate code when not needed) + 17: NO_GZIP -- deflate can't write gzip streams, and inflate can't detect + and decode gzip streams (to avoid linking crc code) + 18-19: 0 (reserved) + + Operation variations (changes in library functionality): + 20: PKZIP_BUG_WORKAROUND -- slightly more permissive inflate + 21: FASTEST -- deflate algorithm with only one, lowest compression level + 22,23: 0 (reserved) + + The sprintf variant used by gzprintf (zero is best): + 24: 0 = vs*, 1 = s* -- 1 means limited to 20 arguments after the format + 25: 0 = *nprintf, 1 = *printf -- 1 means gzprintf() not secure! + 26: 0 = returns value, 1 = void -- 1 means inferred string length returned + + Remainder: + 27-31: 0 (reserved) + */ + +#ifndef Z_SOLO + + /* utility functions */ + +/* + The following utility functions are implemented on top of the basic + stream-oriented functions. To simplify the interface, some default options + are assumed (compression level and memory usage, standard memory allocation + functions). The source code of these utility functions can be modified if + you need special options. +*/ + +ZEXTERN int ZEXPORT compress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Compresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer. +*/ + +ZEXTERN int ZEXPORT compress2 OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen, + int level)); +/* + Compresses the source buffer into the destination buffer. The level + parameter has the same meaning as in deflateInit. sourceLen is the byte + length of the source buffer. Upon entry, destLen is the total size of the + destination buffer, which must be at least the value returned by + compressBound(sourceLen). Upon exit, destLen is the actual size of the + compressed buffer. + + compress2 returns Z_OK if success, Z_MEM_ERROR if there was not enough + memory, Z_BUF_ERROR if there was not enough room in the output buffer, + Z_STREAM_ERROR if the level parameter is invalid. +*/ + +ZEXTERN uLong ZEXPORT compressBound OF((uLong sourceLen)); +/* + compressBound() returns an upper bound on the compressed size after + compress() or compress2() on sourceLen bytes. It would be used before a + compress() or compress2() call to allocate the destination buffer. +*/ + +ZEXTERN int ZEXPORT uncompress OF((Bytef *dest, uLongf *destLen, + const Bytef *source, uLong sourceLen)); +/* + Decompresses the source buffer into the destination buffer. sourceLen is + the byte length of the source buffer. Upon entry, destLen is the total size + of the destination buffer, which must be large enough to hold the entire + uncompressed data. (The size of the uncompressed data must have been saved + previously by the compressor and transmitted to the decompressor by some + mechanism outside the scope of this compression library.) Upon exit, destLen + is the actual size of the uncompressed buffer. + + uncompress returns Z_OK if success, Z_MEM_ERROR if there was not + enough memory, Z_BUF_ERROR if there was not enough room in the output + buffer, or Z_DATA_ERROR if the input data was corrupted or incomplete. In + the case where there is not enough room, uncompress() will fill the output + buffer with the uncompressed data up to that point. +*/ + + /* gzip file access functions */ + +/* + This library supports reading and writing files in gzip (.gz) format with + an interface similar to that of stdio, using the functions that start with + "gz". The gzip format is different from the zlib format. gzip is a gzip + wrapper, documented in RFC 1952, wrapped around a deflate stream. +*/ + +typedef struct gzFile_s *gzFile; /* semi-opaque gzip file descriptor */ + +/* +ZEXTERN gzFile ZEXPORT gzopen OF((const char *path, const char *mode)); + + Opens a gzip (.gz) file for reading or writing. The mode parameter is as + in fopen ("rb" or "wb") but can also include a compression level ("wb9") or + a strategy: 'f' for filtered data as in "wb6f", 'h' for Huffman-only + compression as in "wb1h", 'R' for run-length encoding as in "wb1R", or 'F' + for fixed code compression as in "wb9F". (See the description of + deflateInit2 for more information about the strategy parameter.) 'T' will + request transparent writing or appending with no compression and not using + the gzip format. + + "a" can be used instead of "w" to request that the gzip stream that will + be written be appended to the file. "+" will result in an error, since + reading and writing to the same gzip file is not supported. The addition of + "x" when writing will create the file exclusively, which fails if the file + already exists. On systems that support it, the addition of "e" when + reading or writing will set the flag to close the file on an execve() call. + + These functions, as well as gzip, will read and decode a sequence of gzip + streams in a file. The append function of gzopen() can be used to create + such a file. (Also see gzflush() for another way to do this.) When + appending, gzopen does not test whether the file begins with a gzip stream, + nor does it look for the end of the gzip streams to begin appending. gzopen + will simply append a gzip stream to the existing file. + + gzopen can be used to read a file which is not in gzip format; in this + case gzread will directly read from the file without decompression. When + reading, this will be detected automatically by looking for the magic two- + byte gzip header. + + gzopen returns NULL if the file could not be opened, if there was + insufficient memory to allocate the gzFile state, or if an invalid mode was + specified (an 'r', 'w', or 'a' was not provided, or '+' was provided). + errno can be checked to determine if the reason gzopen failed was that the + file could not be opened. +*/ + +ZEXTERN gzFile ZEXPORT gzdopen OF((int fd, const char *mode)); +/* + gzdopen associates a gzFile with the file descriptor fd. File descriptors + are obtained from calls like open, dup, creat, pipe or fileno (if the file + has been previously opened with fopen). The mode parameter is as in gzopen. + + The next call of gzclose on the returned gzFile will also close the file + descriptor fd, just like fclose(fdopen(fd, mode)) closes the file descriptor + fd. If you want to keep fd open, use fd = dup(fd_keep); gz = gzdopen(fd, + mode);. The duplicated descriptor should be saved to avoid a leak, since + gzdopen does not close fd if it fails. If you are using fileno() to get the + file descriptor from a FILE *, then you will have to use dup() to avoid + double-close()ing the file descriptor. Both gzclose() and fclose() will + close the associated file descriptor, so they need to have different file + descriptors. + + gzdopen returns NULL if there was insufficient memory to allocate the + gzFile state, if an invalid mode was specified (an 'r', 'w', or 'a' was not + provided, or '+' was provided), or if fd is -1. The file descriptor is not + used until the next gz* read, write, seek, or close operation, so gzdopen + will not detect if fd is invalid (unless fd is -1). +*/ + +ZEXTERN int ZEXPORT gzbuffer OF((gzFile file, unsigned size)); +/* + Set the internal buffer size used by this library's functions. The + default buffer size is 8192 bytes. This function must be called after + gzopen() or gzdopen(), and before any other calls that read or write the + file. The buffer memory allocation is always deferred to the first read or + write. Two buffers are allocated, either both of the specified size when + writing, or one of the specified size and the other twice that size when + reading. A larger buffer size of, for example, 64K or 128K bytes will + noticeably increase the speed of decompression (reading). + + The new buffer size also affects the maximum length for gzprintf(). + + gzbuffer() returns 0 on success, or -1 on failure, such as being called + too late. +*/ + +ZEXTERN int ZEXPORT gzsetparams OF((gzFile file, int level, int strategy)); +/* + Dynamically update the compression level or strategy. See the description + of deflateInit2 for the meaning of these parameters. + + gzsetparams returns Z_OK if success, or Z_STREAM_ERROR if the file was not + opened for writing. +*/ + +ZEXTERN int ZEXPORT gzread OF((gzFile file, voidp buf, unsigned len)); +/* + Reads the given number of uncompressed bytes from the compressed file. If + the input file is not in gzip format, gzread copies the given number of + bytes into the buffer directly from the file. + + After reaching the end of a gzip stream in the input, gzread will continue + to read, looking for another gzip stream. Any number of gzip streams may be + concatenated in the input file, and will all be decompressed by gzread(). + If something other than a gzip stream is encountered after a gzip stream, + that remaining trailing garbage is ignored (and no error is returned). + + gzread can be used to read a gzip file that is being concurrently written. + Upon reaching the end of the input, gzread will return with the available + data. If the error code returned by gzerror is Z_OK or Z_BUF_ERROR, then + gzclearerr can be used to clear the end of file indicator in order to permit + gzread to be tried again. Z_OK indicates that a gzip stream was completed + on the last gzread. Z_BUF_ERROR indicates that the input file ended in the + middle of a gzip stream. Note that gzread does not return -1 in the event + of an incomplete gzip stream. This error is deferred until gzclose(), which + will return Z_BUF_ERROR if the last gzread ended in the middle of a gzip + stream. Alternatively, gzerror can be used before gzclose to detect this + case. + + gzread returns the number of uncompressed bytes actually read, less than + len for end of file, or -1 for error. +*/ + +ZEXTERN int ZEXPORT gzwrite OF((gzFile file, + voidpc buf, unsigned len)); +/* + Writes the given number of uncompressed bytes into the compressed file. + gzwrite returns the number of uncompressed bytes written or 0 in case of + error. +*/ + +ZEXTERN int ZEXPORTVA gzprintf Z_ARG((gzFile file, const char *format, ...)); +/* + Converts, formats, and writes the arguments to the compressed file under + control of the format string, as in fprintf. gzprintf returns the number of + uncompressed bytes actually written, or 0 in case of error. The number of + uncompressed bytes written is limited to 8191, or one less than the buffer + size given to gzbuffer(). The caller should assure that this limit is not + exceeded. If it is exceeded, then gzprintf() will return an error (0) with + nothing written. In this case, there may also be a buffer overflow with + unpredictable consequences, which is possible only if zlib was compiled with + the insecure functions sprintf() or vsprintf() because the secure snprintf() + or vsnprintf() functions were not available. This can be determined using + zlibCompileFlags(). +*/ + +ZEXTERN int ZEXPORT gzputs OF((gzFile file, const char *s)); +/* + Writes the given null-terminated string to the compressed file, excluding + the terminating null character. + + gzputs returns the number of characters written, or -1 in case of error. +*/ + +ZEXTERN char * ZEXPORT gzgets OF((gzFile file, char *buf, int len)); +/* + Reads bytes from the compressed file until len-1 characters are read, or a + newline character is read and transferred to buf, or an end-of-file + condition is encountered. If any characters are read or if len == 1, the + string is terminated with a null character. If no characters are read due + to an end-of-file or len < 1, then the buffer is left untouched. + + gzgets returns buf which is a null-terminated string, or it returns NULL + for end-of-file or in case of error. If there was an error, the contents at + buf are indeterminate. +*/ + +ZEXTERN int ZEXPORT gzputc OF((gzFile file, int c)); +/* + Writes c, converted to an unsigned char, into the compressed file. gzputc + returns the value that was written, or -1 in case of error. +*/ + +ZEXTERN int ZEXPORT gzgetc OF((gzFile file)); +/* + Reads one byte from the compressed file. gzgetc returns this byte or -1 + in case of end of file or error. This is implemented as a macro for speed. + As such, it does not do all of the checking the other functions do. I.e. + it does not check to see if file is NULL, nor whether the structure file + points to has been clobbered or not. +*/ + +ZEXTERN int ZEXPORT gzungetc OF((int c, gzFile file)); +/* + Push one character back onto the stream to be read as the first character + on the next read. At least one character of push-back is allowed. + gzungetc() returns the character pushed, or -1 on failure. gzungetc() will + fail if c is -1, and may fail if a character has been pushed but not read + yet. If gzungetc is used immediately after gzopen or gzdopen, at least the + output buffer size of pushed characters is allowed. (See gzbuffer above.) + The pushed character will be discarded if the stream is repositioned with + gzseek() or gzrewind(). +*/ + +ZEXTERN int ZEXPORT gzflush OF((gzFile file, int flush)); +/* + Flushes all pending output into the compressed file. The parameter flush + is as in the deflate() function. The return value is the zlib error number + (see function gzerror below). gzflush is only permitted when writing. + + If the flush parameter is Z_FINISH, the remaining data is written and the + gzip stream is completed in the output. If gzwrite() is called again, a new + gzip stream will be started in the output. gzread() is able to read such + concatented gzip streams. + + gzflush should be called only when strictly necessary because it will + degrade compression if called too often. +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile file, + z_off_t offset, int whence)); + + Sets the starting position for the next gzread or gzwrite on the given + compressed file. The offset represents a number of bytes in the + uncompressed data stream. The whence parameter is defined as in lseek(2); + the value SEEK_END is not supported. + + If the file is opened for reading, this function is emulated but can be + extremely slow. If the file is opened for writing, only forward seeks are + supported; gzseek then compresses a sequence of zeroes up to the new + starting position. + + gzseek returns the resulting offset location as measured in bytes from + the beginning of the uncompressed stream, or -1 in case of error, in + particular if the file is opened for writing and the new starting position + would be before the current position. +*/ + +ZEXTERN int ZEXPORT gzrewind OF((gzFile file)); +/* + Rewinds the given file. This function is supported only for reading. + + gzrewind(file) is equivalent to (int)gzseek(file, 0L, SEEK_SET) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gztell OF((gzFile file)); + + Returns the starting position for the next gzread or gzwrite on the given + compressed file. This position represents a number of bytes in the + uncompressed data stream, and is zero when starting, even if appending or + reading a gzip stream from the middle of a file using gzdopen(). + + gztell(file) is equivalent to gzseek(file, 0L, SEEK_CUR) +*/ + +/* +ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile file)); + + Returns the current offset in the file being read or written. This offset + includes the count of bytes that precede the gzip stream, for example when + appending or when using gzdopen() for reading. When reading, the offset + does not include as yet unused buffered input. This information can be used + for a progress indicator. On error, gzoffset() returns -1. +*/ + +ZEXTERN int ZEXPORT gzeof OF((gzFile file)); +/* + Returns true (1) if the end-of-file indicator has been set while reading, + false (0) otherwise. Note that the end-of-file indicator is set only if the + read tried to go past the end of the input, but came up short. Therefore, + just like feof(), gzeof() may return false even if there is no more data to + read, in the event that the last read request was for the exact number of + bytes remaining in the input file. This will happen if the input file size + is an exact multiple of the buffer size. + + If gzeof() returns true, then the read functions will return no more data, + unless the end-of-file indicator is reset by gzclearerr() and the input file + has grown since the previous end of file was detected. +*/ + +ZEXTERN int ZEXPORT gzdirect OF((gzFile file)); +/* + Returns true (1) if file is being copied directly while reading, or false + (0) if file is a gzip stream being decompressed. + + If the input file is empty, gzdirect() will return true, since the input + does not contain a gzip stream. + + If gzdirect() is used immediately after gzopen() or gzdopen() it will + cause buffers to be allocated to allow reading the file to determine if it + is a gzip file. Therefore if gzbuffer() is used, it should be called before + gzdirect(). + + When writing, gzdirect() returns true (1) if transparent writing was + requested ("wT" for the gzopen() mode), or false (0) otherwise. (Note: + gzdirect() is not needed when writing. Transparent writing must be + explicitly requested, so the application already knows the answer. When + linking statically, using gzdirect() will include all of the zlib code for + gzip file reading and decompression, which may not be desired.) +*/ + +ZEXTERN int ZEXPORT gzclose OF((gzFile file)); +/* + Flushes all pending output if necessary, closes the compressed file and + deallocates the (de)compression state. Note that once file is closed, you + cannot call gzerror with file, since its structures have been deallocated. + gzclose must not be called more than once on the same file, just as free + must not be called more than once on the same allocation. + + gzclose will return Z_STREAM_ERROR if file is not valid, Z_ERRNO on a + file operation error, Z_MEM_ERROR if out of memory, Z_BUF_ERROR if the + last read ended in the middle of a gzip stream, or Z_OK on success. +*/ + +ZEXTERN int ZEXPORT gzclose_r OF((gzFile file)); +ZEXTERN int ZEXPORT gzclose_w OF((gzFile file)); +/* + Same as gzclose(), but gzclose_r() is only for use when reading, and + gzclose_w() is only for use when writing or appending. The advantage to + using these instead of gzclose() is that they avoid linking in zlib + compression or decompression code that is not used when only reading or only + writing respectively. If gzclose() is used, then both compression and + decompression code will be included the application when linking to a static + zlib library. +*/ + +ZEXTERN const char * ZEXPORT gzerror OF((gzFile file, int *errnum)); +/* + Returns the error message for the last error which occurred on the given + compressed file. errnum is set to zlib error number. If an error occurred + in the file system and not in the compression library, errnum is set to + Z_ERRNO and the application may consult errno to get the exact error code. + + The application must not modify the returned string. Future calls to + this function may invalidate the previously returned string. If file is + closed, then the string previously returned by gzerror will no longer be + available. + + gzerror() should be used to distinguish errors from end-of-file for those + functions above that do not distinguish those cases in their return values. +*/ + +ZEXTERN void ZEXPORT gzclearerr OF((gzFile file)); +/* + Clears the error and end-of-file flags for file. This is analogous to the + clearerr() function in stdio. This is useful for continuing to read a gzip + file that is being written concurrently. +*/ + +#endif /* !Z_SOLO */ + + /* checksum functions */ + +/* + These functions are not related to compression but are exported + anyway because they might be useful in applications using the compression + library. +*/ + +ZEXTERN uLong ZEXPORT adler32 OF((uLong adler, const Bytef *buf, uInt len)); +/* + Update a running Adler-32 checksum with the bytes buf[0..len-1] and + return the updated checksum. If buf is Z_NULL, this function returns the + required initial value for the checksum. + + An Adler-32 checksum is almost as reliable as a CRC32 but can be computed + much faster. + + Usage example: + + uLong adler = adler32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + adler = adler32(adler, buffer, length); + } + if (adler != original_adler) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT adler32_combine OF((uLong adler1, uLong adler2, + z_off_t len2)); + + Combine two Adler-32 checksums into one. For two sequences of bytes, seq1 + and seq2 with lengths len1 and len2, Adler-32 checksums were calculated for + each, adler1 and adler2. adler32_combine() returns the Adler-32 checksum of + seq1 and seq2 concatenated, requiring only adler1, adler2, and len2. Note + that the z_off_t type (like off_t) is a signed integer. If len2 is + negative, the result has no meaning or utility. +*/ + +ZEXTERN uLong ZEXPORT crc32 OF((uLong crc, const Bytef *buf, uInt len)); +/* + Update a running CRC-32 with the bytes buf[0..len-1] and return the + updated CRC-32. If buf is Z_NULL, this function returns the required + initial value for the crc. Pre- and post-conditioning (one's complement) is + performed within this function so it shouldn't be done by the application. + + Usage example: + + uLong crc = crc32(0L, Z_NULL, 0); + + while (read_buffer(buffer, length) != EOF) { + crc = crc32(crc, buffer, length); + } + if (crc != original_crc) error(); +*/ + +/* +ZEXTERN uLong ZEXPORT crc32_combine OF((uLong crc1, uLong crc2, z_off_t len2)); + + Combine two CRC-32 check values into one. For two sequences of bytes, + seq1 and seq2 with lengths len1 and len2, CRC-32 check values were + calculated for each, crc1 and crc2. crc32_combine() returns the CRC-32 + check value of seq1 and seq2 concatenated, requiring only crc1, crc2, and + len2. +*/ + + + /* various hacks, don't look :) */ + +/* deflateInit and inflateInit are macros to allow checking the zlib version + * and the compiler's view of z_stream: + */ +ZEXTERN int ZEXPORT deflateInit_ OF((z_streamp strm, int level, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateInit_ OF((z_streamp strm, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT deflateInit2_ OF((z_streamp strm, int level, int method, + int windowBits, int memLevel, + int strategy, const char *version, + int stream_size)); +ZEXTERN int ZEXPORT inflateInit2_ OF((z_streamp strm, int windowBits, + const char *version, int stream_size)); +ZEXTERN int ZEXPORT inflateBackInit_ OF((z_streamp strm, int windowBits, + unsigned char FAR *window, + const char *version, + int stream_size)); +#define deflateInit(strm, level) \ + deflateInit_((strm), (level), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit(strm) \ + inflateInit_((strm), ZLIB_VERSION, (int)sizeof(z_stream)) +#define deflateInit2(strm, level, method, windowBits, memLevel, strategy) \ + deflateInit2_((strm),(level),(method),(windowBits),(memLevel),\ + (strategy), ZLIB_VERSION, (int)sizeof(z_stream)) +#define inflateInit2(strm, windowBits) \ + inflateInit2_((strm), (windowBits), ZLIB_VERSION, \ + (int)sizeof(z_stream)) +#define inflateBackInit(strm, windowBits, window) \ + inflateBackInit_((strm), (windowBits), (window), \ + ZLIB_VERSION, (int)sizeof(z_stream)) + +#ifndef Z_SOLO + +/* gzgetc() macro and its supporting function and exposed data structure. Note + * that the real internal state is much larger than the exposed structure. + * This abbreviated structure exposes just enough for the gzgetc() macro. The + * user should not mess with these exposed elements, since their names or + * behavior could change in the future, perhaps even capriciously. They can + * only be used by the gzgetc() macro. You have been warned. + */ +struct gzFile_s { + unsigned have; + unsigned char *next; + z_off64_t pos; +}; +ZEXTERN int ZEXPORT gzgetc_ OF((gzFile file)); /* backward compatibility */ +#ifdef Z_PREFIX_SET +# undef z_gzgetc +# define z_gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#else +# define gzgetc(g) \ + ((g)->have ? ((g)->have--, (g)->pos++, *((g)->next)++) : gzgetc(g)) +#endif + +/* provide 64-bit offset functions if _LARGEFILE64_SOURCE defined, and/or + * change the regular functions to 64 bits if _FILE_OFFSET_BITS is 64 (if + * both are true, the application gets the *64 functions, and the regular + * functions are changed to 64 bits) -- in case these are set on systems + * without large file support, _LFS64_LARGEFILE must also be true + */ +#ifdef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off64_t ZEXPORT gzseek64 OF((gzFile, z_off64_t, int)); + ZEXTERN z_off64_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off64_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off64_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off64_t)); +#endif + +#if !defined(ZLIB_INTERNAL) && defined(Z_WANT64) +# ifdef Z_PREFIX_SET +# define z_gzopen z_gzopen64 +# define z_gzseek z_gzseek64 +# define z_gztell z_gztell64 +# define z_gzoffset z_gzoffset64 +# define z_adler32_combine z_adler32_combine64 +# define z_crc32_combine z_crc32_combine64 +# else +# define gzopen gzopen64 +# define gzseek gzseek64 +# define gztell gztell64 +# define gzoffset gzoffset64 +# define adler32_combine adler32_combine64 +# define crc32_combine crc32_combine64 +# endif +# ifndef Z_LARGE64 + ZEXTERN gzFile ZEXPORT gzopen64 OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek64 OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell64 OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset64 OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine64 OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine64 OF((uLong, uLong, z_off_t)); +# endif +#else + ZEXTERN gzFile ZEXPORT gzopen OF((const char *, const char *)); + ZEXTERN z_off_t ZEXPORT gzseek OF((gzFile, z_off_t, int)); + ZEXTERN z_off_t ZEXPORT gztell OF((gzFile)); + ZEXTERN z_off_t ZEXPORT gzoffset OF((gzFile)); + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); +#endif + +#else /* Z_SOLO */ + + ZEXTERN uLong ZEXPORT adler32_combine OF((uLong, uLong, z_off_t)); + ZEXTERN uLong ZEXPORT crc32_combine OF((uLong, uLong, z_off_t)); + +#endif /* !Z_SOLO */ + +/* hack for buggy compilers */ +#if !defined(ZUTIL_H) && !defined(NO_DUMMY_DECL) + struct internal_state {int dummy;}; +#endif + +/* undocumented functions */ +ZEXTERN const char * ZEXPORT zError OF((int)); +ZEXTERN int ZEXPORT inflateSyncPoint OF((z_streamp)); +ZEXTERN const z_crc_t FAR * ZEXPORT get_crc_table OF((void)); +ZEXTERN int ZEXPORT inflateUndermine OF((z_streamp, int)); +ZEXTERN int ZEXPORT inflateResetKeep OF((z_streamp)); +ZEXTERN int ZEXPORT deflateResetKeep OF((z_streamp)); +#if defined(_WIN32) && !defined(Z_SOLO) +ZEXTERN gzFile ZEXPORT gzopen_w OF((const wchar_t *path, + const char *mode)); +#endif +#if defined(STDC) || defined(Z_HAVE_STDARG_H) +# ifndef Z_SOLO +ZEXTERN int ZEXPORTVA gzvprintf Z_ARG((gzFile file, + const char *format, + va_list va)); +# endif +#endif + +#ifdef __cplusplus +} +#endif + +#endif /* ZLIB_H */ diff --git a/frontend/libpicofe b/frontend/libpicofe deleted file mode 160000 -Subproject 21604a047941b8fe81d381ede0371c75da964af diff --git a/frontend/libretro.c b/frontend/libretro.c index 940ff05..35e37a0 100644 --- a/frontend/libretro.c +++ b/frontend/libretro.c @@ -33,6 +33,21 @@ #include "revision.h" #include "libretro.h" +#ifdef _3DS +#include "3ds/3ds_utils.h" +#endif + +#define PORTS_NUMBER 8 + +#ifndef MIN +#define MIN(a, b) ((a) < (b) ? (a) : (b)) +#endif + +#define ISHEXDEC ((buf[cursor]>='0') && (buf[cursor]<='9')) || ((buf[cursor]>='a') && (buf[cursor]<='f')) || ((buf[cursor]>='A') && (buf[cursor]<='F')) + +//hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key +static int rebootemu = 0; + static retro_video_refresh_t video_cb; static retro_input_poll_t input_poll_cb; static retro_input_state_t input_state_cb; @@ -41,28 +56,46 @@ static retro_audio_sample_batch_t audio_batch_cb; static struct retro_rumble_interface rumble; static void *vout_buf; +static void * vout_buf_ptr; static int vout_width, vout_height; static int vout_doffs_old, vout_fb_dirty; static bool vout_can_dupe; static bool duping_enable; +static bool found_bios; static int plugins_opened; static int is_pal_mode; /* memory card data */ extern char Mcd1Data[MCD_SIZE]; +extern char Mcd2Data[MCD_SIZE]; extern char McdDisable[2]; /* PCSX ReARMed core calls and stuff */ -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; -int in_keystate; +int in_type[8] = { PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE, + PSE_PAD_TYPE_NONE, PSE_PAD_TYPE_NONE }; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +unsigned short in_keystate[PORTS_NUMBER]; +int multitap1 = 0; +int multitap2 = 0; int in_enable_vibration = 1; /* PSX max resolution is 640x512, but with enhancement it's 1024x512 */ #define VOUT_MAX_WIDTH 1024 #define VOUT_MAX_HEIGHT 512 +//Dummy functions +bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info){return false;} +void retro_unload_game(void){} +static int vout_open(void){return 0;} +static void vout_close(void){} +static int snd_init(void){return 0;} +static void snd_finish(void){} +static int snd_busy(void){return 0;} + static void init_memcard(char *mcd_data) { unsigned off = 0; @@ -96,15 +129,24 @@ static void init_memcard(char *mcd_data) } } -static int vout_open(void) -{ - return 0; -} - static void vout_set_mode(int w, int h, int raw_w, int raw_h, int bpp) { vout_width = w; vout_height = h; + + struct retro_framebuffer fb = {0}; + + fb.width = vout_width; + fb.height = vout_height; + fb.access_flags = RETRO_MEMORY_ACCESS_WRITE; + + vout_buf_ptr = vout_buf; + + if (environ_cb(RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER, &fb) && fb.format == RETRO_PIXEL_FORMAT_RGB565) + { + vout_buf_ptr = (uint16_t*)fb.data; + } + } #ifndef FRONTEND_SUPPORTS_RGB565 @@ -121,14 +163,14 @@ static void convert(void *buf, size_t bytes) static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) { - unsigned short *dest = vout_buf; + unsigned short *dest = vout_buf_ptr; const unsigned short *src = vram; int dstride = vout_width, h1 = h; int doffs; if (vram == NULL) { // blanking - memset(vout_buf, 0, dstride * h * 2); + memset(vout_buf_ptr, 0, dstride * h * 2); goto out; } @@ -136,7 +178,7 @@ static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) doffs += (dstride - w) / 2 & ~1; if (doffs != vout_doffs_old) { // clear borders - memset(vout_buf, 0, dstride * h * 2); + memset(vout_buf_ptr, 0, dstride * h * 2); vout_doffs_old = doffs; } dest += doffs; @@ -159,15 +201,172 @@ static void vout_flip(const void *vram, int stride, int bgr24, int w, int h) out: #ifndef FRONTEND_SUPPORTS_RGB565 - convert(vout_buf, vout_width * vout_height * 2); + convert(vout_buf_ptr, vout_width * vout_height * 2); #endif vout_fb_dirty = 1; pl_rearmed_cbs.flip_cnt++; } -static void vout_close(void) +#ifdef _3DS +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +psx_map_t custom_psx_maps[] = { + {NULL, 0x13000000, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, 0x12800000, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, 0x12c00000, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, 0x11000000, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, 0x12000000, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +void* pl_3ds_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) +{ + (void)is_fixed; + (void)addr; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + uint32_t ptr_aligned, tmp; + + custom_map->buffer = malloc(size + 0x1000); + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + if(svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_MAP, 0x3) < 0) + { + SysPrintf("could not map memory @0x%08X\n", custom_map->target_map); + exit(1); + } + + return (void*)custom_map->target_map; + } + } + } + + return malloc(size); +} + +void pl_3ds_munmap(void *ptr, size_t size, enum psxMapTag tag) +{ + (void)tag; + + if (__ctr_svchax) + { + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->target_map == (uint32_t)ptr)) + { + uint32_t ptr_aligned, tmp; + + ptr_aligned = (((u32)custom_map->buffer) + 0xFFF) & ~0xFFF; + + svcControlMemory(&tmp, (void*)custom_map->target_map, (void*)ptr_aligned, size, MEMOP_UNMAP, 0x3); + + free(custom_map->buffer); + custom_map->buffer = NULL; + return; + } + } + } + + free(ptr); +} +#endif + +#ifdef VITA +typedef struct +{ + void* buffer; + uint32_t target_map; + size_t size; + enum psxMapTag tag; +}psx_map_t; + +void* addr = NULL; + +psx_map_t custom_psx_maps[] = { + {NULL, NULL, 0x210000, MAP_TAG_RAM}, // 0x80000000 + {NULL, NULL, 0x010000, MAP_TAG_OTHER}, // 0x1f800000 + {NULL, NULL, 0x080000, MAP_TAG_OTHER}, // 0x1fc00000 + {NULL, NULL, 0x800000, MAP_TAG_LUTS}, // 0x08000000 + {NULL, NULL, 0x200000, MAP_TAG_VRAM}, // 0x00000000 +}; + +int init_vita_mmap(){ + int n; + void * tmpaddr; + addr = malloc(64*1024*1024); + if(addr==NULL) + return -1; + tmpaddr = ((u32)(addr+0xFFFFFF))&~0xFFFFFF; + custom_psx_maps[0].buffer=tmpaddr+0x2000000; + custom_psx_maps[1].buffer=tmpaddr+0x1800000; + custom_psx_maps[2].buffer=tmpaddr+0x1c00000; + custom_psx_maps[3].buffer=tmpaddr+0x0000000; + custom_psx_maps[4].buffer=tmpaddr+0x1000000; +#if 0 + for(n = 0; n < 5; n++){ + sceClibPrintf("addr reserved %x\n",custom_psx_maps[n].buffer); + } +#endif + return 0; +} + +void deinit_vita_mmap(){ + free(addr); +} + +void* pl_vita_mmap(unsigned long addr, size_t size, int is_fixed, + enum psxMapTag tag) +{ + (void)is_fixed; + (void)addr; + + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->size == size) && (custom_map->tag == tag)) + { + return custom_map->buffer; + } + } + + + return malloc(size); +} + +void pl_vita_munmap(void *ptr, size_t size, enum psxMapTag tag) { + (void)tag; + + psx_map_t* custom_map = custom_psx_maps; + + for (; custom_map->size; custom_map++) + { + if ((custom_map->buffer == ptr)) + { + return; + } + } + + free(ptr); } +#endif static void *pl_mmap(unsigned int size) { @@ -204,8 +403,11 @@ void pl_timing_prepare(int is_pal) void plat_trigger_vibrate(int pad, int low, int high) { - rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8); - rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0); + if(in_enable_vibration) + { + rumble.set_rumble_state(pad, RETRO_RUMBLE_STRONG, high << 8); + rumble.set_rumble_state(pad, RETRO_RUMBLE_WEAK, low ? 0xffff : 0x0); + } } void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in) @@ -213,20 +415,6 @@ void pl_update_gun(int *xn, int *yn, int *xres, int *yres, int *in) } /* sound calls */ -static int snd_init(void) -{ - return 0; -} - -static void snd_finish(void) -{ -} - -static int snd_busy(void) -{ - return 0; -} - static void snd_feed(void *buf, int bytes) { if (audio_batch_cb != NULL) @@ -248,8 +436,17 @@ void retro_set_environment(retro_environment_t cb) static const struct retro_variable vars[] = { { "pcsx_rearmed_frameskip", "Frameskip; 0|1|2|3" }, { "pcsx_rearmed_region", "Region; Auto|NTSC|PAL" }, - { "pcsx_rearmed_pad1type", "Pad 1 Type; standard|analog" }, - { "pcsx_rearmed_pad2type", "Pad 2 Type; standard|analog" }, + { "pcsx_rearmed_pad1type", "Pad 1 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad2type", "Pad 2 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad3type", "Pad 3 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad4type", "Pad 4 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad5type", "Pad 5 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad6type", "Pad 6 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad7type", "Pad 7 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_pad8type", "Pad 8 Type; default|none|standard|analog|negcon" }, + { "pcsx_rearmed_multitap1", "Multitap 1; auto|disabled|enabled" }, + { "pcsx_rearmed_multitap2", "Multitap 2; auto|disabled|enabled" }, + { "pcsx_rearmed_vibration", "Enable Vibration; enabled|disabled" }, #ifndef DRC_DISABLE { "pcsx_rearmed_drc", "Dynamic recompiler; enabled|disabled" }, #endif @@ -258,9 +455,12 @@ void retro_set_environment(retro_environment_t cb) { "pcsx_rearmed_neon_enhancement_enable", "Enhanced resolution (slow); disabled|enabled" }, { "pcsx_rearmed_neon_enhancement_no_main", "Enhanced resolution speed hack; disabled|enabled" }, #endif - { "pcsx_rearmed_duping_enable", "Frame duping; on|off" }, - { "pcsx_rearmed_spu_reverb", "Sound: Reverb; on|off" }, + { "pcsx_rearmed_duping_enable", "Frame duping; enabled|disabled" }, + { "pcsx_rearmed_show_bios_bootlogo", "Show Bios Bootlogo(Breaks some games); disabled|enabled" }, + { "pcsx_rearmed_spu_reverb", "Sound: Reverb; enabled|disabled" }, { "pcsx_rearmed_spu_interpolation", "Sound: Interpolation; simple|gaussian|cubic|off" }, + { "pcsx_rearmed_pe2_fix", "Parasite Eve 2/Vandal Hearts 1/2 Fix; disabled|enabled" }, + { "pcsx_rearmed_inuyasha_fix", "InuYasha Sengoku Battle Fix; disabled|enabled" }, { NULL, NULL }, }; @@ -280,15 +480,170 @@ unsigned retro_api_version(void) return RETRO_API_VERSION; } +static int controller_port_variable(unsigned port, struct retro_variable *var) +{ + if (port >= PORTS_NUMBER) + return 0; + + if (!environ_cb) + return 0; + + var->value = NULL; + switch (port) { + case 0: + var->key = "pcsx_rearmed_pad1type"; + break; + case 1: + var->key = "pcsx_rearmed_pad2type"; + break; + case 2: + var->key = "pcsx_rearmed_pad3type"; + break; + case 3: + var->key = "pcsx_rearmed_pad4type"; + break; + case 4: + var->key = "pcsx_rearmed_pad5type"; + break; + case 5: + var->key = "pcsx_rearmed_pad6type"; + break; + case 6: + var->key = "pcsx_rearmed_pad7type"; + break; + case 7: + var->key = "pcsx_rearmed_pad8type"; + break; + } + + return environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, var) || var->value; +} + +static void update_controller_port_variable(unsigned port) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (controller_port_variable(port, &var)) + { + if (strcmp(var.value, "standard") == 0) + in_type[port] = PSE_PAD_TYPE_STANDARD; + else if (strcmp(var.value, "analog") == 0) + in_type[port] = PSE_PAD_TYPE_ANALOGPAD; + else if (strcmp(var.value, "negcon") == 0) + in_type[port] = PSE_PAD_TYPE_NEGCON; + else if (strcmp(var.value, "none") == 0) + in_type[port] = PSE_PAD_TYPE_NONE; + // else 'default' case, do nothing + } +} + +static void update_controller_port_device(unsigned port, unsigned device) +{ + if (port >= PORTS_NUMBER) + return; + + struct retro_variable var; + + if (!controller_port_variable(port, &var)) + return; + + if (strcmp(var.value, "default") != 0) + return; + + switch (device) + { + case RETRO_DEVICE_JOYPAD: + in_type[port] = PSE_PAD_TYPE_STANDARD; + break; + case RETRO_DEVICE_ANALOG: + in_type[port] = PSE_PAD_TYPE_ANALOGPAD; + break; + case RETRO_DEVICE_MOUSE: + in_type[port] = PSE_PAD_TYPE_MOUSE; + break; + case RETRO_DEVICE_LIGHTGUN: + in_type[port] = PSE_PAD_TYPE_GUN; + break; + case RETRO_DEVICE_NONE: + default: + in_type[port] = PSE_PAD_TYPE_NONE; + } +} + +static void update_multitap() +{ + struct retro_variable var; + int auto_case, port; + + var.value = NULL; + var.key = "pcsx_rearmed_multitap1"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap1 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap1 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 2, we need a first multitap. + multitap1 = 0; + for (port = 2; port < PORTS_NUMBER; port++) + multitap1 |= in_type[port] != PSE_PAD_TYPE_NONE; + } + + var.value = NULL; + var.key = "pcsx_rearmed_multitap2"; + auto_case = 0; + if (environ_cb && (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value)) + { + if (strcmp(var.value, "enabled") == 0) + multitap2 = 1; + else if (strcmp(var.value, "disabled") == 0) + multitap2 = 0; + else // 'auto' case + auto_case = 1; + } + else + auto_case = 1; + + if (auto_case) + { + // If a gamepad is plugged after port 4, we need a second multitap. + multitap2 = 0; + for (port = 4; port < PORTS_NUMBER; port++) + multitap2 |= in_type[port] != PSE_PAD_TYPE_NONE; + } +} + void retro_set_controller_port_device(unsigned port, unsigned device) { + SysPrintf("port %u device %u",port,device); + + if (port >= PORTS_NUMBER) + return; + + update_controller_port_device(port, device); + update_multitap(); } void retro_get_system_info(struct retro_system_info *info) { memset(info, 0, sizeof(*info)); info->library_name = "PCSX-ReARMed"; - info->library_version = "r22"; +#ifndef GIT_VERSION +#define GIT_VERSION "" +#endif + info->library_version = "r22" GIT_VERSION; info->valid_extensions = "bin|cue|img|mdf|pbp|toc|cbn|m3u"; info->need_fullpath = true; } @@ -306,8 +661,8 @@ void retro_get_system_av_info(struct retro_system_av_info *info) } /* savestates */ -size_t retro_serialize_size(void) -{ +size_t retro_serialize_size(void) +{ // it's currently 4380651-4397047 bytes, // but have some reserved for future return 0x440000; @@ -393,7 +748,7 @@ static void save_close(void *file) } bool retro_serialize(void *data, size_t size) -{ +{ int ret = SaveState(data); return ret == 0 ? true : false; } @@ -418,6 +773,21 @@ void retro_cheat_set(unsigned index, bool enabled, const char *code) // cheat funcs are destructive, need a copy.. strncpy(buf, code, sizeof(buf)); buf[sizeof(buf) - 1] = 0; + + //Prepare buffered cheat for PCSX's AddCheat fucntion. + int cursor=0; + int nonhexdec=0; + while (buf[cursor]){ + if (!(ISHEXDEC)){ + if (++nonhexdec%2){ + buf[cursor]=' '; + } else { + buf[cursor]='\n'; + } + } + cursor++; + } + if (index < NumCheats) ret = EditCheat(index, "", buf); @@ -557,6 +927,10 @@ static struct retro_disk_control_callback disk_control = { #define SLASH '/' #endif +#ifndef PATH_MAX +#define PATH_MAX 4096 +#endif + static char base_dir[PATH_MAX]; static bool read_m3u(const char *file) @@ -761,7 +1135,7 @@ bool retro_load_game(const struct retro_game_info *info) { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 5, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 5, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -782,7 +1156,7 @@ bool retro_load_game(const struct retro_game_info *info) { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 6, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 6, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -803,7 +1177,7 @@ bool retro_load_game(const struct retro_game_info *info) { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R2, "R2" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_R3, "R3" }, { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_SELECT, "Select" }, - { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, + { 7, RETRO_DEVICE_JOYPAD, 0, RETRO_DEVICE_ID_JOYPAD_START, "Start" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X, "Left Analog X" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y, "Left Analog Y" }, { 7, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X, "Right Analog X" }, @@ -897,15 +1271,6 @@ bool retro_load_game(const struct retro_game_info *info) return true; } -bool retro_load_game_special(unsigned game_type, const struct retro_game_info *info, size_t num_info) -{ - return false; -} - -void retro_unload_game(void) -{ -} - unsigned retro_get_region(void) { return is_pal_mode ? RETRO_REGION_PAL : RETRO_REGION_NTSC; @@ -929,7 +1294,9 @@ size_t retro_get_memory_size(unsigned id) void retro_reset(void) { - SysReset(); + //hack to prevent retroarch freezing when reseting in the menu but not while running with the hot key + rebootemu = 1; + //SysReset(); } static const unsigned short retro_psx_map[] = { @@ -955,16 +1322,15 @@ static const unsigned short retro_psx_map[] = { static void update_variables(bool in_flight) { struct retro_variable var; - + int i; + var.value = NULL; var.key = "pcsx_rearmed_frameskip"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) pl_rearmed_cbs.frameskip = atoi(var.value); var.value = NULL; var.key = "pcsx_rearmed_region"; - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { Config.PsxAuto = 0; @@ -976,24 +1342,20 @@ static void update_variables(bool in_flight) Config.PsxType = 1; } - var.value = NULL; - var.key = "pcsx_rearmed_pad1type"; + for (i = 0; i < PORTS_NUMBER; i++) + update_controller_port_variable(i); - if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) - { - in_type1 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type1 = PSE_PAD_TYPE_ANALOGPAD; - } + update_multitap(); var.value = NULL; - var.key = "pcsx_rearmed_pad2type"; + var.key = "pcsx_rearmed_vibration"; if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - in_type2 = PSE_PAD_TYPE_STANDARD; - if (strcmp(var.value, "analog") == 0) - in_type2 = PSE_PAD_TYPE_ANALOGPAD; + if (strcmp(var.value, "disabled") == 0) + in_enable_vibration = 0; + else if (strcmp(var.value, "enabled") == 0) + in_enable_vibration = 1; } #ifdef __ARM_NEON__ @@ -1036,9 +1398,9 @@ static void update_variables(bool in_flight) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - if (strcmp(var.value, "off") == 0) + if (strcmp(var.value, "disabled") == 0) duping_enable = false; - else if (strcmp(var.value, "on") == 0) + else if (strcmp(var.value, "enabled") == 0) duping_enable = true; } @@ -1050,6 +1412,11 @@ static void update_variables(bool in_flight) { R3000Acpu *prev_cpu = psxCpu; +#ifdef _3DS + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; + else +#endif if (strcmp(var.value, "disabled") == 0) Config.Cpu = CPU_INTERPRETER; else if (strcmp(var.value, "enabled") == 0) @@ -1069,9 +1436,9 @@ static void update_variables(bool in_flight) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) { - if (strcmp(var.value, "off") == 0) + if (strcmp(var.value, "disabled") == 0) spu_config.iUseReverb = false; - else if (strcmp(var.value, "on") == 0) + else if (strcmp(var.value, "enabled") == 0) spu_config.iUseReverb = true; } @@ -1090,6 +1457,28 @@ static void update_variables(bool in_flight) spu_config.iUseInterpolation = 0; } + var.value = "NULL"; + var.key = "pcsx_rearmed_pe2_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.RCntFix = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.RCntFix = 1; + } + + var.value = "NULL"; + var.key = "pcsx_rearmed_inuyasha_fix"; + + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "disabled") == 0) + Config.VSyncWA = 0; + else if (strcmp(var.value, "enabled") == 0) + Config.VSyncWA = 1; + } + if (in_flight) { // inform core things about possible config changes plugin_call_rearmed_cbs(); @@ -1101,11 +1490,30 @@ static void update_variables(bool in_flight) dfinput_activate(); } + else{ + //not yet running + + //bootlogo display hack + if (found_bios) { + var.value = "NULL"; + var.key = "pcsx_rearmed_show_bios_bootlogo"; + if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE, &var) || var.value) + { + if (strcmp(var.value, "enabled") == 0) + rebootemu = 1; + } + } + } } -void retro_run(void) +void retro_run(void) { - int i; + int i; + //SysReset must be run while core is running,Not in menu (Locks up Retroarch) + if(rebootemu != 0){ + rebootemu = 0; + SysReset(); + } input_poll_cb(); @@ -1113,27 +1521,32 @@ void retro_run(void) if (environ_cb(RETRO_ENVIRONMENT_GET_VARIABLE_UPDATE, &updated) && updated) update_variables(true); - in_keystate = 0; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(1, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; - in_keystate <<= 16; - for (i = 0; i < RETRO_PSX_MAP_LEN; i++) - if (input_state_cb(0, RETRO_DEVICE_JOYPAD, 0, i)) - in_keystate |= retro_psx_map[i]; + // reset all keystate, query libretro for keystate + int j; + for(i = 0; i < PORTS_NUMBER; i++) { + in_keystate[i] = 0; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) - { - in_a1[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a1[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; - in_a2[0] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 256) + 128; - in_a2[1] = (input_state_cb(0, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 256) + 128; + if (in_type[i] == PSE_PAD_TYPE_NONE) + continue; + + // query libretro for keystate + for (j = 0; j < RETRO_PSX_MAP_LEN; j++) + if (input_state_cb(i, RETRO_DEVICE_JOYPAD, 0, j)) + in_keystate[i] |= retro_psx_map[j]; + + if (in_type[i] == PSE_PAD_TYPE_ANALOGPAD) + { + in_analog_left[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255); + in_analog_left[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_LEFT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255); + in_analog_right[i][0] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_X) / 255) + 128, 255); + in_analog_right[i][1] = MIN((input_state_cb(i, RETRO_DEVICE_ANALOG, RETRO_DEVICE_INDEX_ANALOG_RIGHT, RETRO_DEVICE_ID_ANALOG_Y) / 255) + 128, 255); + } } stop = 0; psxCpu->Execute(); - video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf : NULL, + video_cb((vout_fb_dirty || !vout_can_dupe || !duping_enable) ? vout_buf_ptr : NULL, vout_width, vout_height, vout_width * 2); vout_fb_dirty = 0; } @@ -1162,7 +1575,7 @@ static bool try_use_bios(const char *path) return true; } -#if 1 +#ifndef VITA #include <sys/types.h> #include <dirent.h> @@ -1200,33 +1613,54 @@ static void check_system_specs(void) void retro_init(void) { - const char *bios[] = { "scph1001", "scph5501", "scph7001" }; + const char *bios[] = { "SCPH101", "SCPH7001", "SCPH5501", "SCPH1001" }; const char *dir; char path[256]; int i, ret; - bool found_bios = false; + + found_bios = false; #ifdef __MACH__ // magic sauce to make the dynarec work on iOS syscall(SYS_ptrace, 0 /*PTRACE_TRACEME*/, 0, 0, 0); #endif +#ifdef _3DS + psxMapHook = pl_3ds_mmap; + psxUnmapHook = pl_3ds_munmap; +#endif +#ifdef VITA + if(init_vita_mmap()<0) + abort(); + psxMapHook = pl_vita_mmap; + psxUnmapHook = pl_vita_munmap; +#endif ret = emu_core_preinit(); +#ifdef _3DS + /* emu_core_preinit sets the cpu to dynarec */ + if(!__ctr_svchax) + Config.Cpu = CPU_INTERPRETER; +#endif + ret |= emu_core_init(); if (ret != 0) { SysPrintf("PCSX init failed.\n"); exit(1); } -#if defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) +#ifdef _3DS + vout_buf = linearMemAlign(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2, 0x80); +#elif defined(_POSIX_C_SOURCE) && (_POSIX_C_SOURCE >= 200112L) && !defined(VITA) posix_memalign(&vout_buf, 16, VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); #else vout_buf = malloc(VOUT_MAX_WIDTH * VOUT_MAX_HEIGHT * 2); #endif - + + vout_buf_ptr = vout_buf; + if (environ_cb(RETRO_ENVIRONMENT_GET_SYSTEM_DIRECTORY, &dir) && dir) { - snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s/", dir); + snprintf(Config.BiosDir, sizeof(Config.BiosDir), "%s", dir); for (i = 0; i < sizeof(bios) / sizeof(bios[0]); i++) { snprintf(path, sizeof(path), "%s/%s.bin", dir, bios[i]); @@ -1244,9 +1678,9 @@ void retro_init(void) else { SysPrintf("no BIOS files found.\n"); - struct retro_message msg = + struct retro_message msg = { - "no BIOS found, expect bugs!", + "No BIOS file found - add for better compatibility", 180 }; environ_cb(RETRO_ENVIRONMENT_SET_MESSAGE, (void*)&msg); @@ -1269,6 +1703,7 @@ void retro_init(void) McdDisable[0] = 0; McdDisable[1] = 1; init_memcard(Mcd1Data); + init_memcard(Mcd2Data); SaveFuncs.open = save_open; SaveFuncs.read = save_read; @@ -1283,6 +1718,22 @@ void retro_init(void) void retro_deinit(void) { SysClose(); +#ifdef _3DS + linearFree(vout_buf); +#else free(vout_buf); +#endif vout_buf = NULL; + +#ifdef VITA + deinit_vita_mmap(); +#endif +} + +#ifdef VITA +#include <psp2/kernel/threadmgr.h> +int usleep (unsigned long us) +{ + sceKernelDelayThread(us); } +#endif diff --git a/frontend/libretro.h b/frontend/libretro.h index 16c274a..a231548 100755 --- a/frontend/libretro.h +++ b/frontend/libretro.h @@ -1,4 +1,4 @@ -/* Copyright (C) 2010-2014 The RetroArch team +/* Copyright (C) 2010-2016 The RetroArch team * * --------------------------------------------------------------------------------------- * The following license statement only applies to this libretro API header (libretro.h). @@ -43,6 +43,40 @@ extern "C" { #endif #endif +#ifndef RETRO_CALLCONV +# if defined(__GNUC__) && defined(__i386__) && !defined(__x86_64__) +# define RETRO_CALLCONV __attribute__((cdecl)) +# elif defined(_MSC_VER) && defined(_M_X86) && !defined(_M_X64) +# define RETRO_CALLCONV __cdecl +# else +# define RETRO_CALLCONV /* all other platforms only have one calling convention each */ +# endif +#endif + +#ifndef RETRO_API +# if defined(_WIN32) || defined(__CYGWIN__) || defined(__MINGW32__) +# ifdef RETRO_IMPORT_SYMBOLS +# ifdef __GNUC__ +# define RETRO_API RETRO_CALLCONV __attribute__((__dllimport__)) +# else +# define RETRO_API RETRO_CALLCONV __declspec(dllimport) +# endif +# else +# ifdef __GNUC__ +# define RETRO_API RETRO_CALLCONV __attribute__((__dllexport__)) +# else +# define RETRO_API RETRO_CALLCONV __declspec(dllexport) +# endif +# endif +# else +# if defined(__GNUC__) && __GNUC__ >= 4 && !defined(__CELLOS_LV2__) +# define RETRO_API RETRO_CALLCONV __attribute__((__visibility__("default"))) +# else +# define RETRO_API RETRO_CALLCONV +# endif +# endif +#endif + /* Used for checking API/ABI mismatches that can break libretro * implementations. * It is not incremented for compatible changes to the API. @@ -165,13 +199,15 @@ extern "C" { #define RETRO_DEVICE_ID_ANALOG_Y 1 /* Id values for MOUSE. */ -#define RETRO_DEVICE_ID_MOUSE_X 0 -#define RETRO_DEVICE_ID_MOUSE_Y 1 -#define RETRO_DEVICE_ID_MOUSE_LEFT 2 -#define RETRO_DEVICE_ID_MOUSE_RIGHT 3 -#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4 -#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5 -#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6 +#define RETRO_DEVICE_ID_MOUSE_X 0 +#define RETRO_DEVICE_ID_MOUSE_Y 1 +#define RETRO_DEVICE_ID_MOUSE_LEFT 2 +#define RETRO_DEVICE_ID_MOUSE_RIGHT 3 +#define RETRO_DEVICE_ID_MOUSE_WHEELUP 4 +#define RETRO_DEVICE_ID_MOUSE_WHEELDOWN 5 +#define RETRO_DEVICE_ID_MOUSE_MIDDLE 6 +#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELUP 7 +#define RETRO_DEVICE_ID_MOUSE_HORIZ_WHEELDOWN 8 /* Id values for LIGHTGUN types. */ #define RETRO_DEVICE_ID_LIGHTGUN_X 0 @@ -206,6 +242,8 @@ enum retro_language RETRO_LANGUAGE_KOREAN = 9, RETRO_LANGUAGE_CHINESE_TRADITIONAL = 10, RETRO_LANGUAGE_CHINESE_SIMPLIFIED = 11, + RETRO_LANGUAGE_ESPERANTO = 12, + RETRO_LANGUAGE_POLISH = 13, RETRO_LANGUAGE_LAST, /* Ensure sizeof(enum) == sizeof(int) */ @@ -693,9 +731,10 @@ enum retro_mod * location-based information from the host device, * such as current latitude / longitude. */ -#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 +#define RETRO_ENVIRONMENT_GET_CONTENT_DIRECTORY 30 /* Old name, kept for compatibility. */ +#define RETRO_ENVIRONMENT_GET_CORE_ASSETS_DIRECTORY 30 /* const char ** -- - * Returns the "content" directory of the frontend. + * Returns the "core assets" directory of the frontend. * This directory can be used to store specific assets that the * core relies upon, such as art assets, * input data, etc etc. @@ -851,6 +890,61 @@ enum retro_mod * Returns the specified language of the frontend, if specified by the user. * It can be used by the core for localization purposes. */ +#define RETRO_ENVIRONMENT_GET_CURRENT_SOFTWARE_FRAMEBUFFER (40 | RETRO_ENVIRONMENT_EXPERIMENTAL) + /* struct retro_framebuffer * -- + * Returns a preallocated framebuffer which the core can use for rendering + * the frame into when not using SET_HW_RENDER. + * The framebuffer returned from this call must not be used + * after the current call to retro_run() returns. + * + * The goal of this call is to allow zero-copy behavior where a core + * can render directly into video memory, avoiding extra bandwidth cost by copying + * memory from core to video memory. + * + * If this call succeeds and the core renders into it, + * the framebuffer pointer and pitch can be passed to retro_video_refresh_t. + * If the buffer from GET_CURRENT_SOFTWARE_FRAMEBUFFER is to be used, + * the core must pass the exact + * same pointer as returned by GET_CURRENT_SOFTWARE_FRAMEBUFFER; + * i.e. passing a pointer which is offset from the + * buffer is undefined. The width, height and pitch parameters + * must also match exactly to the values obtained from GET_CURRENT_SOFTWARE_FRAMEBUFFER. + * + * It is possible for a frontend to return a different pixel format + * than the one used in SET_PIXEL_FORMAT. This can happen if the frontend + * needs to perform conversion. + * + * It is still valid for a core to render to a different buffer + * even if GET_CURRENT_SOFTWARE_FRAMEBUFFER succeeds. + * + * A frontend must make sure that the pointer obtained from this function is + * writeable (and readable). + */ + +enum retro_hw_render_interface_type +{ + RETRO_HW_RENDER_INTERFACE_VULKAN = 0, + RETRO_HW_RENDER_INTERFACE_DUMMY = INT_MAX +}; + +/* Base struct. All retro_hw_render_interface_* types + * contain at least these fields. */ +struct retro_hw_render_interface +{ + enum retro_hw_render_interface_type interface_type; + unsigned interface_version; +}; +#define RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE (41 | RETRO_ENVIRONMENT_EXPERIMENTAL) + /* const struct retro_hw_render_interface ** -- + * Returns an API specific rendering interface for accessing API specific data. + * Not all HW rendering APIs support or need this. + * The contents of the returned pointer is specific to the rendering API + * being used. See the various headers like libretro_vulkan.h, etc. + * + * GET_HW_RENDER_INTERFACE cannot be called before context_reset has been called. + * Similarly, after context_destroyed callback returns, + * the contents of the HW_RENDER_INTERFACE are invalidated. + */ #define RETRO_MEMDESC_CONST (1 << 0) /* The frontend will never change this memory area once retro_load_game has returned. */ #define RETRO_MEMDESC_BIGENDIAN (1 << 1) /* The memory area contains big endian data. Default is little endian. */ @@ -1125,6 +1219,10 @@ struct retro_log_callback #define RETRO_SIMD_VFPU (1 << 13) #define RETRO_SIMD_PS (1 << 14) #define RETRO_SIMD_AES (1 << 15) +#define RETRO_SIMD_VFPV3 (1 << 16) +#define RETRO_SIMD_VFPV4 (1 << 17) +#define RETRO_SIMD_POPCNT (1 << 18) +#define RETRO_SIMD_MOVBE (1 << 19) typedef uint64_t retro_perf_tick_t; typedef int64_t retro_time_t; @@ -1464,6 +1562,9 @@ enum retro_hw_context_type * use the corresponding enums directly. */ RETRO_HW_CONTEXT_OPENGLES_VERSION = 5, + /* Vulkan, see RETRO_ENVIRONMENT_GET_HW_RENDER_INTERFACE. */ + RETRO_HW_CONTEXT_VULKAN = 6, + RETRO_HW_CONTEXT_DUMMY = INT_MAX }; @@ -1486,23 +1587,28 @@ struct retro_hw_render_callback */ retro_hw_context_reset_t context_reset; - /* Set by frontend. */ + /* Set by frontend. + * TODO: This is rather obsolete. The frontend should not + * be providing preallocated framebuffers. */ retro_hw_get_current_framebuffer_t get_current_framebuffer; /* Set by frontend. */ retro_hw_get_proc_address_t get_proc_address; - /* Set if render buffers should have depth component attached. */ + /* Set if render buffers should have depth component attached. + * TODO: Obsolete. */ bool depth; - /* Set if stencil buffers should be attached. */ + /* Set if stencil buffers should be attached. + * TODO: Obsolete. */ bool stencil; /* If depth and stencil are true, a packed 24/8 buffer will be added. * Only attaching stencil is invalid and will be ignored. */ /* Use conventional bottom-left origin convention. If false, - * standard libretro top-left origin semantics are used. */ + * standard libretro top-left origin semantics are used. + * TODO: Move to GL specific interface. */ bool bottom_left_origin; /* Major version number for core GL context or GLES 3.1+. */ @@ -1513,6 +1619,7 @@ struct retro_hw_render_callback /* If this is true, the frontend will go very far to avoid * resetting context in scenarios like toggling fullscreen, etc. + * TODO: Obsolete? Maybe frontend should just always assume this ... */ bool cache_context; @@ -1779,6 +1886,36 @@ struct retro_game_info const char *meta; /* String of implementation specific meta-data. */ }; +#define RETRO_MEMORY_ACCESS_WRITE (1 << 0) + /* The core will write to the buffer provided by retro_framebuffer::data. */ +#define RETRO_MEMORY_ACCESS_READ (1 << 1) + /* The core will read from retro_framebuffer::data. */ +#define RETRO_MEMORY_TYPE_CACHED (1 << 0) + /* The memory in data is cached. + * If not cached, random writes and/or reading from the buffer is expected to be very slow. */ +struct retro_framebuffer +{ + void *data; /* The framebuffer which the core can render into. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. + The initial contents of data are unspecified. */ + unsigned width; /* The framebuffer width used by the core. Set by core. */ + unsigned height; /* The framebuffer height used by the core. Set by core. */ + size_t pitch; /* The number of bytes between the beginning of a scanline, + and beginning of the next scanline. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ + enum retro_pixel_format format; /* The pixel format the core must use to render into data. + This format could differ from the format used in + SET_PIXEL_FORMAT. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ + + unsigned access_flags; /* How the core will access the memory in the framebuffer. + RETRO_MEMORY_ACCESS_* flags. + Set by core. */ + unsigned memory_flags; /* Flags telling core how the memory has been mapped. + RETRO_MEMORY_TYPE_* flags. + Set by frontend in GET_CURRENT_SOFTWARE_FRAMEBUFFER. */ +}; + /* Callbacks */ /* Environment callback. Gives implementations a way of performing @@ -1832,25 +1969,25 @@ typedef int16_t (*retro_input_state_t)(unsigned port, unsigned device, * * The rest of the set_* functions are guaranteed to have been called * before the first call to retro_run() is made. */ -void retro_set_environment(retro_environment_t); -void retro_set_video_refresh(retro_video_refresh_t); -void retro_set_audio_sample(retro_audio_sample_t); -void retro_set_audio_sample_batch(retro_audio_sample_batch_t); -void retro_set_input_poll(retro_input_poll_t); -void retro_set_input_state(retro_input_state_t); +RETRO_API void retro_set_environment(retro_environment_t); +RETRO_API void retro_set_video_refresh(retro_video_refresh_t); +RETRO_API void retro_set_audio_sample(retro_audio_sample_t); +RETRO_API void retro_set_audio_sample_batch(retro_audio_sample_batch_t); +RETRO_API void retro_set_input_poll(retro_input_poll_t); +RETRO_API void retro_set_input_state(retro_input_state_t); /* Library global initialization/deinitialization. */ -void retro_init(void); -void retro_deinit(void); +RETRO_API void retro_init(void); +RETRO_API void retro_deinit(void); /* Must return RETRO_API_VERSION. Used to validate ABI compatibility * when the API is revised. */ -unsigned retro_api_version(void); +RETRO_API unsigned retro_api_version(void); /* Gets statically known system info. Pointers provided in *info * must be statically allocated. * Can be called at any time, even before retro_init(). */ -void retro_get_system_info(struct retro_system_info *info); +RETRO_API void retro_get_system_info(struct retro_system_info *info); /* Gets information about system audio/video timings and geometry. * Can be called only after retro_load_game() has successfully completed. @@ -1858,7 +1995,7 @@ void retro_get_system_info(struct retro_system_info *info); * variable if needed. * E.g. geom.aspect_ratio might not be initialized if core doesn't * desire a particular aspect ratio. */ -void retro_get_system_av_info(struct retro_system_av_info *info); +RETRO_API void retro_get_system_av_info(struct retro_system_av_info *info); /* Sets device to be used for player 'port'. * By default, RETRO_DEVICE_JOYPAD is assumed to be plugged into all @@ -1868,10 +2005,10 @@ void retro_get_system_av_info(struct retro_system_av_info *info); * hint to the libretro core when a core cannot automatically detect the * appropriate input device type on its own. It is also relevant when a * core can change its behavior depending on device type. */ -void retro_set_controller_port_device(unsigned port, unsigned device); +RETRO_API void retro_set_controller_port_device(unsigned port, unsigned device); /* Resets the current game. */ -void retro_reset(void); +RETRO_API void retro_reset(void); /* Runs the game for one video frame. * During retro_run(), input_poll callback must be called at least once. @@ -1881,7 +2018,7 @@ void retro_reset(void); * a frame if GET_CAN_DUPE returns true. * In this case, the video callback can take a NULL argument for data. */ -void retro_run(void); +RETRO_API void retro_run(void); /* Returns the amount of data the implementation requires to serialize * internal state (save states). @@ -1889,35 +2026,35 @@ void retro_run(void); * returned size is never allowed to be larger than a previous returned * value, to ensure that the frontend can allocate a save state buffer once. */ -size_t retro_serialize_size(void); +RETRO_API size_t retro_serialize_size(void); /* Serializes internal state. If failed, or size is lower than * retro_serialize_size(), it should return false, true otherwise. */ -bool retro_serialize(void *data, size_t size); -bool retro_unserialize(const void *data, size_t size); +RETRO_API bool retro_serialize(void *data, size_t size); +RETRO_API bool retro_unserialize(const void *data, size_t size); -void retro_cheat_reset(void); -void retro_cheat_set(unsigned index, bool enabled, const char *code); +RETRO_API void retro_cheat_reset(void); +RETRO_API void retro_cheat_set(unsigned index, bool enabled, const char *code); /* Loads a game. */ -bool retro_load_game(const struct retro_game_info *game); +RETRO_API bool retro_load_game(const struct retro_game_info *game); /* Loads a "special" kind of game. Should not be used, * except in extreme cases. */ -bool retro_load_game_special( +RETRO_API bool retro_load_game_special( unsigned game_type, const struct retro_game_info *info, size_t num_info ); /* Unloads a currently loaded game. */ -void retro_unload_game(void); +RETRO_API void retro_unload_game(void); /* Gets region of game. */ -unsigned retro_get_region(void); +RETRO_API unsigned retro_get_region(void); /* Gets region of memory. */ -void *retro_get_memory_data(unsigned id); -size_t retro_get_memory_size(unsigned id); +RETRO_API void *retro_get_memory_data(unsigned id); +RETRO_API size_t retro_get_memory_size(unsigned id); #ifdef __cplusplus } diff --git a/frontend/main.c b/frontend/main.c index a824fdc..2d438aa 100644 --- a/frontend/main.c +++ b/frontend/main.c @@ -11,7 +11,7 @@ #include <unistd.h> #include <signal.h> #include <time.h> -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) #include <dlfcn.h> #endif @@ -151,8 +151,8 @@ void emu_set_default_config(void) new_dynarec_hacks = 0; cycle_multiplier = 200; - in_type1 = PSE_PAD_TYPE_STANDARD; - in_type2 = PSE_PAD_TYPE_STANDARD; + in_type[0] = PSE_PAD_TYPE_STANDARD; + in_type[1] = PSE_PAD_TYPE_STANDARD; } void do_emu_action(void) @@ -721,10 +721,10 @@ void SysReset() { // reset can run code, timing must be set pl_timing_prepare(Config.PsxType); - EmuReset(); - - // hmh core forgets this + // hmh core forgets this CDR_stop(); + + EmuReset(); GPU_updateLace = real_lace; g_emu_resetting = 0; @@ -772,7 +772,7 @@ int emu_save_state(int slot) return ret; ret = SaveState(fname); -#ifdef HAVE_PRE_ARMV7 /* XXX GPH hack */ +#if defined(HAVE_PRE_ARMV7) && !defined(_3DS) /* XXX GPH hack */ sync(); #endif SysPrintf("* %s \"%s\" [%d]\n", @@ -986,7 +986,7 @@ void *SysLoadLibrary(const char *lib) { return (void *)(long)(PLUGIN_DL_BASE + builtin_plugin_ids[i]); } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) ret = dlopen(lib, RTLD_NOW); if (ret == NULL) SysMessage("dlopen: %s", dlerror()); @@ -1003,7 +1003,7 @@ void *SysLoadSym(void *lib, const char *sym) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return plugin_link(plugid - PLUGIN_DL_BASE, sym); -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) return dlsym(lib, sym); #else return NULL; @@ -1011,7 +1011,9 @@ void *SysLoadSym(void *lib, const char *sym) { } const char *SysLibError() { -#ifndef _WIN32 +#if defined(NO_DYLIB) + return NULL; +#elif !defined(_WIN32) return dlerror(); #else return "not supported"; @@ -1024,8 +1026,7 @@ void SysCloseLibrary(void *lib) { if (PLUGIN_DL_BASE <= plugid && plugid < PLUGIN_DL_BASE + ARRAY_SIZE(builtin_plugins)) return; -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) dlclose(lib); #endif } - diff --git a/frontend/menu.c b/frontend/menu.c index cf9382a..7e1fdd1 100644 --- a/frontend/menu.c +++ b/frontend/menu.c @@ -309,12 +309,12 @@ static void menu_sync_config(void) switch (in_type_sel1) { case 1: in_type1 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type1 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type1 = PSE_PAD_TYPE_NEGCON; break; default: in_type1 = PSE_PAD_TYPE_STANDARD; } switch (in_type_sel2) { case 1: in_type2 = PSE_PAD_TYPE_ANALOGPAD; break; - case 2: in_type2 = PSE_PAD_TYPE_GUNCON; break; + case 2: in_type2 = PSE_PAD_TYPE_NEGCON; break; default: in_type2 = PSE_PAD_TYPE_STANDARD; } if (in_evdev_allow_abs_only != allow_abs_only_old) { diff --git a/frontend/pandora/pcsx.png b/frontend/pandora/pcsx.png Binary files differdeleted file mode 100644 index 71f36d0..0000000 --- a/frontend/pandora/pcsx.png +++ /dev/null diff --git a/frontend/pandora/pcsx.pxml.templ b/frontend/pandora/pcsx.pxml.templ deleted file mode 100644 index f748065..0000000 --- a/frontend/pandora/pcsx.pxml.templ +++ /dev/null @@ -1,42 +0,0 @@ -<?xml version="1.0" encoding="UTF-8"?> -<PXML xmlns="http://openpandora.org/namespaces/PXML" xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance" xsi:noNamespaceSchemaLocation="PXML_schema.xsd"> -<package id="package.pcsx_rearmed.notaz"> - <titles> - <title lang="en_US">PCSX ReARMed</title> - </titles> - <version major="1" minor="9" release="93" build="%PR%"/> - <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/> -</package> -<application id="pcsx_rearmed.notaz.%PR%" appdata="pcsx_rearmed"> - <titles> - <title lang="en_US">PCSX ReARMed %PR%</title> - </titles> - <title lang="en_US">PCSX ReARMed %PR%</title> - - <descriptions> - <description lang="en_US">PCSX ReARMed is heavily optimized PlayStation Emulator. It's a PCSX fork based on the PCSX-Reloaded project, which itself contains code from PCSX, PCSX-df and PCSX-Revolution. - -The emulator features MIPS->ARM recompiler by Ari64 and ARM NEON GPU by Exophase, that in many cases produces pixel perfect graphics at very high performance. There is also NEON-optimized GTE code, optimized P.E.Op.S. (Pete's) SPU; PCSX4ALL and traditional P.E.Op.S. GPUs are also available.</description> - </descriptions> - - <exec command="pcsx.sh"/> - - <icon src="pcsx.png"/> - - <author name="PCSX team/notaz" website="http://notaz.gp2x.de/"/> - - <version major="1" minor="9" release="93" build="%PR%"/> - - <licenses> - <license name="GPLv2+" url="http://www.gnu.org/licenses/gpl-2.0.html" sourcecodeurl="http://notaz.gp2x.de/cgi-bin/gitweb.cgi?p=pcsx_rearmed.git"/> - </licenses> - - <info name="PCSX ReARMed %PR% readme" type="text/plain" src="readme.txt"/> - - <categories> - <category name="Game"> - <subcategory name="Emulator"/> - </category> - </categories> -</application> -</PXML> diff --git a/frontend/pandora/pcsx.sh b/frontend/pandora/pcsx.sh deleted file mode 100755 index 710f641..0000000 --- a/frontend/pandora/pcsx.sh +++ /dev/null @@ -1,24 +0,0 @@ -#!/bin/sh - -# stupid nub mode thing -nub0mode=`cat /proc/pandora/nub0/mode` -nub1mode=`cat /proc/pandora/nub1/mode` -/usr/pandora/scripts/op_nubchange.sh absolute absolute - -# 4MB for RAM (2+align) + 2MB for vram (1+overdraw) -# + 10MB for gpu_neon (8+overdraw) + 8MB LUTs -# no big deal if this fails, only performance loss -sudo -n /usr/pandora/scripts/op_hugetlb.sh 24 - -# C64x DSP for SPU -sudo -n /usr/pandora/scripts/op_dsp_c64.sh - -./pcsx "$@" - -# restore stuff if pcsx crashes -./picorestore -sudo -n /usr/pandora/scripts/op_lcdrate.sh 60 -sudo -n /usr/pandora/scripts/op_gamma.sh 0 -sudo -n /usr/pandora/scripts/op_hugetlb.sh 0 - -/usr/pandora/scripts/op_nubchange.sh $nub0mode $nub1mode diff --git a/frontend/pandora/picorestore.c b/frontend/pandora/picorestore.c deleted file mode 100644 index 77f5720..0000000 --- a/frontend/pandora/picorestore.c +++ /dev/null @@ -1,109 +0,0 @@ -/* - * picorestore - clean up after an omapfb program crash - * - * Copyright (c) Gražvydas "notaz" Ignotas, 2010 - * - * Redistribution and use in source and binary forms, with or without - * modification, are permitted provided that the following conditions are met: - * * Redistributions of source code must retain the above copyright - * notice, this list of conditions and the following disclaimer. - * * Redistributions in binary form must reproduce the above copyright - * notice, this list of conditions and the following disclaimer in the - * documentation and/or other materials provided with the distribution. - * * Neither the name of the organization nor the - * names of its contributors may be used to endorse or promote products - * derived from this software without specific prior written permission. - * - * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" - * AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE - * IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE - * ARE DISCLAIMED. IN NO EVENT SHALL COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE - * FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL - * DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR - * SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER - * CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, - * OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE - * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. - */ - -#include <stdio.h> -#include <sys/types.h> -#include <sys/stat.h> -#include <fcntl.h> -#include <unistd.h> -#include <sys/ioctl.h> -#include <linux/fb.h> -#include <linux/omapfb.h> -#include <linux/kd.h> - -int main() -{ - struct fb_var_screeninfo fbvar; - struct omapfb_plane_info pi; - struct omapfb_mem_info mi; - int ret, fbdev, kbdfd; - - fbdev = open("/dev/fb0", O_RDWR); - if (fbdev == -1) { - perror("open fb0"); - goto end_fb0; - } - - ret = ioctl(fbdev, FBIOGET_VSCREENINFO, &fbvar); - if (ret == -1) { - perror("FBIOGET_VSCREENINFO ioctl"); - goto end_fb0; - } - - if (fbvar.yoffset != 0) { - printf("fixing yoffset.. "); - fbvar.yoffset = 0; - ret = ioctl(fbdev, FBIOPAN_DISPLAY, &fbvar); - if (ret < 0) - perror("ioctl FBIOPAN_DISPLAY"); - else - printf("ok\n"); - } - -end_fb0: - if (fbdev >= 0) - close(fbdev); - - fbdev = open("/dev/fb1", O_RDWR); - if (fbdev == -1) { - perror("open fb1"); - goto end_fb1; - } - - ret = ioctl(fbdev, OMAPFB_QUERY_PLANE, &pi); - ret |= ioctl(fbdev, OMAPFB_QUERY_MEM, &mi); - if (ret != 0) - perror("QUERY_*"); - - pi.enabled = 0; - ret = ioctl(fbdev, OMAPFB_SETUP_PLANE, &pi); - if (ret != 0) - perror("SETUP_PLANE"); - - mi.size = 0; - ret = ioctl(fbdev, OMAPFB_SETUP_MEM, &mi); - if (ret != 0) - perror("SETUP_MEM"); - -end_fb1: - if (fbdev >= 0) - close(fbdev); - - kbdfd = open("/dev/tty", O_RDWR); - if (kbdfd == -1) { - perror("open /dev/tty"); - return 1; - } - - if (ioctl(kbdfd, KDSETMODE, KD_TEXT) == -1) - perror("KDSETMODE KD_TEXT"); - - close(kbdfd); - - return 0; -} diff --git a/frontend/pandora/skin/background.png b/frontend/pandora/skin/background.png Binary files differdeleted file mode 100644 index f4b4523..0000000 --- a/frontend/pandora/skin/background.png +++ /dev/null diff --git a/frontend/pandora/skin/font.png b/frontend/pandora/skin/font.png Binary files differdeleted file mode 100644 index 707a5b4..0000000 --- a/frontend/pandora/skin/font.png +++ /dev/null diff --git a/frontend/pandora/skin/readme.txt b/frontend/pandora/skin/readme.txt deleted file mode 100644 index dd83963..0000000 --- a/frontend/pandora/skin/readme.txt +++ /dev/null @@ -1,8 +0,0 @@ -The skin images can be customized, but there are several limitations:
-
-background.png - must be 320x240 image with 24bit RGB colors.
-font.png - must be 128x160 8bit grayscale image.
-selector.png - must be 8x10 8bit grayscale image.
-
-Font and selector colors can be changed by editing skin.txt.
-
diff --git a/frontend/pandora/skin/selector.png b/frontend/pandora/skin/selector.png Binary files differdeleted file mode 100644 index a439169..0000000 --- a/frontend/pandora/skin/selector.png +++ /dev/null diff --git a/frontend/pandora/skin/skin.txt b/frontend/pandora/skin/skin.txt deleted file mode 100644 index 1d6979f..0000000 --- a/frontend/pandora/skin/skin.txt +++ /dev/null @@ -1,4 +0,0 @@ -// html-style hex color codes, ex. ff0000 is red, 0000ff is blue, etc.
-text_color=ffffc0
-selection_color=808010
-
diff --git a/frontend/pandora/ui_feat.h b/frontend/pandora/ui_feat.h deleted file mode 100644 index 3bb808a..0000000 --- a/frontend/pandora/ui_feat.h +++ /dev/null @@ -1,16 +0,0 @@ -#ifndef UI_FEATURES_H -#define UI_FEATURES_H - -#define MENU_BIOS_PATH "<SD card>/pandora/appdata/pcsx_rearmed/bios/" -#define BOOT_MSG "Booting up... (press SPACE for menu)" -#define MENU_SHOW_VARSCALER 1 -#define MENU_SHOW_VOUTMODE 0 -#define MENU_SHOW_SCALER2 0 -#define MENU_SHOW_NUBS_BTNS 1 -#define MENU_SHOW_VIBRATION 0 -#define MENU_SHOW_DEADZONE 0 -#define MENU_SHOW_MINIMIZE 1 -#define MENU_SHOW_FULLSCREEN 0 -#define MENU_SHOW_VOLUME 0 - -#endif // UI_FEATURES_H diff --git a/frontend/plugin.c b/frontend/plugin.c index d9eb04a..6bb9aa4 100644 --- a/frontend/plugin.c +++ b/frontend/plugin.c @@ -49,24 +49,43 @@ extern void CALLBACK SPUasync(unsigned int, unsigned int); extern int CALLBACK SPUplayCDDAchannel(short *, int); /* PAD */ -static long PADreadPort1(PadDataS *pad) -{ - pad->controllerType = in_type1; - pad->buttonStatus = ~in_keystate; - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) { - pad->leftJoyX = in_a1[0]; - pad->leftJoyY = in_a1[1]; - pad->rightJoyX = in_a2[0]; - pad->rightJoyY = in_a2[1]; - } - return 0; +static long PADreadPort1(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap1 == 1) + pad->portMultitap = 1; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } -static long PADreadPort2(PadDataS *pad) -{ - pad->controllerType = in_type2; - pad->buttonStatus = ~in_keystate >> 16; - return 0; +static long PADreadPort2(PadDataS *pad) { + int pad_index = pad->requestPadIndex; + + pad->controllerType = in_type[pad_index]; + pad->buttonStatus = ~in_keystate[pad_index]; + if (multitap2 == 1) + pad->portMultitap = 2; + else + pad->portMultitap = 0; + + if (in_type[pad_index] == PSE_PAD_TYPE_ANALOGPAD || in_type[pad_index] == PSE_PAD_TYPE_NEGCON) + { + pad->leftJoyX = in_analog_left[pad_index][0]; + pad->leftJoyY = in_analog_left[pad_index][1]; + pad->rightJoyX = in_analog_right[pad_index][0]; + pad->rightJoyY = in_analog_right[pad_index][1]; + } + return 0; } /* GPU */ diff --git a/frontend/plugin_lib.c b/frontend/plugin_lib.c index ab4d415..c65bfeb 100644 --- a/frontend/plugin_lib.c +++ b/frontend/plugin_lib.c @@ -36,11 +36,15 @@ #define HUD_HEIGHT 10 -int in_type1, in_type2; -int in_a1[2] = { 127, 127 }, in_a2[2] = { 127, 127 }; +int in_type[8]; +int multitap1; +int multitap2; +int in_analog_left[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; +int in_analog_right[8][2] = {{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 },{ 127, 127 }}; int in_adev[2] = { -1, -1 }, in_adev_axis[2][2] = {{ 0, 1 }, { 0, 1 }}; int in_adev_is_nublike[2]; -int in_keystate, in_state_gun; +unsigned short in_keystate[8]; +int in_state_gun; int in_enable_vibration; void *tsdev; void *pl_vout_buf; @@ -560,7 +564,7 @@ static void update_analog_nub_adjust(int *x_, int *y_) static void update_analogs(void) { - int *nubp[2] = { in_a1, in_a2 }; + int *nubp[2] = { in_analog_left[0], in_analog_right[0] }; int vals[2]; int i, a, v, ret; @@ -597,7 +601,7 @@ static void update_input(void) unsigned int emu_act; in_update(actions); - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD) + if (in_type[0] == PSE_PAD_TYPE_ANALOGPAD) update_analogs(); emu_act = actions[IN_BINDTYPE_EMU]; in_state_gun = (emu_act & SACTION_GUN_MASK) >> SACTION_GUN_TRIGGER; @@ -611,7 +615,7 @@ static void update_input(void) } emu_set_action(emu_act); - in_keystate = actions[IN_BINDTYPE_PLAYER12]; + in_keystate[0] = actions[IN_BINDTYPE_PLAYER12]; } #else /* MAEMO */ extern void update_input(void); diff --git a/frontend/plugin_lib.h b/frontend/plugin_lib.h index 4a11002..83b2774 100644 --- a/frontend/plugin_lib.h +++ b/frontend/plugin_lib.h @@ -17,8 +17,14 @@ enum { DKEY_CROSS, DKEY_SQUARE, }; -extern int in_type1, in_type2; -extern int in_keystate, in_state_gun, in_a1[2], in_a2[2]; +extern int in_state_gun; +extern int in_type[8]; +extern int multitap1; +extern int multitap2; +extern int in_analog_left[8][2]; +extern int in_analog_right[8][2]; +extern unsigned short in_keystate[8]; + extern int in_adev[2], in_adev_axis[2][2]; extern int in_adev_is_nublike[2]; extern int in_enable_vibration; diff --git a/frontend/vita/retro_inline.h b/frontend/vita/retro_inline.h new file mode 100644 index 0000000..8535d84 --- /dev/null +++ b/frontend/vita/retro_inline.h @@ -0,0 +1,39 @@ +/* Copyright (C) 2010-2015 The RetroArch team + * + * --------------------------------------------------------------------------------------- + * The following license statement only applies to this file (retro_inline.h). + * --------------------------------------------------------------------------------------- + * + * Permission is hereby granted, free of charge, + * to any person obtaining a copy of this software and associated documentation files (the "Software"), + * to deal in the Software without restriction, including without limitation the rights to + * use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, + * and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + * + * The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + * + * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, + * INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, + * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. + * IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, + * WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, + * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + */ + +#ifndef __LIBRETRO_SDK_INLINE_H +#define __LIBRETRO_SDK_INLINE_H + +#ifndef INLINE + +#if !defined(__cplusplus) && defined(_WIN32) +#define INLINE _inline +#elif defined(__STDC_VERSION__) && __STDC_VERSION__>=199901L +#define INLINE inline +#elif defined(__GNUC__) +#define INLINE __inline__ +#else +#define INLINE +#endif + +#endif +#endif diff --git a/frontend/vita/sys/mman.h b/frontend/vita/sys/mman.h new file mode 100644 index 0000000..89da513 --- /dev/null +++ b/frontend/vita/sys/mman.h @@ -0,0 +1,69 @@ +#ifndef MMAN_H +#define MMAN_H + +#ifdef __cplusplus +extern "C" { +#endif + +#include "stdlib.h" +#include "stdio.h" + +#define PROT_READ 0b001 +#define PROT_WRITE 0b010 +#define PROT_EXEC 0b100 +#define MAP_PRIVATE 2 +#define MAP_ANONYMOUS 0x20 + +#define MAP_FAILED ((void *)-1) + +static inline void* mmap(void *addr, size_t len, int prot, int flags, int fd, off_t offset) +{ + (void)prot; + (void)flags; + (void)fd; + (void)offset; + + int block, ret; + + block = sceKernelAllocMemBlockForVM("code", len); + if(block<=0){ + sceClibPrintf("could not alloc mem block @0x%08X 0x%08X \n", block, len); + exit(1); + } + + // get base address + ret = sceKernelGetMemBlockBase(block, &addr); + if (ret < 0) + { + sceClibPrintf("could get address @0x%08X 0x%08X \n", block, addr); + exit(1); + } + + + if(!addr) + return MAP_FAILED; + + return addr; +} + +static inline int mprotect(void *addr, size_t len, int prot) +{ + (void)addr; + (void)len; + (void)prot; + return 0; +} + +static inline int munmap(void *addr, size_t len) +{ + int uid = sceKernelFindMemBlockByAddr(addr, len); + + return sceKernelFreeMemBlock(uid); + +} + +#ifdef __cplusplus +}; +#endif + +#endif // MMAN_H diff --git a/frontend/warm b/frontend/warm deleted file mode 160000 -Subproject a6f015da3b10b82a476250793645c071340decb diff --git a/include/psemu_plugin_defs.h b/include/psemu_plugin_defs.h index 9986654..6fc59b7 100644 --- a/include/psemu_plugin_defs.h +++ b/include/psemu_plugin_defs.h @@ -153,6 +153,8 @@ typedef struct +// No controller +#define PSE_PAD_TYPE_NONE 0 // MOUSE SCPH-1030 #define PSE_PAD_TYPE_MOUSE 1 // NEGCON - 16 button analog controller SLPH-00001 @@ -191,9 +193,15 @@ typedef struct typedef struct { - // controler type - fill it withe predefined values above + // controller type - fill it withe predefined values above unsigned char controllerType; + //0 : no multitap between psx and pad + //1 : multitap between psx and pad on port 1 + //2 : multitap between psx and pad on port 2 + int portMultitap; + int requestPadIndex; + // status of buttons - every controller fills this field unsigned short buttonStatus; @@ -207,7 +215,9 @@ typedef struct unsigned char Vib[2]; unsigned char VibF[2]; - + + //configuration mode Request 0x43 + int configMode; unsigned char reserved[87]; } PadDataS; diff --git a/jni/Android.mk b/jni/Android.mk index 72c6738..9dd9e39 100644 --- a/jni/Android.mk +++ b/jni/Android.mk @@ -2,8 +2,16 @@ LOCAL_PATH := $(call my-dir) include $(CLEAR_VARS) +GIT_VERSION := " $(shell git rev-parse --short HEAD || echo unknown)" +ifneq ($(GIT_VERSION)," unknown") + LOCAL_CFLAGS += -DGIT_VERSION=\"$(GIT_VERSION)\" +endif + APP_DIR := ../../src +#fix stupid change in ndk r11 that breaks compiling even when the exe would run fine +LOCAL_DISABLE_FATAL_LINKER_WARNINGS := true + ifneq ($(TARGET_ARCH_ABI),armeabi-v7a) NO_NEON_BUILD := 1 else @@ -24,7 +32,7 @@ ifeq ($(TARGET_ARCH),arm) LOCAL_SRC_FILES += ../libpcsxcore/gte_arm.S # dynarec - LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/linkage_arm.S ../libpcsxcore/new_dynarec/emu_if.c ../libpcsxcore/new_dynarec/pcsxmem.c + LOCAL_SRC_FILES += ../libpcsxcore/new_dynarec/new_dynarec.c ../libpcsxcore/new_dynarec/arm/linkage_arm.S ../libpcsxcore/new_dynarec/backends/psx/emu_if.c ../libpcsxcore/new_dynarec/backends/psx/pcsxmem.c # spu LOCAL_SRC_FILES += ../plugins/dfsound/arm_utils.S @@ -92,7 +100,7 @@ LOCAL_SRC_FILES += ../frontend/main.c ../frontend/plugin.c ../frontend/cspace.c # libretro LOCAL_SRC_FILES += ../frontend/libretro.c -LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 +LOCAL_CFLAGS += -O3 -ffast-math -funroll-loops -DNDEBUG -D_FILE_OFFSET_BITS=64 -DHAVE_LIBRETRO -DNO_FRONTEND -DFRONTEND_SUPPORTS_RGB565 -DANDROID LOCAL_C_INCLUDES += $(LOCAL_PATH)/../include LOCAL_LDLIBS := -lz -llog diff --git a/jni/Application.mk b/jni/Application.mk index f05229c..3e882e7 100644 --- a/jni/Application.mk +++ b/jni/Application.mk @@ -1 +1,2 @@ APP_ABI := armeabi armeabi-v7a +APP_PLATFORM := android-9 diff --git a/libpcsxcore/cdriso.c b/libpcsxcore/cdriso.c index 515370f..169c945 100644 --- a/libpcsxcore/cdriso.c +++ b/libpcsxcore/cdriso.c @@ -25,19 +25,20 @@ #include "cdriso.h" #include "ppf.h" +#include <errno.h> +#include <zlib.h> + #ifdef _WIN32 #define WIN32_LEAN_AND_MEAN #include <process.h> #include <windows.h> #define strcasecmp _stricmp -#define usleep(x) Sleep((x) / 1000) +#define usleep(x) (Sleep((x) / 1000)) #else #include <pthread.h> #include <sys/time.h> #include <unistd.h> #endif -#include <errno.h> -#include <zlib.h> #define OFF_T_MSB ((off_t)1 << (sizeof(off_t) * 8 - 1)) @@ -225,7 +226,9 @@ static void *playthread(void *param) do { ret = SPU_playCDDAchannel((short *)sndbuffer, s); if (ret == 0x7761) + { usleep(6 * 1000); + } } while (ret == 0x7761 && playing); // rearmed_wait } @@ -236,7 +239,9 @@ static void *playthread(void *param) // HACK: stop feeding data while emu is paused extern int stop; while (stop && playing) + { usleep(10000); + } now = GetTickCount(); osleep = t - now; @@ -1089,7 +1094,7 @@ static int cdread_sub_mixed(FILE *f, unsigned int base, void *dest, int sector) return ret; } -static int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size) +static int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size) { static z_stream z; int ret = 0; @@ -1169,7 +1174,7 @@ static int cdread_compressed(FILE *f, unsigned int base, void *dest, int sector) if (is_compressed) { cdbuffer_size_expect = sizeof(compr_img->buff_raw[0]) << compr_img->block_shift; cdbuffer_size = cdbuffer_size_expect; - ret = uncompress2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size); + ret = uncomp2(compr_img->buff_raw[0], &cdbuffer_size, compr_img->buff_compressed, size); if (ret != 0) { SysPrintf("uncompress failed with %d for block %d, sector %d\n", ret, block, sector); diff --git a/libpcsxcore/gte_neon.S b/libpcsxcore/gte_neon.S index fe153e2..fbe0e59 100644 --- a/libpcsxcore/gte_neon.S +++ b/libpcsxcore/gte_neon.S @@ -6,7 +6,7 @@ */ #include "arm_features.h" -#include "new_dynarec/linkage_offsets.h" +#include "new_dynarec/arm/linkage_offsets.h" .syntax unified .text diff --git a/libpcsxcore/new_dynarec/assem_arm.c b/libpcsxcore/new_dynarec/arm/assem_arm.c index 21640f8..db1d2af 100644 --- a/libpcsxcore/new_dynarec/assem_arm.c +++ b/libpcsxcore/new_dynarec/arm/assem_arm.c @@ -19,12 +19,12 @@ * 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301, USA. * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */ -#include "../gte.h" +#include "../../gte.h" #define FLAGLESS -#include "../gte.h" +#include "../../gte.h" #undef FLAGLESS -#include "../gte_arm.h" -#include "../gte_neon.h" +#include "../../gte_arm.h" +#include "../../gte_neon.h" #include "pcnt.h" #include "arm_features.h" @@ -2518,8 +2518,8 @@ static void mov_loadtype_adj(int type,int rs,int rt) } } -#include "pcsxmem.h" -#include "pcsxmem_inline.c" +#include "../backends/psx/pcsxmem.h" +#include "../backends/psx/pcsxmem_inline.c" static void do_readstub(int n) { diff --git a/libpcsxcore/new_dynarec/assem_arm.h b/libpcsxcore/new_dynarec/arm/assem_arm.h index bb6114c..bb6114c 100644 --- a/libpcsxcore/new_dynarec/assem_arm.h +++ b/libpcsxcore/new_dynarec/arm/assem_arm.h diff --git a/libpcsxcore/new_dynarec/linkage_arm.S b/libpcsxcore/new_dynarec/arm/linkage_arm.S index d32dc0b..269eb99 100644 --- a/libpcsxcore/new_dynarec/linkage_arm.S +++ b/libpcsxcore/new_dynarec/arm/linkage_arm.S @@ -20,7 +20,7 @@ * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * * */ #include "arm_features.h" -#include "new_dynarec_config.h" +#include "../new_dynarec_config.h" #include "linkage_offsets.h" diff --git a/libpcsxcore/new_dynarec/linkage_offsets.h b/libpcsxcore/new_dynarec/arm/linkage_offsets.h index f7e1911..f7e1911 100644 --- a/libpcsxcore/new_dynarec/linkage_offsets.h +++ b/libpcsxcore/new_dynarec/arm/linkage_offsets.h diff --git a/libpcsxcore/new_dynarec/emu_if.c b/libpcsxcore/new_dynarec/backends/psx/emu_if.c index 22db5d1..6dc48e2 100644 --- a/libpcsxcore/new_dynarec/emu_if.c +++ b/libpcsxcore/new_dynarec/backends/psx/emu_if.c @@ -9,15 +9,15 @@ #include "emu_if.h" #include "pcsxmem.h" -#include "../psxhle.h" -#include "../r3000a.h" -#include "../cdrom.h" -#include "../psxdma.h" -#include "../mdec.h" -#include "../gte_arm.h" -#include "../gte_neon.h" +#include "../../../psxhle.h" +#include "../../../r3000a.h" +#include "../../../cdrom.h" +#include "../../../psxdma.h" +#include "../../../mdec.h" +#include "../../../gte_arm.h" +#include "../../../gte_neon.h" #define FLAGLESS -#include "../gte.h" +#include "../../../gte.h" #define ARRAY_SIZE(x) (sizeof(x) / sizeof(x[0])) @@ -431,7 +431,7 @@ void do_insn_cmp() {} #ifdef DRC_DISABLE unsigned int address; int pending_exception, stop; -unsigned int next_interupt; +u32 next_interupt; int new_dynarec_did_compile; int cycle_multiplier; int new_dynarec_hacks; diff --git a/libpcsxcore/new_dynarec/emu_if.h b/libpcsxcore/new_dynarec/backends/psx/emu_if.h index 3980490..d8c7990 100644 --- a/libpcsxcore/new_dynarec/emu_if.h +++ b/libpcsxcore/new_dynarec/backends/psx/emu_if.h @@ -1,5 +1,5 @@ -#include "new_dynarec.h" -#include "../r3000a.h" +#include "../../new_dynarec.h" +#include "../../../r3000a.h" extern char invalid_code[0x100000]; @@ -89,7 +89,7 @@ extern void *scratch_buf_ptr; extern u32 inv_code_start, inv_code_end; /* cycles/irqs */ -extern unsigned int next_interupt; +extern u32 next_interupt; extern int pending_exception; /* called by drc */ diff --git a/libpcsxcore/new_dynarec/pcsxmem.c b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.c index 9376ff4..647981e 100644 --- a/libpcsxcore/new_dynarec/pcsxmem.c +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.c @@ -6,11 +6,11 @@ */ #include <stdio.h> -#include "../psxhw.h" -#include "../cdrom.h" -#include "../mdec.h" -#include "../gpu.h" -#include "../psxmem_map.h" +#include "../../../psxhw.h" +#include "../../../cdrom.h" +#include "../../../mdec.h" +#include "../../../gpu.h" +#include "../../../psxmem_map.h" #include "emu_if.h" #include "pcsxmem.h" diff --git a/libpcsxcore/new_dynarec/pcsxmem.h b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.h index 72892a8..72892a8 100644 --- a/libpcsxcore/new_dynarec/pcsxmem.h +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem.h diff --git a/libpcsxcore/new_dynarec/pcsxmem_inline.c b/libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c index 305931a..305931a 100644 --- a/libpcsxcore/new_dynarec/pcsxmem_inline.c +++ b/libpcsxcore/new_dynarec/backends/psx/pcsxmem_inline.c diff --git a/libpcsxcore/new_dynarec/new_dynarec.c b/libpcsxcore/new_dynarec/new_dynarec.c index cd63d2b..dfa17a7 100644 --- a/libpcsxcore/new_dynarec/new_dynarec.c +++ b/libpcsxcore/new_dynarec/new_dynarec.c @@ -32,10 +32,11 @@ #ifdef VITA #include <psp2/kernel/sysmem.h> static int sceBlock; +int getVMBlock(); #endif #include "new_dynarec_config.h" -#include "emu_if.h" //emulator interface +#include "backends/psx/emu_if.h" //emulator interface //#define DISASM //#define assem_debug printf @@ -44,13 +45,17 @@ static int sceBlock; #define inv_debug(...) #ifdef __i386__ -#include "assem_x86.h" +#include "x86/assem_x86.h" #endif #ifdef __x86_64__ -#include "assem_x64.h" +#include "x64/assem_x64.h" #endif #ifdef __arm__ -#include "assem_arm.h" +#include "arm/assem_arm.h" +#endif + +#ifdef VITA +int _newlib_vm_size_user = 1 << TARGET_SIZE_2; #endif #define MAXBLOCK 4096 @@ -361,14 +366,16 @@ static u_int get_vpage(u_int vaddr) // This is called from the recompiled JR/JALR instructions void *get_addr(u_int vaddr) { - u_int page=get_page(vaddr); - u_int vpage=get_vpage(vaddr); - struct ll_entry *head; + struct ll_entry *head = NULL; + u_int page = get_page(vaddr); + u_int vpage = get_vpage(vaddr); //printf("TRACE: count=%d next=%d (get_addr %x,page %d)\n",Count,next_interupt,vaddr,page); head=jump_in[page]; - while(head!=NULL) { - if(head->vaddr==vaddr) { - //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); + while(head!=NULL) + { + if(head->vaddr==vaddr) + { + //printf("TRACE: count=%d next=%d (get_addr match %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; ht_bin[3]=ht_bin[1]; ht_bin[2]=ht_bin[0]; @@ -379,39 +386,47 @@ void *get_addr(u_int vaddr) head=head->next; } head=jump_dirty[vpage]; - while(head!=NULL) { - if(head->vaddr==vaddr) { + while(head!=NULL) + { + if(head->vaddr==vaddr) + { //printf("TRACE: count=%d next=%d (get_addr match dirty %x: %x)\n",Count,next_interupt,vaddr,(int)head->addr); // Don't restore blocks which are about to expire from the cache if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) - if(verify_dirty(head->addr)) { - //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]); - invalid_code[vaddr>>12]=0; - inv_code_start=inv_code_end=~0; - if(vpage<2048) { - restore_candidate[vpage>>3]|=1<<(vpage&7); - } - else restore_candidate[page>>3]|=1<<(page&7); - u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; - if(ht_bin[0]==vaddr) { - ht_bin[1]=(u_int)head->addr; // Replace existing entry - } - else + if(verify_dirty(head->addr)) { - ht_bin[3]=ht_bin[1]; - ht_bin[2]=ht_bin[0]; - ht_bin[1]=(int)head->addr; - ht_bin[0]=vaddr; + //printf("restore candidate: %x (%d) d=%d\n",vaddr,page,invalid_code[vaddr>>12]); + invalid_code[vaddr>>12]=0; + inv_code_start=inv_code_end=~0; + if(vpage<2048) + { + restore_candidate[vpage>>3]|=1<<(vpage&7); + } + else + { + restore_candidate[page>>3]|=1<<(page&7); + } + u_int *ht_bin=hash_table[((vaddr>>16)^vaddr)&0xFFFF]; + + if(ht_bin[0]==vaddr) + ht_bin[1]=(u_int)head->addr; // Replace existing entry + else + { + ht_bin[3]=ht_bin[1]; + ht_bin[2]=ht_bin[0]; + ht_bin[1]=(int)head->addr; + ht_bin[0]=vaddr; + } + return head->addr; } - return head->addr; - } } head=head->next; } //printf("TRACE: count=%d next=%d (get_addr no-match %x)\n",Count,next_interupt,vaddr); int r=new_recompile_block(vaddr); - if(r==0) return get_addr(vaddr); - // Execute in unmapped page, generate pagefault execption + if(r==0) + return get_addr(vaddr); + // Execute in unmapped page, generate pagefault exception Status|=2; Cause=(vaddr<<31)|0x8; EPC=(vaddr&1)?vaddr-5:vaddr; @@ -420,6 +435,7 @@ void *get_addr(u_int vaddr) EntryHi=BadVAddr&0xFFFFE000; return get_addr_ht(0x80000000); } + // Look up address in hash table first void *get_addr_ht(u_int vaddr) { @@ -763,13 +779,13 @@ void alloc_all(struct regstat *cur,int i) } #ifdef __i386__ -#include "assem_x86.c" +#include "x86/assem_x86.c" #endif #ifdef __x86_64__ -#include "assem_x64.c" +#include "x64/assem_x64.c" #endif #ifdef __arm__ -#include "assem_arm.c" +#include "arm/assem_arm.c" #endif // Add virtual address mapping to linked list @@ -943,23 +959,26 @@ static void invalidate_block_range(u_int block, u_int first, u_int last) assert(first+5>page); // NB: this assumes MAXBLOCK<=4096 (4 pages) assert(last<page+5); // Invalidate the adjacent pages if a block crosses a 4K boundary - while(first<page) { + while(first<page) + { invalidate_page(first); first++; } - for(first=page+1;first<last;first++) { + for(first=page+1;first<last;first++) + { invalidate_page(first); } - #ifdef __arm__ - do_clear_cache(); - #endif + +#ifdef __arm__ + do_clear_cache(); +#endif // Don't trap writes invalid_code[block]=1; - #ifdef USE_MINI_HT +#ifdef USE_MINI_HT memset(mini_ht,-1,sizeof(mini_ht)); - #endif +#endif } void invalidate_block(u_int block) @@ -967,19 +986,22 @@ void invalidate_block(u_int block) u_int page=get_page(block<<12); u_int vpage=get_vpage(block<<12); inv_debug("INVALIDATE: %x (%d)\n",block<<12,page); - //inv_debug("invalid_code[block]=%d\n",invalid_code[block]); u_int first,last; first=last=page; struct ll_entry *head; head=jump_dirty[vpage]; //printf("page=%d vpage=%d\n",page,vpage); - while(head!=NULL) { + while(head!=NULL) + { u_int start,end; - if(vpage>2047||(head->vaddr>>12)==block) { // Ignore vaddr hash collision + if(vpage>2047||(head->vaddr>>12)==block) + { // Ignore vaddr hash collision get_bounds((int)head->addr,&start,&end); //printf("start: %x end: %x\n",start,end); - if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) { - if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) { + if(page<2048&&start>=(u_int)rdram&&end<(u_int)rdram+RAM_SIZE) + { + if(((start-(u_int)rdram)>>12)<=page&&((end-1-(u_int)rdram)>>12)>=page) + { if((((start-(u_int)rdram)>>12)&2047)<first) first=((start-(u_int)rdram)>>12)&2047; if((((end-1-(u_int)rdram)>>12)&2047)>last) last=((end-1-(u_int)rdram)>>12)&2047; } @@ -1050,19 +1072,23 @@ void invalidate_addr(u_int addr) // This is called when loading a save state. // Anything could have changed, so invalidate everything. -void invalidate_all_pages() +void invalidate_all_pages(void) { u_int page; for(page=0;page<4096;page++) invalidate_page(page); for(page=0;page<1048576;page++) - if(!invalid_code[page]) { + { + if(!invalid_code[page]) + { restore_candidate[(page&2047)>>3]|=1<<(page&7); restore_candidate[((page&2047)>>3)+256]|=1<<(page&7); } - #ifdef USE_MINI_HT + } + +#ifdef USE_MINI_HT memset(mini_ht,-1,sizeof(mini_ht)); - #endif +#endif } // Add an entry to jump_out after making a link @@ -1087,37 +1113,48 @@ void clean_blocks(u_int page) struct ll_entry *head; inv_debug("INV: clean_blocks page=%d\n",page); head=jump_dirty[page]; - while(head!=NULL) { - if(!invalid_code[head->vaddr>>12]) { + while(head!=NULL) + { + if(!invalid_code[head->vaddr>>12]) + { // Don't restore blocks which are about to expire from the cache - if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) { + if((((u_int)head->addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) + { u_int start,end; - if(verify_dirty(head->addr)) { + if(verify_dirty(head->addr)) + { //printf("Possibly Restore %x (%x)\n",head->vaddr, (int)head->addr); u_int i; u_int inv=0; get_bounds((int)head->addr,&start,&end); - if(start-(u_int)rdram<RAM_SIZE) { - for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) { + if(start-(u_int)rdram<RAM_SIZE) + { + for(i=(start-(u_int)rdram+0x80000000)>>12;i<=(end-1-(u_int)rdram+0x80000000)>>12;i++) + { inv|=invalid_code[i]; } } - else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) { + else if((signed int)head->vaddr>=(signed int)0x80000000+RAM_SIZE) + { inv=1; } - if(!inv) { + if(!inv) + { void * clean_addr=(void *)get_clean_addr((int)head->addr); - if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) { + if((((u_int)clean_addr-(u_int)out)<<(32-TARGET_SIZE_2))>0x60000000+(MAX_OUTPUT_BLOCK_SIZE<<(32-TARGET_SIZE_2))) + { u_int ppage=page; inv_debug("INV: Restored %x (%x/%x)\n",head->vaddr, (int)head->addr, (int)clean_addr); //printf("page=%x, addr=%x\n",page,head->vaddr); //assert(head->vaddr>>12==(page|0x80000)); ll_add_flags(jump_in+ppage,head->vaddr,head->reg_sv_flags,clean_addr); u_int *ht_bin=hash_table[((head->vaddr>>16)^head->vaddr)&0xFFFF]; - if(ht_bin[0]==head->vaddr) { + if(ht_bin[0]==head->vaddr) + { ht_bin[1]=(u_int)clean_addr; // Replace existing entry } - if(ht_bin[2]==head->vaddr) { + if(ht_bin[2]==head->vaddr) + { ht_bin[3]=(u_int)clean_addr; // Replace existing entry } } @@ -1129,15 +1166,17 @@ void clean_blocks(u_int page) } } - -void mov_alloc(struct regstat *current,int i) +static void mov_alloc(struct regstat *current,int i) { // Note: Don't need to actually alloc the source registers - if((~current->is32>>rs1[i])&1) { + if((~current->is32>>rs1[i])&1) + { //alloc_reg64(current,i,rs1[i]); alloc_reg64(current,i,rt1[i]); current->is32&=~(1LL<<rt1[i]); - } else { + } + else + { //alloc_reg(current,i,rs1[i]); alloc_reg(current,i,rt1[i]); current->is32|=(1LL<<rt1[i]); @@ -1695,7 +1734,8 @@ void syscall_alloc(struct regstat *current,int i) void delayslot_alloc(struct regstat *current,int i) { - switch(itype[i]) { + switch(itype[i]) + { case UJUMP: case CJUMP: case SJUMP: @@ -1845,7 +1885,8 @@ void wb_register(signed char r,signed char regmap[],uint64_t dirty,uint64_t is32 } } -int mchecksum() +#if 0 +static int mchecksum(void) { //if(!tracedebug) return 0; int i; @@ -1858,7 +1899,8 @@ int mchecksum() } return sum; } -int rchecksum() + +static int rchecksum(void) { int i; int sum=0; @@ -1866,7 +1908,8 @@ int rchecksum() sum^=((u_int *)reg)[i]; return sum; } -void rlist() + +static void rlist(void) { int i; printf("TRACE: "); @@ -1875,12 +1918,12 @@ void rlist() printf("\n"); } -void enabletrace() +static void enabletrace(void) { tracedebug=1; } -void memdebug(int i) +static void memdebug(int i) { //printf("TRACE: count=%d next=%d (checksum %x) lo=%8x%8x\n",Count,next_interupt,mchecksum(),(int)(reg[LOREG]>>32),(int)reg[LOREG]); //printf("TRACE: count=%d next=%d (rchecksum %x)\n",Count,next_interupt,rchecksum()); @@ -1905,6 +1948,7 @@ void memdebug(int i) } //printf("TRACE: %x\n",(&i)[-1]); } +#endif void alu_assemble(int i,struct regstat *i_regs) { @@ -7016,7 +7060,7 @@ static int new_dynarec_test(void) // clear the state completely, instead of just marking // things invalid like invalidate_all_pages() does -void new_dynarec_clear_full() +void new_dynarec_clear_full(void) { int n; out=(u_char *)BASE_ADDR; @@ -7037,7 +7081,7 @@ void new_dynarec_clear_full() for(n=0;n<4096;n++) ll_clear(jump_dirty+n); } -void new_dynarec_init() +void new_dynarec_init(void) { SysPrintf("Init new dynarec\n"); @@ -7045,37 +7089,45 @@ void new_dynarec_init() // see assem_arm.h for some explanation #if defined(BASE_ADDR_FIXED) if (mmap (translation_cache, 1 << TARGET_SIZE_2, - PROT_READ | PROT_WRITE | PROT_EXEC, - MAP_PRIVATE | MAP_ANONYMOUS, - -1, 0) != translation_cache) { + PROT_READ | PROT_WRITE | PROT_EXEC, + MAP_PRIVATE | MAP_ANONYMOUS, + -1, 0) != translation_cache) + { SysPrintf("mmap() failed: %s\n", strerror(errno)); SysPrintf("disable BASE_ADDR_FIXED and recompile\n"); abort(); } #elif defined(BASE_ADDR_DYNAMIC) - #ifdef VITA - sceBlock = sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2); +#ifdef VITA + sceBlock = getVMBlock();//sceKernelAllocMemBlockForVM("code", 1 << TARGET_SIZE_2); if (sceBlock < 0) SysPrintf("sceKernelAllocMemBlockForVM failed\n"); int ret = sceKernelGetMemBlockBase(sceBlock, (void **)&translation_cache); if (ret < 0) SysPrintf("sceKernelGetMemBlockBase failed\n"); - #else + + sceKernelOpenVMDomain(); + sceClibPrintf("translation_cache = 0x%08X \n ", translation_cache); +#elif defined(_MSC_VER) + base_addr = VirtualAlloc(NULL, 1<<TARGET_SIZE_2, MEM_COMMIT | MEM_RESERVE, + PAGE_EXECUTE_READWRITE); +#else translation_cache = mmap (NULL, 1 << TARGET_SIZE_2, - PROT_READ | PROT_WRITE | PROT_EXEC, - MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); + PROT_READ | PROT_WRITE | PROT_EXEC, + MAP_PRIVATE | MAP_ANONYMOUS, -1, 0); if (translation_cache == MAP_FAILED) { SysPrintf("mmap() failed: %s\n", strerror(errno)); abort(); } - #endif +#endif #else - #ifndef NO_WRITE_EXEC +#ifndef NO_WRITE_EXEC // not all systems allow execute in data segment by default if (mprotect((void *)BASE_ADDR, 1<<TARGET_SIZE_2, PROT_READ | PROT_WRITE | PROT_EXEC) != 0) SysPrintf("mprotect() failed: %s\n", strerror(errno)); - #endif #endif +#endif + out=(u_char *)BASE_ADDR; cycle_multiplier=200; new_dynarec_clear_full(); @@ -7092,24 +7144,28 @@ void new_dynarec_init() SysPrintf("warning: RAM is not directly mapped, performance will suffer\n"); } -void new_dynarec_cleanup() +void new_dynarec_cleanup(void) { int n; #if defined(BASE_ADDR_FIXED) || defined(BASE_ADDR_DYNAMIC) - #ifdef VITA - sceKernelFreeMemBlock(sceBlock); - sceBlock = -1; - #else +#ifndef VITA +#if defined(_MSC_VER) + VirtualFree(base_addr, 0, MEM_RELEASE); +#else if (munmap ((void *)BASE_ADDR, 1<<TARGET_SIZE_2) < 0) SysPrintf("munmap() failed\n"); - #endif #endif - for(n=0;n<4096;n++) ll_clear(jump_in+n); - for(n=0;n<4096;n++) ll_clear(jump_out+n); - for(n=0;n<4096;n++) ll_clear(jump_dirty+n); - #ifdef ROM_COPY +#endif +#endif + for(n=0;n<4096;n++) + ll_clear(jump_in+n); + for(n=0;n<4096;n++) + ll_clear(jump_out+n); + for(n=0;n<4096;n++) + ll_clear(jump_dirty+n); +#ifdef ROM_COPY if (munmap (ROM_COPY, 67108864) < 0) {SysPrintf("munmap() failed\n");} - #endif +#endif } static u_int *get_source_start(u_int addr, u_int *limit) diff --git a/libpcsxcore/new_dynarec/new_dynarec.h b/libpcsxcore/new_dynarec/new_dynarec.h index ddc84a5..e7eb247 100644 --- a/libpcsxcore/new_dynarec/new_dynarec.h +++ b/libpcsxcore/new_dynarec/new_dynarec.h @@ -11,12 +11,12 @@ extern int cycle_multiplier; // 100 for 1.0 #define NDHACK_GTE_NO_FLAGS (1<<2) extern int new_dynarec_hacks; -void new_dynarec_init(); -void new_dynarec_cleanup(); -void new_dynarec_clear_full(); -void new_dyna_start(); +void new_dynarec_init(void); +void new_dynarec_cleanup(void); +void new_dynarec_clear_full(void); +void new_dyna_start(void); int new_dynarec_save_blocks(void *save, int size); void new_dynarec_load_blocks(const void *save, int size); -void invalidate_all_pages(); +void invalidate_all_pages(void); void invalidate_block(unsigned int block); diff --git a/libpcsxcore/new_dynarec/new_dynarec_config.h b/libpcsxcore/new_dynarec/new_dynarec_config.h index fbd08ac..d55f128 100644 --- a/libpcsxcore/new_dynarec/new_dynarec_config.h +++ b/libpcsxcore/new_dynarec/new_dynarec_config.h @@ -4,7 +4,7 @@ #define USE_MINI_HT 1 //#define REG_PREFETCH 1 -#if defined(__MACH__) || defined(VITA) +#if defined(__MACH__) #define NO_WRITE_EXEC 1 #endif #ifdef VITA diff --git a/libpcsxcore/plugins.c b/libpcsxcore/plugins.c index e6d8a11..afe3f3b 100644 --- a/libpcsxcore/plugins.c +++ b/libpcsxcore/plugins.c @@ -1,836 +1,1198 @@ -/***************************************************************************
- * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team *
- * *
- * This program is free software; you can redistribute it and/or modify *
- * it under the terms of the GNU General Public License as published by *
- * the Free Software Foundation; either version 2 of the License, or *
- * (at your option) any later version. *
- * *
- * This program is distributed in the hope that it will be useful, *
- * but WITHOUT ANY WARRANTY; without even the implied warranty of *
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the *
- * GNU General Public License for more details. *
- * *
- * You should have received a copy of the GNU General Public License *
- * along with this program; if not, write to the *
- * Free Software Foundation, Inc., *
- * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. *
- ***************************************************************************/
-
-/*
-* Plugin library callback/access functions.
-*/
-
-#include "plugins.h"
-#include "cdriso.h"
-
-static char IsoFile[MAXPATHLEN] = "";
-static s64 cdOpenCaseTime = 0;
-
-GPUupdateLace GPU_updateLace;
-GPUinit GPU_init;
-GPUshutdown GPU_shutdown;
-GPUconfigure GPU_configure;
-GPUtest GPU_test;
-GPUabout GPU_about;
-GPUopen GPU_open;
-GPUclose GPU_close;
-GPUreadStatus GPU_readStatus;
-GPUreadData GPU_readData;
-GPUreadDataMem GPU_readDataMem;
-GPUwriteStatus GPU_writeStatus;
-GPUwriteData GPU_writeData;
-GPUwriteDataMem GPU_writeDataMem;
-GPUdmaChain GPU_dmaChain;
-GPUkeypressed GPU_keypressed;
-GPUdisplayText GPU_displayText;
-GPUmakeSnapshot GPU_makeSnapshot;
-GPUfreeze GPU_freeze;
-GPUgetScreenPic GPU_getScreenPic;
-GPUshowScreenPic GPU_showScreenPic;
-GPUclearDynarec GPU_clearDynarec;
-GPUvBlank GPU_vBlank;
-
-CDRinit CDR_init;
-CDRshutdown CDR_shutdown;
-CDRopen CDR_open;
-CDRclose CDR_close;
-CDRtest CDR_test;
-CDRgetTN CDR_getTN;
-CDRgetTD CDR_getTD;
-CDRreadTrack CDR_readTrack;
-CDRgetBuffer CDR_getBuffer;
-CDRplay CDR_play;
-CDRstop CDR_stop;
-CDRgetStatus CDR_getStatus;
-CDRgetDriveLetter CDR_getDriveLetter;
-CDRgetBufferSub CDR_getBufferSub;
-CDRconfigure CDR_configure;
-CDRabout CDR_about;
-CDRsetfilename CDR_setfilename;
-CDRreadCDDA CDR_readCDDA;
-CDRgetTE CDR_getTE;
-
-SPUconfigure SPU_configure;
-SPUabout SPU_about;
-SPUinit SPU_init;
-SPUshutdown SPU_shutdown;
-SPUtest SPU_test;
-SPUopen SPU_open;
-SPUclose SPU_close;
-SPUplaySample SPU_playSample;
-SPUwriteRegister SPU_writeRegister;
-SPUreadRegister SPU_readRegister;
-SPUwriteDMA SPU_writeDMA;
-SPUreadDMA SPU_readDMA;
-SPUwriteDMAMem SPU_writeDMAMem;
-SPUreadDMAMem SPU_readDMAMem;
-SPUplayADPCMchannel SPU_playADPCMchannel;
-SPUfreeze SPU_freeze;
-SPUregisterCallback SPU_registerCallback;
-SPUregisterScheduleCb SPU_registerScheduleCb;
-SPUasync SPU_async;
-SPUplayCDDAchannel SPU_playCDDAchannel;
-
-PADconfigure PAD1_configure;
-PADabout PAD1_about;
-PADinit PAD1_init;
-PADshutdown PAD1_shutdown;
-PADtest PAD1_test;
-PADopen PAD1_open;
-PADclose PAD1_close;
-PADquery PAD1_query;
-PADreadPort1 PAD1_readPort1;
-PADkeypressed PAD1_keypressed;
-PADstartPoll PAD1_startPoll;
-PADpoll PAD1_poll;
-PADsetSensitive PAD1_setSensitive;
-
-PADconfigure PAD2_configure;
-PADabout PAD2_about;
-PADinit PAD2_init;
-PADshutdown PAD2_shutdown;
-PADtest PAD2_test;
-PADopen PAD2_open;
-PADclose PAD2_close;
-PADquery PAD2_query;
-PADreadPort2 PAD2_readPort2;
-PADkeypressed PAD2_keypressed;
-PADstartPoll PAD2_startPoll;
-PADpoll PAD2_poll;
-PADsetSensitive PAD2_setSensitive;
-
-NETinit NET_init;
-NETshutdown NET_shutdown;
-NETopen NET_open;
-NETclose NET_close;
-NETtest NET_test;
-NETconfigure NET_configure;
-NETabout NET_about;
-NETpause NET_pause;
-NETresume NET_resume;
-NETqueryPlayer NET_queryPlayer;
-NETsendData NET_sendData;
-NETrecvData NET_recvData;
-NETsendPadData NET_sendPadData;
-NETrecvPadData NET_recvPadData;
-NETsetInfo NET_setInfo;
-NETkeypressed NET_keypressed;
-
-#ifdef ENABLE_SIO1API
-
-SIO1init SIO1_init;
-SIO1shutdown SIO1_shutdown;
-SIO1open SIO1_open;
-SIO1close SIO1_close;
-SIO1test SIO1_test;
-SIO1configure SIO1_configure;
-SIO1about SIO1_about;
-SIO1pause SIO1_pause;
-SIO1resume SIO1_resume;
-SIO1keypressed SIO1_keypressed;
-SIO1writeData8 SIO1_writeData8;
-SIO1writeData16 SIO1_writeData16;
-SIO1writeData32 SIO1_writeData32;
-SIO1writeStat16 SIO1_writeStat16;
-SIO1writeStat32 SIO1_writeStat32;
-SIO1writeMode16 SIO1_writeMode16;
-SIO1writeMode32 SIO1_writeMode32;
-SIO1writeCtrl16 SIO1_writeCtrl16;
-SIO1writeCtrl32 SIO1_writeCtrl32;
-SIO1writeBaud16 SIO1_writeBaud16;
-SIO1writeBaud32 SIO1_writeBaud32;
-SIO1readData8 SIO1_readData8;
-SIO1readData16 SIO1_readData16;
-SIO1readData32 SIO1_readData32;
-SIO1readStat16 SIO1_readStat16;
-SIO1readStat32 SIO1_readStat32;
-SIO1readMode16 SIO1_readMode16;
-SIO1readMode32 SIO1_readMode32;
-SIO1readCtrl16 SIO1_readCtrl16;
-SIO1readCtrl32 SIO1_readCtrl32;
-SIO1readBaud16 SIO1_readBaud16;
-SIO1readBaud32 SIO1_readBaud32;
-SIO1registerCallback SIO1_registerCallback;
-
-#endif
-
-static const char *err;
-
-#define CheckErr(func) { \
- err = SysLibError(); \
- if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \
-}
-
-#define LoadSym(dest, src, name, checkerr) { \
- dest = (src)SysLoadSym(drv, name); \
- if (checkerr) { CheckErr(name); } else SysLibError(); \
-}
-
-void *hGPUDriver = NULL;
-
-void CALLBACK GPU__displayText(char *pText) {
- SysPrintf("%s\n", pText);
-}
-
-long CALLBACK GPU__configure(void) { return 0; }
-long CALLBACK GPU__test(void) { return 0; }
-void CALLBACK GPU__about(void) {}
-void CALLBACK GPU__makeSnapshot(void) {}
-void CALLBACK GPU__keypressed(int key) {}
-long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; }
-long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; }
-void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {}
-void CALLBACK GPU__vBlank(int val) {}
-
-#define LoadGpuSym1(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, TRUE);
-
-#define LoadGpuSym0(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, FALSE); \
- if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest;
-
-#define LoadGpuSymN(dest, name) \
- LoadSym(GPU_##dest, GPU##dest, name, FALSE);
-
-static int LoadGPUplugin(const char *GPUdll) {
- void *drv;
-
- hGPUDriver = SysLoadLibrary(GPUdll);
- if (hGPUDriver == NULL) {
- GPU_configure = NULL;
- SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1;
- }
- drv = hGPUDriver;
- LoadGpuSym1(init, "GPUinit");
- LoadGpuSym1(shutdown, "GPUshutdown");
- LoadGpuSym1(open, "GPUopen");
- LoadGpuSym1(close, "GPUclose");
- LoadGpuSym1(readData, "GPUreadData");
- LoadGpuSym1(readDataMem, "GPUreadDataMem");
- LoadGpuSym1(readStatus, "GPUreadStatus");
- LoadGpuSym1(writeData, "GPUwriteData");
- LoadGpuSym1(writeDataMem, "GPUwriteDataMem");
- LoadGpuSym1(writeStatus, "GPUwriteStatus");
- LoadGpuSym1(dmaChain, "GPUdmaChain");
- LoadGpuSym1(updateLace, "GPUupdateLace");
- LoadGpuSym0(keypressed, "GPUkeypressed");
- LoadGpuSym0(displayText, "GPUdisplayText");
- LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot");
- LoadGpuSym1(freeze, "GPUfreeze");
- LoadGpuSym0(getScreenPic, "GPUgetScreenPic");
- LoadGpuSym0(showScreenPic, "GPUshowScreenPic");
- LoadGpuSym0(clearDynarec, "GPUclearDynarec");
- LoadGpuSym0(vBlank, "GPUvBlank");
- LoadGpuSym0(configure, "GPUconfigure");
- LoadGpuSym0(test, "GPUtest");
- LoadGpuSym0(about, "GPUabout");
-
- return 0;
-}
-
-void *hCDRDriver = NULL;
-
-long CALLBACK CDR__play(unsigned char *sector) { return 0; }
-long CALLBACK CDR__stop(void) { return 0; }
-
-long CALLBACK CDR__getStatus(struct CdrStat *stat) {
- if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL))
- stat->Status = 0x10;
- else
- stat->Status = 0;
-
- return 0;
-}
-
-char* CALLBACK CDR__getDriveLetter(void) { return NULL; }
-long CALLBACK CDR__configure(void) { return 0; }
-long CALLBACK CDR__test(void) { return 0; }
-void CALLBACK CDR__about(void) {}
-long CALLBACK CDR__setfilename(char*filename) { return 0; }
-
-#define LoadCdrSym1(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, TRUE);
-
-#define LoadCdrSym0(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, FALSE); \
- if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest;
-
-#define LoadCdrSymN(dest, name) \
- LoadSym(CDR_##dest, CDR##dest, name, FALSE);
-
-static int LoadCDRplugin(const char *CDRdll) {
- void *drv;
-
- if (CDRdll == NULL) {
- cdrIsoInit();
- return 0;
- }
-
- hCDRDriver = SysLoadLibrary(CDRdll);
- if (hCDRDriver == NULL) {
- CDR_configure = NULL;
- SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1;
- }
- drv = hCDRDriver;
- LoadCdrSym1(init, "CDRinit");
- LoadCdrSym1(shutdown, "CDRshutdown");
- LoadCdrSym1(open, "CDRopen");
- LoadCdrSym1(close, "CDRclose");
- LoadCdrSym1(getTN, "CDRgetTN");
- LoadCdrSym1(getTD, "CDRgetTD");
- LoadCdrSym1(readTrack, "CDRreadTrack");
- LoadCdrSym1(getBuffer, "CDRgetBuffer");
- LoadCdrSym1(getBufferSub, "CDRgetBufferSub");
- LoadCdrSym0(play, "CDRplay");
- LoadCdrSym0(stop, "CDRstop");
- LoadCdrSym0(getStatus, "CDRgetStatus");
- LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter");
- LoadCdrSym0(configure, "CDRconfigure");
- LoadCdrSym0(test, "CDRtest");
- LoadCdrSym0(about, "CDRabout");
- LoadCdrSym0(setfilename, "CDRsetfilename");
- LoadCdrSymN(readCDDA, "CDRreadCDDA");
- LoadCdrSymN(getTE, "CDRgetTE");
-
- return 0;
-}
-
-void *hSPUDriver = NULL;
-
-long CALLBACK SPU__configure(void) { return 0; }
-void CALLBACK SPU__about(void) {}
-long CALLBACK SPU__test(void) { return 0; }
-void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {}
-
-#define LoadSpuSym1(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, TRUE);
-
-#define LoadSpuSym0(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, FALSE); \
- if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest;
-
-#define LoadSpuSymN(dest, name) \
- LoadSym(SPU_##dest, SPU##dest, name, FALSE);
-
-static int LoadSPUplugin(const char *SPUdll) {
- void *drv;
-
- hSPUDriver = SysLoadLibrary(SPUdll);
- if (hSPUDriver == NULL) {
- SPU_configure = NULL;
- SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1;
- }
- drv = hSPUDriver;
- LoadSpuSym1(init, "SPUinit");
- LoadSpuSym1(shutdown, "SPUshutdown");
- LoadSpuSym1(open, "SPUopen");
- LoadSpuSym1(close, "SPUclose");
- LoadSpuSym0(configure, "SPUconfigure");
- LoadSpuSym0(about, "SPUabout");
- LoadSpuSym0(test, "SPUtest");
- LoadSpuSym1(writeRegister, "SPUwriteRegister");
- LoadSpuSym1(readRegister, "SPUreadRegister");
- LoadSpuSym1(writeDMA, "SPUwriteDMA");
- LoadSpuSym1(readDMA, "SPUreadDMA");
- LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem");
- LoadSpuSym1(readDMAMem, "SPUreadDMAMem");
- LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel");
- LoadSpuSym1(freeze, "SPUfreeze");
- LoadSpuSym1(registerCallback, "SPUregisterCallback");
- LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb");
- LoadSpuSymN(async, "SPUasync");
- LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel");
-
- return 0;
-}
-
-void *hPAD1Driver = NULL;
-void *hPAD2Driver = NULL;
-
-static unsigned char buf[256];
-unsigned char stdpar[10] = { 0x00, 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-unsigned char mousepar[8] = { 0x00, 0x12, 0x5a, 0xff, 0xff, 0xff, 0xff };
-unsigned char analogpar[9] = { 0x00, 0xff, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
-
-static int bufcount, bufc;
-
-PadDataS padd1, padd2;
-
-unsigned char _PADstartPoll(PadDataS *pad) {
- bufc = 0;
-
- switch (pad->controllerType) {
- case PSE_PAD_TYPE_MOUSE:
- mousepar[3] = pad->buttonStatus & 0xff;
- mousepar[4] = pad->buttonStatus >> 8;
- mousepar[5] = pad->moveX;
- mousepar[6] = pad->moveY;
-
- memcpy(buf, mousepar, 7);
- bufcount = 6;
- break;
- case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069)
- analogpar[1] = 0x23;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_ANALOGPAD: // scph1150
- analogpar[1] = 0x73;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_ANALOGJOY: // scph1110
- analogpar[1] = 0x53;
- analogpar[3] = pad->buttonStatus & 0xff;
- analogpar[4] = pad->buttonStatus >> 8;
- analogpar[5] = pad->rightJoyX;
- analogpar[6] = pad->rightJoyY;
- analogpar[7] = pad->leftJoyX;
- analogpar[8] = pad->leftJoyY;
-
- memcpy(buf, analogpar, 9);
- bufcount = 8;
- break;
- case PSE_PAD_TYPE_STANDARD:
- default:
- stdpar[3] = pad->buttonStatus & 0xff;
- stdpar[4] = pad->buttonStatus >> 8;
-
- memcpy(buf, stdpar, 5);
- bufcount = 4;
- }
-
- return buf[bufc++];
-}
-
-unsigned char _PADpoll(unsigned char value) {
- if (bufc > bufcount) return 0;
- return buf[bufc++];
-}
-
-unsigned char CALLBACK PAD1__startPoll(int pad) {
- PadDataS padd;
-
- PAD1_readPort1(&padd);
-
- return _PADstartPoll(&padd);
-}
-
-unsigned char CALLBACK PAD1__poll(unsigned char value) {
- return _PADpoll(value);
-}
-
-long CALLBACK PAD1__configure(void) { return 0; }
-void CALLBACK PAD1__about(void) {}
-long CALLBACK PAD1__test(void) { return 0; }
-long CALLBACK PAD1__query(void) { return 3; }
-long CALLBACK PAD1__keypressed() { return 0; }
-
-#define LoadPad1Sym1(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, TRUE);
-
-#define LoadPad1SymN(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE);
-
-#define LoadPad1Sym0(dest, name) \
- LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \
- if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest;
-
-static int LoadPAD1plugin(const char *PAD1dll) {
- void *drv;
-
- hPAD1Driver = SysLoadLibrary(PAD1dll);
- if (hPAD1Driver == NULL) {
- PAD1_configure = NULL;
- SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1;
- }
- drv = hPAD1Driver;
- LoadPad1Sym1(init, "PADinit");
- LoadPad1Sym1(shutdown, "PADshutdown");
- LoadPad1Sym1(open, "PADopen");
- LoadPad1Sym1(close, "PADclose");
- LoadPad1Sym0(query, "PADquery");
- LoadPad1Sym1(readPort1, "PADreadPort1");
- LoadPad1Sym0(configure, "PADconfigure");
- LoadPad1Sym0(test, "PADtest");
- LoadPad1Sym0(about, "PADabout");
- LoadPad1Sym0(keypressed, "PADkeypressed");
- LoadPad1Sym0(startPoll, "PADstartPoll");
- LoadPad1Sym0(poll, "PADpoll");
- LoadPad1SymN(setSensitive, "PADsetSensitive");
-
- return 0;
-}
-
-unsigned char CALLBACK PAD2__startPoll(int pad) {
- PadDataS padd;
-
- PAD2_readPort2(&padd);
-
- return _PADstartPoll(&padd);
-}
-
-unsigned char CALLBACK PAD2__poll(unsigned char value) {
- return _PADpoll(value);
-}
-
-long CALLBACK PAD2__configure(void) { return 0; }
-void CALLBACK PAD2__about(void) {}
-long CALLBACK PAD2__test(void) { return 0; }
-long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; }
-long CALLBACK PAD2__keypressed() { return 0; }
-
-#define LoadPad2Sym1(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, TRUE);
-
-#define LoadPad2Sym0(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \
- if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest;
-
-#define LoadPad2SymN(dest, name) \
- LoadSym(PAD2_##dest, PAD##dest, name, FALSE);
-
-static int LoadPAD2plugin(const char *PAD2dll) {
- void *drv;
-
- hPAD2Driver = SysLoadLibrary(PAD2dll);
- if (hPAD2Driver == NULL) {
- PAD2_configure = NULL;
- SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1;
- }
- drv = hPAD2Driver;
- LoadPad2Sym1(init, "PADinit");
- LoadPad2Sym1(shutdown, "PADshutdown");
- LoadPad2Sym1(open, "PADopen");
- LoadPad2Sym1(close, "PADclose");
- LoadPad2Sym0(query, "PADquery");
- LoadPad2Sym1(readPort2, "PADreadPort2");
- LoadPad2Sym0(configure, "PADconfigure");
- LoadPad2Sym0(test, "PADtest");
- LoadPad2Sym0(about, "PADabout");
- LoadPad2Sym0(keypressed, "PADkeypressed");
- LoadPad2Sym0(startPoll, "PADstartPoll");
- LoadPad2Sym0(poll, "PADpoll");
- LoadPad2SymN(setSensitive, "PADsetSensitive");
-
- return 0;
-}
-
-void *hNETDriver = NULL;
-
-void CALLBACK NET__setInfo(netInfo *info) {}
-void CALLBACK NET__keypressed(int key) {}
-long CALLBACK NET__configure(void) { return 0; }
-long CALLBACK NET__test(void) { return 0; }
-void CALLBACK NET__about(void) {}
-
-#define LoadNetSym1(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, TRUE);
-
-#define LoadNetSymN(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, FALSE);
-
-#define LoadNetSym0(dest, name) \
- LoadSym(NET_##dest, NET##dest, name, FALSE); \
- if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest;
-
-static int LoadNETplugin(const char *NETdll) {
- void *drv;
-
- hNETDriver = SysLoadLibrary(NETdll);
- if (hNETDriver == NULL) {
- SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1;
- }
- drv = hNETDriver;
- LoadNetSym1(init, "NETinit");
- LoadNetSym1(shutdown, "NETshutdown");
- LoadNetSym1(open, "NETopen");
- LoadNetSym1(close, "NETclose");
- LoadNetSymN(sendData, "NETsendData");
- LoadNetSymN(recvData, "NETrecvData");
- LoadNetSym1(sendPadData, "NETsendPadData");
- LoadNetSym1(recvPadData, "NETrecvPadData");
- LoadNetSym1(queryPlayer, "NETqueryPlayer");
- LoadNetSym1(pause, "NETpause");
- LoadNetSym1(resume, "NETresume");
- LoadNetSym0(setInfo, "NETsetInfo");
- LoadNetSym0(keypressed, "NETkeypressed");
- LoadNetSym0(configure, "NETconfigure");
- LoadNetSym0(test, "NETtest");
- LoadNetSym0(about, "NETabout");
-
- return 0;
-}
-
-#ifdef ENABLE_SIO1API
-
-void *hSIO1Driver = NULL;
-
-long CALLBACK SIO1__init(void) { return 0; }
-long CALLBACK SIO1__shutdown(void) { return 0; }
-long CALLBACK SIO1__open(void) { return 0; }
-long CALLBACK SIO1__close(void) { return 0; }
-long CALLBACK SIO1__configure(void) { return 0; }
-long CALLBACK SIO1__test(void) { return 0; }
-void CALLBACK SIO1__about(void) {}
-void CALLBACK SIO1__pause(void) {}
-void CALLBACK SIO1__resume(void) {}
-long CALLBACK SIO1__keypressed(int key) { return 0; }
-void CALLBACK SIO1__writeData8(unsigned char val) {}
-void CALLBACK SIO1__writeData16(unsigned short val) {}
-void CALLBACK SIO1__writeData32(unsigned long val) {}
-void CALLBACK SIO1__writeStat16(unsigned short val) {}
-void CALLBACK SIO1__writeStat32(unsigned long val) {}
-void CALLBACK SIO1__writeMode16(unsigned short val) {}
-void CALLBACK SIO1__writeMode32(unsigned long val) {}
-void CALLBACK SIO1__writeCtrl16(unsigned short val) {}
-void CALLBACK SIO1__writeCtrl32(unsigned long val) {}
-void CALLBACK SIO1__writeBaud16(unsigned short val) {}
-void CALLBACK SIO1__writeBaud32(unsigned long val) {}
-unsigned char CALLBACK SIO1__readData8(void) { return 0; }
-unsigned short CALLBACK SIO1__readData16(void) { return 0; }
-unsigned long CALLBACK SIO1__readData32(void) { return 0; }
-unsigned short CALLBACK SIO1__readStat16(void) { return 0; }
-unsigned long CALLBACK SIO1__readStat32(void) { return 0; }
-unsigned short CALLBACK SIO1__readMode16(void) { return 0; }
-unsigned long CALLBACK SIO1__readMode32(void) { return 0; }
-unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; }
-unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; }
-unsigned short CALLBACK SIO1__readBaud16(void) { return 0; }
-unsigned long CALLBACK SIO1__readBaud32(void) { return 0; }
-void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {};
-
-void CALLBACK SIO1irq(void) {
- psxHu32ref(0x1070) |= SWAPu32(0x100);
-}
-
-#define LoadSio1Sym1(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, TRUE);
-
-#define LoadSio1SymN(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE);
-
-#define LoadSio1Sym0(dest, name) \
- LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \
- if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest;
-
-static int LoadSIO1plugin(const char *SIO1dll) {
- void *drv;
-
- hSIO1Driver = SysLoadLibrary(SIO1dll);
- if (hSIO1Driver == NULL) {
- SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1;
- }
- drv = hSIO1Driver;
-
- LoadSio1Sym0(init, "SIO1init");
- LoadSio1Sym0(shutdown, "SIO1shutdown");
- LoadSio1Sym0(open, "SIO1open");
- LoadSio1Sym0(close, "SIO1close");
- LoadSio1Sym0(pause, "SIO1pause");
- LoadSio1Sym0(resume, "SIO1resume");
- LoadSio1Sym0(keypressed, "SIO1keypressed");
- LoadSio1Sym0(configure, "SIO1configure");
- LoadSio1Sym0(test, "SIO1test");
- LoadSio1Sym0(about, "SIO1about");
- LoadSio1Sym0(writeData8, "SIO1writeData8");
- LoadSio1Sym0(writeData16, "SIO1writeData16");
- LoadSio1Sym0(writeData32, "SIO1writeData32");
- LoadSio1Sym0(writeStat16, "SIO1writeStat16");
- LoadSio1Sym0(writeStat32, "SIO1writeStat32");
- LoadSio1Sym0(writeMode16, "SIO1writeMode16");
- LoadSio1Sym0(writeMode32, "SIO1writeMode32");
- LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16");
- LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32");
- LoadSio1Sym0(writeBaud16, "SIO1writeBaud16");
- LoadSio1Sym0(writeBaud32, "SIO1writeBaud32");
- LoadSio1Sym0(readData16, "SIO1readData16");
- LoadSio1Sym0(readData32, "SIO1readData32");
- LoadSio1Sym0(readStat16, "SIO1readStat16");
- LoadSio1Sym0(readStat32, "SIO1readStat32");
- LoadSio1Sym0(readMode16, "SIO1readMode16");
- LoadSio1Sym0(readMode32, "SIO1readMode32");
- LoadSio1Sym0(readCtrl16, "SIO1readCtrl16");
- LoadSio1Sym0(readCtrl32, "SIO1readCtrl32");
- LoadSio1Sym0(readBaud16, "SIO1readBaud16");
- LoadSio1Sym0(readBaud32, "SIO1readBaud32");
- LoadSio1Sym0(registerCallback, "SIO1registerCallback");
-
- return 0;
-}
-
-#endif
-
-void CALLBACK clearDynarec(void) {
- psxCpu->Reset();
-}
-
-int LoadPlugins() {
- int ret;
- char Plugin[MAXPATHLEN];
-
- ReleasePlugins();
- SysLibError();
-
- if (UsingIso()) {
- LoadCDRplugin(NULL);
- } else {
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
- if (LoadCDRplugin(Plugin) == -1) return -1;
- }
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu);
- if (LoadGPUplugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu);
- if (LoadSPUplugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1);
- if (LoadPAD1plugin(Plugin) == -1) return -1;
-
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2);
- if (LoadPAD2plugin(Plugin) == -1) return -1;
-
- if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0)
- Config.UseNet = FALSE;
- else {
- Config.UseNet = TRUE;
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net);
- if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE;
- }
-
-#ifdef ENABLE_SIO1API
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1);
- if (LoadSIO1plugin(Plugin) == -1) return -1;
-#endif
-
- ret = CDR_init();
- if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; }
- ret = GPU_init();
- if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; }
- ret = SPU_init();
- if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; }
- ret = PAD1_init(1);
- if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; }
- ret = PAD2_init(2);
- if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; }
-
- if (Config.UseNet) {
- ret = NET_init();
- if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; }
- }
-
-#ifdef ENABLE_SIO1API
- ret = SIO1_init();
- if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; }
-#endif
-
- SysPrintf(_("Plugins loaded.\n"));
- return 0;
-}
-
-void ReleasePlugins() {
- if (Config.UseNet) {
- int ret = NET_close();
- if (ret < 0) Config.UseNet = FALSE;
- }
- NetOpened = FALSE;
-
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
- if (hGPUDriver != NULL) GPU_shutdown();
- if (hSPUDriver != NULL) SPU_shutdown();
- if (hPAD1Driver != NULL) PAD1_shutdown();
- if (hPAD2Driver != NULL) PAD2_shutdown();
-
- if (Config.UseNet && hNETDriver != NULL) NET_shutdown();
-
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
- if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL;
- if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL;
- if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL;
- if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL;
-
- if (Config.UseNet && hNETDriver != NULL) {
- SysCloseLibrary(hNETDriver); hNETDriver = NULL;
- }
-
-#ifdef ENABLE_SIO1API
- if (hSIO1Driver != NULL) {
- SIO1_shutdown();
- SysCloseLibrary(hSIO1Driver);
- hSIO1Driver = NULL;
- }
-#endif
-}
-
-// for CD swap
-int ReloadCdromPlugin()
-{
- if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown();
- if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL;
-
- if (UsingIso()) {
- LoadCDRplugin(NULL);
- } else {
- char Plugin[MAXPATHLEN];
- sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr);
- if (LoadCDRplugin(Plugin) == -1) return -1;
- }
-
- return CDR_init();
-}
-
-void SetIsoFile(const char *filename) {
- if (filename == NULL) {
- IsoFile[0] = '\0';
- return;
- }
- strncpy(IsoFile, filename, MAXPATHLEN);
-}
-
-const char *GetIsoFile(void) {
- return IsoFile;
-}
-
-boolean UsingIso(void) {
- return (IsoFile[0] != '\0');
-}
-
-void SetCdOpenCaseTime(s64 time) {
- cdOpenCaseTime = time;
-}
+/*************************************************************************** + * Copyright (C) 2007 Ryan Schultz, PCSX-df Team, PCSX team * + * * + * This program is free software; you can redistribute it and/or modify * + * it under the terms of the GNU General Public License as published by * + * the Free Software Foundation; either version 2 of the License, or * + * (at your option) any later version. * + * * + * This program is distributed in the hope that it will be useful, * + * but WITHOUT ANY WARRANTY; without even the implied warranty of * + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the * + * GNU General Public License for more details. * + * * + * You should have received a copy of the GNU General Public License * + * along with this program; if not, write to the * + * Free Software Foundation, Inc., * + * 51 Franklin Street, Fifth Floor, Boston, MA 02111-1307 USA. * + ***************************************************************************/ + +/* +* Plugin library callback/access functions. +*/ + +#include "plugins.h" +#include "cdriso.h" +#include "../plugins/dfinput/externals.h" + +static char IsoFile[MAXPATHLEN] = ""; +static s64 cdOpenCaseTime = 0; + +GPUupdateLace GPU_updateLace; +GPUinit GPU_init; +GPUshutdown GPU_shutdown; +GPUconfigure GPU_configure; +GPUtest GPU_test; +GPUabout GPU_about; +GPUopen GPU_open; +GPUclose GPU_close; +GPUreadStatus GPU_readStatus; +GPUreadData GPU_readData; +GPUreadDataMem GPU_readDataMem; +GPUwriteStatus GPU_writeStatus; +GPUwriteData GPU_writeData; +GPUwriteDataMem GPU_writeDataMem; +GPUdmaChain GPU_dmaChain; +GPUkeypressed GPU_keypressed; +GPUdisplayText GPU_displayText; +GPUmakeSnapshot GPU_makeSnapshot; +GPUfreeze GPU_freeze; +GPUgetScreenPic GPU_getScreenPic; +GPUshowScreenPic GPU_showScreenPic; +GPUclearDynarec GPU_clearDynarec; +GPUvBlank GPU_vBlank; + +CDRinit CDR_init; +CDRshutdown CDR_shutdown; +CDRopen CDR_open; +CDRclose CDR_close; +CDRtest CDR_test; +CDRgetTN CDR_getTN; +CDRgetTD CDR_getTD; +CDRreadTrack CDR_readTrack; +CDRgetBuffer CDR_getBuffer; +CDRplay CDR_play; +CDRstop CDR_stop; +CDRgetStatus CDR_getStatus; +CDRgetDriveLetter CDR_getDriveLetter; +CDRgetBufferSub CDR_getBufferSub; +CDRconfigure CDR_configure; +CDRabout CDR_about; +CDRsetfilename CDR_setfilename; +CDRreadCDDA CDR_readCDDA; +CDRgetTE CDR_getTE; + +SPUconfigure SPU_configure; +SPUabout SPU_about; +SPUinit SPU_init; +SPUshutdown SPU_shutdown; +SPUtest SPU_test; +SPUopen SPU_open; +SPUclose SPU_close; +SPUplaySample SPU_playSample; +SPUwriteRegister SPU_writeRegister; +SPUreadRegister SPU_readRegister; +SPUwriteDMA SPU_writeDMA; +SPUreadDMA SPU_readDMA; +SPUwriteDMAMem SPU_writeDMAMem; +SPUreadDMAMem SPU_readDMAMem; +SPUplayADPCMchannel SPU_playADPCMchannel; +SPUfreeze SPU_freeze; +SPUregisterCallback SPU_registerCallback; +SPUregisterScheduleCb SPU_registerScheduleCb; +SPUasync SPU_async; +SPUplayCDDAchannel SPU_playCDDAchannel; + +PADconfigure PAD1_configure; +PADabout PAD1_about; +PADinit PAD1_init; +PADshutdown PAD1_shutdown; +PADtest PAD1_test; +PADopen PAD1_open; +PADclose PAD1_close; +PADquery PAD1_query; +PADreadPort1 PAD1_readPort1; +PADkeypressed PAD1_keypressed; +PADstartPoll PAD1_startPoll; +PADpoll PAD1_poll; +PADsetSensitive PAD1_setSensitive; + +PADconfigure PAD2_configure; +PADabout PAD2_about; +PADinit PAD2_init; +PADshutdown PAD2_shutdown; +PADtest PAD2_test; +PADopen PAD2_open; +PADclose PAD2_close; +PADquery PAD2_query; +PADreadPort2 PAD2_readPort2; +PADkeypressed PAD2_keypressed; +PADstartPoll PAD2_startPoll; +PADpoll PAD2_poll; +PADsetSensitive PAD2_setSensitive; + +NETinit NET_init; +NETshutdown NET_shutdown; +NETopen NET_open; +NETclose NET_close; +NETtest NET_test; +NETconfigure NET_configure; +NETabout NET_about; +NETpause NET_pause; +NETresume NET_resume; +NETqueryPlayer NET_queryPlayer; +NETsendData NET_sendData; +NETrecvData NET_recvData; +NETsendPadData NET_sendPadData; +NETrecvPadData NET_recvPadData; +NETsetInfo NET_setInfo; +NETkeypressed NET_keypressed; + +#ifdef ENABLE_SIO1API + +SIO1init SIO1_init; +SIO1shutdown SIO1_shutdown; +SIO1open SIO1_open; +SIO1close SIO1_close; +SIO1test SIO1_test; +SIO1configure SIO1_configure; +SIO1about SIO1_about; +SIO1pause SIO1_pause; +SIO1resume SIO1_resume; +SIO1keypressed SIO1_keypressed; +SIO1writeData8 SIO1_writeData8; +SIO1writeData16 SIO1_writeData16; +SIO1writeData32 SIO1_writeData32; +SIO1writeStat16 SIO1_writeStat16; +SIO1writeStat32 SIO1_writeStat32; +SIO1writeMode16 SIO1_writeMode16; +SIO1writeMode32 SIO1_writeMode32; +SIO1writeCtrl16 SIO1_writeCtrl16; +SIO1writeCtrl32 SIO1_writeCtrl32; +SIO1writeBaud16 SIO1_writeBaud16; +SIO1writeBaud32 SIO1_writeBaud32; +SIO1readData8 SIO1_readData8; +SIO1readData16 SIO1_readData16; +SIO1readData32 SIO1_readData32; +SIO1readStat16 SIO1_readStat16; +SIO1readStat32 SIO1_readStat32; +SIO1readMode16 SIO1_readMode16; +SIO1readMode32 SIO1_readMode32; +SIO1readCtrl16 SIO1_readCtrl16; +SIO1readCtrl32 SIO1_readCtrl32; +SIO1readBaud16 SIO1_readBaud16; +SIO1readBaud32 SIO1_readBaud32; +SIO1registerCallback SIO1_registerCallback; + +#endif + +static const char *err; + +#define CheckErr(func) { \ + err = SysLibError(); \ + if (err != NULL) { SysMessage(_("Error loading %s: %s"), func, err); return -1; } \ +} + +#define LoadSym(dest, src, name, checkerr) { \ + dest = (src)SysLoadSym(drv, name); \ + if (checkerr) { CheckErr(name); } else SysLibError(); \ +} + +void *hGPUDriver = NULL; + +void CALLBACK GPU__displayText(char *pText) { + SysPrintf("%s\n", pText); +} + +long CALLBACK GPU__configure(void) { return 0; } +long CALLBACK GPU__test(void) { return 0; } +void CALLBACK GPU__about(void) {} +void CALLBACK GPU__makeSnapshot(void) {} +void CALLBACK GPU__keypressed(int key) {} +long CALLBACK GPU__getScreenPic(unsigned char *pMem) { return -1; } +long CALLBACK GPU__showScreenPic(unsigned char *pMem) { return -1; } +void CALLBACK GPU__clearDynarec(void (CALLBACK *callback)(void)) {} +void CALLBACK GPU__vBlank(int val) {} + +#define LoadGpuSym1(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, TRUE); + +#define LoadGpuSym0(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, FALSE); \ + if (GPU_##dest == NULL) GPU_##dest = (GPU##dest) GPU__##dest; + +#define LoadGpuSymN(dest, name) \ + LoadSym(GPU_##dest, GPU##dest, name, FALSE); + +static int LoadGPUplugin(const char *GPUdll) { + void *drv; + + hGPUDriver = SysLoadLibrary(GPUdll); + if (hGPUDriver == NULL) { + GPU_configure = NULL; + SysMessage (_("Could not load GPU plugin %s!"), GPUdll); return -1; + } + drv = hGPUDriver; + LoadGpuSym1(init, "GPUinit"); + LoadGpuSym1(shutdown, "GPUshutdown"); + LoadGpuSym1(open, "GPUopen"); + LoadGpuSym1(close, "GPUclose"); + LoadGpuSym1(readData, "GPUreadData"); + LoadGpuSym1(readDataMem, "GPUreadDataMem"); + LoadGpuSym1(readStatus, "GPUreadStatus"); + LoadGpuSym1(writeData, "GPUwriteData"); + LoadGpuSym1(writeDataMem, "GPUwriteDataMem"); + LoadGpuSym1(writeStatus, "GPUwriteStatus"); + LoadGpuSym1(dmaChain, "GPUdmaChain"); + LoadGpuSym1(updateLace, "GPUupdateLace"); + LoadGpuSym0(keypressed, "GPUkeypressed"); + LoadGpuSym0(displayText, "GPUdisplayText"); + LoadGpuSym0(makeSnapshot, "GPUmakeSnapshot"); + LoadGpuSym1(freeze, "GPUfreeze"); + LoadGpuSym0(getScreenPic, "GPUgetScreenPic"); + LoadGpuSym0(showScreenPic, "GPUshowScreenPic"); + LoadGpuSym0(clearDynarec, "GPUclearDynarec"); + LoadGpuSym0(vBlank, "GPUvBlank"); + LoadGpuSym0(configure, "GPUconfigure"); + LoadGpuSym0(test, "GPUtest"); + LoadGpuSym0(about, "GPUabout"); + + return 0; +} + +void *hCDRDriver = NULL; + +long CALLBACK CDR__play(unsigned char *sector) { return 0; } +long CALLBACK CDR__stop(void) { return 0; } + +long CALLBACK CDR__getStatus(struct CdrStat *stat) { + if (cdOpenCaseTime < 0 || cdOpenCaseTime > (s64)time(NULL)) + stat->Status = 0x10; + else + stat->Status = 0; + + return 0; +} + +char* CALLBACK CDR__getDriveLetter(void) { return NULL; } +long CALLBACK CDR__configure(void) { return 0; } +long CALLBACK CDR__test(void) { return 0; } +void CALLBACK CDR__about(void) {} +long CALLBACK CDR__setfilename(char*filename) { return 0; } + +#define LoadCdrSym1(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, TRUE); + +#define LoadCdrSym0(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, FALSE); \ + if (CDR_##dest == NULL) CDR_##dest = (CDR##dest) CDR__##dest; + +#define LoadCdrSymN(dest, name) \ + LoadSym(CDR_##dest, CDR##dest, name, FALSE); + +static int LoadCDRplugin(const char *CDRdll) { + void *drv; + + if (CDRdll == NULL) { + cdrIsoInit(); + return 0; + } + + hCDRDriver = SysLoadLibrary(CDRdll); + if (hCDRDriver == NULL) { + CDR_configure = NULL; + SysMessage (_("Could not load CD-ROM plugin %s!"), CDRdll); return -1; + } + drv = hCDRDriver; + LoadCdrSym1(init, "CDRinit"); + LoadCdrSym1(shutdown, "CDRshutdown"); + LoadCdrSym1(open, "CDRopen"); + LoadCdrSym1(close, "CDRclose"); + LoadCdrSym1(getTN, "CDRgetTN"); + LoadCdrSym1(getTD, "CDRgetTD"); + LoadCdrSym1(readTrack, "CDRreadTrack"); + LoadCdrSym1(getBuffer, "CDRgetBuffer"); + LoadCdrSym1(getBufferSub, "CDRgetBufferSub"); + LoadCdrSym0(play, "CDRplay"); + LoadCdrSym0(stop, "CDRstop"); + LoadCdrSym0(getStatus, "CDRgetStatus"); + LoadCdrSym0(getDriveLetter, "CDRgetDriveLetter"); + LoadCdrSym0(configure, "CDRconfigure"); + LoadCdrSym0(test, "CDRtest"); + LoadCdrSym0(about, "CDRabout"); + LoadCdrSym0(setfilename, "CDRsetfilename"); + LoadCdrSymN(readCDDA, "CDRreadCDDA"); + LoadCdrSymN(getTE, "CDRgetTE"); + + return 0; +} + +void *hSPUDriver = NULL; + +long CALLBACK SPU__configure(void) { return 0; } +void CALLBACK SPU__about(void) {} +long CALLBACK SPU__test(void) { return 0; } +void CALLBACK SPU__registerScheduleCb(void (CALLBACK *cb)(unsigned int)) {} + +#define LoadSpuSym1(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, TRUE); + +#define LoadSpuSym0(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, FALSE); \ + if (SPU_##dest == NULL) SPU_##dest = (SPU##dest) SPU__##dest; + +#define LoadSpuSymN(dest, name) \ + LoadSym(SPU_##dest, SPU##dest, name, FALSE); + +static int LoadSPUplugin(const char *SPUdll) { + void *drv; + + hSPUDriver = SysLoadLibrary(SPUdll); + if (hSPUDriver == NULL) { + SPU_configure = NULL; + SysMessage (_("Could not load SPU plugin %s!"), SPUdll); return -1; + } + drv = hSPUDriver; + LoadSpuSym1(init, "SPUinit"); + LoadSpuSym1(shutdown, "SPUshutdown"); + LoadSpuSym1(open, "SPUopen"); + LoadSpuSym1(close, "SPUclose"); + LoadSpuSym0(configure, "SPUconfigure"); + LoadSpuSym0(about, "SPUabout"); + LoadSpuSym0(test, "SPUtest"); + LoadSpuSym1(writeRegister, "SPUwriteRegister"); + LoadSpuSym1(readRegister, "SPUreadRegister"); + LoadSpuSym1(writeDMA, "SPUwriteDMA"); + LoadSpuSym1(readDMA, "SPUreadDMA"); + LoadSpuSym1(writeDMAMem, "SPUwriteDMAMem"); + LoadSpuSym1(readDMAMem, "SPUreadDMAMem"); + LoadSpuSym1(playADPCMchannel, "SPUplayADPCMchannel"); + LoadSpuSym1(freeze, "SPUfreeze"); + LoadSpuSym1(registerCallback, "SPUregisterCallback"); + LoadSpuSym0(registerScheduleCb, "SPUregisterScheduleCb"); + LoadSpuSymN(async, "SPUasync"); + LoadSpuSymN(playCDDAchannel, "SPUplayCDDAchannel"); + + return 0; +} + +void *hPAD1Driver = NULL; +void *hPAD2Driver = NULL; + +static int multitap1 = -1; +static int multitap2 = -1; +//Pad information, keystate, mode, config mode, vibration +static PadDataS pad[8]; + +static int reqPos, respSize, req; +static int ledStateReq44[8]; + +static unsigned char buf[256]; +static unsigned char bufMulti[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; + +unsigned char stdpar[8] = { 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; +unsigned char multitappar[34] = { 0x80, 0x5a, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff, + 0x41, 0x5a, 0xff, 0xff, 0xff, 0xff, 0xff, 0xff}; + +//response for request 44, 45, 46, 47, 4C, 4D +static unsigned char resp45[8] = {0xF3, 0x5A, 0x01, 0x02, 0x00, 0x02, 0x01, 0x00}; +static unsigned char resp46_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A}; +static unsigned char resp46_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14}; +static unsigned char resp47[8] = {0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00}; +static unsigned char resp4C_00[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00}; +static unsigned char resp4C_01[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00}; +static unsigned char resp4D[8] = {0xF3, 0x5A, 0x00, 0x01, 0xFF, 0xFF, 0xFF, 0xFF}; + +//fixed reponse of request number 41, 48, 49, 4A, 4B, 4E, 4F +static unsigned char resp40[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp41[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp43[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp44[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp49[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4A[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4B[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4E[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; +static unsigned char resp4F[8] = {0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00}; + +// Resquest of psx core +enum { + // REQUEST + // first call of this request for the pad, the pad is configured as an digital pad. + // 0x0X, 0x42, 0x0Y, 0xZZ, 0xAA, 0x00, 0x00, 0x00, 0x00 + // X pad number (used for the multitap, first request response 0x00, 0x80, 0x5A, (8 bytes pad A), (8 bytes pad B), (8 bytes pad C), (8 bytes pad D) + // Y if 1 : psx request the full length response for the multitap, 3 bytes header and 4 block of 8 bytes per pad + // Y if 0 : psx request a pad key state + // ZZ rumble small motor 00-> OFF, 01 -> ON + // AA rumble large motor speed 0x00 -> 0xFF + // RESPONSE + // header 3 Bytes + // 0x00 + // PadId -> 0x41 for digital pas, 0x73 for analog pad + // 0x5A mode has not change (no press on analog button on the center of pad), 0x00 the analog button have been pressed and the mode switch + // 6 Bytes for keystates + CMD_READ_DATA_AND_VIBRATE = 0x42, + + // REQUEST + // Header + // 0x0N, 0x43, 0x00, XX, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // XX = 00 -> Normal mode : Seconde bytes of response = padId + // XX = 01 -> Configuration mode : Seconde bytes of response = 0xF3 + // RESPONSE + // enter in config mode example : + // req : 01 43 00 01 00 00 00 00 00 00 + // res : 00 41 5A buttons state, analog states + // exit config mode : + // req : 01 43 00 00 00 00 00 00 00 00 + // res : 00 F3 5A buttons state, analog states + CMD_CONFIG_MODE = 0x43, + + // Set led State + // REQUEST + // 0x0N, 0x44, 0x00, VAL, SEL, 0x00, 0x00, 0x00, 0x00 + // If sel = 2 then + // VAL = 00 -> OFF + // VAL = 01 -> ON + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + CMD_SET_MODE_AND_LOCK = 0x44, + + // Get Analog Led state + // REQUEST + // 0x0N, 0x45, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x01, 0x02, VAL, 0x02, 0x01, 0x00 + // VAL = 00 Led OFF + // VAL = 01 Led ON + CMD_QUERY_MODEL_AND_MODE = 0x45, + + //Get Variable A + // REQUEST + // 0x0N, 0x46, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX=00 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x02, 0x00, 0x0A + // XX=01 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x01, 0x01, 0x01, 0x14 + CMD_QUERY_ACT = 0x46, + + // REQUEST + // 0x0N, 0x47, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x02, 0x00, 0x01, 0x00 + CMD_QUERY_COMB = 0x47, + + // REQUEST + // 0x0N, 0x4C, 0x00, 0xXX, 0x00, 0x00, 0x00, 0x00, 0x00 + // RESPONSE + // XX = 0 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x04, 0x00, 0x00 + // XX = 1 + // 0x00, 0xF3, 0x5A, 0x00, 0x00, 0x00, 0x07, 0x00, 0x00 + CMD_QUERY_MODE = 0x4C, + + // REQUEST + // 0x0N, 0x4D, 0x00, 0xAA, 0xBB, 0xCC, 0xDD, 0xEE, 0xFF + // RESPONSE + // 0x00, 0xF3, 0x5A, old value or + // AA = 01 unlock large motor (and swap VAL1 and VAL2) + // BB = 01 unlock large motor (default) + // CC, DD, EE, FF = all FF -> unlock small motor + // + // default repsonse for analog pad with 2 motor : 0x00 0xF3 0x5A 0x00 0x01 0xFF 0xFF 0xFF 0xFF + // + CMD_VIBRATION_TOGGLE = 0x4D, + REQ40 = 0x40, + REQ41 = 0x41, + REQ49 = 0x49, + REQ4A = 0x4A, + REQ4B = 0x4B, + REQ4E = 0x4E, + REQ4F = 0x4F +}; + + + + +//NO MULTITAP + +void initBufForRequest(int padIndex, char value){ + switch (value){ + //Pad keystate already in buffer + //case CMD_READ_DATA_AND_VIBRATE : + // break; + case CMD_CONFIG_MODE : + if (pad[padIndex].configMode == 1) { + memcpy(buf, resp43, 8); + break; + } + //else, not in config mode, pad keystate return (already in the buffer) + break; + case CMD_SET_MODE_AND_LOCK : + memcpy(buf, resp44, 8); + break; + case CMD_QUERY_MODEL_AND_MODE : + memcpy(buf, resp45, 8); + break; + case CMD_QUERY_ACT : + memcpy(buf, resp46_00, 8); + break; + case CMD_QUERY_COMB : + memcpy(buf, resp47, 8); + break; + case CMD_QUERY_MODE : + memcpy(buf, resp4C_00, 8); + break; + case CMD_VIBRATION_TOGGLE : + memcpy(buf, resp4D, 8); + break; + case REQ40 : + memcpy(buf, resp40, 8); + break; + case REQ41 : + memcpy(buf, resp41, 8); + break; + case REQ49 : + memcpy(buf, resp49, 8); + break; + case REQ4A : + memcpy(buf, resp4A, 8); + break; + case REQ4B : + memcpy(buf, resp4B, 8); + break; + case REQ4E : + memcpy(buf, resp4E, 8); + break; + case REQ4F : + memcpy(buf, resp4F, 8); + break; + } +} + + + + +void reqIndex2Treatment(int padIndex, char value){ + switch (req){ + case CMD_CONFIG_MODE : + //0x43 + if (value == 0) { + pad[padIndex].configMode = 0; + } else { + pad[padIndex].configMode = 1; + } + break; + case CMD_SET_MODE_AND_LOCK : + //0x44 store the led state for change mode if the next value = 0x02 + //0x01 analog ON + //0x00 analog OFF + ledStateReq44[padIndex] = value; + break; + case CMD_QUERY_ACT : + //0x46 + if (value == 1) { + memcpy(buf, resp46_01, 8); + } + break; + case CMD_QUERY_MODE : + if (value == 1) { + memcpy(buf, resp4C_01, 8); + } + break; + case CMD_VIBRATION_TOGGLE : + //0x4D + memcpy(buf, resp4D, 8); + break; + case CMD_READ_DATA_AND_VIBRATE: + //mem the vibration value for small motor; + pad[padIndex].Vib[0] = value; + break; + } +} + +void vibrate(int padIndex){ + if (pad[padIndex].Vib[0] != pad[padIndex].VibF[0] || pad[padIndex].Vib[1] != pad[padIndex].VibF[1]) { + //value is different update Value and call libretro for vibration + pad[padIndex].VibF[0] = pad[padIndex].Vib[0]; + pad[padIndex].VibF[1] = pad[padIndex].Vib[1]; + plat_trigger_vibrate(padIndex, pad[padIndex].VibF[0], pad[padIndex].VibF[1]); + //printf("vibration pad %i", padIndex); + } +} + + + + +//Build response for 0x42 request Pad in port +void _PADstartPoll(PadDataS *pad) { + switch (pad->controllerType) { + case PSE_PAD_TYPE_MOUSE: + stdpar[0] = 0x12; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->moveX; + stdpar[5] = pad->moveY; + memcpy(buf, stdpar, 6); + respSize = 6; + break; + case PSE_PAD_TYPE_NEGCON: // npc101/npc104(slph00001/slph00069) + stdpar[0] = 0x23; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_ANALOGPAD: // scph1150 + stdpar[0] = 0x73; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_ANALOGJOY: // scph1110 + stdpar[0] = 0x53; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + stdpar[4] = pad->rightJoyX; + stdpar[5] = pad->rightJoyY; + stdpar[6] = pad->leftJoyX; + stdpar[7] = pad->leftJoyY; + memcpy(buf, stdpar, 8); + respSize = 8; + break; + case PSE_PAD_TYPE_STANDARD: + default: + stdpar[0] = 0x41; + stdpar[2] = pad->buttonStatus & 0xff; + stdpar[3] = pad->buttonStatus >> 8; + //avoid analog value in multitap mode if change pad type in game. + stdpar[4] = 0xff; + stdpar[5] = 0xff; + stdpar[6] = 0xff; + stdpar[7] = 0xff; + memcpy(buf, stdpar, 8); + respSize = 8; + } +} + + +//Build response for 0x42 request Multitap in port +//Response header for multitap : 0x80, 0x5A, (Pad information port 1-2A), (Pad information port 1-2B), (Pad information port 1-2C), (Pad information port 1-2D) +void _PADstartPollMultitap(PadDataS* padd) { + int i, offset; + for(i = 0; i < 4; i++) { + offset = 2 + (i * 8); + _PADstartPoll(&padd[i]); + memcpy(multitappar+offset, stdpar, 8); + } + memcpy(bufMulti, multitappar, 34); + respSize = 34; +} + + +unsigned char _PADpoll(int port, unsigned char value) { + if (reqPos == 0) { + //mem the request number + req = value; + //copy the default value of request response in buffer instead of the keystate + initBufForRequest(port, value); + } + + //if no new request the pad return 0xff, for signaling connected + if (reqPos >= respSize) return 0xff; + + switch(reqPos){ + case 2: + reqIndex2Treatment(port, value); + break; + case 3: + switch(req) { + case CMD_SET_MODE_AND_LOCK : + //change mode on pad + break; + case CMD_READ_DATA_AND_VIBRATE: + //mem the vibration value for Large motor; + pad[port].Vib[1] = value; + //vibration + vibrate(port); + break; + } + break; + } + return buf[reqPos++]; +} + + +unsigned char _PADpollMultitap(int port, unsigned char value) { + if (reqPos >= respSize) return 0xff; + return bufMulti[reqPos++]; +} + + +// refresh the button state on port 1. +// int pad is not needed. +unsigned char CALLBACK PAD1__startPoll(int pad) { + reqPos = 0; + // first call the pad provide if a multitap is connected between the psx and himself + if (multitap1 == -1) { + PadDataS padd; + padd.requestPadIndex = 0; + PAD1_readPort1(&padd); + multitap1 = padd.portMultitap; + } + // just one pad is on port 1 : NO MULTITAP + if (multitap1 == 0) { + PadDataS padd; + padd.requestPadIndex = 0; + PAD1_readPort1(&padd); + _PADstartPoll(&padd); + } else { + // a multitap is plugged : refresh all pad. + int i; + PadDataS padd[4]; + for(i = 0; i < 4; i++) { + padd[i].requestPadIndex = i; + PAD1_readPort1(&padd[i]); + } + _PADstartPollMultitap(padd); + } + //printf("\npad 1 : "); + return 0x00; +} + +unsigned char CALLBACK PAD1__poll(unsigned char value) { + char tmp; + if (multitap1 == 1) { + tmp = _PADpollMultitap(0, value); + } else { + tmp = _PADpoll(0, value); + } + //printf("%2x:%2x, ",value,tmp); + return tmp; + +} + + +long CALLBACK PAD1__configure(void) { return 0; } +void CALLBACK PAD1__about(void) {} +long CALLBACK PAD1__test(void) { return 0; } +long CALLBACK PAD1__query(void) { return 3; } +long CALLBACK PAD1__keypressed() { return 0; } + +#define LoadPad1Sym1(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, TRUE); + +#define LoadPad1SymN(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, FALSE); + +#define LoadPad1Sym0(dest, name) \ + LoadSym(PAD1_##dest, PAD##dest, name, FALSE); \ + if (PAD1_##dest == NULL) PAD1_##dest = (PAD##dest) PAD1__##dest; + +static int LoadPAD1plugin(const char *PAD1dll) { + void *drv; + + hPAD1Driver = SysLoadLibrary(PAD1dll); + if (hPAD1Driver == NULL) { + PAD1_configure = NULL; + SysMessage (_("Could not load Controller 1 plugin %s!"), PAD1dll); return -1; + } + drv = hPAD1Driver; + LoadPad1Sym1(init, "PADinit"); + LoadPad1Sym1(shutdown, "PADshutdown"); + LoadPad1Sym1(open, "PADopen"); + LoadPad1Sym1(close, "PADclose"); + LoadPad1Sym0(query, "PADquery"); + LoadPad1Sym1(readPort1, "PADreadPort1"); + LoadPad1Sym0(configure, "PADconfigure"); + LoadPad1Sym0(test, "PADtest"); + LoadPad1Sym0(about, "PADabout"); + LoadPad1Sym0(keypressed, "PADkeypressed"); + LoadPad1Sym0(startPoll, "PADstartPoll"); + LoadPad1Sym0(poll, "PADpoll"); + LoadPad1SymN(setSensitive, "PADsetSensitive"); + + return 0; +} + +unsigned char CALLBACK PAD2__startPoll(int pad) { + int pad_index; + + reqPos = 0; + if (multitap1 == 0 && (multitap2 == 0 || multitap2 == 2)) { + pad_index = 1; + } else if(multitap1 == 1 && (multitap2 == 0 || multitap2 == 2)) { + pad_index = 4; + } else { + pad_index = 0; + } + + //first call the pad provide if a multitap is connected between the psx and himself + if (multitap2 == -1) { + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd); + multitap2 = padd.portMultitap; + } + + // just one pad is on port 1 : NO MULTITAP + if (multitap2 == 0) { + PadDataS padd; + padd.requestPadIndex = pad_index; + PAD2_readPort2(&padd); + _PADstartPoll(&padd); + } else { + // a multitap is plugged : refresh all pad. + int i; + PadDataS padd[4]; + for(i = 0; i < 4; i++) { + padd[i].requestPadIndex = i+pad_index; + PAD2_readPort2(&padd[i]); + } + _PADstartPollMultitap(padd); + } + //printf("\npad 2 : "); + return 0x00; +} + +unsigned char CALLBACK PAD2__poll(unsigned char value) { + char tmp; + if (multitap2 == 2) { + tmp = _PADpollMultitap(1, value); + } else { + tmp = _PADpoll(1, value); + } + //printf("%2x:%2x, ",value,tmp); + return tmp; +} + +long CALLBACK PAD2__configure(void) { return 0; } +void CALLBACK PAD2__about(void) {} +long CALLBACK PAD2__test(void) { return 0; } +long CALLBACK PAD2__query(void) { return PSE_PAD_USE_PORT1 | PSE_PAD_USE_PORT2; } +long CALLBACK PAD2__keypressed() { return 0; } + +#define LoadPad2Sym1(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, TRUE); + +#define LoadPad2Sym0(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, FALSE); \ + if (PAD2_##dest == NULL) PAD2_##dest = (PAD##dest) PAD2__##dest; + +#define LoadPad2SymN(dest, name) \ + LoadSym(PAD2_##dest, PAD##dest, name, FALSE); + +static int LoadPAD2plugin(const char *PAD2dll) { + void *drv; + + hPAD2Driver = SysLoadLibrary(PAD2dll); + if (hPAD2Driver == NULL) { + PAD2_configure = NULL; + SysMessage (_("Could not load Controller 2 plugin %s!"), PAD2dll); return -1; + } + drv = hPAD2Driver; + LoadPad2Sym1(init, "PADinit"); + LoadPad2Sym1(shutdown, "PADshutdown"); + LoadPad2Sym1(open, "PADopen"); + LoadPad2Sym1(close, "PADclose"); + LoadPad2Sym0(query, "PADquery"); + LoadPad2Sym1(readPort2, "PADreadPort2"); + LoadPad2Sym0(configure, "PADconfigure"); + LoadPad2Sym0(test, "PADtest"); + LoadPad2Sym0(about, "PADabout"); + LoadPad2Sym0(keypressed, "PADkeypressed"); + LoadPad2Sym0(startPoll, "PADstartPoll"); + LoadPad2Sym0(poll, "PADpoll"); + LoadPad2SymN(setSensitive, "PADsetSensitive"); + + return 0; +} + +void *hNETDriver = NULL; + +void CALLBACK NET__setInfo(netInfo *info) {} +void CALLBACK NET__keypressed(int key) {} +long CALLBACK NET__configure(void) { return 0; } +long CALLBACK NET__test(void) { return 0; } +void CALLBACK NET__about(void) {} + +#define LoadNetSym1(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, TRUE); + +#define LoadNetSymN(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, FALSE); + +#define LoadNetSym0(dest, name) \ + LoadSym(NET_##dest, NET##dest, name, FALSE); \ + if (NET_##dest == NULL) NET_##dest = (NET##dest) NET__##dest; + +static int LoadNETplugin(const char *NETdll) { + void *drv; + + hNETDriver = SysLoadLibrary(NETdll); + if (hNETDriver == NULL) { + SysMessage (_("Could not load NetPlay plugin %s!"), NETdll); return -1; + } + drv = hNETDriver; + LoadNetSym1(init, "NETinit"); + LoadNetSym1(shutdown, "NETshutdown"); + LoadNetSym1(open, "NETopen"); + LoadNetSym1(close, "NETclose"); + LoadNetSymN(sendData, "NETsendData"); + LoadNetSymN(recvData, "NETrecvData"); + LoadNetSym1(sendPadData, "NETsendPadData"); + LoadNetSym1(recvPadData, "NETrecvPadData"); + LoadNetSym1(queryPlayer, "NETqueryPlayer"); + LoadNetSym1(pause, "NETpause"); + LoadNetSym1(resume, "NETresume"); + LoadNetSym0(setInfo, "NETsetInfo"); + LoadNetSym0(keypressed, "NETkeypressed"); + LoadNetSym0(configure, "NETconfigure"); + LoadNetSym0(test, "NETtest"); + LoadNetSym0(about, "NETabout"); + + return 0; +} + +#ifdef ENABLE_SIO1API + +void *hSIO1Driver = NULL; + +long CALLBACK SIO1__init(void) { return 0; } +long CALLBACK SIO1__shutdown(void) { return 0; } +long CALLBACK SIO1__open(void) { return 0; } +long CALLBACK SIO1__close(void) { return 0; } +long CALLBACK SIO1__configure(void) { return 0; } +long CALLBACK SIO1__test(void) { return 0; } +void CALLBACK SIO1__about(void) {} +void CALLBACK SIO1__pause(void) {} +void CALLBACK SIO1__resume(void) {} +long CALLBACK SIO1__keypressed(int key) { return 0; } +void CALLBACK SIO1__writeData8(unsigned char val) {} +void CALLBACK SIO1__writeData16(unsigned short val) {} +void CALLBACK SIO1__writeData32(unsigned long val) {} +void CALLBACK SIO1__writeStat16(unsigned short val) {} +void CALLBACK SIO1__writeStat32(unsigned long val) {} +void CALLBACK SIO1__writeMode16(unsigned short val) {} +void CALLBACK SIO1__writeMode32(unsigned long val) {} +void CALLBACK SIO1__writeCtrl16(unsigned short val) {} +void CALLBACK SIO1__writeCtrl32(unsigned long val) {} +void CALLBACK SIO1__writeBaud16(unsigned short val) {} +void CALLBACK SIO1__writeBaud32(unsigned long val) {} +unsigned char CALLBACK SIO1__readData8(void) { return 0; } +unsigned short CALLBACK SIO1__readData16(void) { return 0; } +unsigned long CALLBACK SIO1__readData32(void) { return 0; } +unsigned short CALLBACK SIO1__readStat16(void) { return 0; } +unsigned long CALLBACK SIO1__readStat32(void) { return 0; } +unsigned short CALLBACK SIO1__readMode16(void) { return 0; } +unsigned long CALLBACK SIO1__readMode32(void) { return 0; } +unsigned short CALLBACK SIO1__readCtrl16(void) { return 0; } +unsigned long CALLBACK SIO1__readCtrl32(void) { return 0; } +unsigned short CALLBACK SIO1__readBaud16(void) { return 0; } +unsigned long CALLBACK SIO1__readBaud32(void) { return 0; } +void CALLBACK SIO1__registerCallback(void (CALLBACK *callback)(void)) {}; + +void CALLBACK SIO1irq(void) { + psxHu32ref(0x1070) |= SWAPu32(0x100); +} + +#define LoadSio1Sym1(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, TRUE); + +#define LoadSio1SymN(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); + +#define LoadSio1Sym0(dest, name) \ + LoadSym(SIO1_##dest, SIO1##dest, name, FALSE); \ + if (SIO1_##dest == NULL) SIO1_##dest = (SIO1##dest) SIO1__##dest; + +static int LoadSIO1plugin(const char *SIO1dll) { + void *drv; + + hSIO1Driver = SysLoadLibrary(SIO1dll); + if (hSIO1Driver == NULL) { + SysMessage (_("Could not load SIO1 plugin %s!"), SIO1dll); return -1; + } + drv = hSIO1Driver; + + LoadSio1Sym0(init, "SIO1init"); + LoadSio1Sym0(shutdown, "SIO1shutdown"); + LoadSio1Sym0(open, "SIO1open"); + LoadSio1Sym0(close, "SIO1close"); + LoadSio1Sym0(pause, "SIO1pause"); + LoadSio1Sym0(resume, "SIO1resume"); + LoadSio1Sym0(keypressed, "SIO1keypressed"); + LoadSio1Sym0(configure, "SIO1configure"); + LoadSio1Sym0(test, "SIO1test"); + LoadSio1Sym0(about, "SIO1about"); + LoadSio1Sym0(writeData8, "SIO1writeData8"); + LoadSio1Sym0(writeData16, "SIO1writeData16"); + LoadSio1Sym0(writeData32, "SIO1writeData32"); + LoadSio1Sym0(writeStat16, "SIO1writeStat16"); + LoadSio1Sym0(writeStat32, "SIO1writeStat32"); + LoadSio1Sym0(writeMode16, "SIO1writeMode16"); + LoadSio1Sym0(writeMode32, "SIO1writeMode32"); + LoadSio1Sym0(writeCtrl16, "SIO1writeCtrl16"); + LoadSio1Sym0(writeCtrl32, "SIO1writeCtrl32"); + LoadSio1Sym0(writeBaud16, "SIO1writeBaud16"); + LoadSio1Sym0(writeBaud32, "SIO1writeBaud32"); + LoadSio1Sym0(readData16, "SIO1readData16"); + LoadSio1Sym0(readData32, "SIO1readData32"); + LoadSio1Sym0(readStat16, "SIO1readStat16"); + LoadSio1Sym0(readStat32, "SIO1readStat32"); + LoadSio1Sym0(readMode16, "SIO1readMode16"); + LoadSio1Sym0(readMode32, "SIO1readMode32"); + LoadSio1Sym0(readCtrl16, "SIO1readCtrl16"); + LoadSio1Sym0(readCtrl32, "SIO1readCtrl32"); + LoadSio1Sym0(readBaud16, "SIO1readBaud16"); + LoadSio1Sym0(readBaud32, "SIO1readBaud32"); + LoadSio1Sym0(registerCallback, "SIO1registerCallback"); + + return 0; +} + +#endif + +void CALLBACK clearDynarec(void) { + psxCpu->Reset(); +} + +int LoadPlugins() { + int ret; + char Plugin[MAXPATHLEN]; + + ReleasePlugins(); + SysLibError(); + + if (UsingIso()) { + LoadCDRplugin(NULL); + } else { + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr); + if (LoadCDRplugin(Plugin) == -1) return -1; + } + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Gpu); + if (LoadGPUplugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Spu); + if (LoadSPUplugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad1); + if (LoadPAD1plugin(Plugin) == -1) return -1; + + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Pad2); + if (LoadPAD2plugin(Plugin) == -1) return -1; + + if (strcmp("Disabled", Config.Net) == 0 || strcmp("", Config.Net) == 0) + Config.UseNet = FALSE; + else { + Config.UseNet = TRUE; + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Net); + if (LoadNETplugin(Plugin) == -1) Config.UseNet = FALSE; + } + +#ifdef ENABLE_SIO1API + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Sio1); + if (LoadSIO1plugin(Plugin) == -1) return -1; +#endif + + ret = CDR_init(); + if (ret < 0) { SysMessage (_("Error initializing CD-ROM plugin: %d"), ret); return -1; } + ret = GPU_init(); + if (ret < 0) { SysMessage (_("Error initializing GPU plugin: %d"), ret); return -1; } + ret = SPU_init(); + if (ret < 0) { SysMessage (_("Error initializing SPU plugin: %d"), ret); return -1; } + ret = PAD1_init(1); + if (ret < 0) { SysMessage (_("Error initializing Controller 1 plugin: %d"), ret); return -1; } + ret = PAD2_init(2); + if (ret < 0) { SysMessage (_("Error initializing Controller 2 plugin: %d"), ret); return -1; } + + if (Config.UseNet) { + ret = NET_init(); + if (ret < 0) { SysMessage (_("Error initializing NetPlay plugin: %d"), ret); return -1; } + } + +#ifdef ENABLE_SIO1API + ret = SIO1_init(); + if (ret < 0) { SysMessage (_("Error initializing SIO1 plugin: %d"), ret); return -1; } +#endif + + SysPrintf(_("Plugins loaded.\n")); + return 0; +} + +void ReleasePlugins() { + if (Config.UseNet) { + int ret = NET_close(); + if (ret < 0) Config.UseNet = FALSE; + } + NetOpened = FALSE; + + if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown(); + if (hGPUDriver != NULL) GPU_shutdown(); + if (hSPUDriver != NULL) SPU_shutdown(); + if (hPAD1Driver != NULL) PAD1_shutdown(); + if (hPAD2Driver != NULL) PAD2_shutdown(); + + if (Config.UseNet && hNETDriver != NULL) NET_shutdown(); + + if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL; + if (hGPUDriver != NULL) SysCloseLibrary(hGPUDriver); hGPUDriver = NULL; + if (hSPUDriver != NULL) SysCloseLibrary(hSPUDriver); hSPUDriver = NULL; + if (hPAD1Driver != NULL) SysCloseLibrary(hPAD1Driver); hPAD1Driver = NULL; + if (hPAD2Driver != NULL) SysCloseLibrary(hPAD2Driver); hPAD2Driver = NULL; + + if (Config.UseNet && hNETDriver != NULL) { + SysCloseLibrary(hNETDriver); hNETDriver = NULL; + } + +#ifdef ENABLE_SIO1API + if (hSIO1Driver != NULL) { + SIO1_shutdown(); + SysCloseLibrary(hSIO1Driver); + hSIO1Driver = NULL; + } +#endif +} + +// for CD swap +int ReloadCdromPlugin() +{ + if (hCDRDriver != NULL || cdrIsoActive()) CDR_shutdown(); + if (hCDRDriver != NULL) SysCloseLibrary(hCDRDriver); hCDRDriver = NULL; + + if (UsingIso()) { + LoadCDRplugin(NULL); + } else { + char Plugin[MAXPATHLEN]; + sprintf(Plugin, "%s/%s", Config.PluginsDir, Config.Cdr); + if (LoadCDRplugin(Plugin) == -1) return -1; + } + + return CDR_init(); +} + +void SetIsoFile(const char *filename) { + if (filename == NULL) { + IsoFile[0] = '\0'; + return; + } + strncpy(IsoFile, filename, MAXPATHLEN); +} + +const char *GetIsoFile(void) { + return IsoFile; +} + +boolean UsingIso(void) { + return (IsoFile[0] != '\0'); +} + +void SetCdOpenCaseTime(s64 time) { + cdOpenCaseTime = time; +} diff --git a/libpcsxcore/psxbios.c b/libpcsxcore/psxbios.c index 292d80d..d5ed725 100644 --- a/libpcsxcore/psxbios.c +++ b/libpcsxcore/psxbios.c @@ -2216,6 +2216,15 @@ void psxBios_ChangeClearPad() { // 5b pc0 = ra; } +void psxBios__card_status() { // 5c +#ifdef PSXBIOS_LOG + PSXBIOS_LOG("psxBios_%s: %x\n", biosB0n[0x5c], a0); +#endif + + v0 = 1; + pc0 = ra; +} + /* System calls C0 */ /* @@ -2569,7 +2578,7 @@ void psxBiosInit() { //biosB0[0x59] = psxBios_sys_b0_59; //biosB0[0x5a] = psxBios_sys_b0_5a; biosB0[0x5b] = psxBios_ChangeClearPad; - //biosB0[0x5c] = psxBios__card_status; + biosB0[0x5c] = psxBios__card_status; //biosB0[0x5d] = psxBios__card_wait; //*******************C0 CALLS**************************** //biosC0[0x00] = psxBios_InitRCnt; diff --git a/libpcsxcore/r3000a.c b/libpcsxcore/r3000a.c index 82eb885..22341c5 100644 --- a/libpcsxcore/r3000a.c +++ b/libpcsxcore/r3000a.c @@ -50,7 +50,7 @@ int psxInit() { void psxReset() { psxMemReset(); - memset(&psxRegs, 0, sizeof(psxRegs)); + memset(&psxRegs, 0x00, sizeof(psxRegs)); psxRegs.pc = 0xbfc00000; // Start in bootstrap diff --git a/libpcsxcore/sio.c b/libpcsxcore/sio.c index b3732d2..d251fa7 100644 --- a/libpcsxcore/sio.c +++ b/libpcsxcore/sio.c @@ -117,6 +117,20 @@ void sioWrite8(unsigned char value) { break; } } + // NegCon - Wipeout 3 + if( buf[parp] == 0x23 ) { + switch (value) { + // enter config mode + case 0x43: + buf[1] = 0x79; + break; + + // get status + case 0x45: + buf[1] = 0xf3; + break; + } + } } else padst = 0; return; diff --git a/libpcsxcore/socket.c b/libpcsxcore/socket.c index 31f82e2..c408bc3 100644 --- a/libpcsxcore/socket.c +++ b/libpcsxcore/socket.c @@ -15,6 +15,22 @@ * along with this program; if not, see <http://www.gnu.org/licenses>. */ +#ifdef NO_SOCKET + +int StartServer() { return 0;} +void StopServer() {} +void GetClient() {} +void CloseClient() {} +int HasClient() { return 0;} +int ReadSocket(char * buffer, int len) { return 0;} +int RawReadSocket(char * buffer, int len) { return 0;} +void WriteSocket(char * buffer, int len) {} + +void SetsBlock() {} +void SetsNonblock() {} + +#else // NO_SOCKET + #ifdef _WIN32 #include <winsock2.h> #endif @@ -252,3 +268,4 @@ void SetsNonblock() { fcntl(server_socket, F_SETFL, flags | O_NONBLOCK); #endif } +#endif // NO_SOCKET diff --git a/maemo/hildon.c b/maemo/hildon.c deleted file mode 100644 index 7e9cd9f..0000000 --- a/maemo/hildon.c +++ /dev/null @@ -1,843 +0,0 @@ -#include <gtk/gtk.h> -#include <glib.h> -#include <stdlib.h> -#include <stdint.h> -#include <unistd.h> -#include <hildon/hildon.h> -#include <string.h> -#include <pthread.h> - -#include "../frontend/plugin_lib.h" -#include "../frontend/main.h" -#include "../libpcsxcore/misc.h" -#include "../include/psemu_plugin_defs.h" -#include "../libpcsxcore/cdrom.h" -#include "../libpcsxcore/cdriso.h" -#include "../plugins/dfinput/main.h" -#include "../frontend/libpicofe/readpng.h" -#include "maemo_common.h" -#include <libosso.h> -#include <dbus/dbus.h> - -#define X_RES 800 -#define Y_RES 480 -#define D_WIDTH 640 -#define D_HEIGHT 480 - -#define CALL_SIGNAL_IF "com.nokia.csd.Call" -#define CALL_SIGNAL_PATH "/com/nokia/csd/call" -#define CALL_INCOMING_SIG "Coming" - -#define DBUS_RULE_CALL_INCOMING "type='signal',interface='" CALL_SIGNAL_IF \ - "',path='" CALL_SIGNAL_PATH \ - "',member='" CALL_INCOMING_SIG "'" - -osso_context_t* osso = NULL; -int bRunning = TRUE; -extern int bKeepDisplayOn; -extern int bAutosaveOnExit; -extern int cornerActions[4]; -extern char keys_config_file[MAXPATHLEN]; -static pthread_t display_thread = (pthread_t)0; -int g_layer_x = (X_RES - D_WIDTH) / 2; -int g_layer_y = (Y_RES - D_HEIGHT) / 2; -int g_layer_w = D_WIDTH, g_layer_h = D_HEIGHT; - -static GdkImage *image; -static HildonAnimationActor *actor; -static GtkWidget *window, *drawing = NULL; - -static int pl_buf_w, pl_buf_h; -int keymap[65536]; -int direction_keys[4]; - -// map psx4m compatible keymap to PSX keys -static const unsigned char keymap2[14] = { - DKEY_LEFT, // 0 - DKEY_RIGHT, - DKEY_UP, - DKEY_DOWN, - DKEY_CIRCLE, - DKEY_CROSS, // 5 - DKEY_TRIANGLE, - DKEY_SQUARE, - DKEY_SELECT, - DKEY_START, - DKEY_L1, // 10 - DKEY_R1, - DKEY_L2, - DKEY_R2, -}; - -void hildon_quit() -{ - maemo_finish(); - gtk_main_quit(); - exit(0); -} - -gdouble press_x = -1; -gdouble press_y = -1; - -int maemo_x11_update_keys(); -void show_notification(char* text); - -void change_slot(int delta) -{ - state_slot += delta; - if (state_slot > 9) - state_slot = 0; - else if (state_slot < 0) - state_slot = 9; - char message[50]; - sprintf(message,"Savestate slot: %i",state_slot + 1); - show_notification(message); -} - -void save(int state_slot) -{ - emu_save_state(state_slot); - char buf[MAXPATHLEN]; - if (image && image->mem){ - sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,state_slot); - writepng(buf, image->mem, pl_buf_w,pl_buf_h); - } - char message[50]; - sprintf(message,"Saved savestate slot: %i",state_slot + 1); - show_notification(message); -} - -void quit() -{ - if (bAutosaveOnExit){ - show_notification("Autosaving"); - emu_save_state(99); - char buf[MAXPATHLEN]; - if (image && image->mem){ - sprintf (buf,"/opt/maemo/usr/games/screenshots%s.%3.3d",file_name,99); - writepng(buf, image->mem, pl_buf_w,pl_buf_h); - } - } - hildon_quit(); -} - -int show_confirmbox(char* text) -{ - if (!window) - return TRUE; - - GtkWidget *dialog; - dialog = gtk_message_dialog_new (GTK_WINDOW(window), - GTK_DIALOG_DESTROY_WITH_PARENT, - GTK_MESSAGE_QUESTION, - GTK_BUTTONS_YES_NO, - text); - gint result = gtk_dialog_run (GTK_DIALOG (dialog)); - gtk_widget_destroy (dialog); - if (result == GTK_RESPONSE_YES) - return TRUE; - return FALSE; -} - -static void -window_button_proxy(GtkWidget *widget, - GdkEventButton *event, - gpointer user_data) -{ - int corner = -1; - int sens = 100; - - switch (event->type){ - case GDK_BUTTON_PRESS: - //printf("GDK_BUTTON_PRESS: x=%f y=%f\n", event->x, event->y); - press_x = event->x; - press_y = event->y; - break; - case GDK_BUTTON_RELEASE: - //printf("GDK_BUTTON_RELEASE: x=%f y=%f\n", event->x, event->y); - if (press_x < sens && press_y < sens && event->x < sens && event->y < sens) - corner = 0; - else if (press_x > 800 - sens && press_y < sens && event->x > 800 - sens && event->y < sens) - corner = 1; - else if (press_x > 800 - sens && press_y > 480 - sens && event->x > 800 - sens && event->y > 480 - sens) - corner = 2; - else if (press_x < sens && press_y > 480 - sens && event->x < sens && event->y > 480 - sens) - corner = 3; - - press_x = -1; - press_y = -1; - break; - default: - break; - } - - if (corner >= 0){ - switch (cornerActions[corner]){ - case 1: - if (show_confirmbox("Save savestate?")) - save(state_slot); - break; - case 2: - if (show_confirmbox("Load savestate?")) - emu_load_state(state_slot); - break; - case 3: - change_slot(1); - break; - case 4: - change_slot(-1); - break; - case 5: - if (show_confirmbox("Quit?")) - quit(); - break; - } - } -} - -static void *displayThread(void *arg) -{ - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - DBusMessage* msg = dbus_message_new_method_call("com.nokia.mce", - "/com/nokia/mce/request", - "com.nokia.mce.request", - "req_display_blanking_pause"); - if (msg && system_bus) { - bRunning = TRUE; - while (bRunning) { - dbus_connection_send(system_bus, msg, NULL); - dbus_connection_flush(system_bus); - int i = 0; - for (i=0; i<8; i++){ - usleep(500000); - if (!bRunning) - break; - } - } - dbus_message_unref(msg); - } - - pthread_exit(0); - return NULL; -} - -void show_notification(char* text) -{ - if (window){ - GtkWidget* banner = hildon_banner_show_information(GTK_WIDGET(window), NULL, text); - hildon_banner_set_timeout(HILDON_BANNER(banner), 3000); - }else{ - DBusConnection* session_bus = (DBusConnection*)osso_get_dbus_connection(osso); - DBusMessageIter args; - DBusMessage*msg = dbus_message_new_method_call("org.freedesktop.Notifications", - "/org/freedesktop/Notifications", - "org.freedesktop.Notifications", - "SystemNoteInfoprint"); - if (msg) { - dbus_message_iter_init_append(msg, &args); - char* param = text; - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_STRING, ¶m)) { - dbus_connection_send(session_bus, msg, NULL); - dbus_connection_flush(session_bus); - } - dbus_message_unref(msg); - } - } -} - -void show_messagebox(char* text) -{ - if (!window) - return; - - GtkWidget *dialog; - dialog = gtk_message_dialog_new (GTK_WINDOW(window), - GTK_DIALOG_DESTROY_WITH_PARENT, - GTK_MESSAGE_INFO, - GTK_BUTTONS_OK, - text); - gtk_dialog_run (GTK_DIALOG (dialog)); - gtk_widget_destroy (dialog); -} - -#include <hildon/hildon-file-chooser-dialog.h> -void change_disc() -{ - GtkWidget *dialog; - dialog = hildon_file_chooser_dialog_new (GTK_WINDOW(window), GTK_FILE_CHOOSER_ACTION_OPEN); - gtk_window_set_title (GTK_WINDOW (dialog), "Change disc"); - - char currentFile[MAXPATHLEN]; - strcpy(currentFile, GetIsoFile()); - if (strlen(currentFile)) - gtk_file_chooser_set_filename (GTK_FILE_CHOOSER(dialog), currentFile); - else - gtk_file_chooser_set_current_folder (GTK_FILE_CHOOSER(dialog), "/home/user/MyDocs/"); - - GtkFileFilter *filter=gtk_file_filter_new(); - gtk_file_filter_add_pattern (filter,"*.bin"); - gtk_file_filter_add_pattern (filter,"*.BIN"); - gtk_file_filter_add_pattern (filter,"*.iso"); - gtk_file_filter_add_pattern (filter,"*.ISO"); - gtk_file_filter_add_pattern (filter,"*.img"); - gtk_file_filter_add_pattern (filter,"*.IMG"); - gtk_file_filter_add_pattern (filter,"*.z"); - gtk_file_filter_add_pattern (filter,"*.Z"); - gtk_file_filter_add_pattern (filter,"*.znx"); - gtk_file_filter_add_pattern (filter,"*.ZNX"); - gtk_file_filter_add_pattern (filter,"*.pbp"); - gtk_file_filter_add_pattern (filter,"*.PBP"); - gtk_file_filter_add_pattern (filter,"*.mdf"); - gtk_file_filter_add_pattern (filter,"*.MDF"); - gtk_file_chooser_set_filter (GTK_FILE_CHOOSER (dialog),filter); - - if (gtk_dialog_run (GTK_DIALOG (dialog)) == GTK_RESPONSE_OK) { - char *filename = gtk_file_chooser_get_filename (GTK_FILE_CHOOSER (dialog)); - - //if (strcmp(filename, currentFile)) { - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - set_cd_image(filename); - if (ReloadCdromPlugin() < 0) - printf("Failed to load cdr plugin\n"); - - if (CDR_open() < 0) - printf("Failed to open cdr plugin\n"); - - strcpy(file_name, strrchr(filename,'/')); - - SetCdOpenCaseTime(time(NULL) + 3); - LidInterrupt(); - //} - g_free (filename); - } - - gtk_widget_destroy (dialog); -} - -void change_multi_disc() -{ - HildonDialog* window = HILDON_DIALOG(hildon_dialog_new()); - gtk_window_set_title (GTK_WINDOW (window), "Change disc"); - gtk_window_set_default_size(GTK_WINDOW (window), 480, 300); - - GtkWidget* sw = hildon_pannable_area_new (); - gtk_box_pack_start (GTK_BOX(GTK_DIALOG(window)->vbox), sw, TRUE, TRUE, 0); - - GtkWidget* tree_view = hildon_gtk_tree_view_new (HILDON_UI_MODE_EDIT); - gtk_widget_set_name (tree_view, "fremantle-widget"); - - gtk_tree_view_set_rules_hint (GTK_TREE_VIEW (tree_view), TRUE); - - int i; - GtkListStore *store = gtk_list_store_new (1, G_TYPE_STRING); - for (i = 0; i < cdrIsoMultidiskCount; i++) { - gchar *str; - - str = g_strdup_printf ("Disc %d", i+1); - gtk_list_store_insert_with_values (store, NULL, i, 0, str, -1); - g_free (str); - } - GtkTreeModel* model = GTK_TREE_MODEL (store); - - gtk_tree_view_set_model (GTK_TREE_VIEW (tree_view), model); - g_object_unref (model); - - GtkTreeSelection* selection = gtk_tree_view_get_selection (GTK_TREE_VIEW (tree_view)); - gtk_tree_selection_set_mode (selection, GTK_SELECTION_SINGLE); - - GtkCellRenderer* renderer = gtk_cell_renderer_text_new (); - g_object_set (renderer, - "xalign", 0.5, - "weight", PANGO_WEIGHT_NORMAL, - NULL); - - gtk_tree_view_insert_column_with_attributes (GTK_TREE_VIEW (tree_view), - 0, "Column 0", - renderer, - "text", 0, - NULL); - - char current[5]; - sprintf(current, "%i", cdrIsoMultidiskSelect); - GtkTreePath* path = gtk_tree_path_new_from_string(current); - gtk_tree_selection_select_path (selection, path); - gtk_tree_path_free(path); - - gtk_widget_set_size_request (tree_view, 480, 800); - gtk_container_add (GTK_CONTAINER (sw), tree_view); - - hildon_dialog_add_button (HILDON_DIALOG(window), GTK_STOCK_OK, GTK_RESPONSE_ACCEPT); - - gtk_widget_show_all (GTK_WIDGET(window)); - gint result = gtk_dialog_run (GTK_DIALOG (window)); - if (result == GTK_RESPONSE_ACCEPT) { - GtkTreeModel* model; - GtkTreeIter iter; - GtkTreeSelection* selection = gtk_tree_view_get_selection(GTK_TREE_VIEW(tree_view)); - if (gtk_tree_selection_get_selected(selection, &model, &iter)){ - GtkTreePath* path = gtk_tree_model_get_path(model , &iter); - int* i = gtk_tree_path_get_indices(path) ; - - cdrIsoMultidiskSelect = *i; - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - CDR_close(); - if (CDR_open() < 0) { - printf("Failed to load cdr plugin\n"); - return; - } - - SetCdOpenCaseTime(time(NULL) + 3); - LidInterrupt(); - } - } - gtk_widget_destroy(GTK_WIDGET(window)); -} - -static DBusHandlerResult on_msg_recieved(DBusConnection* connection G_GNUC_UNUSED, DBusMessage* message, void* data) -{ - const char* path = dbus_message_get_path(message); - if (path && g_str_equal(path, CALL_SIGNAL_PATH)){ - const char* mbr = dbus_message_get_member(message); - if (mbr && g_str_equal(mbr, CALL_INCOMING_SIG)) - show_messagebox("Paused"); - } - - return DBUS_HANDLER_RESULT_NOT_YET_HANDLED; -} - -static void -window_key_proxy(GtkWidget *widget, - GdkEventKey *event, - gpointer user_data) -{ - key_press_event(event->hardware_keycode, event->type == GDK_KEY_PRESS ? 1 : (event->type == GDK_KEY_RELEASE ? 2 : 0) ); -} - -int last_key_pressed = 0; -inline void key_press_event(int key2,int type) -{ - int psxkey1 = -1, psxkey2 = -1; - int key=keymap[key2]; - - if (key < 0) - return; - - if (type == 1 && key2 == last_key_pressed) - return; - last_key_pressed = type == 1 ? key2 : 0; - - //printf("Key: %i %s\n", key2, type == 1 ? "Pressed" : (type == 2 ? "Released" : "Unknown")); - if (key < ARRAY_SIZE(keymap2)){ - psxkey1 = keymap2[key]; - }else switch (key) { - case 14: - quit(); - break; - case 15: - psxkey1 = DKEY_UP; - psxkey2 = DKEY_LEFT; - break; - case 16: - psxkey1 = DKEY_UP; - psxkey2 = DKEY_RIGHT; - break; - case 17: - psxkey1 = DKEY_DOWN; - psxkey2 = DKEY_LEFT; - break; - case 18: - psxkey1 = DKEY_DOWN; - psxkey2 = DKEY_RIGHT; - break; - case 19: - if (type == 1) - save(state_slot); - return; - case 20: - if (type == 1) - emu_load_state(state_slot); - return; - case 21: - if (type == 1) - change_slot(1); - return; - case 22: - if (type == 1) - change_slot(-1); - return; - case 23: - if (type == 1){ - if (cdrIsoMultidiskCount > 1) - change_multi_disc(); - else - change_disc(); - } - return; - } - - if (in_type1 == PSE_PAD_TYPE_GUNCON){ - if (type == 1) { - switch (psxkey1){ - case DKEY_CROSS: - in_state_gun |= SACTION_GUN_A; - break; - case DKEY_CIRCLE: - in_state_gun |= SACTION_GUN_B; - break; - case DKEY_TRIANGLE: - in_state_gun |= SACTION_GUN_TRIGGER2; - break; - case DKEY_SQUARE: - in_state_gun |= SACTION_GUN_TRIGGER; - break; - } - }else if (type == 2) { - switch (psxkey1){ - case DKEY_CROSS: - in_state_gun &= ~SACTION_GUN_A; - break; - case DKEY_CIRCLE: - in_state_gun &= ~SACTION_GUN_B; - break; - case DKEY_TRIANGLE: - in_state_gun &= ~SACTION_GUN_TRIGGER2; - break; - case DKEY_SQUARE: - in_state_gun &= ~SACTION_GUN_TRIGGER; - break; - } - } - }else{ - if (type == 1) { - if (psxkey1 >= 0) - in_keystate |= 1 << psxkey1; - if (psxkey2 >= 0) - in_keystate |= 1 << psxkey2; - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - switch(psxkey1){ - case DKEY_LEFT: - in_a1[0] = 0; - break; - case DKEY_RIGHT: - in_a1[0] = 255; - break; - case DKEY_UP: - in_a1[1] = 0; - break; - case DKEY_DOWN: - in_a1[1] = 255; - break; - } - } - } - else if (type == 2) { - if (psxkey1 >= 0) - in_keystate &= ~(1 << psxkey1); - if (psxkey2 >= 0) - in_keystate &= ~(1 << psxkey2); - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - switch(psxkey1){ - case DKEY_LEFT: - case DKEY_RIGHT: - in_a1[0] = 127; - break; - case DKEY_UP: - case DKEY_DOWN: - in_a1[1] = 127; - break; - } - } - emu_set_action(SACTION_NONE); - } - } -} - -void plat_finish() -{ - hildon_quit(); -} - -void set_accel_multipliers() -{ - accelOptions.xMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0); - accelOptions.yMultiplier = 255.0 / ( (accelOptions.maxValue - accelOptions.sens) * 2.0); -} - -#include <gdk/gdkx.h> -int maemo_init(int *argc, char ***argv) -{ - osso = osso_initialize("pcsxrearmed", PACKAGE_VERSION, FALSE, NULL); - - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - dbus_bus_add_match(system_bus, DBUS_RULE_CALL_INCOMING, NULL); - dbus_connection_add_filter(system_bus, on_msg_recieved, NULL, NULL); - - FILE* pFile; - pFile = fopen(keys_config_file, "r"); - if (pFile == NULL){ - fprintf(stderr, "Error opening keys config file %s\n", keys_config_file); - return 1; - } - printf("Keys config read from %s\n", keys_config_file); - - int ch; - int i=0; - for (i=0;i<65536;i++) - keymap[i]=-1; - if (NULL != pFile) { - for(i=0;i<24;i++){ - fscanf(pFile, "%i",&ch); - keymap[ch]=i; - if (i < 4) - direction_keys[i] = ch; - } - fclose(pFile); - } - - switch (in_type1){ - case PSE_PAD_TYPE_GUNCON: - memset(cornerActions, 0, sizeof(cornerActions)); - printf("Controller set to GUNCON (SLPH-00034)\n"); - break; - case PSE_PAD_TYPE_STANDARD: - printf("Controller set to standard (SCPH-1080)\n"); - break; - case PSE_PAD_TYPE_ANALOGPAD: - printf("Controller set to analog (SCPH-1150)\n"); - break; - } - - if (in_enable_vibration) - printf("Vibration enabled\n"); - - if (!(g_maemo_opts&8)){ - gtk_init (argc, argv); - - window = hildon_stackable_window_new (); - gtk_widget_realize (window); - gtk_window_fullscreen (GTK_WINDOW(window)); - - if (cornerActions[0] + cornerActions[1] + cornerActions[2] + cornerActions[3] > 0){ - g_signal_connect (G_OBJECT (window), "button_release_event", - G_CALLBACK (window_button_proxy), NULL); - g_signal_connect (G_OBJECT (window), "button_press_event", - G_CALLBACK (window_button_proxy), NULL); - } - - g_signal_connect (G_OBJECT (window), "key-press-event", - G_CALLBACK (window_key_proxy), NULL); - g_signal_connect (G_OBJECT (window), "key-release-event", - G_CALLBACK (window_key_proxy), NULL); - g_signal_connect (G_OBJECT (window), "delete_event", - G_CALLBACK (hildon_quit), NULL); - gtk_widget_add_events (window, - GDK_BUTTON_PRESS_MASK | GDK_BUTTON_RELEASE_MASK); - - actor = HILDON_ANIMATION_ACTOR (hildon_animation_actor_new()); - if (g_maemo_opts & 2) - hildon_animation_actor_set_position (actor, 0, 0 ); - else - hildon_animation_actor_set_position (actor, (X_RES - D_WIDTH)/2, (Y_RES - D_HEIGHT)/2 ); - hildon_animation_actor_set_parent (actor, GTK_WINDOW (window)); - - drawing = gtk_image_new (); - - gtk_container_add (GTK_CONTAINER (actor), drawing); - - gtk_widget_show_all (GTK_WIDGET (actor)); - gtk_widget_show_all (GTK_WIDGET (window)); - }else{ - gtk_init (argc, argv); - /*GdkScreen* scr = gdk_screen_get_default(); - window = GTK_WIDGET(gdk_screen_get_root_window(scr)); - if (!window) - window = GTK_WIDGET(gdk_get_default_root_window());*/ - } - - set_accel_multipliers(); - - if (bKeepDisplayOn){ - if (pthread_create(&display_thread, NULL, displayThread, NULL)) - printf("Failed to create display thread.\n"); - } - - pl_rearmed_cbs.only_16bpp = 1; - return 0; -} - -void maemo_finish() -{ - if (display_thread > 0){ - bRunning = FALSE; - pthread_join(display_thread, NULL); - } - - if (osso){ - osso_deinitialize(osso); - osso = NULL; - } - printf("Exiting\n"); -} - -void menu_loop(void) -{ -} - -void *plat_gvideo_set_mode(int *w_, int *h_, int *bpp_) -{ - int w = *w_, h = *h_; - - if (g_maemo_opts&8) return pl_vout_buf; - //printf("Setting video mode %ix%i\n", w, h); - - if (w <= 0 || h <= 0) - return pl_vout_buf; - - if (image) gdk_image_destroy(image); - image = gdk_image_new( GDK_IMAGE_FASTEST, gdk_visual_get_system(), w, h ); - - pl_vout_buf = (void *) image->mem; - - gtk_image_set_from_image (GTK_IMAGE(drawing), image, NULL); - - gtk_window_resize (GTK_WINDOW (actor), w, h); - if (g_maemo_opts & 2) - hildon_animation_actor_set_scale (actor, - (gdouble)800 / (gdouble)w, - (gdouble)480 / (gdouble)h - ); - else - hildon_animation_actor_set_scale (actor, - (gdouble)D_WIDTH / (gdouble)w, - (gdouble)D_HEIGHT / (gdouble)h - ); - pl_buf_w=w;pl_buf_h=h; - return pl_vout_buf; -} - -void *plat_gvideo_flip(void) -{ - if (!(g_maemo_opts&8)) - gtk_widget_queue_draw(drawing); - - // process accelometer - if (g_maemo_opts & 4) { - float x, y, z; - FILE* f = fopen( "/sys/class/i2c-adapter/i2c-3/3-001d/coord", "r" ); - if( !f ) {printf ("err in accel"); exit(1);} - fscanf( f, "%f %f %f", &x, &y, &z ); - fclose( f ); - - if (in_type1 == PSE_PAD_TYPE_ANALOGPAD){ - if (x > accelOptions.maxValue) x = accelOptions.maxValue; - else if (x < -accelOptions.maxValue) x = -accelOptions.maxValue; - - const int maxValue = accelOptions.maxValue - accelOptions.sens; - if(x > accelOptions.sens){ - x -= accelOptions.sens; - in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier; - }else if (x < -accelOptions.sens){ - x += accelOptions.sens; - in_a1[0] = (-x + maxValue ) * accelOptions.xMultiplier; - }else in_a1[0] = 127; - - y += accelOptions.y_def; - if (y > accelOptions.maxValue) y = accelOptions.maxValue; - else if (y < -accelOptions.maxValue) y = -accelOptions.maxValue; - - if(y > accelOptions.sens){ - y -= accelOptions.sens; - in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier; - }else if (y < -accelOptions.sens){ - y += accelOptions.sens; - in_a1[1] = (-y + maxValue ) * accelOptions.yMultiplier; - }else in_a1[1] = 127; - - //printf("x: %i y: %i\n", in_a1[0], in_a1[1]); - }else{ - if( x > accelOptions.sens ) in_keystate |= 1 << DKEY_LEFT; - else if( x < -accelOptions.sens ) in_keystate |= 1 << DKEY_RIGHT; - else {in_keystate &= ~(1 << DKEY_LEFT);in_keystate &= ~(1 << DKEY_RIGHT);} - - y += accelOptions.y_def; - if( y > accelOptions.sens )in_keystate |= 1 << DKEY_UP; - else if( y < -accelOptions.sens ) in_keystate |= 1 << DKEY_DOWN; - else {in_keystate &= ~(1 << DKEY_DOWN);in_keystate &= ~(1 << DKEY_UP);} - } - } - - return pl_vout_buf; -} - -// for frontend/plugin_lib.c -void update_input(void) -{ - if (g_maemo_opts & 8) - maemo_x11_update_keys(); - else { - /* process GTK+ events */ - while (gtk_events_pending()) - gtk_main_iteration(); - } -} - -int omap_enable_layer(int enabled) -{ - return 0; -} - -void menu_notify_mode_change(int w, int h, int bpp) -{ -} - -void *plat_prepare_screenshot(int *w, int *h, int *bpp) -{ - return NULL; -} - -void plat_step_volume(int is_up) -{ -} - -void plat_trigger_vibrate(int pad, int low, int high) -{ - const int vDuration = 10; - - DBusConnection* system_bus = (DBusConnection*)osso_get_sys_dbus_connection(osso); - DBusMessageIter args; - DBusMessage*msg = dbus_message_new_method_call("com.nokia.mce", - "/com/nokia/mce/request", - "com.nokia.mce.request", - "req_start_manual_vibration"); - if (msg) { - dbus_message_iter_init_append(msg, &args); - // FIXME: somebody with hardware should tune this - int speed = high; // is_strong ? 200 : 150; - int duration = vDuration; - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &speed)) { - if (dbus_message_iter_append_basic(&args, DBUS_TYPE_INT32, &duration)) { - dbus_connection_send(system_bus, msg, NULL); - //dbus_connection_flush(system_bus); - } - } - dbus_message_unref(msg); - } -} - -void plat_minimize(void) -{ -} - -void plat_gvideo_close(void) -{ -} - -void plat_gvideo_open(int is_pal) -{ -} diff --git a/maemo/maemo_common.h b/maemo/maemo_common.h deleted file mode 100644 index ace0bfd..0000000 --- a/maemo/maemo_common.h +++ /dev/null @@ -1,18 +0,0 @@ -int maemo_init(int *argc, char ***argv); -void maemo_finish(); - -extern char file_name[MAXPATHLEN]; -extern int g_maemo_opts; - -extern inline void key_press_event(int key,int type); - -typedef struct -{ - int sens; - int y_def; - float maxValue; - float xMultiplier; - float yMultiplier; -} accel_option; - -extern accel_option accelOptions; diff --git a/maemo/maemo_xkb.c b/maemo/maemo_xkb.c deleted file mode 100644 index 52af2ca..0000000 --- a/maemo/maemo_xkb.c +++ /dev/null @@ -1,88 +0,0 @@ -/* - * Copyright (c) 2009, Wei Mingzhi <whistler@openoffice.org>. - * All Rights Reserved. - * - * This program is free software; you can redistribute it and/or modify - * it under the terms of the GNU General Public License as published by - * the Free Software Foundation; either version 2 of the License, or - * (at your option) any later version. - * - * This program is distributed in the hope that it will be useful, - * but WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the - * GNU General Public License for more details. - * - * You should have received a copy of the GNU General Public License - * along with this program; if not, see <http://www.gnu.org/licenses>. - */ - -#include <stdio.h> -#include <stdlib.h> -#include <stdint.h> -#include <X11/Xlib.h> -#include <X11/Xutil.h> -#include <X11/keysym.h> -#include <X11/XKBlib.h> - -#include "../frontend/main.h" -#include "../frontend/plugin_lib.h" - -static Atom wmprotocols, wmdelwindow; -static int initialized; - - - -static void InitKeyboard(void) { - Display *disp = (Display *)gpuDisp; - if (disp){ - wmprotocols = XInternAtom(disp, "WM_PROTOCOLS", 0); - wmdelwindow = XInternAtom(disp, "WM_DELETE_WINDOW", 0); - XkbSetDetectableAutoRepeat(disp, 1, NULL); - } -} - -static void DestroyKeyboard(void) { - Display *disp = (Display *)gpuDisp; - if (disp) - XkbSetDetectableAutoRepeat(disp, 0, NULL); -} -#include "maemo_common.h" - -int maemo_x11_update_keys() { - - XEvent evt; - XClientMessageEvent *xce; - int leave = 0; - Display *disp = (Display *)gpuDisp; - - if (!disp) - return 0; - - if (!initialized) { - initialized++; - InitKeyboard(); - } - - while (XPending(disp)>0) { - XNextEvent(disp, &evt); - switch (evt.type) { - case KeyPress: - case KeyRelease: - key_press_event(evt.xkey.keycode, evt.type==KeyPress ? 1 : (evt.type==KeyRelease ? 2 : 0) ); - break; - - case ClientMessage: - xce = (XClientMessageEvent *)&evt; - if (xce->message_type == wmprotocols && (Atom)xce->data.l[0] == wmdelwindow) - leave = 1; - break; - } - } - - if (leave) { - DestroyKeyboard(); - exit(1); - } - - return 0; -} diff --git a/maemo/main.c b/maemo/main.c deleted file mode 100644 index 85db400..0000000 --- a/maemo/main.c +++ /dev/null @@ -1,418 +0,0 @@ -/* - * (C) notaz, 2010-2011 - * - * This work is licensed under the terms of the GNU GPLv2 or later. - * See the COPYING file in the top-level directory. - */ - -#include <stdio.h> -#include <string.h> -#include <stdint.h> -#include <unistd.h> - -#include "../frontend/main.h" -#include "../frontend/menu.h" -#include "../frontend/plugin.h" -#include "../frontend/plugin_lib.h" -#include "../libpcsxcore/misc.h" -#include "../libpcsxcore/cdriso.h" -#include "../libpcsxcore/new_dynarec/new_dynarec.h" -#include "../plugins/dfinput/main.h" -#include "../plugins/dfsound/spu_config.h" -#include "maemo_common.h" - -extern int in_enable_vibration; -extern int cycle_multiplier; -extern int in_type1, in_type2; - -accel_option accelOptions; -int ready_to_go, g_emu_want_quit, g_emu_resetting; -int g_menuscreen_w, g_menuscreen_h; -int g_scaler, soft_filter; -int g_opts = 0; -int g_maemo_opts; -int cornerActions[4] = {0,0,0,0}; -int bKeepDisplayOn = FALSE; -int bAutosaveOnExit = FALSE; -char file_name[MAXPATHLEN]; -char keys_config_file[MAXPATHLEN] = "/opt/psx4m/keys"; - -enum sched_action emu_action; -void do_emu_action(void); - -static void ChangeWorkingDirectory(char *exe) -{ - char exepath[1024]; - char *s; - snprintf(exepath, sizeof(exepath), "%s", exe); - s = strrchr(exepath, '/'); - if (s != NULL) { - *s = '\0'; - chdir(exepath); - } -} - -void PrintHelp() -{ - printf("PCSX-ReARMed version %s for Maemo\n\n", PACKAGE_VERSION); - - printf("Usage:\n"); - printf(" pcsx [options] -cdfile FILE\n\n"); - - printf("Options:\n"); - printf(" -help : This help\n"); - printf(" -disc VALUE : Disc number for multi discs images\n"); - printf(" -fullscreen : Run fullscreen\n"); - printf(" -frameskip : Frameskip\n"); - printf(" -1=Auto (Default)\n"); - printf(" 0=Disabled\n"); - printf(" 1=Set to 1\n"); - printf(" ...\n"); - printf(" -autosave : Enable auto save on exit\n"); - printf(" -accel : Enable accelerometer\n"); - printf(" -analog : Use analog pad for accel\n"); - printf(" -vibration : Activate vibration\n"); - printf(" -sens VALUE : Set accelerometer sens [0-1000]\n"); - printf(" (Default 150)\n"); - printf(" -ydef VALUE : Set accelerometer y zero [0-1000]\n"); - printf(" (Default 500)\n"); - printf(" -max VALUE : Set accelerometer max value[0-1000]\n"); - printf(" (Default 500)\n"); - printf(" -nosound : No sound output\n"); - printf(" -bdir PATH : Set the bios path\n"); - printf(" -pdir PATH : Set the plugins path\n"); - printf(" -bios : Set the bios\n"); - printf(" -cdda : Disable CD Audio for a performance boost\n"); - printf(" -xa : Disables XA sound, which can sometimes\n"); - printf(" improve performance\n"); - printf(" -sio : SIO IRQ Always Enabled\n"); - printf(" -spuirq : SPU IRQ Always Enabled\n"); - printf(" -fps : Show fps\n"); - printf(" -cpu : Show CPU load\n"); - printf(" -spu : Show SPU channels\n"); - printf(" -nofl : Disable Frame Limiter\n"); - printf(" -mcd1 FILE : Set memory card 1 file\n"); - printf(" -mcd2 FILE : Set memory card 2 file\n"); - printf(" -region VALUE : Set PSX region\n"); - printf(" -1=Auto (Default)\n"); - printf(" 0=NTSC\n"); - printf(" 1=PAL\n"); - printf(" -cpuclock VALUE: PSX CPU clock %% [1-500]\n"); - printf(" (Default 50)\n"); - printf(" -displayon : Prevent display from blanking\n"); - printf(" (Default disabled)\n"); - printf(" -keys FILE : File with keys configuration\n"); - printf(" (Default /opt/psx4m/keys)\n"); - printf(" -corners VALUE : Define actions for click on the\n"); - printf(" display corners\n"); - printf(" VALUE is a four digit number, each number\n"); - printf(" represent a corner (topleft, topright,\n"); - printf(" bottomright and bottomleft\n"); - printf(" Actions:\n"); - printf(" 0=No action\n"); - printf(" 1=Save\n"); - printf(" 2=Load\n"); - printf(" 3=Change slot (+1)\n"); - printf(" 4=Change slot (-1)\n"); - printf(" 5=Quit\n"); - printf(" -guncon : Set the controller to guncon\n"); - printf(" -gunnotrigger : Don't trigger (shoot) when touching screen\n"); - printf(" 0=Auto (Default)\n"); - printf(" 1=On\n"); - printf(" 2=Off\n"); - - - printf("\nGPU Options:\n"); - printf(" -gles : Use the GLES plugin (gpu_gles.so)\n"); - printf(" -oldgpu : Use the peops plugin (gpu_peops.so)\n"); - printf(" -unai : Use the unai plugin (gpu_unai.so)\n"); - - printf("\nSound Options:\n"); - printf(" -spu_reverb VALUE : Enable/disable reverb [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -spu_interpolation VALUE : Set interpolation mode\n"); - printf(" 0=None (Default)\n"); - printf(" 1=Simple\n"); - printf(" 2=Gaussian\n"); - printf(" 3=Cubic\n"); - - printf("\nNeon Options (default GPU):\n"); - printf(" -enhance : Enable graphic enhancement\n"); - - printf("\nGles Options:\n"); - printf(" -gles_dithering VALUE : Enable/disable dithering [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_mask VALUE : Enable/disable mask detect [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_filtering VALUE : Texture Filtering\n"); - printf(" 0=None (Default)\n"); - printf(" 1=Standard\n"); - printf(" 2=Extended\n"); - printf(" 3=Standard-sprites\n"); - printf(" 4=Extended-sprites\n"); - printf(" 5=Standard+sprites\n"); - printf(" 6=Extended+sprites\n"); - printf(" -gles_fbtex VALUE : Framebuffer Textures\n"); - printf(" 0=Emulated VRam (Default)\n"); - printf(" 1=Black\n"); - printf(" 2=Card\n"); - printf(" 3=Card+soft\n"); - printf(" -gles_vram VALUE : Texture RAM size in MB [4-128]\n"); - printf(" (Default 64)\n"); - printf(" -gles_fastmdec VALUE : Enable/disable Fast Mdec [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_advblend VALUE : Enable/disable Adv. Blend [0/1]\n"); - printf(" (Default disabled)\n"); - printf(" -gles_opaque VALUE : Enable/disable Opaque Pass [0/1]\n"); - printf(" (Default disabled)\n"); -} - -int main(int argc, char **argv) -{ - if (argc == 1 || (argc == 2 && (!strcmp(argv[1], "--help") || !strcmp(argv[1], "-help") || !strcmp(argv[1], "-h")))) { - PrintHelp(); - return 0; - } - - emu_core_preinit(); - ChangeWorkingDirectory("c"); - char file[MAXPATHLEN] = ""; - char path[MAXPATHLEN]; - const char *cdfile = NULL; - int loadst = 0; - int i; - int getst = -1; - int discNumber = 0; - - g_menuscreen_w = 800; - g_menuscreen_h = 480; - - strcpy(Config.Gpu, "builtin_gpu"); - strcpy(Config.Spu, "builtin_spu"); - strcpy(Config.BiosDir, "/home/user/MyDocs"); - strcpy(Config.PluginsDir, "/opt/maemo/usr/games/plugins"); - snprintf(Config.PatchesDir, sizeof(Config.PatchesDir), "/opt/maemo/usr/games" PATCHES_DIR); - Config.PsxAuto = 1; - pl_rearmed_cbs.frameskip = -1; - strcpy(Config.Bios, "HLE"); - spu_config.iUseReverb = 1; - spu_config.iUseInterpolation = 1; - - in_type1 = PSE_PAD_TYPE_STANDARD; - in_type2 = PSE_PAD_TYPE_STANDARD; - - accelOptions.sens = 150; - accelOptions.y_def = 500; - accelOptions.maxValue = 500.0; - - // read command line options - for (i = 1; i < argc; i++) { - if (!strcmp(argv[i], "-psxout")) Config.PsxOut = 1; - else if (!strcmp(argv[i], "-load")) loadst = atol(argv[++i]); - else if (!strcmp(argv[i], "-cdfile")) { - char isofilename[MAXPATHLEN]; - if (i+1 >= argc) break; - strncpy(isofilename, argv[++i], MAXPATHLEN); - if (isofilename[0] != '/') { - getcwd(path, MAXPATHLEN); - if (strlen(path) + strlen(isofilename) + 1 < MAXPATHLEN) { - strcat(path, "/"); - strcat(path, isofilename); - strcpy(isofilename, path); - } else - isofilename[0] = 0; - } - cdfile = isofilename; - } - else if (!strcmp(argv[i],"-frameskip")) { - int tv_reg = atol(argv[++i]); - if (tv_reg < -1) - pl_rearmed_cbs.frameskip = -1; - else - pl_rearmed_cbs.frameskip = tv_reg; - } - else if (!strcmp(argv[i],"-region")) { - int psx_reg = atol(argv[++i]); - if (psx_reg == 0 || psx_reg == 1){ - Config.PsxAuto = 0; - Config.PsxType = psx_reg; - } - } - - else if (!strcmp(argv[i],"-get_sstatename")) getst = atol(argv[++i]); - - else if (!strcmp(argv[i], "-fullscreen")) g_maemo_opts |= 2; - else if (!strcmp(argv[i], "-accel")) g_maemo_opts |= 4; - else if (!strcmp(argv[i], "-nosound")) strcpy(Config.Spu, "spunull.so"); - else if (!strcmp(argv[i], "-bdir")) sprintf(Config.BiosDir, "%s", argv[++i]); - else if (!strcmp(argv[i], "-pdir")) sprintf(Config.PluginsDir, "%s", argv[++i]); - else if (!strcmp(argv[i], "-bios")) sprintf(Config.Bios, "%s", argv[++i]); - else if (!strcmp(argv[i], "-gles")) { strcpy(Config.Gpu, "gpu_gles.so"); g_maemo_opts |= 8 ;} - else if (!strcmp(argv[i], "-oldgpu")) strcpy(Config.Gpu, "gpu_peops.so"); - else if (!strcmp(argv[i], "-unai")) strcpy(Config.Gpu, "gpu_unai.so"); - else if (!strcmp(argv[i], "-cdda")) Config.Cdda = 1; - else if (!strcmp(argv[i], "-xa")) Config.Xa = 1; - else if (!strcmp(argv[i], "-rcnt")) Config.RCntFix = 1 ; - else if (!strcmp(argv[i], "-sio")) Config.Sio = 1; - else if (!strcmp(argv[i], "-spuirq")) Config.SpuIrq = 1; - else if (!strcmp(argv[i], "-vsync")) Config.VSyncWA = 1; - else if (!strcmp(argv[i], "-fps")) g_opts |=OPT_SHOWFPS; - else if (!strcmp(argv[i], "-cpu")) g_opts |=OPT_SHOWCPU; - else if (!strcmp(argv[i], "-spu")) g_opts |=OPT_SHOWSPU; - else if (!strcmp(argv[i], "-nofl")) g_opts |=OPT_NO_FRAMELIM; - else if (!strcmp(argv[i], "-mcd1")) sprintf(Config.Mcd1, "%s", argv[++i]); - else if (!strcmp(argv[i], "-mcd2")) sprintf(Config.Mcd2, "%s", argv[++i]); - - else if (!strcmp(argv[i], "-cpuclock")) cycle_multiplier = 10000 / atol(argv[++i]); - else if (!strcmp(argv[i], "-guncon")) in_type1 = PSE_PAD_TYPE_GUNCON; - else if (!strcmp(argv[i], "-gunnotrigger")) g_opts |= OPT_TSGUN_NOTRIGGER; - else if (!strcmp(argv[i], "-analog")) in_type1 = PSE_PAD_TYPE_ANALOGPAD; - else if (!strcmp(argv[i], "-vibration")) { in_type1 = PSE_PAD_TYPE_ANALOGPAD; in_enable_vibration = 1; } - else if (!strcmp(argv[i], "-sens")) accelOptions.sens = atol(argv[++i]); - else if (!strcmp(argv[i], "-ydef")) accelOptions.y_def = atol(argv[++i]); - else if (!strcmp(argv[i], "-max")) accelOptions.maxValue = atol(argv[++i]); - else if (!strcmp(argv[i], "-displayon")) bKeepDisplayOn = TRUE; - else if (!strcmp(argv[i], "-keys")) sprintf(keys_config_file, "%s", argv[++i]); - else if (!strcmp(argv[i], "-autosave")) bAutosaveOnExit = TRUE; - else if (!strcmp(argv[i], "-disc")) discNumber = atol(argv[++i]); - else if (!strcmp(argv[i], "-corners")){ - int j = 0; - i++; - char num[2]; - for (j=0; j<strlen(argv[i]); j++){ - strncpy(num, argv[i] + j, 1); - cornerActions[j] = atoi(num); - } - } - - else if (!strcmp(argv[i], "-spu_reverb")) spu_config.iUseReverb = atol(argv[++i]); - else if (!strcmp(argv[i], "-spu_interpolation")) spu_config.iUseInterpolation = atol(argv[++i]); - - else if (!strcmp(argv[i], "-enhance")) pl_rearmed_cbs.gpu_neon.enhancement_enable = 1; - else if (!strcmp(argv[i], "-enhancehack")) pl_rearmed_cbs.gpu_neon.enhancement_no_main = 1; - - else if (!strcmp(argv[i], "-gles_dithering")) pl_rearmed_cbs.gpu_peopsgl.bDrawDither = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_mask")) pl_rearmed_cbs.gpu_peopsgl.iUseMask = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_filtering")) pl_rearmed_cbs.gpu_peopsgl.iFilterType = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_fbtex")) pl_rearmed_cbs.gpu_peopsgl.iFrameTexType = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_vram")) pl_rearmed_cbs.gpu_peopsgl.iVRamSize = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_fastmdec")) pl_rearmed_cbs.gpu_peopsgl.bUseFastMdec = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_advblend")) pl_rearmed_cbs.gpu_peopsgl.bAdvancedBlend = atol(argv[++i]); - else if (!strcmp(argv[i], "-gles_opaque")) pl_rearmed_cbs.gpu_peopsgl.bOpaquePass = atol(argv[++i]); - - else { - fprintf(stderr, "Unknown option: %s\n", argv[i]); - return 1; - } - } - - pl_init(); - if (emu_core_init() == -1) - return 1; - - if (cdfile) { - set_cd_image(cdfile); - strcpy(file_name, strrchr(cdfile,'/')); - } - - if (LoadPlugins() == -1) { - SysMessage("Failed loading plugins!"); - return 1; - } - - if (discNumber > 0) - cdrIsoMultidiskSelect = discNumber - 1; - - if (OpenPlugins() == -1) { - return 1; - } - plugin_call_rearmed_cbs(); - - CheckCdrom(); - - if (getst >= 0){ - char fname[MAXPATHLEN]; - - get_state_filename(fname, sizeof(fname), getst); - printf("SAVESTATE: %s\n", fname); - if (cdrIsoMultidiskCount > 1){ - int i = 0; - for (i=1; i<cdrIsoMultidiskCount; i++){ - cdrIsoMultidiskSelect = i; - CdromId[0] = '\0'; - CdromLabel[0] = '\0'; - - CDR_close(); - if (CDR_open() == 0){ - CheckCdrom(); - get_state_filename(fname, sizeof(fname), getst); - printf("SAVESTATE: %s\n", fname); - } - } - } - return 0; - } - - SysReset(); - - if (file[0] != '\0') { - if (Load(file) != -1) - ready_to_go = 1; - } else { - if (cdfile) { - if (LoadCdrom() == -1) { - ClosePlugins(); - printf(_("Could not load CD-ROM!\n")); - return -1; - } - emu_on_new_cd(0); - ready_to_go = 1; - } - } - - if (!ready_to_go) { - printf ("something goes wrong, maybe you forgot -cdfile ? \n"); - return 1; - } - - if (cdrIsoMultidiskCount > 1) - printf ("Loaded a multidisc image: %i discs.\n", cdrIsoMultidiskCount); - - // If a state has been specified, then load that - if (loadst) { - int ret = emu_load_state(loadst - 1); - printf("%s state %d\n", ret ? "Failed to load" : "Loaded", loadst); - state_slot = loadst - 1; - } - - if (maemo_init(&argc, &argv)) - return 1; - - if (GPU_open != NULL) { - int ret = GPU_open(&gpuDisp, "PCSX", NULL); - if (ret){ - fprintf(stderr, "Warning: GPU_open returned %d\n", ret); - gpuDisp=ret; - } - } - - if (Config.HLE) - printf("Note: running without BIOS, expect compatibility problems\n"); - - dfinput_activate(); - pl_timing_prepare(Config.PsxType); - - while (1) - { - stop = 0; - emu_action = SACTION_NONE; - - psxCpu->Execute(); - if (emu_action != SACTION_NONE) - do_emu_action(); - } - - maemo_finish(); - return 0; -} - diff --git a/plugins/cdrcimg/cdrcimg.c b/plugins/cdrcimg/cdrcimg.c index 76cdfba..45016bb 100644 --- a/plugins/cdrcimg/cdrcimg.c +++ b/plugins/cdrcimg/cdrcimg.c @@ -14,7 +14,9 @@ #include <zlib.h> #ifndef _WIN32 #define CALLBACK +#ifndef NO_DYLIB #include <dlfcn.h> +#endif #else #define WIN32_LEAN_AND_MEAN #include <windows.h> @@ -98,7 +100,7 @@ static long CDRgetTD(unsigned char track, unsigned char *buffer) return 0; } -int uncompress2(void *out, unsigned long *out_size, void *in, unsigned long in_size) +int uncomp2(void *out, unsigned long *out_size, void *in, unsigned long in_size) { static z_stream z; int ret = 0; @@ -199,7 +201,7 @@ static long CDRreadTrack(unsigned char *time) ret = uncompress(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); break; case CDRC_ZLIB2: - ret = uncompress2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); + ret = uncomp2(cdbuffer->raw[0], &cdbuffer_size, cdbuffer->compressed, size); break; case CDRC_BZ: ret = pBZ2_bzBuffToBuffDecompress((char *)cdbuffer->raw, (unsigned int *)&cdbuffer_size, @@ -285,7 +287,7 @@ static long CDRinit(void) return -1; } } -#ifndef _WIN32 +#if !defined(_WIN32) && !defined(NO_DYLIB) if (pBZ2_bzBuffToBuffDecompress == NULL) { void *h = dlopen("/usr/lib/libbz2.so.1", RTLD_LAZY); if (h == NULL) diff --git a/plugins/dfinput/main.c b/plugins/dfinput/main.c index 475ea07..4204b86 100644 --- a/plugins/dfinput/main.c +++ b/plugins/dfinput/main.c @@ -44,6 +44,7 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; PAD##n##_poll = PADpoll_guncon; \ guncon_init(); \ break; \ + case PSE_PAD_TYPE_NEGCON: \ case PSE_PAD_TYPE_GUN: \ default: \ PAD##n##_startPoll = PAD##n##__startPoll; \ @@ -52,13 +53,19 @@ static int old_controller_type1 = -1, old_controller_type2 = -1; } \ } + void dfinput_activate(void) { + #ifndef HAVE_LIBRETRO PadDataS pad; + pad.portMultitap = -1; + pad.requestPadIndex = 0; PAD1_readPort1(&pad); select_pad(1); + pad.requestPadIndex = 1; PAD2_readPort2(&pad); select_pad(2); + #endif } diff --git a/plugins/dfinput/pad.c b/plugins/dfinput/pad.c index 7e00a11..853c8c8 100644 --- a/plugins/dfinput/pad.c +++ b/plugins/dfinput/pad.c @@ -254,6 +254,7 @@ unsigned char PADpoll(unsigned char value) { #define PADpoll PADpoll_ #endif +#ifndef HAVE_LIBRETRO unsigned char PADpoll_pad(unsigned char value) { if (CurByte == 0) { CurCmd = value; @@ -302,3 +303,4 @@ void pad_init(void) padstate[i].PadMode = padstate[i].pad.controllerType == PSE_PAD_TYPE_ANALOGPAD; } } +#endif diff --git a/plugins/dfxvideo/gpulib_if.c b/plugins/dfxvideo/gpulib_if.c index 01b8dde..bb3ad56 100644 --- a/plugins/dfxvideo/gpulib_if.c +++ b/plugins/dfxvideo/gpulib_if.c @@ -309,11 +309,11 @@ void renderer_notify_res_change(void) extern const unsigned char cmd_lengths[256]; -int do_cmd_list(unsigned int *list, int list_len, int *last_cmd) +int do_cmd_list(uint32_t *list, int list_len, int *last_cmd) { unsigned int cmd = 0, len; - unsigned int *list_start = list; - unsigned int *list_end = list + list_len; + uint32_t *list_start = list; + uint32_t *list_end = list + list_len; for (; list < list_end; list += 1 + len) { |